Team:Evry Paris-Saclay/Template:Javascript
/*!
* jQuery JavaScript Library v3.2.1 * https://jquery.com/ * * Includes Sizzle.js * https://sizzlejs.com/ * * Copyright JS Foundation and other contributors * Released under the MIT license * https://jquery.org/license * * Date: 2017-03-20T18:59Z */
(function (global, factory) {
"use strict";
if (typeof module === "object" && typeof module.exports === "object") {
// For CommonJS and CommonJS-like environments where a proper `window`
// is present, execute the factory and get jQuery.
// For environments that do not have a `window` with a `document`
// (such as Node.js), expose a factory as module.exports.
// This accentuates the need for the creation of a real `window`.
// e.g. var jQuery = require("jquery")(window);
// See ticket #14549 for more info.
module.exports = global.document ?
factory(global, true) :
function (w) {
if (!w.document) {
throw new Error("jQuery requires a window with a document");
}
return factory(w);
};
} else {
factory(global);
}
// Pass this if window is not defined yet
})(typeof window !== "undefined" ? window : this, function (window, noGlobal) {
// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 // throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode // arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common // enough that all such attempts are guarded in a try block. "use strict";
var arr = [];
var document = window.document;
var getProto = Object.getPrototypeOf;
var slice = arr.slice;
var concat = arr.concat;
var push = arr.push;
var indexOf = arr.indexOf;
var class2type = {};
var toString = class2type.toString;
var hasOwn = class2type.hasOwnProperty;
var fnToString = hasOwn.toString;
var ObjectFunctionString = fnToString.call(Object);
var support = {};
function DOMEval(code, doc) {
doc = doc || document;
var script = doc.createElement("script");
script.text = code;
doc.head.appendChild(script).parentNode.removeChild(script);
}
/* global Symbol */
// Defining this global in .eslintrc.json would create a danger of using the global
// unguarded in another place, it seems safer to define global only for this module
var
version = "3.2.1",
// Define a local copy of jQuery
jQuery = function (selector, context) {
// The jQuery object is actually just the init constructor 'enhanced'
// Need init if jQuery is called (just allow error to be thrown if not included)
return new jQuery.fn.init(selector, context);
},
// Support: Android <=4.0 only
// Make sure we trim BOM and NBSP
rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
// Matches dashed string for camelizing
rmsPrefix = /^-ms-/,
rdashAlpha = /-([a-z])/g,
// Used by jQuery.camelCase as callback to replace()
fcamelCase = function (all, letter) {
return letter.toUpperCase();
};
jQuery.fn = jQuery.prototype = {
// The current version of jQuery being used
jquery: version,
constructor: jQuery,
// The default length of a jQuery object is 0
length: 0,
toArray: function () {
return slice.call(this);
},
// Get the Nth element in the matched element set OR
// Get the whole matched element set as a clean array
get: function (num) {
// Return all the elements in a clean array
if (num == null) {
return slice.call(this);
}
// Return just the one element from the set
return num < 0 ? this[num + this.length] : this[num];
},
// Take an array of elements and push it onto the stack
// (returning the new matched element set)
pushStack: function (elems) {
// Build a new jQuery matched element set
var ret = jQuery.merge(this.constructor(), elems);
// Add the old object onto the stack (as a reference)
ret.prevObject = this;
// Return the newly-formed element set
return ret;
},
// Execute a callback for every element in the matched set.
each: function (callback) {
return jQuery.each(this, callback);
},
map: function (callback) {
return this.pushStack(jQuery.map(this, function (elem, i) {
return callback.call(elem, i, elem);
}));
},
slice: function () {
return this.pushStack(slice.apply(this, arguments));
},
first: function () {
return this.eq(0);
},
last: function () {
return this.eq(-1);
},
eq: function (i) {
var len = this.length,
j = +i + (i < 0 ? len : 0);
return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
},
end: function () {
return this.prevObject || this.constructor();
},
// For internal use only.
// Behaves like an Array's method, not like a jQuery method.
push: push,
sort: arr.sort,
splice: arr.splice
};
jQuery.extend = jQuery.fn.extend = function () {
var options, name, src, copy, copyIsArray, clone,
target = arguments[0] || {},
i = 1,
length = arguments.length,
deep = false;
// Handle a deep copy situation
if (typeof target === "boolean") {
deep = target;
// Skip the boolean and the target
target = arguments[i] || {};
i++;
}
// Handle case when target is a string or something (possible in deep copy)
if (typeof target !== "object" && !jQuery.isFunction(target)) {
target = {};
}
// Extend jQuery itself if only one argument is passed
if (i === length) {
target = this;
i--;
}
for (; i < length; i++) {
// Only deal with non-null/undefined values
if ((options = arguments[i]) != null) {
// Extend the base object
for (name in options) {
src = target[name];
copy = options[name];
// Prevent never-ending loop
if (target === copy) {
continue;
}
// Recurse if we're merging plain objects or arrays
if (deep && copy && (jQuery.isPlainObject(copy) ||
(copyIsArray = Array.isArray(copy)))) {
if (copyIsArray) {
copyIsArray = false;
clone = src && Array.isArray(src) ? src : [];
} else {
clone = src && jQuery.isPlainObject(src) ? src : {};
}
// Never move original objects, clone them
target[name] = jQuery.extend(deep, clone, copy);
// Don't bring in undefined values
} else if (copy !== undefined) {
target[name] = copy;
}
}
}
}
// Return the modified object
return target;
};
jQuery.extend({
// Unique for each copy of jQuery on the page
expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""),
// Assume jQuery is ready without the ready module
isReady: true,
error: function (msg) {
throw new Error(msg);
},
noop: function () {},
isFunction: function (obj) {
return jQuery.type(obj) === "function";
},
isWindow: function (obj) {
return obj != null && obj === obj.window;
},
isNumeric: function (obj) {
// As of jQuery 3.0, isNumeric is limited to
// strings and numbers (primitives or objects)
// that can be coerced to finite numbers (gh-2662)
var type = jQuery.type(obj);
return (type === "number" || type === "string") &&
// parseFloat NaNs numeric-cast false positives ("")
// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
// subtraction forces infinities to NaN
!isNaN(obj - parseFloat(obj));
},
isPlainObject: function (obj) {
var proto, Ctor;
// Detect obvious negatives
// Use toString instead of jQuery.type to catch host objects
if (!obj || toString.call(obj) !== "[object Object]") {
return false;
}
proto = getProto(obj);
// Objects with no prototype (e.g., `Object.create( null )`) are plain
if (!proto) {
return true;
}
// Objects with prototype are plain iff they were constructed by a global Object function
Ctor = hasOwn.call(proto, "constructor") && proto.constructor;
return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString;
},
isEmptyObject: function (obj) {
/* eslint-disable no-unused-vars */
// See https://github.com/eslint/eslint/issues/6125
var name;
for (name in obj) {
return false;
}
return true;
},
type: function (obj) {
if (obj == null) {
return obj + "";
}
// Support: Android <=2.3 only (functionish RegExp)
return typeof obj === "object" || typeof obj === "function" ?
class2type[toString.call(obj)] || "object" :
typeof obj;
},
// Evaluates a script in a global context
globalEval: function (code) {
DOMEval(code);
},
// Convert dashed to camelCase; used by the css and data modules
// Support: IE <=9 - 11, Edge 12 - 13
// Microsoft forgot to hump their vendor prefix (#9572)
camelCase: function (string) {
return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
},
each: function (obj, callback) {
var length, i = 0;
if (isArrayLike(obj)) {
length = obj.length;
for (; i < length; i++) {
if (callback.call(obj[i], i, obj[i]) === false) {
break;
}
}
} else {
for (i in obj) {
if (callback.call(obj[i], i, obj[i]) === false) {
break;
}
}
}
return obj;
},
// Support: Android <=4.0 only
trim: function (text) {
return text == null ?
"" :
(text + "").replace(rtrim, "");
},
// results is for internal usage only
makeArray: function (arr, results) {
var ret = results || [];
if (arr != null) {
if (isArrayLike(Object(arr))) {
jQuery.merge(ret,
typeof arr === "string" ? [arr] : arr
);
} else {
push.call(ret, arr);
}
}
return ret;
},
inArray: function (elem, arr, i) {
return arr == null ? -1 : indexOf.call(arr, elem, i);
},
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
merge: function (first, second) {
var len = +second.length,
j = 0,
i = first.length;
for (; j < len; j++) {
first[i++] = second[j];
}
first.length = i;
return first;
},
grep: function (elems, callback, invert) {
var callbackInverse,
matches = [],
i = 0,
length = elems.length,
callbackExpect = !invert;
// Go through the array, only saving the items
// that pass the validator function
for (; i < length; i++) {
callbackInverse = !callback(elems[i], i);
if (callbackInverse !== callbackExpect) {
matches.push(elems[i]);
}
}
return matches;
},
// arg is for internal usage only
map: function (elems, callback, arg) {
var length, value,
i = 0,
ret = [];
// Go through the array, translating each of the items to their new values
if (isArrayLike(elems)) {
length = elems.length;
for (; i < length; i++) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
// Go through every key on the object,
} else {
for (i in elems) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
}
// Flatten any nested arrays
return concat.apply([], ret);
},
// A global GUID counter for objects
guid: 1,
// Bind a function to a context, optionally partially applying any
// arguments.
proxy: function (fn, context) {
var tmp, args, proxy;
if (typeof context === "string") {
tmp = fn[context];
context = fn;
fn = tmp;
}
// Quick check to determine if target is callable, in the spec
// this throws a TypeError, but we will just return undefined.
if (!jQuery.isFunction(fn)) {
return undefined;
}
// Simulated bind
args = slice.call(arguments, 2);
proxy = function () {
return fn.apply(context || this, args.concat(slice.call(arguments)));
};
// Set the guid of unique handler to the same of original handler, so it can be removed
proxy.guid = fn.guid = fn.guid || jQuery.guid++;
return proxy;
},
now: Date.now,
// jQuery.support is not used in Core but other projects attach their
// properties to it so it needs to exist.
support: support
});
if (typeof Symbol === "function") {
jQuery.fn[Symbol.iterator] = arr[Symbol.iterator];
}
// Populate the class2type map
jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),
function (i, name) {
class2type["[object " + name + "]"] = name.toLowerCase();
});
function isArrayLike(obj) {
// Support: real iOS 8.2 only (not reproducible in simulator)
// `in` check used to prevent JIT error (gh-2145)
// hasOwn isn't used here due to false negatives
// regarding Nodelist length in IE
var length = !!obj && "length" in obj && obj.length,
type = jQuery.type(obj);
if (type === "function" || jQuery.isWindow(obj)) {
return false;
}
return type === "array" || length === 0 ||
typeof length === "number" && length > 0 && (length - 1) in obj;
}
var Sizzle =
/*!
* Sizzle CSS Selector Engine v2.3.3
* https://sizzlejs.com/
*
* Copyright jQuery Foundation and other contributors
* Released under the MIT license
* http://jquery.org/license
*
* Date: 2016-08-08
*/
(function (window) {
var i,
support,
Expr,
getText,
isXML,
tokenize,
compile,
select,
outermostContext,
sortInput,
hasDuplicate,
// Local document vars
setDocument,
document,
docElem,
documentIsHTML,
rbuggyQSA,
rbuggyMatches,
matches,
contains,
// Instance-specific data
expando = "sizzle" + 1 * new Date(),
preferredDoc = window.document,
dirruns = 0,
done = 0,
classCache = createCache(),
tokenCache = createCache(),
compilerCache = createCache(),
sortOrder = function (a, b) {
if (a === b) {
hasDuplicate = true;
}
return 0;
},
// Instance methods
hasOwn = ({}).hasOwnProperty,
arr = [],
pop = arr.pop,
push_native = arr.push,
push = arr.push,
slice = arr.slice,
// Use a stripped-down indexOf as it's faster than native
// https://jsperf.com/thor-indexof-vs-for/5
indexOf = function (list, elem) {
var i = 0,
len = list.length;
for (; i < len; i++) {
if (list[i] === elem) {
return i;
}
}
return -1;
},
booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
// Regular expressions
// http://www.w3.org/TR/css3-selectors/#whitespace whitespace = "[\\x20\\t\\r\\n\\f]",
// http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+",
// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + // Operator (capture 2) "*([*^$|!~]?=)" + whitespace + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + "*\\]",
pseudos = ":(" + identifier + ")(?:\\((" +
// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
// 1. quoted (capture 3; capture 4 or capture 5)
"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
// 2. simple (capture 6)
"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
// 3. anything else (capture 2)
".*" +
")\\)|)",
// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
rwhitespace = new RegExp(whitespace + "+", "g"),
rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g"),
rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"),
rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*"),
rattributeQuotes = new RegExp("=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g"),
rpseudo = new RegExp(pseudos),
ridentifier = new RegExp("^" + identifier + "$"),
matchExpr = {
"ID": new RegExp("^#(" + identifier + ")"),
"CLASS": new RegExp("^\\.(" + identifier + ")"),
"TAG": new RegExp("^(" + identifier + "|[*])"),
"ATTR": new RegExp("^" + attributes),
"PSEUDO": new RegExp("^" + pseudos),
"CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
"*(\\d+)|))" + whitespace + "*\\)|)", "i"),
"bool": new RegExp("^(?:" + booleans + ")$", "i"),
// For use in libraries implementing .is()
// We use this for POS matching in `select`
"needsContext": new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
},
rinputs = /^(?:input|select|textarea|button)$/i,
rheader = /^h\d$/i,
rnative = /^[^{]+\{\s*\[native \w/,
// Easily-parseable/retrievable ID or TAG or CLASS selectors
rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
rsibling = /[+~]/,
// CSS escapes
// http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
runescape = new RegExp("\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig"),
funescape = function (_, escaped, escapedWhitespace) {
var high = "0x" + escaped - 0x10000;
// NaN means non-codepoint
// Support: Firefox<24
// Workaround erroneous numeric interpretation of +"0x"
return high !== high || escapedWhitespace ?
escaped :
high < 0 ?
// BMP codepoint
String.fromCharCode(high + 0x10000) :
// Supplemental Plane codepoint (surrogate pair)
String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00);
},
// CSS string/identifier serialization
// https://drafts.csswg.org/cssom/#common-serializing-idioms
rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
fcssescape = function (ch, asCodePoint) {
if (asCodePoint) {
// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
if (ch === "\0") {
return "\uFFFD";
}
// Control characters and (dependent upon position) numbers get escaped as code points
return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
}
// Other potentially-special ASCII characters get backslash-escaped
return "\\" + ch;
},
// Used for iframes
// See setDocument()
// Removing the function wrapper causes a "Permission Denied"
// error in IE
unloadHandler = function () {
setDocument();
},
disabledAncestor = addCombinator(
function (elem) {
return elem.disabled === true && ("form" in elem || "label" in elem);
}, {
dir: "parentNode",
next: "legend"
}
);
// Optimize for push.apply( _, NodeList )
try {
push.apply(
(arr = slice.call(preferredDoc.childNodes)),
preferredDoc.childNodes
);
// Support: Android<4.0
// Detect silently failing push.apply
arr[preferredDoc.childNodes.length].nodeType;
} catch (e) {
push = {
apply: arr.length ?
// Leverage slice if possible
function (target, els) {
push_native.apply(target, slice.call(els));
} :
// Support: IE<9
// Otherwise append directly
function (target, els) {
var j = target.length,
i = 0;
// Can't trust NodeList.length
while ((target[j++] = els[i++])) {}
target.length = j - 1;
}
};
}
function Sizzle(selector, context, results, seed) {
var m, i, elem, nid, match, groups, newSelector,
newContext = context && context.ownerDocument,
// nodeType defaults to 9, since context defaults to document
nodeType = context ? context.nodeType : 9;
results = results || [];
// Return early from calls with invalid selector or context
if (typeof selector !== "string" || !selector ||
nodeType !== 1 && nodeType !== 9 && nodeType !== 11) {
return results;
}
// Try to shortcut find operations (as opposed to filters) in HTML documents
if (!seed) {
if ((context ? context.ownerDocument || context : preferredDoc) !== document) {
setDocument(context);
}
context = context || document;
if (documentIsHTML) {
// If the selector is sufficiently simple, try using a "get*By*" DOM method
// (excepting DocumentFragment context, where the methods don't exist)
if (nodeType !== 11 && (match = rquickExpr.exec(selector))) {
// ID selector
if ((m = match[1])) {
// Document context
if (nodeType === 9) {
if ((elem = context.getElementById(m))) {
// Support: IE, Opera, Webkit
// TODO: identify versions
// getElementById can match elements by name instead of ID
if (elem.id === m) {
results.push(elem);
return results;
}
} else {
return results;
}
// Element context
} else {
// Support: IE, Opera, Webkit
// TODO: identify versions
// getElementById can match elements by name instead of ID
if (newContext && (elem = newContext.getElementById(m)) &&
contains(context, elem) &&
elem.id === m) {
results.push(elem);
return results;
}
}
// Type selector
} else if (match[2]) {
push.apply(results, context.getElementsByTagName(selector));
return results;
// Class selector
} else if ((m = match[3]) && support.getElementsByClassName &&
context.getElementsByClassName) {
push.apply(results, context.getElementsByClassName(m));
return results;
}
}
// Take advantage of querySelectorAll
if (support.qsa &&
!compilerCache[selector + " "] &&
(!rbuggyQSA || !rbuggyQSA.test(selector))) {
if (nodeType !== 1) {
newContext = context;
newSelector = selector;
// qSA looks outside Element context, which is not what we want
// Thanks to Andrew Dupont for this workaround technique
// Support: IE <=8
// Exclude object elements
} else if (context.nodeName.toLowerCase() !== "object") {
// Capture the context ID, setting it first if necessary
if ((nid = context.getAttribute("id"))) {
nid = nid.replace(rcssescape, fcssescape);
} else {
context.setAttribute("id", (nid = expando));
}
// Prefix every selector in the list
groups = tokenize(selector);
i = groups.length;
while (i--) {
groups[i] = "#" + nid + " " + toSelector(groups[i]);
}
newSelector = groups.join(",");
// Expand context for sibling selectors
newContext = rsibling.test(selector) && testContext(context.parentNode) ||
context;
}
if (newSelector) {
try {
push.apply(results,
newContext.querySelectorAll(newSelector)
);
return results;
} catch (qsaError) {} finally {
if (nid === expando) {
context.removeAttribute("id");
}
}
}
}
}
}
// All others
return select(selector.replace(rtrim, "$1"), context, results, seed);
}
/**
* Create key-value caches of limited size
* @returns {function(string, object)} Returns the Object data after storing it on itself with
* property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
* deleting the oldest entry
*/
function createCache() {
var keys = [];
function cache(key, value) {
// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
if (keys.push(key + " ") > Expr.cacheLength) {
// Only keep the most recent entries
delete cache[keys.shift()];
}
return (cache[key + " "] = value);
}
return cache;
}
/**
* Mark a function for special use by Sizzle
* @param {Function} fn The function to mark
*/
function markFunction(fn) {
fn[expando] = true;
return fn;
}
/**
* Support testing using an element
* @param {Function} fn Passed the created element and returns a boolean result
*/
function assert(fn) {
var el = document.createElement("fieldset");
try {
return !!fn(el);
} catch (e) {
return false;
} finally {
// Remove from its parent by default
if (el.parentNode) {
el.parentNode.removeChild(el);
}
// release memory in IE
el = null;
}
}
/**
* Adds the same handler for all of the specified attrs
* @param {String} attrs Pipe-separated list of attributes
* @param {Function} handler The method that will be applied
*/
function addHandle(attrs, handler) {
var arr = attrs.split("|"),
i = arr.length;
while (i--) {
Expr.attrHandle[arr[i]] = handler;
}
}
/**
* Checks document order of two siblings
* @param {Element} a
* @param {Element} b
* @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
*/
function siblingCheck(a, b) {
var cur = b && a,
diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
a.sourceIndex - b.sourceIndex;
// Use IE sourceIndex if available on both nodes
if (diff) {
return diff;
}
// Check if b follows a
if (cur) {
while ((cur = cur.nextSibling)) {
if (cur === b) {
return -1;
}
}
}
return a ? 1 : -1;
}
/**
* Returns a function to use in pseudos for input types
* @param {String} type
*/
function createInputPseudo(type) {
return function (elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === type;
};
}
/**
* Returns a function to use in pseudos for buttons
* @param {String} type
*/
function createButtonPseudo(type) {
return function (elem) {
var name = elem.nodeName.toLowerCase();
return (name === "input" || name === "button") && elem.type === type;
};
}
/**
* Returns a function to use in pseudos for :enabled/:disabled
* @param {Boolean} disabled true for :disabled; false for :enabled
*/
function createDisabledPseudo(disabled) {
// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
return function (elem) {
// Only certain elements can match :enabled or :disabled
// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
if ("form" in elem) {
// Check for inherited disabledness on relevant non-disabled elements:
// * listed form-associated elements in a disabled fieldset
// https://html.spec.whatwg.org/multipage/forms.html#category-listed
// https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
// * option elements in a disabled optgroup
// https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
// All such elements have a "form" property.
if (elem.parentNode && elem.disabled === false) {
// Option elements defer to a parent optgroup if present
if ("label" in elem) {
if ("label" in elem.parentNode) {
return elem.parentNode.disabled === disabled;
} else {
return elem.disabled === disabled;
}
}
// Support: IE 6 - 11
// Use the isDisabled shortcut property to check for disabled fieldset ancestors
return elem.isDisabled === disabled ||
// Where there is no isDisabled, check manually
/* jshint -W018 */
elem.isDisabled !== !disabled &&
disabledAncestor(elem) === disabled;
}
return elem.disabled === disabled;
// Try to winnow out elements that can't be disabled before trusting the disabled property.
// Some victims get caught in our net (label, legend, menu, track), but it shouldn't
// even exist on them, let alone have a boolean value.
} else if ("label" in elem) {
return elem.disabled === disabled;
}
// Remaining elements are neither :enabled nor :disabled
return false;
};
}
/**
* Returns a function to use in pseudos for positionals
* @param {Function} fn
*/
function createPositionalPseudo(fn) {
return markFunction(function (argument) {
argument = +argument;
return markFunction(function (seed, matches) {
var j,
matchIndexes = fn([], seed.length, argument),
i = matchIndexes.length;
// Match elements found at the specified indexes
while (i--) {
if (seed[(j = matchIndexes[i])]) {
seed[j] = !(matches[j] = seed[j]);
}
}
});
});
}
/**
* Checks a node for validity as a Sizzle context
* @param {Element|Object=} context
* @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
*/
function testContext(context) {
return context && typeof context.getElementsByTagName !== "undefined" && context;
}
// Expose support vars for convenience
support = Sizzle.support = {};
/**
* Detects XML nodes
* @param {Element|Object} elem An element or a document
* @returns {Boolean} True iff elem is a non-HTML XML node
*/
isXML = Sizzle.isXML = function (elem) {
// documentElement is verified for cases where it doesn't yet exist
// (such as loading iframes in IE - #4833)
var documentElement = elem && (elem.ownerDocument || elem).documentElement;
return documentElement ? documentElement.nodeName !== "HTML" : false;
};
/**
* Sets document-related variables once based on the current document
* @param {Element|Object} [doc] An element or document object to use to set the document
* @returns {Object} Returns the current document
*/
setDocument = Sizzle.setDocument = function (node) {
var hasCompare, subWindow,
doc = node ? node.ownerDocument || node : preferredDoc;
// Return early if doc is invalid or already selected
if (doc === document || doc.nodeType !== 9 || !doc.documentElement) {
return document;
}
// Update global variables
document = doc;
docElem = document.documentElement;
documentIsHTML = !isXML(document);
// Support: IE 9-11, Edge
// Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
if (preferredDoc !== document &&
(subWindow = document.defaultView) && subWindow.top !== subWindow) {
// Support: IE 11, Edge
if (subWindow.addEventListener) {
subWindow.addEventListener("unload", unloadHandler, false);
// Support: IE 9 - 10 only
} else if (subWindow.attachEvent) {
subWindow.attachEvent("onunload", unloadHandler);
}
}
/* Attributes
---------------------------------------------------------------------- */
// Support: IE<8
// Verify that getAttribute really returns attributes and not properties
// (excepting IE8 booleans)
support.attributes = assert(function (el) {
el.className = "i";
return !el.getAttribute("className");
});
/* getElement(s)By*
---------------------------------------------------------------------- */
// Check if getElementsByTagName("*") returns only elements
support.getElementsByTagName = assert(function (el) {
el.appendChild(document.createComment(""));
return !el.getElementsByTagName("*").length;
});
// Support: IE<9
support.getElementsByClassName = rnative.test(document.getElementsByClassName);
// Support: IE<10
// Check if getElementById returns elements by name
// The broken getElementById methods don't pick up programmatically-set names,
// so use a roundabout getElementsByName test
support.getById = assert(function (el) {
docElem.appendChild(el).id = expando;
return !document.getElementsByName || !document.getElementsByName(expando).length;
});
// ID filter and find
if (support.getById) {
Expr.filter["ID"] = function (id) {
var attrId = id.replace(runescape, funescape);
return function (elem) {
return elem.getAttribute("id") === attrId;
};
};
Expr.find["ID"] = function (id, context) {
if (typeof context.getElementById !== "undefined" && documentIsHTML) {
var elem = context.getElementById(id);
return elem ? [elem] : [];
}
};
} else {
Expr.filter["ID"] = function (id) {
var attrId = id.replace(runescape, funescape);
return function (elem) {
var node = typeof elem.getAttributeNode !== "undefined" &&
elem.getAttributeNode("id");
return node && node.value === attrId;
};
};
// Support: IE 6 - 7 only
// getElementById is not reliable as a find shortcut
Expr.find["ID"] = function (id, context) {
if (typeof context.getElementById !== "undefined" && documentIsHTML) {
var node, i, elems,
elem = context.getElementById(id);
if (elem) {
// Verify the id attribute
node = elem.getAttributeNode("id");
if (node && node.value === id) {
return [elem];
}
// Fall back on getElementsByName
elems = context.getElementsByName(id);
i = 0;
while ((elem = elems[i++])) {
node = elem.getAttributeNode("id");
if (node && node.value === id) {
return [elem];
}
}
}
return [];
}
};
}
// Tag
Expr.find["TAG"] = support.getElementsByTagName ?
function (tag, context) {
if (typeof context.getElementsByTagName !== "undefined") {
return context.getElementsByTagName(tag);
// DocumentFragment nodes don't have gEBTN
} else if (support.qsa) {
return context.querySelectorAll(tag);
}
} :
function (tag, context) {
var elem,
tmp = [],
i = 0,
// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
results = context.getElementsByTagName(tag);
// Filter out possible comments
if (tag === "*") {
while ((elem = results[i++])) {
if (elem.nodeType === 1) {
tmp.push(elem);
}
}
return tmp;
}
return results;
};
// Class
Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) {
if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) {
return context.getElementsByClassName(className);
}
};
/* QSA/matchesSelector
---------------------------------------------------------------------- */
// QSA and matchesSelector support
// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
rbuggyMatches = [];
// qSa(:focus) reports false when true (Chrome 21)
// We allow this because of a bug in IE8/9 that throws an error
// whenever `document.activeElement` is accessed on an iframe
// So, we allow :focus to pass through QSA all the time to avoid the IE error
// See https://bugs.jquery.com/ticket/13378
rbuggyQSA = [];
if ((support.qsa = rnative.test(document.querySelectorAll))) {
// Build QSA regex
// Regex strategy adopted from Diego Perini
assert(function (el) {
// Select is set to empty string on purpose
// This is to test IE's treatment of not explicitly
// setting a boolean content attribute,
// since its presence should be enough
// https://bugs.jquery.com/ticket/12359
docElem.appendChild(el).innerHTML = "<a id='" + expando + "'></a>" +
"<select id='" + expando + "-\r\\' msallowcapture=>" +
"<option selected=></option></select>";
// Support: IE8, Opera 11-12.16
// Nothing should be selected when empty strings follow ^= or $= or *=
// The test attribute must be unknown in Opera but "safe" for WinRT
// https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
if (el.querySelectorAll("[msallowcapture^=]").length) {
rbuggyQSA.push("[*^$]=" + whitespace + "*(?:|\"\")");
}
// Support: IE8
// Boolean attributes and "value" are not treated correctly
if (!el.querySelectorAll("[selected]").length) {
rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")");
}
// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
if (!el.querySelectorAll("[id~=" + expando + "-]").length) {
rbuggyQSA.push("~=");
}
// Webkit/Opera - :checked should return selected option elements
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
// IE8 throws error here and will not see later tests
if (!el.querySelectorAll(":checked").length) {
rbuggyQSA.push(":checked");
}
// Support: Safari 8+, iOS 8+
// https://bugs.webkit.org/show_bug.cgi?id=136851
// In-page `selector#id sibling-combinator selector` fails
if (!el.querySelectorAll("a#" + expando + "+*").length) {
rbuggyQSA.push(".#.+[+~]");
}
});
assert(function (el) {
el.innerHTML = "<a href= disabled='disabled'></a>" +
"<select disabled='disabled'><option/></select>";
// Support: Windows 8 Native Apps
// The type and name attributes are restricted during .innerHTML assignment
var input = document.createElement("input");
input.setAttribute("type", "hidden");
el.appendChild(input).setAttribute("name", "D");
// Support: IE8
// Enforce case-sensitivity of name attribute
if (el.querySelectorAll("[name=d]").length) {
rbuggyQSA.push("name" + whitespace + "*[*^$|!~]?=");
}
// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
// IE8 throws error here and will not see later tests
if (el.querySelectorAll(":enabled").length !== 2) {
rbuggyQSA.push(":enabled", ":disabled");
}
// Support: IE9-11+
// IE's :disabled selector does not pick up the children of disabled fieldsets
docElem.appendChild(el).disabled = true;
if (el.querySelectorAll(":disabled").length !== 2) {
rbuggyQSA.push(":enabled", ":disabled");
}
// Opera 10-11 does not throw on post-comma invalid pseudos
el.querySelectorAll("*,:x");
rbuggyQSA.push(",.*:");
});
}
if ((support.matchesSelector = rnative.test((matches = docElem.matches ||
docElem.webkitMatchesSelector ||
docElem.mozMatchesSelector ||
docElem.oMatchesSelector ||
docElem.msMatchesSelector)))) {
assert(function (el) {
// Check to see if it's possible to do matchesSelector
// on a disconnected node (IE 9)
support.disconnectedMatch = matches.call(el, "*");
// This should fail with an exception
// Gecko does not error, returns false instead
matches.call(el, "[s!=]:x");
rbuggyMatches.push("!=", pseudos);
});
}
rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
/* Contains
---------------------------------------------------------------------- */
hasCompare = rnative.test(docElem.compareDocumentPosition);
// Element contains another
// Purposefully self-exclusive
// As in, an element does not contain itself
contains = hasCompare || rnative.test(docElem.contains) ?
function (a, b) {
var adown = a.nodeType === 9 ? a.documentElement : a,
bup = b && b.parentNode;
return a === bup || !!(bup && bup.nodeType === 1 && (
adown.contains ?
adown.contains(bup) :
a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16
));
} :
function (a, b) {
if (b) {
while ((b = b.parentNode)) {
if (b === a) {
return true;
}
}
}
return false;
};
/* Sorting
---------------------------------------------------------------------- */
// Document order sorting
sortOrder = hasCompare ?
function (a, b) {
// Flag for duplicate removal
if (a === b) {
hasDuplicate = true;
return 0;
}
// Sort on method existence if only one input has compareDocumentPosition
var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
if (compare) {
return compare;
}
// Calculate position if both inputs belong to the same document
compare = (a.ownerDocument || a) === (b.ownerDocument || b) ?
a.compareDocumentPosition(b) :
// Otherwise we know they are disconnected
1;
// Disconnected nodes
if (compare & 1 ||
(!support.sortDetached && b.compareDocumentPosition(a) === compare)) {
// Choose the first element that is related to our preferred document
if (a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a)) {
return -1;
}
if (b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b)) {
return 1;
}
// Maintain original order
return sortInput ?
(indexOf(sortInput, a) - indexOf(sortInput, b)) :
0;
}
return compare & 4 ? -1 : 1;
} :
function (a, b) {
// Exit early if the nodes are identical
if (a === b) {
hasDuplicate = true;
return 0;
}
var cur,
i = 0,
aup = a.parentNode,
bup = b.parentNode,
ap = [a],
bp = [b];
// Parentless nodes are either documents or disconnected
if (!aup || !bup) {
return a === document ? -1 :
b === document ? 1 :
aup ? -1 :
bup ? 1 :
sortInput ?
(indexOf(sortInput, a) - indexOf(sortInput, b)) :
0;
// If the nodes are siblings, we can do a quick check
} else if (aup === bup) {
return siblingCheck(a, b);
}
// Otherwise we need full lists of their ancestors for comparison
cur = a;
while ((cur = cur.parentNode)) {
ap.unshift(cur);
}
cur = b;
while ((cur = cur.parentNode)) {
bp.unshift(cur);
}
// Walk down the tree looking for a discrepancy
while (ap[i] === bp[i]) {
i++;
}
return i ?
// Do a sibling check if the nodes have a common ancestor
siblingCheck(ap[i], bp[i]) :
// Otherwise nodes in our document sort first
ap[i] === preferredDoc ? -1 :
bp[i] === preferredDoc ? 1 :
0;
};
return document;
};
Sizzle.matches = function (expr, elements) {
return Sizzle(expr, null, null, elements);
};
Sizzle.matchesSelector = function (elem, expr) {
// Set document vars if needed
if ((elem.ownerDocument || elem) !== document) {
setDocument(elem);
}
// Make sure that attribute selectors are quoted
expr = expr.replace(rattributeQuotes, "='$1']");
if (support.matchesSelector && documentIsHTML &&
!compilerCache[expr + " "] &&
(!rbuggyMatches || !rbuggyMatches.test(expr)) &&
(!rbuggyQSA || !rbuggyQSA.test(expr))) {
try {
var ret = matches.call(elem, expr);
// IE 9's matchesSelector returns false on disconnected nodes
if (ret || support.disconnectedMatch ||
// As well, disconnected nodes are said to be in a document
// fragment in IE 9
elem.document && elem.document.nodeType !== 11) {
return ret;
}
} catch (e) {}
}
return Sizzle(expr, document, null, [elem]).length > 0;
};
Sizzle.contains = function (context, elem) {
// Set document vars if needed
if ((context.ownerDocument || context) !== document) {
setDocument(context);
}
return contains(context, elem);
};
Sizzle.attr = function (elem, name) {
// Set document vars if needed
if ((elem.ownerDocument || elem) !== document) {
setDocument(elem);
}
var fn = Expr.attrHandle[name.toLowerCase()],
// Don't get fooled by Object.prototype properties (jQuery #13807)
val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ?
fn(elem, name, !documentIsHTML) :
undefined;
return val !== undefined ?
val :
support.attributes || !documentIsHTML ?
elem.getAttribute(name) :
(val = elem.getAttributeNode(name)) && val.specified ?
val.value :
null;
};
Sizzle.escape = function (sel) {
return (sel + "").replace(rcssescape, fcssescape);
};
Sizzle.error = function (msg) {
throw new Error("Syntax error, unrecognized expression: " + msg);
};
/**
* Document sorting and removing duplicates
* @param {ArrayLike} results
*/
Sizzle.uniqueSort = function (results) {
var elem,
duplicates = [],
j = 0,
i = 0;
// Unless we *know* we can detect duplicates, assume their presence
hasDuplicate = !support.detectDuplicates;
sortInput = !support.sortStable && results.slice(0);
results.sort(sortOrder);
if (hasDuplicate) {
while ((elem = results[i++])) {
if (elem === results[i]) {
j = duplicates.push(i);
}
}
while (j--) {
results.splice(duplicates[j], 1);
}
}
// Clear input after sorting to release objects
// See https://github.com/jquery/sizzle/pull/225
sortInput = null;
return results;
};
/**
* Utility function for retrieving the text value of an array of DOM nodes
* @param {Array|Element} elem
*/
getText = Sizzle.getText = function (elem) {
var node,
ret = "",
i = 0,
nodeType = elem.nodeType;
if (!nodeType) {
// If no nodeType, this is expected to be an array
while ((node = elem[i++])) {
// Do not traverse comment nodes
ret += getText(node);
}
} else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
// Use textContent for elements
// innerText usage removed for consistency of new lines (jQuery #11153)
if (typeof elem.textContent === "string") {
return elem.textContent;
} else {
// Traverse its children
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
ret += getText(elem);
}
}
} else if (nodeType === 3 || nodeType === 4) {
return elem.nodeValue;
}
// Do not include comment or processing instruction nodes
return ret;
};
Expr = Sizzle.selectors = {
// Can be adjusted by the user
cacheLength: 50,
createPseudo: markFunction,
match: matchExpr,
attrHandle: {},
find: {},
relative: {
">": {
dir: "parentNode",
first: true
},
" ": {
dir: "parentNode"
},
"+": {
dir: "previousSibling",
first: true
},
"~": {
dir: "previousSibling"
}
},
preFilter: {
"ATTR": function (match) {
match[1] = match[1].replace(runescape, funescape);
// Move the given value to match[3] whether quoted or unquoted
match[3] = (match[3] || match[4] || match[5] || "").replace(runescape, funescape);
if (match[2] === "~=") {
match[3] = " " + match[3] + " ";
}
return match.slice(0, 4);
},
"CHILD": function (match) {
/* matches from matchExpr["CHILD"]
1 type (only|nth|...)
2 what (child|of-type)
3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
4 xn-component of xn+y argument ([+-]?\d*n|)
5 sign of xn-component
6 x of xn-component
7 sign of y-component
8 y of y-component
*/
match[1] = match[1].toLowerCase();
if (match[1].slice(0, 3) === "nth") {
// nth-* requires argument
if (!match[3]) {
Sizzle.error(match[0]);
}
// numeric x and y parameters for Expr.filter.CHILD
// remember that false/true cast respectively to 0/1
match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] === "even" || match[3] === "odd"));
match[5] = +((match[7] + match[8]) || match[3] === "odd");
// other types prohibit arguments
} else if (match[3]) {
Sizzle.error(match[0]);
}
return match;
},
"PSEUDO": function (match) {
var excess,
unquoted = !match[6] && match[2];
if (matchExpr["CHILD"].test(match[0])) {
return null;
}
// Accept quoted arguments as-is
if (match[3]) {
match[2] = match[4] || match[5] || "";
// Strip excess characters from unquoted arguments
} else if (unquoted && rpseudo.test(unquoted) &&
// Get excess from tokenize (recursively)
(excess = tokenize(unquoted, true)) &&
// advance to the next closing parenthesis
(excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
// excess is a negative index
match[0] = match[0].slice(0, excess);
match[2] = unquoted.slice(0, excess);
}
// Return only captures needed by the pseudo filter method (type and argument)
return match.slice(0, 3);
}
},
filter: {
"TAG": function (nodeNameSelector) {
var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase();
return nodeNameSelector === "*" ?
function () {
return true;
} :
function (elem) {
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
};
},
"CLASS": function (className) {
var pattern = classCache[className + " "];
return pattern ||
(pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) &&
classCache(className, function (elem) {
return pattern.test(typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "");
});
},
"ATTR": function (name, operator, check) {
return function (elem) {
var result = Sizzle.attr(elem, name);
if (result == null) {
return operator === "!=";
}
if (!operator) {
return true;
}
result += "";
return operator === "=" ? result === check :
operator === "!=" ? result !== check :
operator === "^=" ? check && result.indexOf(check) === 0 :
operator === "*=" ? check && result.indexOf(check) > -1 :
operator === "$=" ? check && result.slice(-check.length) === check :
operator === "~=" ? (" " + result.replace(rwhitespace, " ") + " ").indexOf(check) > -1 :
operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" :
false;
};
},
"CHILD": function (type, what, argument, first, last) {
var simple = type.slice(0, 3) !== "nth",
forward = type.slice(-4) !== "last",
ofType = what === "of-type";
return first === 1 && last === 0 ?
// Shortcut for :nth-*(n)
function (elem) {
return !!elem.parentNode;
} :
function (elem, context, xml) {
var cache, uniqueCache, outerCache, node, nodeIndex, start,
dir = simple !== forward ? "nextSibling" : "previousSibling",
parent = elem.parentNode,
name = ofType && elem.nodeName.toLowerCase(),
useCache = !xml && !ofType,
diff = false;
if (parent) {
// :(first|last|only)-(child|of-type)
if (simple) {
while (dir) {
node = elem;
while ((node = node[dir])) {
if (ofType ?
node.nodeName.toLowerCase() === name :
node.nodeType === 1) {
return false;
}
}
// Reverse direction for :only-* (if we haven't yet done so)
start = dir = type === "only" && !start && "nextSibling";
}
return true;
}
start = [forward ? parent.firstChild : parent.lastChild];
// non-xml :nth-child(...) stores cache data on `parent`
if (forward && useCache) {
// Seek `elem` from a previously-cached index
// ...in a gzip-friendly way
node = parent;
outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[node.uniqueID] ||
(outerCache[node.uniqueID] = {});
cache = uniqueCache[type] || [];
nodeIndex = cache[0] === dirruns && cache[1];
diff = nodeIndex && cache[2];
node = nodeIndex && parent.childNodes[nodeIndex];
while ((node = ++nodeIndex && node && node[dir] ||
// Fallback to seeking `elem` from the start
(diff = nodeIndex = 0) || start.pop())) {
// When found, cache indexes on `parent` and break
if (node.nodeType === 1 && ++diff && node === elem) {
uniqueCache[type] = [dirruns, nodeIndex, diff];
break;
}
}
} else {
// Use previously-cached element index if available
if (useCache) {
// ...in a gzip-friendly way
node = elem;
outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[node.uniqueID] ||
(outerCache[node.uniqueID] = {});
cache = uniqueCache[type] || [];
nodeIndex = cache[0] === dirruns && cache[1];
diff = nodeIndex;
}
// xml :nth-child(...)
// or :nth-last-child(...) or :nth(-last)?-of-type(...)
if (diff === false) {
// Use the same loop as above to seek `elem` from the start
while ((node = ++nodeIndex && node && node[dir] ||
(diff = nodeIndex = 0) || start.pop())) {
if ((ofType ?
node.nodeName.toLowerCase() === name :
node.nodeType === 1) &&
++diff) {
// Cache the index of each encountered element
if (useCache) {
outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[node.uniqueID] ||
(outerCache[node.uniqueID] = {});
uniqueCache[type] = [dirruns, diff];
}
if (node === elem) {
break;
}
}
}
}
}
// Incorporate the offset, then check against cycle size
diff -= last;
return diff === first || (diff % first === 0 && diff / first >= 0);
}
};
},
"PSEUDO": function (pseudo, argument) {
// pseudo-class names are case-insensitive
// http://www.w3.org/TR/selectors/#pseudo-classes
// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
// Remember that setFilters inherits from pseudos
var args,
fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] ||
Sizzle.error("unsupported pseudo: " + pseudo);
// The user may use createPseudo to indicate that
// arguments are needed to create the filter function
// just as Sizzle does
if (fn[expando]) {
return fn(argument);
}
// But maintain support for old signatures
if (fn.length > 1) {
args = [pseudo, pseudo, "", argument];
return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ?
markFunction(function (seed, matches) {
var idx,
matched = fn(seed, argument),
i = matched.length;
while (i--) {
idx = indexOf(seed, matched[i]);
seed[idx] = !(matches[idx] = matched[i]);
}
}) :
function (elem) {
return fn(elem, 0, args);
};
}
return fn;
}
},
pseudos: {
// Potentially complex pseudos
"not": markFunction(function (selector) {
// Trim the selector passed to compile
// to avoid treating leading and trailing
// spaces as combinators
var input = [],
results = [],
matcher = compile(selector.replace(rtrim, "$1"));
return matcher[expando] ?
markFunction(function (seed, matches, context, xml) {
var elem,
unmatched = matcher(seed, null, xml, []),
i = seed.length;
// Match elements unmatched by `matcher`
while (i--) {
if ((elem = unmatched[i])) {
seed[i] = !(matches[i] = elem);
}
}
}) :
function (elem, context, xml) {
input[0] = elem;
matcher(input, null, xml, results);
// Don't keep the element (issue #299)
input[0] = null;
return !results.pop();
};
}),
"has": markFunction(function (selector) {
return function (elem) {
return Sizzle(selector, elem).length > 0;
};
}),
"contains": markFunction(function (text) {
text = text.replace(runescape, funescape);
return function (elem) {
return (elem.textContent || elem.innerText || getText(elem)).indexOf(text) > -1;
};
}),
// "Whether an element is represented by a :lang() selector
// is based solely on the element's language value
// being equal to the identifier C,
// or beginning with the identifier C immediately followed by "-".
// The matching of C against the element's language value is performed case-insensitively.
// The identifier C does not have to be a valid language name."
// http://www.w3.org/TR/selectors/#lang-pseudo
"lang": markFunction(function (lang) {
// lang value must be a valid identifier
if (!ridentifier.test(lang || "")) {
Sizzle.error("unsupported lang: " + lang);
}
lang = lang.replace(runescape, funescape).toLowerCase();
return function (elem) {
var elemLang;
do {
if ((elemLang = documentIsHTML ?
elem.lang :
elem.getAttribute("xml:lang") || elem.getAttribute("lang"))) {
elemLang = elemLang.toLowerCase();
return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
}
} while ((elem = elem.parentNode) && elem.nodeType === 1);
return false;
};
}),
// Miscellaneous
"target": function (elem) {
var hash = window.location && window.location.hash;
return hash && hash.slice(1) === elem.id;
},
"root": function (elem) {
return elem === docElem;
},
"focus": function (elem) {
return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
},
// Boolean properties
"enabled": createDisabledPseudo(false),
"disabled": createDisabledPseudo(true),
"checked": function (elem) {
// In CSS3, :checked should return both checked and selected elements
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
var nodeName = elem.nodeName.toLowerCase();
return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
},
"selected": function (elem) {
// Accessing this property makes selected-by-default
// options in Safari work properly
if (elem.parentNode) {
elem.parentNode.selectedIndex;
}
return elem.selected === true;
},
// Contents
"empty": function (elem) {
// http://www.w3.org/TR/selectors/#empty-pseudo
// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
// but not by others (comment: 8; processing instruction: 7; etc.)
// nodeType < 6 works because attributes (2) do not appear as children
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
if (elem.nodeType < 6) {
return false;
}
}
return true;
},
"parent": function (elem) {
return !Expr.pseudos["empty"](elem);
},
// Element/input types
"header": function (elem) {
return rheader.test(elem.nodeName);
},
"input": function (elem) {
return rinputs.test(elem.nodeName);
},
"button": function (elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === "button" || name === "button";
},
"text": function (elem) {
var attr;
return elem.nodeName.toLowerCase() === "input" &&
elem.type === "text" &&
// Support: IE<8
// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text");
},
// Position-in-collection
"first": createPositionalPseudo(function () {
return [0];
}),
"last": createPositionalPseudo(function (matchIndexes, length) {
return [length - 1];
}),
"eq": createPositionalPseudo(function (matchIndexes, length, argument) {
return [argument < 0 ? argument + length : argument];
}),
"even": createPositionalPseudo(function (matchIndexes, length) {
var i = 0;
for (; i < length; i += 2) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"odd": createPositionalPseudo(function (matchIndexes, length) {
var i = 1;
for (; i < length; i += 2) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"lt": createPositionalPseudo(function (matchIndexes, length, argument) {
var i = argument < 0 ? argument + length : argument;
for (; --i >= 0;) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"gt": createPositionalPseudo(function (matchIndexes, length, argument) {
var i = argument < 0 ? argument + length : argument;
for (; ++i < length;) {
matchIndexes.push(i);
}
return matchIndexes;
})
}
};
Expr.pseudos["nth"] = Expr.pseudos["eq"];
// Add button/input type pseudos
for (i in {
radio: true,
checkbox: true,
file: true,
password: true,
image: true
}) {
Expr.pseudos[i] = createInputPseudo(i);
}
for (i in {
submit: true,
reset: true
}) {
Expr.pseudos[i] = createButtonPseudo(i);
}
// Easy API for creating new setFilters
function setFilters() {}
setFilters.prototype = Expr.filters = Expr.pseudos;
Expr.setFilters = new setFilters();
tokenize = Sizzle.tokenize = function (selector, parseOnly) {
var matched, match, tokens, type,
soFar, groups, preFilters,
cached = tokenCache[selector + " "];
if (cached) {
return parseOnly ? 0 : cached.slice(0);
}
soFar = selector;
groups = [];
preFilters = Expr.preFilter;
while (soFar) {
// Comma and first run
if (!matched || (match = rcomma.exec(soFar))) {
if (match) {
// Don't consume trailing commas as valid
soFar = soFar.slice(match[0].length) || soFar;
}
groups.push((tokens = []));
}
matched = false;
// Combinators
if ((match = rcombinators.exec(soFar))) {
matched = match.shift();
tokens.push({
value: matched,
// Cast descendant combinators to space
type: match[0].replace(rtrim, " ")
});
soFar = soFar.slice(matched.length);
}
// Filters
for (type in Expr.filter) {
if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] ||
(match = preFilters[type](match)))) {
matched = match.shift();
tokens.push({
value: matched,
type: type,
matches: match
});
soFar = soFar.slice(matched.length);
}
}
if (!matched) {
break;
}
}
// Return the length of the invalid excess
// if we're just parsing
// Otherwise, throw an error or return tokens
return parseOnly ?
soFar.length :
soFar ?
Sizzle.error(selector) :
// Cache the tokens
tokenCache(selector, groups).slice(0);
};
function toSelector(tokens) {
var i = 0,
len = tokens.length,
selector = "";
for (; i < len; i++) {
selector += tokens[i].value;
}
return selector;
}
function addCombinator(matcher, combinator, base) {
var dir = combinator.dir,
skip = combinator.next,
key = skip || dir,
checkNonElements = base && key === "parentNode",
doneName = done++;
return combinator.first ?
// Check against closest ancestor/preceding element
function (elem, context, xml) {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
return matcher(elem, context, xml);
}
}
return false;
} :
// Check against all ancestor/preceding elements
function (elem, context, xml) {
var oldCache, uniqueCache, outerCache,
newCache = [dirruns, doneName];
// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
if (xml) {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
if (matcher(elem, context, xml)) {
return true;
}
}
}
} else {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
outerCache = elem[expando] || (elem[expando] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[elem.uniqueID] || (outerCache[elem.uniqueID] = {});
if (skip && skip === elem.nodeName.toLowerCase()) {
elem = elem[dir] || elem;
} else if ((oldCache = uniqueCache[key]) &&
oldCache[0] === dirruns && oldCache[1] === doneName) {
// Assign to newCache so results back-propagate to previous elements
return (newCache[2] = oldCache[2]);
} else {
// Reuse newcache so results back-propagate to previous elements
uniqueCache[key] = newCache;
// A match means we're done; a fail means we have to keep checking
if ((newCache[2] = matcher(elem, context, xml))) {
return true;
}
}
}
}
}
return false;
};
}
function elementMatcher(matchers) {
return matchers.length > 1 ?
function (elem, context, xml) {
var i = matchers.length;
while (i--) {
if (!matchers[i](elem, context, xml)) {
return false;
}
}
return true;
} :
matchers[0];
}
function multipleContexts(selector, contexts, results) {
var i = 0,
len = contexts.length;
for (; i < len; i++) {
Sizzle(selector, contexts[i], results);
}
return results;
}
function condense(unmatched, map, filter, context, xml) {
var elem,
newUnmatched = [],
i = 0,
len = unmatched.length,
mapped = map != null;
for (; i < len; i++) {
if ((elem = unmatched[i])) {
if (!filter || filter(elem, context, xml)) {
newUnmatched.push(elem);
if (mapped) {
map.push(i);
}
}
}
}
return newUnmatched;
}
function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
if (postFilter && !postFilter[expando]) {
postFilter = setMatcher(postFilter);
}
if (postFinder && !postFinder[expando]) {
postFinder = setMatcher(postFinder, postSelector);
}
return markFunction(function (seed, results, context, xml) {
var temp, i, elem,
preMap = [],
postMap = [],
preexisting = results.length,
// Get initial elements from seed or context
elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []),
// Prefilter to get matcher input, preserving a map for seed-results synchronization
matcherIn = preFilter && (seed || !selector) ?
condense(elems, preMap, preFilter, context, xml) :
elems,
matcherOut = matcher ?
// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
postFinder || (seed ? preFilter : preexisting || postFilter) ?
// ...intermediate processing is necessary
[] :
// ...otherwise use results directly
results :
matcherIn;
// Find primary matches
if (matcher) {
matcher(matcherIn, matcherOut, context, xml);
}
// Apply postFilter
if (postFilter) {
temp = condense(matcherOut, postMap);
postFilter(temp, [], context, xml);
// Un-match failing elements by moving them back to matcherIn
i = temp.length;
while (i--) {
if ((elem = temp[i])) {
matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
}
}
}
if (seed) {
if (postFinder || preFilter) {
if (postFinder) {
// Get the final matcherOut by condensing this intermediate into postFinder contexts
temp = [];
i = matcherOut.length;
while (i--) {
if ((elem = matcherOut[i])) {
// Restore matcherIn since elem is not yet a final match
temp.push((matcherIn[i] = elem));
}
}
postFinder(null, (matcherOut = []), temp, xml);
}
// Move matched elements from seed to results to keep them synchronized
i = matcherOut.length;
while (i--) {
if ((elem = matcherOut[i]) &&
(temp = postFinder ? indexOf(seed, elem) : preMap[i]) > -1) {
seed[temp] = !(results[temp] = elem);
}
}
}
// Add elements to results, through postFinder if defined
} else {
matcherOut = condense(
matcherOut === results ?
matcherOut.splice(preexisting, matcherOut.length) :
matcherOut
);
if (postFinder) {
postFinder(null, results, matcherOut, xml);
} else {
push.apply(results, matcherOut);
}
}
});
}
function matcherFromTokens(tokens) {
var checkContext, matcher, j,
len = tokens.length,
leadingRelative = Expr.relative[tokens[0].type],
implicitRelative = leadingRelative || Expr.relative[" "],
i = leadingRelative ? 1 : 0,
// The foundational matcher ensures that elements are reachable from top-level context(s)
matchContext = addCombinator(function (elem) {
return elem === checkContext;
}, implicitRelative, true),
matchAnyContext = addCombinator(function (elem) {
return indexOf(checkContext, elem) > -1;
}, implicitRelative, true),
matchers = [function (elem, context, xml) {
var ret = (!leadingRelative && (xml || context !== outermostContext)) || (
(checkContext = context).nodeType ?
matchContext(elem, context, xml) :
matchAnyContext(elem, context, xml));
// Avoid hanging onto element (issue #299)
checkContext = null;
return ret;
}];
for (; i < len; i++) {
if ((matcher = Expr.relative[tokens[i].type])) {
matchers = [addCombinator(elementMatcher(matchers), matcher)];
} else {
matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
// Return special upon seeing a positional matcher
if (matcher[expando]) {
// Find the next relative operator (if any) for proper handling
j = ++i;
for (; j < len; j++) {
if (Expr.relative[tokens[j].type]) {
break;
}
}
return setMatcher(
i > 1 && elementMatcher(matchers),
i > 1 && toSelector(
// If the preceding token was a descendant combinator, insert an implicit any-element `*`
tokens.slice(0, i - 1).concat({
value: tokens[i - 2].type === " " ? "*" : ""
})
).replace(rtrim, "$1"),
matcher,
i < j && matcherFromTokens(tokens.slice(i, j)),
j < len && matcherFromTokens((tokens = tokens.slice(j))),
j < len && toSelector(tokens)
);
}
matchers.push(matcher);
}
}
return elementMatcher(matchers);
}
function matcherFromGroupMatchers(elementMatchers, setMatchers) {
var bySet = setMatchers.length > 0,
byElement = elementMatchers.length > 0,
superMatcher = function (seed, context, xml, results, outermost) {
var elem, j, matcher,
matchedCount = 0,
i = "0",
unmatched = seed && [],
setMatched = [],
contextBackup = outermostContext,
// We must always have either seed elements or outermost context
elems = seed || byElement && Expr.find["TAG"]("*", outermost),
// Use integer dirruns iff this is the outermost matcher
dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
len = elems.length;
if (outermost) {
outermostContext = context === document || context || outermost;
}
// Add elements passing elementMatchers directly to results
// Support: IE<9, Safari
// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
for (; i !== len && (elem = elems[i]) != null; i++) {
if (byElement && elem) {
j = 0;
if (!context && elem.ownerDocument !== document) {
setDocument(elem);
xml = !documentIsHTML;
}
while ((matcher = elementMatchers[j++])) {
if (matcher(elem, context || document, xml)) {
results.push(elem);
break;
}
}
if (outermost) {
dirruns = dirrunsUnique;
}
}
// Track unmatched elements for set filters
if (bySet) {
// They will have gone through all possible matchers
if ((elem = !matcher && elem)) {
matchedCount--;
}
// Lengthen the array for every element, matched or not
if (seed) {
unmatched.push(elem);
}
}
}
// `i` is now the count of elements visited above, and adding it to `matchedCount`
// makes the latter nonnegative.
matchedCount += i;
// Apply set filters to unmatched elements
// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
// no element matchers and no seed.
// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
// case, which will result in a "00" `matchedCount` that differs from `i` but is also
// numerically zero.
if (bySet && i !== matchedCount) {
j = 0;
while ((matcher = setMatchers[j++])) {
matcher(unmatched, setMatched, context, xml);
}
if (seed) {
// Reintegrate element matches to eliminate the need for sorting
if (matchedCount > 0) {
while (i--) {
if (!(unmatched[i] || setMatched[i])) {
setMatched[i] = pop.call(results);
}
}
}
// Discard index placeholder values to get only actual matches
setMatched = condense(setMatched);
}
// Add matches to results
push.apply(results, setMatched);
// Seedless set matches succeeding multiple successful matchers stipulate sorting
if (outermost && !seed && setMatched.length > 0 &&
(matchedCount + setMatchers.length) > 1) {
Sizzle.uniqueSort(results);
}
}
// Override manipulation of globals by nested matchers
if (outermost) {
dirruns = dirrunsUnique;
outermostContext = contextBackup;
}
return unmatched;
};
return bySet ?
markFunction(superMatcher) :
superMatcher;
}
compile = Sizzle.compile = function (selector, match /* Internal Use Only */ ) {
var i,
setMatchers = [],
elementMatchers = [],
cached = compilerCache[selector + " "];
if (!cached) {
// Generate a function of recursive functions that can be used to check each element
if (!match) {
match = tokenize(selector);
}
i = match.length;
while (i--) {
cached = matcherFromTokens(match[i]);
if (cached[expando]) {
setMatchers.push(cached);
} else {
elementMatchers.push(cached);
}
}
// Cache the compiled function
cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
// Save selector and tokenization
cached.selector = selector;
}
return cached;
};
/**
* A low-level selection function that works with Sizzle's compiled
* selector functions
* @param {String|Function} selector A selector or a pre-compiled
* selector function built with Sizzle.compile
* @param {Element} context
* @param {Array} [results]
* @param {Array} [seed] A set of elements to match against
*/
select = Sizzle.select = function (selector, context, results, seed) {
var i, tokens, token, type, find,
compiled = typeof selector === "function" && selector,
match = !seed && tokenize((selector = compiled.selector || selector));
results = results || [];
// Try to minimize operations if there is only one selector in the list and no seed
// (the latter of which guarantees us context)
if (match.length === 1) {
// Reduce context if the leading compound selector is an ID
tokens = match[0] = match[0].slice(0);
if (tokens.length > 2 && (token = tokens[0]).type === "ID" &&
context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) {
context = (Expr.find["ID"](token.matches[0].replace(runescape, funescape), context) || [])[0];
if (!context) {
return results;
// Precompiled matchers will still verify ancestry, so step up a level
} else if (compiled) {
context = context.parentNode;
}
selector = selector.slice(tokens.shift().value.length);
}
// Fetch a seed set for right-to-left matching
i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
while (i--) {
token = tokens[i];
// Abort if we hit a combinator
if (Expr.relative[(type = token.type)]) {
break;
}
if ((find = Expr.find[type])) {
// Search, expanding context for leading sibling combinators
if ((seed = find(
token.matches[0].replace(runescape, funescape),
rsibling.test(tokens[0].type) && testContext(context.parentNode) || context
))) {
// If seed is empty or no tokens remain, we can return early
tokens.splice(i, 1);
selector = seed.length && toSelector(tokens);
if (!selector) {
push.apply(results, seed);
return results;
}
break;
}
}
}
}
// Compile and execute a filtering function if one is not provided
// Provide `match` to avoid retokenization if we modified the selector above
(compiled || compile(selector, match))(
seed,
context, !documentIsHTML,
results, !context || rsibling.test(selector) && testContext(context.parentNode) || context
);
return results;
};
// One-time assignments
// Sort stability
support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
// Support: Chrome 14-35+
// Always assume duplicates if they aren't passed to the comparison function
support.detectDuplicates = !!hasDuplicate;
// Initialize against the default document
setDocument();
// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
// Detached nodes confoundingly follow *each other*
support.sortDetached = assert(function (el) {
// Should return 1, but returns 4 (following)
return el.compareDocumentPosition(document.createElement("fieldset")) & 1;
});
// Support: IE<8
// Prevent attribute/property "interpolation"
// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
if (!assert(function (el) {
el.innerHTML = "<a href='#'></a>";
return el.firstChild.getAttribute("href") === "#";
})) {
addHandle("type|href|height|width", function (elem, name, isXML) {
if (!isXML) {
return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2);
}
});
}
// Support: IE<9
// Use defaultValue in place of getAttribute("value")
if (!support.attributes || !assert(function (el) {
el.innerHTML = "<input/>";
el.firstChild.setAttribute("value", "");
return el.firstChild.getAttribute("value") === "";
})) {
addHandle("value", function (elem, name, isXML) {
if (!isXML && elem.nodeName.toLowerCase() === "input") {
return elem.defaultValue;
}
});
}
// Support: IE<9
// Use getAttributeNode to fetch booleans when getAttribute lies
if (!assert(function (el) {
return el.getAttribute("disabled") == null;
})) {
addHandle(booleans, function (elem, name, isXML) {
var val;
if (!isXML) {
return elem[name] === true ? name.toLowerCase() :
(val = elem.getAttributeNode(name)) && val.specified ?
val.value :
null;
}
});
}
return Sizzle;
})(window);
jQuery.find = Sizzle; jQuery.expr = Sizzle.selectors;
// Deprecated jQuery.expr[":"] = jQuery.expr.pseudos; jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; jQuery.text = Sizzle.getText; jQuery.isXMLDoc = Sizzle.isXML; jQuery.contains = Sizzle.contains; jQuery.escapeSelector = Sizzle.escape;
var dir = function (elem, dir, until) {
var matched = [],
truncate = until !== undefined;
while ((elem = elem[dir]) && elem.nodeType !== 9) {
if (elem.nodeType === 1) {
if (truncate && jQuery(elem).is(until)) {
break;
}
matched.push(elem);
}
}
return matched;
};
var siblings = function (n, elem) {
var matched = [];
for (; n; n = n.nextSibling) {
if (n.nodeType === 1 && n !== elem) {
matched.push(n);
}
}
return matched; };
var rneedsContext = jQuery.expr.match.needsContext;
function nodeName(elem, name) {
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
}; var rsingleTag = (/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i);
var risSimple = /^.[^:#\[\.,]*$/;
// Implement the identical functionality for filter and not
function winnow(elements, qualifier, not) {
if (jQuery.isFunction(qualifier)) {
return jQuery.grep(elements, function (elem, i) {
return !!qualifier.call(elem, i, elem) !== not;
});
}
// Single element
if (qualifier.nodeType) {
return jQuery.grep(elements, function (elem) {
return (elem === qualifier) !== not;
});
}
// Arraylike of elements (jQuery, arguments, Array)
if (typeof qualifier !== "string") {
return jQuery.grep(elements, function (elem) {
return (indexOf.call(qualifier, elem) > -1) !== not;
});
}
// Simple selector that can be filtered directly, removing non-Elements
if (risSimple.test(qualifier)) {
return jQuery.filter(qualifier, elements, not);
}
// Complex selector, compare the two sets, removing non-Elements
qualifier = jQuery.filter(qualifier, elements);
return jQuery.grep(elements, function (elem) {
return (indexOf.call(qualifier, elem) > -1) !== not && elem.nodeType === 1;
});
}
jQuery.filter = function (expr, elems, not) {
var elem = elems[0];
if (not) {
expr = ":not(" + expr + ")";
}
if (elems.length === 1 && elem.nodeType === 1) {
return jQuery.find.matchesSelector(elem, expr) ? [elem] : [];
}
return jQuery.find.matches(expr, jQuery.grep(elems, function (elem) {
return elem.nodeType === 1;
}));
};
jQuery.fn.extend({
find: function (selector) {
var i, ret,
len = this.length,
self = this;
if (typeof selector !== "string") {
return this.pushStack(jQuery(selector).filter(function () {
for (i = 0; i < len; i++) {
if (jQuery.contains(self[i], this)) {
return true;
}
}
}));
}
ret = this.pushStack([]);
for (i = 0; i < len; i++) {
jQuery.find(selector, self[i], ret);
}
return len > 1 ? jQuery.uniqueSort(ret) : ret;
},
filter: function (selector) {
return this.pushStack(winnow(this, selector || [], false));
},
not: function (selector) {
return this.pushStack(winnow(this, selector || [], true));
},
is: function (selector) {
return !!winnow(
this,
// If this is a positional/relative selector, check membership in the returned set
// so $("p:first").is("p:last") won't return true for a doc with two "p".
typeof selector === "string" && rneedsContext.test(selector) ?
jQuery(selector) :
selector || [],
false
).length;
}
});
// Initialize a jQuery object
// A central reference to the root jQuery(document) var rootjQuery,
// A simple way to check for HTML strings
// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
// Strict HTML recognition (#11290: must start with <)
// Shortcut simple #id case for speed
rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
init = jQuery.fn.init = function (selector, context, root) {
var match, elem;
// HANDLE: $(""), $(null), $(undefined), $(false)
if (!selector) {
return this;
}
// Method init() accepts an alternate rootjQuery
// so migrate can support jQuery.sub (gh-2101)
root = root || rootjQuery;
// Handle HTML strings
if (typeof selector === "string") {
if (selector[0] === "<" &&
selector[selector.length - 1] === ">" &&
selector.length >= 3) {
// Assume that strings that start and end with <> are HTML and skip the regex check
match = [null, selector, null];
} else {
match = rquickExpr.exec(selector);
}
// Match html or make sure no context is specified for #id
if (match && (match[1] || !context)) {
// HANDLE: $(html) -> $(array)
if (match[1]) {
context = context instanceof jQuery ? context[0] : context;
// Option to run scripts is true for back-compat
// Intentionally let the error be thrown if parseHTML is not present
jQuery.merge(this, jQuery.parseHTML(
match[1],
context && context.nodeType ? context.ownerDocument || context : document,
true
));
// HANDLE: $(html, props)
if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) {
for (match in context) {
// Properties of context are called as methods if possible
if (jQuery.isFunction(this[match])) {
this[match](context[match]);
// ...and otherwise set as attributes
} else {
this.attr(match, context[match]);
}
}
}
return this;
// HANDLE: $(#id)
} else {
elem = document.getElementById(match[2]);
if (elem) {
// Inject the element directly into the jQuery object
this[0] = elem;
this.length = 1;
}
return this;
}
// HANDLE: $(expr, $(...))
} else if (!context || context.jquery) {
return (context || root).find(selector);
// HANDLE: $(expr, context)
// (which is just equivalent to: $(context).find(expr)
} else {
return this.constructor(context).find(selector);
}
// HANDLE: $(DOMElement)
} else if (selector.nodeType) {
this[0] = selector;
this.length = 1;
return this;
// HANDLE: $(function)
// Shortcut for document ready
} else if (jQuery.isFunction(selector)) {
return root.ready !== undefined ?
root.ready(selector) :
// Execute immediately if ready is not present
selector(jQuery);
}
return jQuery.makeArray(selector, this);
};
// Give the init function the jQuery prototype for later instantiation init.prototype = jQuery.fn;
// Initialize central reference rootjQuery = jQuery(document);
var rparentsprev = /^(?:parents|prev(?:Until|All))/,
// Methods guaranteed to produce a unique set when starting from a unique set
guaranteedUnique = {
children: true,
contents: true,
next: true,
prev: true
};
jQuery.fn.extend({
has: function (target) {
var targets = jQuery(target, this),
l = targets.length;
return this.filter(function () {
var i = 0;
for (; i < l; i++) {
if (jQuery.contains(this, targets[i])) {
return true;
}
}
});
},
closest: function (selectors, context) {
var cur,
i = 0,
l = this.length,
matched = [],
targets = typeof selectors !== "string" && jQuery(selectors);
// Positional selectors never match, since there's no _selection_ context
if (!rneedsContext.test(selectors)) {
for (; i < l; i++) {
for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
// Always skip document fragments
if (cur.nodeType < 11 && (targets ?
targets.index(cur) > -1 :
// Don't pass non-elements to Sizzle
cur.nodeType === 1 &&
jQuery.find.matchesSelector(cur, selectors))) {
matched.push(cur);
break;
}
}
}
}
return this.pushStack(matched.length > 1 ? jQuery.uniqueSort(matched) : matched);
},
// Determine the position of an element within the set
index: function (elem) {
// No argument, return index in parent
if (!elem) {
return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1;
}
// Index in selector
if (typeof elem === "string") {
return indexOf.call(jQuery(elem), this[0]);
}
// Locate the position of the desired element
return indexOf.call(this,
// If it receives a jQuery object, the first element is used
elem.jquery ? elem[0] : elem
);
},
add: function (selector, context) {
return this.pushStack(
jQuery.uniqueSort(
jQuery.merge(this.get(), jQuery(selector, context))
)
);
},
addBack: function (selector) {
return this.add(selector == null ?
this.prevObject : this.prevObject.filter(selector)
);
}
});
function sibling(cur, dir) {
while ((cur = cur[dir]) && cur.nodeType !== 1) {}
return cur;
}
jQuery.each({
parent: function (elem) {
var parent = elem.parentNode;
return parent && parent.nodeType !== 11 ? parent : null;
},
parents: function (elem) {
return dir(elem, "parentNode");
},
parentsUntil: function (elem, i, until) {
return dir(elem, "parentNode", until);
},
next: function (elem) {
return sibling(elem, "nextSibling");
},
prev: function (elem) {
return sibling(elem, "previousSibling");
},
nextAll: function (elem) {
return dir(elem, "nextSibling");
},
prevAll: function (elem) {
return dir(elem, "previousSibling");
},
nextUntil: function (elem, i, until) {
return dir(elem, "nextSibling", until);
},
prevUntil: function (elem, i, until) {
return dir(elem, "previousSibling", until);
},
siblings: function (elem) {
return siblings((elem.parentNode || {}).firstChild, elem);
},
children: function (elem) {
return siblings(elem.firstChild);
},
contents: function (elem) {
if (nodeName(elem, "iframe")) {
return elem.contentDocument;
}
// Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
// Treat the template element as a regular one in browsers that
// don't support it.
if (nodeName(elem, "template")) {
elem = elem.content || elem;
}
return jQuery.merge([], elem.childNodes);
}
}, function (name, fn) {
jQuery.fn[name] = function (until, selector) {
var matched = jQuery.map(this, fn, until);
if (name.slice(-5) !== "Until") {
selector = until;
}
if (selector && typeof selector === "string") {
matched = jQuery.filter(selector, matched);
}
if (this.length > 1) {
// Remove duplicates
if (!guaranteedUnique[name]) {
jQuery.uniqueSort(matched);
}
// Reverse order for parents* and prev-derivatives
if (rparentsprev.test(name)) {
matched.reverse();
}
}
return this.pushStack(matched);
};
});
var rnothtmlwhite = (/[^\x20\t\r\n\f]+/g);
// Convert String-formatted options into Object-formatted ones
function createOptions(options) {
var object = {};
jQuery.each(options.match(rnothtmlwhite) || [], function (_, flag) {
object[flag] = true;
});
return object;
}
/*
* Create a callback list using the following parameters:
*
* options: an optional list of space-separated options that will change how
* the callback list behaves or a more traditional option object
*
* By default a callback list will act like an event callback list and can be
* "fired" multiple times.
*
* Possible options:
*
* once: will ensure the callback list can only be fired once (like a Deferred)
*
* memory: will keep track of previous values and will call any callback added
* after the list has been fired right away with the latest "memorized"
* values (like a Deferred)
*
* unique: will ensure a callback can only be added once (no duplicate in the list)
*
* stopOnFalse: interrupt callings when a callback returns false
*
*/
jQuery.Callbacks = function (options) {
// Convert options from String-formatted to Object-formatted if needed
// (we check in cache first)
options = typeof options === "string" ?
createOptions(options) :
jQuery.extend({}, options);
var // Flag to know if list is currently firing
firing,
// Last fire value for non-forgettable lists
memory,
// Flag to know if list was already fired
fired,
// Flag to prevent firing
locked,
// Actual callback list
list = [],
// Queue of execution data for repeatable lists
queue = [],
// Index of currently firing callback (modified by add/remove as needed)
firingIndex = -1,
// Fire callbacks
fire = function () {
// Enforce single-firing
locked = locked || options.once;
// Execute callbacks for all pending executions,
// respecting firingIndex overrides and runtime changes
fired = firing = true;
for (; queue.length; firingIndex = -1) {
memory = queue.shift();
while (++firingIndex < list.length) {
// Run callback and check for early termination
if (list[firingIndex].apply(memory[0], memory[1]) === false &&
options.stopOnFalse) {
// Jump to end and forget the data so .add doesn't re-fire
firingIndex = list.length;
memory = false;
}
}
}
// Forget the data if we're done with it
if (!options.memory) {
memory = false;
}
firing = false;
// Clean up if we're done firing for good
if (locked) {
// Keep an empty list if we have data for future add calls
if (memory) {
list = [];
// Otherwise, this object is spent
} else {
list = "";
}
}
},
// Actual Callbacks object
self = {
// Add a callback or a collection of callbacks to the list
add: function () {
if (list) {
// If we have memory from a past run, we should fire after adding
if (memory && !firing) {
firingIndex = list.length - 1;
queue.push(memory);
}
(function add(args) {
jQuery.each(args, function (_, arg) {
if (jQuery.isFunction(arg)) {
if (!options.unique || !self.has(arg)) {
list.push(arg);
}
} else if (arg && arg.length && jQuery.type(arg) !== "string") {
// Inspect recursively
add(arg);
}
});
})(arguments);
if (memory && !firing) {
fire();
}
}
return this;
},
// Remove a callback from the list
remove: function () {
jQuery.each(arguments, function (_, arg) {
var index;
while ((index = jQuery.inArray(arg, list, index)) > -1) {
list.splice(index, 1);
// Handle firing indexes
if (index <= firingIndex) {
firingIndex--;
}
}
});
return this;
},
// Check if a given callback is in the list.
// If no argument is given, return whether or not list has callbacks attached.
has: function (fn) {
return fn ?
jQuery.inArray(fn, list) > -1 :
list.length > 0;
},
// Remove all callbacks from the list
empty: function () {
if (list) {
list = [];
}
return this;
},
// Disable .fire and .add
// Abort any current/pending executions
// Clear all callbacks and values
disable: function () {
locked = queue = [];
list = memory = "";
return this;
},
disabled: function () {
return !list;
},
// Disable .fire
// Also disable .add unless we have memory (since it would have no effect)
// Abort any pending executions
lock: function () {
locked = queue = [];
if (!memory && !firing) {
list = memory = "";
}
return this;
},
locked: function () {
return !!locked;
},
// Call all callbacks with the given context and arguments
fireWith: function (context, args) {
if (!locked) {
args = args || [];
args = [context, args.slice ? args.slice() : args];
queue.push(args);
if (!firing) {
fire();
}
}
return this;
},
// Call all the callbacks with the given arguments
fire: function () {
self.fireWith(this, arguments);
return this;
},
// To know if the callbacks have already been called at least once
fired: function () {
return !!fired;
}
};
return self; };
function Identity(v) {
return v;
}
function Thrower(ex) {
throw ex;
}
function adoptValue(value, resolve, reject, noValue) {
var method;
try {
// Check for promise aspect first to privilege synchronous behavior
if (value && jQuery.isFunction((method = value.promise))) {
method.call(value).done(resolve).fail(reject);
// Other thenables
} else if (value && jQuery.isFunction((method = value.then))) {
method.call(value, resolve, reject);
// Other non-thenables
} else {
// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
// * false: [ value ].slice( 0 ) => resolve( value )
// * true: [ value ].slice( 1 ) => resolve()
resolve.apply(undefined, [value].slice(noValue));
}
// For Promises/A+, convert exceptions into rejections
// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
// Deferred#then to conditionally suppress rejection.
} catch (value) {
// Support: Android 4.0 only
// Strict mode functions invoked without .call/.apply get global-object context
reject.apply(undefined, [value]);
}
}
jQuery.extend({
Deferred: function (func) {
var tuples = [
// action, add listener, callbacks, // ... .then handlers, argument index, [final state] ["notify", "progress", jQuery.Callbacks("memory"), jQuery.Callbacks("memory"), 2], ["resolve", "done", jQuery.Callbacks("once memory"), jQuery.Callbacks("once memory"), 0, "resolved"], ["reject", "fail", jQuery.Callbacks("once memory"), jQuery.Callbacks("once memory"), 1, "rejected"] ],
state = "pending",
promise = {
state: function () {
return state;
},
always: function () {
deferred.done(arguments).fail(arguments);
return this;
},
"catch": function (fn) {
return promise.then(null, fn);
},
// Keep pipe for back-compat
pipe: function ( /* fnDone, fnFail, fnProgress */ ) {
var fns = arguments;
return jQuery.Deferred(function (newDefer) {
jQuery.each(tuples, function (i, tuple) {
// Map tuples (progress, done, fail) to arguments (done, fail, progress)
var fn = jQuery.isFunction(fns[tuple[4]]) && fns[tuple[4]];
// deferred.progress(function() { bind to newDefer or newDefer.notify })
// deferred.done(function() { bind to newDefer or newDefer.resolve })
// deferred.fail(function() { bind to newDefer or newDefer.reject })
deferred[tuple[1]](function () {
var returned = fn && fn.apply(this, arguments);
if (returned && jQuery.isFunction(returned.promise)) {
returned.promise()
.progress(newDefer.notify)
.done(newDefer.resolve)
.fail(newDefer.reject);
} else {
newDefer[tuple[0] + "With"](
this,
fn ? [returned] : arguments
);
}
});
});
fns = null;
}).promise();
},
then: function (onFulfilled, onRejected, onProgress) {
var maxDepth = 0;
function resolve(depth, deferred, handler, special) {
return function () {
var that = this,
args = arguments,
mightThrow = function () {
var returned, then;
// Support: Promises/A+ section 2.3.3.3.3
// https://promisesaplus.com/#point-59
// Ignore double-resolution attempts
if (depth < maxDepth) {
return;
}
returned = handler.apply(that, args);
// Support: Promises/A+ section 2.3.1
// https://promisesaplus.com/#point-48
if (returned === deferred.promise()) {
throw new TypeError("Thenable self-resolution");
}
// Support: Promises/A+ sections 2.3.3.1, 3.5
// https://promisesaplus.com/#point-54
// https://promisesaplus.com/#point-75
// Retrieve `then` only once
then = returned &&
// Support: Promises/A+ section 2.3.4
// https://promisesaplus.com/#point-64
// Only check objects and functions for thenability
(typeof returned === "object" ||
typeof returned === "function") &&
returned.then;
// Handle a returned thenable
if (jQuery.isFunction(then)) {
// Special processors (notify) just wait for resolution
if (special) {
then.call(
returned,
resolve(maxDepth, deferred, Identity, special),
resolve(maxDepth, deferred, Thrower, special)
);
// Normal processors (resolve) also hook into progress
} else {
// ...and disregard older resolution values
maxDepth++;
then.call(
returned,
resolve(maxDepth, deferred, Identity, special),
resolve(maxDepth, deferred, Thrower, special),
resolve(maxDepth, deferred, Identity,
deferred.notifyWith)
);
}
// Handle all other returned values
} else {
// Only substitute handlers pass on context
// and multiple values (non-spec behavior)
if (handler !== Identity) {
that = undefined;
args = [returned];
}
// Process the value(s)
// Default process is resolve
(special || deferred.resolveWith)(that, args);
}
},
// Only normal processors (resolve) catch and reject exceptions
process = special ?
mightThrow :
function () {
try {
mightThrow();
} catch (e) {
if (jQuery.Deferred.exceptionHook) {
jQuery.Deferred.exceptionHook(e,
process.stackTrace);
}
// Support: Promises/A+ section 2.3.3.3.4.1
// https://promisesaplus.com/#point-61
// Ignore post-resolution exceptions
if (depth + 1 >= maxDepth) {
// Only substitute handlers pass on context
// and multiple values (non-spec behavior)
if (handler !== Thrower) {
that = undefined;
args = [e];
}
deferred.rejectWith(that, args);
}
}
};
// Support: Promises/A+ section 2.3.3.3.1
// https://promisesaplus.com/#point-57
// Re-resolve promises immediately to dodge false rejection from
// subsequent errors
if (depth) {
process();
} else {
// Call an optional hook to record the stack, in case of exception
// since it's otherwise lost when execution goes async
if (jQuery.Deferred.getStackHook) {
process.stackTrace = jQuery.Deferred.getStackHook();
}
window.setTimeout(process);
}
};
}
return jQuery.Deferred(function (newDefer) {
// progress_handlers.add( ... )
tuples[0][3].add(
resolve(
0,
newDefer,
jQuery.isFunction(onProgress) ?
onProgress :
Identity,
newDefer.notifyWith
)
);
// fulfilled_handlers.add( ... )
tuples[1][3].add(
resolve(
0,
newDefer,
jQuery.isFunction(onFulfilled) ?
onFulfilled :
Identity
)
);
// rejected_handlers.add( ... )
tuples[2][3].add(
resolve(
0,
newDefer,
jQuery.isFunction(onRejected) ?
onRejected :
Thrower
)
);
}).promise();
},
// Get a promise for this deferred
// If obj is provided, the promise aspect is added to the object
promise: function (obj) {
return obj != null ? jQuery.extend(obj, promise) : promise;
}
},
deferred = {};
// Add list-specific methods
jQuery.each(tuples, function (i, tuple) {
var list = tuple[2],
stateString = tuple[5];
// promise.progress = list.add
// promise.done = list.add
// promise.fail = list.add
promise[tuple[1]] = list.add;
// Handle state
if (stateString) {
list.add(
function () {
// state = "resolved" (i.e., fulfilled)
// state = "rejected"
state = stateString;
},
// rejected_callbacks.disable
// fulfilled_callbacks.disable
tuples[3 - i][2].disable,
// progress_callbacks.lock
tuples[0][2].lock
);
}
// progress_handlers.fire
// fulfilled_handlers.fire
// rejected_handlers.fire
list.add(tuple[3].fire);
// deferred.notify = function() { deferred.notifyWith(...) }
// deferred.resolve = function() { deferred.resolveWith(...) }
// deferred.reject = function() { deferred.rejectWith(...) }
deferred[tuple[0]] = function () {
deferred[tuple[0] + "With"](this === deferred ? undefined : this, arguments);
return this;
};
// deferred.notifyWith = list.fireWith
// deferred.resolveWith = list.fireWith
// deferred.rejectWith = list.fireWith
deferred[tuple[0] + "With"] = list.fireWith;
});
// Make the deferred a promise
promise.promise(deferred);
// Call given func if any
if (func) {
func.call(deferred, deferred);
}
// All done!
return deferred;
},
// Deferred helper
when: function (singleValue) {
var
// count of uncompleted subordinates
remaining = arguments.length,
// count of unprocessed arguments
i = remaining,
// subordinate fulfillment data
resolveContexts = Array(i),
resolveValues = slice.call(arguments),
// the master Deferred
master = jQuery.Deferred(),
// subordinate callback factory
updateFunc = function (i) {
return function (value) {
resolveContexts[i] = this;
resolveValues[i] = arguments.length > 1 ? slice.call(arguments) : value;
if (!(--remaining)) {
master.resolveWith(resolveContexts, resolveValues);
}
};
};
// Single- and empty arguments are adopted like Promise.resolve
if (remaining <= 1) {
adoptValue(singleValue, master.done(updateFunc(i)).resolve, master.reject, !remaining);
// Use .then() to unwrap secondary thenables (cf. gh-3000)
if (master.state() === "pending" ||
jQuery.isFunction(resolveValues[i] && resolveValues[i].then)) {
return master.then();
}
}
// Multiple arguments are aggregated like Promise.all array elements
while (i--) {
adoptValue(resolveValues[i], updateFunc(i), master.reject);
}
return master.promise();
}
});
// These usually indicate a programmer mistake during development, // warn about them ASAP rather than swallowing them by default. var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
jQuery.Deferred.exceptionHook = function (error, stack) {
// Support: IE 8 - 9 only
// Console exists when dev tools are open, which can happen at any time
if (window.console && window.console.warn && error && rerrorNames.test(error.name)) {
window.console.warn("jQuery.Deferred exception: " + error.message, error.stack, stack);
}
};
jQuery.readyException = function (error) {
window.setTimeout(function () {
throw error;
});
};
// The deferred used on DOM ready var readyList = jQuery.Deferred();
jQuery.fn.ready = function (fn) {
readyList
.then(fn)
// Wrap jQuery.readyException in a function so that the lookup
// happens at the time of error handling instead of callback
// registration.
.catch(function (error) {
jQuery.readyException(error);
});
return this; };
jQuery.extend({
// Is the DOM ready to be used? Set to true once it occurs.
isReady: false,
// A counter to track how many items to wait for before
// the ready event fires. See #6781
readyWait: 1,
// Handle when the DOM is ready
ready: function (wait) {
// Abort if there are pending holds or we're already ready
if (wait === true ? --jQuery.readyWait : jQuery.isReady) {
return;
}
// Remember that the DOM is ready
jQuery.isReady = true;
// If a normal DOM Ready event fired, decrement, and wait if need be
if (wait !== true && --jQuery.readyWait > 0) {
return;
}
// If there are functions bound, to execute
readyList.resolveWith(document, [jQuery]);
}
});
jQuery.ready.then = readyList.then;
// The ready event handler and self cleanup method
function completed() {
document.removeEventListener("DOMContentLoaded", completed);
window.removeEventListener("load", completed);
jQuery.ready();
}
// Catch cases where $(document).ready() is called
// after the browser event has already occurred.
// Support: IE <=9 - 10 only
// Older IE sometimes signals "interactive" too soon
if (document.readyState === "complete" ||
(document.readyState !== "loading" && !document.documentElement.doScroll)) {
// Handle it asynchronously to allow scripts the opportunity to delay ready
window.setTimeout(jQuery.ready);
} else {
// Use the handy event callback
document.addEventListener("DOMContentLoaded", completed);
// A fallback to window.onload, that will always work
window.addEventListener("load", completed);
}
// Multifunctional method to get and set values of a collection
// The value/s can optionally be executed if it's a function
var access = function (elems, fn, key, value, chainable, emptyGet, raw) {
var i = 0,
len = elems.length,
bulk = key == null;
// Sets many values
if (jQuery.type(key) === "object") {
chainable = true;
for (i in key) {
access(elems, fn, i, key[i], true, emptyGet, raw);
}
// Sets one value
} else if (value !== undefined) {
chainable = true;
if (!jQuery.isFunction(value)) {
raw = true;
}
if (bulk) {
// Bulk operations run against the entire set
if (raw) {
fn.call(elems, value);
fn = null;
// ...except when executing function values
} else {
bulk = fn;
fn = function (elem, key, value) {
return bulk.call(jQuery(elem), value);
};
}
}
if (fn) {
for (; i < len; i++) {
fn(
elems[i], key, raw ?
value :
value.call(elems[i], i, fn(elems[i], key))
);
}
}
}
if (chainable) {
return elems;
}
// Gets
if (bulk) {
return fn.call(elems);
}
return len ? fn(elems[0], key) : emptyGet;
};
var acceptData = function (owner) {
// Accepts only:
// - Node
// - Node.ELEMENT_NODE
// - Node.DOCUMENT_NODE
// - Object
// - Any
return owner.nodeType === 1 || owner.nodeType === 9 || !(+owner.nodeType);
};
function Data() {
this.expando = jQuery.expando + Data.uid++;
}
Data.uid = 1;
Data.prototype = {
cache: function (owner) {
// Check if the owner object already has a cache
var value = owner[this.expando];
// If not, create one
if (!value) {
value = {};
// We can accept data for non-element nodes in modern browsers,
// but we should not, see #8335.
// Always return an empty object.
if (acceptData(owner)) {
// If it is a node unlikely to be stringify-ed or looped over
// use plain assignment
if (owner.nodeType) {
owner[this.expando] = value;
// Otherwise secure it in a non-enumerable property
// configurable must be true to allow the property to be
// deleted when data is removed
} else {
Object.defineProperty(owner, this.expando, {
value: value,
configurable: true
});
}
}
}
return value;
},
set: function (owner, data, value) {
var prop,
cache = this.cache(owner);
// Handle: [ owner, key, value ] args
// Always use camelCase key (gh-2257)
if (typeof data === "string") {
cache[jQuery.camelCase(data)] = value;
// Handle: [ owner, { properties } ] args
} else {
// Copy the properties one-by-one to the cache object
for (prop in data) {
cache[jQuery.camelCase(prop)] = data[prop];
}
}
return cache;
},
get: function (owner, key) {
return key === undefined ?
this.cache(owner) :
// Always use camelCase key (gh-2257)
owner[this.expando] && owner[this.expando][jQuery.camelCase(key)];
},
access: function (owner, key, value) {
// In cases where either:
//
// 1. No key was specified
// 2. A string key was specified, but no value provided
//
// Take the "read" path and allow the get method to determine
// which value to return, respectively either:
//
// 1. The entire cache object
// 2. The data stored at the key
//
if (key === undefined ||
((key && typeof key === "string") && value === undefined)) {
return this.get(owner, key);
}
// When the key is not a string, or both a key and value
// are specified, set or extend (existing objects) with either:
//
// 1. An object of properties
// 2. A key and value
//
this.set(owner, key, value);
// Since the "set" path can have two possible entry points
// return the expected data based on which path was taken[*]
return value !== undefined ? value : key;
},
remove: function (owner, key) {
var i,
cache = owner[this.expando];
if (cache === undefined) {
return;
}
if (key !== undefined) {
// Support array or space separated string of keys
if (Array.isArray(key)) {
// If key is an array of keys...
// We always set camelCase keys, so remove that.
key = key.map(jQuery.camelCase);
} else {
key = jQuery.camelCase(key);
// If a key with the spaces exists, use it.
// Otherwise, create an array by matching non-whitespace
key = key in cache ? [key] :
(key.match(rnothtmlwhite) || []);
}
i = key.length;
while (i--) {
delete cache[key[i]];
}
}
// Remove the expando if there's no more data
if (key === undefined || jQuery.isEmptyObject(cache)) {
// Support: Chrome <=35 - 45
// Webkit & Blink performance suffers when deleting properties
// from DOM nodes, so set to undefined instead
// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
if (owner.nodeType) {
owner[this.expando] = undefined;
} else {
delete owner[this.expando];
}
}
},
hasData: function (owner) {
var cache = owner[this.expando];
return cache !== undefined && !jQuery.isEmptyObject(cache);
}
};
var dataPriv = new Data();
var dataUser = new Data();
// Implementation Summary // // 1. Enforce API surface and semantic compatibility with 1.9.x branch // 2. Improve the module's maintainability by reducing the storage // paths to a single mechanism. // 3. Use the same single mechanism to support "private" and "user" data. // 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) // 5. Avoid exposing implementation details on user objects (eg. expando properties) // 6. Provide a clear path for implementation upgrade to WeakMap in 2014
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
rmultiDash = /[A-Z]/g;
function getData(data) {
if (data === "true") {
return true;
}
if (data === "false") {
return false;
}
if (data === "null") {
return null;
}
// Only convert to a number if it doesn't change the string
if (data === +data + "") {
return +data;
}
if (rbrace.test(data)) {
return JSON.parse(data);
}
return data; }
function dataAttr(elem, key, data) {
var name;
// If nothing was found internally, try to fetch any
// data from the HTML5 data-* attribute
if (data === undefined && elem.nodeType === 1) {
name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase();
data = elem.getAttribute(name);
if (typeof data === "string") {
try {
data = getData(data);
} catch (e) {}
// Make sure we set the data so it isn't changed later
dataUser.set(elem, key, data);
} else {
data = undefined;
}
}
return data;
}
jQuery.extend({
hasData: function (elem) {
return dataUser.hasData(elem) || dataPriv.hasData(elem);
},
data: function (elem, name, data) {
return dataUser.access(elem, name, data);
},
removeData: function (elem, name) {
dataUser.remove(elem, name);
},
// TODO: Now that all calls to _data and _removeData have been replaced
// with direct calls to dataPriv methods, these can be deprecated.
_data: function (elem, name, data) {
return dataPriv.access(elem, name, data);
},
_removeData: function (elem, name) {
dataPriv.remove(elem, name);
}
});
jQuery.fn.extend({
data: function (key, value) {
var i, name, data,
elem = this[0],
attrs = elem && elem.attributes;
// Gets all values
if (key === undefined) {
if (this.length) {
data = dataUser.get(elem);
if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) {
i = attrs.length;
while (i--) {
// Support: IE 11 only
// The attrs elements can be null (#14894)
if (attrs[i]) {
name = attrs[i].name;
if (name.indexOf("data-") === 0) {
name = jQuery.camelCase(name.slice(5));
dataAttr(elem, name, data[name]);
}
}
}
dataPriv.set(elem, "hasDataAttrs", true);
}
}
return data;
}
// Sets multiple values
if (typeof key === "object") {
return this.each(function () {
dataUser.set(this, key);
});
}
return access(this, function (value) {
var data;
// The calling jQuery object (element matches) is not empty
// (and therefore has an element appears at this[ 0 ]) and the
// `value` parameter was not undefined. An empty jQuery object
// will result in `undefined` for elem = this[ 0 ] which will
// throw an exception if an attempt to read a data cache is made.
if (elem && value === undefined) {
// Attempt to get data from the cache
// The key will always be camelCased in Data
data = dataUser.get(elem, key);
if (data !== undefined) {
return data;
}
// Attempt to "discover" the data in
// HTML5 custom data-* attrs
data = dataAttr(elem, key);
if (data !== undefined) {
return data;
}
// We tried really hard, but the data doesn't exist.
return;
}
// Set the data...
this.each(function () {
// We always store the camelCased key
dataUser.set(this, key, value);
});
}, null, value, arguments.length > 1, null, true);
},
removeData: function (key) {
return this.each(function () {
dataUser.remove(this, key);
});
}
});
jQuery.extend({
queue: function (elem, type, data) {
var queue;
if (elem) {
type = (type || "fx") + "queue";
queue = dataPriv.get(elem, type);
// Speed up dequeue by getting out quickly if this is just a lookup
if (data) {
if (!queue || Array.isArray(data)) {
queue = dataPriv.access(elem, type, jQuery.makeArray(data));
} else {
queue.push(data);
}
}
return queue || [];
}
},
dequeue: function (elem, type) {
type = type || "fx";
var queue = jQuery.queue(elem, type),
startLength = queue.length,
fn = queue.shift(),
hooks = jQuery._queueHooks(elem, type),
next = function () {
jQuery.dequeue(elem, type);
};
// If the fx queue is dequeued, always remove the progress sentinel
if (fn === "inprogress") {
fn = queue.shift();
startLength--;
}
if (fn) {
// Add a progress sentinel to prevent the fx queue from being
// automatically dequeued
if (type === "fx") {
queue.unshift("inprogress");
}
// Clear up the last queue stop function
delete hooks.stop;
fn.call(elem, next, hooks);
}
if (!startLength && hooks) {
hooks.empty.fire();
}
},
// Not public - generate a queueHooks object, or return the current one
_queueHooks: function (elem, type) {
var key = type + "queueHooks";
return dataPriv.get(elem, key) || dataPriv.access(elem, key, {
empty: jQuery.Callbacks("once memory").add(function () {
dataPriv.remove(elem, [type + "queue", key]);
})
});
}
});
jQuery.fn.extend({
queue: function (type, data) {
var setter = 2;
if (typeof type !== "string") {
data = type;
type = "fx";
setter--;
}
if (arguments.length < setter) {
return jQuery.queue(this[0], type);
}
return data === undefined ?
this :
this.each(function () {
var queue = jQuery.queue(this, type, data);
// Ensure a hooks for this queue
jQuery._queueHooks(this, type);
if (type === "fx" && queue[0] !== "inprogress") {
jQuery.dequeue(this, type);
}
});
},
dequeue: function (type) {
return this.each(function () {
jQuery.dequeue(this, type);
});
},
clearQueue: function (type) {
return this.queue(type || "fx", []);
},
// Get a promise resolved when queues of a certain type
// are emptied (fx is the type by default)
promise: function (type, obj) {
var tmp,
count = 1,
defer = jQuery.Deferred(),
elements = this,
i = this.length,
resolve = function () {
if (!(--count)) {
defer.resolveWith(elements, [elements]);
}
};
if (typeof type !== "string") {
obj = type;
type = undefined;
}
type = type || "fx";
while (i--) {
tmp = dataPriv.get(elements[i], type + "queueHooks");
if (tmp && tmp.empty) {
count++;
tmp.empty.add(resolve);
}
}
resolve();
return defer.promise(obj);
}
});
var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i");
var cssExpand = ["Top", "Right", "Bottom", "Left"];
var isHiddenWithinTree = function (elem, el) {
// isHiddenWithinTree might be called from jQuery#filter function;
// in that case, element will be second argument
elem = el || elem;
// Inline style trumps all
return elem.style.display === "none" ||
elem.style.display === "" &&
// Otherwise, check computed style
// Support: Firefox <=43 - 45
// Disconnected elements can have computed display: none, so first confirm that elem is
// in the document.
jQuery.contains(elem.ownerDocument, elem) &&
jQuery.css(elem, "display") === "none"; };
var swap = function (elem, options, callback, args) {
var ret, name,
old = {};
// Remember the old values, and insert the new ones
for (name in options) {
old[name] = elem.style[name];
elem.style[name] = options[name];
}
ret = callback.apply(elem, args || []);
// Revert the old values
for (name in options) {
elem.style[name] = old[name];
}
return ret; };
function adjustCSS(elem, prop, valueParts, tween) {
var adjusted,
scale = 1,
maxIterations = 20,
currentValue = tween ?
function () {
return tween.cur();
} :
function () {
return jQuery.css(elem, prop, "");
},
initial = currentValue(),
unit = valueParts && valueParts[3] || (jQuery.cssNumber[prop] ? "" : "px"),
// Starting value computation is required for potential unit mismatches
initialInUnit = (jQuery.cssNumber[prop] || unit !== "px" && +initial) &&
rcssNum.exec(jQuery.css(elem, prop));
if (initialInUnit && initialInUnit[3] !== unit) {
// Trust units reported by jQuery.css
unit = unit || initialInUnit[3];
// Make sure we update the tween properties later on
valueParts = valueParts || [];
// Iteratively approximate from a nonzero starting point
initialInUnit = +initial || 1;
do {
// If previous iteration zeroed out, double until we get *something*.
// Use string for doubling so we don't accidentally see scale as unchanged below
scale = scale || ".5";
// Adjust and apply
initialInUnit = initialInUnit / scale;
jQuery.style(elem, prop, initialInUnit + unit);
// Update scale, tolerating zero or NaN from tween.cur()
// Break the loop if scale is unchanged or perfect, or if we've just had enough.
} while (
scale !== (scale = currentValue() / initial) && scale !== 1 && --maxIterations
);
}
if (valueParts) {
initialInUnit = +initialInUnit || +initial || 0;
// Apply relative offset (+=/-=) if specified
adjusted = valueParts[1] ?
initialInUnit + (valueParts[1] + 1) * valueParts[2] :
+valueParts[2];
if (tween) {
tween.unit = unit;
tween.start = initialInUnit;
tween.end = adjusted;
}
}
return adjusted;
}
var defaultDisplayMap = {};
function getDefaultDisplay(elem) {
var temp,
doc = elem.ownerDocument,
nodeName = elem.nodeName,
display = defaultDisplayMap[nodeName];
if (display) {
return display;
}
temp = doc.body.appendChild(doc.createElement(nodeName));
display = jQuery.css(temp, "display");
temp.parentNode.removeChild(temp);
if (display === "none") {
display = "block";
}
defaultDisplayMap[nodeName] = display;
return display; }
function showHide(elements, show) {
var display, elem,
values = [],
index = 0,
length = elements.length;
// Determine new display value for elements that need to change
for (; index < length; index++) {
elem = elements[index];
if (!elem.style) {
continue;
}
display = elem.style.display;
if (show) {
// Since we force visibility upon cascade-hidden elements, an immediate (and slow)
// check is required in this first loop unless we have a nonempty display value (either
// inline or about-to-be-restored)
if (display === "none") {
values[index] = dataPriv.get(elem, "display") || null;
if (!values[index]) {
elem.style.display = "";
}
}
if (elem.style.display === "" && isHiddenWithinTree(elem)) {
values[index] = getDefaultDisplay(elem);
}
} else {
if (display !== "none") {
values[index] = "none";
// Remember what we're overwriting
dataPriv.set(elem, "display", display);
}
}
}
// Set the display of the elements in a second loop to avoid constant reflow
for (index = 0; index < length; index++) {
if (values[index] != null) {
elements[index].style.display = values[index];
}
}
return elements; }
jQuery.fn.extend({
show: function () {
return showHide(this, true);
},
hide: function () {
return showHide(this);
},
toggle: function (state) {
if (typeof state === "boolean") {
return state ? this.show() : this.hide();
}
return this.each(function () {
if (isHiddenWithinTree(this)) {
jQuery(this).show();
} else {
jQuery(this).hide();
}
});
}
});
var rcheckableType = (/^(?:checkbox|radio)$/i);
var rtagName = (/<([a-z][^\/\0>\x20\t\r\n\f]+)/i);
var rscriptType = (/^$|\/(?:java|ecma)script/i);
// We have to close these tags to support XHTML (#13200)
var wrapMap = {
// Support: IE <=9 only
option: [1, "<select multiple='multiple'>", "</select>"],
// XHTML parsers do not magically insert elements in the
// same way that tag soup parsers do. So we cannot shorten
// this by omitting <tbody> or other required elements.
thead: [1, "_default: [0, "", ""] };
// Support: IE <=9 only wrapMap.optgroup = wrapMap.option;
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; wrapMap.th = wrapMap.td;
function getAll(context, tag) {
// Support: IE <=9 - 11 only
// Use typeof to avoid zero-argument method invocation on host objects (#15151)
var ret;
if (typeof context.getElementsByTagName !== "undefined") {
ret = context.getElementsByTagName(tag || "*");
} else if (typeof context.querySelectorAll !== "undefined") {
ret = context.querySelectorAll(tag || "*");
} else {
ret = [];
}
if (tag === undefined || tag && nodeName(context, tag)) {
return jQuery.merge([context], ret);
}
return ret; }
// Mark scripts as having already been evaluated
function setGlobalEval(elems, refElements) {
var i = 0,
l = elems.length;
for (; i < l; i++) {
dataPriv.set(
elems[i],
"globalEval", !refElements || dataPriv.get(refElements[i], "globalEval")
);
}
}
var rhtml = /<|&#?\w+;/;
function buildFragment(elems, context, scripts, selection, ignored) {
var elem, tmp, tag, wrap, contains, j,
fragment = context.createDocumentFragment(),
nodes = [],
i = 0,
l = elems.length;
for (; i < l; i++) {
elem = elems[i];
if (elem || elem === 0) {
// Add nodes directly
if (jQuery.type(elem) === "object") {
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge(nodes, elem.nodeType ? [elem] : elem);
// Convert non-html into a text node
} else if (!rhtml.test(elem)) {
nodes.push(context.createTextNode(elem));
// Convert html into DOM nodes
} else {
tmp = tmp || fragment.appendChild(context.createElement("div"));
// Deserialize a standard representation
tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
wrap = wrapMap[tag] || wrapMap._default;
tmp.innerHTML = wrap[1] + jQuery.htmlPrefilter(elem) + wrap[2];
// Descend through wrappers to the right content
j = wrap[0];
while (j--) {
tmp = tmp.lastChild;
}
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge(nodes, tmp.childNodes);
// Remember the top-level container
tmp = fragment.firstChild;
// Ensure the created nodes are orphaned (#12392)
tmp.textContent = "";
}
}
}
// Remove wrapper from fragment
fragment.textContent = "";
i = 0;
while ((elem = nodes[i++])) {
// Skip elements already in the context collection (trac-4087)
if (selection && jQuery.inArray(elem, selection) > -1) {
if (ignored) {
ignored.push(elem);
}
continue;
}
contains = jQuery.contains(elem.ownerDocument, elem);
// Append to fragment
tmp = getAll(fragment.appendChild(elem), "script");
// Preserve script evaluation history
if (contains) {
setGlobalEval(tmp);
}
// Capture executables
if (scripts) {
j = 0;
while ((elem = tmp[j++])) {
if (rscriptType.test(elem.type || "")) {
scripts.push(elem);
}
}
}
}
return fragment; }
(function () {
var fragment = document.createDocumentFragment(),
div = fragment.appendChild(document.createElement("div")),
input = document.createElement("input");
// Support: Android 4.0 - 4.3 only
// Check state lost if the name is set (#11217)
// Support: Windows Web Apps (WWA)
// `name` and `type` must use .setAttribute for WWA (#14901)
input.setAttribute("type", "radio");
input.setAttribute("checked", "checked");
input.setAttribute("name", "t");
div.appendChild(input);
// Support: Android <=4.1 only
// Older WebKit doesn't clone checked state correctly in fragments
support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
// Support: IE <=11 only
// Make sure textarea (and checkbox) defaultValue is properly cloned
div.innerHTML = "<textarea>x</textarea>";
support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue;
})();
var documentElement = document.documentElement;
var
rkeyEvent = /^key/,
rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
function returnTrue() {
return true;
}
function returnFalse() {
return false;
}
// Support: IE <=9 only
// See #13393 for more info
function safeActiveElement() {
try {
return document.activeElement;
} catch (err) {}
}
function on(elem, types, selector, data, fn, one) {
var origFn, type;
// Types can be a map of types/handlers
if (typeof types === "object") {
// ( types-Object, selector, data )
if (typeof selector !== "string") {
// ( types-Object, data )
data = data || selector;
selector = undefined;
}
for (type in types) {
on(elem, type, selector, data, types[type], one);
}
return elem;
}
if (data == null && fn == null) {
// ( types, fn )
fn = selector;
data = selector = undefined;
} else if (fn == null) {
if (typeof selector === "string") {
// ( types, selector, fn )
fn = data;
data = undefined;
} else {
// ( types, data, fn )
fn = data;
data = selector;
selector = undefined;
}
}
if (fn === false) {
fn = returnFalse;
} else if (!fn) {
return elem;
}
if (one === 1) {
origFn = fn;
fn = function (event) {
// Can use an empty set, since event contains the info
jQuery().off(event);
return origFn.apply(this, arguments);
};
// Use same guid so caller can remove using origFn
fn.guid = origFn.guid || (origFn.guid = jQuery.guid++);
}
return elem.each(function () {
jQuery.event.add(this, types, fn, data, selector);
});
}
/*
* Helper functions for managing events -- not part of the public interface.
* Props to Dean Edwards' addEvent library for many of the ideas.
*/
jQuery.event = {
global: {},
add: function (elem, types, handler, data, selector) {
var handleObjIn, eventHandle, tmp,
events, t, handleObj,
special, handlers, type, namespaces, origType,
elemData = dataPriv.get(elem);
// Don't attach events to noData or text/comment nodes (but allow plain objects)
if (!elemData) {
return;
}
// Caller can pass in an object of custom data in lieu of the handler
if (handler.handler) {
handleObjIn = handler;
handler = handleObjIn.handler;
selector = handleObjIn.selector;
}
// Ensure that invalid selectors throw exceptions at attach time
// Evaluate against documentElement in case elem is a non-element node (e.g., document)
if (selector) {
jQuery.find.matchesSelector(documentElement, selector);
}
// Make sure that the handler has a unique ID, used to find/remove it later
if (!handler.guid) {
handler.guid = jQuery.guid++;
}
// Init the element's event structure and main handler, if this is the first
if (!(events = elemData.events)) {
events = elemData.events = {};
}
if (!(eventHandle = elemData.handle)) {
eventHandle = elemData.handle = function (e) {
// Discard the second event of a jQuery.event.trigger() and
// when an event is called after a page has unloaded
return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
jQuery.event.dispatch.apply(elem, arguments) : undefined;
};
}
// Handle multiple events separated by a space
types = (types || "").match(rnothtmlwhite) || [""];
t = types.length;
while (t--) {
tmp = rtypenamespace.exec(types[t]) || [];
type = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
// There *must* be a type, no attaching namespace-only handlers
if (!type) {
continue;
}
// If event changes its type, use the special event handlers for the changed type
special = jQuery.event.special[type] || {};
// If selector defined, determine special event api type, otherwise given type
type = (selector ? special.delegateType : special.bindType) || type;
// Update special based on newly reset type
special = jQuery.event.special[type] || {};
// handleObj is passed to all event handlers
handleObj = jQuery.extend({
type: type,
origType: origType,
data: data,
handler: handler,
guid: handler.guid,
selector: selector,
needsContext: selector && jQuery.expr.match.needsContext.test(selector),
namespace: namespaces.join(".")
}, handleObjIn);
// Init the event handler queue if we're the first
if (!(handlers = events[type])) {
handlers = events[type] = [];
handlers.delegateCount = 0;
// Only use addEventListener if the special events handler returns false
if (!special.setup ||
special.setup.call(elem, data, namespaces, eventHandle) === false) {
if (elem.addEventListener) {
elem.addEventListener(type, eventHandle);
}
}
}
if (special.add) {
special.add.call(elem, handleObj);
if (!handleObj.handler.guid) {
handleObj.handler.guid = handler.guid;
}
}
// Add to the element's handler list, delegates in front
if (selector) {
handlers.splice(handlers.delegateCount++, 0, handleObj);
} else {
handlers.push(handleObj);
}
// Keep track of which events have ever been used, for event optimization
jQuery.event.global[type] = true;
}
},
// Detach an event or set of events from an element
remove: function (elem, types, handler, selector, mappedTypes) {
var j, origCount, tmp,
events, t, handleObj,
special, handlers, type, namespaces, origType,
elemData = dataPriv.hasData(elem) && dataPriv.get(elem);
if (!elemData || !(events = elemData.events)) {
return;
}
// Once for each type.namespace in types; type may be omitted
types = (types || "").match(rnothtmlwhite) || [""];
t = types.length;
while (t--) {
tmp = rtypenamespace.exec(types[t]) || [];
type = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
// Unbind all events (on this namespace, if provided) for the element
if (!type) {
for (type in events) {
jQuery.event.remove(elem, type + types[t], handler, selector, true);
}
continue;
}
special = jQuery.event.special[type] || {};
type = (selector ? special.delegateType : special.bindType) || type;
handlers = events[type] || [];
tmp = tmp[2] &&
new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
// Remove matching events
origCount = j = handlers.length;
while (j--) {
handleObj = handlers[j];
if ((mappedTypes || origType === handleObj.origType) &&
(!handler || handler.guid === handleObj.guid) &&
(!tmp || tmp.test(handleObj.namespace)) &&
(!selector || selector === handleObj.selector ||
selector === "**" && handleObj.selector)) {
handlers.splice(j, 1);
if (handleObj.selector) {
handlers.delegateCount--;
}
if (special.remove) {
special.remove.call(elem, handleObj);
}
}
}
// Remove generic event handler if we removed something and no more handlers exist
// (avoids potential for endless recursion during removal of special event handlers)
if (origCount && !handlers.length) {
if (!special.teardown ||
special.teardown.call(elem, namespaces, elemData.handle) === false) {
jQuery.removeEvent(elem, type, elemData.handle);
}
delete events[type];
}
}
// Remove data and the expando if it's no longer used
if (jQuery.isEmptyObject(events)) {
dataPriv.remove(elem, "handle events");
}
},
dispatch: function (nativeEvent) {
// Make a writable jQuery.Event from the native event object
var event = jQuery.event.fix(nativeEvent);
var i, j, ret, matched, handleObj, handlerQueue,
args = new Array(arguments.length),
handlers = (dataPriv.get(this, "events") || {})[event.type] || [],
special = jQuery.event.special[event.type] || {};
// Use the fix-ed jQuery.Event rather than the (read-only) native event
args[0] = event;
for (i = 1; i < arguments.length; i++) {
args[i] = arguments[i];
}
event.delegateTarget = this;
// Call the preDispatch hook for the mapped type, and let it bail if desired
if (special.preDispatch && special.preDispatch.call(this, event) === false) {
return;
}
// Determine handlers
handlerQueue = jQuery.event.handlers.call(this, event, handlers);
// Run delegates first; they may want to stop propagation beneath us
i = 0;
while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
event.currentTarget = matched.elem;
j = 0;
while ((handleObj = matched.handlers[j++]) &&
!event.isImmediatePropagationStopped()) {
// Triggered event must either 1) have no namespace, or 2) have namespace(s)
// a subset or equal to those in the bound event (both can have no namespace).
if (!event.rnamespace || event.rnamespace.test(handleObj.namespace)) {
event.handleObj = handleObj;
event.data = handleObj.data;
ret = ((jQuery.event.special[handleObj.origType] || {}).handle ||
handleObj.handler).apply(matched.elem, args);
if (ret !== undefined) {
if ((event.result = ret) === false) {
event.preventDefault();
event.stopPropagation();
}
}
}
}
}
// Call the postDispatch hook for the mapped type
if (special.postDispatch) {
special.postDispatch.call(this, event);
}
return event.result;
},
handlers: function (event, handlers) {
var i, handleObj, sel, matchedHandlers, matchedSelectors,
handlerQueue = [],
delegateCount = handlers.delegateCount,
cur = event.target;
// Find delegate handlers
if (delegateCount &&
// Support: IE <=9
// Black-hole SVG <use> instance trees (trac-13180)
cur.nodeType &&
// Support: Firefox <=42
// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
// Support: IE 11 only
// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
!(event.type === "click" && event.button >= 1)) {
for (; cur !== this; cur = cur.parentNode || this) {
// Don't check non-elements (#13208)
// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) {
matchedHandlers = [];
matchedSelectors = {};
for (i = 0; i < delegateCount; i++) {
handleObj = handlers[i];
// Don't conflict with Object.prototype properties (#13203)
sel = handleObj.selector + " ";
if (matchedSelectors[sel] === undefined) {
matchedSelectors[sel] = handleObj.needsContext ?
jQuery(sel, this).index(cur) > -1 :
jQuery.find(sel, this, null, [cur]).length;
}
if (matchedSelectors[sel]) {
matchedHandlers.push(handleObj);
}
}
if (matchedHandlers.length) {
handlerQueue.push({
elem: cur,
handlers: matchedHandlers
});
}
}
}
}
// Add the remaining (directly-bound) handlers
cur = this;
if (delegateCount < handlers.length) {
handlerQueue.push({
elem: cur,
handlers: handlers.slice(delegateCount)
});
}
return handlerQueue;
},
addProp: function (name, hook) {
Object.defineProperty(jQuery.Event.prototype, name, {
enumerable: true,
configurable: true,
get: jQuery.isFunction(hook) ?
function () {
if (this.originalEvent) {
return hook(this.originalEvent);
}
} : function () {
if (this.originalEvent) {
return this.originalEvent[name];
}
},
set: function (value) {
Object.defineProperty(this, name, {
enumerable: true,
configurable: true,
writable: true,
value: value
});
}
});
},
fix: function (originalEvent) {
return originalEvent[jQuery.expando] ?
originalEvent :
new jQuery.Event(originalEvent);
},
special: {
load: {
// Prevent triggered image.load events from bubbling to window.load
noBubble: true
},
focus: {
// Fire native event if possible so blur/focus sequence is correct
trigger: function () {
if (this !== safeActiveElement() && this.focus) {
this.focus();
return false;
}
},
delegateType: "focusin"
},
blur: {
trigger: function () {
if (this === safeActiveElement() && this.blur) {
this.blur();
return false;
}
},
delegateType: "focusout"
},
click: {
// For checkbox, fire native event so checked state will be right
trigger: function () {
if (this.type === "checkbox" && this.click && nodeName(this, "input")) {
this.click();
return false;
}
},
// For cross-browser consistency, don't fire native .click() on links
_default: function (event) {
return nodeName(event.target, "a");
}
},
beforeunload: {
postDispatch: function (event) {
// Support: Firefox 20+
// Firefox doesn't alert if the returnValue field is not set.
if (event.result !== undefined && event.originalEvent) {
event.originalEvent.returnValue = event.result;
}
}
}
}
};
jQuery.removeEvent = function (elem, type, handle) {
// This "if" is needed for plain objects
if (elem.removeEventListener) {
elem.removeEventListener(type, handle);
}
};
jQuery.Event = function (src, props) {
// Allow instantiation without the 'new' keyword
if (!(this instanceof jQuery.Event)) {
return new jQuery.Event(src, props);
}
// Event object
if (src && src.type) {
this.originalEvent = src;
this.type = src.type;
// Events bubbling up the document may have been marked as prevented
// by a handler lower down the tree; reflect the correct value.
this.isDefaultPrevented = src.defaultPrevented ||
src.defaultPrevented === undefined &&
// Support: Android <=2.3 only
src.returnValue === false ?
returnTrue :
returnFalse;
// Create target properties
// Support: Safari <=6 - 7 only
// Target should not be a text node (#504, #13143)
this.target = (src.target && src.target.nodeType === 3) ?
src.target.parentNode :
src.target;
this.currentTarget = src.currentTarget;
this.relatedTarget = src.relatedTarget;
// Event type
} else {
this.type = src;
}
// Put explicitly provided properties onto the event object
if (props) {
jQuery.extend(this, props);
}
// Create a timestamp if incoming event doesn't have one
this.timeStamp = src && src.timeStamp || jQuery.now();
// Mark it as fixed
this[jQuery.expando] = true;
};
// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding // https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html jQuery.Event.prototype = { constructor: jQuery.Event, isDefaultPrevented: returnFalse, isPropagationStopped: returnFalse, isImmediatePropagationStopped: returnFalse, isSimulated: false,
preventDefault: function () {
var e = this.originalEvent;
this.isDefaultPrevented = returnTrue;
if (e && !this.isSimulated) {
e.preventDefault();
}
},
stopPropagation: function () {
var e = this.originalEvent;
this.isPropagationStopped = returnTrue;
if (e && !this.isSimulated) {
e.stopPropagation();
}
},
stopImmediatePropagation: function () {
var e = this.originalEvent;
this.isImmediatePropagationStopped = returnTrue;
if (e && !this.isSimulated) {
e.stopImmediatePropagation();
}
this.stopPropagation();
}
};
// Includes all common event props including KeyEvent and MouseEvent specific props
jQuery.each({
altKey: true,
bubbles: true,
cancelable: true,
changedTouches: true,
ctrlKey: true,
detail: true,
eventPhase: true,
metaKey: true,
pageX: true,
pageY: true,
shiftKey: true,
view: true,
"char": true,
charCode: true,
key: true,
keyCode: true,
button: true,
buttons: true,
clientX: true,
clientY: true,
offsetX: true,
offsetY: true,
pointerId: true,
pointerType: true,
screenX: true,
screenY: true,
targetTouches: true,
toElement: true,
touches: true,
which: function (event) {
var button = event.button;
// Add which for key events
if (event.which == null && rkeyEvent.test(event.type)) {
return event.charCode != null ? event.charCode : event.keyCode;
}
// Add which for click: 1 === left; 2 === middle; 3 === right
if (!event.which && button !== undefined && rmouseEvent.test(event.type)) {
if (button & 1) {
return 1;
}
if (button & 2) {
return 3;
}
if (button & 4) {
return 2;
}
return 0;
}
return event.which;
}
}, jQuery.event.addProp);
// Create mouseenter/leave events using mouseover/out and event-time checks // so that event delegation works in jQuery. // Do the same for pointerenter/pointerleave and pointerover/pointerout // // Support: Safari 7 only // Safari sends mouseenter too often; see: // https://bugs.chromium.org/p/chromium/issues/detail?id=470258 // for the description of the bug (it existed in older Chrome versions as well). jQuery.each({ mouseenter: "mouseover", mouseleave: "mouseout", pointerenter: "pointerover", pointerleave: "pointerout" }, function (orig, fix) { jQuery.event.special[orig] = { delegateType: fix, bindType: fix,
handle: function (event) {
var ret,
target = this,
related = event.relatedTarget,
handleObj = event.handleObj;
// For mouseenter/leave call the handler if related is outside the target.
// NB: No relatedTarget if the mouse left/entered the browser window
if (!related || (related !== target && !jQuery.contains(target, related))) {
event.type = handleObj.origType;
ret = handleObj.handler.apply(this, arguments);
event.type = fix;
}
return ret;
}
};
});
jQuery.fn.extend({
on: function (types, selector, data, fn) {
return on(this, types, selector, data, fn);
},
one: function (types, selector, data, fn) {
return on(this, types, selector, data, fn, 1);
},
off: function (types, selector, fn) {
var handleObj, type;
if (types && types.preventDefault && types.handleObj) {
// ( event ) dispatched jQuery.Event
handleObj = types.handleObj;
jQuery(types.delegateTarget).off(
handleObj.namespace ?
handleObj.origType + "." + handleObj.namespace :
handleObj.origType,
handleObj.selector,
handleObj.handler
);
return this;
}
if (typeof types === "object") {
// ( types-object [, selector] )
for (type in types) {
this.off(type, selector, types[type]);
}
return this;
}
if (selector === false || typeof selector === "function") {
// ( types [, fn] )
fn = selector;
selector = undefined;
}
if (fn === false) {
fn = returnFalse;
}
return this.each(function () {
jQuery.event.remove(this, types, fn, selector);
});
}
});
var
/* eslint-disable max-len */
// See https://github.com/eslint/eslint/issues/3229 rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
/* eslint-enable */
// Support: IE <=10 - 11, Edge 12 - 13
// In IE/Edge using regex groups here causes severe slowdowns.
// See https://connect.microsoft.com/IE/feedback/details/1736512/
rnoInnerhtml = /<script|<style|<link/i,
// checked="checked" or checked
rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
rscriptTypeMasked = /^true\/(.*)/,
rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
// Prefer a tbody over its parent table for containing new rows
function manipulationTarget(elem, content) {
if (nodeName(elem, "table") &&
nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) {
return jQuery(">tbody", elem)[0] || elem;
}
return elem; }
// Replace/restore the type attribute of script elements for safe DOM manipulation
function disableScript(elem) {
elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type;
return elem;
}
function restoreScript(elem) {
var match = rscriptTypeMasked.exec(elem.type);
if (match) {
elem.type = match[1];
} else {
elem.removeAttribute("type");
}
return elem; }
function cloneCopyEvent(src, dest) {
var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
if (dest.nodeType !== 1) {
return;
}
// 1. Copy private data: events, handlers, etc.
if (dataPriv.hasData(src)) {
pdataOld = dataPriv.access(src);
pdataCur = dataPriv.set(dest, pdataOld);
events = pdataOld.events;
if (events) {
delete pdataCur.handle;
pdataCur.events = {};
for (type in events) {
for (i = 0, l = events[type].length; i < l; i++) {
jQuery.event.add(dest, type, events[type][i]);
}
}
}
}
// 2. Copy user data
if (dataUser.hasData(src)) {
udataOld = dataUser.access(src);
udataCur = jQuery.extend({}, udataOld);
dataUser.set(dest, udataCur);
}
}
// Fix IE bugs, see support tests
function fixInput(src, dest) {
var nodeName = dest.nodeName.toLowerCase();
// Fails to persist the checked state of a cloned checkbox or radio button.
if (nodeName === "input" && rcheckableType.test(src.type)) {
dest.checked = src.checked;
// Fails to return the selected option to the default selected state when cloning options
} else if (nodeName === "input" || nodeName === "textarea") {
dest.defaultValue = src.defaultValue;
}
}
function domManip(collection, args, callback, ignored) {
// Flatten any nested arrays
args = concat.apply([], args);
var fragment, first, scripts, hasScripts, node, doc,
i = 0,
l = collection.length,
iNoClone = l - 1,
value = args[0],
isFunction = jQuery.isFunction(value);
// We can't cloneNode fragments that contain checked, in WebKit
if (isFunction ||
(l > 1 && typeof value === "string" &&
!support.checkClone && rchecked.test(value))) {
return collection.each(function (index) {
var self = collection.eq(index);
if (isFunction) {
args[0] = value.call(this, index, self.html());
}
domManip(self, args, callback, ignored);
});
}
if (l) {
fragment = buildFragment(args, collection[0].ownerDocument, false, collection, ignored);
first = fragment.firstChild;
if (fragment.childNodes.length === 1) {
fragment = first;
}
// Require either new content or an interest in ignored elements to invoke the callback
if (first || ignored) {
scripts = jQuery.map(getAll(fragment, "script"), disableScript);
hasScripts = scripts.length;
// Use the original fragment for the last item
// instead of the first because it can end up
// being emptied incorrectly in certain situations (#8070).
for (; i < l; i++) {
node = fragment;
if (i !== iNoClone) {
node = jQuery.clone(node, true, true);
// Keep references to cloned scripts for later restoration
if (hasScripts) {
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge(scripts, getAll(node, "script"));
}
}
callback.call(collection[i], node, i);
}
if (hasScripts) {
doc = scripts[scripts.length - 1].ownerDocument;
// Reenable scripts
jQuery.map(scripts, restoreScript);
// Evaluate executable scripts on first document insertion
for (i = 0; i < hasScripts; i++) {
node = scripts[i];
if (rscriptType.test(node.type || "") &&
!dataPriv.access(node, "globalEval") &&
jQuery.contains(doc, node)) {
if (node.src) {
// Optional AJAX dependency, but won't run scripts if not present
if (jQuery._evalUrl) {
jQuery._evalUrl(node.src);
}
} else {
DOMEval(node.textContent.replace(rcleanScript, ""), doc);
}
}
}
}
}
}
return collection; }
function remove(elem, selector, keepData) {
var node,
nodes = selector ? jQuery.filter(selector, elem) : elem,
i = 0;
for (;
(node = nodes[i]) != null; i++) {
if (!keepData && node.nodeType === 1) {
jQuery.cleanData(getAll(node));
}
if (node.parentNode) {
if (keepData && jQuery.contains(node.ownerDocument, node)) {
setGlobalEval(getAll(node, "script"));
}
node.parentNode.removeChild(node);
}
}
return elem; }
jQuery.extend({
htmlPrefilter: function (html) {
return html.replace(rxhtmlTag, "<$1></$2>");
},
clone: function (elem, dataAndEvents, deepDataAndEvents) {
var i, l, srcElements, destElements,
clone = elem.cloneNode(true),
inPage = jQuery.contains(elem.ownerDocument, elem);
// Fix IE cloning issues
if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) &&
!jQuery.isXMLDoc(elem)) {
// We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 destElements = getAll(clone); srcElements = getAll(elem);
for (i = 0, l = srcElements.length; i < l; i++) {
fixInput(srcElements[i], destElements[i]);
}
}
// Copy the events from the original to the clone
if (dataAndEvents) {
if (deepDataAndEvents) {
srcElements = srcElements || getAll(elem);
destElements = destElements || getAll(clone);
for (i = 0, l = srcElements.length; i < l; i++) {
cloneCopyEvent(srcElements[i], destElements[i]);
}
} else {
cloneCopyEvent(elem, clone);
}
}
// Preserve script evaluation history
destElements = getAll(clone, "script");
if (destElements.length > 0) {
setGlobalEval(destElements, !inPage && getAll(elem, "script"));
}
// Return the cloned set
return clone;
},
cleanData: function (elems) {
var data, elem, type,
special = jQuery.event.special,
i = 0;
for (;
(elem = elems[i]) !== undefined; i++) {
if (acceptData(elem)) {
if ((data = elem[dataPriv.expando])) {
if (data.events) {
for (type in data.events) {
if (special[type]) {
jQuery.event.remove(elem, type);
// This is a shortcut to avoid jQuery.event.remove's overhead
} else {
jQuery.removeEvent(elem, type, data.handle);
}
}
}
// Support: Chrome <=35 - 45+
// Assign undefined instead of using delete, see Data#remove
elem[dataPriv.expando] = undefined;
}
if (elem[dataUser.expando]) {
// Support: Chrome <=35 - 45+
// Assign undefined instead of using delete, see Data#remove
elem[dataUser.expando] = undefined;
}
}
}
}
});
jQuery.fn.extend({
detach: function (selector) {
return remove(this, selector, true);
},
remove: function (selector) {
return remove(this, selector);
},
text: function (value) {
return access(this, function (value) {
return value === undefined ?
jQuery.text(this) :
this.empty().each(function () {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
this.textContent = value;
}
});
}, null, value, arguments.length);
},
append: function () {
return domManip(this, arguments, function (elem) {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
var target = manipulationTarget(this, elem);
target.appendChild(elem);
}
});
},
prepend: function () {
return domManip(this, arguments, function (elem) {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
var target = manipulationTarget(this, elem);
target.insertBefore(elem, target.firstChild);
}
});
},
before: function () {
return domManip(this, arguments, function (elem) {
if (this.parentNode) {
this.parentNode.insertBefore(elem, this);
}
});
},
after: function () {
return domManip(this, arguments, function (elem) {
if (this.parentNode) {
this.parentNode.insertBefore(elem, this.nextSibling);
}
});
},
empty: function () {
var elem,
i = 0;
for (;
(elem = this[i]) != null; i++) {
if (elem.nodeType === 1) {
// Prevent memory leaks
jQuery.cleanData(getAll(elem, false));
// Remove any remaining nodes
elem.textContent = "";
}
}
return this;
},
clone: function (dataAndEvents, deepDataAndEvents) {
dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
return this.map(function () {
return jQuery.clone(this, dataAndEvents, deepDataAndEvents);
});
},
html: function (value) {
return access(this, function (value) {
var elem = this[0] || {},
i = 0,
l = this.length;
if (value === undefined && elem.nodeType === 1) {
return elem.innerHTML;
}
// See if we can take a shortcut and just use innerHTML
if (typeof value === "string" && !rnoInnerhtml.test(value) &&
!wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) {
value = jQuery.htmlPrefilter(value);
try {
for (; i < l; i++) {
elem = this[i] || {};
// Remove element nodes and prevent memory leaks
if (elem.nodeType === 1) {
jQuery.cleanData(getAll(elem, false));
elem.innerHTML = value;
}
}
elem = 0;
// If using innerHTML throws an exception, use the fallback method
} catch (e) {}
}
if (elem) {
this.empty().append(value);
}
}, null, value, arguments.length);
},
replaceWith: function () {
var ignored = [];
// Make the changes, replacing each non-ignored context element with the new content
return domManip(this, arguments, function (elem) {
var parent = this.parentNode;
if (jQuery.inArray(this, ignored) < 0) {
jQuery.cleanData(getAll(this));
if (parent) {
parent.replaceChild(elem, this);
}
}
// Force callback invocation
}, ignored);
}
});
jQuery.each({
appendTo: "append",
prependTo: "prepend",
insertBefore: "before",
insertAfter: "after",
replaceAll: "replaceWith"
}, function (name, original) {
jQuery.fn[name] = function (selector) {
var elems,
ret = [],
insert = jQuery(selector),
last = insert.length - 1,
i = 0;
for (; i <= last; i++) {
elems = i === last ? this : this.clone(true);
jQuery(insert[i])[original](elems);
// Support: Android <=4.0 only, PhantomJS 1 only
// .get() because push.apply(_, arraylike) throws on ancient WebKit
push.apply(ret, elems.get());
}
return this.pushStack(ret);
};
});
var rmargin = (/^margin/);
var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i");
var getStyles = function (elem) {
// Support: IE <=11 only, Firefox <=30 (#15098, #14150)
// IE throws on elements created in popups
// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
var view = elem.ownerDocument.defaultView;
if (!view || !view.opener) {
view = window;
}
return view.getComputedStyle(elem); };
(function () {
// Executing both pixelPosition & boxSizingReliable tests require only one layout
// so they're executed at the same time to save the second computation.
function computeStyleTests() {
// This is a singleton, we need to execute it only once
if (!div) {
return;
}
div.style.cssText =
"box-sizing:border-box;" +
"position:relative;display:block;" +
"margin:auto;border:1px;padding:1px;" +
"top:1%;width:50%";
div.innerHTML = "";
documentElement.appendChild(container);
var divStyle = window.getComputedStyle(div);
pixelPositionVal = divStyle.top !== "1%";
// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
reliableMarginLeftVal = divStyle.marginLeft === "2px";
boxSizingReliableVal = divStyle.width === "4px";
// Support: Android 4.0 - 4.3 only
// Some styles come back with percentage values, even though they shouldn't
div.style.marginRight = "50%";
pixelMarginRightVal = divStyle.marginRight === "4px";
documentElement.removeChild(container);
// Nullify the div so it wouldn't be stored in the memory and
// it will also be a sign that checks already performed
div = null;
}
var pixelPositionVal, boxSizingReliableVal, pixelMarginRightVal, reliableMarginLeftVal,
container = document.createElement("div"),
div = document.createElement("div");
// Finish early in limited (non-browser) environments
if (!div.style) {
return;
}
// Support: IE <=9 - 11 only
// Style of cloned element affects source element cloned (#8908)
div.style.backgroundClip = "content-box";
div.cloneNode(true).style.backgroundClip = "";
support.clearCloneStyle = div.style.backgroundClip === "content-box";
container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" +
"padding:0;margin-top:1px;position:absolute";
container.appendChild(div);
jQuery.extend(support, {
pixelPosition: function () {
computeStyleTests();
return pixelPositionVal;
},
boxSizingReliable: function () {
computeStyleTests();
return boxSizingReliableVal;
},
pixelMarginRight: function () {
computeStyleTests();
return pixelMarginRightVal;
},
reliableMarginLeft: function () {
computeStyleTests();
return reliableMarginLeftVal;
}
});
})();
function curCSS(elem, name, computed) {
var width, minWidth, maxWidth, ret,
// Support: Firefox 51+
// Retrieving style before computed somehow
// fixes an issue with getting wrong values
// on detached elements
style = elem.style;
computed = computed || getStyles(elem);
// getPropertyValue is needed for:
// .css('filter') (IE 9 only, #12537)
// .css('--customProperty) (#3144)
if (computed) {
ret = computed.getPropertyValue(name) || computed[name];
if (ret === "" && !jQuery.contains(elem.ownerDocument, elem)) {
ret = jQuery.style(elem, name);
}
// A tribute to the "awesome hack by Dean Edwards"
// Android Browser returns percentage for some values,
// but width seems to be reliably pixels.
// This is against the CSSOM draft spec:
// https://drafts.csswg.org/cssom/#resolved-values
if (!support.pixelMarginRight() && rnumnonpx.test(ret) && rmargin.test(name)) {
// Remember the original values
width = style.width;
minWidth = style.minWidth;
maxWidth = style.maxWidth;
// Put in the new values to get a computed value out
style.minWidth = style.maxWidth = style.width = ret;
ret = computed.width;
// Revert the changed values
style.width = width;
style.minWidth = minWidth;
style.maxWidth = maxWidth;
}
}
return ret !== undefined ?
// Support: IE <=9 - 11 only
// IE returns zIndex value as an integer.
ret + "" :
ret;
}
function addGetHookIf(conditionFn, hookFn) {
// Define the hook, we'll check on the first run if it's really needed.
return {
get: function () {
if (conditionFn()) {
// Hook not needed (or it's not possible to use it due
// to missing dependency), remove it.
delete this.get;
return;
}
// Hook needed; redefine it so that the support test is not executed again.
return (this.get = hookFn).apply(this, arguments);
}
};
}
var
// Swappable if display is none or starts with table // except "table", "table-cell", or "table-caption" // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display rdisplayswap = /^(none|table(?!-c[ea]).+)/, rcustomProp = /^--/, cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssNormalTransform = { letterSpacing: "0", fontWeight: "400" },
cssPrefixes = ["Webkit", "Moz", "ms"],
emptyStyle = document.createElement("div").style;
// Return a css property mapped to a potentially vendor prefixed property
function vendorPropName(name) {
// Shortcut for names that are not vendor prefixed
if (name in emptyStyle) {
return name;
}
// Check for vendor prefixed names
var capName = name[0].toUpperCase() + name.slice(1),
i = cssPrefixes.length;
while (i--) {
name = cssPrefixes[i] + capName;
if (name in emptyStyle) {
return name;
}
}
}
// Return a property mapped along what jQuery.cssProps suggests or to
// a vendor prefixed property.
function finalPropName(name) {
var ret = jQuery.cssProps[name];
if (!ret) {
ret = jQuery.cssProps[name] = vendorPropName(name) || name;
}
return ret;
}
function setPositiveNumber(elem, value, subtract) {
// Any relative (+/-) values have already been
// normalized at this point
var matches = rcssNum.exec(value);
return matches ?
// Guard against undefined "subtract", e.g., when used as in cssHooks
Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px") :
value;
}
function augmentWidthOrHeight(elem, name, extra, isBorderBox, styles) {
var i,
val = 0;
// If we already have the right measurement, avoid augmentation
if (extra === (isBorderBox ? "border" : "content")) {
i = 4;
// Otherwise initialize for horizontal or vertical properties
} else {
i = name === "width" ? 1 : 0;
}
for (; i < 4; i += 2) {
// Both box models exclude margin, so add it if we want it
if (extra === "margin") {
val += jQuery.css(elem, extra + cssExpand[i], true, styles);
}
if (isBorderBox) {
// border-box includes padding, so remove it if we want content
if (extra === "content") {
val -= jQuery.css(elem, "padding" + cssExpand[i], true, styles);
}
// At this point, extra isn't border nor margin, so remove border
if (extra !== "margin") {
val -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
} else {
// At this point, extra isn't content, so add padding
val += jQuery.css(elem, "padding" + cssExpand[i], true, styles);
// At this point, extra isn't content nor padding, so add border
if (extra !== "padding") {
val += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
}
}
return val; }
function getWidthOrHeight(elem, name, extra) {
// Start with computed style
var valueIsBorderBox,
styles = getStyles(elem),
val = curCSS(elem, name, styles),
isBorderBox = jQuery.css(elem, "boxSizing", false, styles) === "border-box";
// Computed unit is not pixels. Stop here and return.
if (rnumnonpx.test(val)) {
return val;
}
// Check for style in case a browser which returns unreliable values
// for getComputedStyle silently falls back to the reliable elem.style
valueIsBorderBox = isBorderBox &&
(support.boxSizingReliable() || val === elem.style[name]);
// Fall back to offsetWidth/Height when value is "auto"
// This happens for inline elements with no explicit setting (gh-3571)
if (val === "auto") {
val = elem["offset" + name[0].toUpperCase() + name.slice(1)];
}
// Normalize "", auto, and prepare for extra
val = parseFloat(val) || 0;
// Use the active box-sizing model to add/subtract irrelevant styles
return (val +
augmentWidthOrHeight(
elem,
name,
extra || (isBorderBox ? "border" : "content"),
valueIsBorderBox,
styles
)
) + "px";
}
jQuery.extend({
// Add in style property hooks for overriding the default
// behavior of getting and setting a style property
cssHooks: {
opacity: {
get: function (elem, computed) {
if (computed) {
// We should always get a number back from opacity
var ret = curCSS(elem, "opacity");
return ret === "" ? "1" : ret;
}
}
}
},
// Don't automatically add "px" to these possibly-unitless properties
cssNumber: {
"animationIterationCount": true,
"columnCount": true,
"fillOpacity": true,
"flexGrow": true,
"flexShrink": true,
"fontWeight": true,
"lineHeight": true,
"opacity": true,
"order": true,
"orphans": true,
"widows": true,
"zIndex": true,
"zoom": true
},
// Add in properties whose names you wish to fix before
// setting or getting the value
cssProps: {
"float": "cssFloat"
},
// Get and set the style property on a DOM Node
style: function (elem, name, value, extra) {
// Don't set styles on text and comment nodes
if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
return;
}
// Make sure that we're working with the right name
var ret, type, hooks,
origName = jQuery.camelCase(name),
isCustomProp = rcustomProp.test(name),
style = elem.style;
// Make sure that we're working with the right name. We don't
// want to query the value if it is a CSS custom property
// since they are user-defined.
if (!isCustomProp) {
name = finalPropName(origName);
}
// Gets hook for the prefixed version, then unprefixed version
hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
// Check if we're setting a value
if (value !== undefined) {
type = typeof value;
// Convert "+=" or "-=" to relative numbers (#7345)
if (type === "string" && (ret = rcssNum.exec(value)) && ret[1]) {
value = adjustCSS(elem, name, ret);
// Fixes bug #9237
type = "number";
}
// Make sure that null and NaN values aren't set (#7116)
if (value == null || value !== value) {
return;
}
// If a number was passed in, add the unit (except for certain CSS properties)
if (type === "number") {
value += ret && ret[3] || (jQuery.cssNumber[origName] ? "" : "px");
}
// background-* props affect original clone's values
if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
style[name] = "inherit";
}
// If a hook was provided, use that value, otherwise just set the specified value
if (!hooks || !("set" in hooks) ||
(value = hooks.set(elem, value, extra)) !== undefined) {
if (isCustomProp) {
style.setProperty(name, value);
} else {
style[name] = value;
}
}
} else {
// If a hook was provided get the non-computed value from there
if (hooks && "get" in hooks &&
(ret = hooks.get(elem, false, extra)) !== undefined) {
return ret;
}
// Otherwise just get the value from the style object
return style[name];
}
},
css: function (elem, name, extra, styles) {
var val, num, hooks,
origName = jQuery.camelCase(name),
isCustomProp = rcustomProp.test(name);
// Make sure that we're working with the right name. We don't
// want to modify the value if it is a CSS custom property
// since they are user-defined.
if (!isCustomProp) {
name = finalPropName(origName);
}
// Try prefixed name followed by the unprefixed name
hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
// If a hook was provided get the computed value from there
if (hooks && "get" in hooks) {
val = hooks.get(elem, true, extra);
}
// Otherwise, if a way to get the computed value exists, use that
if (val === undefined) {
val = curCSS(elem, name, styles);
}
// Convert "normal" to computed value
if (val === "normal" && name in cssNormalTransform) {
val = cssNormalTransform[name];
}
// Make numeric if forced or a qualifier was provided and val looks numeric
if (extra === "" || extra) {
num = parseFloat(val);
return extra === true || isFinite(num) ? num || 0 : val;
}
return val;
}
});
jQuery.each(["height", "width"], function (i, name) {
jQuery.cssHooks[name] = {
get: function (elem, computed, extra) {
if (computed) {
// Certain elements can have dimension info if we invisibly show them
// but it must have a current display style that would benefit
return rdisplayswap.test(jQuery.css(elem, "display")) &&
// Support: Safari 8+
// Table columns in Safari have non-zero offsetWidth & zero
// getBoundingClientRect().width unless display is changed.
// Support: IE <=11 only
// Running getBoundingClientRect on a disconnected node
// in IE throws an error.
(!elem.getClientRects().length || !elem.getBoundingClientRect().width) ?
swap(elem, cssShow, function () {
return getWidthOrHeight(elem, name, extra);
}) :
getWidthOrHeight(elem, name, extra);
}
},
set: function (elem, value, extra) {
var matches,
styles = extra && getStyles(elem),
subtract = extra && augmentWidthOrHeight(
elem,
name,
extra,
jQuery.css(elem, "boxSizing", false, styles) === "border-box",
styles
);
// Convert to pixels if value adjustment is needed
if (subtract && (matches = rcssNum.exec(value)) &&
(matches[3] || "px") !== "px") {
elem.style[name] = value;
value = jQuery.css(elem, name);
}
return setPositiveNumber(elem, value, subtract);
}
};
});
jQuery.cssHooks.marginLeft = addGetHookIf(support.reliableMarginLeft,
function (elem, computed) {
if (computed) {
return (parseFloat(curCSS(elem, "marginLeft")) ||
elem.getBoundingClientRect().left -
swap(elem, {
marginLeft: 0
}, function () {
return elem.getBoundingClientRect().left;
})
) + "px";
}
}
);
// These hooks are used by animate to expand properties
jQuery.each({
margin: "",
padding: "",
border: "Width"
}, function (prefix, suffix) {
jQuery.cssHooks[prefix + suffix] = {
expand: function (value) {
var i = 0,
expanded = {},
// Assumes a single number if not a string
parts = typeof value === "string" ? value.split(" ") : [value];
for (; i < 4; i++) {
expanded[prefix + cssExpand[i] + suffix] =
parts[i] || parts[i - 2] || parts[0];
}
return expanded;
}
};
if (!rmargin.test(prefix)) {
jQuery.cssHooks[prefix + suffix].set = setPositiveNumber;
}
});
jQuery.fn.extend({
css: function (name, value) {
return access(this, function (elem, name, value) {
var styles, len,
map = {},
i = 0;
if (Array.isArray(name)) {
styles = getStyles(elem);
len = name.length;
for (; i < len; i++) {
map[name[i]] = jQuery.css(elem, name[i], false, styles);
}
return map;
}
return value !== undefined ?
jQuery.style(elem, name, value) :
jQuery.css(elem, name);
}, name, value, arguments.length > 1);
}
});
function Tween(elem, options, prop, end, easing) {
return new Tween.prototype.init(elem, options, prop, end, easing);
}
jQuery.Tween = Tween;
Tween.prototype = {
constructor: Tween,
init: function (elem, options, prop, end, easing, unit) {
this.elem = elem;
this.prop = prop;
this.easing = easing || jQuery.easing._default;
this.options = options;
this.start = this.now = this.cur();
this.end = end;
this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px");
},
cur: function () {
var hooks = Tween.propHooks[this.prop];
return hooks && hooks.get ?
hooks.get(this) :
Tween.propHooks._default.get(this);
},
run: function (percent) {
var eased,
hooks = Tween.propHooks[this.prop];
if (this.options.duration) {
this.pos = eased = jQuery.easing[this.easing](
percent, this.options.duration * percent, 0, 1, this.options.duration
);
} else {
this.pos = eased = percent;
}
this.now = (this.end - this.start) * eased + this.start;
if (this.options.step) {
this.options.step.call(this.elem, this.now, this);
}
if (hooks && hooks.set) {
hooks.set(this);
} else {
Tween.propHooks._default.set(this);
}
return this;
}
};
Tween.prototype.init.prototype = Tween.prototype;
Tween.propHooks = {
_default: {
get: function (tween) {
var result;
// Use a property on the element directly when it is not a DOM element,
// or when there is no matching style property that exists.
if (tween.elem.nodeType !== 1 ||
tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) {
return tween.elem[tween.prop];
}
// Passing an empty string as a 3rd parameter to .css will automatically
// attempt a parseFloat and fallback to a string if the parse fails.
// Simple values such as "10px" are parsed to Float;
// complex values such as "rotate(1rad)" are returned as-is.
result = jQuery.css(tween.elem, tween.prop, "");
// Empty strings, null, undefined and "auto" are converted to 0.
return !result || result === "auto" ? 0 : result;
},
set: function (tween) {
// Use step hook for back compat.
// Use cssHook if its there.
// Use .style if available and use plain properties where available.
if (jQuery.fx.step[tween.prop]) {
jQuery.fx.step[tween.prop](tween);
} else if (tween.elem.nodeType === 1 &&
(tween.elem.style[jQuery.cssProps[tween.prop]] != null ||
jQuery.cssHooks[tween.prop])) {
jQuery.style(tween.elem, tween.prop, tween.now + tween.unit);
} else {
tween.elem[tween.prop] = tween.now;
}
}
}
};
// Support: IE <=9 only
// Panic based approach to setting things on disconnected nodes
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
set: function (tween) {
if (tween.elem.nodeType && tween.elem.parentNode) {
tween.elem[tween.prop] = tween.now;
}
}
};
jQuery.easing = {
linear: function (p) {
return p;
},
swing: function (p) {
return 0.5 - Math.cos(p * Math.PI) / 2;
},
_default: "swing"
};
jQuery.fx = Tween.prototype.init;
// Back compat <1.8 extension point
jQuery.fx.step = {};
var
fxNow, inProgress,
rfxtypes = /^(?:toggle|show|hide)$/,
rrun = /queueHooks$/;
function schedule() {
if (inProgress) {
if (document.hidden === false && window.requestAnimationFrame) {
window.requestAnimationFrame(schedule);
} else {
window.setTimeout(schedule, jQuery.fx.interval);
}
jQuery.fx.tick();
}
}
// Animations created synchronously will run synchronously
function createFxNow() {
window.setTimeout(function () {
fxNow = undefined;
});
return (fxNow = jQuery.now());
}
// Generate parameters to create a standard animation
function genFx(type, includeWidth) {
var which,
i = 0,
attrs = {
height: type
};
// If we include width, step value is 1 to do all cssExpand values,
// otherwise step value is 2 to skip over Left and Right
includeWidth = includeWidth ? 1 : 0;
for (; i < 4; i += 2 - includeWidth) {
which = cssExpand[i];
attrs["margin" + which] = attrs["padding" + which] = type;
}
if (includeWidth) {
attrs.opacity = attrs.width = type;
}
return attrs; }
function createTween(value, prop, animation) {
var tween,
collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]),
index = 0,
length = collection.length;
for (; index < length; index++) {
if ((tween = collection[index].call(animation, prop, value))) {
// We're done with this property
return tween;
}
}
}
function defaultPrefilter(elem, props, opts) {
var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
isBox = "width" in props || "height" in props,
anim = this,
orig = {},
style = elem.style,
hidden = elem.nodeType && isHiddenWithinTree(elem),
dataShow = dataPriv.get(elem, "fxshow");
// Queue-skipping animations hijack the fx hooks
if (!opts.queue) {
hooks = jQuery._queueHooks(elem, "fx");
if (hooks.unqueued == null) {
hooks.unqueued = 0;
oldfire = hooks.empty.fire;
hooks.empty.fire = function () {
if (!hooks.unqueued) {
oldfire();
}
};
}
hooks.unqueued++;
anim.always(function () {
// Ensure the complete handler is called before this completes
anim.always(function () {
hooks.unqueued--;
if (!jQuery.queue(elem, "fx").length) {
hooks.empty.fire();
}
});
});
}
// Detect show/hide animations
for (prop in props) {
value = props[prop];
if (rfxtypes.test(value)) {
delete props[prop];
toggle = toggle || value === "toggle";
if (value === (hidden ? "hide" : "show")) {
// Pretend to be hidden if this is a "show" and
// there is still data from a stopped show/hide
if (value === "show" && dataShow && dataShow[prop] !== undefined) {
hidden = true;
// Ignore all other no-op show/hide data
} else {
continue;
}
}
orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop);
}
}
// Bail out if this is a no-op like .hide().hide()
propTween = !jQuery.isEmptyObject(props);
if (!propTween && jQuery.isEmptyObject(orig)) {
return;
}
// Restrict "overflow" and "display" styles during box animations
if (isBox && elem.nodeType === 1) {
// Support: IE <=9 - 11, Edge 12 - 13
// Record all 3 overflow attributes because IE does not infer the shorthand
// from identically-valued overflowX and overflowY
opts.overflow = [style.overflow, style.overflowX, style.overflowY];
// Identify a display type, preferring old show/hide data over the CSS cascade
restoreDisplay = dataShow && dataShow.display;
if (restoreDisplay == null) {
restoreDisplay = dataPriv.get(elem, "display");
}
display = jQuery.css(elem, "display");
if (display === "none") {
if (restoreDisplay) {
display = restoreDisplay;
} else {
// Get nonempty value(s) by temporarily forcing visibility
showHide([elem], true);
restoreDisplay = elem.style.display || restoreDisplay;
display = jQuery.css(elem, "display");
showHide([elem]);
}
}
// Animate inline elements as inline-block
if (display === "inline" || display === "inline-block" && restoreDisplay != null) {
if (jQuery.css(elem, "float") === "none") {
// Restore the original display value at the end of pure show/hide animations
if (!propTween) {
anim.done(function () {
style.display = restoreDisplay;
});
if (restoreDisplay == null) {
display = style.display;
restoreDisplay = display === "none" ? "" : display;
}
}
style.display = "inline-block";
}
}
}
if (opts.overflow) {
style.overflow = "hidden";
anim.always(function () {
style.overflow = opts.overflow[0];
style.overflowX = opts.overflow[1];
style.overflowY = opts.overflow[2];
});
}
// Implement show/hide animations
propTween = false;
for (prop in orig) {
// General show/hide setup for this element animation
if (!propTween) {
if (dataShow) {
if ("hidden" in dataShow) {
hidden = dataShow.hidden;
}
} else {
dataShow = dataPriv.access(elem, "fxshow", {
display: restoreDisplay
});
}
// Store hidden/visible for toggle so `.stop().toggle()` "reverses"
if (toggle) {
dataShow.hidden = !hidden;
}
// Show elements before animating them
if (hidden) {
showHide([elem], true);
}
/* eslint-disable no-loop-func */
anim.done(function () {
/* eslint-enable no-loop-func */
// The final step of a "hide" animation is actually hiding the element
if (!hidden) {
showHide([elem]);
}
dataPriv.remove(elem, "fxshow");
for (prop in orig) {
jQuery.style(elem, prop, orig[prop]);
}
});
}
// Per-property setup
propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
if (!(prop in dataShow)) {
dataShow[prop] = propTween.start;
if (hidden) {
propTween.end = propTween.start;
propTween.start = 0;
}
}
}
}
function propFilter(props, specialEasing) {
var index, name, easing, value, hooks;
// camelCase, specialEasing and expand cssHook pass
for (index in props) {
name = jQuery.camelCase(index);
easing = specialEasing[name];
value = props[index];
if (Array.isArray(value)) {
easing = value[1];
value = props[index] = value[0];
}
if (index !== name) {
props[name] = value;
delete props[index];
}
hooks = jQuery.cssHooks[name];
if (hooks && "expand" in hooks) {
value = hooks.expand(value);
delete props[name];
// Not quite $.extend, this won't overwrite existing keys.
// Reusing 'index' because we have the correct "name"
for (index in value) {
if (!(index in props)) {
props[index] = value[index];
specialEasing[index] = easing;
}
}
} else {
specialEasing[name] = easing;
}
}
}
function Animation(elem, properties, options) {
var result,
stopped,
index = 0,
length = Animation.prefilters.length,
deferred = jQuery.Deferred().always(function () {
// Don't match elem in the :animated selector
delete tick.elem;
}),
tick = function () {
if (stopped) {
return false;
}
var currentTime = fxNow || createFxNow(),
remaining = Math.max(0, animation.startTime + animation.duration - currentTime),
// Support: Android 2.3 only
// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
temp = remaining / animation.duration || 0,
percent = 1 - temp,
index = 0,
length = animation.tweens.length;
for (; index < length; index++) {
animation.tweens[index].run(percent);
}
deferred.notifyWith(elem, [animation, percent, remaining]);
// If there's more to do, yield
if (percent < 1 && length) {
return remaining;
}
// If this was an empty animation, synthesize a final progress notification
if (!length) {
deferred.notifyWith(elem, [animation, 1, 0]);
}
// Resolve the animation and report its conclusion
deferred.resolveWith(elem, [animation]);
return false;
},
animation = deferred.promise({
elem: elem,
props: jQuery.extend({}, properties),
opts: jQuery.extend(true, {
specialEasing: {},
easing: jQuery.easing._default
}, options),
originalProperties: properties,
originalOptions: options,
startTime: fxNow || createFxNow(),
duration: options.duration,
tweens: [],
createTween: function (prop, end) {
var tween = jQuery.Tween(elem, animation.opts, prop, end,
animation.opts.specialEasing[prop] || animation.opts.easing);
animation.tweens.push(tween);
return tween;
},
stop: function (gotoEnd) {
var index = 0,
// If we are going to the end, we want to run all the tweens
// otherwise we skip this part
length = gotoEnd ? animation.tweens.length : 0;
if (stopped) {
return this;
}
stopped = true;
for (; index < length; index++) {
animation.tweens[index].run(1);
}
// Resolve when we played the last frame; otherwise, reject
if (gotoEnd) {
deferred.notifyWith(elem, [animation, 1, 0]);
deferred.resolveWith(elem, [animation, gotoEnd]);
} else {
deferred.rejectWith(elem, [animation, gotoEnd]);
}
return this;
}
}),
props = animation.props;
propFilter(props, animation.opts.specialEasing);
for (; index < length; index++) {
result = Animation.prefilters[index].call(animation, elem, props, animation.opts);
if (result) {
if (jQuery.isFunction(result.stop)) {
jQuery._queueHooks(animation.elem, animation.opts.queue).stop =
jQuery.proxy(result.stop, result);
}
return result;
}
}
jQuery.map(props, createTween, animation);
if (jQuery.isFunction(animation.opts.start)) {
animation.opts.start.call(elem, animation);
}
// Attach callbacks from options
animation
.progress(animation.opts.progress)
.done(animation.opts.done, animation.opts.complete)
.fail(animation.opts.fail)
.always(animation.opts.always);
jQuery.fx.timer(
jQuery.extend(tick, {
elem: elem,
anim: animation,
queue: animation.opts.queue
})
);
return animation; }
jQuery.Animation = jQuery.extend(Animation, {
tweeners: {
"*": [function (prop, value) {
var tween = this.createTween(prop, value);
adjustCSS(tween.elem, prop, rcssNum.exec(value), tween);
return tween;
}]
},
tweener: function (props, callback) {
if (jQuery.isFunction(props)) {
callback = props;
props = ["*"];
} else {
props = props.match(rnothtmlwhite);
}
var prop,
index = 0,
length = props.length;
for (; index < length; index++) {
prop = props[index];
Animation.tweeners[prop] = Animation.tweeners[prop] || [];
Animation.tweeners[prop].unshift(callback);
}
},
prefilters: [defaultPrefilter],
prefilter: function (callback, prepend) {
if (prepend) {
Animation.prefilters.unshift(callback);
} else {
Animation.prefilters.push(callback);
}
}
});
jQuery.speed = function (speed, easing, fn) {
var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
complete: fn || !fn && easing ||
jQuery.isFunction(speed) && speed,
duration: speed,
easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
};
// Go to the end state if fx are off
if (jQuery.fx.off) {
opt.duration = 0;
} else {
if (typeof opt.duration !== "number") {
if (opt.duration in jQuery.fx.speeds) {
opt.duration = jQuery.fx.speeds[opt.duration];
} else {
opt.duration = jQuery.fx.speeds._default;
}
}
}
// Normalize opt.queue - true/undefined/null -> "fx"
if (opt.queue == null || opt.queue === true) {
opt.queue = "fx";
}
// Queueing
opt.old = opt.complete;
opt.complete = function () {
if (jQuery.isFunction(opt.old)) {
opt.old.call(this);
}
if (opt.queue) {
jQuery.dequeue(this, opt.queue);
}
};
return opt; };
jQuery.fn.extend({
fadeTo: function (speed, to, easing, callback) {
// Show any hidden elements after setting opacity to 0
return this.filter(isHiddenWithinTree).css("opacity", 0).show()
// Animate to the value specified
.end().animate({
opacity: to
}, speed, easing, callback);
},
animate: function (prop, speed, easing, callback) {
var empty = jQuery.isEmptyObject(prop),
optall = jQuery.speed(speed, easing, callback),
doAnimation = function () {
// Operate on a copy of prop so per-property easing won't be lost
var anim = Animation(this, jQuery.extend({}, prop), optall);
// Empty animations, or finishing resolves immediately
if (empty || dataPriv.get(this, "finish")) {
anim.stop(true);
}
};
doAnimation.finish = doAnimation;
return empty || optall.queue === false ?
this.each(doAnimation) :
this.queue(optall.queue, doAnimation);
},
stop: function (type, clearQueue, gotoEnd) {
var stopQueue = function (hooks) {
var stop = hooks.stop;
delete hooks.stop;
stop(gotoEnd);
};
if (typeof type !== "string") {
gotoEnd = clearQueue;
clearQueue = type;
type = undefined;
}
if (clearQueue && type !== false) {
this.queue(type || "fx", []);
}
return this.each(function () {
var dequeue = true,
index = type != null && type + "queueHooks",
timers = jQuery.timers,
data = dataPriv.get(this);
if (index) {
if (data[index] && data[index].stop) {
stopQueue(data[index]);
}
} else {
for (index in data) {
if (data[index] && data[index].stop && rrun.test(index)) {
stopQueue(data[index]);
}
}
}
for (index = timers.length; index--;) {
if (timers[index].elem === this &&
(type == null || timers[index].queue === type)) {
timers[index].anim.stop(gotoEnd);
dequeue = false;
timers.splice(index, 1);
}
}
// Start the next in the queue if the last step wasn't forced.
// Timers currently will call their complete callbacks, which
// will dequeue but only if they were gotoEnd.
if (dequeue || !gotoEnd) {
jQuery.dequeue(this, type);
}
});
},
finish: function (type) {
if (type !== false) {
type = type || "fx";
}
return this.each(function () {
var index,
data = dataPriv.get(this),
queue = data[type + "queue"],
hooks = data[type + "queueHooks"],
timers = jQuery.timers,
length = queue ? queue.length : 0;
// Enable finishing flag on private data
data.finish = true;
// Empty the queue first
jQuery.queue(this, type, []);
if (hooks && hooks.stop) {
hooks.stop.call(this, true);
}
// Look for any active animations, and finish them
for (index = timers.length; index--;) {
if (timers[index].elem === this && timers[index].queue === type) {
timers[index].anim.stop(true);
timers.splice(index, 1);
}
}
// Look for any animations in the old queue and finish them
for (index = 0; index < length; index++) {
if (queue[index] && queue[index].finish) {
queue[index].finish.call(this);
}
}
// Turn off finishing flag
delete data.finish;
});
}
});
jQuery.each(["toggle", "show", "hide"], function (i, name) {
var cssFn = jQuery.fn[name];
jQuery.fn[name] = function (speed, easing, callback) {
return speed == null || typeof speed === "boolean" ?
cssFn.apply(this, arguments) :
this.animate(genFx(name, true), speed, easing, callback);
};
});
// Generate shortcuts for custom animations
jQuery.each({
slideDown: genFx("show"),
slideUp: genFx("hide"),
slideToggle: genFx("toggle"),
fadeIn: {
opacity: "show"
},
fadeOut: {
opacity: "hide"
},
fadeToggle: {
opacity: "toggle"
}
}, function (name, props) {
jQuery.fn[name] = function (speed, easing, callback) {
return this.animate(props, speed, easing, callback);
};
});
jQuery.timers = [];
jQuery.fx.tick = function () {
var timer,
i = 0,
timers = jQuery.timers;
fxNow = jQuery.now();
for (; i < timers.length; i++) {
timer = timers[i];
// Run the timer and safely remove it when done (allowing for external removal)
if (!timer() && timers[i] === timer) {
timers.splice(i--, 1);
}
}
if (!timers.length) {
jQuery.fx.stop();
}
fxNow = undefined;
};
jQuery.fx.timer = function (timer) {
jQuery.timers.push(timer);
jQuery.fx.start();
};
jQuery.fx.interval = 13;
jQuery.fx.start = function () {
if (inProgress) {
return;
}
inProgress = true;
schedule();
};
jQuery.fx.stop = function () {
inProgress = null;
};
jQuery.fx.speeds = {
slow: 600,
fast: 200,
// Default speed
_default: 400
};
// Based off of the plugin by Clint Helfers, with permission. // https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ jQuery.fn.delay = function (time, type) { time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; type = type || "fx";
return this.queue(type, function (next, hooks) {
var timeout = window.setTimeout(next, time);
hooks.stop = function () {
window.clearTimeout(timeout);
};
});
};
(function () {
var input = document.createElement("input"),
select = document.createElement("select"),
opt = select.appendChild(document.createElement("option"));
input.type = "checkbox";
// Support: Android <=4.3 only
// Default value for a checkbox should be "on"
support.checkOn = input.value !== "";
// Support: IE <=11 only
// Must access selectedIndex to make default options select
support.optSelected = opt.selected;
// Support: IE <=11 only
// An input loses its value after becoming a radio
input = document.createElement("input");
input.value = "t";
input.type = "radio";
support.radioValue = input.value === "t";
})();
var boolHook,
attrHandle = jQuery.expr.attrHandle;
jQuery.fn.extend({
attr: function (name, value) {
return access(this, jQuery.attr, name, value, arguments.length > 1);
},
removeAttr: function (name) {
return this.each(function () {
jQuery.removeAttr(this, name);
});
}
});
jQuery.extend({
attr: function (elem, name, value) {
var ret, hooks,
nType = elem.nodeType;
// Don't get/set attributes on text, comment and attribute nodes
if (nType === 3 || nType === 8 || nType === 2) {
return;
}
// Fallback to prop when attributes are not supported
if (typeof elem.getAttribute === "undefined") {
return jQuery.prop(elem, name, value);
}
// Attribute hooks are determined by the lowercase version
// Grab necessary hook if one is defined
if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
hooks = jQuery.attrHooks[name.toLowerCase()] ||
(jQuery.expr.match.bool.test(name) ? boolHook : undefined);
}
if (value !== undefined) {
if (value === null) {
jQuery.removeAttr(elem, name);
return;
}
if (hooks && "set" in hooks &&
(ret = hooks.set(elem, value, name)) !== undefined) {
return ret;
}
elem.setAttribute(name, value + "");
return value;
}
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
return ret;
}
ret = jQuery.find.attr(elem, name);
// Non-existent attributes return null, we normalize to undefined
return ret == null ? undefined : ret;
},
attrHooks: {
type: {
set: function (elem, value) {
if (!support.radioValue && value === "radio" &&
nodeName(elem, "input")) {
var val = elem.value;
elem.setAttribute("type", value);
if (val) {
elem.value = val;
}
return value;
}
}
}
},
removeAttr: function (elem, value) {
var name,
i = 0,
// Attribute names can contain non-HTML whitespace characters
// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
attrNames = value && value.match(rnothtmlwhite);
if (attrNames && elem.nodeType === 1) {
while ((name = attrNames[i++])) {
elem.removeAttribute(name);
}
}
}
});
// Hooks for boolean attributes
boolHook = {
set: function (elem, value, name) {
if (value === false) {
// Remove boolean attributes when set to false
jQuery.removeAttr(elem, name);
} else {
elem.setAttribute(name, name);
}
return name;
}
};
jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (i, name) {
var getter = attrHandle[name] || jQuery.find.attr;
attrHandle[name] = function (elem, name, isXML) {
var ret, handle,
lowercaseName = name.toLowerCase();
if (!isXML) {
// Avoid an infinite loop by temporarily removing this function from the getter
handle = attrHandle[lowercaseName];
attrHandle[lowercaseName] = ret;
ret = getter(elem, name, isXML) != null ?
lowercaseName :
null;
attrHandle[lowercaseName] = handle;
}
return ret;
};
});
var rfocusable = /^(?:input|select|textarea|button)$/i,
rclickable = /^(?:a|area)$/i;
jQuery.fn.extend({
prop: function (name, value) {
return access(this, jQuery.prop, name, value, arguments.length > 1);
},
removeProp: function (name) {
return this.each(function () {
delete this[jQuery.propFix[name] || name];
});
}
});
jQuery.extend({
prop: function (elem, name, value) {
var ret, hooks,
nType = elem.nodeType;
// Don't get/set properties on text, comment and attribute nodes
if (nType === 3 || nType === 8 || nType === 2) {
return;
}
if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
// Fix name and attach hooks
name = jQuery.propFix[name] || name;
hooks = jQuery.propHooks[name];
}
if (value !== undefined) {
if (hooks && "set" in hooks &&
(ret = hooks.set(elem, value, name)) !== undefined) {
return ret;
}
return (elem[name] = value);
}
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
return ret;
}
return elem[name];
},
propHooks: {
tabIndex: {
get: function (elem) {
// Support: IE <=9 - 11 only
// elem.tabIndex doesn't always return the
// correct value when it hasn't been explicitly set
// https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
// Use proper attribute retrieval(#12072)
var tabindex = jQuery.find.attr(elem, "tabindex");
if (tabindex) {
return parseInt(tabindex, 10);
}
if (
rfocusable.test(elem.nodeName) ||
rclickable.test(elem.nodeName) &&
elem.href
) {
return 0;
}
return -1;
}
}
},
propFix: {
"for": "htmlFor",
"class": "className"
}
});
// Support: IE <=11 only
// Accessing the selectedIndex property
// forces the browser to respect setting selected
// on the option
// The getter ensures a default option is selected
// when in an optgroup
// eslint rule "no-unused-expressions" is disabled for this code
// since it considers such accessions noop
if (!support.optSelected) {
jQuery.propHooks.selected = {
get: function (elem) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode;
if (parent && parent.parentNode) {
parent.parentNode.selectedIndex;
}
return null;
},
set: function (elem) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode;
if (parent) {
parent.selectedIndex;
if (parent.parentNode) {
parent.parentNode.selectedIndex;
}
}
}
};
}
jQuery.each([
"tabIndex", "readOnly", "maxLength", "cellSpacing", "cellPadding", "rowSpan", "colSpan", "useMap", "frameBorder", "contentEditable" ], function () {
jQuery.propFix[this.toLowerCase()] = this; });
// Strip and collapse whitespace according to HTML spec // https://html.spec.whatwg.org/multipage/infrastructure.html#strip-and-collapse-whitespace function stripAndCollapse(value) { var tokens = value.match(rnothtmlwhite) || []; return tokens.join(" "); }
function getClass(elem) {
return elem.getAttribute && elem.getAttribute("class") || "";
}
jQuery.fn.extend({
addClass: function (value) {
var classes, elem, cur, curValue, clazz, j, finalValue,
i = 0;
if (jQuery.isFunction(value)) {
return this.each(function (j) {
jQuery(this).addClass(value.call(this, j, getClass(this)));
});
}
if (typeof value === "string" && value) {
classes = value.match(rnothtmlwhite) || [];
while ((elem = this[i++])) {
curValue = getClass(elem);
cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
if (cur) {
j = 0;
while ((clazz = classes[j++])) {
if (cur.indexOf(" " + clazz + " ") < 0) {
cur += clazz + " ";
}
}
// Only assign if different to avoid unneeded rendering.
finalValue = stripAndCollapse(cur);
if (curValue !== finalValue) {
elem.setAttribute("class", finalValue);
}
}
}
}
return this;
},
removeClass: function (value) {
var classes, elem, cur, curValue, clazz, j, finalValue,
i = 0;
if (jQuery.isFunction(value)) {
return this.each(function (j) {
jQuery(this).removeClass(value.call(this, j, getClass(this)));
});
}
if (!arguments.length) {
return this.attr("class", "");
}
if (typeof value === "string" && value) {
classes = value.match(rnothtmlwhite) || [];
while ((elem = this[i++])) {
curValue = getClass(elem);
// This expression is here for better compressibility (see addClass)
cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
if (cur) {
j = 0;
while ((clazz = classes[j++])) {
// Remove *all* instances
while (cur.indexOf(" " + clazz + " ") > -1) {
cur = cur.replace(" " + clazz + " ", " ");
}
}
// Only assign if different to avoid unneeded rendering.
finalValue = stripAndCollapse(cur);
if (curValue !== finalValue) {
elem.setAttribute("class", finalValue);
}
}
}
}
return this;
},
toggleClass: function (value, stateVal) {
var type = typeof value;
if (typeof stateVal === "boolean" && type === "string") {
return stateVal ? this.addClass(value) : this.removeClass(value);
}
if (jQuery.isFunction(value)) {
return this.each(function (i) {
jQuery(this).toggleClass(
value.call(this, i, getClass(this), stateVal),
stateVal
);
});
}
return this.each(function () {
var className, i, self, classNames;
if (type === "string") {
// Toggle individual class names
i = 0;
self = jQuery(this);
classNames = value.match(rnothtmlwhite) || [];
while ((className = classNames[i++])) {
// Check each className given, space separated list
if (self.hasClass(className)) {
self.removeClass(className);
} else {
self.addClass(className);
}
}
// Toggle whole class name
} else if (value === undefined || type === "boolean") {
className = getClass(this);
if (className) {
// Store className if set
dataPriv.set(this, "__className__", className);
}
// If the element has a class name or if we're passed `false`,
// then remove the whole classname (if there was one, the above saved it).
// Otherwise bring back whatever was previously saved (if anything),
// falling back to the empty string if nothing was stored.
if (this.setAttribute) {
this.setAttribute("class",
className || value === false ?
"" :
dataPriv.get(this, "__className__") || ""
);
}
}
});
},
hasClass: function (selector) {
var className, elem,
i = 0;
className = " " + selector + " ";
while ((elem = this[i++])) {
if (elem.nodeType === 1 &&
(" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) {
return true;
}
}
return false;
}
});
var rreturn = /\r/g;
jQuery.fn.extend({
val: function (value) {
var hooks, ret, isFunction,
elem = this[0];
if (!arguments.length) {
if (elem) {
hooks = jQuery.valHooks[elem.type] ||
jQuery.valHooks[elem.nodeName.toLowerCase()];
if (hooks &&
"get" in hooks &&
(ret = hooks.get(elem, "value")) !== undefined
) {
return ret;
}
ret = elem.value;
// Handle most common string cases
if (typeof ret === "string") {
return ret.replace(rreturn, "");
}
// Handle cases where value is null/undef or number
return ret == null ? "" : ret;
}
return;
}
isFunction = jQuery.isFunction(value);
return this.each(function (i) {
var val;
if (this.nodeType !== 1) {
return;
}
if (isFunction) {
val = value.call(this, i, jQuery(this).val());
} else {
val = value;
}
// Treat null/undefined as ""; convert numbers to string
if (val == null) {
val = "";
} else if (typeof val === "number") {
val += "";
} else if (Array.isArray(val)) {
val = jQuery.map(val, function (value) {
return value == null ? "" : value + "";
});
}
hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()];
// If set returns undefined, fall back to normal setting
if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) {
this.value = val;
}
});
}
});
jQuery.extend({
valHooks: {
option: {
get: function (elem) {
var val = jQuery.find.attr(elem, "value");
return val != null ?
val :
// Support: IE <=10 - 11 only
// option.text throws exceptions (#14686, #14858)
// Strip and collapse whitespace
// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
stripAndCollapse(jQuery.text(elem));
}
},
select: {
get: function (elem) {
var value, option, i,
options = elem.options,
index = elem.selectedIndex,
one = elem.type === "select-one",
values = one ? null : [],
max = one ? index + 1 : options.length;
if (index < 0) {
i = max;
} else {
i = one ? index : 0;
}
// Loop through all the selected options
for (; i < max; i++) {
option = options[i];
// Support: IE <=9 only
// IE8-9 doesn't update selected after form reset (#2551)
if ((option.selected || i === index) &&
// Don't return options that are disabled or in a disabled optgroup
!option.disabled &&
(!option.parentNode.disabled ||
!nodeName(option.parentNode, "optgroup"))) {
// Get the specific value for the option
value = jQuery(option).val();
// We don't need an array for one selects
if (one) {
return value;
}
// Multi-Selects return an array
values.push(value);
}
}
return values;
},
set: function (elem, value) {
var optionSet, option,
options = elem.options,
values = jQuery.makeArray(value),
i = options.length;
while (i--) {
option = options[i];
/* eslint-disable no-cond-assign */
if (option.selected =
jQuery.inArray(jQuery.valHooks.option.get(option), values) > -1
) {
optionSet = true;
}
/* eslint-enable no-cond-assign */
}
// Force browsers to behave consistently when non-matching value is set
if (!optionSet) {
elem.selectedIndex = -1;
}
return values;
}
}
}
});
// Radios and checkboxes getter/setter
jQuery.each(["radio", "checkbox"], function () {
jQuery.valHooks[this] = {
set: function (elem, value) {
if (Array.isArray(value)) {
return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) > -1);
}
}
};
if (!support.checkOn) {
jQuery.valHooks[this].get = function (elem) {
return elem.getAttribute("value") === null ? "on" : elem.value;
};
}
});
// Return jQuery for attributes-only inclusion
var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/;
jQuery.extend(jQuery.event, {
trigger: function (event, data, elem, onlyHandlers) {
var i, cur, tmp, bubbleType, ontype, handle, special,
eventPath = [elem || document],
type = hasOwn.call(event, "type") ? event.type : event,
namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
cur = tmp = elem = elem || document;
// Don't do events on text and comment nodes
if (elem.nodeType === 3 || elem.nodeType === 8) {
return;
}
// focus/blur morphs to focusin/out; ensure we're not firing them right now
if (rfocusMorph.test(type + jQuery.event.triggered)) {
return;
}
if (type.indexOf(".") > -1) {
// Namespaced trigger; create a regexp to match event type in handle()
namespaces = type.split(".");
type = namespaces.shift();
namespaces.sort();
}
ontype = type.indexOf(":") < 0 && "on" + type;
// Caller can pass in a jQuery.Event object, Object, or just an event type string
event = event[jQuery.expando] ?
event :
new jQuery.Event(type, typeof event === "object" && event);
// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
event.isTrigger = onlyHandlers ? 2 : 3;
event.namespace = namespaces.join(".");
event.rnamespace = event.namespace ?
new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") :
null;
// Clean up the event in case it is being reused
event.result = undefined;
if (!event.target) {
event.target = elem;
}
// Clone any incoming data and prepend the event, creating the handler arg list
data = data == null ? [event] :
jQuery.makeArray(data, [event]);
// Allow special events to draw outside the lines
special = jQuery.event.special[type] || {};
if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
return;
}
// Determine event propagation path in advance, per W3C events spec (#9951)
// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
if (!onlyHandlers && !special.noBubble && !jQuery.isWindow(elem)) {
bubbleType = special.delegateType || type;
if (!rfocusMorph.test(bubbleType + type)) {
cur = cur.parentNode;
}
for (; cur; cur = cur.parentNode) {
eventPath.push(cur);
tmp = cur;
}
// Only add window if we got to document (e.g., not plain obj or detached DOM)
if (tmp === (elem.ownerDocument || document)) {
eventPath.push(tmp.defaultView || tmp.parentWindow || window);
}
}
// Fire handlers on the event path
i = 0;
while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
event.type = i > 1 ?
bubbleType :
special.bindType || type;
// jQuery handler
handle = (dataPriv.get(cur, "events") || {})[event.type] &&
dataPriv.get(cur, "handle");
if (handle) {
handle.apply(cur, data);
}
// Native handler
handle = ontype && cur[ontype];
if (handle && handle.apply && acceptData(cur)) {
event.result = handle.apply(cur, data);
if (event.result === false) {
event.preventDefault();
}
}
}
event.type = type;
// If nobody prevented the default action, do it now
if (!onlyHandlers && !event.isDefaultPrevented()) {
if ((!special._default ||
special._default.apply(eventPath.pop(), data) === false) &&
acceptData(elem)) {
// Call a native DOM method on the target with the same name as the event.
// Don't do default actions on window, that's where global variables be (#6170)
if (ontype && jQuery.isFunction(elem[type]) && !jQuery.isWindow(elem)) {
// Don't re-trigger an onFOO event when we call its FOO() method
tmp = elem[ontype];
if (tmp) {
elem[ontype] = null;
}
// Prevent re-triggering of the same event, since we already bubbled it above
jQuery.event.triggered = type;
elem[type]();
jQuery.event.triggered = undefined;
if (tmp) {
elem[ontype] = tmp;
}
}
}
}
return event.result;
},
// Piggyback on a donor event to simulate a different one
// Used only for `focus(in | out)` events
simulate: function (type, elem, event) {
var e = jQuery.extend(
new jQuery.Event(),
event, {
type: type,
isSimulated: true
}
);
jQuery.event.trigger(e, null, elem);
}
});
jQuery.fn.extend({
trigger: function (type, data) {
return this.each(function () {
jQuery.event.trigger(type, data, this);
});
},
triggerHandler: function (type, data) {
var elem = this[0];
if (elem) {
return jQuery.event.trigger(type, data, elem, true);
}
}
});
jQuery.each(("blur focus focusin focusout resize scroll click dblclick " +
"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
"change select submit keydown keypress keyup contextmenu").split(" "),
function (i, name) {
// Handle event binding
jQuery.fn[name] = function (data, fn) {
return arguments.length > 0 ?
this.on(name, null, data, fn) :
this.trigger(name);
};
});
jQuery.fn.extend({
hover: function (fnOver, fnOut) {
return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
}
});
support.focusin = "onfocusin" in window;
// Support: Firefox <=44 // Firefox doesn't have focus(in | out) events // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 // // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 // focus(in | out) events fire after focus & blur events, // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 if (!support.focusin) { jQuery.each({ focus: "focusin", blur: "focusout" }, function (orig, fix) {
// Attach a single capturing handler on the document while someone wants focusin/focusout
var handler = function (event) {
jQuery.event.simulate(fix, event.target, jQuery.event.fix(event));
};
jQuery.event.special[fix] = {
setup: function () {
var doc = this.ownerDocument || this,
attaches = dataPriv.access(doc, fix);
if (!attaches) {
doc.addEventListener(orig, handler, true);
}
dataPriv.access(doc, fix, (attaches || 0) + 1);
},
teardown: function () {
var doc = this.ownerDocument || this,
attaches = dataPriv.access(doc, fix) - 1;
if (!attaches) {
doc.removeEventListener(orig, handler, true);
dataPriv.remove(doc, fix);
} else {
dataPriv.access(doc, fix, attaches);
}
}
};
});
}
var location = window.location;
var nonce = jQuery.now();
var rquery = (/\?/);
// Cross-browser xml parsing
jQuery.parseXML = function (data) {
var xml;
if (!data || typeof data !== "string") {
return null;
}
// Support: IE 9 - 11 only
// IE throws on parseFromString with invalid input.
try {
xml = (new window.DOMParser()).parseFromString(data, "text/xml");
} catch (e) {
xml = undefined;
}
if (!xml || xml.getElementsByTagName("parsererror").length) {
jQuery.error("Invalid XML: " + data);
}
return xml;
};
var
rbracket = /\[\]$/,
rCRLF = /\r?\n/g,
rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
rsubmittable = /^(?:input|select|textarea|keygen)/i;
function buildParams(prefix, obj, traditional, add) {
var name;
if (Array.isArray(obj)) {
// Serialize array item.
jQuery.each(obj, function (i, v) {
if (traditional || rbracket.test(prefix)) {
// Treat each array item as a scalar.
add(prefix, v);
} else {
// Item is non-scalar (array or object), encode its numeric index.
buildParams(
prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]",
v,
traditional,
add
);
}
});
} else if (!traditional && jQuery.type(obj) === "object") {
// Serialize object item.
for (name in obj) {
buildParams(prefix + "[" + name + "]", obj[name], traditional, add);
}
} else {
// Serialize scalar item.
add(prefix, obj);
}
}
// Serialize an array of form elements or a set of
// key/values into a query string
jQuery.param = function (a, traditional) {
var prefix,
s = [],
add = function (key, valueOrFunction) {
// If value is a function, invoke it and use its return value
var value = jQuery.isFunction(valueOrFunction) ?
valueOrFunction() :
valueOrFunction;
s[s.length] = encodeURIComponent(key) + "=" +
encodeURIComponent(value == null ? "" : value);
};
// If an array was passed in, assume that it is an array of form elements.
if (Array.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) {
// Serialize the form elements
jQuery.each(a, function () {
add(this.name, this.value);
});
} else {
// If traditional, encode the "old" way (the way 1.3.2 or older
// did it), otherwise encode params recursively.
for (prefix in a) {
buildParams(prefix, a[prefix], traditional, add);
}
}
// Return the resulting serialization
return s.join("&");
};
jQuery.fn.extend({
serialize: function () {
return jQuery.param(this.serializeArray());
},
serializeArray: function () {
return this.map(function () {
// Can add propHook for "elements" to filter or add form elements
var elements = jQuery.prop(this, "elements");
return elements ? jQuery.makeArray(elements) : this;
})
.filter(function () {
var type = this.type;
// Use .is( ":disabled" ) so that fieldset[disabled] works
return this.name && !jQuery(this).is(":disabled") &&
rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) &&
(this.checked || !rcheckableType.test(type));
})
.map(function (i, elem) {
var val = jQuery(this).val();
if (val == null) {
return null;
}
if (Array.isArray(val)) {
return jQuery.map(val, function (val) {
return {
name: elem.name,
value: val.replace(rCRLF, "\r\n")
};
});
}
return {
name: elem.name,
value: val.replace(rCRLF, "\r\n")
};
}).get();
}
});
var
r20 = /%20/g,
rhash = /#.*$/,
rantiCache = /([?&])_=[^&]*/,
rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
// #7653, #8125, #8152: local protocol detection
rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
rnoContent = /^(?:GET|HEAD)$/,
rprotocol = /^\/\//,
/* Prefilters
* 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
* 2) These are called:
* - BEFORE asking for a transport
* - AFTER param serialization (s.data is a string if s.processData is true)
* 3) key is the dataType
* 4) the catchall symbol "*" can be used
* 5) execution will start with transport dataType and THEN continue down to "*" if needed
*/
prefilters = {},
/* Transports bindings
* 1) key is the dataType
* 2) the catchall symbol "*" can be used
* 3) selection will start with transport dataType and THEN go to "*" if needed
*/
transports = {},
// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
allTypes = "*/".concat("*"),
// Anchor tag for parsing the document origin
originAnchor = document.createElement("a");
originAnchor.href = location.href;
// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
function addToPrefiltersOrTransports(structure) {
// dataTypeExpression is optional and defaults to "*"
return function (dataTypeExpression, func) {
if (typeof dataTypeExpression !== "string") {
func = dataTypeExpression;
dataTypeExpression = "*";
}
var dataType,
i = 0,
dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || [];
if (jQuery.isFunction(func)) {
// For each dataType in the dataTypeExpression
while ((dataType = dataTypes[i++])) {
// Prepend if requested
if (dataType[0] === "+") {
dataType = dataType.slice(1) || "*";
(structure[dataType] = structure[dataType] || []).unshift(func);
// Otherwise append
} else {
(structure[dataType] = structure[dataType] || []).push(func);
}
}
}
};
}
// Base inspection function for prefilters and transports
function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
var inspected = {},
seekingTransport = (structure === transports);
function inspect(dataType) {
var selected;
inspected[dataType] = true;
jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) {
var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
if (typeof dataTypeOrTransport === "string" &&
!seekingTransport && !inspected[dataTypeOrTransport]) {
options.dataTypes.unshift(dataTypeOrTransport);
inspect(dataTypeOrTransport);
return false;
} else if (seekingTransport) {
return !(selected = dataTypeOrTransport);
}
});
return selected;
}
return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
}
// A special extend for ajax options
// that takes "flat" options (not to be deep extended)
// Fixes #9887
function ajaxExtend(target, src) {
var key, deep,
flatOptions = jQuery.ajaxSettings.flatOptions || {};
for (key in src) {
if (src[key] !== undefined) {
(flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key];
}
}
if (deep) {
jQuery.extend(true, target, deep);
}
return target; }
/* Handles responses to an ajax request:
* - finds the right dataType (mediates between content-type and expected dataType)
* - returns the corresponding response
*/
function ajaxHandleResponses(s, jqXHR, responses) {
var ct, type, finalDataType, firstDataType,
contents = s.contents,
dataTypes = s.dataTypes;
// Remove auto dataType and get content-type in the process
while (dataTypes[0] === "*") {
dataTypes.shift();
if (ct === undefined) {
ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
}
}
// Check if we're dealing with a known content-type
if (ct) {
for (type in contents) {
if (contents[type] && contents[type].test(ct)) {
dataTypes.unshift(type);
break;
}
}
}
// Check to see if we have a response for the expected dataType
if (dataTypes[0] in responses) {
finalDataType = dataTypes[0];
} else {
// Try convertible dataTypes
for (type in responses) {
if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
finalDataType = type;
break;
}
if (!firstDataType) {
firstDataType = type;
}
}
// Or just use first one
finalDataType = finalDataType || firstDataType;
}
// If we found a dataType
// We add the dataType to the list if needed
// and return the corresponding response
if (finalDataType) {
if (finalDataType !== dataTypes[0]) {
dataTypes.unshift(finalDataType);
}
return responses[finalDataType];
}
}
/* Chain conversions given the request and the original response
* Also sets the responseXXX fields on the jqXHR instance
*/
function ajaxConvert(s, response, jqXHR, isSuccess) {
var conv2, current, conv, tmp, prev,
converters = {},
// Work with a copy of dataTypes in case we need to modify it for conversion
dataTypes = s.dataTypes.slice();
// Create converters map with lowercased keys
if (dataTypes[1]) {
for (conv in s.converters) {
converters[conv.toLowerCase()] = s.converters[conv];
}
}
current = dataTypes.shift();
// Convert to each sequential dataType
while (current) {
if (s.responseFields[current]) {
jqXHR[s.responseFields[current]] = response;
}
// Apply the dataFilter if provided
if (!prev && isSuccess && s.dataFilter) {
response = s.dataFilter(response, s.dataType);
}
prev = current;
current = dataTypes.shift();
if (current) {
// There's only work to do if current dataType is non-auto
if (current === "*") {
current = prev;
// Convert response if prev dataType is non-auto and differs from current
} else if (prev !== "*" && prev !== current) {
// Seek a direct converter
conv = converters[prev + " " + current] || converters["* " + current];
// If none found, seek a pair
if (!conv) {
for (conv2 in converters) {
// If conv2 outputs current
tmp = conv2.split(" ");
if (tmp[1] === current) {
// If prev can be converted to accepted input
conv = converters[prev + " " + tmp[0]] ||
converters["* " + tmp[0]];
if (conv) {
// Condense equivalence converters
if (conv === true) {
conv = converters[conv2];
// Otherwise, insert the intermediate dataType
} else if (converters[conv2] !== true) {
current = tmp[0];
dataTypes.unshift(tmp[1]);
}
break;
}
}
}
}
// Apply converter (if not an equivalence)
if (conv !== true) {
// Unless errors are allowed to bubble, catch and return them
if (conv && s.throws) {
response = conv(response);
} else {
try {
response = conv(response);
} catch (e) {
return {
state: "parsererror",
error: conv ? e : "No conversion from " + prev + " to " + current
};
}
}
}
}
}
}
return {
state: "success",
data: response
};
}
jQuery.extend({
// Counter for holding the number of active queries
active: 0,
// Last-Modified header cache for next request
lastModified: {},
etag: {},
ajaxSettings: {
url: location.href,
type: "GET",
isLocal: rlocalProtocol.test(location.protocol),
global: true,
processData: true,
async: true,
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
/*
timeout: 0,
data: null,
dataType: null,
username: null,
password: null,
cache: null,
throws: false,
traditional: false,
headers: {},
*/
accepts: {
"*": allTypes,
text: "text/plain",
html: "text/html",
xml: "application/xml, text/xml",
json: "application/json, text/javascript"
},
contents: {
xml: /\bxml\b/,
html: /\bhtml/,
json: /\bjson\b/
},
responseFields: {
xml: "responseXML",
text: "responseText",
json: "responseJSON"
},
// Data converters
// Keys separate source (or catchall "*") and destination types with a single space
converters: {
// Convert anything to text
"* text": String,
// Text to html (true = no transformation)
"text html": true,
// Evaluate text as a json expression
"text json": JSON.parse,
// Parse text as xml
"text xml": jQuery.parseXML
},
// For options that shouldn't be deep extended:
// you can add your own custom options here if
// and when you create one that shouldn't be
// deep extended (see ajaxExtend)
flatOptions: {
url: true,
context: true
}
},
// Creates a full fledged settings object into target
// with both ajaxSettings and settings fields.
// If target is omitted, writes into ajaxSettings.
ajaxSetup: function (target, settings) {
return settings ?
// Building a settings object
ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :
// Extending ajaxSettings
ajaxExtend(jQuery.ajaxSettings, target);
},
ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
ajaxTransport: addToPrefiltersOrTransports(transports),
// Main method
ajax: function (url, options) {
// If url is an object, simulate pre-1.5 signature
if (typeof url === "object") {
options = url;
url = undefined;
}
// Force options to be an object
options = options || {};
var transport,
// URL without anti-cache param
cacheURL,
// Response headers
responseHeadersString,
responseHeaders,
// timeout handle
timeoutTimer,
// Url cleanup var
urlAnchor,
// Request state (becomes false upon send and true upon completion)
completed,
// To know if global events are to be dispatched
fireGlobals,
// Loop variable
i,
// uncached part of the url
uncached,
// Create the final options object
s = jQuery.ajaxSetup({}, options),
// Callbacks context
callbackContext = s.context || s,
// Context for global events is callbackContext if it is a DOM node or jQuery collection
globalEventContext = s.context &&
(callbackContext.nodeType || callbackContext.jquery) ?
jQuery(callbackContext) :
jQuery.event,
// Deferreds
deferred = jQuery.Deferred(),
completeDeferred = jQuery.Callbacks("once memory"),
// Status-dependent callbacks
statusCode = s.statusCode || {},
// Headers (they are sent all at once)
requestHeaders = {},
requestHeadersNames = {},
// Default abort message
strAbort = "canceled",
// Fake xhr
jqXHR = {
readyState: 0,
// Builds headers hashtable if needed
getResponseHeader: function (key) {
var match;
if (completed) {
if (!responseHeaders) {
responseHeaders = {};
while ((match = rheaders.exec(responseHeadersString))) {
responseHeaders[match[1].toLowerCase()] = match[2];
}
}
match = responseHeaders[key.toLowerCase()];
}
return match == null ? null : match;
},
// Raw string
getAllResponseHeaders: function () {
return completed ? responseHeadersString : null;
},
// Caches the header
setRequestHeader: function (name, value) {
if (completed == null) {
name = requestHeadersNames[name.toLowerCase()] =
requestHeadersNames[name.toLowerCase()] || name;
requestHeaders[name] = value;
}
return this;
},
// Overrides response content-type header
overrideMimeType: function (type) {
if (completed == null) {
s.mimeType = type;
}
return this;
},
// Status-dependent callbacks
statusCode: function (map) {
var code;
if (map) {
if (completed) {
// Execute the appropriate callbacks
jqXHR.always(map[jqXHR.status]);
} else {
// Lazy-add the new callbacks in a way that preserves old ones
for (code in map) {
statusCode[code] = [statusCode[code], map[code]];
}
}
}
return this;
},
// Cancel the request
abort: function (statusText) {
var finalText = statusText || strAbort;
if (transport) {
transport.abort(finalText);
}
done(0, finalText);
return this;
}
};
// Attach deferreds
deferred.promise(jqXHR);
// Add protocol if not provided (prefilters might expect it)
// Handle falsy url in the settings object (#10093: consistency with old signature)
// We also use the url parameter if available
s.url = ((url || s.url || location.href) + "")
.replace(rprotocol, location.protocol + "//");
// Alias method option to type as per ticket #12004
s.type = options.method || options.type || s.method || s.type;
// Extract dataTypes list
s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""];
// A cross-domain request is in order when the origin doesn't match the current origin.
if (s.crossDomain == null) {
urlAnchor = document.createElement("a");
// Support: IE <=8 - 11, Edge 12 - 13
// IE throws exception on accessing the href property if url is malformed,
// e.g. http://example.com:80x/
try {
urlAnchor.href = s.url;
// Support: IE <=8 - 11 only
// Anchor's host property isn't correctly set when s.url is relative
urlAnchor.href = urlAnchor.href;
s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
urlAnchor.protocol + "//" + urlAnchor.host;
} catch (e) {
// If there is an error parsing the URL, assume it is crossDomain,
// it can be rejected by the transport if it is invalid
s.crossDomain = true;
}
}
// Convert data if not already a string
if (s.data && s.processData && typeof s.data !== "string") {
s.data = jQuery.param(s.data, s.traditional);
}
// Apply prefilters
inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
// If request was aborted inside a prefilter, stop there
if (completed) {
return jqXHR;
}
// We can fire global events as of now if asked to
// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
fireGlobals = jQuery.event && s.global;
// Watch for a new set of requests
if (fireGlobals && jQuery.active++ === 0) {
jQuery.event.trigger("ajaxStart");
}
// Uppercase the type
s.type = s.type.toUpperCase();
// Determine if request has content
s.hasContent = !rnoContent.test(s.type);
// Save the URL in case we're toying with the If-Modified-Since
// and/or If-None-Match header later on
// Remove hash to simplify url manipulation
cacheURL = s.url.replace(rhash, "");
// More options handling for requests with no content
if (!s.hasContent) {
// Remember the hash so we can put it back
uncached = s.url.slice(cacheURL.length);
// If data is available, append data to url
if (s.data) {
cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data;
// #9682: remove data so that it's not used in an eventual retry
delete s.data;
}
// Add or update anti-cache param if needed
if (s.cache === false) {
cacheURL = cacheURL.replace(rantiCache, "$1");
uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + (nonce++) + uncached;
}
// Put hash and anti-cache on the URL that will be requested (gh-1732)
s.url = cacheURL + uncached;
// Change '%20' to '+' if this is encoded form body content (gh-2658)
} else if (s.data && s.processData &&
(s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) {
s.data = s.data.replace(r20, "+");
}
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
if (s.ifModified) {
if (jQuery.lastModified[cacheURL]) {
jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]);
}
if (jQuery.etag[cacheURL]) {
jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]);
}
}
// Set the correct header, if data is being sent
if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
jqXHR.setRequestHeader("Content-Type", s.contentType);
}
// Set the Accepts header for the server, depending on the dataType
jqXHR.setRequestHeader(
"Accept",
s.dataTypes[0] && s.accepts[s.dataTypes[0]] ?
s.accepts[s.dataTypes[0]] +
(s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") :
s.accepts["*"]
);
// Check for headers option
for (i in s.headers) {
jqXHR.setRequestHeader(i, s.headers[i]);
}
// Allow custom headers/mimetypes and early abort
if (s.beforeSend &&
(s.beforeSend.call(callbackContext, jqXHR, s) === false || completed)) {
// Abort if not done already and return
return jqXHR.abort();
}
// Aborting is no longer a cancellation
strAbort = "abort";
// Install callbacks on deferreds
completeDeferred.add(s.complete);
jqXHR.done(s.success);
jqXHR.fail(s.error);
// Get transport
transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
// If no transport, we auto-abort
if (!transport) {
done(-1, "No Transport");
} else {
jqXHR.readyState = 1;
// Send global event
if (fireGlobals) {
globalEventContext.trigger("ajaxSend", [jqXHR, s]);
}
// If request was aborted inside ajaxSend, stop there
if (completed) {
return jqXHR;
}
// Timeout
if (s.async && s.timeout > 0) {
timeoutTimer = window.setTimeout(function () {
jqXHR.abort("timeout");
}, s.timeout);
}
try {
completed = false;
transport.send(requestHeaders, done);
} catch (e) {
// Rethrow post-completion exceptions
if (completed) {
throw e;
}
// Propagate others as results
done(-1, e);
}
}
// Callback for when everything is done
function done(status, nativeStatusText, responses, headers) {
var isSuccess, success, error, response, modified,
statusText = nativeStatusText;
// Ignore repeat invocations
if (completed) {
return;
}
completed = true;
// Clear timeout if it exists
if (timeoutTimer) {
window.clearTimeout(timeoutTimer);
}
// Dereference transport for early garbage collection
// (no matter how long the jqXHR object will be used)
transport = undefined;
// Cache response headers
responseHeadersString = headers || "";
// Set readyState
jqXHR.readyState = status > 0 ? 4 : 0;
// Determine if successful
isSuccess = status >= 200 && status < 300 || status === 304;
// Get response data
if (responses) {
response = ajaxHandleResponses(s, jqXHR, responses);
}
// Convert no matter what (that way responseXXX fields are always set)
response = ajaxConvert(s, response, jqXHR, isSuccess);
// If successful, handle type chaining
if (isSuccess) {
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
if (s.ifModified) {
modified = jqXHR.getResponseHeader("Last-Modified");
if (modified) {
jQuery.lastModified[cacheURL] = modified;
}
modified = jqXHR.getResponseHeader("etag");
if (modified) {
jQuery.etag[cacheURL] = modified;
}
}
// if no content
if (status === 204 || s.type === "HEAD") {
statusText = "nocontent";
// if not modified
} else if (status === 304) {
statusText = "notmodified";
// If we have data, let's convert it
} else {
statusText = response.state;
success = response.data;
error = response.error;
isSuccess = !error;
}
} else {
// Extract error from statusText and normalize for non-aborts
error = statusText;
if (status || !statusText) {
statusText = "error";
if (status < 0) {
status = 0;
}
}
}
// Set data for the fake xhr object
jqXHR.status = status;
jqXHR.statusText = (nativeStatusText || statusText) + "";
// Success/Error
if (isSuccess) {
deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
} else {
deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
}
// Status-dependent callbacks
jqXHR.statusCode(statusCode);
statusCode = undefined;
if (fireGlobals) {
globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", [jqXHR, s, isSuccess ? success : error]);
}
// Complete
completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
if (fireGlobals) {
globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
// Handle the global AJAX counter
if (!(--jQuery.active)) {
jQuery.event.trigger("ajaxStop");
}
}
}
return jqXHR;
},
getJSON: function (url, data, callback) {
return jQuery.get(url, data, callback, "json");
},
getScript: function (url, callback) {
return jQuery.get(url, undefined, callback, "script");
}
});
jQuery.each(["get", "post"], function (i, method) {
jQuery[method] = function (url, data, callback, type) {
// Shift arguments if data argument was omitted
if (jQuery.isFunction(data)) {
type = type || callback;
callback = data;
data = undefined;
}
// The url can be an options object (which then must have .url)
return jQuery.ajax(jQuery.extend({
url: url,
type: method,
dataType: type,
data: data,
success: callback
}, jQuery.isPlainObject(url) && url));
};
});
jQuery._evalUrl = function (url) {
return jQuery.ajax({
url: url,
// Make this explicit, since user can override this through ajaxSetup (#11264)
type: "GET",
dataType: "script",
cache: true,
async: false,
global: false,
"throws": true
});
};
jQuery.fn.extend({
wrapAll: function (html) {
var wrap;
if (this[0]) {
if (jQuery.isFunction(html)) {
html = html.call(this[0]);
}
// The elements to wrap the target around
wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);
if (this[0].parentNode) {
wrap.insertBefore(this[0]);
}
wrap.map(function () {
var elem = this;
while (elem.firstElementChild) {
elem = elem.firstElementChild;
}
return elem;
}).append(this);
}
return this;
},
wrapInner: function (html) {
if (jQuery.isFunction(html)) {
return this.each(function (i) {
jQuery(this).wrapInner(html.call(this, i));
});
}
return this.each(function () {
var self = jQuery(this),
contents = self.contents();
if (contents.length) {
contents.wrapAll(html);
} else {
self.append(html);
}
});
},
wrap: function (html) {
var isFunction = jQuery.isFunction(html);
return this.each(function (i) {
jQuery(this).wrapAll(isFunction ? html.call(this, i) : html);
});
},
unwrap: function (selector) {
this.parent(selector).not("body").each(function () {
jQuery(this).replaceWith(this.childNodes);
});
return this;
}
});
jQuery.expr.pseudos.hidden = function (elem) {
return !jQuery.expr.pseudos.visible(elem);
};
jQuery.expr.pseudos.visible = function (elem) {
return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length);
};
jQuery.ajaxSettings.xhr = function () {
try {
return new window.XMLHttpRequest();
} catch (e) {}
};
var xhrSuccessStatus = {
// File protocol always yields status code 0, assume 200
0: 200,
// Support: IE <=9 only
// #1450: sometimes IE returns 1223 when it should be 204
1223: 204
},
xhrSupported = jQuery.ajaxSettings.xhr();
support.cors = !!xhrSupported && ("withCredentials" in xhrSupported);
support.ajax = xhrSupported = !!xhrSupported;
jQuery.ajaxTransport(function (options) {
var callback, errorCallback;
// Cross domain only allowed if supported through XMLHttpRequest
if (support.cors || xhrSupported && !options.crossDomain) {
return {
send: function (headers, complete) {
var i,
xhr = options.xhr();
xhr.open(
options.type,
options.url,
options.async,
options.username,
options.password
);
// Apply custom fields if provided
if (options.xhrFields) {
for (i in options.xhrFields) {
xhr[i] = options.xhrFields[i];
}
}
// Override mime type if needed
if (options.mimeType && xhr.overrideMimeType) {
xhr.overrideMimeType(options.mimeType);
}
// X-Requested-With header
// For cross-domain requests, seeing as conditions for a preflight are
// akin to a jigsaw puzzle, we simply never set it to be sure.
// (it can always be set on a per-request basis or even using ajaxSetup)
// For same-domain requests, won't change header if already provided.
if (!options.crossDomain && !headers["X-Requested-With"]) {
headers["X-Requested-With"] = "XMLHttpRequest";
}
// Set headers
for (i in headers) {
xhr.setRequestHeader(i, headers[i]);
}
// Callback
callback = function (type) {
return function () {
if (callback) {
callback = errorCallback = xhr.onload =
xhr.onerror = xhr.onabort = xhr.onreadystatechange = null;
if (type === "abort") {
xhr.abort();
} else if (type === "error") {
// Support: IE <=9 only
// On a manual native abort, IE9 throws
// errors on any property access that is not readyState
if (typeof xhr.status !== "number") {
complete(0, "error");
} else {
complete(
// File: protocol always yields status 0; see #8605, #14207
xhr.status,
xhr.statusText
);
}
} else {
complete(
xhrSuccessStatus[xhr.status] || xhr.status,
xhr.statusText,
// Support: IE <=9 only
// IE9 has no XHR2 but throws on binary (trac-11426)
// For XHR2 non-text, let the caller handle it (gh-2498)
(xhr.responseType || "text") !== "text" ||
typeof xhr.responseText !== "string" ? {
binary: xhr.response
} : {
text: xhr.responseText
},
xhr.getAllResponseHeaders()
);
}
}
};
};
// Listen to events
xhr.onload = callback();
errorCallback = xhr.onerror = callback("error");
// Support: IE 9 only
// Use onreadystatechange to replace onabort
// to handle uncaught aborts
if (xhr.onabort !== undefined) {
xhr.onabort = errorCallback;
} else {
xhr.onreadystatechange = function () {
// Check readyState before timeout as it changes
if (xhr.readyState === 4) {
// Allow onerror to be called first,
// but that will not handle a native abort
// Also, save errorCallback to a variable
// as xhr.onerror cannot be accessed
window.setTimeout(function () {
if (callback) {
errorCallback();
}
});
}
};
}
// Create the abort callback
callback = callback("abort");
try {
// Do send the request (this may raise an exception)
xhr.send(options.hasContent && options.data || null);
} catch (e) {
// #14683: Only rethrow if this hasn't been notified as an error yet
if (callback) {
throw e;
}
}
},
abort: function () {
if (callback) {
callback();
}
}
};
}
});
// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
jQuery.ajaxPrefilter(function (s) {
if (s.crossDomain) {
s.contents.script = false;
}
});
// Install script dataType
jQuery.ajaxSetup({
accepts: {
script: "text/javascript, application/javascript, " +
"application/ecmascript, application/x-ecmascript"
},
contents: {
script: /\b(?:java|ecma)script\b/
},
converters: {
"text script": function (text) {
jQuery.globalEval(text);
return text;
}
}
});
// Handle cache's special case and crossDomain
jQuery.ajaxPrefilter("script", function (s) {
if (s.cache === undefined) {
s.cache = false;
}
if (s.crossDomain) {
s.type = "GET";
}
});
// Bind script tag hack transport
jQuery.ajaxTransport("script", function (s) {
// This transport only deals with cross domain requests
if (s.crossDomain) {
var script, callback;
return {
send: function (_, complete) {
script = jQuery("<script>").prop({
charset: s.scriptCharset,
src: s.url
}).on(
"load error",
callback = function (evt) {
script.remove();
callback = null;
if (evt) {
complete(evt.type === "error" ? 404 : 200, evt.type);
}
}
);
// Use native DOM manipulation to avoid our domManip AJAX trickery
document.head.appendChild(script[0]);
},
abort: function () {
if (callback) {
callback();
}
}
};
}
});
var oldCallbacks = [],
rjsonp = /(=)\?(?=&|$)|\?\?/;
// Default jsonp settings
jQuery.ajaxSetup({
jsonp: "callback",
jsonpCallback: function () {
var callback = oldCallbacks.pop() || (jQuery.expando + "_" + (nonce++));
this[callback] = true;
return callback;
}
});
// Detect, normalize options and install callbacks for jsonp requests
jQuery.ajaxPrefilter("json jsonp", function (s, originalSettings, jqXHR) {
var callbackName, overwritten, responseContainer,
jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ?
"url" :
typeof s.data === "string" &&
(s.contentType || "")
.indexOf("application/x-www-form-urlencoded") === 0 &&
rjsonp.test(s.data) && "data"
);
// Handle iff the expected data type is "jsonp" or we have a parameter to set
if (jsonProp || s.dataTypes[0] === "jsonp") {
// Get callback name, remembering preexisting value associated with it
callbackName = s.jsonpCallback = jQuery.isFunction(s.jsonpCallback) ?
s.jsonpCallback() :
s.jsonpCallback;
// Insert callback into url or form data
if (jsonProp) {
s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
} else if (s.jsonp !== false) {
s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
}
// Use data converter to retrieve json after script execution
s.converters["script json"] = function () {
if (!responseContainer) {
jQuery.error(callbackName + " was not called");
}
return responseContainer[0];
};
// Force json dataType
s.dataTypes[0] = "json";
// Install callback
overwritten = window[callbackName];
window[callbackName] = function () {
responseContainer = arguments;
};
// Clean-up function (fires after converters)
jqXHR.always(function () {
// If previous value didn't exist - remove it
if (overwritten === undefined) {
jQuery(window).removeProp(callbackName);
// Otherwise restore preexisting value
} else {
window[callbackName] = overwritten;
}
// Save back as free
if (s[callbackName]) {
// Make sure that re-using the options doesn't screw things around
s.jsonpCallback = originalSettings.jsonpCallback;
// Save the callback name for future use
oldCallbacks.push(callbackName);
}
// Call if it was a function and we have a response
if (responseContainer && jQuery.isFunction(overwritten)) {
overwritten(responseContainer[0]);
}
responseContainer = overwritten = undefined;
});
// Delegate to script
return "script";
}
});
// Support: Safari 8 only // In Safari 8 documents created via document.implementation.createHTMLDocument // collapse sibling forms: the second one becomes a child of the first one. // Because of that, this security measure has to be disabled in Safari 8. // https://bugs.webkit.org/show_bug.cgi?id=137337 support.createHTMLDocument = (function () { var body = document.implementation.createHTMLDocument("").body; body.innerHTML = "<form></form><form></form>"; return body.childNodes.length === 2; })();
// Argument "data" should be string of html
// context (optional): If specified, the fragment will be created in this context,
// defaults to document
// keepScripts (optional): If true, will include scripts passed in the html string
jQuery.parseHTML = function (data, context, keepScripts) {
if (typeof data !== "string") {
return [];
}
if (typeof context === "boolean") {
keepScripts = context;
context = false;
}
var base, parsed, scripts;
if (!context) {
// Stop scripts or inline event handlers from being executed immediately
// by using document.implementation
if (support.createHTMLDocument) {
context = document.implementation.createHTMLDocument("");
// Set the base href for the created document
// so any parsed elements with URLs
// are based on the document's URL (gh-2965)
base = context.createElement("base");
base.href = document.location.href;
context.head.appendChild(base);
} else {
context = document;
}
}
parsed = rsingleTag.exec(data);
scripts = !keepScripts && [];
// Single tag
if (parsed) {
return [context.createElement(parsed[1])];
}
parsed = buildFragment([data], context, scripts);
if (scripts && scripts.length) {
jQuery(scripts).remove();
}
return jQuery.merge([], parsed.childNodes); };
/**
* Load a url into a page
*/
jQuery.fn.load = function (url, params, callback) {
var selector, type, response,
self = this,
off = url.indexOf(" ");
if (off > -1) {
selector = stripAndCollapse(url.slice(off));
url = url.slice(0, off);
}
// If it's a function
if (jQuery.isFunction(params)) {
// We assume that it's the callback
callback = params;
params = undefined;
// Otherwise, build a param string
} else if (params && typeof params === "object") {
type = "POST";
}
// If we have elements to modify, make the request
if (self.length > 0) {
jQuery.ajax({
url: url,
// If "type" variable is undefined, then "GET" method will be used.
// Make value of this field explicit since
// user can override it through ajaxSetup method
type: type || "GET",
dataType: "html",
data: params
}).done(function (responseText) {
// Save response for use in complete callback
response = arguments;
self.html(selector ?
// If a selector was specified, locate the right elements in a dummy div
// Exclude scripts to avoid IE 'Permission Denied' errors
jQuery("").append(jQuery.parseHTML(responseText)).find(selector) :
<img alt="" src="' + icon_url + '"' + classString + '>' + multipleCheckbox + option.html() + ' '));
' + multipleCheckbox + option.html() + ' '));
' + $(this).attr('label') + ' '));
// Otherwise use the full result
responseText);
// If the request succeeds, this function gets "data", "status", "jqXHR"
// but they are ignored because response was set above.
// If it fails, this function gets "jqXHR", "status", "error"
}).always(callback && function (jqXHR, status) {
self.each(function () {
callback.apply(this, response || [jqXHR.responseText, status, jqXHR]);
});
});
}
return this; };
// Attach a bunch of functions for handling common AJAX events jQuery.each([
"ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend" ], function (i, type) {
jQuery.fn[type] = function (fn) {
return this.on(type, fn);
};
});
jQuery.expr.pseudos.animated = function (elem) {
return jQuery.grep(jQuery.timers, function (fn) {
return elem === fn.elem;
}).length;
};
jQuery.offset = {
setOffset: function (elem, options, i) {
var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
position = jQuery.css(elem, "position"),
curElem = jQuery(elem),
props = {};
// Set position first, in-case top/left are set even on static elem
if (position === "static") {
elem.style.position = "relative";
}
curOffset = curElem.offset();
curCSSTop = jQuery.css(elem, "top");
curCSSLeft = jQuery.css(elem, "left");
calculatePosition = (position === "absolute" || position === "fixed") &&
(curCSSTop + curCSSLeft).indexOf("auto") > -1;
// Need to be able to calculate position if either
// top or left is auto and position is either absolute or fixed
if (calculatePosition) {
curPosition = curElem.position();
curTop = curPosition.top;
curLeft = curPosition.left;
} else {
curTop = parseFloat(curCSSTop) || 0;
curLeft = parseFloat(curCSSLeft) || 0;
}
if (jQuery.isFunction(options)) {
// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
options = options.call(elem, i, jQuery.extend({}, curOffset));
}
if (options.top != null) {
props.top = (options.top - curOffset.top) + curTop;
}
if (options.left != null) {
props.left = (options.left - curOffset.left) + curLeft;
}
if ("using" in options) {
options.using.call(elem, props);
} else {
curElem.css(props);
}
}
};
jQuery.fn.extend({
offset: function (options) {
// Preserve chaining for setter
if (arguments.length) {
return options === undefined ?
this :
this.each(function (i) {
jQuery.offset.setOffset(this, options, i);
});
}
var doc, docElem, rect, win,
elem = this[0];
if (!elem) {
return;
}
// Return zeros for disconnected and hidden (display: none) elements (gh-2310)
// Support: IE <=11 only
// Running getBoundingClientRect on a
// disconnected node in IE throws an error
if (!elem.getClientRects().length) {
return {
top: 0,
left: 0
};
}
rect = elem.getBoundingClientRect();
doc = elem.ownerDocument;
docElem = doc.documentElement;
win = doc.defaultView;
return {
top: rect.top + win.pageYOffset - docElem.clientTop,
left: rect.left + win.pageXOffset - docElem.clientLeft
};
},
position: function () {
if (!this[0]) {
return;
}
var offsetParent, offset,
elem = this[0],
parentOffset = {
top: 0,
left: 0
};
// Fixed elements are offset from window (parentOffset = {top:0, left: 0},
// because it is its only offset parent
if (jQuery.css(elem, "position") === "fixed") {
// Assume getBoundingClientRect is there when computed position is fixed
offset = elem.getBoundingClientRect();
} else {
// Get *real* offsetParent
offsetParent = this.offsetParent();
// Get correct offsets
offset = this.offset();
if (!nodeName(offsetParent[0], "html")) {
parentOffset = offsetParent.offset();
}
// Add offsetParent borders
parentOffset = {
top: parentOffset.top + jQuery.css(offsetParent[0], "borderTopWidth", true),
left: parentOffset.left + jQuery.css(offsetParent[0], "borderLeftWidth", true)
};
}
// Subtract parent offsets and element margins
return {
top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true),
left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true)
};
},
// This method will return documentElement in the following cases:
// 1) For the element inside the iframe without offsetParent, this method will return
// documentElement of the parent window
// 2) For the hidden or detached element
// 3) For body or html element, i.e. in case of the html node - it will return itself
//
// but those exceptions were never presented as a real life use-cases
// and might be considered as more preferable results.
//
// This logic, however, is not guaranteed and can change at any point in the future
offsetParent: function () {
return this.map(function () {
var offsetParent = this.offsetParent;
while (offsetParent && jQuery.css(offsetParent, "position") === "static") {
offsetParent = offsetParent.offsetParent;
}
return offsetParent || documentElement;
});
}
});
// Create scrollLeft and scrollTop methods
jQuery.each({
scrollLeft: "pageXOffset",
scrollTop: "pageYOffset"
}, function (method, prop) {
var top = "pageYOffset" === prop;
jQuery.fn[method] = function (val) {
return access(this, function (elem, method, val) {
// Coalesce documents and windows
var win;
if (jQuery.isWindow(elem)) {
win = elem;
} else if (elem.nodeType === 9) {
win = elem.defaultView;
}
if (val === undefined) {
return win ? win[prop] : elem[method];
}
if (win) {
win.scrollTo(!top ? val : win.pageXOffset,
top ? val : win.pageYOffset
);
} else {
elem[method] = val;
}
}, method, val, arguments.length);
};
});
// Support: Safari <=7 - 9.1, Chrome <=37 - 49 // Add the top/left cssHooks using jQuery.fn.position // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 // Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347 // getComputedStyle returns percent when specified for top/left/bottom/right; // rather than make the css module depend on the offset module, just check for it here jQuery.each(["top", "left"], function (i, prop) { jQuery.cssHooks[prop] = addGetHookIf(support.pixelPosition, function (elem, computed) { if (computed) { computed = curCSS(elem, prop);
// If curCSS returns percentage, fallback to offset
return rnumnonpx.test(computed) ?
jQuery(elem).position()[prop] + "px" :
computed;
}
}
);
});
// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
jQuery.each({
Height: "height",
Width: "width"
}, function (name, type) {
jQuery.each({
padding: "inner" + name,
content: type,
"": "outer" + name
},
function (defaultExtra, funcName) {
// Margin is only for outerHeight, outerWidth
jQuery.fn[funcName] = function (margin, value) {
var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"),
extra = defaultExtra || (margin === true || value === true ? "margin" : "border");
return access(this, function (elem, type, value) {
var doc;
if (jQuery.isWindow(elem)) {
// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
return funcName.indexOf("outer") === 0 ?
elem["inner" + name] :
elem.document.documentElement["client" + name];
}
// Get document width or height
if (elem.nodeType === 9) {
doc = elem.documentElement;
// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
// whichever is greatest
return Math.max(
elem.body["scroll" + name], doc["scroll" + name],
elem.body["offset" + name], doc["offset" + name],
doc["client" + name]
);
}
return value === undefined ?
// Get width or height on the element, requesting but not forcing parseFloat
jQuery.css(elem, type, extra) :
// Set width or height on the element
jQuery.style(elem, type, value, extra);
}, type, chainable ? margin : undefined, chainable);
};
});
});
jQuery.fn.extend({
bind: function (types, data, fn) {
return this.on(types, null, data, fn);
},
unbind: function (types, fn) {
return this.off(types, null, fn);
},
delegate: function (selector, types, data, fn) {
return this.on(types, selector, data, fn);
},
undelegate: function (selector, types, fn) {
// ( namespace ) or ( selector, types [, fn] )
return arguments.length === 1 ?
this.off(selector, "**") :
this.off(types, selector || "**", fn);
}
});
jQuery.holdReady = function (hold) {
if (hold) {
jQuery.readyWait++;
} else {
jQuery.ready(true);
}
};
jQuery.isArray = Array.isArray;
jQuery.parseJSON = JSON.parse;
jQuery.nodeName = nodeName;
// Register as a named AMD module, since jQuery can be concatenated with other // files that may use define, but not via a proper concatenation script that // understands anonymous AMD modules. A named AMD is safest and most robust // way to register. Lowercase jquery is used because AMD module names are // derived from file names, and jQuery is normally delivered in a lowercase // file name. Do this after creating the global so that if an AMD module wants // to call noConflict to hide this version of jQuery, it will work.
// Note that for maximum portability, libraries that are not jQuery should // declare themselves as anonymous modules, and avoid setting a global if an // AMD loader is present. jQuery is a special case. For more information, see // https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
if (typeof define === "function" && define.amd) {
define("jquery", [], function () {
return jQuery;
});
}
var
// Map over jQuery in case of overwrite
_jQuery = window.jQuery,
// Map over the $ in case of overwrite
_$ = window.$;
jQuery.noConflict = function (deep) {
if (window.$ === jQuery) {
window.$ = _$;
}
if (deep && window.jQuery === jQuery) {
window.jQuery = _jQuery;
}
return jQuery; };
// Expose jQuery and $ identifiers, even in AMD // (#7102#comment:10, https://github.com/jquery/jquery/pull/557) // and CommonJS for browser emulators (#13566) if (!noGlobal) { window.jQuery = window.$ = jQuery; }
return jQuery;
});
/*!
* Materialize v0.99.0 (http://materializecss.com) * Copyright 2014-2017 Materialize * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) */
// Check for jQuery. if (typeof (jQuery) === 'undefined') {
var jQuery;
// Check if require is a defined function.
if (typeof (require) === 'function') {
jQuery = $ = require('jquery');
// Else use the dollar sign alias.
} else {
jQuery = $;
}
}; /*
* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/ * Open source under the BSD License. * Copyright © 2008 George McGinley Smith * All rights reserved. * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE */
(function (factory) {
if (typeof define === "function" && define.amd) {
define(['jquery'], function ($) {
return factory($);
});
} else if (typeof module === "object" && typeof module.exports === "object") {
exports = factory(require('jquery'));
} else {
factory(jQuery);
}
})(function ($) {
// Preserve the original jQuery "swing" easing as "jswing" $.easing['jswing'] = $.easing['swing'];
var pow = Math.pow,
sqrt = Math.sqrt,
sin = Math.sin,
cos = Math.cos,
PI = Math.PI,
c1 = 1.70158,
c2 = c1 * 1.525,
c3 = c1 + 1,
c4 = (2 * PI) / 3,
c5 = (2 * PI) / 4.5;
// x is the fraction of animation progress, in the range 0..1
function bounceOut(x) {
var n1 = 7.5625,
d1 = 2.75;
if (x < 1 / d1) {
return n1 * x * x;
} else if (x < 2 / d1) {
return n1 * (x -= (1.5 / d1)) * x + .75;
} else if (x < 2.5 / d1) {
return n1 * (x -= (2.25 / d1)) * x + .9375;
} else {
return n1 * (x -= (2.625 / d1)) * x + .984375;
}
}
$.extend($.easing, {
def: 'easeOutQuad',
swing: function (x) {
return $.easing[$.easing.def](x);
},
easeInQuad: function (x) {
return x * x;
},
easeOutQuad: function (x) {
return 1 - (1 - x) * (1 - x);
},
easeInOutQuad: function (x) {
return x < 0.5 ?
2 * x * x :
1 - pow(-2 * x + 2, 2) / 2;
},
easeInCubic: function (x) {
return x * x * x;
},
easeOutCubic: function (x) {
return 1 - pow(1 - x, 3);
},
easeInOutCubic: function (x) {
return x < 0.5 ?
4 * x * x * x :
1 - pow(-2 * x + 2, 3) / 2;
},
easeInQuart: function (x) {
return x * x * x * x;
},
easeOutQuart: function (x) {
return 1 - pow(1 - x, 4);
},
easeInOutQuart: function (x) {
return x < 0.5 ?
8 * x * x * x * x :
1 - pow(-2 * x + 2, 4) / 2;
},
easeInQuint: function (x) {
return x * x * x * x * x;
},
easeOutQuint: function (x) {
return 1 - pow(1 - x, 5);
},
easeInOutQuint: function (x) {
return x < 0.5 ?
16 * x * x * x * x * x :
1 - pow(-2 * x + 2, 5) / 2;
},
easeInSine: function (x) {
return 1 - cos(x * PI / 2);
},
easeOutSine: function (x) {
return sin(x * PI / 2);
},
easeInOutSine: function (x) {
return -(cos(PI * x) - 1) / 2;
},
easeInExpo: function (x) {
return x === 0 ? 0 : pow(2, 10 * x - 10);
},
easeOutExpo: function (x) {
return x === 1 ? 1 : 1 - pow(2, -10 * x);
},
easeInOutExpo: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
pow(2, 20 * x - 10) / 2 :
(2 - pow(2, -20 * x + 10)) / 2;
},
easeInCirc: function (x) {
return 1 - sqrt(1 - pow(x, 2));
},
easeOutCirc: function (x) {
return sqrt(1 - pow(x - 1, 2));
},
easeInOutCirc: function (x) {
return x < 0.5 ?
(1 - sqrt(1 - pow(2 * x, 2))) / 2 :
(sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
},
easeInElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 :
-pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
},
easeOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 :
pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
},
easeInOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
-(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 :
pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
},
easeInBack: function (x) {
return c3 * x * x * x - c1 * x * x;
},
easeOutBack: function (x) {
return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
},
easeInOutBack: function (x) {
return x < 0.5 ?
(pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 :
(pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
},
easeInBounce: function (x) {
return 1 - bounceOut(1 - x);
},
easeOutBounce: bounceOut,
easeInOutBounce: function (x) {
return x < 0.5 ?
(1 - bounceOut(1 - 2 * x)) / 2 :
(1 + bounceOut(2 * x - 1)) / 2;
}
});
});; // Custom Easing jQuery.extend(jQuery.easing, {
easeInOutMaterial: function (x, t, b, c, d) {
if ((t /= d / 2) < 1) return c / 2 * t * t + b;
return c / 4 * ((t -= 2) * t * t + 2) + b;
}
});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (! function (e) {
function t(e) {
var t = e.length,
a = r.type(e);
return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e
}
if (!e.jQuery) {
var r = function (e, t) {
return new r.fn.init(e, t)
};
r.isWindow = function (e) {
return null != e && e == e.window
}, r.type = function (e) {
return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e
}, r.isArray = Array.isArray || function (e) {
return "array" === r.type(e)
}, r.isPlainObject = function (e) {
var t;
if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;
try {
if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1
} catch (a) {
return !1
}
for (t in e);
return void 0 === t || o.call(e, t)
}, r.each = function (e, r, a) {
var n, o = 0,
i = e.length,
s = t(e);
if (a) {
if (s)
for (; i > o && (n = r.apply(e[o], a), n !== !1); o++);
else
for (o in e)
if (n = r.apply(e[o], a), n === !1) break
} else if (s)
for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++);
else
for (o in e)
if (n = r.call(e[o], o, e[o]), n === !1) break; return e
}, r.data = function (e, t, n) {
if (void 0 === n) {
var o = e[r.expando],
i = o && a[o];
if (void 0 === t) return i;
if (i && t in i) return i[t]
} else if (void 0 !== t) {
var o = e[r.expando] || (e[r.expando] = ++r.uuid);
return a[o] = a[o] || {}, a[o][t] = n, n
}
}, r.removeData = function (e, t) {
var n = e[r.expando],
o = n && a[n];
o && r.each(t, function (e, t) {
delete o[t]
})
}, r.extend = function () {
var e, t, a, n, o, i, s = arguments[0] || {},
l = 1,
u = arguments.length,
c = !1;
for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++)
if (null != (o = arguments[l]))
for (n in o) e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
return s
}, r.queue = function (e, a, n) {
function o(e, r) {
var a = r || [];
return null != e && (t(Object(e)) ? ! function (e, t) {
for (var r = +t.length, a = 0, n = e.length; r > a;) e[n++] = t[a++];
if (r !== r)
for (; void 0 !== t[a];) e[n++] = t[a++];
return e.length = n, e
}(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a
}
if (e) {
a = (a || "fx") + "queue";
var i = r.data(e, a);
return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []
}
}, r.dequeue = function (e, t) {
r.each(e.nodeType ? [e] : e, function (e, a) {
t = t || "fx";
var n = r.queue(a, t),
o = n.shift();
"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
r.dequeue(a, t)
}))
})
}, r.fn = r.prototype = {
init: function (e) {
if (e.nodeType) return this[0] = e, this;
throw new Error("Not a DOM node.")
},
offset: function () {
var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : {
top: 0,
left: 0
};
return {
top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0),
left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0)
}
},
position: function () {
function e() {
for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) e = e.offsetParent;
return e || document
}
var t = this[0],
e = e.apply(t),
a = this.offset(),
n = /^(?:body|html)$/i.test(e.nodeName) ? {
top: 0,
left: 0
} : r(e).offset();
return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), {
top: a.top - n.top,
left: a.left - n.left
}
}
};
var a = {};
r.expando = "velocity" + (new Date).getTime(), r.uuid = 0;
for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) n["[object " + s[l] + "]"] = s[l].toLowerCase();
r.fn.init.prototype = r.fn, e.Velocity = {
Utilities: r
}
}
}(window), function (e) {
"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e()
}(function () {
return function (e, t, r, a) {
function n(e) {
for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
var n = e[t];
n && a.push(n)
}
return a
}
function o(e) {
return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e
}
function i(e) {
var t = f.data(e, "velocity");
return null === t ? a : t
}
function s(e) {
return function (t) {
return Math.round(t * e) * (1 / e)
}
}
function l(e, r, a, n) {
function o(e, t) {
return 1 - 3 * t + 3 * e
}
function i(e, t) {
return 3 * t - 6 * e
}
function s(e) {
return 3 * e
}
function l(e, t, r) {
return ((o(t, r) * e + i(t, r)) * e + s(t)) * e
}
function u(e, t, r) {
return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t)
}
function c(t, r) {
for (var n = 0; m > n; ++n) {
var o = u(r, e, a);
if (0 === o) return r;
var i = l(r, e, a) - t;
r -= i / o
}
return r
}
function p() {
for (var t = 0; b > t; ++t) w[t] = l(t * x, e, a)
}
function f(t, r, n) {
var o, i, s = 0;
do i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; while (Math.abs(o) > h && ++s < v);
return i
}
function d(t) {
for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) r += x;
--n;
var i = (t - w[n]) / (w[n + 1] - w[n]),
s = r + i * x,
l = u(s, e, a);
return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x)
}
function g() {
V = !0, (e != r || a != n) && p()
}
var m = 4,
y = .001,
h = 1e-7,
v = 10,
b = 11,
x = 1 / (b - 1),
S = "Float32Array" in t;
if (4 !== arguments.length) return !1;
for (var P = 0; 4 > P; ++P)
if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);
var w = S ? new Float32Array(b) : new Array(b),
V = !1,
C = function (t) {
return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n)
};
C.getControlPoints = function () {
return [{
x: e,
y: r
}, {
x: a,
y: n
}]
};
var T = "generateBezier(" + [e, r, a, n] + ")";
return C.toString = function () {
return T
}, C
}
function u(e, t) {
var r = e;
return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r
}
function c(e) {
if (e) {
var t = (new Date).getTime(),
r = b.State.calls.length;
r > 1e4 && (b.State.calls = n(b.State.calls));
for (var o = 0; r > o; o++)
if (b.State.calls[o]) {
var s = b.State.calls[o],
l = s[0],
u = s[2],
d = s[3],
g = !!d,
y = null;
d || (d = b.State.calls[o][3] = t - 16);
for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
var P = l[v],
V = P.element;
if (i(V)) {
var C = !1;
if (u.display !== a && null !== u.display && "none" !== u.display) {
if ("flex" === u.display) {
var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];
f.each(T, function (e, t) {
S.setPropertyValue(V, "display", t)
})
}
S.setPropertyValue(V, "display", u.display)
}
u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);
for (var k in P)
if ("element" !== k) {
var A, F = P[k],
j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;
if (1 === h) A = F.endValue;
else {
var E = F.endValue - F.startValue;
if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue
}
if (F.currentValue = A, "tween" === k) y = A;
else {
if (S.Hooks.registered[k]) {
var H = S.Hooks.getRoot(k),
N = i(V).rootPropertyValueCache[H];
N && (F.rootPropertyValue = N)
}
var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);
S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0)
}
}
u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V)
}
}
u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o)
}
}
b.State.isTicking && w(c)
}
function p(e, t) {
if (!b.State.calls[e]) return !1;
for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
var p = r[u].element;
if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};
var d = !1;
f.each(S.Lists.transforms3D, function (e, t) {
var r = /^scale/.test(t) ? 1 : 0,
n = i(p).transformCache[t];
i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t])
}), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating")
}
if (!t && o.complete && !o.loop && u === c - 1) try {
o.complete.call(n, n)
} catch (g) {
setTimeout(function () {
throw g
}, 1)
}
s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
/^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100)
}), b(p, "reverse", {
loop: !0,
delay: o.delay
})), o.queue !== !1 && f.dequeue(p, o.queue)
}
b.State.calls[e] = !1;
for (var m = 0, y = b.State.calls.length; y > m; m++)
if (b.State.calls[m] !== !1) {
l = !0;
break
}
l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = [])
}
var f, d = function () {
if (r.documentMode) return r.documentMode;
for (var e = 7; e > 4; e--) {
var t = r.createElement("div");
if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e
}
return a
}(),
g = function () {
var e = 0;
return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
var r, a = (new Date).getTime();
return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
t(a + r)
}, r)
}
}(),
m = {
isString: function (e) {
return "string" == typeof e
},
isArray: Array.isArray || function (e) {
return "[object Array]" === Object.prototype.toString.call(e)
},
isFunction: function (e) {
return "[object Function]" === Object.prototype.toString.call(e)
},
isNode: function (e) {
return e && e.nodeType
},
isNodeList: function (e) {
return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0)
},
isWrapped: function (e) {
return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e))
},
isSVG: function (e) {
return t.SVGElement && e instanceof t.SVGElement
},
isEmptyObject: function (e) {
for (var t in e) return !1;
return !0
}
},
y = !1;
if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");
if (7 >= d) return void(jQuery.fn.velocity = jQuery.fn.animate);
var h = 400,
v = "swing",
b = {
State: {
isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
isAndroid: /Android/i.test(navigator.userAgent),
isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent),
isChrome: t.chrome,
isFirefox: /Firefox/i.test(navigator.userAgent),
prefixElement: r.createElement("div"),
prefixMatches: {},
scrollAnchor: null,
scrollPropertyLeft: null,
scrollPropertyTop: null,
isTicking: !1,
calls: []
},
CSS: {},
Utilities: f,
Redirects: {},
Easings: {},
Promise: t.Promise,
defaults: {
queue: "",
duration: h,
easing: v,
begin: a,
complete: a,
progress: a,
display: a,
visibility: a,
loop: !1,
delay: !1,
mobileHA: !0,
_cacheValues: !0
},
init: function (e) {
f.data(e, "velocity", {
isSVG: m.isSVG(e),
isAnimating: !1,
computedStyle: null,
tweensContainer: null,
rootPropertyValueCache: {},
transformCache: {}
})
},
hook: null,
mock: !1,
version: {
major: 1,
minor: 2,
patch: 2
},
debug: !1
};
t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");
var x = function () {
function e(e) {
return -e.tension * e.x - e.friction * e.v
}
function t(t, r, a) {
var n = {
x: t.x + a.dx * r,
v: t.v + a.dv * r,
tension: t.tension,
friction: t.friction
};
return {
dx: n.v,
dv: e(n)
}
}
function r(r, a) {
var n = {
dx: r.v,
dv: e(r)
},
o = t(r, .5 * a, n),
i = t(r, .5 * a, o),
s = t(r, a, i),
l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);
return r.x = r.x + l * a, r.v = r.v + u * a, r
}
return function a(e, t, n) {
var o, i, s, l = {
x: -1,
v: 0,
tension: null,
friction: null
},
u = [0],
c = 0,
p = 1e-4,
f = .016;
for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;);
return o ? function (e) {
return u[e * (u.length - 1) | 0]
} : c
}
}();
b.Easings = {
linear: function (e) {
return e
},
swing: function (e) {
return .5 - Math.cos(e * Math.PI) / 2
},
spring: function (e) {
return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e)
}
}, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
b.Easings[t[0]] = l.apply(null, t[1])
});
var S = b.CSS = {
RegEx: {
isHex: /^#([A-f\d]{3}){1,2}$/i,
valueUnwrap: /^[A-z]+\((.*)\)$/i,
wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,
valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi
},
Lists: {
colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"],
transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"],
transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"]
},
Hooks: {
templates: {
textShadow: ["Color X Y Blur", "black 0px 0px 0px"],
boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"],
clip: ["Top Right Bottom Left", "0px 0px 0px 0px"],
backgroundPosition: ["X Y", "0% 0%"],
transformOrigin: ["X Y Z", "50% 50% 0px"],
perspectiveOrigin: ["X Y", "50% 50%"]
},
registered: {},
register: function () {
for (var e = 0; e < S.Lists.colors.length; e++) {
var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";
S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]
}
var r, a, n;
if (d)
for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");
var o = a[1].match(S.RegEx.valueSplit);
"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")])
}
for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");
for (var e in n) {
var i = r + n[e],
s = e;
S.Hooks.registered[i] = [r, s]
}
}
},
getRoot: function (e) {
var t = S.Hooks.registered[e];
return t ? t[0] : e
},
cleanRootPropertyValue: function (e, t) {
return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t
},
extractValue: function (e, t) {
var r = S.Hooks.registered[e];
if (r) {
var a = r[0],
n = r[1];
return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]
}
return t
},
injectValue: function (e, t, r) {
var a = S.Hooks.registered[e];
if (a) {
var n, o, i = a[0],
s = a[1];
return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ")
}
return r
}
},
Normalizations: {
registered: {
clip: function (e, t, r) {
switch (e) {
case "name":
return "clip";
case "extract":
var a;
return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;
case "inject":
return "rect(" + r + ")"
}
},
blur: function (e, t, r) {
switch (e) {
case "name":
return b.State.isFirefox ? "filter" : "-webkit-filter";
case "extract":
var a = parseFloat(r);
if (!a && 0 !== a) {
var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);
a = n ? n[1] : 0
}
return a;
case "inject":
return parseFloat(r) ? "blur(" + r + ")" : "none"
}
},
opacity: function (e, t, r) {
if (8 >= d) switch (e) {
case "name":
return "filter";
case "extract":
var a = r.toString().match(/alpha\(opacity=(.*)\)/i);
return r = a ? a[1] / 100 : 1;
case "inject":
return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")"
} else switch (e) {
case "name":
return "opacity";
case "extract":
return r;
case "inject":
return r
}
}
},
register: function () {
9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));
for (var e = 0; e < S.Lists.transformsBase.length; e++) ! function () {
var t = S.Lists.transformsBase[e];
S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {
case "name":
return "transform";
case "extract":
return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");
case "inject":
var o = !1;
switch (t.substr(0, t.length - 1)) {
case "translate":
o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);
break;
case "scal":
case "scale":
b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);
break;
case "skew":
o = !/(deg|\d)$/i.test(n);
break;
case "rotate":
o = !/(deg|\d)$/i.test(n)
}
return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t]
}
}
}();
for (var e = 0; e < S.Lists.colors.length; e++) ! function () {
var t = S.Lists.colors[e];
S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {
case "name":
return t;
case "extract":
var o;
if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;
else {
var i, s = {
black: "rgb(0, 0, 0)",
blue: "rgb(0, 0, 255)",
gray: "rgb(128, 128, 128)",
green: "rgb(0, 128, 0)",
red: "rgb(255, 0, 0)",
white: "rgb(255, 255, 255)"
};
/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ")
}
return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;
case "inject":
return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")"
}
}
}()
}
},
Names: {
camelCase: function (e) {
return e.replace(/-(\w)/g, function (e, t) {
return t.toUpperCase()
})
},
SVGAttribute: function (e) {
var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";
return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e)
},
prefixCheck: function (e) {
if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];
for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
var n;
if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
return e.toUpperCase()
}), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]
}
return [e, !1]
}
},
Values: {
hexToRgb: function (e) {
var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;
return e = e.replace(r, function (e, t, r, a) {
return t + t + r + r + a + a
}), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]
},
isCSSNullValue: function (e) {
return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)
},
getUnitType: function (e) {
return /^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
},
getDisplayType: function (e) {
var t = e && e.tagName.toString().toLowerCase();
return /^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
},
addClass: function (e, t) {
e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t
},
removeClass: function (e, t) {
e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ")
}
},
getPropertyValue: function (e, r, n, o) {
function s(e, r) {
function n() {
u && S.setPropertyValue(e, "display", "none")
}
var l = 0;
if (8 >= d) l = f.css(e, r);
else {
var u = !1;
if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);
return n(), c
}
if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);
return n(), p
}
}
var g;
g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n()
}
if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
var m = s(e, "position");
("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px")
}
return l
}
var l;
if (S.Hooks.registered[r]) {
var u = r,
c = S.Hooks.getRoot(u);
n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n)
} else if (S.Normalizations.registered[r]) {
var p, g;
p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g)
}
if (!/^[\d-]/.test(l))
if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r))
if (/^(height|width)$/i.test(r)) try {
l = e.getBBox()[r]
} catch (m) {
l = 0
} else l = e.getAttribute(r);
else l = s(e, S.Names.prefixCheck(r)[0]);
return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l
},
setPropertyValue: function (e, r, a, n, o) {
var s = r;
if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);
else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];
else {
if (S.Hooks.registered[r]) {
var l = r,
u = S.Hooks.getRoot(r);
n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u
}
if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
e.style[s] = a
} catch (c) {
b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]")
} else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;
b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a)
}
return [s, a]
},
flushTransformCache: function (e) {
function t(t) {
return parseFloat(S.getPropertyValue(e, t))
}
var r = "";
if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
var a = {
translate: [t("translateX"), t("translateY")],
skewX: [t("skewX")],
skewY: [t("skewY")],
scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")],
rotate: [t("rotateZ"), 0, 0]
};
f.each(i(e).transformCache, function (e) {
/^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e])
})
} else {
var n, o;
f.each(i(e).transformCache, function (t) {
return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void(r += t + n + " "))
}), o && (r = "perspective" + o + " " + r)
}
S.setPropertyValue(e, "transform", r)
}
};
S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
var n = a;
return e = o(e), f.each(e, function (e, o) {
if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));
else {
var s = b.CSS.setPropertyValue(o, t, r);
"transform" === s[0] && b.CSS.flushTransformCache(o), n = s
}
}), n
};
var P = function () {
function e() {
return s ? k.promise || null : l
}
function n() {
function e(e) {
function p(e, t) {
var r = a,
n = a,
i = a;
return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]
}
function d(e, t) {
var r, a;
return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
return r = e, ""
}), r || (r = S.Values.getUnitType(e)), [a, r]
}
function h() {
var e = {
myParent: o.parentNode || r.body,
position: S.getPropertyValue(o, "position"),
fontSize: S.getPropertyValue(o, "fontSize")
},
a = e.position === L.lastPosition && e.myParent === L.lastParent,
n = e.fontSize === L.lastFontSize;
L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;
var s = 100,
l = {};
if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;
else {
var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");
b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
b.CSS.setPropertyValue(u, t, "hidden")
}), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
b.CSS.setPropertyValue(u, t, s + "%")
}), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u)
}
return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l
}
if (s.begin && 0 === V) try {
s.begin.call(g, g)
} catch (x) {
setTimeout(function () {
throw x
}, 1)
}
if ("scroll" === A) {
var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top",
j = parseFloat(s.offset) || 0;
s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = {
scroll: {
rootPropertyValue: !1,
startValue: P,
currentValue: P,
endValue: T,
unitType: "",
easing: s.easing,
scrollData: {
container: s.container,
direction: F,
alternateValue: C
}
},
element: o
}, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o)
} else if ("reverse" === A) {
if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);
"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);
var E = f.extend(!0, {}, i(o).tweensContainer);
for (var H in E)
if ("element" !== H) {
var N = E[H].startValue;
E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o)
}
l = E
} else if ("start" === A) {
var E;
i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
var r = p(t, !0),
n = r[0],
o = r[1],
i = r[2];
if (S.RegEx.isHex.test(n)) {
for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
var f = [l[c]];
o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f
}
delete y[e]
}
}
});
for (var z in y) {
var O = p(y[z]),
q = O[0],
$ = O[1],
M = O[2];
z = S.Names.camelCase(z);
var I = S.Hooks.getRoot(z),
B = !1;
if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
(s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));
var W, G, Y, D = !1;
if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
return D = t, ""
}), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;
else if (Y !== G && 0 !== M)
if (0 === q) G = Y;
else {
n = n || h();
var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";
switch (Y) {
case "%":
M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;
break;
case "px":
break;
default:
M *= n[Y + "ToPx"]
}
switch (G) {
case "%":
M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);
break;
case "px":
break;
default:
M *= 1 / n[G + "ToPx"]
}
}
switch (D) {
case "+":
q = M + q;
break;
case "-":
q = M - q;
break;
case "*":
q = M * q;
break;
case "/":
q = M / q
}
l[z] = {
rootPropertyValue: B,
startValue: M,
currentValue: M,
endValue: q,
unitType: G,
easing: $
}, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o)
} else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.")
}
l.element = o
}
l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++)
}
var n, o = this,
s = f.extend({}, b.defaults, v),
l = {};
switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
b.velocityQueueEntryFlag = !0, i(o).delayTimer = {
setTimeout: setTimeout(e, parseFloat(s.delay)),
next: e
}
}), s.duration.toString().toLowerCase()) {
case "fast":
s.duration = 200;
break;
case "normal":
s.duration = h;
break;
case "slow":
s.duration = 600;
break;
default:
s.duration = parseFloat(s.duration) || 1
}
b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t))
}), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o)
}
var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));
if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);
var w = g.length,
V = 0;
if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
var C = d + 1;
v = {};
for (var T = C; T < arguments.length; T++) m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]
}
var k = {
promise: null,
resolver: null,
rejecter: null
};
s && b.Promise && (k.promise = new b.Promise(function (e, t) {
k.resolver = e, k.rejecter = t
}));
var A;
switch (y) {
case "scroll":
A = "scroll";
break;
case "reverse":
A = "reverse";
break;
case "finish":
case "stop":
f.each(g, function (e, t) {
i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer)
});
var F = [];
return f.each(b.State.calls, function (e, t) {
t && f.each(t[1], function (r, n) {
var o = v === a ? "" : v;
return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
m.isFunction(t) && t(null, !0)
}), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
t.endValue = t.currentValue
}), F.push(e)) : "finish" === y && (t[2].duration = 1))
}) : !0
})
}), "stop" === y && (f.each(F, function (e, t) {
p(t, !0)
}), k.promise && k.resolver(g)), e();
default:
if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
if (m.isString(y) && b.Redirects[y]) {
var j = f.extend({}, v),
E = j.duration,
H = j.delay || 0;
return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a)
}), e()
}
var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";
return k.promise ? k.rejecter(new Error(N)) : console.log(N), e()
}
A = "start"
}
var L = {
lastParent: null,
lastPosition: null,
lastFontSize: null,
lastPercentToPxWidth: null,
lastPercentToPxHeight: null,
lastEmToPx: null,
remToPx: null,
vwToPx: null,
vhToPx: null
},
R = [];
f.each(g, function (e, t) {
m.isNode(t) && n.call(t)
});
var z, j = f.extend({}, b.defaults, v);
if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop)
for (var O = 0; z > O; O++) {
var q = {
delay: j.delay,
progress: j.progress
};
O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q)
}
return e()
}
};
b = f.extend(P, b), b.animate = P;
var w = t.requestAnimationFrame || g;
return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
r.hidden ? (w = function (e) {
return setTimeout(function () {
e(!0)
}, 16)
}, c()) : w = t.requestAnimationFrame || g
}), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = l.begin,
c = l.complete,
p = {
height: "",
marginTop: "",
marginBottom: "",
paddingTop: "",
paddingBottom: ""
},
d = {};
l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
u && u.call(i, i);
for (var r in p) {
d[r] = e.style[r];
var a = b.CSS.getPropertyValue(e, r);
p[r] = "Down" === t ? [a, 0] : [0, a]
}
d.overflow = e.style.overflow, e.style.overflow = "hidden"
}, l.complete = function () {
for (var t in d) e.style[t] = d[t];
c && c.call(i, i), s && s.resolver(i)
}, b(e, p, l)
}
}), f.each(["In", "Out"], function (e, t) {
b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = {
opacity: "In" === t ? 1 : 0
},
c = l.complete;
l.complete = n !== o - 1 ? l.begin = null : function () {
c && c.call(i, i), s && s.resolver(i)
}, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l)
}
}), b
}(window.jQuery || window.Zepto || window, window, document)
}));; ! function (a, b, c, d) {
"use strict";
function k(a, b, c) {
return setTimeout(q(a, c), b)
}
function l(a, b, c) {
return Array.isArray(a) ? (m(a, c[b], c), !0) : !1
}
function m(a, b, c) {
var e;
if (a)
if (a.forEach) a.forEach(b, c);
else if (a.length !== d)
for (e = 0; e < a.length;) b.call(c, a[e], e, a), e++;
else
for (e in a) a.hasOwnProperty(e) && b.call(c, a[e], e, a)
}
function n(a, b, c) {
for (var e = Object.keys(b), f = 0; f < e.length;)(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
return a
}
function o(a, b) {
return n(a, b, !0)
}
function p(a, b, c) {
var e, d = b.prototype;
e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c)
}
function q(a, b) {
return function () {
return a.apply(b, arguments)
}
}
function r(a, b) {
return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a
}
function s(a, b) {
return a === d ? b : a
}
function t(a, b, c) {
m(x(b), function (b) {
a.addEventListener(b, c, !1)
})
}
function u(a, b, c) {
m(x(b), function (b) {
a.removeEventListener(b, c, !1)
})
}
function v(a, b) {
for (; a;) {
if (a == b) return !0;
a = a.parentNode
}
return !1
}
function w(a, b) {
return a.indexOf(b) > -1
}
function x(a) {
return a.trim().split(/\s+/g)
}
function y(a, b, c) {
if (a.indexOf && !c) return a.indexOf(b);
for (var d = 0; d < a.length;) {
if (c && a[d][c] == b || !c && a[d] === b) return d;
d++
}
return -1
}
function z(a) {
return Array.prototype.slice.call(a, 0)
}
function A(a, b, c) {
for (var d = [], e = [], f = 0; f < a.length;) {
var g = b ? a[f][b] : a[f];
y(e, g) < 0 && d.push(a[f]), e[f] = g, f++
}
return c && (d = b ? d.sort(function (a, c) {
return a[b] > c[b]
}) : d.sort()), d
}
function B(a, b) {
for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
if (c = e[h], f = c ? c + g : b, f in a) return f;
h++
}
return d
}
function D() {
return C++
}
function E(a) {
var b = a.ownerDocument;
return b.defaultView || b.parentWindow
}
function ab(a, b) {
var c = this;
this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
r(a.options.enable, [a]) && c.handler(b)
}, this.init()
}
function bb(a) {
var b, c = a.options.inputClass;
return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb)
}
function cb(a, b, c) {
var d = c.pointers.length,
e = c.changedPointers.length,
f = b & O && 0 === d - e,
g = b & (Q | R) && 0 === d - e;
c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c
}
function db(a, b) {
var c = a.session,
d = b.pointers,
e = d.length;
c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);
var f = c.firstInput,
g = c.firstMultiple,
h = g ? g.center : f.center,
i = b.center = hb(d);
b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);
var k = a.element;
v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k
}
function eb(a, b) {
var c = b.center,
d = a.offsetDelta || {},
e = a.prevDelta || {},
f = a.prevInput || {};
(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = {
x: f.deltaX || 0,
y: f.deltaY || 0
}, d = a.offsetDelta = {
x: c.x,
y: c.y
}), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y)
}
function fb(a, b) {
var f, g, h, j, c = a.lastInterval || b,
e = b.timeStamp - c.timeStamp;
if (b.eventType != R && (e > N || c.velocity === d)) {
var k = c.deltaX - b.deltaX,
l = c.deltaY - b.deltaY,
m = ib(e, k, l);
g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b
} else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;
b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j
}
function gb(a) {
for (var b = [], c = 0; c < a.pointers.length;) b[c] = {
clientX: h(a.pointers[c].clientX),
clientY: h(a.pointers[c].clientY)
}, c++;
return {
timeStamp: j(),
pointers: b,
center: hb(b),
deltaX: a.deltaX,
deltaY: a.deltaY
}
}
function hb(a) {
var b = a.length;
if (1 === b) return {
x: h(a[0].clientX),
y: h(a[0].clientY)
};
for (var c = 0, d = 0, e = 0; b > e;) c += a[e].clientX, d += a[e].clientY, e++;
return {
x: h(c / b),
y: h(d / b)
}
}
function ib(a, b, c) {
return {
x: b / a || 0,
y: c / a || 0
}
}
function jb(a, b) {
return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W
}
function kb(a, b, c) {
c || (c = $);
var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];
return Math.sqrt(d * d + e * e)
}
function lb(a, b, c) {
c || (c = $);
var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];
return 180 * Math.atan2(e, d) / Math.PI
}
function mb(a, b) {
return lb(b[1], b[0], _) - lb(a[1], a[0], _)
}
function nb(a, b) {
return kb(b[0], b[1], _) / kb(a[0], a[1], _)
}
function rb() {
this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments)
}
function wb() {
this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []
}
function Ab() {
this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments)
}
function Bb(a, b) {
var c = z(a.touches),
d = z(a.changedTouches);
return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]
}
function Eb() {
this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments)
}
function Fb(a, b) {
var c = z(a.touches),
d = this.targetIds;
if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];
var e, f, g = z(a.changedTouches),
h = [],
i = this.target;
if (f = c.filter(function (a) {
return v(a.target, i)
}), b === O)
for (e = 0; e < f.length;) d[f[e].identifier] = !0, e++;
for (e = 0; e < g.length;) d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0
}
function Gb() {
ab.apply(this, arguments);
var a = q(this.handler, this);
this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a)
}
function Pb(a, b) {
this.manager = a, this.set(b)
}
function Qb(a) {
if (w(a, Mb)) return Mb;
var b = w(a, Nb),
c = w(a, Ob);
return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb
}
function Yb(a) {
this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []
}
function Zb(a) {
return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""
}
function $b(a) {
return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""
}
function _b(a, b) {
var c = b.manager;
return c ? c.get(a) : a
}
function ac() {
Yb.apply(this, arguments)
}
function bc() {
ac.apply(this, arguments), this.pX = null, this.pY = null
}
function cc() {
ac.apply(this, arguments)
}
function dc() {
Yb.apply(this, arguments), this._timer = null, this._input = null
}
function ec() {
ac.apply(this, arguments)
}
function fc() {
ac.apply(this, arguments)
}
function gc() {
Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0
}
function hc(a, b) {
return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b)
}
function kc(a, b) {
b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
var b = this.add(new a[0](a[1]));
a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3])
}, this)
}
function lc(a, b) {
var c = a.element;
m(a.options.cssProps, function (a, d) {
c.style[B(c.style, d)] = b ? a : ""
})
}
function mc(a, c) {
var d = b.createEvent("Event");
d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d)
}
var e = ["", "webkit", "moz", "MS", "ms", "o"],
f = b.createElement("div"),
g = "function",
h = Math.round,
i = Math.abs,
j = Date.now,
C = 1,
F = /mobile|tablet|ip(ad|hone|od)|android/i,
G = "ontouchstart" in a,
H = B(a, "PointerEvent") !== d,
I = G && F.test(navigator.userAgent),
J = "touch",
K = "pen",
L = "mouse",
M = "kinect",
N = 25,
O = 1,
P = 2,
Q = 4,
R = 8,
S = 1,
T = 2,
U = 4,
V = 8,
W = 16,
X = T | U,
Y = V | W,
Z = X | Y,
$ = ["x", "y"],
_ = ["clientX", "clientY"];
ab.prototype = {
handler: function () {},
init: function () {
this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler)
},
destroy: function () {
this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler)
}
};
var ob = {
mousedown: O,
mousemove: P,
mouseup: Q
},
pb = "mousedown",
qb = "mousemove mouseup";
p(rb, ab, {
handler: function (a) {
var b = ob[a.type];
b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, {
pointers: [a],
changedPointers: [a],
pointerType: L,
srcEvent: a
}))
}
});
var sb = {
pointerdown: O,
pointermove: P,
pointerup: Q,
pointercancel: R,
pointerout: R
},
tb = {
2: J,
3: K,
4: L,
5: M
},
ub = "pointerdown",
vb = "pointermove pointerup pointercancel";
a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, {
handler: function (a) {
var b = this.store,
c = !1,
d = a.type.toLowerCase().replace("ms", ""),
e = sb[d],
f = tb[a.pointerType] || a.pointerType,
g = f == J,
h = y(b, a.pointerId, "pointerId");
e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, {
pointers: b,
changedPointers: [a],
pointerType: f,
srcEvent: a
}), c && b.splice(h, 1))
}
});
var xb = {
touchstart: O,
touchmove: P,
touchend: Q,
touchcancel: R
},
yb = "touchstart",
zb = "touchstart touchmove touchend touchcancel";
p(Ab, ab, {
handler: function (a) {
var b = xb[a.type];
if (b === O && (this.started = !0), this.started) {
var c = Bb.call(this, a, b);
b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, {
pointers: c[0],
changedPointers: c[1],
pointerType: J,
srcEvent: a
})
}
}
});
var Cb = {
touchstart: O,
touchmove: P,
touchend: Q,
touchcancel: R
},
Db = "touchstart touchmove touchend touchcancel";
p(Eb, ab, {
handler: function (a) {
var b = Cb[a.type],
c = Fb.call(this, a, b);
c && this.callback(this.manager, b, {
pointers: c[0],
changedPointers: c[1],
pointerType: J,
srcEvent: a
})
}
}), p(Gb, ab, {
handler: function (a, b, c) {
var d = c.pointerType == J,
e = c.pointerType == L;
if (d) this.mouse.allow = !1;
else if (e && !this.mouse.allow) return;
b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c)
},
destroy: function () {
this.touch.destroy(), this.mouse.destroy()
}
});
var Hb = B(f.style, "touchAction"),
Ib = Hb !== d,
Jb = "compute",
Kb = "auto",
Lb = "manipulation",
Mb = "none",
Nb = "pan-x",
Ob = "pan-y";
Pb.prototype = {
set: function (a) {
a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim()
},
update: function () {
this.set(this.manager.options.touchAction)
},
compute: function () {
var a = [];
return m(this.manager.recognizers, function (b) {
r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()))
}), Qb(a.join(" "))
},
preventDefaults: function (a) {
if (!Ib) {
var b = a.srcEvent,
c = a.offsetDirection;
if (this.manager.session.prevented) return b.preventDefault(), void 0;
var d = this.actions,
e = w(d, Mb),
f = w(d, Ob),
g = w(d, Nb);
return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0
}
},
preventSrc: function (a) {
this.manager.session.prevented = !0, a.preventDefault()
}
};
var Rb = 1,
Sb = 2,
Tb = 4,
Ub = 8,
Vb = Ub,
Wb = 16,
Xb = 32;
Yb.prototype = {
defaults: {},
set: function (a) {
return n(this.options, a), this.manager && this.manager.touchAction.update(), this
},
recognizeWith: function (a) {
if (l(a, "recognizeWith", this)) return this;
var b = this.simultaneous;
return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this
},
dropRecognizeWith: function (a) {
return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this)
},
requireFailure: function (a) {
if (l(a, "requireFailure", this)) return this;
var b = this.requireFail;
return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this
},
dropRequireFailure: function (a) {
if (l(a, "dropRequireFailure", this)) return this;
a = _b(a, this);
var b = y(this.requireFail, a);
return b > -1 && this.requireFail.splice(b, 1), this
},
hasRequireFailures: function () {
return this.requireFail.length > 0
},
canRecognizeWith: function (a) {
return !!this.simultaneous[a.id]
},
emit: function (a) {
function d(d) {
b.manager.emit(b.options.event + (d ? Zb(c) : ""), a)
}
var b = this,
c = this.state;
Ub > c && d(!0), d(), c >= Ub && d(!0)
},
tryEmit: function (a) {
return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0)
},
canEmit: function () {
for (var a = 0; a < this.requireFail.length;) {
if (!(this.requireFail[a].state & (Xb | Rb))) return !1;
a++
}
return !0
},
recognize: function (a) {
var b = n({}, a);
return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0)
},
process: function () {},
getTouchAction: function () {},
reset: function () {}
}, p(ac, Yb, {
defaults: {
pointers: 1
},
attrTest: function (a) {
var b = this.options.pointers;
return 0 === b || a.pointers.length === b
},
process: function (a) {
var b = this.state,
c = a.eventType,
d = b & (Sb | Tb),
e = this.attrTest(a);
return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb
}
}), p(bc, ac, {
defaults: {
event: "pan",
threshold: 10,
pointers: 1,
direction: Z
},
getTouchAction: function () {
var a = this.options.direction,
b = [];
return a & X && b.push(Ob), a & Y && b.push(Nb), b
},
directionTest: function (a) {
var b = this.options,
c = !0,
d = a.distance,
e = a.direction,
f = a.deltaX,
g = a.deltaY;
return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction
},
attrTest: function (a) {
return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a))
},
emit: function (a) {
this.pX = a.deltaX, this.pY = a.deltaY;
var b = $b(a.direction);
b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a)
}
}), p(cc, ac, {
defaults: {
event: "pinch",
threshold: 0,
pointers: 2
},
getTouchAction: function () {
return [Mb]
},
attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb)
},
emit: function (a) {
if (this._super.emit.call(this, a), 1 !== a.scale) {
var b = a.scale < 1 ? "in" : "out";
this.manager.emit(this.options.event + b, a)
}
}
}), p(dc, Yb, {
defaults: {
event: "press",
pointers: 1,
time: 500,
threshold: 5
},
getTouchAction: function () {
return [Kb]
},
process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime > b.time;
if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();
else if (a.eventType & O) this.reset(), this._timer = k(function () {
this.state = Vb, this.tryEmit()
}, b.time, this);
else if (a.eventType & Q) return Vb;
return Xb
},
reset: function () {
clearTimeout(this._timer)
},
emit: function (a) {
this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)))
}
}), p(ec, ac, {
defaults: {
event: "rotate",
threshold: 0,
pointers: 2
},
getTouchAction: function () {
return [Mb]
},
attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb)
}
}), p(fc, ac, {
defaults: {
event: "swipe",
threshold: 10,
velocity: .65,
direction: X | Y,
pointers: 1
},
getTouchAction: function () {
return bc.prototype.getTouchAction.call(this)
},
attrTest: function (a) {
var c, b = this.options.direction;
return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q
},
emit: function (a) {
var b = $b(a.direction);
b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a)
}
}), p(gc, Yb, {
defaults: {
event: "tap",
pointers: 1,
taps: 1,
interval: 300,
time: 250,
threshold: 2,
posThreshold: 10
},
getTouchAction: function () {
return [Lb]
},
process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime < b.time;
if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();
if (d && e && c) {
if (a.eventType != Q) return this.failTimeout();
var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;
this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;
var h = this.count % b.taps;
if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
this.state = Vb, this.tryEmit()
}, b.interval, this), Sb) : Vb
}
return Xb
},
failTimeout: function () {
return this._timer = k(function () {
this.state = Xb
}, this.options.interval, this), Xb
},
reset: function () {
clearTimeout(this._timer)
},
emit: function () {
this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input))
}
}), hc.VERSION = "2.0.4", hc.defaults = {
domEvents: !1,
touchAction: Jb,
enable: !0,
inputTarget: null,
inputClass: null,
preset: [[ec, {
enable: !1
}], [cc, {
enable: !1
}, ["rotate"]], [fc, {
direction: X
}], [bc, {
direction: X
}, ["swipe"]], [gc], [gc, {
event: "doubletap",
taps: 2
}, ["tap"]], [dc]],
cssProps: {
userSelect: "default",
touchSelect: "none",
touchCallout: "none",
contentZooming: "none",
userDrag: "none",
tapHighlightColor: "rgba(0,0,0,0)"
}
};
var ic = 1,
jc = 2;
kc.prototype = {
set: function (a) {
return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this
},
stop: function (a) {
this.session.stopped = a ? jc : ic
},
recognize: function (a) {
var b = this.session;
if (!b.stopped) {
this.touchAction.preventDefaults(a);
var c, d = this.recognizers,
e = b.curRecognizer;
(!e || e && e.state & Vb) && (e = b.curRecognizer = null);
for (var f = 0; f < d.length;) c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++
}
},
get: function (a) {
if (a instanceof Yb) return a;
for (var b = this.recognizers, c = 0; c < b.length; c++)
if (b[c].options.event == a) return b[c];
return null
},
add: function (a) {
if (l(a, "add", this)) return this;
var b = this.get(a.options.event);
return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a
},
remove: function (a) {
if (l(a, "remove", this)) return this;
var b = this.recognizers;
return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this
},
on: function (a, b) {
var c = this.handlers;
return m(x(a), function (a) {
c[a] = c[a] || [], c[a].push(b)
}), this
},
off: function (a, b) {
var c = this.handlers;
return m(x(a), function (a) {
b ? c[a].splice(y(c[a], b), 1) : delete c[a]
}), this
},
emit: function (a, b) {
this.options.domEvents && mc(a, b);
var c = this.handlers[a] && this.handlers[a].slice();
if (c && c.length) {
b.type = a, b.preventDefault = function () {
b.srcEvent.preventDefault()
};
for (var d = 0; d < c.length;) c[d](b), d++
}
},
destroy: function () {
this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null
}
}, n(hc, {
INPUT_START: O,
INPUT_MOVE: P,
INPUT_END: Q,
INPUT_CANCEL: R,
STATE_POSSIBLE: Rb,
STATE_BEGAN: Sb,
STATE_CHANGED: Tb,
STATE_ENDED: Ub,
STATE_RECOGNIZED: Vb,
STATE_CANCELLED: Wb,
STATE_FAILED: Xb,
DIRECTION_NONE: S,
DIRECTION_LEFT: T,
DIRECTION_RIGHT: U,
DIRECTION_UP: V,
DIRECTION_DOWN: W,
DIRECTION_HORIZONTAL: X,
DIRECTION_VERTICAL: Y,
DIRECTION_ALL: Z,
Manager: kc,
Input: ab,
TouchAction: Pb,
TouchInput: Eb,
MouseInput: rb,
PointerEventInput: wb,
TouchMouseInput: Gb,
SingleTouchInput: Ab,
Recognizer: Yb,
AttrRecognizer: ac,
Tap: gc,
Pan: bc,
Swipe: fc,
Pinch: cc,
Rotate: ec,
Press: dc,
on: t,
off: u,
each: m,
merge: o,
extend: n,
inherit: p,
bindFn: q,
prefixed: B
}), typeof define == g && define.amd ? define(function () {
return hc
}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc
}(window, document, "Hammer");; (function (factory) {
if (typeof define === 'function' && define.amd) {
define(['jquery', 'hammerjs'], factory);
} else if (typeof exports === 'object') {
factory(require('jquery'), require('hammerjs'));
} else {
factory(jQuery, Hammer);
}
}(function ($, Hammer) {
function hammerify(el, options) {
var $el = $(el);
if (!$el.data("hammer")) {
$el.data("hammer", new Hammer($el[0], options));
}
}
$.fn.hammer = function (options) {
return this.each(function () {
hammerify(this, options);
});
};
// extend the emit method to also trigger jQuery events
Hammer.Manager.prototype.emit = (function (originalEmit) {
return function (type, data) {
originalEmit.call(this, type, data);
$(this.element).trigger({
type: type,
gesture: data
});
};
})(Hammer.Manager.prototype.emit);
}));; // Required for Meteor package, the use of window prevents export by Meteor (function (window) {
if (window.Package) {
Materialize = {};
} else {
window.Materialize = {};
}
})(window);
/*
* raf.js * https://github.com/ngryman/raf.js * * original requestAnimationFrame polyfill by Erik Möller * inspired from paul_irish gist and post * * Copyright (c) 2013 ngryman * Licensed under the MIT license. */
(function (window) {
var lastTime = 0,
vendors = ['webkit', 'moz'],
requestAnimationFrame = window.requestAnimationFrame,
cancelAnimationFrame = window.cancelAnimationFrame,
i = vendors.length;
// try to un-prefix existing raf
while (--i >= 0 && !requestAnimationFrame) {
requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
}
// polyfill with setTimeout fallback // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 if (!requestAnimationFrame || !cancelAnimationFrame) { requestAnimationFrame = function (callback) { var now = +Date.now(), nextTime = Math.max(lastTime + 16, now); return setTimeout(function () { callback(lastTime = nextTime); }, nextTime - now); };
cancelAnimationFrame = clearTimeout; }
// export to window window.requestAnimationFrame = requestAnimationFrame; window.cancelAnimationFrame = cancelAnimationFrame;
}(window));
/**
* Generate approximated selector string for a jQuery object
* @param {jQuery} obj jQuery object to be parsed
* @returns {string}
*/
Materialize.objectSelectorString = function (obj) {
var tagStr = obj.prop('tagName') || ;
var idStr = obj.attr('id') || ;
var classStr = obj.attr('class') || ;
return (tagStr + idStr + classStr).replace(/\s/g, );
};
// Unique Random ID
Materialize.guid = (function () {
function s4() {
return Math.floor((1 + Math.random()) * 0x10000)
.toString(16)
.substring(1);
}
return function () {
return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
s4() + '-' + s4() + s4() + s4();
};
})();
/**
* Escapes hash from special characters
* @param {string} hash String returned from this.hash
* @returns {string}
*/
Materialize.escapeHash = function (hash) {
return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
};
Materialize.elementOrParentIsFixed = function (element) {
var $element = $(element);
var $checkElements = $element.add($element.parents());
var isFixed = false;
$checkElements.each(function () {
if ($(this).css("position") === "fixed") {
isFixed = true;
return false;
}
});
return isFixed;
};
/**
* Get time in ms * @license https://raw.github.com/jashkenas/underscore/master/LICENSE * @type {function} * @return {number} */
var getTime = (Date.now || function () {
return new Date().getTime();
});
/**
* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/
Materialize.throttle = function (func, wait, options) {
var context, args, result;
var timeout = null;
var previous = 0;
options || (options = {});
var later = function () {
previous = options.leading === false ? 0 : getTime();
timeout = null;
result = func.apply(context, args);
context = args = null;
};
return function () {
var now = getTime();
if (!previous && options.leading === false) previous = now;
var remaining = wait - (now - previous);
context = this;
args = arguments;
if (remaining <= 0) {
clearTimeout(timeout);
timeout = null;
previous = now;
result = func.apply(context, args);
context = args = null;
} else if (!timeout && options.trailing !== false) {
timeout = setTimeout(later, remaining);
}
return result;
};
};
// Velocity has conflicts when loaded with jQuery, this will check for it
// First, check if in noConflict mode
var Vel;
if (jQuery) {
Vel = jQuery.Velocity;
} else if ($) {
Vel = $.Velocity;
} else {
Vel = Velocity;
}; (function ($) {
$.fn.collapsible = function (options, methodParam) {
var defaults = {
accordion: undefined,
onOpen: undefined,
onClose: undefined
};
var methodName = options;
options = $.extend(defaults, options);
return this.each(function () {
var $this = $(this);
var $panel_headers = $(this).find('> li > .collapsible-header');
var collapsible_type = $this.data("collapsible");
/****************
Helper Functions
****************/
// Accordion Open
function accordionOpen(object) {
$panel_headers = $this.find('> li > .collapsible-header');
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', );
}
});
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', );
}
});
}
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
// Close previously open accordion elements.
$panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
if ($(this).is(':visible')) {
$(this).slideUp({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', );
execCallbacks($(this).siblings('.collapsible-header'));
}
});
}
});
}
// Expandable Open
function expandableOpen(object) {
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', );
}
});
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', );
}
});
}
}
// Open collapsible. object: .collapsible-header
function collapsibleOpen(object, noToggle) {
if (!noToggle) {
object.toggleClass('active');
}
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
accordionOpen(object);
} else { // Handle Expandables
expandableOpen(object);
}
execCallbacks(object);
}
// Handle callbacks
function execCallbacks(object) {
if (object.hasClass('active')) {
if (typeof (options.onOpen) === "function") {
options.onOpen.call(this, object.parent());
}
} else {
if (typeof (options.onClose) === "function") {
options.onClose.call(this, object.parent());
}
}
}
/**
* Check if object is children of panel header
* @param {Object} object Jquery object
* @return {Boolean} true if it is children
*/
function isChildrenOfPanelHeader(object) {
var panelHeader = getPanelHeader(object);
return panelHeader.length > 0;
}
/**
* Get panel header from a children element
* @param {Object} object Jquery object
* @return {Object} panel header object
*/
function getPanelHeader(object) {
return object.closest('li > .collapsible-header');
}
// Turn off any existing event handlers
function removeEventHandlers() {
$this.off('click.collapse', '> li > .collapsible-header');
}
/***** End Helper Functions *****/
// Methods
if (methodName === 'destroy') {
removeEventHandlers();
return;
} else if (methodParam >= 0 &&
methodParam < $panel_headers.length) {
var $curr_header = $panel_headers.eq(methodParam);
if ($curr_header.length &&
(methodName === 'open' ||
(methodName === 'close' &&
$curr_header.hasClass('active')))) {
collapsibleOpen($curr_header);
}
return;
}
removeEventHandlers();
// Add click handler to only direct collapsible header children
$this.on('click.collapse', '> li > .collapsible-header', function (e) {
var element = $(e.target);
if (isChildrenOfPanelHeader(element)) {
element = getPanelHeader(element);
}
collapsibleOpen(element);
});
// Open first active
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
collapsibleOpen($panel_headers.filter('.active').first(), true);
} else { // Handle Expandables
$panel_headers.filter('.active').each(function () {
collapsibleOpen($(this), true);
});
}
}); };
$(document).ready(function () {
$('.collapsible').collapsible();
});
}(jQuery));; (function ($) {
// Add posibility to scroll to selected option
// usefull for select for example
$.fn.scrollTo = function (elem) {
$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
return this;
};
$.fn.dropdown = function (options) {
var defaults = {
inDuration: 300,
outDuration: 225,
constrainWidth: true, // Constrains width of dropdown to the activator
hover: false,
gutter: 0, // Spacing from edge
belowOrigin: false,
alignment: 'left',
stopPropagation: false
};
// Open dropdown.
if (options === "open") {
this.each(function () {
$(this).trigger('open');
});
return false;
}
// Close dropdown.
if (options === "close") {
this.each(function () {
$(this).trigger('close');
});
return false;
}
this.each(function () {
var origin = $(this);
var curr_options = $.extend({}, defaults, options);
var isFocused = false;
// Dropdown menu
var activates = $("#" + origin.attr('data-activates'));
function updateOptions() {
if (origin.data('induration') !== undefined)
curr_options.inDuration = origin.data('induration');
if (origin.data('outduration') !== undefined)
curr_options.outDuration = origin.data('outduration');
if (origin.data('constrainwidth') !== undefined)
curr_options.constrainWidth = origin.data('constrainwidth');
if (origin.data('hover') !== undefined)
curr_options.hover = origin.data('hover');
if (origin.data('gutter') !== undefined)
curr_options.gutter = origin.data('gutter');
if (origin.data('beloworigin') !== undefined)
curr_options.belowOrigin = origin.data('beloworigin');
if (origin.data('alignment') !== undefined)
curr_options.alignment = origin.data('alignment');
if (origin.data('stoppropagation') !== undefined)
curr_options.stopPropagation = origin.data('stoppropagation');
}
updateOptions();
// Attach dropdown to its activator
origin.after(activates);
/*
Helper function to position and resize dropdown.
Used in hover and click handler.
*/
function placeDropdown(eventType) {
// Check for simultaneous focus and click events.
if (eventType === 'focus') {
isFocused = true;
}
// Check html data attributes
updateOptions();
// Set Dropdown state
activates.addClass('active');
origin.addClass('active');
// Constrain width
if (curr_options.constrainWidth === true) {
activates.css('width', origin.outerWidth());
} else {
activates.css('white-space', 'nowrap');
}
// Offscreen detection
var windowHeight = window.innerHeight;
var originHeight = origin.innerHeight();
var offsetLeft = origin.offset().left;
var offsetTop = origin.offset().top - $(window).scrollTop();
var currAlignment = curr_options.alignment;
var gutterSpacing = 0;
var leftPosition = 0;
// Below Origin
var verticalOffset = 0;
if (curr_options.belowOrigin === true) {
verticalOffset = originHeight;
}
// Check for scrolling positioned container.
var scrollYOffset = 0;
var scrollXOffset = 0;
var wrapper = origin.parent();
if (!wrapper.is('body')) {
if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
scrollYOffset = wrapper[0].scrollTop;
}
if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
scrollXOffset = wrapper[0].scrollLeft;
}
}
if (offsetLeft + activates.innerWidth() > $(window).width()) {
// Dropdown goes past screen on right, force right alignment
currAlignment = 'right';
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
// Dropdown goes past screen on left, force left alignment
currAlignment = 'left';
}
// Vertical bottom offscreen detection
if (offsetTop + activates.innerHeight() > windowHeight) {
// If going upwards still goes offscreen, just crop height of dropdown.
if (offsetTop + originHeight - activates.innerHeight() < 0) {
var adjustedHeight = windowHeight - offsetTop - verticalOffset;
activates.css('max-height', adjustedHeight);
} else {
// Flow upwards.
if (!verticalOffset) {
verticalOffset += originHeight;
}
verticalOffset -= activates.innerHeight();
}
}
// Handle edge alignment
if (currAlignment === 'left') {
gutterSpacing = curr_options.gutter;
leftPosition = origin.position().left + gutterSpacing;
} else if (currAlignment === 'right') {
// Material icons fix
activates
.stop(true, true)
.css({
opacity: 0,
left: 0
})
var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
gutterSpacing = -curr_options.gutter;
leftPosition = offsetRight + gutterSpacing;
}
// Position dropdown
activates.css({
position: 'absolute',
top: origin.position().top + verticalOffset + scrollYOffset,
left: leftPosition + scrollXOffset
});
// Show dropdown
activates
.slideDown({
queue: false,
duration: curr_options.inDuration,
easing: 'easeOutCubic',
complete: function () {
$(this).css('height', );
}
})
.animate({
opacity: 1
}, {
queue: false,
duration: curr_options.inDuration,
easing: 'easeOutSine'
});
// Add click close handler to document
setTimeout(function () {
$(document).on('click.' + activates.attr('id'), function (e) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
});
}, 0);
}
function hideDropdown() {
// Check for simultaneous focus and click events.
isFocused = false;
activates.fadeOut(curr_options.outDuration);
activates.removeClass('active');
origin.removeClass('active');
$(document).off('click.' + activates.attr('id'));
setTimeout(function () {
activates.css('max-height', );
}, curr_options.outDuration);
}
// Hover
if (curr_options.hover) {
var open = false;
origin.off('click.' + origin.attr('id'));
// Hover handler to show dropdown
origin.on('mouseenter', function (e) { // Mouse over
if (open === false) {
placeDropdown();
open = true;
}
});
origin.on('mouseleave', function (e) {
// If hover on origin then to something other than dropdown content, then close
var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
if (!$(toEl).closest('.dropdown-content').is(activates)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
activates.on('mouseleave', function (e) { // Mouse out
var toEl = e.toElement || e.relatedTarget;
if (!$(toEl).closest('.dropdown-button').is(origin)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
// Click
} else {
// Click handler to show dropdown
origin.off('click.' + origin.attr('id'));
origin.on('click.' + origin.attr('id'), function (e) {
if (!isFocused) {
if (origin[0] == e.currentTarget &&
!origin.hasClass('active') &&
($(e.target).closest('.dropdown-content').length === 0)) {
e.preventDefault(); // Prevents button click from moving window
if (curr_options.stopPropagation) {
e.stopPropagation();
}
placeDropdown('click');
}
// If origin is clicked and menu is open, close menu
else if (origin.hasClass('active')) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
}
}
});
} // End else
// Listen to open and close event - useful for select component
origin.on('open', function (e, eventType) {
placeDropdown(eventType);
});
origin.on('close', hideDropdown);
}); }; // End dropdown plugin
$(document).ready(function () {
$('.dropdown-button').dropdown();
});
}(jQuery));; (function ($) {
var _stack = 0,
_lastID = 0,
_generateID = function () {
_lastID++;
return 'materialize-modal-overlay-' + _lastID;
};
var methods = {
init: function (options) {
var defaults = {
opacity: 0.5,
inDuration: 350,
outDuration: 250,
ready: undefined,
complete: undefined,
dismissible: true,
startingTop: '4%',
endingTop: '10%'
};
// Override defaults
options = $.extend(defaults, options);
return this.each(function () {
var $modal = $(this);
var modal_id = $(this).attr("id") || '#' + $(this).data('target');
var closeModal = function () {
var overlayID = $modal.data('overlay-id');
var $overlay = $('#' + overlayID);
$modal.removeClass('open');
// Enable scrolling
$('body').css({
overflow: ,
width:
});
$modal.find('.modal-close').off('click.close');
$(document).off('keyup.modal' + overlayID);
$overlay.velocity({
opacity: 0
}, {
duration: options.outDuration,
queue: false,
ease: "easeOutQuart"
});
// Define Bottom Sheet animation
var exitVelocityOptions = {
duration: options.outDuration,
queue: false,
ease: "easeOutCubic",
// Handle modal ready callback
complete: function () {
$(this).css({
display: "none"
});
// Call complete callback
if (typeof (options.complete) === "function") {
options.complete.call(this, $modal);
}
$overlay.remove();
_stack--;
}
};
if ($modal.hasClass('bottom-sheet')) {
$modal.velocity({
bottom: "-100%",
opacity: 0
}, exitVelocityOptions);
} else {
$modal.velocity({
top: options.startingTop,
opacity: 0,
scaleX: 0.7
},
exitVelocityOptions
);
}
};
var openModal = function ($trigger) {
var $body = $('body');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
if ($modal.hasClass('open')) {
return;
}
var overlayID = _generateID();var $overlay = $('');
var lStack = (++_stack);
// Store a reference of the overlay
$overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
$modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
$modal.addClass('open');
$("body").append($overlay);
if (options.dismissible) {
$overlay.click(function () {
closeModal();
});
// Return on ESC
$(document).on('keyup.modal' + overlayID, function (e) {
if (e.keyCode === 27) { // ESC key
closeModal();
}
});
}
$modal.find(".modal-close").on('click.close', function (e) {
closeModal();
});
$overlay.css({
display: "block",
opacity: 0
});
$modal.css({
display: "block",
opacity: 0
});
$overlay.velocity({
opacity: options.opacity
}, {
duration: options.inDuration,
queue: false,
ease: "easeOutCubic"
});
$modal.data('associated-overlay', $overlay[0]);
// Define Bottom Sheet animation
var enterVelocityOptions = {
duration: options.inDuration,
queue: false,
ease: "easeOutCubic",
// Handle modal ready callback
complete: function () {
if (typeof (options.ready) === "function") {
options.ready.call(this, $modal, $trigger);
}
}
};
if ($modal.hasClass('bottom-sheet')) {
$modal.velocity({
bottom: "0",
opacity: 1
}, enterVelocityOptions);
} else {
$.Velocity.hook($modal, "scaleX", 0.7);
$modal.css({
top: options.startingTop
});
$modal.velocity({
top: options.endingTop,
opacity: 1,
scaleX: '1'
}, enterVelocityOptions);
}
};
// Reset handlers
$(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
$(this).off('openModal');
$(this).off('closeModal');
// Close Handlers
$(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function (e) {
options.startingTop = ($(this).offset().top - $(window).scrollTop()) / 1.15;
openModal($(this));
e.preventDefault();
}); // done set on click
$(this).on('openModal', function () {
var modal_id = $(this).attr("href") || '#' + $(this).data('target');
openModal();
});
$(this).on('closeModal', function () {
closeModal();
});
}); // done return
},
open: function () {
methods.init.apply(this, arguments);
$(this).trigger('openModal');
},
close: function () {
$(this).trigger('closeModal');
}
};
$.fn.modal = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
}
};
})(jQuery);; (function ($) {
$.fn.materialbox = function () {
return this.each(function () {
if ($(this).hasClass('initialized')) {
return;
}
$(this).addClass('initialized');
var overlayActive = false;
var doneAnimating = true;
var inDuration = 275;
var outDuration = 200;
var origin = $(this);
var placeholder = $('').addClass('material-placeholder');
var originalWidth = 0;
var originalHeight = 0;
var ancestorsChanged;
var ancestor;
var originInlineStyles = origin.attr('style');
origin.wrap(placeholder);
// Start click handler
origin.on('click', function () {
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.width();
var originalHeight = origin.height();
// If already modal, return to original
if (doneAnimating === false) {
returnToOriginal();
return false;
} else if (overlayActive && doneAnimating === true) {
returnToOriginal();
return false;
}
// Set states
doneAnimating = false;
origin.addClass('active');
overlayActive = true;
// Set positioning for placeholder
placeholder.css({
width: placeholder[0].getBoundingClientRect().width,
height: placeholder[0].getBoundingClientRect().height,
position: 'relative',
top: 0,
left: 0
});
// Find ancestor with overflow: hidden; and remove it
ancestorsChanged = undefined;
ancestor = placeholder[0].parentNode;
var count = 0;
while (ancestor !== null && !$(ancestor).is(document)) {
var curr = $(ancestor);
if (curr.css('overflow') !== 'visible') {
curr.css('overflow', 'visible');
if (ancestorsChanged === undefined) {
ancestorsChanged = curr;
} else {
ancestorsChanged = ancestorsChanged.add(curr);
}
}
ancestor = ancestor.parentNode;
}
// Set css on origin
origin.css({
position: 'absolute',
'z-index': 1000,
'will-change': 'left, top, width, height'
})
.data('width', originalWidth)
.data('height', originalHeight);
// Add overlayvar overlay = $('')
.css({
opacity: 0
})
.click(function () {
if (doneAnimating === true)
returnToOriginal();
});
// Put before in origin image to preserve z-index layering.
origin.before(overlay);
// Set dimensions if needed
var overlayOffset = overlay[0].getBoundingClientRect();
overlay.css({
width: windowWidth,
height: windowHeight,
left: -1 * overlayOffset.left,
top: -1 * overlayOffset.top
})
// Animate Overlay
overlay.velocity({
opacity: 1
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad'
});
// Add and animate caption if it exists
if (origin.data('caption') !== "") {
var $photo_caption = $('');
$photo_caption.text(origin.data('caption'));
$('body').append($photo_caption);
$photo_caption.css({
"display": "inline"
});
$photo_caption.velocity({
opacity: 1
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad'
});
}
// Resize Image
var ratio = 0;
var widthPercent = originalWidth / windowWidth;
var heightPercent = originalHeight / windowHeight;
var newWidth = 0;
var newHeight = 0;
if (widthPercent > heightPercent) {
ratio = originalHeight / originalWidth;
newWidth = windowWidth * 0.9;
newHeight = windowWidth * 0.9 * ratio;
} else {
ratio = originalWidth / originalHeight;
newWidth = (windowHeight * 0.9) * ratio;
newHeight = windowHeight * 0.9;
}
// Animate image + set z-index
if (origin.hasClass('responsive-img')) {
origin.velocity({
'max-width': newWidth,
'width': originalWidth
}, {
duration: 0,
queue: false,
complete: function () {
origin.css({
left: 0,
top: 0
})
.velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
});
} // End Complete
}); // End Velocity
} else {
origin.css('left', 0)
.css('top', 0)
.velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
}); // End Velocity
}
// Handle Exit triggers
$(window).on('scroll.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(window).on('resize.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(document).on('keyup.materialbox', function (e) {
// ESC key
if (e.keyCode === 27 &&
doneAnimating === true &&
overlayActive) {
returnToOriginal();
}
});
}); // End click handler
// This function returns the modaled image to the original spot
function returnToOriginal() {
doneAnimating = false;
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.data('width');
var originalHeight = origin.data('height');
origin.velocity("stop", true);
$('#materialbox-overlay').velocity("stop", true);
$('.materialbox-caption').velocity("stop", true);
// disable exit handlers
$(window).off('scroll.materialbox');
$(document).off('keyup.materialbox');
$(window).off('resize.materialbox');
$('#materialbox-overlay').velocity({
opacity: 0
}, {
duration: outDuration, // Delay prevents animation overlapping
queue: false,
easing: 'easeOutQuad',
complete: function () {
// Remove Overlay
overlayActive = false;
$(this).remove();
}
});
// Resize Image
origin.velocity({
width: originalWidth,
height: originalHeight,
left: 0,
top: 0
}, {
duration: outDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
placeholder.css({
height: ,
width: ,
position: ,
top: ,
left:
});
origin.removeAttr('style');
origin.attr('style', originInlineStyles);
// Remove class
origin.removeClass('active');
doneAnimating = true;
// Remove overflow overrides on ancestors
if (ancestorsChanged) {
ancestorsChanged.css('overflow', );
}
}
});
// Remove Caption + reset css settings on image
$('.materialbox-caption').velocity({
opacity: 0
}, {
duration: outDuration, // Delay prevents animation overlapping
queue: false,
easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
}
});
};
$(document).ready(function () {
$('.materialboxed').materialbox();
});
}(jQuery));; (function ($) {
$.fn.parallax = function () {
var window_width = $(window).width();
// Parallax Scripts
return this.each(function (i) {
var $this = $(this);
$this.addClass('parallax');
function updateParallax(initial) {
var container_height;
if (window_width < 601) {
container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
} else {
container_height = ($this.height() > 0) ? $this.height() : 500;
}
var $img = $this.children("img").first();
var img_height = $img.height();
var parallax_dist = img_height - container_height;
var bottom = $this.offset().top + container_height;
var top = $this.offset().top;
var scrollTop = $(window).scrollTop();
var windowHeight = window.innerHeight;
var windowBottom = scrollTop + windowHeight;
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
var parallax = Math.round((parallax_dist * percentScrolled));
if (initial) {
$img.css('display', 'block');
}
if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
}
}
// Wait for image load
$this.children("img").one("load", function () {
updateParallax(true);
}).each(function () {
if (this.complete) $(this).trigger("load");
});
$(window).scroll(function () {
window_width = $(window).width();
updateParallax(false);
});
$(window).resize(function () {
window_width = $(window).width();
updateParallax(false);
});
});
};
}(jQuery));; (function ($) {
var methods = {
init: function (options) {
var defaults = {
onShow: null,
swipeable: false,
responsiveThreshold: Infinity, // breakpoint for swipeable
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
// For each set of tabs, we want to keep track of
// which tab is active and its associated content
var $this = $(this),
window_width = $(window).width();
var $active, $content, $links = $this.find('li.tab a'),
$tabs_width = $this.width(),
$tabs_content = $(),
$tabs_wrapper,
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
$indicator,
index = prev_index = 0,
clicked = false,
clickedTimeout,
transition = 300;
// Finds right attribute for indicator based on active tab.
// el: jQuery Object
var calcRightPos = function (el) {
return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft());
};
// Finds left attribute for indicator based on active tab.
// el: jQuery Object
var calcLeftPos = function (el) {
return Math.floor(el.position().left + $this.scrollLeft());
};
// Animates Indicator to active tab.
// prev_index: Number
var animateIndicator = function (prev_index) {
if ((index - prev_index) >= 0) {
$indicator.velocity({
"right": calcRightPos($active)
}, {
duration: transition,
queue: false,
easing: 'easeOutQuad'
});
$indicator.velocity({
"left": calcLeftPos($active)
}, {
duration: transition,
queue: false,
easing: 'easeOutQuad',
delay: 90
});
} else {
$indicator.velocity({
"left": calcLeftPos($active)
}, {
duration: transition,
queue: false,
easing: 'easeOutQuad'
});
$indicator.velocity({
"right": calcRightPos($active)
}, {
duration: transition,
queue: false,
easing: 'easeOutQuad',
delay: 90
});
}
};
// Change swipeable according to responsive threshold
if (options.swipeable) {
if (window_width > options.responsiveThreshold) {
options.swipeable = false;
}
}
// If the location.hash matches one of the links, use that as the active tab.
$active = $($links.filter('[href="' + location.hash + '"]'));
// If no match is found, use the first link or any with class 'active' as the initial active tab.
if ($active.length === 0) {
$active = $(this).find('li.tab a.active').first();
}
if ($active.length === 0) {
$active = $(this).find('li.tab a').first();
}
$active.addClass('active');
index = $links.index($active);
if (index < 0) {
index = 0;
}
if ($active[0] !== undefined) {
$content = $($active[0].hash);
$content.addClass('active');
}
// append indicator then set indicator width to tab width
if (!$this.find('.indicator').length) {
$this.append('');
}
$indicator = $this.find('.indicator');
// we make sure that the indicator is at the end of the tabs
$this.append($indicator);
if ($this.is(":visible")) {
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
// $indicator.css({"left": index * $tab_width});
setTimeout(function () {
$indicator.css({
"right": calcRightPos($active)
});
$indicator.css({
"left": calcLeftPos($active)
});
}, 0);
}
$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
if (index < 0) {
index = 0;
}
if ($tab_width !== 0 && $tabs_width !== 0) {
$indicator.css({
"right": calcRightPos($active)
});
$indicator.css({
"left": calcLeftPos($active)
});
}
});
// Initialize Tabs Content.
if (options.swipeable) {
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
$links.each(function () {
var $curr_content = $(Materialize.escapeHash(this.hash));
$curr_content.addClass('carousel-item');
$tabs_content = $tabs_content.add($curr_content);
});
$tabs_wrapper = $tabs_content.wrapAll('');
$tabs_content.css('display', );
$('.tabs-content.carousel').carousel({
fullWidth: true,
noWrap: true,
onCycleTo: function (item) {
if (!clicked) {
var prev_index = index;
index = $tabs_wrapper.index(item);
$active = $links.eq(index);
animateIndicator(prev_index);
if (typeof (options.onShow) === "function") {
options.onShow.call($this[0], $content);
}
}
},
});
} else {
// Hide the remaining content
$links.not($active).each(function () {
$(Materialize.escapeHash(this.hash)).hide();
});
}
// Bind the click event handler
$this.off('click.tabs').on('click.tabs', 'a', function (e) {
if ($(this).parent().hasClass('disabled')) {
e.preventDefault();
return;
}
// Act as regular link if target attribute is specified.
if (!!$(this).attr("target")) {
return;
}
clicked = true;
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
// Make the old tab inactive.
$active.removeClass('active');
var $oldContent = $content
// Update the variables with the new link and content
$active = $(this);
$content = $(Materialize.escapeHash(this.hash));
$links = $this.find('li.tab a');
var activeRect = $active.position();
// Make the tab active.
$active.addClass('active');
prev_index = index;
index = $links.index($(this));
if (index < 0) {
index = 0;
}
// Change url to current tab
// window.location.hash = $active.attr('href');
// Swap content
if (options.swipeable) {
if ($tabs_content.length) {
$tabs_content.carousel('set', index, function () {
if (typeof (options.onShow) === "function") {
options.onShow.call($this[0], $content);
}
});
}
} else {
if ($content !== undefined) {
$content.show();
$content.addClass('active');
if (typeof (options.onShow) === "function") {
options.onShow.call(this, $content);
}
}
if ($oldContent !== undefined &&
!$oldContent.is($content)) {
$oldContent.hide();
$oldContent.removeClass('active');
}
}
// Reset clicked state
clickedTimeout = setTimeout(function () {
clicked = false;
}, transition);
// Update indicator
animateIndicator(prev_index);
// Prevent the anchor's default click action
e.preventDefault();
});
});
},
select_tab: function (id) {
this.find('a[href="#' + id + '"]').trigger('click');
}
};
$.fn.tabs = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
}
};
$(document).ready(function () {
$('ul.tabs').tabs();
});
}(jQuery));; (function ($) {
$.fn.tooltip = function (options) {
var timeout = null,
margin = 5;
// Defaults
var defaults = {
delay: 350,
tooltip: ,
position: 'bottom',
html: false
};
// Remove tooltip from the activator
if (options === "remove") {
this.each(function () {
$('#' + $(this).attr('data-tooltip-id')).remove();
$(this).off('mouseenter.tooltip mouseleave.tooltip');
});
return false;
}
options = $.extend(defaults, options);
return this.each(function () {
var tooltipId = Materialize.guid();
var origin = $(this);
// Destroy old tooltip
if (origin.attr('data-tooltip-id')) {
$('#' + origin.attr('data-tooltip-id')).remove();
}
origin.attr('data-tooltip-id', tooltipId);
// Get attributes.
var allowHtml,
tooltipDelay,
tooltipPosition,
tooltipText,
tooltipEl,
backdrop;
var setAttributes = function () {
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
tooltipDelay = origin.attr('data-delay');
tooltipDelay = (tooltipDelay === undefined || tooltipDelay === ) ?
options.delay : tooltipDelay;
tooltipPosition = origin.attr('data-position');
tooltipPosition = (tooltipPosition === undefined || tooltipPosition === ) ?
options.position : tooltipPosition;
tooltipText = origin.attr('data-tooltip');
tooltipText = (tooltipText === undefined || tooltipText === ) ?
options.tooltip : tooltipText;
};
setAttributes();
var renderTooltipEl = function () {
var tooltip = $('');
// Create Text span
if (allowHtml) {
tooltipText = $('').html(tooltipText);
} else {
tooltipText = $('').text(tooltipText);
}
// Create tooltip
tooltip.append(tooltipText)
.appendTo($('body'))
.attr('id', tooltipId);
// Create backdropbackdrop = $('');
backdrop.appendTo(tooltip);
return tooltip;
};
tooltipEl = renderTooltipEl();
// Destroy previously binded events
origin.off('mouseenter.tooltip mouseleave.tooltip');
// Mouse In
var started = false,
timeoutRef;
origin.on({
'mouseenter.tooltip': function (e) {
var showTooltip = function () {
setAttributes();
started = true;
tooltipEl.velocity('stop');
backdrop.velocity('stop');
tooltipEl.css({
visibility: 'visible',
left: '0px',
top: '0px'
});
// Tooltip positioning
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var tooltipHeight = tooltipEl.outerHeight();
var tooltipWidth = tooltipEl.outerWidth();
var tooltipVerticalMovement = '0px';
var tooltipHorizontalMovement = '0px';
var backdropOffsetWidth = backdrop[0].offsetWidth;
var backdropOffsetHeight = backdrop[0].offsetHeight;
var scaleXFactor = 8;
var scaleYFactor = 8;
var scaleFactor = 0;
var targetTop, targetLeft, newCoordinates;
if (tooltipPosition === "top") {
// Top Position
targetTop = origin.offset().top - tooltipHeight - margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '-10px';
backdrop.css({
bottom: 0,
left: 0,
borderRadius: '14px 14px 0 0',
transformOrigin: '50% 100%',
marginTop: tooltipHeight,
marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
});
}
// Left Position
else if (tooltipPosition === "left") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left - tooltipWidth - margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '-10px';
backdrop.css({
top: '-7px',
right: 0,
width: '14px',
height: '14px',
borderRadius: '14px 0 0 14px',
transformOrigin: '95% 50%',
marginTop: tooltipHeight / 2,
marginLeft: tooltipWidth
});
}
// Right Position
else if (tooltipPosition === "right") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left + originWidth + margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '+10px';
backdrop.css({
top: '-7px',
left: 0,
width: '14px',
height: '14px',
borderRadius: '0 14px 14px 0',
transformOrigin: '5% 50%',
marginTop: tooltipHeight / 2,
marginLeft: '0px'
});
} else {
// Bottom Position
targetTop = origin.offset().top + origin.outerHeight() + margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '+10px';
backdrop.css({
top: 0,
left: 0,
marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
});
}
// Set tooptip css placement
tooltipEl.css({
top: newCoordinates.y,
left: newCoordinates.x
});
// Calculate Scale to fill
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
tooltipEl.velocity({
translateY: tooltipVerticalMovement,
translateX: tooltipHorizontalMovement
}, {
duration: 350,
queue: false
})
.velocity({
opacity: 1
}, {
duration: 300,
delay: 50,
queue: false
});
backdrop.css({
visibility: 'visible'
})
.velocity({
opacity: 1
}, {
duration: 55,
delay: 0,
queue: false
})
.velocity({
scaleX: scaleFactor,
scaleY: scaleFactor
}, {
duration: 300,
delay: 0,
queue: false,
easing: 'easeInOutQuad'
});
};
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
// Mouse Out
},
'mouseleave.tooltip': function () {
// Reset State
started = false;
clearTimeout(timeoutRef);
// Animate back
setTimeout(function () {
if (started !== true) {
tooltipEl.velocity({
opacity: 0,
translateY: 0,
translateX: 0
}, {
duration: 225,
queue: false
});
backdrop.velocity({
opacity: 0,
scaleX: 1,
scaleY: 1
}, {
duration: 225,
queue: false,
complete: function () {
backdrop.css({
visibility: 'hidden'
});
tooltipEl.css({
visibility: 'hidden'
});
started = false;
}
});
}
}, 225);
}
});
});
};
var repositionWithinScreen = function (x, y, width, height) {
var newX = x;
var newY = y;
if (newX < 0) {
newX = 4;
} else if (newX + width > window.innerWidth) {
newX -= newX + width - window.innerWidth;
}
if (newY < 0) {
newY = 4;
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
newY -= newY + height - window.innerHeight;
}
return {
x: newX,
y: newY
};
};
$(document).ready(function () {
$('.tooltipped').tooltip();
});
}(jQuery));; /*!
* Waves v0.6.4 * http://fian.my.id/Waves * * Copyright 2014 Alfiana E. Sibuea and other contributors * Released under the MIT license * https://github.com/fians/Waves/blob/master/LICENSE */
(function (window) {
'use strict';
var Waves = Waves || {};
var $$ = document.querySelectorAll.bind(document);
// Find exact position of element
function isWindow(obj) {
return obj !== null && obj === obj.window;
}
function getWindow(elem) {
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
}
function offset(elem) {
var docElem, win,
box = {
top: 0,
left: 0
},
doc = elem && elem.ownerDocument;
docElem = doc.documentElement;
if (typeof elem.getBoundingClientRect !== typeof undefined) {
box = elem.getBoundingClientRect();
}
win = getWindow(doc);
return {
top: box.top + win.pageYOffset - docElem.clientTop,
left: box.left + win.pageXOffset - docElem.clientLeft
};
}
function convertStyle(obj) {
var style = ;
for (var a in obj) {
if (obj.hasOwnProperty(a)) {
style += (a + ':' + obj[a] + ';');
}
}
return style; }
var Effect = {
// Effect delay
duration: 750,
show: function (e, element) {
// Disable right click
if (e.button === 2) {
return false;
}
var el = element || this;
// Create ripple
var ripple = document.createElement('div');
ripple.className = 'waves-ripple';
el.appendChild(ripple);
// Get click coordinate and element witdh
var pos = offset(el);
var relativeY = (e.pageY - pos.top);
var relativeX = (e.pageX - pos.left);
var scale = 'scale(' + ((el.clientWidth / 100) * 10) + ')';
// Support for touch devices
if ('touches' in e) {
relativeY = (e.touches[0].pageY - pos.top);
relativeX = (e.touches[0].pageX - pos.left);
}
// Attach data to element
ripple.setAttribute('data-hold', Date.now());
ripple.setAttribute('data-scale', scale);
ripple.setAttribute('data-x', relativeX);
ripple.setAttribute('data-y', relativeY);
// Set ripple position
var rippleStyle = {
'top': relativeY + 'px',
'left': relativeX + 'px'
};
ripple.className = ripple.className + ' waves-notransition';
ripple.setAttribute('style', convertStyle(rippleStyle));
ripple.className = ripple.className.replace('waves-notransition', );
// Scale the ripple
rippleStyle['-webkit-transform'] = scale;
rippleStyle['-moz-transform'] = scale;
rippleStyle['-ms-transform'] = scale;
rippleStyle['-o-transform'] = scale;
rippleStyle.transform = scale;
rippleStyle.opacity = '1';
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
rippleStyle['transition-duration'] = Effect.duration + 'ms';
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
ripple.setAttribute('style', convertStyle(rippleStyle));
},
hide: function (e) {
TouchHandler.touchup(e);
var el = this;
var width = el.clientWidth * 1.4;
// Get first ripple
var ripple = null;
var ripples = el.getElementsByClassName('waves-ripple');
if (ripples.length > 0) {
ripple = ripples[ripples.length - 1];
} else {
return false;
}
var relativeX = ripple.getAttribute('data-x');
var relativeY = ripple.getAttribute('data-y');
var scale = ripple.getAttribute('data-scale');
// Get delay beetween mousedown and mouse leave
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
var delay = 350 - diff;
if (delay < 0) {
delay = 0;
}
// Fade out ripple after delay
setTimeout(function () {
var style = {
'top': relativeY + 'px',
'left': relativeX + 'px',
'opacity': '0',
// Duration
'-webkit-transition-duration': Effect.duration + 'ms',
'-moz-transition-duration': Effect.duration + 'ms',
'-o-transition-duration': Effect.duration + 'ms',
'transition-duration': Effect.duration + 'ms',
'-webkit-transform': scale,
'-moz-transform': scale,
'-ms-transform': scale,
'-o-transform': scale,
'transform': scale,
};
ripple.setAttribute('style', convertStyle(style));
setTimeout(function () {
try {
el.removeChild(ripple);
} catch (e) {
return false;
}
}, Effect.duration);
}, delay);
},
// Little hack to make <input> can perform waves effect
wrapInput: function (elements) {
for (var a = 0; a < elements.length; a++) {
var el = elements[a];
if (el.tagName.toLowerCase() === 'input') {
var parent = el.parentNode;
// If input already have parent just pass through
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
continue;
}
// Put element class and style to the specified parent
var wrapper = document.createElement('i');
wrapper.className = el.className + ' waves-input-wrapper';
var elementStyle = el.getAttribute('style');
if (!elementStyle) {
elementStyle = ;
}
wrapper.setAttribute('style', elementStyle);
el.className = 'waves-button-input';
el.removeAttribute('style');
// Put element as child
parent.replaceChild(wrapper, el);
wrapper.appendChild(el);
}
}
}
};
/**
* Disable mousedown event for 500ms during and after touch
*/
var TouchHandler = {
/* uses an integer rather than bool so there's no issues with
* needing to clear timeouts if another touch event occurred
* within the 500ms. Cannot mouseup between touchstart and
* touchend, nor in the 500ms after touchend. */
touches: 0,
allowEvent: function (e) {
var allow = true;
if (e.type === 'touchstart') {
TouchHandler.touches += 1; //push
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
setTimeout(function () {
if (TouchHandler.touches > 0) {
TouchHandler.touches -= 1; //pop after 500ms
}
}, 500);
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
allow = false;
}
return allow;
},
touchup: function (e) {
TouchHandler.allowEvent(e);
}
};
/**
* Delegated click handler for .waves-effect element.
* returns null when .waves-effect element not in "click tree"
*/
function getWavesEffectElement(e) {
if (TouchHandler.allowEvent(e) === false) {
return null;
}
var element = null;
var target = e.target || e.srcElement;
while (target.parentElement !== null) {
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
element = target;
break;
} else if (target.className.indexOf('waves-effect') !== -1) {
element = target;
break;
}
target = target.parentElement;
}
return element; }
/**
* Bubble the click and show effect if .waves-effect elem was found
*/
function showEffect(e) {
var element = getWavesEffectElement(e);
if (element !== null) {
Effect.show(e, element);
if ('ontouchstart' in window) {
element.addEventListener('touchend', Effect.hide, false);
element.addEventListener('touchcancel', Effect.hide, false);
}
element.addEventListener('mouseup', Effect.hide, false);
element.addEventListener('mouseleave', Effect.hide, false);
}
}
Waves.displayEffect = function (options) {
options = options || {};
if ('duration' in options) {
Effect.duration = options.duration;
}
//Wrap input inside tag
Effect.wrapInput($$('.waves-effect'));
if ('ontouchstart' in window) {
document.body.addEventListener('touchstart', showEffect, false);
}
document.body.addEventListener('mousedown', showEffect, false);
};
/**
* Attach Waves to an input element (or any element which doesn't
* bubble mouseup/mousedown events).
* Intended to be used with dynamically loaded forms/inputs, or
* where the user doesn't want a delegated click handler.
*/
Waves.attach = function (element) {
//FUTURE: automatically add waves classes and allow users
// to specify them with an options param? Eg. light/classic/button
if (element.tagName.toLowerCase() === 'input') {
Effect.wrapInput([element]);
element = element.parentElement;
}
if ('ontouchstart' in window) {
element.addEventListener('touchstart', showEffect, false);
}
element.addEventListener('mousedown', showEffect, false);
};
window.Waves = Waves;
document.addEventListener('DOMContentLoaded', function () {
Waves.displayEffect();
}, false);
})(window);; Materialize.toast = function (message, displayLength, className, completeCallback) {
className = className || "";
var container = document.getElementById('toast-container');
// Create toast container if it does not exist
if (container === null) {
// create notification container
container = document.createElement('div');
container.id = 'toast-container';
document.body.appendChild(container);
}
// Select and append toast var newToast = createToast(message);
// only append toast if message is not undefined
if (message) {
container.appendChild(newToast);
}
newToast.style.opacity = 0;
// Animate toast in
Vel(newToast, {
translateY: '-35px',
opacity: 1
}, {
duration: 300,
easing: 'easeOutCubic',
queue: false
});
// Allows timer to be pause while being panned
var timeLeft = displayLength;
var counterInterval;
if (timeLeft != null) {
counterInterval = setInterval(function () {
if (newToast.parentNode === null)
window.clearInterval(counterInterval);
// If toast is not being dragged, decrease its time remaining
if (!newToast.classList.contains('panning')) {
timeLeft -= 20;
}
if (timeLeft <= 0) {
// Animate toast out
Vel(newToast, {
"opacity": 0,
marginTop: '-40px'
}, {
duration: 375,
easing: 'easeOutExpo',
queue: false,
complete: function () {
// Call the optional callback
if (typeof (completeCallback) === "function")
completeCallback();
// Remove toast after it times out
this[0].parentNode.removeChild(this[0]);
}
});
window.clearInterval(counterInterval);
}
}, 20);
}
function createToast(html) {
// Create toast
var toast = document.createElement('div');
toast.classList.add('toast');
if (className) {
var classes = className.split(' ');
for (var i = 0, count = classes.length; i < count; i++) {
toast.classList.add(classes[i]);
}
}
// If type of parameter is HTML Element
if (typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName === "string") {
toast.appendChild(html);
} else if (html instanceof jQuery) {
// Check if it is jQuery object
toast.appendChild(html[0]);
} else {
// Insert as text;
toast.innerHTML = html;
}
// Bind hammer
var hammerHandler = new Hammer(toast, {
prevent_default: false
});
hammerHandler.on('pan', function (e) {
var deltaX = e.deltaX;
var activationDistance = 80;
// Change toast state
if (!toast.classList.contains('panning')) {
toast.classList.add('panning');
}
var opacityPercent = 1 - Math.abs(deltaX / activationDistance);
if (opacityPercent < 0)
opacityPercent = 0;
Vel(toast, {
left: deltaX,
opacity: opacityPercent
}, {
duration: 50,
queue: false,
easing: 'easeOutQuad'
});
});
hammerHandler.on('panend', function (e) {
var deltaX = e.deltaX;
var activationDistance = 80;
// If toast dragged past activation point
if (Math.abs(deltaX) > activationDistance) {
Vel(toast, {
marginTop: '-40px'
}, {
duration: 375,
easing: 'easeOutExpo',
queue: false,
complete: function () {
if (typeof (completeCallback) === "function") {
completeCallback();
}
toast.parentNode.removeChild(toast);
}
});
} else {
toast.classList.remove('panning');
// Put toast back into original position
Vel(toast, {
left: 0,
opacity: 1
}, {
duration: 300,
easing: 'easeOutExpo',
queue: false
});
}
});
return toast; }
};; (function ($) {
var methods = {
init: function (options) {
var defaults = {
menuWidth: 300,
edge: 'left',
closeOnClick: false,
draggable: true,
onOpen: null,
onClose: null
};
options = $.extend(defaults, options);
$(this).each(function () {
var $this = $(this);
var menuId = $this.attr('data-activates');
var menu = $("#" + menuId);
// Set to width
if (options.menuWidth != 300) {
menu.css('width', options.menuWidth);
}
// Add Touch Area
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
if (options.draggable) {
// Regenerate dragTarget
if ($dragTarget.length) {
$dragTarget.remove();
}
$dragTarget = $('').attr('data-sidenav', menuId);
$('body').append($dragTarget);
} else {
$dragTarget = $();
}
if (options.edge == 'left') {
menu.css('transform', 'translateX(-100%)');
$dragTarget.css({
'left': 0
}); // Add Touch Area
} else {
menu.addClass('right-aligned') // Change text-alignment to right
.css('transform', 'translateX(100%)');
$dragTarget.css({
'right': 0
}); // Add Touch Area
}
// If fixed sidenav, bring menu out
if (menu.hasClass('fixed')) {
if (window.innerWidth > 992) {
menu.css('transform', 'translateX(0)');
}
}
// Window resize to reset on large screens fixed
if (menu.hasClass('fixed')) {
$(window).resize(function () {
if (window.innerWidth > 992) {
// Close menu if window is resized bigger than 992 and user has fixed sidenav
if ($('#sidenav-overlay').length !== 0 && menuOut) {
removeMenu(true);
} else {
// menu.removeAttr('style');
menu.css('transform', 'translateX(0%)');
// menu.css('width', options.menuWidth);
}
} else if (menuOut === false) {
if (options.edge === 'left') {
menu.css('transform', 'translateX(-100%)');
} else {
menu.css('transform', 'translateX(100%)');
}
}
});
}
// if closeOnClick, then add close event for all a tags in side sideNav
if (options.closeOnClick === true) {
menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
removeMenu();
}
});
}
var removeMenu = function (restoreNav) {
panning = false;
menuOut = false;
// Reenable scrolling
$('body').css({
overflow: ,
width:
});
$('#sidenav-overlay').velocity({
opacity: 0
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
if (options.edge === 'left') {
// Reset phantom div
$dragTarget.css({
width: ,
right: ,
left: '0'
});
menu.velocity({
'translateX': '-100%'
}, {
duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
} else {
// Reset phantom div
$dragTarget.css({
width: ,
right: '0',
left:
});
menu.velocity({
'translateX': '100%'
}, {
duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
}
// Callback
if (typeof (options.onClose) === 'function') {
options.onClose.call(this, menu);
}
}
// Touch Event
var panning = false;
var menuOut = false;
if (options.draggable) {
$dragTarget.on('click', function () {
if (menuOut) {
removeMenu();
}
});
$dragTarget.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType == "touch") {
var direction = e.gesture.direction;
var x = e.gesture.center.x;
var y = e.gesture.center.y;
var velocityX = e.gesture.velocityX;
// Vertical scroll bugfix
if (x === 0 && y === 0) {
return;
}
// Disable Scrolling
var $body = $('body');
var $overlay = $('#sidenav-overlay');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// If overlay does not exist, create one and if it is clicked, close menu
if ($overlay.length === 0) {
$overlay = $('');
$overlay.css('opacity', 0).click(function () {
removeMenu();
});
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
if (typeof (options.onOpen) === 'function') {
options.onOpen.call(this, menu);
}
$('body').append($overlay);
}
// Keep within boundaries
if (options.edge === 'left') {
if (x > options.menuWidth) {
x = options.menuWidth;
} else if (x < 0) {
x = 0;
}
}
if (options.edge === 'left') {
// Left Direction
if (x < (options.menuWidth / 2)) {
menuOut = false;
}
// Right Direction
else if (x >= (options.menuWidth / 2)) {
menuOut = true;
}
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
} else {
// Left Direction
if (x < (window.innerWidth - options.menuWidth / 2)) {
menuOut = true;
}
// Right Direction
else if (x >= (window.innerWidth - options.menuWidth / 2)) {
menuOut = false;
}
var rightPos = (x - options.menuWidth / 2);
if (rightPos < 0) {
rightPos = 0;
}
menu.css('transform', 'translateX(' + rightPos + 'px)');
}
// Percentage overlay
var overlayPerc;
if (options.edge === 'left') {
overlayPerc = x / options.menuWidth;
$overlay.velocity({
opacity: overlayPerc
}, {
duration: 10,
queue: false,
easing: 'easeOutQuad'
});
} else {
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
$overlay.velocity({
opacity: overlayPerc
}, {
duration: 10,
queue: false,
easing: 'easeOutQuad'
});
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType == "touch") {
var $overlay = $('#sidenav-overlay');
var velocityX = e.gesture.velocityX;
var x = e.gesture.center.x;
var leftPos = x - options.menuWidth;
var rightPos = x - options.menuWidth / 2;
if (leftPos > 0) {
leftPos = 0;
}
if (rightPos < 0) {
rightPos = 0;
}
panning = false;
if (options.edge === 'left') {
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
// Return menu to open
if (leftPos !== 0) {
menu.velocity({
'translateX': [0, leftPos]
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
}
$overlay.velocity({
opacity: 1
}, {
duration: 50,
queue: false,
easing: 'easeOutQuad'
});
$dragTarget.css({
width: '50%',
right: 0,
left:
});
menuOut = true;
} else if (!menuOut || velocityX > 0.3) {
// Enable Scrolling
$('body').css({
overflow: ,
width:
});
// Slide menu closed
menu.velocity({
'translateX': [-1 * options.menuWidth - 10, leftPos]
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad'
});
$overlay.velocity({
opacity: 0
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof (options.onClose) === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
}
});
$dragTarget.css({
width: '10px',
right: ,
left: 0
});
}
} else {
if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
// Return menu to open
if (rightPos !== 0) {
menu.velocity({
'translateX': [0, rightPos]
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
}
$overlay.velocity({
opacity: 1
}, {
duration: 50,
queue: false,
easing: 'easeOutQuad'
});
$dragTarget.css({
width: '50%',
right: ,
left: 0
});
menuOut = true;
} else if (!menuOut || velocityX < -0.3) {
// Enable Scrolling
$('body').css({
overflow: ,
width:
});
// Slide menu closed
menu.velocity({
'translateX': [options.menuWidth + 10, rightPos]
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad'
});
$overlay.velocity({
opacity: 0
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
$dragTarget.css({
width: '10px',
right: 0,
left:
});
}
}
}
});
}
$this.off('click.sidenav').on('click.sidenav', function () {
if (menuOut === true) {
menuOut = false;
panning = false;
removeMenu();
} else {
// Disable Scrolling
var $body = $('body');
var $overlay = $('');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// Push current drag target on top of DOM tree
$('body').append($dragTarget);
if (options.edge === 'left') {
$dragTarget.css({
width: '50%',
right: 0,
left:
});
menu.velocity({
'translateX': [0, -1 * options.menuWidth]
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
} else {
$dragTarget.css({
width: '50%',
right: ,
left: 0
});
menu.velocity({
'translateX': [0, options.menuWidth]
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
}
$overlay.css('opacity', 0)
.click(function () {
menuOut = false;
panning = false;
removeMenu();
$overlay.velocity({
opacity: 0
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
});
$('body').append($overlay);
$overlay.velocity({
opacity: 1
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad',
complete: function () {
menuOut = true;
panning = false;
}
});
// Callback
if (typeof (options.onOpen) === 'function') {
options.onOpen.call(this, menu);
}
}
return false;
});
});
},
destroy: function () {
var $overlay = $('#sidenav-overlay');
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
$overlay.trigger('click');
$dragTarget.remove();
$(this).off('click');
$overlay.remove();
},
show: function () {
this.trigger('click');
},
hide: function () {
$('#sidenav-overlay').trigger('click');
}
};
$.fn.sideNav = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
}
}; // Plugin end
}(jQuery));; /**
* Extend jquery with a scrollspy plugin. * This watches the window scroll and fires events when elements are scrolled into viewport. * * throttle() and getTime() taken from Underscore.js * https://github.com/jashkenas/underscore * * @author Copyright 2013 John Smart * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE * @see https://github.com/thesmart * @version 0.1.2 */
(function ($) {
var jWindow = $(window);
var elements = [];
var elementsInView = [];
var isSpying = false;
var ticks = 0;
var unique_id = 1;
var offset = {
top: 0,
right: 0,
bottom: 0,
left: 0,
}
/**
* Find elements that are within the boundary
* @param {number} top
* @param {number} right
* @param {number} bottom
* @param {number} left
* @return {jQuery} A collection of elements
*/
function findElements(top, right, bottom, left) {
var hits = $();
$.each(elements, function (i, element) {
if (element.height() > 0) {
var elTop = element.offset().top,
elLeft = element.offset().left,
elRight = elLeft + element.width(),
elBottom = elTop + element.height();
var isIntersect = !(elLeft > right ||
elRight < left ||
elTop > bottom ||
elBottom < top);
if (isIntersect) {
hits.push(element);
}
}
});
return hits; }
/**
* Called when the user scrolls the window
*/
function onScroll(scrollOffset) {
// unique tick id
++ticks;
// viewport rectangle
var top = jWindow.scrollTop(),
left = jWindow.scrollLeft(),
right = left + jWindow.width(),
bottom = top + jWindow.height();
// determine which elements are in view
var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
$.each(intersections, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick != 'number') {
// entered into view
element.triggerHandler('scrollSpy:enter');
}
// update tick id
element.data('scrollSpy:ticks', ticks);
});
// determine which elements are no longer in view
$.each(elementsInView, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick == 'number' && lastTick !== ticks) {
// exited from view
element.triggerHandler('scrollSpy:exit');
element.data('scrollSpy:ticks', null);
}
});
// remember elements in view for next tick
elementsInView = intersections;
}
/**
* Called when window is resized
*/
function onWinSize() {
jWindow.trigger('scrollSpy:winSize');
}
/**
* Enables ScrollSpy using a selector * @param {jQuery|string} selector The elements collection, or a selector * @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
activeClass : string -> Class name to be added to the active link. Default: active * @returns {jQuery} */
$.scrollSpy = function (selector, options) {
var defaults = {
throttle: 100,
scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
activeClass: 'active',
getActiveElement: function (id) {
return 'a[href="#' + id + '"]';
}
};
options = $.extend(defaults, options);
var visible = [];
selector = $(selector);
selector.each(function (i, element) {
elements.push($(element));
$(element).data("scrollSpy:id", i);
// Smooth scroll to section
$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
e.preventDefault();
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
$('html, body').animate({
scrollTop: offset - options.scrollOffset
}, {
duration: 400,
queue: false,
easing: 'easeOutCubic'
});
});
});
offset.top = options.offsetTop || 0;
offset.right = options.offsetRight || 0;
offset.bottom = options.offsetBottom || 0;
offset.left = options.offsetLeft || 0;
var throttledScroll = Materialize.throttle(function () {
onScroll(options.scrollOffset);
}, options.throttle || 100);
var readyScroll = function () {
$(document).ready(throttledScroll);
};
if (!isSpying) {
jWindow.on('scroll', readyScroll);
jWindow.on('resize', readyScroll);
isSpying = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(readyScroll, 0);
selector.on('scrollSpy:enter', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
var $this = $(this);
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
visible.unshift($(this));
} else {
visible.push($(this));
}
} else {
visible.push($(this));
}
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
});
selector.on('scrollSpy:exit', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
var $this = $(this);
visible = $.grep(visible, function (value) {
return value.attr('id') != $this.attr('id');
});
if (visible[0]) { // Check if empty
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
}
}
});
return selector; };
/**
* Listen for window resize events
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
* @returns {jQuery} $(window)
*/
$.winSizeSpy = function (options) {
$.winSizeSpy = function () {
return jWindow;
}; // lock from multiple calls
options = options || {
throttle: 100
};
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
};
/**
* Enables ScrollSpy on a collection of elements
* e.g. $('.scrollSpy').scrollSpy()
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
* @returns {jQuery}
*/
$.fn.scrollSpy = function (options) {
return $.scrollSpy($(this), options);
};
})(jQuery);; (function ($) {
$(document).ready(function () {
// Function to update labels of text fields
Materialize.updateTextFields = function () {
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
$(input_selector).each(function (index, element) {
var $this = $(this);
if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
$this.siblings('label').addClass('active');
} else if ($(element)[0].validity) {
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
} else {
$this.siblings('label').removeClass('active');
}
});
};
// Text based inputs
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
// Add active if form auto complete
$(document).on('change', input_selector, function () {
if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
$(this).siblings('label').addClass('active');
}
validate_field($(this));
});
// Add active if input element has been pre-populated on document ready
$(document).ready(function () {
Materialize.updateTextFields();
});
// HTML DOM FORM RESET handling
$(document).on('reset', function (e) {
var formReset = $(e.target);
if (formReset.is('form')) {
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
formReset.find(input_selector).each(function () {
if ($(this).attr('value') === ) {
$(this).siblings('label').removeClass('active');
}
});
// Reset select
formReset.find('select.initialized').each(function () {
var reset_text = formReset.find('option[selected]').text();
formReset.siblings('input.select-dropdown').val(reset_text);
});
}
});
// Add active when element has focus
$(document).on('focus', input_selector, function () {
$(this).siblings('label, .prefix').addClass('active');
});
$(document).on('blur', input_selector, function () {
var $inputElement = $(this);
var selector = ".prefix";
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
selector += ", label";
}
$inputElement.siblings(selector).removeClass('active');
validate_field($inputElement);
});
window.validate_field = function (object) {
var hasLength = object.attr('data-length') !== undefined;
var lenAttr = parseInt(object.attr('data-length'));
var len = object.val().length;
if (object.val().length === 0 && object[0].validity.badInput === false) {
if (object.hasClass('validate')) {
object.removeClass('valid');
object.removeClass('invalid');
}
} else {
if (object.hasClass('validate')) {
// Check for character counter attributes
if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
object.removeClass('invalid');
object.addClass('valid');
} else {
object.removeClass('valid');
object.addClass('invalid');
}
}
}
};
// Radio and Checkbox focus class
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
$(document).on('keyup.radio', radio_checkbox, function (e) {
// TAB, check if tabbing to radio or checkbox.
if (e.which === 9) {
$(this).addClass('tabbed');
var $this = $(this);
$this.one('blur', function (e) {
$(this).removeClass('tabbed');
});
return;
}
});
// Textarea Auto Resize
var hiddenDiv = $('.hiddendiv').first();
if (!hiddenDiv.length) {
hiddenDiv = $('');
$('body').append(hiddenDiv);
}
var text_area_selector = '.materialize-textarea';
function textareaAutoResize($textarea) {
// Set font properties of hiddenDiv
var fontFamily = $textarea.css('font-family');
var fontSize = $textarea.css('font-size');
var lineHeight = $textarea.css('line-height');
if (fontSize) {
hiddenDiv.css('font-size', fontSize);
}
if (fontFamily) {
hiddenDiv.css('font-family', fontFamily);
}
if (lineHeight) {
hiddenDiv.css('line-height', lineHeight);
}
// Set original-height, if none
if (!$textarea.data('original-height')) {
$textarea.data('original-height', $textarea.height());
}
if ($textarea.attr('wrap') === 'off') {
hiddenDiv.css('overflow-wrap', 'normal')
.css('white-space', 'pre');
}
hiddenDiv.text($textarea.val() + '\n');
var content = hiddenDiv.html().replace(/\n/g, '
');
hiddenDiv.html(content);
// When textarea is hidden, width goes crazy.
// Approximate with half of window size
if ($textarea.is(':visible')) {
hiddenDiv.css('width', $textarea.width());
} else {
hiddenDiv.css('width', $(window).width() / 2);
}
/**
* Resize if the new height is greater than the
* original height of the textarea
*/
if ($textarea.data('original-height') <= hiddenDiv.height()) {
$textarea.css('height', hiddenDiv.height());
} else if ($textarea.val().length < $textarea.data('previous-length')) {
/**
* In case the new height is less than original height, it
* means the textarea has less text than before
* So we set the height to the original one
*/
$textarea.css('height', $textarea.data('original-height'));
}
$textarea.data('previous-length', $textarea.val().length);
}
$(text_area_selector).each(function () {
var $textarea = $(this);
/**
* Instead of resizing textarea on document load,
* store the original height and the original length
*/
$textarea.data('original-height', $textarea.height());
$textarea.data('previous-length', $textarea.val().length);
});
$('body').on('keyup keydown autoresize', text_area_selector, function () {
textareaAutoResize($(this));
});
// File Input Path
$(document).on('change', '.file-field input[type="file"]', function () {
var file_field = $(this).closest('.file-field');
var path_input = file_field.find('input.file-path');
var files = $(this)[0].files;
var file_names = [];
for (var i = 0; i < files.length; i++) {
file_names.push(files[i].name);
}
path_input.val(file_names.join(", "));
path_input.trigger('change');
});
/****************
* Range Input *
****************/
var range_type = 'input[type=range]';
var range_mousedown = false;
var left;
$(range_type).each(function () {
var thumb = $('');
$(this).after(thumb);
});
var showRangeBubble = function (thumb) {
var paddingLeft = parseInt(thumb.parent().css('padding-left'));
var marginLeft = (-7 + paddingLeft) + 'px';
thumb.velocity({
height: "30px",
width: "30px",
top: "-30px",
marginLeft: marginLeft
}, {
duration: 300,
easing: 'easeOutExpo'
});
};
var calcRangeOffset = function (range) {
var width = range.width() - 15;
var max = parseFloat(range.attr('max'));
var min = parseFloat(range.attr('min'));
var percent = (parseFloat(range.val()) - min) / (max - min);
return percent * width;
}
var range_wrapper = '.range-field';
$(document).on('change', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
thumb.find('.value').html($(this).val());
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
});
$(document).on('mousedown touchstart', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
// If thumb indicator does not exist yet, create it
if (thumb.length <= 0) {
thumb = $('');
$(this).after(thumb);
}
// Set indicator value
thumb.find('.value').html($(this).val());
range_mousedown = true;
$(this).addClass('active');
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
if (e.type !== 'input') {
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
}
});
$(document).on('mouseup touchend', range_wrapper, function () {
range_mousedown = false;
$(this).removeClass('active');
});
$(document).on('input mousemove touchmove', range_wrapper, function (e) {
var thumb = $(this).children('.thumb');
var left;
var input = $(this).find(range_type);
if (range_mousedown) {
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset(input);
thumb.addClass('active').css('left', offsetLeft);
thumb.find('.value').html(thumb.siblings(range_type).val());
}
});
$(document).on('mouseout touchleave', range_wrapper, function () {
if (!range_mousedown) {
var thumb = $(this).children('.thumb');
var paddingLeft = parseInt($(this).css('padding-left'));
var marginLeft = (7 + paddingLeft) + 'px';
if (thumb.hasClass('active')) {
thumb.velocity({
height: '0',
width: '0',
top: '10px',
marginLeft: marginLeft
}, {
duration: 100
});
}
thumb.removeClass('active');
}
});
/**************************
* Auto complete plugin *
*************************/
$.fn.autocomplete = function (options) {
// Defaults
var defaults = {
data: {},
limit: Infinity,
onAutocomplete: null,
minLength: 1
};
options = $.extend(defaults, options);
return this.each(function () {
var $input = $(this);
var data = options.data,
count = 0,
activeIndex = -1,
oldVal,
$inputDiv = $input.closest('.input-field'); // Div to append on
// Check if data isn't empty
if (!$.isEmptyObject(data)) {
var $autocomplete = $('var $oldAutocomplete;
// Append autocomplete element.
// Prevent double structure init.
if ($inputDiv.length) {
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
if (!$oldAutocomplete.length) {
$inputDiv.append($autocomplete); // Set ul in body
}
} else {
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
if (!$oldAutocomplete.length) {
$input.after($autocomplete);
}
}
if ($oldAutocomplete.length) {
$autocomplete = $oldAutocomplete;
}
// Highlight partial match.
var highlight = function (string, $el) {
var img = $el.find('img');
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
matchEnd = matchStart + string.length - 1,
beforeMatch = $el.text().slice(0, matchStart),
matchText = $el.text().slice(matchStart, matchEnd + 1),
afterMatch = $el.text().slice(matchEnd + 1);
$el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
if (img.length) {
$el.prepend(img);
}
};
// Reset current element position
var resetCurrentElement = function () {
activeIndex = -1;
$autocomplete.find('.active').removeClass('active');
}
// Remove autocomplete elements
var removeAutocomplete = function () {
$autocomplete.empty();
resetCurrentElement();
oldVal = undefined;
};
$input.off('blur.autocomplete').on('blur.autocomplete', function () {
removeAutocomplete();
});
// Perform search
$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
// Reset count.
count = 0;
var val = $input.val().toLowerCase();
// Don't capture enter or arrow key usage.
if (e.which === 13 ||
e.which === 38 ||
e.which === 40) {
return;
}
// Check if the input isn't empty
if (oldVal !== val) {
removeAutocomplete();
if (val.length >= options.minLength) {
for (var key in data) {
if (data.hasOwnProperty(key) &&
key.toLowerCase().indexOf(val) !== -1 &&
key.toLowerCase() !== val) {
// Break if past limit
if (count >= options.limit) {
break;
}
var autocompleteOption = $('');
if (!!data[key]) {
autocompleteOption.append('<img src="' + data[key] + '" class="right circle">' + key + '');
} else {
autocompleteOption.append('' + key + '');
}
$autocomplete.append(autocompleteOption);
highlight(val, autocompleteOption);
count++;
}
}
}
}
// Update oldVal
oldVal = val;
});
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
// Arrow keys and enter key usage
var keyCode = e.which,
liElement,
numItems = $autocomplete.children('li').length,
$active = $autocomplete.children('.active').first();
// select element on Enter
if (keyCode === 13 && activeIndex >= 0) {
liElement = $autocomplete.children('li').eq(activeIndex);
if (liElement.length) {
liElement.trigger('mousedown.autocomplete');
e.preventDefault();
}
return;
}
// Capture up and down key
if (keyCode === 38 || keyCode === 40) {
e.preventDefault();
if (keyCode === 38 &&
activeIndex > 0) {
activeIndex--;
}
if (keyCode === 40 &&
activeIndex < (numItems - 1)) {
activeIndex++;
}
$active.removeClass('active');
if (activeIndex >= 0) {
$autocomplete.children('li').eq(activeIndex).addClass('active');
}
}
});
// Set input value
$autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
var text = $(this).text().trim();
$input.val(text);
$input.trigger('change');
removeAutocomplete();
// Handle onAutocomplete callback.
if (typeof (options.onAutocomplete) === "function") {
options.onAutocomplete.call(this, text);
}
});
}
});
};
}); // End of $(document).ready
/*******************
* Select Plugin *
******************/
$.fn.material_select = function (callback) {
$(this).each(function () {
var $select = $(this);
if ($select.hasClass('browser-default')) {
return; // Continue to next (return false breaks out of entire loop)
}
var multiple = $select.attr('multiple') ? true : false,
lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
if (lastID) {
$select.parent().find('span.caret').remove();
$select.parent().find('input').remove();
$select.unwrap();
$('ul#select-options-' + lastID).remove();
}
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
if (callback === 'destroy') {
$select.data('select-id', null).removeClass('initialized');
return;
}
var uniqueID = Materialize.guid();
$select.data('select-id', uniqueID);
var wrapper = $('');
wrapper.addClass($select.attr('class'));
var options = $(' selectChildren = $select.children('option, optgroup'),
valuesSelected = [],
optionsHover = false;
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
// Function that renders and appends the option taking into
// account type and possible image icon.
var appendOptionWithIcon = function (select, option, type) {
// Add disabled attr if disabled
var disabledClass = (option.is(':disabled')) ? 'disabled ' : ;
var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ;
var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ;
// add icons
var icon_url = option.data('icon');
var classes = option.attr('class');
if (!!icon_url) {
var classString = ;
if (!!classes) classString = ' class="' + classes + '"';
// Check for multiple type.options.append($('
return true;
}
// Check for multiple type.options.append($('
};
/* Create dropdown structure. */
if (selectChildren.length) {
selectChildren.each(function () {
if ($(this).is('option')) {
// Direct descendant option.
if (multiple) {
appendOptionWithIcon($select, $(this), 'multiple');
} else {
appendOptionWithIcon($select, $(this));
}
} else if ($(this).is('optgroup')) {
// Optgroup.
var selectOptions = $(this).children('option');
options.append($(' selectOptions.each(function () {
appendOptionWithIcon($select, $(this), 'optgroup-option');
});
}
});
}
options.find('li:not(.optgroup)').each(function (i) {
$(this).click(function (e) {
// Check if option element is disabled
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
var selected = true;
if (multiple) {
$('input[type="checkbox"]', this).prop('checked', function (i, v) {
return !v;
});
selected = toggleEntryFromArray(valuesSelected, i, $select);
$newSelect.trigger('focus');
} else {
options.find('li').removeClass('active');
$(this).toggleClass('active');
$newSelect.val($(this).text());
}
activateOption(options, $(this));
$select.find('option').eq(i).prop('selected', selected);
// Trigger onchange() event
$select.trigger('change');
if (typeof callback !== 'undefined') callback();
}
e.stopPropagation();
});
});
// Wrap Elements
$select.wrap(wrapper);
// Add Select Display Element
var dropdownIcon = $('▼');
if ($select.is(':disabled'))
dropdownIcon.addClass('disabled');
// escape double quotes
var sanitizedLabelHtml = label.replace(/"/g, '"');
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : ) + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
$select.before($newSelect);
$newSelect.before(dropdownIcon);
$newSelect.after(options);
// Check if section element is disabled
if (!$select.is(':disabled')) {
$newSelect.dropdown({
'hover': false
});
}
// Copy tabindex
if ($select.attr('tabindex')) {
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
}
$select.addClass('initialized');
$newSelect.on({
'focus': function () {
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
$('input.select-dropdown').trigger('close');
}
if (!options.is(':visible')) {
$(this).trigger('open', ['focus']);
var label = $(this).val();
if (multiple && label.indexOf(',') >= 0) {
label = label.split(',')[0];
}
var selectedOption = options.find('li').filter(function () {
return $(this).text().toLowerCase() === label.toLowerCase();
})[0];
activateOption(options, selectedOption, true);
}
},
'click': function (e) {
e.stopPropagation();
}
});
$newSelect.on('blur', function () {
if (!multiple) {
$(this).trigger('close');
}
options.find('li.selected').removeClass('selected');
});
options.hover(function () {
optionsHover = true;
}, function () {
optionsHover = false;
});
$(window).on({
'click': function () {
multiple && (optionsHover || $newSelect.trigger('close'));
}
});
// Add initial multiple selections.
if (multiple) {
$select.find("option:selected:not(:disabled)").each(function () {
var index = $(this).index();
toggleEntryFromArray(valuesSelected, index, $select);
options.find("li").eq(index).find(":checkbox").prop("checked", true);
});
}
/**
* Make option as selected and scroll to selected position
* @param {jQuery} collection Select options jQuery element
* @param {Element} newOption element of the new option
* @param {Boolean} firstActivation If on first activation of select
*/
var activateOption = function (collection, newOption, firstActivation) {
if (newOption) {
collection.find('li.selected').removeClass('selected');
var option = $(newOption);
option.addClass('selected');
if (!multiple || !!firstActivation) {
options.scrollTo(option);
}
}
};
// Allow user to search by typing
// this array is cleared after 1 second
var filterQuery = [],
onKeyDown = function (e) {
// TAB - switch to another input
if (e.which == 9) {
$newSelect.trigger('close');
return;
}
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
if (e.which == 40 && !options.is(':visible')) {
$newSelect.trigger('open');
return;
}
// ENTER WHEN SELECT IS CLOSED - submit form
if (e.which == 13 && !options.is(':visible')) {
return;
}
e.preventDefault();
// CASE WHEN USER TYPE LETTERS
var letter = String.fromCharCode(e.which).toLowerCase(),
nonLetters = [9, 13, 27, 38, 40];
if (letter && (nonLetters.indexOf(e.which) === -1)) {
filterQuery.push(letter);
var string = filterQuery.join(),
newOption = options.find('li').filter(function () {
return $(this).text().toLowerCase().indexOf(string) === 0;
})[0];
if (newOption) {
activateOption(options, newOption);
}
}
// ENTER - select option and close when select options are opened
if (e.which == 13) {
var activeOption = options.find('li.selected:not(.disabled)')[0];
if (activeOption) {
$(activeOption).trigger('click');
if (!multiple) {
$newSelect.trigger('close');
}
}
}
// ARROW DOWN - move to next not disabled option
if (e.which == 40) {
if (options.find('li.selected').length) {
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
} else {
newOption = options.find('li:not(.disabled)')[0];
}
activateOption(options, newOption);
}
// ESC - close options
if (e.which == 27) {
$newSelect.trigger('close');
}
// ARROW UP - move to previous not disabled option
if (e.which == 38) {
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
if (newOption)
activateOption(options, newOption);
}
// Automaticaly clean filter query so user can search again by starting letters
setTimeout(function () {
filterQuery = [];
}, 1000);
};
$newSelect.on('keydown', onKeyDown);
});
function toggleEntryFromArray(entriesArray, entryIndex, select) {
var index = entriesArray.indexOf(entryIndex),
notAdded = index === -1;
if (notAdded) {
entriesArray.push(entryIndex);
} else {
entriesArray.splice(index, 1);
}
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
// use notAdded instead of true (to detect if the option is selected or not)
select.find('option').eq(entryIndex).prop('selected', notAdded);
setValueToInput(entriesArray, select);
return notAdded;
}
function setValueToInput(entriesArray, select) {
var value = ;
for (var i = 0, count = entriesArray.length; i < count; i++) {
var text = select.find('option').eq(entriesArray[i]).text();
i === 0 ? value += text : value += ', ' + text;
}
if (value === ) {
value = select.find('option:disabled').eq(0).text();
}
select.siblings('input.select-dropdown').val(value);
}
};
}(jQuery));; (function ($) {
var methods = {
init: function (options) {
var defaults = {
indicators: true,
height: 400,
transition: 500,
interval: 6000
};
options = $.extend(defaults, options);
return this.each(function () {
// For each slider, we want to keep track of
// which slide is active and its associated content
var $this = $(this);
var $slider = $this.find('ul.slides').first();
var $slides = $slider.find('> li');
var $active_index = $slider.find('.active').index();
var $active, $indicators, $interval;
if ($active_index != -1) {
$active = $slides.eq($active_index);
}
// Transitions the caption depending on alignment
function captionTransition(caption, duration) {
if (caption.hasClass("center-align")) {
caption.velocity({
opacity: 0,
translateY: -100
}, {
duration: duration,
queue: false
});
} else if (caption.hasClass("right-align")) {
caption.velocity({
opacity: 0,
translateX: 100
}, {
duration: duration,
queue: false
});
} else if (caption.hasClass("left-align")) {
caption.velocity({
opacity: 0,
translateX: -100
}, {
duration: duration,
queue: false
});
}
}
// This function will transition the slide to any index of the next slide
function moveToSlide(index) {
// Wrap around indices.
if (index >= $slides.length) index = 0;
else if (index < 0) index = $slides.length - 1;
$active_index = $slider.find('.active').index();
// Only do if index changes
if ($active_index != index) {
$active = $slides.eq($active_index);
$caption = $active.find('.caption');
$active.removeClass('active');
$active.velocity({
opacity: 0
}, {
duration: options.transition,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$slides.not('.active').velocity({
opacity: 0,
translateX: 0,
translateY: 0
}, {
duration: 0,
queue: false
});
}
});
captionTransition($caption, options.transition);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).removeClass('active');
}
$slides.eq(index).velocity({
opacity: 1
}, {
duration: options.transition,
queue: false,
easing: 'easeOutQuad'
});
$slides.eq(index).find('.caption').velocity({
opacity: 1,
translateX: 0,
translateY: 0
}, {
duration: options.transition,
delay: options.transition,
queue: false,
easing: 'easeOutQuad'
});
$slides.eq(index).addClass('active');
// Update indicators
if (options.indicators) {
$indicators.eq(index).addClass('active');
}
}
}
// Set height of slider
// If fullscreen, do nothing
if (!$this.hasClass('fullscreen')) {
if (options.indicators) {
// Add height if indicators are present
$this.height(options.height + 40);
} else {
$this.height(options.height);
}
$slider.height(options.height);
}
// Set initial positions of captions
$slides.find('.caption').each(function () {
captionTransition($(this), 0);
});
// Move img src into background-image
$slides.find('img').each(function () {
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
if ($(this).attr('src') !== placeholderBase64) {
$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
$(this).attr('src', placeholderBase64);
}
});
// dynamically add indicators
if (options.indicators) {
$indicators = $(' $slides.each(function (index) {
var $indicator = $('');
// Handle clicks on indicators
$indicator.click(function () {
var $parent = $slider.parent();
var curr_index = $parent.find($(this)).index();
moveToSlide(curr_index);
// reset interval
clearInterval($interval);
$interval = setInterval(
function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval
);
});
$indicators.append($indicator);
});
$this.append($indicators);
$indicators = $this.find('ul.indicators').find('li.indicator-item');
}
if ($active) {
$active.show();
} else {
$slides.first().addClass('active').velocity({
opacity: 1
}, {
duration: options.transition,
queue: false,
easing: 'easeOutQuad'
});
$active_index = 0;
$active = $slides.eq($active_index);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).addClass('active');
}
}
// Adjust height to current slide
$active.find('img').each(function () {
$active.find('.caption').velocity({
opacity: 1,
translateX: 0,
translateY: 0
}, {
duration: options.transition,
queue: false,
easing: 'easeOutQuad'
});
});
// auto scroll
$interval = setInterval(
function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
}, options.transition + options.interval
);
// HammerJS, Swipe navigation
// Touch Event
var panning = false;
var swipeLeft = false;
var swipeRight = false;
$this.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
// reset interval
clearInterval($interval);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
var velocityY = e.gesture.velocityY;
$curr_slide = $slider.find('.active');
if (Math.abs(velocityX) > Math.abs(velocityY)) {
$curr_slide.velocity({
translateX: x
}, {
duration: 50,
queue: false,
easing: 'easeOutQuad'
});
}
// Swipe Left
if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
swipeRight = true;
}
// Swipe Right
else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
swipeLeft = true;
}
// Make Slide Behind active slide visible
var next_slide;
if (swipeLeft) {
next_slide = $curr_slide.next();
if (next_slide.length === 0) {
next_slide = $slides.first();
}
next_slide.velocity({
opacity: 1
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
}
if (swipeRight) {
next_slide = $curr_slide.prev();
if (next_slide.length === 0) {
next_slide = $slides.last();
}
next_slide.velocity({
opacity: 1
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType === "touch") {
$curr_slide = $slider.find('.active');
panning = false;
curr_index = $slider.find('.active').index();
if (!swipeRight && !swipeLeft || $slides.length <= 1) {
// Return to original spot
$curr_slide.velocity({
translateX: 0
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad'
});
} else if (swipeLeft) {
moveToSlide(curr_index + 1);
$curr_slide.velocity({
translateX: -1 * $this.innerWidth()
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({
opacity: 0,
translateX: 0
}, {
duration: 0,
queue: false
});
}
});
} else if (swipeRight) {
moveToSlide(curr_index - 1);
$curr_slide.velocity({
translateX: $this.innerWidth()
}, {
duration: 300,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({
opacity: 0,
translateX: 0
}, {
duration: 0,
queue: false
});
}
});
}
swipeLeft = false;
swipeRight = false;
// Restart interval
clearInterval($interval);
$interval = setInterval(
function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval
);
}
});
$this.on('sliderPause', function () {
clearInterval($interval);
});
$this.on('sliderStart', function () {
clearInterval($interval);
$interval = setInterval(
function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval
);
});
$this.on('sliderNext', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
});
$this.on('sliderPrev', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index - 1);
});
});
},
pause: function () {
$(this).trigger('sliderPause');
},
start: function () {
$(this).trigger('sliderStart');
},
next: function () {
$(this).trigger('sliderNext');
},
prev: function () {
$(this).trigger('sliderPrev');
}
};
$.fn.slider = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
}
}; // Plugin end
}(jQuery));; (function ($) {
$(document).ready(function () {
$(document).on('click.card', '.card', function (e) {
if ($(this).find('> .card-reveal').length) {
var $card = $(e.target).closest('.card');
if ($card.data('initialOverflow') === undefined) {
$card.data(
'initialOverflow',
$card.css('overflow') === undefined ? : $card.css('overflow')
);
}
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
// Make Reveal animate down and display none
$(this).find('.card-reveal').velocity({
translateY: 0
}, {
duration: 225,
queue: false,
easing: 'easeInOutQuad',
complete: function () {
$(this).css({
display: 'none'
});
$card.css('overflow', $card.data('initialOverflow'));
}
});
} else if ($(e.target).is($('.card .activator')) ||
$(e.target).is($('.card .activator i'))) {
$card.css('overflow', 'hidden');
$(this).find('.card-reveal').css({
display: 'block'
}).velocity("stop", false).velocity({
translateY: '-100%'
}, {
duration: 300,
queue: false,
easing: 'easeInOutQuad'
});
}
}
});
});
}(jQuery));; (function ($) {
var materialChipsDefaults = {
data: [],
placeholder: ,
secondaryPlaceholder: ,
autocompleteOptions: {},
};
$(document).ready(function () {
// Handle removal of static chips.
$(document).on('click', '.chip .close', function (e) {
var $chips = $(this).closest('.chips');
if ($chips.attr('data-initialized')) {
return;
}
$(this).closest('.chip').remove();
});
});
$.fn.material_chip = function (options) {
var self = this;
this.$el = $(this);
this.$document = $(document);
this.SELS = {
CHIPS: '.chips',
CHIP: '.chip',
INPUT: 'input',
DELETE: '.material-icons',
SELECTED_CHIP: '.selected',
};
if ('data' === options) {
return this.$el.data('chips');
}
var curr_options = $.extend({}, materialChipsDefaults, options);
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
// Initialize
this.init = function () {
var i = 0;
var chips;
self.$el.each(function () {
var $chips = $(this);
var chipId = Materialize.guid();
self.chipId = chipId;
if (!curr_options.data || !(curr_options.data instanceof Array)) {
curr_options.data = [];
}
$chips.data('chips', curr_options.data);
$chips.attr('data-index', i);
$chips.attr('data-initialized', true);
if (!$chips.hasClass(self.SELS.CHIPS)) {
$chips.addClass('chips');
}
self.chips($chips, chipId);
i++;
});
};
this.handleEvents = function () {
var SELS = self.SELS;
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
$(e.target).find(SELS.INPUT).focus();
});
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
var $chip = $(e.target);
if ($chip.length) {
var wasSelected = $chip.hasClass('selected');
var $chips = $chip.closest(SELS.CHIPS);
$(SELS.CHIP).removeClass('selected');
if (!wasSelected) {
self.selectChip($chip.index(), $chips);
}
}
});
self.$document.off('keydown.chips').on('keydown.chips', function (e) {
if ($(e.target).is('input, textarea')) {
return;
}
// delete
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
var $chips = $chip.closest(SELS.CHIPS);
var length = $chip.siblings(SELS.CHIP).length;
var index;
if (!$chip.length) {
return;
}
if (e.which === 8 || e.which === 46) {
e.preventDefault();
index = $chip.index();
self.deleteChip(index, $chips);
var selectIndex = null;
if ((index + 1) < length) {
selectIndex = index;
} else if (index === length || (index + 1) === length) {
selectIndex = length - 1;
}
if (selectIndex < 0) selectIndex = null;
if (null !== selectIndex) {
self.selectChip(selectIndex, $chips);
}
if (!length) $chips.find('input').focus();
// left
} else if (e.which === 37) {
index = $chip.index() - 1;
if (index < 0) {
return;
}
$(SELS.CHIP).removeClass('selected');
self.selectChip(index, $chips);
// right
} else if (e.which === 39) {
index = $chip.index() + 1;
$(SELS.CHIP).removeClass('selected');
if (index > length) {
$chips.find('input').focus();
return;
}
self.selectChip(index, $chips);
}
});
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.addClass('focus');
$currChips.siblings('label, .prefix').addClass('active');
$(SELS.CHIP).removeClass('selected');
});
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.removeClass('focus');
// Remove active if empty
if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
$currChips.siblings('label').removeClass('active');
}
$currChips.siblings('.prefix').removeClass('active');
});
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var chipsLength = $chips.children(SELS.CHIP).length;
// enter
if (13 === e.which) {
// Override enter if autocompleting.
if (self.hasAutocomplete &&
$chips.find('.autocomplete-content.dropdown-content').length &&
$chips.find('.autocomplete-content.dropdown-content').children().length) {
return;
}
e.preventDefault();
self.addChip({
tag: $target.val()
}, $chips);
$target.val();
return;
}
// delete or left
if ((8 === e.keyCode || 37 === e.keyCode) && === $target.val() && chipsLength) {
e.preventDefault();
self.selectChip(chipsLength - 1, $chips);
$target.blur();
return;
}
});
// Click on delete icon in chip.
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var $chip = $target.closest(SELS.CHIP);
e.stopPropagation();
self.deleteChip($chip.index(), $chips);
$chips.find('input').focus();
});
};
this.chips = function ($chips, chipId) {
$chips.empty();
$chips.data('chips').forEach(function (elem) {
$chips.append(self.renderChip(elem));
});
$chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
self.setPlaceholder($chips);
// Set for attribute for label
var label = $chips.next('label');
if (label.length) {
label.attr('for', chipId);
if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
label.addClass('active');
}
}
// Setup autocomplete if needed.
var input = $('#' + chipId);
if (self.hasAutocomplete) {
curr_options.autocompleteOptions.onAutocomplete = function (val) {
self.addChip({
tag: val
}, $chips);
input.val();
input.focus();
}
input.autocomplete(curr_options.autocompleteOptions);
}
};
/**
* Render chip jQuery element.
* @param {Object} elem
* @return {jQuery}
*/
this.renderChip = function (elem) {
if (!elem.tag) return;
var $renderedChip = $('');
$renderedChip.text(elem.tag);
if (elem.image) {
$renderedChip.prepend($('<img />').attr('src', elem.image))
}
$renderedChip.append($('<i class="material-icons close">close'));
return $renderedChip;
};
this.setPlaceholder = function ($chips) {
if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) {
$chips.find('input').prop('placeholder', curr_options.placeholder);
} else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
}
};
this.isValid = function ($chips, elem) {
var chips = $chips.data('chips');
var exists = false;
for (var i = 0; i < chips.length; i++) {
if (chips[i].tag === elem.tag) {
exists = true;
return;
}
}
return !== elem.tag && !exists;
};
this.addChip = function (elem, $chips) {
if (!self.isValid($chips, elem)) {
return;
}
var $renderedChip = self.renderChip(elem);
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
newData.push(oldData[i]);
}
newData.push(elem);
$chips.data('chips', newData);
$renderedChip.insertBefore($chips.find('input'));
$chips.trigger('chip.add', elem);
self.setPlaceholder($chips);
};
this.deleteChip = function (chipIndex, $chips) {
var chip = $chips.data('chips')[chipIndex];
$chips.find('.chip').eq(chipIndex).remove();
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
if (i !== chipIndex) {
newData.push(oldData[i]);
}
}
$chips.data('chips', newData);
$chips.trigger('chip.delete', chip);
self.setPlaceholder($chips);
};
this.selectChip = function (chipIndex, $chips) {
var $chip = $chips.find('.chip').eq(chipIndex);
if ($chip && false === $chip.hasClass('selected')) {
$chip.addClass('selected');
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
}
};
this.getChipsElement = function (index, $chips) {
return $chips.eq(index);
};
// init
this.init();
this.handleEvents(); };
}(jQuery));; (function ($) {
$.fn.pushpin = function (options) {
// Defaults
var defaults = {
top: 0,
bottom: Infinity,
offset: 0
};
// Remove pushpin event and classes
if (options === "remove") {
this.each(function () {
if (id = $(this).data('pushpin-id')) {
$(window).off('scroll.' + id);
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
}
});
return false;
}
options = $.extend(defaults, options);
$index = 0;
return this.each(function () {
var $uniqueId = Materialize.guid(),
$this = $(this),
$original_offset = $(this).offset().top;
function removePinClasses(object) {
object.removeClass('pin-top');
object.removeClass('pinned');
object.removeClass('pin-bottom');
}
function updateElements(objects, scrolled) {
objects.each(function () {
// Add position fixed (because its between top and bottom)
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
removePinClasses($(this));
$(this).css('top', options.offset);
$(this).addClass('pinned');
}
// Add pin-top (when scrolled position is above top)
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
removePinClasses($(this));
$(this).css('top', 0);
$(this).addClass('pin-top');
}
// Add pin-bottom (when scrolled position is below bottom)
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
removePinClasses($(this));
$(this).addClass('pin-bottom');
$(this).css('top', options.bottom - $original_offset);
}
});
}
$(this).data('pushpin-id', $uniqueId);
updateElements($this, $(window).scrollTop());
$(window).on('scroll.' + $uniqueId, function () {
var $scrolled = $(window).scrollTop() + options.offset;
updateElements($this, $scrolled);
});
});
};
}(jQuery));; (function ($) {
$(document).ready(function () {
// jQuery reverse
$.fn.reverse = [].reverse;
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
openFABMenu($this);
});
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
closeFABMenu($this);
});
// Toggle-on-click behaviour.
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
if ($menu.hasClass('active')) {
closeFABMenu($menu);
} else {
openFABMenu($menu);
}
});
// Toolbar transition behaviour.
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
FABtoToolbar($menu);
});
});
$.fn.extend({
openFAB: function () {
openFABMenu($(this));
},
closeFAB: function () {
closeFABMenu($(this));
},
openToolbar: function () {
FABtoToolbar($(this));
},
closeToolbar: function () {
toolbarToFAB($(this));
}
});
var openFABMenu = function (btn) {
var $this = btn;
if ($this.hasClass('active') === false) {
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.addClass('active');
$this.find('ul .btn-floating').velocity({
scaleY: ".4",
scaleX: ".4",
translateY: offsetY + 'px',
translateX: offsetX + 'px'
}, {
duration: 0
});
var time = 0;
$this.find('ul .btn-floating').reverse().each(function () {
$(this).velocity({
opacity: "1",
scaleX: "1",
scaleY: "1",
translateY: "0",
translateX: '0'
}, {
duration: 80,
delay: time
});
time += 40;
});
}
};
var closeFABMenu = function (btn) {
var $this = btn;
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.removeClass('active');
var time = 0;
$this.find('ul .btn-floating').velocity("stop", true);
$this.find('ul .btn-floating').velocity({
opacity: "0",
scaleX: ".4",
scaleY: ".4",
translateY: offsetY + 'px',
translateX: offsetX + 'px'
}, {
duration: 80
});
};
/**
* Transform FAB into toolbar
* @param {Object} object jQuery object
*/
var FABtoToolbar = function (btn) {
if (btn.attr('data-open') === "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnRect = btn[0].getBoundingClientRect();
var anchor = btn.find('> a').first();
var menu = btn.find('> ul').first();
var backdrop = $('');
var fabColor = anchor.css('background-color');
anchor.append(backdrop);
offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
offsetY = windowHeight - btnRect.bottom;
scaleFactor = windowWidth / backdrop.width();
btn.attr('data-origin-bottom', btnRect.bottom);
btn.attr('data-origin-left', btnRect.left);
btn.attr('data-origin-width', btnRect.width);
// Set initial state
btn.addClass('active');
btn.attr('data-open', true);
btn.css({
'text-align': 'center',
width: '100%',
bottom: 0,
left: 0,
transform: 'translateX(' + offsetX + 'px)',
transition: 'none'
});
anchor.css({
transform: 'translateY(' + -offsetY + 'px)',
transition: 'none'
});
backdrop.css({
'background-color': fabColor
});
setTimeout(function () {
btn.css({
transform: ,
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
});
anchor.css({
overflow: 'visible',
transform: ,
transition: 'transform .2s'
});
setTimeout(function () {
btn.css({
overflow: 'hidden',
'background-color': fabColor
});
backdrop.css({
transform: 'scale(' + scaleFactor + ')',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
menu.find('> li > a').css({
opacity: 1
});
// Scroll to close.
$(window).on('scroll.fabToolbarClose', function () {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
});
$(document).on('click.fabToolbarClose', function (e) {
if (!$(e.target).closest(menu).length) {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
}
});
}, 100);
}, 0);
};
/**
* Transform toolbar back into FAB
* @param {Object} object jQuery object
*/
var toolbarToFAB = function (btn) {
if (btn.attr('data-open') !== "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnWidth = btn.attr('data-origin-width');
var btnBottom = btn.attr('data-origin-bottom');
var btnLeft = btn.attr('data-origin-left');
var anchor = btn.find('> .btn-floating').first();
var menu = btn.find('> ul').first();
var backdrop = btn.find('.fab-backdrop');
var fabColor = anchor.css('background-color');
offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
offsetY = windowHeight - btnBottom;
scaleFactor = windowWidth / backdrop.width();
// Hide backdrop
btn.removeClass('active');
btn.attr('data-open', false);
btn.css({
'background-color': 'transparent',
transition: 'none'
});
anchor.css({
transition: 'none'
});
backdrop.css({
transform: 'scale(0)',
'background-color': fabColor
});
menu.find('> li > a').css({
opacity:
});
setTimeout(function () {
backdrop.remove();
// Set initial state.
btn.css({
'text-align': ,
width: ,
bottom: ,
left: ,
overflow: ,
'background-color': ,
transform: 'translate3d(' + -offsetX + 'px,0,0)'
});
anchor.css({
overflow: ,
transform: 'translate3d(0,' + offsetY + 'px,0)'
});
setTimeout(function () {
btn.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s'
});
anchor.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
}, 20);
}, 200);
};
}(jQuery));;
(function ($) {
// Image transition function
Materialize.fadeInImage = function (selectorOrEl) {
var element;
if (typeof (selectorOrEl) === 'string') {
element = $(selectorOrEl);
} else if (typeof (selectorOrEl) === 'object') {
element = selectorOrEl;
} else {
return;
}
element.css({
opacity: 0
});
$(element).velocity({
opacity: 1
}, {
duration: 650,
queue: false,
easing: 'easeOutSine'
});
$(element).velocity({
opacity: 1
}, {
duration: 1300,
queue: false,
easing: 'swing',
step: function (now, fx) {
fx.start = 100;
var grayscale_setting = now / 100;
var brightness_setting = 150 - (100 - now) / 1.75;
if (brightness_setting < 100) {
brightness_setting = 100;
}
if (now >= 0) {
$(this).css({
"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
});
}
}
});
};
// Horizontal staggered list
Materialize.showStaggeredList = function (selectorOrEl) {
var element;
if (typeof (selectorOrEl) === 'string') {
element = $(selectorOrEl);
} else if (typeof (selectorOrEl) === 'object') {
element = selectorOrEl;
} else {
return;
}
var time = 0;
element.find('li').velocity({
translateX: "-100px"
}, {
duration: 0
});
element.find('li').each(function () {
$(this).velocity({
opacity: "1",
translateX: "0"
}, {
duration: 800,
delay: time,
easing: [60, 10]
});
time += 120;
});
};
$(document).ready(function () {
// Hardcoded .staggered-list scrollFire
// var staggeredListOptions = [];
// $('ul.staggered-list').each(function (i) {
// var label = 'scrollFire-' + i;
// $(this).addClass(label);
// staggeredListOptions.push(
// {selector: 'ul.staggered-list.' + label,
// offset: 200,
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
// });
// scrollFire(staggeredListOptions);
// HammerJS, Swipe navigation
// Touch Event
var swipeLeft = false;
var swipeRight = false;
// Dismissible Collections
$('.dismissable').each(function () {
$(this).hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
var $this = $(this);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
$this.velocity({
translateX: x
}, {
duration: 50,
queue: false,
easing: 'easeOutQuad'
});
// Swipe Left
if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
swipeLeft = true;
}
// Swipe Right
if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
swipeRight = true;
}
}
}).on('panend', function (e) {
// Reset if collection is moved back into original position
if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
swipeRight = false;
swipeLeft = false;
}
if (e.gesture.pointerType === "touch") {
var $this = $(this);
if (swipeLeft || swipeRight) {
var fullWidth;
if (swipeLeft) {
fullWidth = $this.innerWidth();
} else {
fullWidth = -1 * $this.innerWidth();
}
$this.velocity({
translateX: fullWidth,
}, {
duration: 100,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$this.css('border', 'none');
$this.velocity({
height: 0,
padding: 0,
}, {
duration: 200,
queue: false,
easing: 'easeOutQuad',
complete: function () {
$this.remove();
}
});
}
});
} else {
$this.velocity({
translateX: 0,
}, {
duration: 100,
queue: false,
easing: 'easeOutQuad'
});
}
swipeLeft = false;
swipeRight = false;
}
});
});
// time = 0
// // Vertical Staggered list
// $('ul.staggered-list.vertical li').velocity(
// { translateY: "100px"},
// { duration: 0 });
// $('ul.staggered-list.vertical li').each(function() {
// $(this).velocity(
// { opacity: "1", translateY: "0"},
// { duration: 800, delay: time, easing: [60, 25] });
// time += 120;
// });
// // Fade in and Scale
// $('.fade-in.scale').velocity(
// { scaleX: .4, scaleY: .4, translateX: -600},
// { duration: 0});
// $('.fade-in').each(function() {
// $(this).velocity(
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
// { duration: 800, easing: [60, 10] });
// });
});
}(jQuery));; (function ($) {
var scrollFireEventsHandled = false;
// Input: Array of JSON objects {selector, offset, callback}
Materialize.scrollFire = function (options) {
var onScroll = function () {
var windowScroll = window.pageYOffset + window.innerHeight;
for (var i = 0; i < options.length; i++) {
// Get options from each line
var value = options[i];
var selector = value.selector,
offset = value.offset,
callback = value.callback;
var currentElement = document.querySelector(selector);
if (currentElement !== null) {
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
if (windowScroll > (elementOffset + offset)) {
if (value.done !== true) {
if (typeof (callback) === 'function') {
callback.call(this, currentElement);
} else if (typeof (callback) === 'string') {
var callbackFunc = new Function(callback);
callbackFunc(currentElement);
}
value.done = true;
}
}
}
}
};
var throttledScroll = Materialize.throttle(function () {
onScroll();
}, options.throttle || 100);
if (!scrollFireEventsHandled) {
window.addEventListener("scroll", throttledScroll);
window.addEventListener("resize", throttledScroll);
scrollFireEventsHandled = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(throttledScroll, 0);
};
})(jQuery);; /*!
* pickadate.js v3.5.0, 2014/04/13 * By Amsul, http://amsul.ca * Hosted on http://amsul.github.io/pickadate.js * Licensed under MIT */
(function (factory) {
// AMD.
if (typeof define == 'function' && define.amd)
define('picker', ['jquery'], factory)
// Node.js/browserify.
else if (typeof exports == 'object')
module.exports = factory(require('jquery'))
// Browser globals. else this.Picker = factory(jQuery)
}(function ($) {
var $window = $(window) var $document = $(document) var $html = $(document.documentElement)
/**
* The picker constructor that creates a blank picker.
*/
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
// If there’s no element, return the picker constructor.
if (!ELEMENT) return PickerConstructor
var
IS_DEFAULT_THEME = false,
// The state of the picker.
STATE = {
id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
},
// Merge the defaults and options passed.
SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
// Merge the default classes with the settings classes.
CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
// The element node wrapper into a jQuery object.
$ELEMENT = $(ELEMENT),
// Pseudo picker constructor.
PickerInstance = function () {
return this.start()
},
// The picker prototype.
P = PickerInstance.prototype = {
constructor: PickerInstance,
$node: $ELEMENT,
/**
* Initialize everything
*/
start: function () {
// If it’s already started, do nothing.
if (STATE && STATE.start) return P
// Update the picker states.
STATE.methods = {}
STATE.start = true
STATE.open = false
STATE.type = ELEMENT.type
// Confirm focus state, convert into text input to remove UA stylings,
// and set as readonly to prevent keyboard popup.
ELEMENT.autofocus = ELEMENT == getActiveElement()
ELEMENT.readOnly = !SETTINGS.editable
ELEMENT.id = ELEMENT.id || STATE.id
if (ELEMENT.type != 'text') {
ELEMENT.type = 'text'
}
// Create a new picker component with the settings.
P.component = new COMPONENT(P, SETTINGS)
// Create the picker root with a holder and then prepare it.
P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'))
prepareElementRoot()
// If there’s a format for the hidden input element, create the element.
if (SETTINGS.formatSubmit) {
prepareElementHidden()
}
// Prepare the input element.
prepareElement()
// Insert the root as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P.$root)
else $ELEMENT.after(P.$root)
// Bind the default component and settings events.
P.on({
start: P.component.onStart,
render: P.component.onRender,
stop: P.component.onStop,
open: P.component.onOpen,
close: P.component.onClose,
set: P.component.onSet
}).on({
start: SETTINGS.onStart,
render: SETTINGS.onRender,
stop: SETTINGS.onStop,
open: SETTINGS.onOpen,
close: SETTINGS.onClose,
set: SETTINGS.onSet
})
// Once we’re all set, check the theme in use.
IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0])
// If the element has autofocus, open the picker.
if (ELEMENT.autofocus) {
P.open()
}
// Trigger queued the “start” and “render” events.
return P.trigger('start').trigger('render')
}, //start
/**
* Render a new picker
*/
render: function (entireComponent) {
// Insert a new component holder in the root or box.
if (entireComponent) P.$root.html(createWrappedComponent())
else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open))
// Trigger the queued “render” events.
return P.trigger('render')
}, //render
/**
* Destroy everything
*/
stop: function () {
// If it’s already stopped, do nothing.
if (!STATE.start) return P
// Then close the picker.
P.close()
// Remove the hidden field.
if (P._hidden) {
P._hidden.parentNode.removeChild(P._hidden)
}
// Remove the root.
P.$root.remove()
// Remove the input class, remove the stored data, and unbind
// the events (after a tick for IE - see `P.close`).
$ELEMENT.removeClass(CLASSES.input).removeData(NAME)
setTimeout(function () {
$ELEMENT.off('.' + STATE.id)
}, 0)
// Restore the element state
ELEMENT.type = STATE.type
ELEMENT.readOnly = false
// Trigger the queued “stop” events.
P.trigger('stop')
// Reset the picker states.
STATE.methods = {}
STATE.start = false
return P
}, //stop
/**
* Open up the picker
*/
open: function (dontGiveFocus) {
// If it’s already open, do nothing.
if (STATE.open) return P
// Add the “active” class.
$ELEMENT.addClass(CLASSES.active)
aria(ELEMENT, 'expanded', true)
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So add the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Add the “opened” class to the picker root.
P.$root.addClass(CLASSES.opened)
aria(P.$root[0], 'hidden', false)
}, 0)
// If we have to give focus, bind the element and doc events.
if (dontGiveFocus !== false) {
// Set it as open.
STATE.open = true
// Prevent the page from scrolling.
if (IS_DEFAULT_THEME) {
$html.
css('overflow', 'hidden').
css('padding-right', '+=' + getScrollbarWidth())
}
// Pass focus to the root element’s jQuery object.
// * Workaround for iOS8 to bring the picker’s root into view.
P.$root.eq(0).focus()
// Bind the document events.
$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
var target = event.target
// If the target of the event is not the element, close the picker picker.
// * Don’t worry about clicks or focusins on the root because those don’t bubble up.
// Also, for Firefox, a click on an `option` element bubbles up directly
// to the doc. So make sure the target wasn't the doc.
// * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
// which causes the picker to unexpectedly close when right-clicking it. So make
// sure the event wasn’t a right-click.
if (target != ELEMENT && target != document && event.which != 3) {
// If the target was the holder that covers the screen,
// keep the element focused to maintain tabindex.
P.close(target === P.$root.children()[0])
}
}).on('keydown.' + STATE.id, function (event) {
var
// Get the keycode.
keycode = event.keyCode,
// Translate that to a selection change.
keycodeToMove = P.component.key[keycode],
// Grab the target.
target = event.target
// On escape, close the picker and give focus.
if (keycode == 27) {
P.close(true)
}
// Check if there is a key movement or “enter” keypress on the element.
else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
// Prevent the default action to stop page movement.
event.preventDefault()
// Trigger the key movement action.
if (keycodeToMove) {
PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)])
}
// On “enter”, if the highlighted item isn’t disabled, set the value and close.
else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
P.set('select', P.component.item.highlight).close()
}
}
// If the target is within the root and “enter” is pressed,
// prevent the default action and trigger a click on the target instead.
else if ($.contains(P.$root[0], target) && keycode == 13) {
event.preventDefault()
target.click()
}
})
}
// Trigger the queued “open” events.
return P.trigger('open')
}, //open
/**
* Close the picker
*/
close: function (giveFocus) {
// If we need to give focus, do it before changing states.
if (giveFocus) {
// ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
// The focus is triggered *after* the close has completed - causing it
// to open again. So unbind and rebind the event at the next tick.
P.$root.off('focus.toOpen').eq(0).focus()
setTimeout(function () {
P.$root.on('focus.toOpen', handleFocusToOpenEvent)
}, 0)
}
// Remove the “active” class.
$ELEMENT.removeClass(CLASSES.active)
aria(ELEMENT, 'expanded', false)
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So remove the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Remove the “opened” and “focused” class from the picker root.
P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused)
aria(P.$root[0], 'hidden', true)
}, 0)
// If it’s already closed, do nothing more.
if (!STATE.open) return P
// Set it as closed.
STATE.open = false
// Allow the page to scroll.
if (IS_DEFAULT_THEME) {
$html.
css('overflow', ).
css('padding-right', '-=' + getScrollbarWidth())
}
// Unbind the document events.
$document.off('.' + STATE.id)
// Trigger the queued “close” events.
return P.trigger('close')
}, //close
/**
* Clear the values
*/
clear: function (options) {
return P.set('clear', null, options)
}, //clear
/**
* Set something
*/
set: function (thing, value, options) {
var thingItem, thingValue,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {}
// Make sure we have usable options.
options = thingIsObject && $.isPlainObject(value) ? value : options || {}
if (thing) {
// If the thing isn’t an object, make it one.
if (!thingIsObject) {
thingObject[thing] = value
}
// Go through the things of items to set.
for (thingItem in thingObject) {
// Grab the value of the thing.
thingValue = thingObject[thingItem]
// First, if the item exists and there’s a value, set it.
if (thingItem in P.component.item) {
if (thingValue === undefined) thingValue = null
P.component.set(thingItem, thingValue, options)
}
// Then, check to update the element value and broadcast a change.
if (thingItem == 'select' || thingItem == 'clear') {
$ELEMENT.
val(thingItem == 'clear' ? : P.get(thingItem, SETTINGS.format)).
trigger('change')
}
}
// Render a new picker.
P.render()
}
// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
return options.muted ? P : P.trigger('set', thingObject)
}, //set
/**
* Get something
*/
get: function (thing, format) {
// Make sure there’s something to get.
thing = thing || 'value'
// If a picker state exists, return that.
if (STATE[thing] != null) {
return STATE[thing]
}
// Return the submission value, if that.
if (thing == 'valueSubmit') {
if (P._hidden) {
return P._hidden.value
}
thing = 'value'
}
// Return the value, if that.
if (thing == 'value') {
return ELEMENT.value
}
// Check if a component item exists, return that.
if (thing in P.component.item) {
if (typeof format == 'string') {
var thingValue = P.component.get(thing)
return thingValue ?
PickerConstructor._.trigger(
P.component.formats.toString,
P.component, [format, thingValue]
) :
}
return P.component.get(thing)
}
}, //get
/**
* Bind events on the things.
*/
on: function (thing, method, internal) {
var thingName, thingMethod,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {}
if (thing) {
// If the thing isn’t an object, make it one.
if (!thingIsObject) {
thingObject[thing] = method
}
// Go through the things to bind to.
for (thingName in thingObject) {
// Grab the method of the thing.
thingMethod = thingObject[thingName]
// If it was an internal binding, prefix it.
if (internal) {
thingName = '_' + thingName
}
// Make sure the thing methods collection exists.
STATE.methods[thingName] = STATE.methods[thingName] || []
// Add the method to the relative method collection.
STATE.methods[thingName].push(thingMethod)
}
}
return P
}, //on
/**
* Unbind events on the things.
*/
off: function () {
var i, thingName,
names = arguments;
for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
thingName = names[i]
if (thingName in STATE.methods) {
delete STATE.methods[thingName]
}
}
return P
},
/**
* Fire off method events.
*/
trigger: function (name, data) {
var _trigger = function (name) {
var methodList = STATE.methods[name]
if (methodList) {
methodList.map(function (method) {
PickerConstructor._.trigger(method, P, [data])
})
}
}
_trigger('_' + name)
_trigger(name)
return P
} //trigger
} //PickerInstance.prototype
/**
* Wrap the picker holder components together.
*/
function createWrappedComponent() {
// Create a picker wrapper holder
return PickerConstructor._.node('div',
// Create a picker wrapper node
PickerConstructor._.node('div',
// Create a picker frame
PickerConstructor._.node('div',
// Create a picker box node
PickerConstructor._.node('div',
// Create the components nodes.
P.component.nodes(STATE.open),
// The picker box class
CLASSES.box
),
// Picker wrap class
CLASSES.wrap
),
// Picker frame class
CLASSES.frame
),
// Picker holder class
CLASSES.holder
) //endreturn
} //createWrappedComponent
/**
* Prepare the input element with all bindings.
*/
function prepareElement() {
$ELEMENT.
// Store the picker data by component name.
data(NAME, P).
// Add the “input” class name.
addClass(CLASSES.input).
// Remove the tabindex.
attr('tabindex', -1).
// If there’s a `data-value`, update the value of the element.
val($ELEMENT.data('value') ?
P.get('select', SETTINGS.format) :
ELEMENT.value
)
// Only bind keydown events if the element isn’t editable.
if (!SETTINGS.editable) {
$ELEMENT.
// On focus/click, focus onto the root to open it up.
on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
event.preventDefault()
P.$root.eq(0).focus()
}).
// Handle keyboard event based on the picker being opened or not.
on('keydown.' + STATE.id, handleKeydownEvent)
}
// Update the aria attributes.
aria(ELEMENT, {
haspopup: true,
expanded: false,
readonly: false,
owns: ELEMENT.id + '_root'
})
}
/**
* Prepare the root picker element with all bindings.
*/
function prepareElementRoot() {
P.$root.
on({
// For iOS8.
keydown: handleKeydownEvent,
// When something within the root is focused, stop from bubbling
// to the doc and remove the “focused” state from the root.
focusin: function (event) {
P.$root.removeClass(CLASSES.focused)
event.stopPropagation()
},
// When something within the root holder is clicked, stop it
// from bubbling to the doc.
'mousedown click': function (event) {
var target = event.target
// Make sure the target isn’t the root holder so it can bubble up.
if (target != P.$root.children()[0]) {
event.stopPropagation()
// * For mousedown events, cancel the default action in order to
// prevent cases where focus is shifted onto external elements
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
// Also, for Firefox, don’t prevent action on the `option` element.
if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
event.preventDefault()
// Re-focus onto the root so that users can click away
// from elements focused within the picker.
P.$root.eq(0).focus()
}
}
}
}).
// Add/remove the “target” class on focus and blur.
on({
focus: function () {
$ELEMENT.addClass(CLASSES.target)
},
blur: function () {
$ELEMENT.removeClass(CLASSES.target)
}
}).
// Open the picker and adjust the root “focused” state
on('focus.toOpen', handleFocusToOpenEvent).
// If there’s a click on an actionable element, carry out the actions.
on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
var $target = $(this),
targetData = $target.data(),
targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
// * For IE, non-focusable elements can be active elements as well
// (http://stackoverflow.com/a/2684561).
activeElement = getActiveElement()
activeElement = activeElement && (activeElement.type || activeElement.href)
// If it’s disabled or nothing inside is actively focused, re-focus the element.
if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
P.$root.eq(0).focus()
}
// If something is superficially changed, update the `highlight` based on the `nav`.
if (!targetDisabled && targetData.nav) {
P.set('highlight', P.component.item.highlight, {
nav: targetData.nav
})
}
// If something is picked, set `select` then close with focus.
else if (!targetDisabled && 'pick' in targetData) {
P.set('select', targetData.pick)
}
// If a “clear” button is pressed, empty the values and close with focus.
else if (targetData.clear) {
P.clear().close(true)
} else if (targetData.close) {
P.close(true)
}
}) //P.$root
aria(P.$root[0], 'hidden', true)
}
/**
* Prepare the hidden input element along with all bindings.
*/
function prepareElementHidden() {
var name
if (SETTINGS.hiddenName === true) {
name = ELEMENT.name
ELEMENT.name =
} else {
name = [
typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : ,
typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
]
name = name[0] + ELEMENT.name + name[1]
}
P._hidden = $(
'<input ' +
'type=hidden ' +
// Create the name using the original input’s with a prefix and suffix.
'name="' + name + '"' +
// If the element has a value, set the hidden value as well.
(
$ELEMENT.data('value') || ELEMENT.value ?
' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
) +
'>'
)[0]
$ELEMENT.
// If the value changes, update the hidden input with the correct format.
on('change.' + STATE.id, function () {
P._hidden.value = ELEMENT.value ?
P.get('select', SETTINGS.formatSubmit) :
})
// Insert the hidden input as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P._hidden)
else $ELEMENT.after(P._hidden)
}
// For iOS8.
function handleKeydownEvent(event) {
var keycode = event.keyCode,
// Check if one of the delete keys was pressed.
isKeycodeDelete = /^(8|46)$/.test(keycode)
// For some reason IE clears the input value on “escape”.
if (keycode == 27) {
P.close()
return false
}
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
// Prevent it from moving the page and bubbling to doc.
event.preventDefault()
event.stopPropagation()
// If `delete` was pressed, clear the values and close the picker.
// Otherwise open the picker.
if (isKeycodeDelete) {
P.clear().close()
} else {
P.open()
}
}
}
// Separated for IE
function handleFocusToOpenEvent(event) {
// Stop the event from propagating to the doc.
event.stopPropagation()
// If it’s a focus event, add the “focused” class to the root.
if (event.type == 'focus') {
P.$root.addClass(CLASSES.focused)
}
// And then finally open the picker.
P.open()
}
// Return a new picker instance.
return new PickerInstance()
} //PickerConstructor
/**
* The default classes and prefix to use for the HTML classes.
*/
PickerConstructor.klasses = function (prefix) {
prefix = prefix || 'picker'
return {
picker: prefix,
opened: prefix + '--opened',
focused: prefix + '--focused',
input: prefix + '__input',
active: prefix + '__input--active',
target: prefix + '__input--target',
holder: prefix + '__holder',
frame: prefix + '__frame',
wrap: prefix + '__wrap',
box: prefix + '__box'
}
} //PickerConstructor.klasses
/**
* Check if the default theme is being used.
*/
function isUsingDefaultTheme(element) {
var theme,
prop = 'position'
// For IE.
if (element.currentStyle) {
theme = element.currentStyle[prop]
}
// For normal browsers.
else if (window.getComputedStyle) {
theme = getComputedStyle(element)[prop]
}
return theme == 'fixed' }
/**
* Get the width of the browser’s scrollbar.
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
*/
function getScrollbarWidth() {
if ($html.height() <= $window.height()) {
return 0
}
var $outer = $('<div style="visibility:hidden;width:100px" />').
appendTo('body')
// Get the width without scrollbars.
var widthWithoutScroll = $outer[0].offsetWidth
// Force adding scrollbars.
$outer.css('overflow', 'scroll')
// Add the inner div.
var $inner = $('<div style="width:100%" />').appendTo($outer)
// Get the width with scrollbars.
var widthWithScroll = $inner[0].offsetWidth
// Remove the divs.
$outer.remove()
// Return the difference between the widths.
return widthWithoutScroll - widthWithScroll
}
/**
* PickerConstructor helper methods.
*/
PickerConstructor._ = {
/**
* Create a group of nodes. Expects:
* `
{
min: {Integer},
max: {Integer},
i: {Integer},
node: {String},
item: {Function}
}
* `
*/
group: function (groupObject) {
var
// Scope for the looped object
loopObjectScope,
// Create the nodes list
nodesList = ,
// The counter starts from the `min`
counter = PickerConstructor._.trigger(groupObject.min, groupObject)
// Loop from the `min` to `max`, incrementing by `i`
for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
// Trigger the `item` function within scope of the object
loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter])
// Splice the subgroup and create nodes out of the sub nodes
nodesList += PickerConstructor._.node(
groupObject.node,
loopObjectScope[0], // the node
loopObjectScope[1], // the classes
loopObjectScope[2] // the attributes
)
}
// Return the list of nodes
return nodesList
}, //group
/**
* Create a dom node string
*/
node: function (wrapper, item, klass, attribute) {
// If the item is false-y, just return an empty string
if (!item) return
// If the item is an array, do a join
item = $.isArray(item) ? item.join() : item
// Check for the class
klass = klass ? ' class="' + klass + '"' :
// Check for any attributes
attribute = attribute ? ' ' + attribute :
// Return the wrapped item
return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
}, //node
/**
* Lead numbers below 10 with a zero.
*/
lead: function (number) {
return (number < 10 ? '0' : ) + number
},
/**
* Trigger a function otherwise return the value.
*/
trigger: function (callback, scope, args) {
return typeof callback == 'function' ? callback.apply(scope, args || []) : callback
},
/**
* If the second character is a digit, length is 2 otherwise 1.
*/
digits: function (string) {
return (/\d/).test(string[1]) ? 2 : 1
},
/**
* Tell if something is a date object.
*/
isDate: function (value) {
return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate())
},
/**
* Tell if something is an integer.
*/
isInteger: function (value) {
return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0
},
/**
* Create ARIA attribute strings.
*/
ariaAttr: ariaAttr
} //PickerConstructor._
/**
* Extend the picker with a component and defaults.
*/
PickerConstructor.extend = function (name, Component) {
// Extend jQuery.
$.fn[name] = function (options, action) {
// Grab the component data.
var componentData = this.data(name)
// If the picker is requested, return the data object.
if (options == 'picker') {
return componentData
}
// If the component data exists and `options` is a string, carry out the action.
if (componentData && typeof options == 'string') {
return PickerConstructor._.trigger(componentData[options], componentData, [action])
}
// Otherwise go through each matched element and if the component
// doesn’t exist, create a new picker using `this` element
// and merging the defaults and options with a deep copy.
return this.each(function () {
var $this = $(this)
if (!$this.data(name)) {
new PickerConstructor(this, name, Component, options)
}
})
}
// Set the defaults.
$.fn[name].defaults = Component.defaults
} //PickerConstructor.extend
function aria(element, attribute, value) {
if ($.isPlainObject(attribute)) {
for (var key in attribute) {
ariaSet(element, key, attribute[key])
}
} else {
ariaSet(element, attribute, value)
}
}
function ariaSet(element, attribute, value) {
element.setAttribute(
(attribute == 'role' ? : 'aria-') + attribute,
value
)
}
function ariaAttr(attribute, data) {
if (!$.isPlainObject(attribute)) {
attribute = {
attribute: data
}
}
data =
for (var key in attribute) {
var attr = (key == 'role' ? : 'aria-') + key,
attrVal = attribute[key]
data += attrVal == null ? : attr + '="' + attribute[key] + '"'
}
return data
}
// IE8 bug throws an error for activeElements within iframes.
function getActiveElement() {
try {
return document.activeElement
} catch (err) {}
}
// Expose the picker constructor. return PickerConstructor
}));
/*!
* Date picker for pickadate.js v3.5.0 * http://amsul.github.io/pickadate.js/date.htm */
(function (factory) {
// AMD.
if (typeof define == 'function' && define.amd)
define(['picker', 'jquery'], factory)
// Node.js/browserify.
else if (typeof exports == 'object')
module.exports = factory(require('./picker.js'), require('jquery'))
// Browser globals. else factory(Picker, jQuery)
}(function (Picker, $) {
/**
* Globals and constants
*/
var DAYS_IN_WEEK = 7,
WEEKS_IN_CALENDAR = 6,
_ = Picker._;
/**
* The date picker constructor
*/
function DatePicker(picker, settings) {
var calendar = this,
element = picker.$node[0],
elementValue = element.value,
elementDataValue = picker.$node.data('value'),
valueString = elementDataValue || elementValue,
formatString = elementDataValue ? settings.formatSubmit : settings.format,
isRTL = function () {
return element.currentStyle ?
// For IE.
element.currentStyle.direction == 'rtl' :
// For normal browsers.
getComputedStyle(picker.$root[0]).direction == 'rtl'
}
calendar.settings = settings
calendar.$node = picker.$node
// The queue of methods that will be used to build item objects.
calendar.queue = {
min: 'measure create',
max: 'measure create',
now: 'now create',
select: 'parse create validate',
highlight: 'parse navigate create validate',
view: 'parse create validate viewset',
disable: 'deactivate',
enable: 'activate'
}
// The component's item object.
calendar.item = {}
calendar.item.clear = null
calendar.item.disable = (settings.disable || []).slice(0)
calendar.item.enable = -(function (collectionDisabled) {
return collectionDisabled[0] === true ? collectionDisabled.shift() : -1
})(calendar.item.disable)
calendar.
set('min', settings.min).
set('max', settings.max).
set('now')
// When there’s a value, set the `select`, which in turn
// also sets the `highlight` and `view`.
if (valueString) {
calendar.set('select', valueString, {
format: formatString
})
}
// If there’s no value, default to highlighting “today”.
else {
calendar.
set('select', null).
set('highlight', calendar.item.now)
}
// The keycode to movement mapping.
calendar.key = {
40: 7, // Down
38: -7, // Up
39: function () {
return isRTL() ? -1 : 1
}, // Right
37: function () {
return isRTL() ? 1 : -1
}, // Left
go: function (timeChange) {
var highlightedObject = calendar.item.highlight,
targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange)
calendar.set(
'highlight',
targetDate, {
interval: timeChange
}
)
this.render()
}
}
// Bind some picker events.
picker.
on('render', function () {
picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
var value = this.value
if (value) {
picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date])
picker.$root.find('.' + settings.klass.selectMonth).trigger('focus')
}
})
picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
var value = this.value
if (value) {
picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date])
picker.$root.find('.' + settings.klass.selectYear).trigger('focus')
}
})
}, 1).
on('open', function () {
var includeToday =
if (calendar.disabled(calendar.get('now'))) {
includeToday = ':not(.' + settings.klass.buttonToday + ')'
}
picker.$root.find('button' + includeToday + ', select').attr('disabled', false)
}, 1).
on('close', function () {
picker.$root.find('button, select').attr('disabled', true)
}, 1)
} //DatePicker
/**
* Set a datepicker item object.
*/
DatePicker.prototype.set = function (type, value, options) {
var calendar = this,
calendarItem = calendar.item
// If the value is `null` just set it immediately.
if (value === null) {
if (type == 'clear') type = 'select'
calendarItem[type] = value
return calendar
}
// Otherwise go through the queue of methods, and invoke the functions.
// Update this as the time unit, and set the final value as this item.
// * In the case of `enable`, keep the queue but set `disable` instead.
// And in the case of `flip`, keep the queue but set `enable` instead.
calendarItem[(type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type)] = calendar.queue[type].split(' ').map(function (method) {
value = calendar[method](type, value, options)
return value
}).pop()
// Check if we need to cascade through more updates.
if (type == 'select') {
calendar.set('highlight', calendarItem.select, options)
} else if (type == 'highlight') {
calendar.set('view', calendarItem.highlight, options)
} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
if (calendarItem.select && calendar.disabled(calendarItem.select)) {
calendar.set('select', calendarItem.select, options)
}
if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
calendar.set('highlight', calendarItem.highlight, options)
}
}
return calendar
} //DatePicker.prototype.set
/**
* Get a datepicker item object.
*/
DatePicker.prototype.get = function (type) {
return this.item[type]
} //DatePicker.prototype.get
/**
* Create a picker date object.
*/
DatePicker.prototype.create = function (type, value, options) {
var isInfiniteValue,
calendar = this
// If there’s no value, use the type as the value.
value = value === undefined ? type : value
// If it’s infinity, update the value.
if (value == -Infinity || value == Infinity) {
isInfiniteValue = value
}
// If it’s an object, use the native date object.
else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
value = value.obj
}
// If it’s an array, convert it into a date and make sure
// that it’s a valid date – otherwise default to today.
else if ($.isArray(value)) {
value = new Date(value[0], value[1], value[2])
value = _.isDate(value) ? value : calendar.create().obj
}
// If it’s a number or date object, make a normalized date.
else if (_.isInteger(value) || _.isDate(value)) {
value = calendar.normalize(new Date(value), options)
}
// If it’s a literal true or any other case, set it to now.
else /*if ( value === true )*/ {
value = calendar.now(type, value, options)
}
// Return the compiled object.
return {
year: isInfiniteValue || value.getFullYear(),
month: isInfiniteValue || value.getMonth(),
date: isInfiniteValue || value.getDate(),
day: isInfiniteValue || value.getDay(),
obj: isInfiniteValue || value,
pick: isInfiniteValue || value.getTime()
}
} //DatePicker.prototype.create
/**
* Create a range limit object using an array, date object,
* literal “true”, or integer relative to another time.
*/
DatePicker.prototype.createRange = function (from, to) {
var calendar = this,
createDate = function (date) {
if (date === true || $.isArray(date) || _.isDate(date)) {
return calendar.create(date)
}
return date
}
// Create objects if possible.
if (!_.isInteger(from)) {
from = createDate(from)
}
if (!_.isInteger(to)) {
to = createDate(to)
}
// Create relative dates.
if (_.isInteger(from) && $.isPlainObject(to)) {
from = [to.year, to.month, to.date + from];
} else if (_.isInteger(to) && $.isPlainObject(from)) {
to = [from.year, from.month, from.date + to];
}
return {
from: createDate(from),
to: createDate(to)
}
} //DatePicker.prototype.createRange
/**
* Check if a date unit falls within a date range object.
*/
DatePicker.prototype.withinRange = function (range, dateUnit) {
range = this.createRange(range.from, range.to)
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
}
/**
* Check if two date range objects overlap.
*/
DatePicker.prototype.overlapRanges = function (one, two) {
var calendar = this
// Convert the ranges into comparable dates.
one = calendar.createRange(one.from, one.to)
two = calendar.createRange(two.from, two.to)
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) ||
calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to)
}
/**
* Get the date today.
*/
DatePicker.prototype.now = function (type, value, options) {
value = new Date()
if (options && options.rel) {
value.setDate(value.getDate() + options.rel)
}
return this.normalize(value, options)
}
/**
* Navigate to next/prev month.
*/
DatePicker.prototype.navigate = function (type, value, options) {
var targetDateObject,
targetYear,
targetMonth,
targetDate,
isTargetArray = $.isArray(value),
isTargetObject = $.isPlainObject(value),
viewsetObject = this.item.view
/*,
safety = 100*/
if (isTargetArray || isTargetObject) {
if (isTargetObject) {
targetYear = value.year
targetMonth = value.month
targetDate = value.date
} else {
targetYear = +value[0]
targetMonth = +value[1]
targetDate = +value[2]
}
// If we’re navigating months but the view is in a different
// month, navigate to the view’s year and month.
if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
targetYear = viewsetObject.year
targetMonth = viewsetObject.month
}
// Figure out the expected target year and month.
targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1)
targetYear = targetDateObject.getFullYear()
targetMonth = targetDateObject.getMonth()
// If the month we’re going to doesn’t have enough days,
// keep decreasing the date until we reach the month’s last date.
while ( /*safety &&*/ new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
targetDate -= 1
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
}*/
}
value = [targetYear, targetMonth, targetDate]
}
return value
} //DatePicker.prototype.navigate
/**
* Normalize a date by setting the hours to midnight.
*/
DatePicker.prototype.normalize = function (value /*, options*/ ) {
value.setHours(0, 0, 0, 0)
return value
}
/**
* Measure the range of dates.
*/
DatePicker.prototype.measure = function (type, value /*, options*/ ) {
var calendar = this
// If it’s anything false-y, remove the limits.
if (!value) {
value = type == 'min' ? -Infinity : Infinity
}
// If it’s a string, parse it.
else if (typeof value == 'string') {
value = calendar.parse(type, value)
}
// If it's an integer, get a date relative to today.
else if (_.isInteger(value)) {
value = calendar.now(type, value, {
rel: value
})
}
return value
} ///DatePicker.prototype.measure
/**
* Create a viewset object based on navigation.
*/
DatePicker.prototype.viewset = function (type, dateObject /*, options*/ ) {
return this.create([dateObject.year, dateObject.month, 1])
}
/**
* Validate a date as enabled and shift if needed.
*/
DatePicker.prototype.validate = function (type, dateObject, options) {
var calendar = this,
// Keep a reference to the original date.
originalDateObject = dateObject,
// Make sure we have an interval.
interval = options && options.interval ? options.interval : 1,
// Check if the calendar enabled dates are inverted.
isFlippedBase = calendar.item.enable === -1,
// Check if we have any enabled dates after/before now.
hasEnabledBeforeTarget, hasEnabledAfterTarget,
// The min & max limits.
minLimitObject = calendar.item.min,
maxLimitObject = calendar.item.max,
// Check if we’ve reached the limit during shifting.
reachedMin, reachedMax,
// Check if the calendar is inverted and at least one weekday is enabled.
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
// If there’s a date, check where it is relative to the target.
if ($.isArray(value)) {
var dateTime = calendar.create(value).pick
if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true
else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true
}
// Return only integers for enabled weekdays.
return _.isInteger(value)
}).length
/*,
safety = 100*/
// Cases to validate for:
// [1] Not inverted and date disabled.
// [2] Inverted and some dates enabled.
// [3] Not inverted and out of range.
//
// Cases to **not** validate for:
// • Navigating months.
// • Not inverted and date enabled.
// • Inverted and all dates disabled.
// • ..and anything else.
if (!options || !options.nav)
if (
/* 1 */
(!isFlippedBase && calendar.disabled(dateObject)) ||
/* 2 */
(isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget)) ||
/* 3 */
(!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick))
) {
// When inverted, flip the direction if there aren’t any enabled weekdays
// and there are no enabled dates in the direction of the interval.
if (isFlippedBase && !hasEnabledWeekdays && ((!hasEnabledAfterTarget && interval > 0) || (!hasEnabledBeforeTarget && interval < 0))) {
interval *= -1
}
// Keep looping until we reach an enabled date.
while ( /*safety &&*/ calendar.disabled(dateObject)) {
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
}*/
// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
dateObject = originalDateObject
interval = interval > 0 ? 1 : -1
}
// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
if (dateObject.pick <= minLimitObject.pick) {
reachedMin = true
interval = 1
dateObject = calendar.create([
minLimitObject.year,
minLimitObject.month,
minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
])
} else if (dateObject.pick >= maxLimitObject.pick) {
reachedMax = true
interval = -1
dateObject = calendar.create([
maxLimitObject.year,
maxLimitObject.month,
maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
])
}
// If we’ve reached both limits, just break out of the loop.
if (reachedMin && reachedMax) {
break
}
// Finally, create the shifted date using the interval and keep looping.
dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval])
}
} //endif
// Return the date object settled on.
return dateObject
} //DatePicker.prototype.validate
/**
* Check if a date is disabled.
*/
DatePicker.prototype.disabled = function (dateToVerify) {
var
calendar = this,
// Filter through the disabled dates to check if this is one.
isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
// If the date is a number, match the weekday with 0index and `firstDay` check.
if (_.isInteger(dateToDisable)) {
return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7
}
// If it’s an array or a native JS date, create and match the exact date.
if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
return dateToVerify.pick === calendar.create(dateToDisable).pick
}
// If it’s an object, match a date within the “from” and “to” range.
if ($.isPlainObject(dateToDisable)) {
return calendar.withinRange(dateToDisable, dateToVerify)
}
})
// If this date matches a disabled date, confirm it’s not inverted.
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' ||
$.isPlainObject(dateToDisable) && dateToDisable.inverted
}).length
// Check the calendar “enabled” flag and respectively flip the
// disabled state. Then also check if it’s beyond the min/max limits.
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
dateToVerify.pick < calendar.item.min.pick ||
dateToVerify.pick > calendar.item.max.pick
} //DatePicker.prototype.disabled
/**
* Parse a string into a usable type.
*/
DatePicker.prototype.parse = function (type, value, options) {
var calendar = this,
parsingObject = {}
// If it’s already parsed, we’re good.
if (!value || typeof value != 'string') {
return value
}
// We need a `.format` to parse the value with.
if (!(options && options.format)) {
options = options || {}
options.format = calendar.settings.format
}
// Convert the format into an array and then map through it.
calendar.formats.toArray(options.format).map(function (label) {
var
// Grab the formatting label.
formattingLabel = calendar.formats[label],
// The format length is from the formatting label function or the
// label length without the escaping exclamation (!) mark.
formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, ).length
// If there's a format label, split the value up to the format length.
// Then add it to the parsing object with appropriate label.
if (formattingLabel) {
parsingObject[label] = value.substr(0, formatLength)
}
// Update the value as the substring from format length to end.
value = value.substr(formatLength)
})
// Compensate for month 0index.
return [
parsingObject.yyyy || parsingObject.yy,
+(parsingObject.mm || parsingObject.m) - 1,
parsingObject.dd || parsingObject.d
]
} //DatePicker.prototype.parse
/**
* Various formats to display the object in.
*/
DatePicker.prototype.formats = (function () {
// Return the length of the first word in a collection.
function getWordLengthFromCollection(string, collection, dateObject) {
// Grab the first word from the string.
var word = string.match(/\w+/)[0]
// If there's no month index, add it to the date object
if (!dateObject.mm && !dateObject.m) {
dateObject.m = collection.indexOf(word) + 1
}
// Return the length of the word.
return word.length
}
// Get the length of the first word in a string.
function getFirstWordLength(string) {
return string.match(/\w+/)[0].length
}
return {
d: function (string, dateObject) {
// If there's string, then get the digits length.
// Otherwise return the selected date.
return string ? _.digits(string) : dateObject.date
},
dd: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected date with a leading zero.
return string ? 2 : _.lead(dateObject.date)
},
ddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the short selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]
},
dddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the full selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]
},
m: function (string, dateObject) {
// If there's a string, then get the length of the digits
// Otherwise return the selected month with 0index compensation.
return string ? _.digits(string) : dateObject.month + 1
},
mm: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected month with 0index and leading zero.
return string ? 2 : _.lead(dateObject.month + 1)
},
mmm: function (string, dateObject) {
var collection = this.settings.monthsShort
// If there's a string, get length of the relevant month from the short
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
},
mmmm: function (string, dateObject) {
var collection = this.settings.monthsFull
// If there's a string, get length of the relevant month from the full
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
},
yy: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected year by slicing out the first 2 digits.
return string ? 2 : ( + dateObject.year).slice(2)
},
yyyy: function (string, dateObject) {
// If there's a string, then the length is always 4.
// Otherwise return the selected year.
return string ? 4 : dateObject.year
},
// Create an array by splitting the formatting string passed.
toArray: function (formatString) {
return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)
},
// Format an object into a string using the formatting options.
toString: function (formatString, itemObject) {
var calendar = this
return calendar.formats.toArray(formatString).map(function (label) {
return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, )
}).join()
}
}
})() //DatePicker.prototype.formats
/**
* Check if two date units are the exact.
*/
DatePicker.prototype.isDateExact = function (one, two) {
var calendar = this
// When we’re working with weekdays, do a direct comparison.
if (
(_.isInteger(one) && _.isInteger(two)) ||
(typeof one == 'boolean' && typeof two == 'boolean')
) {
return one === two
}
// When we’re working with date representations, compare the “pick” value.
if (
(_.isDate(one) || $.isArray(one)) &&
(_.isDate(two) || $.isArray(two))
) {
return calendar.create(one).pick === calendar.create(two).pick
}
// When we’re working with range objects, compare the “from” and “to”.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to)
}
return false }
/**
* Check if two date units overlap.
*/
DatePicker.prototype.isDateOverlap = function (one, two) {
var calendar = this,
firstDay = calendar.settings.firstDay ? 1 : 0
// When we’re working with a weekday index, compare the days.
if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
one = one % 7 + firstDay
return one === calendar.create(two).day + 1
}
if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
two = two % 7 + firstDay
return two === calendar.create(one).day + 1
}
// When we’re working with range objects, check if the ranges overlap.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.overlapRanges(one, two)
}
return false }
/**
* Flip the “enabled” state.
*/
DatePicker.prototype.flipEnable = function (val) {
var itemObject = this.item
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
}
/**
* Mark a collection of dates as “disabled”.
*/
DatePicker.prototype.deactivate = function (type, datesToDisable) {
var calendar = this,
disabledItems = calendar.item.disable.slice(0)
// If we’re flipping, that’s all we need to do.
if (datesToDisable == 'flip') {
calendar.flipEnable()
} else if (datesToDisable === false) {
calendar.flipEnable(1)
disabledItems = []
} else if (datesToDisable === true) {
calendar.flipEnable(-1)
disabledItems = []
}
// Otherwise go through the dates to disable.
else {
datesToDisable.map(function (unitToDisable) {
var matchFound
// When we have disabled items, check for matches.
// If something is matched, immediately break out.
for (var index = 0; index < disabledItems.length; index += 1) {
if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
matchFound = true
break
}
}
// If nothing was found, add the validated unit to the collection.
if (!matchFound) {
if (
_.isInteger(unitToDisable) ||
_.isDate(unitToDisable) ||
$.isArray(unitToDisable) ||
($.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to)
) {
disabledItems.push(unitToDisable)
}
}
})
}
// Return the updated collection.
return disabledItems
} //DatePicker.prototype.deactivate
/**
* Mark a collection of dates as “enabled”.
*/
DatePicker.prototype.activate = function (type, datesToEnable) {
var calendar = this,
disabledItems = calendar.item.disable,
disabledItemsCount = disabledItems.length
// If we’re flipping, that’s all we need to do.
if (datesToEnable == 'flip') {
calendar.flipEnable()
} else if (datesToEnable === true) {
calendar.flipEnable(1)
disabledItems = []
} else if (datesToEnable === false) {
calendar.flipEnable(-1)
disabledItems = []
}
// Otherwise go through the disabled dates.
else {
datesToEnable.map(function (unitToEnable) {
var matchFound,
disabledUnit,
index,
isExactRange
// Go through the disabled items and try to find a match.
for (index = 0; index < disabledItemsCount; index += 1) {
disabledUnit = disabledItems[index]
// When an exact match is found, remove it from the collection.
if (calendar.isDateExact(disabledUnit, unitToEnable)) {
matchFound = disabledItems[index] = null
isExactRange = true
break
}
// When an overlapped match is found, add the “inverted” state to it.
else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
if ($.isPlainObject(unitToEnable)) {
unitToEnable.inverted = true
matchFound = unitToEnable
} else if ($.isArray(unitToEnable)) {
matchFound = unitToEnable
if (!matchFound[3]) matchFound.push('inverted')
} else if (_.isDate(unitToEnable)) {
matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']
}
break
}
}
// If a match was found, remove a previous duplicate entry.
if (matchFound)
for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
disabledItems[index] = null
break
}
}
// In the event that we’re dealing with an exact range of dates,
// make sure there are no “inverted” dates because of it.
if (isExactRange)
for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
disabledItems[index] = null
break
}
}
// If something is still matched, add it into the collection.
if (matchFound) {
disabledItems.push(matchFound)
}
})
}
// Return the updated collection.
return disabledItems.filter(function (val) {
return val != null
})
} //DatePicker.prototype.activate
/**
* Create a string for the nodes in the picker.
*/
DatePicker.prototype.nodes = function (isOpen) {
var
calendar = this,
settings = calendar.settings,
calendarItem = calendar.item,
nowObject = calendarItem.now,
selectedObject = calendarItem.select,
highlightedObject = calendarItem.highlight,
viewsetObject = calendarItem.view,
disabledCollection = calendarItem.disable,
minLimitObject = calendarItem.min,
maxLimitObject = calendarItem.max,
// Create the calendar table head using a copy of weekday labels collection.
// * We do a copy so we don't mutate the original array.
tableHead = (function (collection, fullCollection) {
// If the first day should be Monday, move Sunday to the end.
if (settings.firstDay) {
collection.push(collection.shift())
fullCollection.push(fullCollection.shift())
}
// Create and return the table head group.
return _.node(
'thead',
_.node(
'tr',
_.group({
min: 0,
max: DAYS_IN_WEEK - 1,
i: 1,
node: 'th',
item: function (counter) {
return [
collection[counter],
settings.klass.weekdays,
'scope=col title="' + fullCollection[counter] + '"'
]
}
})
)
) //endreturn
// Materialize modified
})((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead
// Create the nav for next/prev month.
createMonthNav = function (next) {
// Otherwise, return the created month tag.
return _.node(
'div',
' ',
settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
// If the focused month is outside the range, disabled the button.
(next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month) ||
(!next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month) ?
' ' + settings.klass.navDisabled :
),
'data-nav=' + (next || -1) + ' ' +
_.ariaAttr({
role: 'button',
controls: calendar.$node[0].id + '_table'
}) + ' ' +
'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'
) //endreturn
}, //createMonthNav
// Create the month label.
//Materialize modified
createMonthLabel = function (override) {
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
// Materialize modified
if (override == "short_months") {
monthsCollection = settings.monthsShort;
}
// If there are months to select, add a dropdown menu.
if (settings.selectMonths && override == undefined) {
return _.node('select',
_.group({
min: 0,
max: 11,
i: 1,
node: 'option',
item: function (loopedMonth) {
return [
// The looped month and no classes.
monthsCollection[loopedMonth], 0,
// Set the value and selected index.
'value=' + loopedMonth +
(viewsetObject.month == loopedMonth ? ' selected' : ) +
(
(
(viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month) ||
(viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month)
) ?
' disabled' :
)
]
}
}),
settings.klass.selectMonth + ' browser-default', (isOpen ? : 'disabled') + ' ' +
_.ariaAttr({
controls: calendar.$node[0].id + '_table'
}) + ' ' +
'title="' + settings.labelMonthSelect + '"'
)
}
// Materialize modified
if (override == "short_months")
if (selectedObject != null)
return monthsCollection[selectedObject.month];
else return monthsCollection[viewsetObject.month];
// If there's a need for a month selector
return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month)
}, //createMonthLabel
// Create the year label.
// Materialize modified
createYearLabel = function (override) {
var focusedYear = viewsetObject.year,
// If years selector is set to a literal "true", set it to 5. Otherwise
// divide in half to get half before and half after focused year.
numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2)
// If there are years to select, add a dropdown menu.
if (numberYears) {
var
minYear = minLimitObject.year,
maxYear = maxLimitObject.year,
lowestYear = focusedYear - numberYears,
highestYear = focusedYear + numberYears
// If the min year is greater than the lowest year, increase the highest year
// by the difference and set the lowest year to the min year.
if (minYear > lowestYear) {
highestYear += minYear - lowestYear
lowestYear = minYear
}
// If the max year is less than the highest year, decrease the lowest year
// by the lower of the two: available and needed years. Then set the
// highest year to the max year.
if (maxYear < highestYear) {
var availableYears = lowestYear - minYear,
neededYears = highestYear - maxYear
lowestYear -= availableYears > neededYears ? neededYears : availableYears
highestYear = maxYear
}
if (settings.selectYears && override == undefined) {
return _.node('select',
_.group({
min: lowestYear,
max: highestYear,
i: 1,
node: 'option',
item: function (loopedYear) {
return [
// The looped year and no classes.
loopedYear, 0,
// Set the value and selected index.
'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : )
]
}
}),
settings.klass.selectYear + ' browser-default', (isOpen ? : 'disabled') + ' ' + _.ariaAttr({
controls: calendar.$node[0].id + '_table'
}) + ' ' +
'title="' + settings.labelYearSelect + '"'
)
}
}
// Materialize modified
if (override == "raw")
return _.node('div', focusedYear)
// Otherwise just return the year focused
return _.node('div', focusedYear, settings.klass.year)
} //createYearLabel
// Materialize modified
createDayLabel = function () {
if (selectedObject != null)
return selectedObject.date
else return nowObject.date
}
createWeekdayLabel = function () {
var display_day;
if (selectedObject != null)
display_day = selectedObject.day;
else
display_day = nowObject.day;
var weekday = settings.weekdaysShort[display_day];
return weekday
}
// Create and return the entire calendar.
return _.node(
// Date presentation View
'div',
_.node(
// Div for Year
'div',
createYearLabel("raw"),
settings.klass.year_display
) +
_.node(
'span',
createWeekdayLabel() + ', ',
"picker__weekday-display"
) +
_.node(
// Div for short Month
'span',
createMonthLabel("short_months") + ' ',
settings.klass.month_display
) +
_.node(
// Div for Day
'span',
createDayLabel(),
settings.klass.day_display
),
settings.klass.date_display
) +
// Calendar container
_.node('div',
_.node('div',
_.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) +
createMonthNav() + createMonthNav(1),
settings.klass.header
) + _.node(
'table',
tableHead +
_.node(
'tbody',
_.group({
min: 0,
max: WEEKS_IN_CALENDAR - 1,
i: 1,
node: 'tr',
item: function (rowCounter) {
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0
return [
_.group({
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
max: function () {
return this.min + DAYS_IN_WEEK - 1
},
i: 1,
node: 'td',
item: function (targetDate) {
// Convert the time date from a relative date to a target date.
targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)])
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate])
return [
_.node(
'div',
targetDate.date, (function (klasses) {
// Add the `infocus` or `outfocus` classes based on month in view.
klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus)
// Add the `today` class if needed.
if (nowObject.pick == targetDate.pick) {
klasses.push(settings.klass.now)
}
// Add the `selected` class if something's selected and the time matches.
if (isSelected) {
klasses.push(settings.klass.selected)
}
// Add the `highlighted` class if something's highlighted and the time matches.
if (isHighlighted) {
klasses.push(settings.klass.highlighted)
}
// Add the `disabled` class if something's disabled and the object matches.
if (isDisabled) {
klasses.push(settings.klass.disabled)
}
return klasses.join(' ')
})([settings.klass.day]),
'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
role: 'gridcell',
label: formattedDate,
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
activedescendant: isHighlighted ? true : null,
disabled: isDisabled ? true : null
})
), , _.ariaAttr({
role: 'presentation'
})
] //endreturn
}
})
] //endreturn
}
})
),
settings.klass.table,
'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
role: 'grid',
controls: calendar.$node[0].id,
readonly: true
})
), settings.klass.calendar_container) // end calendar
+
// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
_.node(
'div',
_.node('button', settings.today, "btn-flat picker__today waves-effect",
'type=button data-pick=' + nowObject.pick +
(isOpen && !calendar.disabled(nowObject) ? : ' disabled') + ' ' +
_.ariaAttr({
controls: calendar.$node[0].id
})) +
_.node('button', settings.clear, "btn-flat picker__clear waves-effect",
'type=button data-clear=1' +
(isOpen ? : ' disabled') + ' ' +
_.ariaAttr({
controls: calendar.$node[0].id
})) +
_.node('button', settings.close, "btn-flat picker__close waves-effect",
'type=button data-close=true ' +
(isOpen ? : ' disabled') + ' ' +
_.ariaAttr({
controls: calendar.$node[0].id
})),
settings.klass.footer
), 'picker__container__wrapper'
) //endreturn
} //DatePicker.prototype.nodes
/**
* The date picker defaults.
*/
DatePicker.defaults = (function (prefix) {
return {
// The title label to use for the month nav buttons
labelMonthNext: 'Next month',
labelMonthPrev: 'Previous month',
// The title label to use for the dropdown selectors
labelMonthSelect: 'Select a month',
labelYearSelect: 'Select a year',
// Months and weekdays
monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
// Materialize modified
weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
// Today and clear
today: 'Today',
clear: 'Clear',
close: 'Ok',
// The format to show on the `input` element
format: 'd mmmm, yyyy',
// Classes
klass: {
table: prefix + 'table',
header: prefix + 'header',
// Materialize Added klasses
date_display: prefix + 'date-display',
day_display: prefix + 'day-display',
month_display: prefix + 'month-display',
year_display: prefix + 'year-display',
calendar_container: prefix + 'calendar-container',
// end
navPrev: prefix + 'nav--prev',
navNext: prefix + 'nav--next',
navDisabled: prefix + 'nav--disabled',
month: prefix + 'month',
year: prefix + 'year',
selectMonth: prefix + 'select--month',
selectYear: prefix + 'select--year',
weekdays: prefix + 'weekday',
day: prefix + 'day',
disabled: prefix + 'day--disabled',
selected: prefix + 'day--selected',
highlighted: prefix + 'day--highlighted',
now: prefix + 'day--today',
infocus: prefix + 'day--infocus',
outfocus: prefix + 'day--outfocus',
footer: prefix + 'footer',
buttonClear: prefix + 'button--clear',
buttonToday: prefix + 'button--today',
buttonClose: prefix + 'button--close'
}
}
})(Picker.klasses().picker + '__')
/**
* Extend the picker to add the date picker.
*/
Picker.extend('pickadate', DatePicker)
}));;
/*!
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) * Copyright 2014 Wang Shenwei. * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) * * Further modified * Copyright 2015 Ching Yaw Hao. */
(function () {
var $ = window.jQuery,
$win = $(window),
$doc = $(document);
// Can I use inline svg ? var svgNS = 'http://www.w3.org/2000/svg', svgSupported = 'SVGAngle' in window && (function () { var supported, el = document.createElement('div'); el.innerHTML = '<svg/>'; supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; el.innerHTML = ; return supported; })();
// Can I use transition ?
var transitionSupported = (function () {
var style = document.createElement('div').style;
return 'transition' in style ||
'WebkitTransition' in style ||
'MozTransition' in style ||
'msTransition' in style ||
'OTransition' in style;
})();
// Listen touch events in touch screen device, instead of mouse events in desktop.
var touchSupported = 'ontouchstart' in window,
mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ),
mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ),
mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : );
// Vibrate the device if supported var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
function createSvgElement(name) {
return document.createElementNS(svgNS, name);
}
function leadingZero(num) {
return (num < 10 ? '0' : ) + num;
}
// Get a unique id var idCounter = 0;
function uniqueId(prefix) {
var id = ++idCounter + ;
return prefix ? prefix + id : id;
}
// Clock size
var dialRadius = 135,
outerRadius = 105,
// innerRadius = 80 on 12 hour clock
innerRadius = 80,
tickRadius = 20,
diameter = dialRadius * 2,
duration = transitionSupported ? 350 : 1;
// Popover template var tpl = ['
',
'
'
',
'
',
'',
'
',
'',
'
',
'',
'
',
'',
'
',
'',
'
',
'',
',
''', ':', '',
'',
'',
'
',
'',
'
',
'',
'
',
'',
'',
'',
'',
'',
'
',
'',
'
',
'].join();
// ClockPicker
function ClockPicker(element, options) {
var popover = $(tpl),
plate = popover.find('.clockpicker-plate'),
holder = popover.find('.picker__holder'),
hoursView = popover.find('.clockpicker-hours'),
minutesView = popover.find('.clockpicker-minutes'),
amPmBlock = popover.find('.clockpicker-am-pm-block'),
isInput = element.prop('tagName') === 'INPUT',
input = isInput ? element : element.find('input'),
label = $("label[for=" + input.attr("id") + "]"),
self = this;
this.id = uniqueId('cp');
this.element = element;
this.holder = holder;
this.options = options;
this.isAppended = false;
this.isShown = false;
this.currentView = 'hours';
this.isInput = isInput;
this.input = input;
this.label = label;
this.popover = popover;
this.plate = plate;
this.hoursView = hoursView;
this.minutesView = minutesView;
this.amPmBlock = amPmBlock;
this.spanHours = popover.find('.clockpicker-span-hours');
this.spanMinutes = popover.find('.clockpicker-span-minutes');
this.spanAmPm = popover.find('.clockpicker-span-am-pm');
this.footer = popover.find('.picker__footer');
this.amOrPm = "PM";
// Setup for for 12 hour clock if option is selected
if (options.twelvehour) {
if (!options.ampmclickable) {
this.spanAmPm.empty();
$('AM
').appendTo(this.spanAmPm);
$('PM
').appendTo(this.spanAmPm);
} else {
this.spanAmPm.empty();
$('AM
').on("click", function () {
self.spanAmPm.children('#click-am').addClass("text-primary");
self.spanAmPm.children('#click-pm').removeClass("text-primary");
self.amOrPm = "AM";
}).appendTo(this.spanAmPm);
$('PM
').on("click", function () {
self.spanAmPm.children('#click-pm').addClass("text-primary");
self.spanAmPm.children('#click-am').removeClass("text-primary");
self.amOrPm = 'PM';
}).appendTo(this.spanAmPm);
}
}
// Add buttons to footer
$('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
// Show or toggle
input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
// Build ticksvar tickTpl = $(''),
i, tick, radian, radius;
// Hours view
if (options.twelvehour) {
for (i = 1; i < 13; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
radius = outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
} else {
for (i = 0; i < 24; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
var inner = i > 0 && i < 13;
radius = inner ? innerRadius : outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
}
// Minutes view
for (i = 0; i < 60; i += 5) {
tick = tickTpl.clone();
radian = i / 30 * Math.PI;
tick.css({
left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
});
tick.html(leadingZero(i));
minutesView.append(tick);
tick.on(mousedownEvent, mousedown);
}
// Clicking on minutes view space
plate.on(mousedownEvent, function (e) {
if ($(e.target).closest('.clockpicker-tick').length === 0) {
mousedown(e, true);
}
});
// Mousedown or touchstart
function mousedown(e, space) {
var offset = plate.offset(),
isTouch = /^touch/.test(e.type),
x0 = offset.left + dialRadius,
y0 = offset.top + dialRadius,
dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
z = Math.sqrt(dx * dx + dy * dy),
moved = false;
// When clicking on minutes view space, check the mouse position
if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
return;
}
e.preventDefault();
// Set cursor style of body after 200ms
var movingTimer = setTimeout(function () {
self.popover.addClass('clockpicker-moving');
}, 200);
// Clock
self.setHand(dx, dy, !space, true);
// Mousemove on document
$doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
if (!moved && x === dx && y === dy) {
// Clicking in chrome on windows will trigger a mousemove event
return;
}
moved = true;
self.setHand(x, y, false, true);
});
// Mouseup on document
$doc.off(mouseupEvent).on(mouseupEvent, function (e) {
$doc.off(mouseupEvent);
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
if ((space || moved) && x === dx && y === dy) {
self.setHand(x, y);
}
if (self.currentView === 'hours') {
self.toggleView('minutes', duration / 2);
} else if (options.autoclose) {
self.minutesView.addClass('clockpicker-dial-out');
setTimeout(function () {
self.done();
}, duration / 2);
}
plate.prepend(canvas);
// Reset cursor style of body
clearTimeout(movingTimer);
self.popover.removeClass('clockpicker-moving');
// Unbind mousemove event
$doc.off(mousemoveEvent);
});
}
if (svgSupported) {
// Draw clock hands and others
var canvas = popover.find('.clockpicker-canvas'),
svg = createSvgElement('svg');
svg.setAttribute('class', 'clockpicker-svg');
svg.setAttribute('width', diameter);
svg.setAttribute('height', diameter);
var g = createSvgElement('g');
g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
var bearing = createSvgElement('circle');
bearing.setAttribute('class', 'clockpicker-canvas-bearing');
bearing.setAttribute('cx', 0);
bearing.setAttribute('cy', 0);
bearing.setAttribute('r', 4);
var hand = createSvgElement('line');
hand.setAttribute('x1', 0);
hand.setAttribute('y1', 0);
var bg = createSvgElement('circle');
bg.setAttribute('class', 'clockpicker-canvas-bg');
bg.setAttribute('r', tickRadius);
g.appendChild(hand);
g.appendChild(bg);
g.appendChild(bearing);
svg.appendChild(g);
canvas.append(svg);
this.hand = hand;
this.bg = bg;
this.bearing = bearing;
this.g = g;
this.canvas = canvas;
}
raiseCallback(this.options.init); }
function raiseCallback(callbackFunction) {
if (callbackFunction && typeof callbackFunction === "function")
callbackFunction();
}
// Default options
ClockPicker.DEFAULTS = {
'default': , // default time, 'now' or '13:14' e.g.
fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
donetext: 'Ok', // done button text
cleartext: 'Clear',
canceltext: 'Cancel',
autoclose: false, // auto close when minute is selected
ampmclickable: true, // set am/pm button on itself
darktheme: false, // set to dark theme
twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
vibrate: true // vibrate the device when dragging clock hand
};
// Show or hide popover
ClockPicker.prototype.toggle = function () {
this[this.isShown ? 'hide' : 'show']();
};
// Set popover position
ClockPicker.prototype.locate = function () {
var element = this.element,
popover = this.popover,
offset = element.offset(),
width = element.outerWidth(),
height = element.outerHeight(),
align = this.options.align,
self = this;
popover.show(); };
// Show popover
ClockPicker.prototype.show = function (e) {
// Not show again
if (this.isShown) {
return;
}
raiseCallback(this.options.beforeShow);
$(':input').each(function () {
$(this).attr('tabindex', -1);
})
var self = this;
// Initialize
this.input.blur();
this.popover.addClass('picker--opened');
this.input.addClass('picker__input picker__input--active');
$(document.body).css('overflow', 'hidden');
// Get the time
var value = ((this.input.prop('value') || this.options['default'] || ) + ).split(':');
if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
if (value[1].indexOf("AM") > 0) {
this.amOrPm = 'AM';
} else {
this.amOrPm = 'PM';
}
value[1] = value[1].replace("AM", "").replace("PM", "");
}
if (value[0] === 'now') {
var now = new Date(+new Date() + this.options.fromnow);
value = [
now.getHours(), now.getMinutes() ];
}
this.hours = +value[0] || 0;
this.minutes = +value[1] || 0;
this.spanHours.html(this.hours);
this.spanMinutes.html(leadingZero(this.minutes));
if (!this.isAppended) {
// Append popover to body
this.popover.insertAfter(this.input);
if (this.options.twelvehour) {
if (this.amOrPm === 'PM') {
this.spanAmPm.children('#click-pm').addClass("text-primary");
this.spanAmPm.children('#click-am').removeClass("text-primary");
} else {
this.spanAmPm.children('#click-am').addClass("text-primary");
this.spanAmPm.children('#click-pm').removeClass("text-primary");
}
}
// Reset position when resize
$win.on('resize.clockpicker' + this.id, function () {
if (self.isShown) {
self.locate();
}
});
this.isAppended = true;
}
// Toggle to hours view
this.toggleView('hours');
// Set position
this.locate();
this.isShown = true;
// Hide when clicking or tabbing on any element except the clock and input
$doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
var target = $(e.target);
if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
self.hide();
}
});
// Hide when ESC is pressed
$doc.on('keyup.clockpicker.' + this.id, function (e) {
if (e.keyCode === 27) {
self.hide();
}
});
raiseCallback(this.options.afterShow);
};
// Hide popover
ClockPicker.prototype.hide = function () {
raiseCallback(this.options.beforeHide);
this.input.removeClass('picker__input picker__input--active');
this.popover.removeClass('picker--opened');
$(document.body).css('overflow', 'visible');
this.isShown = false;
$(':input').each(function (index) {
$(this).attr('tabindex', index + 1);
});
// Unbinding events on document
$doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
$doc.off('keyup.clockpicker.' + this.id);
this.popover.hide();
raiseCallback(this.options.afterHide);
};
// Toggle to hours or minutes view
ClockPicker.prototype.toggleView = function (view, delay) {
var raiseAfterHourSelect = false;
if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
raiseCallback(this.options.beforeHourSelect);
raiseAfterHourSelect = true;
}
var isHours = view === 'hours',
nextView = isHours ? this.hoursView : this.minutesView,
hideView = isHours ? this.minutesView : this.hoursView;
this.currentView = view;
this.spanHours.toggleClass('text-primary', isHours);
this.spanMinutes.toggleClass('text-primary', !isHours);
// Let's make transitions
hideView.addClass('clockpicker-dial-out');
nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
// Reset clock hand
this.resetClock(delay);
// After transitions ended
clearTimeout(this.toggleViewTimer);
this.toggleViewTimer = setTimeout(function () {
hideView.css('visibility', 'hidden');
}, duration);
if (raiseAfterHourSelect) {
raiseCallback(this.options.afterHourSelect);
}
};
// Reset clock hand
ClockPicker.prototype.resetClock = function (delay) {
var view = this.currentView,
value = this[view],
isHours = view === 'hours',
unit = Math.PI / (isHours ? 6 : 30),
radian = value * unit,
radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
x = Math.sin(radian) * radius,
y = -Math.cos(radian) * radius,
self = this;
if (svgSupported && delay) {
self.canvas.addClass('clockpicker-canvas-out');
setTimeout(function () {
self.canvas.removeClass('clockpicker-canvas-out');
self.setHand(x, y);
}, delay);
} else
this.setHand(x, y);
};
// Set clock hand to (x, y)
ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
var radian = Math.atan2(x, -y),
isHours = this.currentView === 'hours',
unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
z = Math.sqrt(x * x + y * y),
options = this.options,
inner = isHours && z < (outerRadius + innerRadius) / 2,
radius = inner ? innerRadius : outerRadius,
value;
if (options.twelvehour) {
radius = outerRadius;
}
// Radian should in range [0, 2PI]
if (radian < 0) {
radian = Math.PI * 2 + radian;
}
// Get the round value
value = Math.round(radian / unit);
// Get the round radian
radian = value * unit;
// Correct the hours or minutes
if (options.twelvehour) {
if (isHours) {
if (value === 0)
value = 12;
} else {
if (roundBy5)
value *= 5;
if (value === 60)
value = 0;
}
} else {
if (isHours) {
if (value === 12)
value = 0;
value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
} else {
if (roundBy5)
value *= 5;
if (value === 60)
value = 0;
}
}
// Once hours or minutes changed, vibrate the device
if (this[this.currentView] !== value) {
if (vibrate && this.options.vibrate) {
// Do not vibrate too frequently
if (!this.vibrateTimer) {
navigator[vibrate](10);
this.vibrateTimer = setTimeout($.proxy(function () {
this.vibrateTimer = null;
}, this), 100);
}
}
}
this[this.currentView] = value;
if (isHours) {
this['spanHours'].html(value);
} else {
this['spanMinutes'].html(leadingZero(value));
}
// If svg is not supported, just add an active class to the tick
if (!svgSupported) {
this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
var tick = $(this);
tick.toggleClass('active', value === +tick.html());
});
return;
}
// Set clock hand and others' position
var cx1 = Math.sin(radian) * (radius - tickRadius),
cy1 = -Math.cos(radian) * (radius - tickRadius),
cx2 = Math.sin(radian) * radius,
cy2 = -Math.cos(radian) * radius;
this.hand.setAttribute('x2', cx1);
this.hand.setAttribute('y2', cy1);
this.bg.setAttribute('cx', cx2);
this.bg.setAttribute('cy', cy2);
};
// Hours and minutes are selected
ClockPicker.prototype.done = function () {
raiseCallback(this.options.beforeDone);
this.hide();
this.label.addClass('active');
var last = this.input.prop('value'),
value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
if (this.options.twelvehour) {
value = value + this.amOrPm;
}
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose)
this.input.trigger('blur');
raiseCallback(this.options.afterDone); };
// Clear input field
ClockPicker.prototype.clear = function () {
this.hide();
this.label.removeClass('active');
var last = this.input.prop('value'),
value = ;
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose) {
this.input.trigger('blur');
}
};
// Remove clockpicker from input
ClockPicker.prototype.remove = function () {
this.element.removeData('clockpicker');
this.input.off('focus.clockpicker click.clockpicker');
if (this.isShown) {
this.hide();
}
if (this.isAppended) {
$win.off('resize.clockpicker' + this.id);
this.popover.remove();
}
};
// Extends $.fn.clockpicker
$.fn.pickatime = function (option) {
var args = Array.prototype.slice.call(arguments, 1);
return this.each(function () {
var $this = $(this),
data = $this.data('clockpicker');
if (!data) {
var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
$this.data('clockpicker', new ClockPicker($this, options));
} else {
// Manual operatsions. show, hide, remove, e.g.
if (typeof data[option] === 'function') {
data[option].apply(data, args);
}
}
});
};
}());; (function ($) {
$.fn.characterCounter = function () {
return this.each(function () {
var $input = $(this);
var $counterElement = $input.parent().find('span[class="character-counter"]');
// character counter has already been added appended to the parent container
if ($counterElement.length) {
return;
}
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
if (itHasLengthAttribute) {
$input.on('input', updateCounter);
$input.on('focus', updateCounter);
$input.on('blur', removeCounterElement);
addCounterElement($input);
}
}); };
function updateCounter() {
var maxLength = +$(this).attr('data-length'),
actualLength = +$(this).val().length,
isValidLength = actualLength <= maxLength;
$(this).parent().find('span[class="character-counter"]')
.html(actualLength + '/' + maxLength);
addInputStyle(isValidLength, $(this)); }
function addCounterElement($input) {
var $counterElement = $input.parent().find('span[class="character-counter"]');
if ($counterElement.length) {
return;
}
$counterElement = $('<span/>')
.addClass('character-counter')
.css('float', 'right')
.css('font-size', '12px')
.css('height', 1);
$input.parent().append($counterElement); }
function removeCounterElement() {
$(this).parent().find('span[class="character-counter"]').html();
}
function addInputStyle(isValidLength, $input) {
var inputHasInvalidClass = $input.hasClass('invalid');
if (isValidLength && inputHasInvalidClass) {
$input.removeClass('invalid');
} else if (!isValidLength && !inputHasInvalidClass) {
$input.removeClass('valid');
$input.addClass('invalid');
}
}
$(document).ready(function () {
$('input, textarea').characterCounter();
});
}(jQuery));; (function ($) {
var methods = {
init: function (options) {
var defaults = {
duration: 200, // ms
dist: -100, // zoom scale TODO: make this more intuitive as an option
shift: 0, // spacing for center image
padding: 0, // Padding between non center items
fullWidth: false, // Change to full width styles
indicators: false, // Toggle indicators
noWrap: false, // Don't wrap around and cycle through items.
onCycleTo: null // Callback for when a new slide is cycled to.
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
var images, item_width, item_height, offset, center, pressed, dim, count,
reference, referenceY, amplitude, target, velocity, scrolling,
xform, frame, timestamp, ticker, dragged, vertical_dragged;
var $indicators = $(' var scrollingTimeout = null;
var oneTimeCallback = null;
// Initialize
var view = $(this);
var showIndicators = view.attr('data-indicators') || options.indicators;
// Options
var setCarouselHeight = function () {
var firstImage = view.find('.carousel-item img').first();
if (firstImage.length) {
if (firstImage.prop('complete')) {
view.css('height', firstImage.height());
} else {
firstImage.on('load', function () {
view.css('height', $(this).height());
});
}
} else {
var imageHeight = view.find('.carousel-item').first().height();
view.css('height', imageHeight);
}
};
if (options.fullWidth) {
options.dist = 0;
setCarouselHeight();
// Offset fixed items when indicators.
if (showIndicators) {
view.find('.carousel-fixed-item').addClass('with-indicators');
}
}
// Don't double initialize.
if (view.hasClass('initialized')) {
// Recalculate variables
$(window).trigger('resize');
// Redraw carousel.
$(this).trigger('carouselNext', [0.000001]);
return true;
}
view.addClass('initialized');
pressed = false;
offset = target = 0;
images = [];
item_width = view.find('.carousel-item').first().innerWidth();
item_height = view.find('.carousel-item').first().innerHeight();
dim = item_width * 2 + options.padding;
view.find('.carousel-item').each(function (i) {
images.push($(this)[0]);
if (showIndicators) {
var $indicator = $('');
// Add active to first by default.
if (i === 0) {
$indicator.addClass('active');
}
// Handle clicks on indicators.
$indicator.click(function (e) {
e.stopPropagation();
var index = $(this).index();
cycleTo(index);
});
$indicators.append($indicator);
}
});
if (showIndicators) {
view.append($indicators);
}
count = images.length;
function setupEvents() {
if (typeof window.ontouchstart !== 'undefined') {
view[0].addEventListener('touchstart', tap);
view[0].addEventListener('touchmove', drag);
view[0].addEventListener('touchend', release);
}
view[0].addEventListener('mousedown', tap);
view[0].addEventListener('mousemove', drag);
view[0].addEventListener('mouseup', release);
view[0].addEventListener('mouseleave', release);
view[0].addEventListener('click', click);
}
function xpos(e) {
// touch event
if (e.targetTouches && (e.targetTouches.length >= 1)) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
function ypos(e) {
// touch event
if (e.targetTouches && (e.targetTouches.length >= 1)) {
return e.targetTouches[0].clientY;
}
// mouse event
return e.clientY;
}
function wrap(x) {
return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
}
function scroll(x) {
// Track scrolling state
scrolling = true;
if (!view.hasClass('scrolling')) {
view.addClass('scrolling');
}
if (scrollingTimeout != null) {
window.clearTimeout(scrollingTimeout);
}
scrollingTimeout = window.setTimeout(function () {
scrolling = false;
view.removeClass('scrolling');
}, options.duration);
// Start actual scroll
var i, half, delta, dir, tween, el, alignment, xTranslation;
var lastCenter = center;
offset = (typeof x === 'number') ? x : offset;
center = Math.floor((offset + dim / 2) / dim);
delta = offset - center * dim;
dir = (delta < 0) ? 1 : -1;
tween = -dir * delta * 2 / dim;
half = count >> 1;
if (!options.fullWidth) {
alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
} else {
alignment = 'translateX(0)';
}
// Set indicator active
if (showIndicators) {
var diff = (center % count);
var activeIndicator = $indicators.find('.indicator-item.active');
if (activeIndicator.index() !== diff) {
activeIndicator.removeClass('active');
$indicators.find('.indicator-item').eq(diff).addClass('active');
}
}
// center
// Don't show wrapped items.
if (!options.noWrap || (center >= 0 && center < count)) {
el = images[wrap(center)];
// Add active class to center item.
if (!$(el).hasClass('active')) {
view.find('.carousel-item').removeClass('active');
$(el).addClass('active');
}
el.style[xform] = alignment +
' translateX(' + (-delta / 2) + 'px)' +
' translateX(' + (dir * options.shift * tween * i) + 'px)' +
' translateZ(' + (options.dist * tween) + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
for (i = 1; i <= half; ++i) {
// right side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 + tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
}
// Don't show wrapped items.
if (!options.noWrap || center + i < count) {
el = images[wrap(center + i)];
el.style[xform] = alignment +
' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// left side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 - tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
}
// Don't show wrapped items.
if (!options.noWrap || center - i >= 0) {
el = images[wrap(center - i)];
el.style[xform] = alignment +
' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
}
// center
// Don't show wrapped items.
if (!options.noWrap || (center >= 0 && center < count)) {
el = images[wrap(center)];
el.style[xform] = alignment +
' translateX(' + (-delta / 2) + 'px)' +
' translateX(' + (dir * options.shift * tween) + 'px)' +
' translateZ(' + (options.dist * tween) + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// onCycleTo callback
if (lastCenter !== center &&
typeof (options.onCycleTo) === "function") {
var $curr_item = view.find('.carousel-item').eq(wrap(center));
options.onCycleTo.call(this, $curr_item, dragged);
}
// One time callback
if (typeof (oneTimeCallback) === "function") {
oneTimeCallback.call(this, $curr_item, dragged);
oneTimeCallback = null;
}
}
function track() {
var now, elapsed, delta, v;
now = Date.now();
elapsed = now - timestamp;
timestamp = now;
delta = offset - frame;
frame = offset;
v = 1000 * delta / (1 + elapsed);
velocity = 0.8 * v + 0.2 * velocity;
}
function autoScroll() {
var elapsed, delta;
if (amplitude) {
elapsed = Date.now() - timestamp;
delta = amplitude * Math.exp(-elapsed / options.duration);
if (delta > 2 || delta < -2) {
scroll(target - delta);
requestAnimationFrame(autoScroll);
} else {
scroll(target);
}
}
}
function click(e) {
// Disable clicks if carousel was dragged.
if (dragged) {
e.preventDefault();
e.stopPropagation();
return false;
} else if (!options.fullWidth) {
var clickedIndex = $(e.target).closest('.carousel-item').index();
var diff = wrap(center) - clickedIndex;
// Disable clicks if carousel was shifted by click
if (diff !== 0) {
e.preventDefault();
e.stopPropagation();
}
cycleTo(clickedIndex);
}
}
function cycleTo(n) {
var diff = (center % count) - n;
// Account for wraparound.
if (!options.noWrap) {
if (diff < 0) {
if (Math.abs(diff + count) < Math.abs(diff)) {
diff += count;
}
} else if (diff > 0) {
if (Math.abs(diff - count) < diff) {
diff -= count;
}
}
}
// Call prev or next accordingly.
if (diff < 0) {
view.trigger('carouselNext', [Math.abs(diff)]);
} else if (diff > 0) {
view.trigger('carouselPrev', [diff]);
}
}
function tap(e) {
if (e.type === 'mousedown') {
e.preventDefault();
}
pressed = true;
dragged = false;
vertical_dragged = false;
reference = xpos(e);
referenceY = ypos(e);
velocity = amplitude = 0;
frame = offset;
timestamp = Date.now();
clearInterval(ticker);
ticker = setInterval(track, 100);
}
function drag(e) {
var x, delta, deltaY;
if (pressed) {
x = xpos(e);
y = ypos(e);
delta = reference - x;
deltaY = Math.abs(referenceY - y);
if (deltaY < 30 && !vertical_dragged) {
// If vertical scrolling don't allow dragging.
if (delta > 2 || delta < -2) {
dragged = true;
reference = x;
scroll(offset + delta);
}
} else if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
} else {
// Vertical scrolling.
vertical_dragged = true;
}
}
if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
}
}
function release(e) {
if (pressed) {
pressed = false;
} else {
return;
}
clearInterval(ticker);
target = offset;
if (velocity > 10 || velocity < -10) {
amplitude = 0.9 * velocity;
target = offset + amplitude;
}
target = Math.round(target / dim) * dim;
// No wrap of items.
if (options.noWrap) {
if (target >= dim * (count - 1)) {
target = dim * (count - 1);
} else if (target < 0) {
target = 0;
}
}
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
if (dragged) {
e.preventDefault();
e.stopPropagation();
}
return false;
}
xform = 'transform';
['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
var e = prefix + 'Transform';
if (typeof document.body.style[e] !== 'undefined') {
xform = e;
return false;
}
return true;
});
$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, function () {
if (options.fullWidth) {
item_width = view.find('.carousel-item').first().innerWidth();
item_height = view.find('.carousel-item').first().innerHeight();
dim = item_width * 2 + options.padding;
offset = center * 2 * item_width;
target = offset;
} else {
scroll();
}
});
setupEvents();
scroll(offset);
$(this).on('carouselNext', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof (callback) === "function") {
oneTimeCallback = callback;
}
target = (dim * Math.round(offset / dim)) + (dim * n);
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselPrev', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof (callback) === "function") {
oneTimeCallback = callback;
}
target = (dim * Math.round(offset / dim)) - (dim * n);
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselSet', function (e, n, callback) {
if (n === undefined) {
n = 0;
}
if (typeof (callback) === "function") {
oneTimeCallback = callback;
}
cycleTo(n);
});
});
},
next: function (n, callback) {
$(this).trigger('carouselNext', [n, callback]);
},
prev: function (n, callback) {
$(this).trigger('carouselPrev', [n, callback]);
},
set: function (n, callback) {
$(this).trigger('carouselSet', [n, callback]);
}
};
$.fn.carousel = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
}
}; // Plugin end
}(jQuery));; (function ($) {
var methods = {
init: function (options) {
return this.each(function () {
var origin = $('#' + $(this).attr('data-activates'));
var screen = $('body');
// Creating tap target
var tapTargetEl = $(this);
var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
// Creating wrapper
if (!tapTargetWrapper.length) {
tapTargetWrapper = tapTargetEl.wrap($('')).parent();
}
// Creating content
if (!tapTargetContentEl.length) {
tapTargetContentEl = $('');
tapTargetEl.append(tapTargetContentEl);
}
// Creating foreground wave
if (!tapTargetWave.length) {
tapTargetWave = $('');
// Creating origin
if (!tapTargetOriginEl.length) {
tapTargetOriginEl = origin.clone(true, true);
tapTargetOriginEl.addClass('tap-target-origin');
tapTargetOriginEl.removeAttr('id');
tapTargetOriginEl.removeAttr('style');
tapTargetWave.append(tapTargetOriginEl);
}
tapTargetWrapper.append(tapTargetWave);
}
// Open
var openTapTarget = function () {
if (tapTargetWrapper.is('.open')) {
return;
}
// Adding open class
tapTargetWrapper.addClass('open');
setTimeout(function () {
tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
tapTargetOriginEl.off('click.tapTarget');
});
$(document).off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
$(document).off('click.tapTarget');
});
var throttledCalc = Materialize.throttle(function () {
calculateTapTarget();
}, 200);
$(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
}, 0);
};
// Close
var closeTapTarget = function () {
if (!tapTargetWrapper.is('.open')) {
return;
}
tapTargetWrapper.removeClass('open');
tapTargetOriginEl.off('click.tapTarget')
$(document).off('click.tapTarget');
$(window).off('resize.tapTarget');
};
// Pre calculate
var calculateTapTarget = function () {
// Element or parent is fixed position?
var isFixed = origin.css('position') === 'fixed';
if (!isFixed) {
var parents = origin.parents();
for (var i = 0; i < parents.length; i++) {
isFixed = $(parents[i]).css('position') == 'fixed';
if (isFixed) {
break;
}
}
}
// Calculating origin
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
// Calculating screen
var windowWidth = $(window).width();
var windowHeight = $(window).height();
var centerX = windowWidth / 2;
var centerY = windowHeight / 2;
var isLeft = originLeft <= centerX;
var isRight = originLeft > centerX;
var isTop = originTop <= centerY;
var isBottom = originTop > centerY;
var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
// Calculating tap target
var tapTargetWidth = tapTargetEl.outerWidth();
var tapTargetHeight = tapTargetEl.outerHeight();
var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
// Calculating content
var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
var tapTargetTextHeight = tapTargetHeight / 2;
var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
var tapTargetTextBottom = 0;
var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
var tapTargetTextRight = 0;
var tapTargetTextPadding = originWidth;
var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
// Calculating wave
var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
var tapTargetWaveHeight = tapTargetWaveWidth;
var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
// Setting tap target
var tapTargetWrapperCssObj = {};
tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ;
tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ;
tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ;
tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ;
tapTargetWrapperCssObj.position = tapTargetPosition;
tapTargetWrapper.css(tapTargetWrapperCssObj);
// Setting content
tapTargetContentEl.css({
width: tapTargetTextWidth,
height: tapTargetTextHeight,
top: tapTargetTextTop,
right: tapTargetTextRight,
bottom: tapTargetTextBottom,
left: tapTargetTextLeft,
padding: tapTargetTextPadding,
verticalAlign: tapTargetTextAlign
});
// Setting wave
tapTargetWave.css({
top: tapTargetWaveTop,
left: tapTargetWaveLeft,
width: tapTargetWaveWidth,
height: tapTargetWaveHeight
});
}
if (options == 'open') {
calculateTapTarget();
openTapTarget();
}
if (options == 'close')
closeTapTarget();
});
},
open: function () {},
close: function () {}
};
$.fn.tapTarget = function (methodOrOptions) {
if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
return methods.init.apply(this, arguments);
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
};
}(jQuery));