/*!
* jQuery JavaScript Library v3.2.1 * https://jquery.com/ * * Includes Sizzle.js * https://sizzlejs.com/ * * Copyright JS Foundation and other contributors * Released under the MIT license * https://jquery.org/license * * Date: 2017-03-20T18:59Z */
(function (global, factory) {
"use strict";
if (typeof module === "object" && typeof module.exports === "object") {
// For CommonJS and CommonJS-like environments where a proper `window` // is present, execute the factory and get jQuery. // For environments that do not have a `window` with a `document` // (such as Node.js), expose a factory as module.exports. // This accentuates the need for the creation of a real `window`. // e.g. var jQuery = require("jquery")(window); // See ticket #14549 for more info. module.exports = global.document ? factory(global, true) : function (w) { if (!w.document) { throw new Error("jQuery requires a window with a document"); } return factory(w); }; } else { factory(global); }
// Pass this if window is not defined yet
})(typeof window !== "undefined" ? window : this, function (window, noGlobal) {
// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 // throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode // arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common // enough that all such attempts are guarded in a try block. "use strict";
var arr = [];
var document = window.document;
var getProto = Object.getPrototypeOf;
var slice = arr.slice;
var concat = arr.concat;
var push = arr.push;
var indexOf = arr.indexOf;
var class2type = {};
var toString = class2type.toString;
var hasOwn = class2type.hasOwnProperty;
var fnToString = hasOwn.toString;
var ObjectFunctionString = fnToString.call(Object);
var support = {};
function DOMEval(code, doc) { doc = doc || document;
var script = doc.createElement("script");
script.text = code; doc.head.appendChild(script).parentNode.removeChild(script); } /* global Symbol */ // Defining this global in .eslintrc.json would create a danger of using the global // unguarded in another place, it seems safer to define global only for this module
var version = "3.2.1",
// Define a local copy of jQuery jQuery = function (selector, context) {
// The jQuery object is actually just the init constructor 'enhanced' // Need init if jQuery is called (just allow error to be thrown if not included) return new jQuery.fn.init(selector, context); },
// Support: Android <=4.0 only // Make sure we trim BOM and NBSP rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
// Matches dashed string for camelizing rmsPrefix = /^-ms-/, rdashAlpha = /-([a-z])/g,
// Used by jQuery.camelCase as callback to replace() fcamelCase = function (all, letter) { return letter.toUpperCase(); };
jQuery.fn = jQuery.prototype = {
// The current version of jQuery being used jquery: version,
constructor: jQuery,
// The default length of a jQuery object is 0 length: 0,
toArray: function () { return slice.call(this); },
// Get the Nth element in the matched element set OR // Get the whole matched element set as a clean array get: function (num) {
// Return all the elements in a clean array if (num == null) { return slice.call(this); }
// Return just the one element from the set return num < 0 ? this[num + this.length] : this[num]; },
// Take an array of elements and push it onto the stack // (returning the new matched element set) pushStack: function (elems) {
// Build a new jQuery matched element set var ret = jQuery.merge(this.constructor(), elems);
// Add the old object onto the stack (as a reference) ret.prevObject = this;
// Return the newly-formed element set return ret; },
// Execute a callback for every element in the matched set. each: function (callback) { return jQuery.each(this, callback); },
map: function (callback) { return this.pushStack(jQuery.map(this, function (elem, i) { return callback.call(elem, i, elem); })); },
slice: function () { return this.pushStack(slice.apply(this, arguments)); },
first: function () { return this.eq(0); },
last: function () { return this.eq(-1); },
eq: function (i) { var len = this.length, j = +i + (i < 0 ? len : 0); return this.pushStack(j >= 0 && j < len ? [this[j]] : []); },
end: function () { return this.prevObject || this.constructor(); },
// For internal use only. // Behaves like an Array's method, not like a jQuery method. push: push, sort: arr.sort, splice: arr.splice };
jQuery.extend = jQuery.fn.extend = function () { var options, name, src, copy, copyIsArray, clone, target = arguments[0] || {}, i = 1, length = arguments.length, deep = false;
// Handle a deep copy situation if (typeof target === "boolean") { deep = target;
// Skip the boolean and the target target = arguments[i] || {}; i++; }
// Handle case when target is a string or something (possible in deep copy) if (typeof target !== "object" && !jQuery.isFunction(target)) { target = {}; }
// Extend jQuery itself if only one argument is passed if (i === length) { target = this; i--; }
for (; i < length; i++) {
// Only deal with non-null/undefined values if ((options = arguments[i]) != null) {
// Extend the base object for (name in options) { src = target[name]; copy = options[name];
// Prevent never-ending loop if (target === copy) { continue; }
// Recurse if we're merging plain objects or arrays if (deep && copy && (jQuery.isPlainObject(copy) || (copyIsArray = Array.isArray(copy)))) {
if (copyIsArray) { copyIsArray = false; clone = src && Array.isArray(src) ? src : [];
} else { clone = src && jQuery.isPlainObject(src) ? src : {}; }
// Never move original objects, clone them target[name] = jQuery.extend(deep, clone, copy);
// Don't bring in undefined values } else if (copy !== undefined) { target[name] = copy; } } } }
// Return the modified object return target; };
jQuery.extend({
// Unique for each copy of jQuery on the page expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""),
// Assume jQuery is ready without the ready module isReady: true,
error: function (msg) { throw new Error(msg); },
noop: function () {},
isFunction: function (obj) { return jQuery.type(obj) === "function"; },
isWindow: function (obj) { return obj != null && obj === obj.window; },
isNumeric: function (obj) {
// As of jQuery 3.0, isNumeric is limited to // strings and numbers (primitives or objects) // that can be coerced to finite numbers (gh-2662) var type = jQuery.type(obj); return (type === "number" || type === "string") &&
// parseFloat NaNs numeric-cast false positives ("") // ...but misinterprets leading-number strings, particularly hex literals ("0x...") // subtraction forces infinities to NaN !isNaN(obj - parseFloat(obj)); },
isPlainObject: function (obj) { var proto, Ctor;
// Detect obvious negatives // Use toString instead of jQuery.type to catch host objects if (!obj || toString.call(obj) !== "[object Object]") { return false; }
proto = getProto(obj);
// Objects with no prototype (e.g., `Object.create( null )`) are plain if (!proto) { return true; }
// Objects with prototype are plain iff they were constructed by a global Object function Ctor = hasOwn.call(proto, "constructor") && proto.constructor; return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString; },
isEmptyObject: function (obj) {
/* eslint-disable no-unused-vars */ // See https://github.com/eslint/eslint/issues/6125 var name;
for (name in obj) { return false; } return true; },
type: function (obj) { if (obj == null) { return obj + ""; }
// Support: Android <=2.3 only (functionish RegExp) return typeof obj === "object" || typeof obj === "function" ? class2type[toString.call(obj)] || "object" : typeof obj; },
// Evaluates a script in a global context globalEval: function (code) { DOMEval(code); },
// Convert dashed to camelCase; used by the css and data modules // Support: IE <=9 - 11, Edge 12 - 13 // Microsoft forgot to hump their vendor prefix (#9572) camelCase: function (string) { return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase); },
each: function (obj, callback) { var length, i = 0;
if (isArrayLike(obj)) { length = obj.length; for (; i < length; i++) { if (callback.call(obj[i], i, obj[i]) === false) { break; } } } else { for (i in obj) { if (callback.call(obj[i], i, obj[i]) === false) { break; } } }
return obj; },
// Support: Android <=4.0 only trim: function (text) { return text == null ? "" : (text + "").replace(rtrim, ""); },
// results is for internal usage only makeArray: function (arr, results) { var ret = results || [];
if (arr != null) { if (isArrayLike(Object(arr))) { jQuery.merge(ret, typeof arr === "string" ? [arr] : arr ); } else { push.call(ret, arr); } }
return ret; },
inArray: function (elem, arr, i) { return arr == null ? -1 : indexOf.call(arr, elem, i); },
// Support: Android <=4.0 only, PhantomJS 1 only // push.apply(_, arraylike) throws on ancient WebKit merge: function (first, second) { var len = +second.length, j = 0, i = first.length;
for (; j < len; j++) { first[i++] = second[j]; }
first.length = i;
return first; },
grep: function (elems, callback, invert) { var callbackInverse, matches = [], i = 0, length = elems.length, callbackExpect = !invert;
// Go through the array, only saving the items // that pass the validator function for (; i < length; i++) { callbackInverse = !callback(elems[i], i); if (callbackInverse !== callbackExpect) { matches.push(elems[i]); } }
return matches; },
// arg is for internal usage only map: function (elems, callback, arg) { var length, value, i = 0, ret = [];
// Go through the array, translating each of the items to their new values if (isArrayLike(elems)) { length = elems.length; for (; i < length; i++) { value = callback(elems[i], i, arg);
if (value != null) { ret.push(value); } }
// Go through every key on the object, } else { for (i in elems) { value = callback(elems[i], i, arg);
if (value != null) { ret.push(value); } } }
// Flatten any nested arrays return concat.apply([], ret); },
// A global GUID counter for objects guid: 1,
// Bind a function to a context, optionally partially applying any // arguments. proxy: function (fn, context) { var tmp, args, proxy;
if (typeof context === "string") { tmp = fn[context]; context = fn; fn = tmp; }
// Quick check to determine if target is callable, in the spec // this throws a TypeError, but we will just return undefined. if (!jQuery.isFunction(fn)) { return undefined; }
// Simulated bind args = slice.call(arguments, 2); proxy = function () { return fn.apply(context || this, args.concat(slice.call(arguments))); };
// Set the guid of unique handler to the same of original handler, so it can be removed proxy.guid = fn.guid = fn.guid || jQuery.guid++;
return proxy; },
now: Date.now,
// jQuery.support is not used in Core but other projects attach their // properties to it so it needs to exist. support: support });
if (typeof Symbol === "function") { jQuery.fn[Symbol.iterator] = arr[Symbol.iterator]; }
// Populate the class2type map jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "), function (i, name) { class2type["[object " + name + "]"] = name.toLowerCase(); });
function isArrayLike(obj) {
// Support: real iOS 8.2 only (not reproducible in simulator) // `in` check used to prevent JIT error (gh-2145) // hasOwn isn't used here due to false negatives // regarding Nodelist length in IE var length = !!obj && "length" in obj && obj.length, type = jQuery.type(obj);
if (type === "function" || jQuery.isWindow(obj)) { return false; }
return type === "array" || length === 0 || typeof length === "number" && length > 0 && (length - 1) in obj; } var Sizzle = /*! * Sizzle CSS Selector Engine v2.3.3 * https://sizzlejs.com/ * * Copyright jQuery Foundation and other contributors * Released under the MIT license * http://jquery.org/license * * Date: 2016-08-08 */ (function (window) {
var i, support, Expr, getText, isXML, tokenize, compile, select, outermostContext, sortInput, hasDuplicate,
// Local document vars setDocument, document, docElem, documentIsHTML, rbuggyQSA, rbuggyMatches, matches, contains,
// Instance-specific data expando = "sizzle" + 1 * new Date(), preferredDoc = window.document, dirruns = 0, done = 0, classCache = createCache(), tokenCache = createCache(), compilerCache = createCache(), sortOrder = function (a, b) { if (a === b) { hasDuplicate = true; } return 0; },
// Instance methods hasOwn = ({}).hasOwnProperty, arr = [], pop = arr.pop, push_native = arr.push, push = arr.push, slice = arr.slice, // Use a stripped-down indexOf as it's faster than native // https://jsperf.com/thor-indexof-vs-for/5 indexOf = function (list, elem) { var i = 0, len = list.length; for (; i < len; i++) { if (list[i] === elem) { return i; } } return -1; },
booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
// Regular expressions
// http://www.w3.org/TR/css3-selectors/#whitespace whitespace = "[\\x20\\t\\r\\n\\f]",
// http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+",
// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + // Operator (capture 2) "*([*^$|!~]?=)" + whitespace + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + "*\\]",
pseudos = ":(" + identifier + ")(?:\\((" + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: // 1. quoted (capture 3; capture 4 or capture 5) "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + // 2. simple (capture 6) "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + // 3. anything else (capture 2) ".*" + ")\\)|)",
// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter rwhitespace = new RegExp(whitespace + "+", "g"), rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g"),
rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"), rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*"),
rattributeQuotes = new RegExp("=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g"),
rpseudo = new RegExp(pseudos), ridentifier = new RegExp("^" + identifier + "$"),
matchExpr = { "ID": new RegExp("^#(" + identifier + ")"), "CLASS": new RegExp("^\\.(" + identifier + ")"), "TAG": new RegExp("^(" + identifier + "|[*])"), "ATTR": new RegExp("^" + attributes), "PSEUDO": new RegExp("^" + pseudos), "CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i"), "bool": new RegExp("^(?:" + booleans + ")$", "i"), // For use in libraries implementing .is() // We use this for POS matching in `select` "needsContext": new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i") },
rinputs = /^(?:input|select|textarea|button)$/i, rheader = /^h\d$/i,
rnative = /^[^{]+\{\s*\[native \w/,
// Easily-parseable/retrievable ID or TAG or CLASS selectors rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
rsibling = /[+~]/,
// CSS escapes // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters runescape = new RegExp("\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig"), funescape = function (_, escaped, escapedWhitespace) { var high = "0x" + escaped - 0x10000; // NaN means non-codepoint // Support: Firefox<24 // Workaround erroneous numeric interpretation of +"0x" return high !== high || escapedWhitespace ? escaped : high < 0 ? // BMP codepoint String.fromCharCode(high + 0x10000) : // Supplemental Plane codepoint (surrogate pair) String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00); },
// CSS string/identifier serialization // https://drafts.csswg.org/cssom/#common-serializing-idioms rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, fcssescape = function (ch, asCodePoint) { if (asCodePoint) {
// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER if (ch === "\0") { return "\uFFFD"; }
// Control characters and (dependent upon position) numbers get escaped as code points return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " "; }
// Other potentially-special ASCII characters get backslash-escaped return "\\" + ch; },
// Used for iframes // See setDocument() // Removing the function wrapper causes a "Permission Denied" // error in IE unloadHandler = function () { setDocument(); },
disabledAncestor = addCombinator( function (elem) { return elem.disabled === true && ("form" in elem || "label" in elem); }, { dir: "parentNode", next: "legend" } );
// Optimize for push.apply( _, NodeList ) try { push.apply( (arr = slice.call(preferredDoc.childNodes)), preferredDoc.childNodes ); // Support: Android<4.0 // Detect silently failing push.apply arr[preferredDoc.childNodes.length].nodeType; } catch (e) { push = { apply: arr.length ?
// Leverage slice if possible function (target, els) { push_native.apply(target, slice.call(els)); } :
// Support: IE<9 // Otherwise append directly function (target, els) { var j = target.length, i = 0; // Can't trust NodeList.length while ((target[j++] = els[i++])) {} target.length = j - 1; } }; }
function Sizzle(selector, context, results, seed) { var m, i, elem, nid, match, groups, newSelector, newContext = context && context.ownerDocument,
// nodeType defaults to 9, since context defaults to document nodeType = context ? context.nodeType : 9;
results = results || [];
// Return early from calls with invalid selector or context if (typeof selector !== "string" || !selector || nodeType !== 1 && nodeType !== 9 && nodeType !== 11) {
return results; }
// Try to shortcut find operations (as opposed to filters) in HTML documents if (!seed) {
if ((context ? context.ownerDocument || context : preferredDoc) !== document) { setDocument(context); } context = context || document;
if (documentIsHTML) {
// If the selector is sufficiently simple, try using a "get*By*" DOM method // (excepting DocumentFragment context, where the methods don't exist) if (nodeType !== 11 && (match = rquickExpr.exec(selector))) {
// ID selector if ((m = match[1])) {
// Document context if (nodeType === 9) { if ((elem = context.getElementById(m))) {
// Support: IE, Opera, Webkit // TODO: identify versions // getElementById can match elements by name instead of ID if (elem.id === m) { results.push(elem); return results; } } else { return results; }
// Element context } else {
// Support: IE, Opera, Webkit // TODO: identify versions // getElementById can match elements by name instead of ID if (newContext && (elem = newContext.getElementById(m)) && contains(context, elem) && elem.id === m) {
results.push(elem); return results; } }
// Type selector } else if (match[2]) { push.apply(results, context.getElementsByTagName(selector)); return results;
// Class selector } else if ((m = match[3]) && support.getElementsByClassName && context.getElementsByClassName) {
push.apply(results, context.getElementsByClassName(m)); return results; } }
// Take advantage of querySelectorAll if (support.qsa && !compilerCache[selector + " "] && (!rbuggyQSA || !rbuggyQSA.test(selector))) {
if (nodeType !== 1) { newContext = context; newSelector = selector;
// qSA looks outside Element context, which is not what we want // Thanks to Andrew Dupont for this workaround technique // Support: IE <=8 // Exclude object elements } else if (context.nodeName.toLowerCase() !== "object") {
// Capture the context ID, setting it first if necessary if ((nid = context.getAttribute("id"))) { nid = nid.replace(rcssescape, fcssescape); } else { context.setAttribute("id", (nid = expando)); }
// Prefix every selector in the list groups = tokenize(selector); i = groups.length; while (i--) { groups[i] = "#" + nid + " " + toSelector(groups[i]); } newSelector = groups.join(",");
// Expand context for sibling selectors newContext = rsibling.test(selector) && testContext(context.parentNode) || context; }
if (newSelector) { try { push.apply(results, newContext.querySelectorAll(newSelector) ); return results; } catch (qsaError) {} finally { if (nid === expando) { context.removeAttribute("id"); } } } } } }
// All others return select(selector.replace(rtrim, "$1"), context, results, seed); }
/** * Create key-value caches of limited size * @returns {function(string, object)} Returns the Object data after storing it on itself with * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) * deleting the oldest entry */ function createCache() { var keys = [];
function cache(key, value) { // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) if (keys.push(key + " ") > Expr.cacheLength) { // Only keep the most recent entries delete cache[keys.shift()]; } return (cache[key + " "] = value); } return cache; }
/** * Mark a function for special use by Sizzle * @param {Function} fn The function to mark */ function markFunction(fn) { fn[expando] = true; return fn; }
/** * Support testing using an element * @param {Function} fn Passed the created element and returns a boolean result */ function assert(fn) { var el = document.createElement("fieldset");
try { return !!fn(el); } catch (e) { return false; } finally { // Remove from its parent by default if (el.parentNode) { el.parentNode.removeChild(el); } // release memory in IE el = null; } }
/** * Adds the same handler for all of the specified attrs * @param {String} attrs Pipe-separated list of attributes * @param {Function} handler The method that will be applied */ function addHandle(attrs, handler) { var arr = attrs.split("|"), i = arr.length;
while (i--) { Expr.attrHandle[arr[i]] = handler; } }
/** * Checks document order of two siblings * @param {Element} a * @param {Element} b * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b */ function siblingCheck(a, b) { var cur = b && a, diff = cur && a.nodeType === 1 && b.nodeType === 1 && a.sourceIndex - b.sourceIndex;
// Use IE sourceIndex if available on both nodes if (diff) { return diff; }
// Check if b follows a if (cur) { while ((cur = cur.nextSibling)) { if (cur === b) { return -1; } } }
return a ? 1 : -1; }
/** * Returns a function to use in pseudos for input types * @param {String} type */ function createInputPseudo(type) { return function (elem) { var name = elem.nodeName.toLowerCase(); return name === "input" && elem.type === type; }; }
/** * Returns a function to use in pseudos for buttons * @param {String} type */ function createButtonPseudo(type) { return function (elem) { var name = elem.nodeName.toLowerCase(); return (name === "input" || name === "button") && elem.type === type; }; }
/** * Returns a function to use in pseudos for :enabled/:disabled * @param {Boolean} disabled true for :disabled; false for :enabled */ function createDisabledPseudo(disabled) {
// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable return function (elem) {
// Only certain elements can match :enabled or :disabled // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled if ("form" in elem) {
// Check for inherited disabledness on relevant non-disabled elements: // * listed form-associated elements in a disabled fieldset // https://html.spec.whatwg.org/multipage/forms.html#category-listed // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled // * option elements in a disabled optgroup // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled // All such elements have a "form" property. if (elem.parentNode && elem.disabled === false) {
// Option elements defer to a parent optgroup if present if ("label" in elem) { if ("label" in elem.parentNode) { return elem.parentNode.disabled === disabled; } else { return elem.disabled === disabled; } }
// Support: IE 6 - 11 // Use the isDisabled shortcut property to check for disabled fieldset ancestors return elem.isDisabled === disabled ||
// Where there is no isDisabled, check manually /* jshint -W018 */ elem.isDisabled !== !disabled && disabledAncestor(elem) === disabled; }
return elem.disabled === disabled;
// Try to winnow out elements that can't be disabled before trusting the disabled property. // Some victims get caught in our net (label, legend, menu, track), but it shouldn't // even exist on them, let alone have a boolean value. } else if ("label" in elem) { return elem.disabled === disabled; }
// Remaining elements are neither :enabled nor :disabled return false; }; }
/** * Returns a function to use in pseudos for positionals * @param {Function} fn */ function createPositionalPseudo(fn) { return markFunction(function (argument) { argument = +argument; return markFunction(function (seed, matches) { var j, matchIndexes = fn([], seed.length, argument), i = matchIndexes.length;
// Match elements found at the specified indexes while (i--) { if (seed[(j = matchIndexes[i])]) { seed[j] = !(matches[j] = seed[j]); } } }); }); }
/** * Checks a node for validity as a Sizzle context * @param {Element|Object=} context * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value */ function testContext(context) { return context && typeof context.getElementsByTagName !== "undefined" && context; }
// Expose support vars for convenience support = Sizzle.support = {};
/** * Detects XML nodes * @param {Element|Object} elem An element or a document * @returns {Boolean} True iff elem is a non-HTML XML node */ isXML = Sizzle.isXML = function (elem) { // documentElement is verified for cases where it doesn't yet exist // (such as loading iframes in IE - #4833) var documentElement = elem && (elem.ownerDocument || elem).documentElement; return documentElement ? documentElement.nodeName !== "HTML" : false; };
/** * Sets document-related variables once based on the current document * @param {Element|Object} [doc] An element or document object to use to set the document * @returns {Object} Returns the current document */ setDocument = Sizzle.setDocument = function (node) { var hasCompare, subWindow, doc = node ? node.ownerDocument || node : preferredDoc;
// Return early if doc is invalid or already selected if (doc === document || doc.nodeType !== 9 || !doc.documentElement) { return document; }
// Update global variables document = doc; docElem = document.documentElement; documentIsHTML = !isXML(document);
// Support: IE 9-11, Edge // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) if (preferredDoc !== document && (subWindow = document.defaultView) && subWindow.top !== subWindow) {
// Support: IE 11, Edge if (subWindow.addEventListener) { subWindow.addEventListener("unload", unloadHandler, false);
// Support: IE 9 - 10 only } else if (subWindow.attachEvent) { subWindow.attachEvent("onunload", unloadHandler); } }
/* Attributes ---------------------------------------------------------------------- */
// Support: IE<8 // Verify that getAttribute really returns attributes and not properties // (excepting IE8 booleans) support.attributes = assert(function (el) { el.className = "i"; return !el.getAttribute("className"); });
/* getElement(s)By* ---------------------------------------------------------------------- */
// Check if getElementsByTagName("*") returns only elements support.getElementsByTagName = assert(function (el) { el.appendChild(document.createComment("")); return !el.getElementsByTagName("*").length; });
// Support: IE<9 support.getElementsByClassName = rnative.test(document.getElementsByClassName);
// Support: IE<10 // Check if getElementById returns elements by name // The broken getElementById methods don't pick up programmatically-set names, // so use a roundabout getElementsByName test support.getById = assert(function (el) { docElem.appendChild(el).id = expando; return !document.getElementsByName || !document.getElementsByName(expando).length; });
// ID filter and find if (support.getById) { Expr.filter["ID"] = function (id) { var attrId = id.replace(runescape, funescape); return function (elem) { return elem.getAttribute("id") === attrId; }; }; Expr.find["ID"] = function (id, context) { if (typeof context.getElementById !== "undefined" && documentIsHTML) { var elem = context.getElementById(id); return elem ? [elem] : []; } }; } else { Expr.filter["ID"] = function (id) { var attrId = id.replace(runescape, funescape); return function (elem) { var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); return node && node.value === attrId; }; };
// Support: IE 6 - 7 only // getElementById is not reliable as a find shortcut Expr.find["ID"] = function (id, context) { if (typeof context.getElementById !== "undefined" && documentIsHTML) { var node, i, elems, elem = context.getElementById(id);
if (elem) {
// Verify the id attribute node = elem.getAttributeNode("id"); if (node && node.value === id) { return [elem]; }
// Fall back on getElementsByName elems = context.getElementsByName(id); i = 0; while ((elem = elems[i++])) { node = elem.getAttributeNode("id"); if (node && node.value === id) { return [elem]; } } }
return []; } }; }
// Tag Expr.find["TAG"] = support.getElementsByTagName ? function (tag, context) { if (typeof context.getElementsByTagName !== "undefined") { return context.getElementsByTagName(tag);
// DocumentFragment nodes don't have gEBTN } else if (support.qsa) { return context.querySelectorAll(tag); } } :
function (tag, context) { var elem, tmp = [], i = 0, // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too results = context.getElementsByTagName(tag);
// Filter out possible comments if (tag === "*") { while ((elem = results[i++])) { if (elem.nodeType === 1) { tmp.push(elem); } }
return tmp; } return results; };
// Class Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) { if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) { return context.getElementsByClassName(className); } };
/* QSA/matchesSelector ---------------------------------------------------------------------- */
// QSA and matchesSelector support
// matchesSelector(:active) reports false when true (IE9/Opera 11.5) rbuggyMatches = [];
// qSa(:focus) reports false when true (Chrome 21) // We allow this because of a bug in IE8/9 that throws an error // whenever `document.activeElement` is accessed on an iframe // So, we allow :focus to pass through QSA all the time to avoid the IE error // See https://bugs.jquery.com/ticket/13378 rbuggyQSA = [];
if ((support.qsa = rnative.test(document.querySelectorAll))) { // Build QSA regex // Regex strategy adopted from Diego Perini assert(function (el) { // Select is set to empty string on purpose // This is to test IE's treatment of not explicitly // setting a boolean content attribute, // since its presence should be enough // https://bugs.jquery.com/ticket/12359 docElem.appendChild(el).innerHTML = "<a id='" + expando + "'></a>" + "<select id='" + expando + "-\r\\' msallowcapture=>" + "<option selected=></option></select>";
// Support: IE8, Opera 11-12.16 // Nothing should be selected when empty strings follow ^= or $= or *= // The test attribute must be unknown in Opera but "safe" for WinRT // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section if (el.querySelectorAll("[msallowcapture^=]").length) { rbuggyQSA.push("[*^$]=" + whitespace + "*(?:|\"\")"); }
// Support: IE8 // Boolean attributes and "value" are not treated correctly if (!el.querySelectorAll("[selected]").length) { rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")"); }
// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ if (!el.querySelectorAll("[id~=" + expando + "-]").length) { rbuggyQSA.push("~="); }
// Webkit/Opera - :checked should return selected option elements // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked // IE8 throws error here and will not see later tests if (!el.querySelectorAll(":checked").length) { rbuggyQSA.push(":checked"); }
// Support: Safari 8+, iOS 8+ // https://bugs.webkit.org/show_bug.cgi?id=136851 // In-page `selector#id sibling-combinator selector` fails if (!el.querySelectorAll("a#" + expando + "+*").length) { rbuggyQSA.push(".#.+[+~]"); } });
assert(function (el) { el.innerHTML = "<a href= disabled='disabled'></a>" + "<select disabled='disabled'><option/></select>";
// Support: Windows 8 Native Apps // The type and name attributes are restricted during .innerHTML assignment var input = document.createElement("input"); input.setAttribute("type", "hidden"); el.appendChild(input).setAttribute("name", "D");
// Support: IE8 // Enforce case-sensitivity of name attribute if (el.querySelectorAll("[name=d]").length) { rbuggyQSA.push("name" + whitespace + "*[*^$|!~]?="); }
// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) // IE8 throws error here and will not see later tests if (el.querySelectorAll(":enabled").length !== 2) { rbuggyQSA.push(":enabled", ":disabled"); }
// Support: IE9-11+ // IE's :disabled selector does not pick up the children of disabled fieldsets docElem.appendChild(el).disabled = true; if (el.querySelectorAll(":disabled").length !== 2) { rbuggyQSA.push(":enabled", ":disabled"); }
// Opera 10-11 does not throw on post-comma invalid pseudos el.querySelectorAll("*,:x"); rbuggyQSA.push(",.*:"); }); }
if ((support.matchesSelector = rnative.test((matches = docElem.matches || docElem.webkitMatchesSelector || docElem.mozMatchesSelector || docElem.oMatchesSelector || docElem.msMatchesSelector)))) {
assert(function (el) { // Check to see if it's possible to do matchesSelector // on a disconnected node (IE 9) support.disconnectedMatch = matches.call(el, "*");
// This should fail with an exception // Gecko does not error, returns false instead matches.call(el, "[s!=]:x"); rbuggyMatches.push("!=", pseudos); }); }
rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|")); rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
/* Contains ---------------------------------------------------------------------- */ hasCompare = rnative.test(docElem.compareDocumentPosition);
// Element contains another // Purposefully self-exclusive // As in, an element does not contain itself contains = hasCompare || rnative.test(docElem.contains) ? function (a, b) { var adown = a.nodeType === 9 ? a.documentElement : a, bup = b && b.parentNode; return a === bup || !!(bup && bup.nodeType === 1 && ( adown.contains ? adown.contains(bup) : a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16 )); } : function (a, b) { if (b) { while ((b = b.parentNode)) { if (b === a) { return true; } } } return false; };
/* Sorting ---------------------------------------------------------------------- */
// Document order sorting sortOrder = hasCompare ? function (a, b) {
// Flag for duplicate removal if (a === b) { hasDuplicate = true; return 0; }
// Sort on method existence if only one input has compareDocumentPosition var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; if (compare) { return compare; }
// Calculate position if both inputs belong to the same document compare = (a.ownerDocument || a) === (b.ownerDocument || b) ? a.compareDocumentPosition(b) :
// Otherwise we know they are disconnected 1;
// Disconnected nodes if (compare & 1 || (!support.sortDetached && b.compareDocumentPosition(a) === compare)) {
// Choose the first element that is related to our preferred document if (a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a)) { return -1; } if (b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b)) { return 1; }
// Maintain original order return sortInput ? (indexOf(sortInput, a) - indexOf(sortInput, b)) : 0; }
return compare & 4 ? -1 : 1; } : function (a, b) { // Exit early if the nodes are identical if (a === b) { hasDuplicate = true; return 0; }
var cur, i = 0, aup = a.parentNode, bup = b.parentNode, ap = [a], bp = [b];
// Parentless nodes are either documents or disconnected if (!aup || !bup) { return a === document ? -1 : b === document ? 1 : aup ? -1 : bup ? 1 : sortInput ? (indexOf(sortInput, a) - indexOf(sortInput, b)) : 0;
// If the nodes are siblings, we can do a quick check } else if (aup === bup) { return siblingCheck(a, b); }
// Otherwise we need full lists of their ancestors for comparison cur = a; while ((cur = cur.parentNode)) { ap.unshift(cur); } cur = b; while ((cur = cur.parentNode)) { bp.unshift(cur); }
// Walk down the tree looking for a discrepancy while (ap[i] === bp[i]) { i++; }
return i ? // Do a sibling check if the nodes have a common ancestor siblingCheck(ap[i], bp[i]) :
// Otherwise nodes in our document sort first ap[i] === preferredDoc ? -1 : bp[i] === preferredDoc ? 1 : 0; };
return document; };
Sizzle.matches = function (expr, elements) { return Sizzle(expr, null, null, elements); };
Sizzle.matchesSelector = function (elem, expr) { // Set document vars if needed if ((elem.ownerDocument || elem) !== document) { setDocument(elem); }
// Make sure that attribute selectors are quoted expr = expr.replace(rattributeQuotes, "='$1']");
if (support.matchesSelector && documentIsHTML && !compilerCache[expr + " "] && (!rbuggyMatches || !rbuggyMatches.test(expr)) && (!rbuggyQSA || !rbuggyQSA.test(expr))) {
try { var ret = matches.call(elem, expr);
// IE 9's matchesSelector returns false on disconnected nodes if (ret || support.disconnectedMatch || // As well, disconnected nodes are said to be in a document // fragment in IE 9 elem.document && elem.document.nodeType !== 11) { return ret; } } catch (e) {} }
return Sizzle(expr, document, null, [elem]).length > 0; };
Sizzle.contains = function (context, elem) { // Set document vars if needed if ((context.ownerDocument || context) !== document) { setDocument(context); } return contains(context, elem); };
Sizzle.attr = function (elem, name) { // Set document vars if needed if ((elem.ownerDocument || elem) !== document) { setDocument(elem); }
var fn = Expr.attrHandle[name.toLowerCase()], // Don't get fooled by Object.prototype properties (jQuery #13807) val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ? fn(elem, name, !documentIsHTML) : undefined;
return val !== undefined ? val : support.attributes || !documentIsHTML ? elem.getAttribute(name) : (val = elem.getAttributeNode(name)) && val.specified ? val.value : null; };
Sizzle.escape = function (sel) { return (sel + "").replace(rcssescape, fcssescape); };
Sizzle.error = function (msg) { throw new Error("Syntax error, unrecognized expression: " + msg); };
/** * Document sorting and removing duplicates * @param {ArrayLike} results */ Sizzle.uniqueSort = function (results) { var elem, duplicates = [], j = 0, i = 0;
// Unless we *know* we can detect duplicates, assume their presence hasDuplicate = !support.detectDuplicates; sortInput = !support.sortStable && results.slice(0); results.sort(sortOrder);
if (hasDuplicate) { while ((elem = results[i++])) { if (elem === results[i]) { j = duplicates.push(i); } } while (j--) { results.splice(duplicates[j], 1); } }
// Clear input after sorting to release objects // See https://github.com/jquery/sizzle/pull/225 sortInput = null;
return results; };
/** * Utility function for retrieving the text value of an array of DOM nodes * @param {Array|Element} elem */ getText = Sizzle.getText = function (elem) { var node, ret = "", i = 0, nodeType = elem.nodeType;
if (!nodeType) { // If no nodeType, this is expected to be an array while ((node = elem[i++])) { // Do not traverse comment nodes ret += getText(node); } } else if (nodeType === 1 || nodeType === 9 || nodeType === 11) { // Use textContent for elements // innerText usage removed for consistency of new lines (jQuery #11153) if (typeof elem.textContent === "string") { return elem.textContent; } else { // Traverse its children for (elem = elem.firstChild; elem; elem = elem.nextSibling) { ret += getText(elem); } } } else if (nodeType === 3 || nodeType === 4) { return elem.nodeValue; } // Do not include comment or processing instruction nodes
return ret; };
Expr = Sizzle.selectors = {
// Can be adjusted by the user cacheLength: 50,
createPseudo: markFunction,
match: matchExpr,
attrHandle: {},
find: {},
relative: { ">": { dir: "parentNode", first: true }, " ": { dir: "parentNode" }, "+": { dir: "previousSibling", first: true }, "~": { dir: "previousSibling" } },
preFilter: { "ATTR": function (match) { match[1] = match[1].replace(runescape, funescape);
// Move the given value to match[3] whether quoted or unquoted match[3] = (match[3] || match[4] || match[5] || "").replace(runescape, funescape);
if (match[2] === "~=") { match[3] = " " + match[3] + " "; }
return match.slice(0, 4); },
"CHILD": function (match) { /* matches from matchExpr["CHILD"] 1 type (only|nth|...) 2 what (child|of-type) 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) 4 xn-component of xn+y argument ([+-]?\d*n|) 5 sign of xn-component 6 x of xn-component 7 sign of y-component 8 y of y-component */ match[1] = match[1].toLowerCase();
if (match[1].slice(0, 3) === "nth") { // nth-* requires argument if (!match[3]) { Sizzle.error(match[0]); }
// numeric x and y parameters for Expr.filter.CHILD // remember that false/true cast respectively to 0/1 match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] === "even" || match[3] === "odd")); match[5] = +((match[7] + match[8]) || match[3] === "odd");
// other types prohibit arguments } else if (match[3]) { Sizzle.error(match[0]); }
return match; },
"PSEUDO": function (match) { var excess, unquoted = !match[6] && match[2];
if (matchExpr["CHILD"].test(match[0])) { return null; }
// Accept quoted arguments as-is if (match[3]) { match[2] = match[4] || match[5] || "";
// Strip excess characters from unquoted arguments } else if (unquoted && rpseudo.test(unquoted) && // Get excess from tokenize (recursively) (excess = tokenize(unquoted, true)) && // advance to the next closing parenthesis (excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
// excess is a negative index match[0] = match[0].slice(0, excess); match[2] = unquoted.slice(0, excess); }
// Return only captures needed by the pseudo filter method (type and argument) return match.slice(0, 3); } },
filter: {
"TAG": function (nodeNameSelector) { var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase(); return nodeNameSelector === "*" ? function () { return true; } : function (elem) { return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; }; },
"CLASS": function (className) { var pattern = classCache[className + " "];
return pattern || (pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) && classCache(className, function (elem) { return pattern.test(typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || ""); }); },
"ATTR": function (name, operator, check) { return function (elem) { var result = Sizzle.attr(elem, name);
if (result == null) { return operator === "!="; } if (!operator) { return true; }
result += "";
return operator === "=" ? result === check : operator === "!=" ? result !== check : operator === "^=" ? check && result.indexOf(check) === 0 : operator === "*=" ? check && result.indexOf(check) > -1 : operator === "$=" ? check && result.slice(-check.length) === check : operator === "~=" ? (" " + result.replace(rwhitespace, " ") + " ").indexOf(check) > -1 : operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" : false; }; },
"CHILD": function (type, what, argument, first, last) { var simple = type.slice(0, 3) !== "nth", forward = type.slice(-4) !== "last", ofType = what === "of-type";
return first === 1 && last === 0 ?
// Shortcut for :nth-*(n) function (elem) { return !!elem.parentNode; } :
function (elem, context, xml) { var cache, uniqueCache, outerCache, node, nodeIndex, start, dir = simple !== forward ? "nextSibling" : "previousSibling", parent = elem.parentNode, name = ofType && elem.nodeName.toLowerCase(), useCache = !xml && !ofType, diff = false;
if (parent) {
// :(first|last|only)-(child|of-type) if (simple) { while (dir) { node = elem; while ((node = node[dir])) { if (ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) {
return false; } } // Reverse direction for :only-* (if we haven't yet done so) start = dir = type === "only" && !start && "nextSibling"; } return true; }
start = [forward ? parent.firstChild : parent.lastChild];
// non-xml :nth-child(...) stores cache data on `parent` if (forward && useCache) {
// Seek `elem` from a previously-cached index
// ...in a gzip-friendly way node = parent; outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only // Defend against cloned attroperties (jQuery gh-1709) uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
cache = uniqueCache[type] || []; nodeIndex = cache[0] === dirruns && cache[1]; diff = nodeIndex && cache[2]; node = nodeIndex && parent.childNodes[nodeIndex];
while ((node = ++nodeIndex && node && node[dir] ||
// Fallback to seeking `elem` from the start (diff = nodeIndex = 0) || start.pop())) {
// When found, cache indexes on `parent` and break if (node.nodeType === 1 && ++diff && node === elem) { uniqueCache[type] = [dirruns, nodeIndex, diff]; break; } }
} else { // Use previously-cached element index if available if (useCache) { // ...in a gzip-friendly way node = elem; outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only // Defend against cloned attroperties (jQuery gh-1709) uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
cache = uniqueCache[type] || []; nodeIndex = cache[0] === dirruns && cache[1]; diff = nodeIndex; }
// xml :nth-child(...) // or :nth-last-child(...) or :nth(-last)?-of-type(...) if (diff === false) { // Use the same loop as above to seek `elem` from the start while ((node = ++nodeIndex && node && node[dir] || (diff = nodeIndex = 0) || start.pop())) {
if ((ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) && ++diff) {
// Cache the index of each encountered element if (useCache) { outerCache = node[expando] || (node[expando] = {});
// Support: IE <9 only // Defend against cloned attroperties (jQuery gh-1709) uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
uniqueCache[type] = [dirruns, diff]; }
if (node === elem) { break; } } } } }
// Incorporate the offset, then check against cycle size diff -= last; return diff === first || (diff % first === 0 && diff / first >= 0); } }; },
"PSEUDO": function (pseudo, argument) { // pseudo-class names are case-insensitive // http://www.w3.org/TR/selectors/#pseudo-classes // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters // Remember that setFilters inherits from pseudos var args, fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] || Sizzle.error("unsupported pseudo: " + pseudo);
// The user may use createPseudo to indicate that // arguments are needed to create the filter function // just as Sizzle does if (fn[expando]) { return fn(argument); }
// But maintain support for old signatures if (fn.length > 1) { args = [pseudo, pseudo, "", argument]; return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ? markFunction(function (seed, matches) { var idx, matched = fn(seed, argument), i = matched.length; while (i--) { idx = indexOf(seed, matched[i]); seed[idx] = !(matches[idx] = matched[i]); } }) : function (elem) { return fn(elem, 0, args); }; }
return fn; } },
pseudos: { // Potentially complex pseudos "not": markFunction(function (selector) { // Trim the selector passed to compile // to avoid treating leading and trailing // spaces as combinators var input = [], results = [], matcher = compile(selector.replace(rtrim, "$1"));
return matcher[expando] ? markFunction(function (seed, matches, context, xml) { var elem, unmatched = matcher(seed, null, xml, []), i = seed.length;
// Match elements unmatched by `matcher` while (i--) { if ((elem = unmatched[i])) { seed[i] = !(matches[i] = elem); } } }) : function (elem, context, xml) { input[0] = elem; matcher(input, null, xml, results); // Don't keep the element (issue #299) input[0] = null; return !results.pop(); }; }),
"has": markFunction(function (selector) { return function (elem) { return Sizzle(selector, elem).length > 0; }; }),
"contains": markFunction(function (text) { text = text.replace(runescape, funescape); return function (elem) { return (elem.textContent || elem.innerText || getText(elem)).indexOf(text) > -1; }; }),
// "Whether an element is represented by a :lang() selector // is based solely on the element's language value // being equal to the identifier C, // or beginning with the identifier C immediately followed by "-". // The matching of C against the element's language value is performed case-insensitively. // The identifier C does not have to be a valid language name." // http://www.w3.org/TR/selectors/#lang-pseudo "lang": markFunction(function (lang) { // lang value must be a valid identifier if (!ridentifier.test(lang || "")) { Sizzle.error("unsupported lang: " + lang); } lang = lang.replace(runescape, funescape).toLowerCase(); return function (elem) { var elemLang; do { if ((elemLang = documentIsHTML ? elem.lang : elem.getAttribute("xml:lang") || elem.getAttribute("lang"))) {
elemLang = elemLang.toLowerCase(); return elemLang === lang || elemLang.indexOf(lang + "-") === 0; } } while ((elem = elem.parentNode) && elem.nodeType === 1); return false; }; }),
// Miscellaneous "target": function (elem) { var hash = window.location && window.location.hash; return hash && hash.slice(1) === elem.id; },
"root": function (elem) { return elem === docElem; },
"focus": function (elem) { return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); },
// Boolean properties "enabled": createDisabledPseudo(false), "disabled": createDisabledPseudo(true),
"checked": function (elem) { // In CSS3, :checked should return both checked and selected elements // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked var nodeName = elem.nodeName.toLowerCase(); return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); },
"selected": function (elem) { // Accessing this property makes selected-by-default // options in Safari work properly if (elem.parentNode) { elem.parentNode.selectedIndex; }
return elem.selected === true; },
// Contents "empty": function (elem) { // http://www.w3.org/TR/selectors/#empty-pseudo // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), // but not by others (comment: 8; processing instruction: 7; etc.) // nodeType < 6 works because attributes (2) do not appear as children for (elem = elem.firstChild; elem; elem = elem.nextSibling) { if (elem.nodeType < 6) { return false; } } return true; },
"parent": function (elem) { return !Expr.pseudos["empty"](elem); },
// Element/input types "header": function (elem) { return rheader.test(elem.nodeName); },
"input": function (elem) { return rinputs.test(elem.nodeName); },
"button": function (elem) { var name = elem.nodeName.toLowerCase(); return name === "input" && elem.type === "button" || name === "button"; },
"text": function (elem) { var attr; return elem.nodeName.toLowerCase() === "input" && elem.type === "text" &&
// Support: IE<8 // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" ((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text"); },
// Position-in-collection "first": createPositionalPseudo(function () { return [0]; }),
"last": createPositionalPseudo(function (matchIndexes, length) { return [length - 1]; }),
"eq": createPositionalPseudo(function (matchIndexes, length, argument) { return [argument < 0 ? argument + length : argument]; }),
"even": createPositionalPseudo(function (matchIndexes, length) { var i = 0; for (; i < length; i += 2) { matchIndexes.push(i); } return matchIndexes; }),
"odd": createPositionalPseudo(function (matchIndexes, length) { var i = 1; for (; i < length; i += 2) { matchIndexes.push(i); } return matchIndexes; }),
"lt": createPositionalPseudo(function (matchIndexes, length, argument) { var i = argument < 0 ? argument + length : argument; for (; --i >= 0;) { matchIndexes.push(i); } return matchIndexes; }),
"gt": createPositionalPseudo(function (matchIndexes, length, argument) { var i = argument < 0 ? argument + length : argument; for (; ++i < length;) { matchIndexes.push(i); } return matchIndexes; }) } };
Expr.pseudos["nth"] = Expr.pseudos["eq"];
// Add button/input type pseudos for (i in { radio: true, checkbox: true, file: true, password: true, image: true }) { Expr.pseudos[i] = createInputPseudo(i); } for (i in { submit: true, reset: true }) { Expr.pseudos[i] = createButtonPseudo(i); }
// Easy API for creating new setFilters function setFilters() {} setFilters.prototype = Expr.filters = Expr.pseudos; Expr.setFilters = new setFilters();
tokenize = Sizzle.tokenize = function (selector, parseOnly) { var matched, match, tokens, type, soFar, groups, preFilters, cached = tokenCache[selector + " "];
if (cached) { return parseOnly ? 0 : cached.slice(0); }
soFar = selector; groups = []; preFilters = Expr.preFilter;
while (soFar) {
// Comma and first run if (!matched || (match = rcomma.exec(soFar))) { if (match) { // Don't consume trailing commas as valid soFar = soFar.slice(match[0].length) || soFar; } groups.push((tokens = [])); }
matched = false;
// Combinators if ((match = rcombinators.exec(soFar))) { matched = match.shift(); tokens.push({ value: matched, // Cast descendant combinators to space type: match[0].replace(rtrim, " ") }); soFar = soFar.slice(matched.length); }
// Filters for (type in Expr.filter) { if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] || (match = preFilters[type](match)))) { matched = match.shift(); tokens.push({ value: matched, type: type, matches: match }); soFar = soFar.slice(matched.length); } }
if (!matched) { break; } }
// Return the length of the invalid excess // if we're just parsing // Otherwise, throw an error or return tokens return parseOnly ? soFar.length : soFar ? Sizzle.error(selector) : // Cache the tokens tokenCache(selector, groups).slice(0); };
function toSelector(tokens) { var i = 0, len = tokens.length, selector = ""; for (; i < len; i++) { selector += tokens[i].value; } return selector; }
function addCombinator(matcher, combinator, base) { var dir = combinator.dir, skip = combinator.next, key = skip || dir, checkNonElements = base && key === "parentNode", doneName = done++;
return combinator.first ? // Check against closest ancestor/preceding element function (elem, context, xml) { while ((elem = elem[dir])) { if (elem.nodeType === 1 || checkNonElements) { return matcher(elem, context, xml); } } return false; } :
// Check against all ancestor/preceding elements function (elem, context, xml) { var oldCache, uniqueCache, outerCache, newCache = [dirruns, doneName];
// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching if (xml) { while ((elem = elem[dir])) { if (elem.nodeType === 1 || checkNonElements) { if (matcher(elem, context, xml)) { return true; } } } } else { while ((elem = elem[dir])) { if (elem.nodeType === 1 || checkNonElements) { outerCache = elem[expando] || (elem[expando] = {});
// Support: IE <9 only // Defend against cloned attroperties (jQuery gh-1709) uniqueCache = outerCache[elem.uniqueID] || (outerCache[elem.uniqueID] = {});
if (skip && skip === elem.nodeName.toLowerCase()) { elem = elem[dir] || elem; } else if ((oldCache = uniqueCache[key]) && oldCache[0] === dirruns && oldCache[1] === doneName) {
// Assign to newCache so results back-propagate to previous elements return (newCache[2] = oldCache[2]); } else { // Reuse newcache so results back-propagate to previous elements uniqueCache[key] = newCache;
// A match means we're done; a fail means we have to keep checking if ((newCache[2] = matcher(elem, context, xml))) { return true; } } } } } return false; }; }
function elementMatcher(matchers) { return matchers.length > 1 ? function (elem, context, xml) { var i = matchers.length; while (i--) { if (!matchers[i](elem, context, xml)) { return false; } } return true; } : matchers[0]; }
function multipleContexts(selector, contexts, results) { var i = 0, len = contexts.length; for (; i < len; i++) { Sizzle(selector, contexts[i], results); } return results; }
function condense(unmatched, map, filter, context, xml) { var elem, newUnmatched = [], i = 0, len = unmatched.length, mapped = map != null;
for (; i < len; i++) { if ((elem = unmatched[i])) { if (!filter || filter(elem, context, xml)) { newUnmatched.push(elem); if (mapped) { map.push(i); } } } }
return newUnmatched; }
function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) { if (postFilter && !postFilter[expando]) { postFilter = setMatcher(postFilter); } if (postFinder && !postFinder[expando]) { postFinder = setMatcher(postFinder, postSelector); } return markFunction(function (seed, results, context, xml) { var temp, i, elem, preMap = [], postMap = [], preexisting = results.length,
// Get initial elements from seed or context elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []),
// Prefilter to get matcher input, preserving a map for seed-results synchronization matcherIn = preFilter && (seed || !selector) ? condense(elems, preMap, preFilter, context, xml) : elems,
matcherOut = matcher ? // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, postFinder || (seed ? preFilter : preexisting || postFilter) ?
// ...intermediate processing is necessary
[] :
// ...otherwise use results directly results : matcherIn;
// Find primary matches if (matcher) { matcher(matcherIn, matcherOut, context, xml); }
// Apply postFilter if (postFilter) { temp = condense(matcherOut, postMap); postFilter(temp, [], context, xml);
// Un-match failing elements by moving them back to matcherIn i = temp.length; while (i--) { if ((elem = temp[i])) { matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem); } } }
if (seed) { if (postFinder || preFilter) { if (postFinder) { // Get the final matcherOut by condensing this intermediate into postFinder contexts temp = []; i = matcherOut.length; while (i--) { if ((elem = matcherOut[i])) { // Restore matcherIn since elem is not yet a final match temp.push((matcherIn[i] = elem)); } } postFinder(null, (matcherOut = []), temp, xml); }
// Move matched elements from seed to results to keep them synchronized i = matcherOut.length; while (i--) { if ((elem = matcherOut[i]) && (temp = postFinder ? indexOf(seed, elem) : preMap[i]) > -1) {
seed[temp] = !(results[temp] = elem); } } }
// Add elements to results, through postFinder if defined } else { matcherOut = condense( matcherOut === results ? matcherOut.splice(preexisting, matcherOut.length) : matcherOut ); if (postFinder) { postFinder(null, results, matcherOut, xml); } else { push.apply(results, matcherOut); } } }); }
function matcherFromTokens(tokens) { var checkContext, matcher, j, len = tokens.length, leadingRelative = Expr.relative[tokens[0].type], implicitRelative = leadingRelative || Expr.relative[" "], i = leadingRelative ? 1 : 0,
// The foundational matcher ensures that elements are reachable from top-level context(s) matchContext = addCombinator(function (elem) { return elem === checkContext; }, implicitRelative, true), matchAnyContext = addCombinator(function (elem) { return indexOf(checkContext, elem) > -1; }, implicitRelative, true), matchers = [function (elem, context, xml) { var ret = (!leadingRelative && (xml || context !== outermostContext)) || ( (checkContext = context).nodeType ? matchContext(elem, context, xml) : matchAnyContext(elem, context, xml)); // Avoid hanging onto element (issue #299) checkContext = null; return ret;
}];
for (; i < len; i++) { if ((matcher = Expr.relative[tokens[i].type])) { matchers = [addCombinator(elementMatcher(matchers), matcher)]; } else { matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
// Return special upon seeing a positional matcher if (matcher[expando]) { // Find the next relative operator (if any) for proper handling j = ++i; for (; j < len; j++) { if (Expr.relative[tokens[j].type]) { break; } } return setMatcher( i > 1 && elementMatcher(matchers), i > 1 && toSelector( // If the preceding token was a descendant combinator, insert an implicit any-element `*` tokens.slice(0, i - 1).concat({ value: tokens[i - 2].type === " " ? "*" : "" }) ).replace(rtrim, "$1"), matcher, i < j && matcherFromTokens(tokens.slice(i, j)), j < len && matcherFromTokens((tokens = tokens.slice(j))), j < len && toSelector(tokens) ); } matchers.push(matcher); } }
return elementMatcher(matchers); }
function matcherFromGroupMatchers(elementMatchers, setMatchers) { var bySet = setMatchers.length > 0, byElement = elementMatchers.length > 0, superMatcher = function (seed, context, xml, results, outermost) { var elem, j, matcher, matchedCount = 0, i = "0", unmatched = seed && [], setMatched = [], contextBackup = outermostContext, // We must always have either seed elements or outermost context elems = seed || byElement && Expr.find["TAG"]("*", outermost), // Use integer dirruns iff this is the outermost matcher dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), len = elems.length;
if (outermost) { outermostContext = context === document || context || outermost; }
// Add elements passing elementMatchers directly to results // Support: IE<9, Safari // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id for (; i !== len && (elem = elems[i]) != null; i++) { if (byElement && elem) { j = 0; if (!context && elem.ownerDocument !== document) { setDocument(elem); xml = !documentIsHTML; } while ((matcher = elementMatchers[j++])) { if (matcher(elem, context || document, xml)) { results.push(elem); break; } } if (outermost) { dirruns = dirrunsUnique; } }
// Track unmatched elements for set filters if (bySet) { // They will have gone through all possible matchers if ((elem = !matcher && elem)) { matchedCount--; }
// Lengthen the array for every element, matched or not if (seed) { unmatched.push(elem); } } }
// `i` is now the count of elements visited above, and adding it to `matchedCount` // makes the latter nonnegative. matchedCount += i;
// Apply set filters to unmatched elements // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` // equals `i`), unless we didn't visit _any_ elements in the above loop because we have // no element matchers and no seed. // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that // case, which will result in a "00" `matchedCount` that differs from `i` but is also // numerically zero. if (bySet && i !== matchedCount) { j = 0; while ((matcher = setMatchers[j++])) { matcher(unmatched, setMatched, context, xml); }
if (seed) { // Reintegrate element matches to eliminate the need for sorting if (matchedCount > 0) { while (i--) { if (!(unmatched[i] || setMatched[i])) { setMatched[i] = pop.call(results); } } }
// Discard index placeholder values to get only actual matches setMatched = condense(setMatched); }
// Add matches to results push.apply(results, setMatched);
// Seedless set matches succeeding multiple successful matchers stipulate sorting if (outermost && !seed && setMatched.length > 0 && (matchedCount + setMatchers.length) > 1) {
Sizzle.uniqueSort(results); } }
// Override manipulation of globals by nested matchers if (outermost) { dirruns = dirrunsUnique; outermostContext = contextBackup; }
return unmatched; };
return bySet ? markFunction(superMatcher) : superMatcher; }
compile = Sizzle.compile = function (selector, match /* Internal Use Only */ ) { var i, setMatchers = [], elementMatchers = [], cached = compilerCache[selector + " "];
if (!cached) { // Generate a function of recursive functions that can be used to check each element if (!match) { match = tokenize(selector); } i = match.length; while (i--) { cached = matcherFromTokens(match[i]); if (cached[expando]) { setMatchers.push(cached); } else { elementMatchers.push(cached); } }
// Cache the compiled function cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
// Save selector and tokenization cached.selector = selector; } return cached; };
/** * A low-level selection function that works with Sizzle's compiled * selector functions * @param {String|Function} selector A selector or a pre-compiled * selector function built with Sizzle.compile * @param {Element} context * @param {Array} [results] * @param {Array} [seed] A set of elements to match against */ select = Sizzle.select = function (selector, context, results, seed) { var i, tokens, token, type, find, compiled = typeof selector === "function" && selector, match = !seed && tokenize((selector = compiled.selector || selector));
results = results || [];
// Try to minimize operations if there is only one selector in the list and no seed // (the latter of which guarantees us context) if (match.length === 1) {
// Reduce context if the leading compound selector is an ID tokens = match[0] = match[0].slice(0); if (tokens.length > 2 && (token = tokens[0]).type === "ID" && context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) {
context = (Expr.find["ID"](token.matches[0].replace(runescape, funescape), context) || [])[0]; if (!context) { return results;
// Precompiled matchers will still verify ancestry, so step up a level } else if (compiled) { context = context.parentNode; }
selector = selector.slice(tokens.shift().value.length); }
// Fetch a seed set for right-to-left matching i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length; while (i--) { token = tokens[i];
// Abort if we hit a combinator if (Expr.relative[(type = token.type)]) { break; } if ((find = Expr.find[type])) { // Search, expanding context for leading sibling combinators if ((seed = find( token.matches[0].replace(runescape, funescape), rsibling.test(tokens[0].type) && testContext(context.parentNode) || context ))) {
// If seed is empty or no tokens remain, we can return early tokens.splice(i, 1); selector = seed.length && toSelector(tokens); if (!selector) { push.apply(results, seed); return results; }
break; } } } }
// Compile and execute a filtering function if one is not provided // Provide `match` to avoid retokenization if we modified the selector above (compiled || compile(selector, match))( seed, context, !documentIsHTML, results, !context || rsibling.test(selector) && testContext(context.parentNode) || context ); return results; };
// One-time assignments
// Sort stability support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
// Support: Chrome 14-35+ // Always assume duplicates if they aren't passed to the comparison function support.detectDuplicates = !!hasDuplicate;
// Initialize against the default document setDocument();
// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) // Detached nodes confoundingly follow *each other* support.sortDetached = assert(function (el) { // Should return 1, but returns 4 (following) return el.compareDocumentPosition(document.createElement("fieldset")) & 1; });
// Support: IE<8 // Prevent attribute/property "interpolation" // https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx if (!assert(function (el) { el.innerHTML = "<a href='#'></a>"; return el.firstChild.getAttribute("href") === "#"; })) { addHandle("type|href|height|width", function (elem, name, isXML) { if (!isXML) { return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2); } }); }
// Support: IE<9 // Use defaultValue in place of getAttribute("value") if (!support.attributes || !assert(function (el) { el.innerHTML = "<input/>"; el.firstChild.setAttribute("value", ""); return el.firstChild.getAttribute("value") === ""; })) { addHandle("value", function (elem, name, isXML) { if (!isXML && elem.nodeName.toLowerCase() === "input") { return elem.defaultValue; } }); }
// Support: IE<9 // Use getAttributeNode to fetch booleans when getAttribute lies if (!assert(function (el) { return el.getAttribute("disabled") == null; })) { addHandle(booleans, function (elem, name, isXML) { var val; if (!isXML) { return elem[name] === true ? name.toLowerCase() : (val = elem.getAttributeNode(name)) && val.specified ? val.value : null; } }); }
return Sizzle;
})(window);
jQuery.find = Sizzle; jQuery.expr = Sizzle.selectors;
// Deprecated jQuery.expr[":"] = jQuery.expr.pseudos; jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; jQuery.text = Sizzle.getText; jQuery.isXMLDoc = Sizzle.isXML; jQuery.contains = Sizzle.contains; jQuery.escapeSelector = Sizzle.escape;
var dir = function (elem, dir, until) { var matched = [], truncate = until !== undefined;
while ((elem = elem[dir]) && elem.nodeType !== 9) { if (elem.nodeType === 1) { if (truncate && jQuery(elem).is(until)) { break; } matched.push(elem); } } return matched; };
var siblings = function (n, elem) { var matched = [];
for (; n; n = n.nextSibling) { if (n.nodeType === 1 && n !== elem) { matched.push(n); } }
return matched; };
var rneedsContext = jQuery.expr.match.needsContext;
function nodeName(elem, name) {
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
}; var rsingleTag = (/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i);
var risSimple = /^.[^:#\[\.,]*$/;
// Implement the identical functionality for filter and not function winnow(elements, qualifier, not) { if (jQuery.isFunction(qualifier)) { return jQuery.grep(elements, function (elem, i) { return !!qualifier.call(elem, i, elem) !== not; }); }
// Single element if (qualifier.nodeType) { return jQuery.grep(elements, function (elem) { return (elem === qualifier) !== not; }); }
// Arraylike of elements (jQuery, arguments, Array) if (typeof qualifier !== "string") { return jQuery.grep(elements, function (elem) { return (indexOf.call(qualifier, elem) > -1) !== not; }); }
// Simple selector that can be filtered directly, removing non-Elements if (risSimple.test(qualifier)) { return jQuery.filter(qualifier, elements, not); }
// Complex selector, compare the two sets, removing non-Elements qualifier = jQuery.filter(qualifier, elements); return jQuery.grep(elements, function (elem) { return (indexOf.call(qualifier, elem) > -1) !== not && elem.nodeType === 1; }); }
jQuery.filter = function (expr, elems, not) { var elem = elems[0];
if (not) { expr = ":not(" + expr + ")"; }
if (elems.length === 1 && elem.nodeType === 1) { return jQuery.find.matchesSelector(elem, expr) ? [elem] : []; }
return jQuery.find.matches(expr, jQuery.grep(elems, function (elem) { return elem.nodeType === 1; })); };
jQuery.fn.extend({ find: function (selector) { var i, ret, len = this.length, self = this;
if (typeof selector !== "string") { return this.pushStack(jQuery(selector).filter(function () { for (i = 0; i < len; i++) { if (jQuery.contains(self[i], this)) { return true; } } })); }
ret = this.pushStack([]);
for (i = 0; i < len; i++) { jQuery.find(selector, self[i], ret); }
return len > 1 ? jQuery.uniqueSort(ret) : ret; }, filter: function (selector) { return this.pushStack(winnow(this, selector || [], false)); }, not: function (selector) { return this.pushStack(winnow(this, selector || [], true)); }, is: function (selector) { return !!winnow( this,
// If this is a positional/relative selector, check membership in the returned set // so $("p:first").is("p:last") won't return true for a doc with two "p". typeof selector === "string" && rneedsContext.test(selector) ? jQuery(selector) : selector || [], false ).length; } });
// Initialize a jQuery object
// A central reference to the root jQuery(document) var rootjQuery,
// A simple way to check for HTML strings // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) // Strict HTML recognition (#11290: must start with <) // Shortcut simple #id case for speed rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
init = jQuery.fn.init = function (selector, context, root) { var match, elem;
// HANDLE: $(""), $(null), $(undefined), $(false) if (!selector) { return this; }
// Method init() accepts an alternate rootjQuery // so migrate can support jQuery.sub (gh-2101) root = root || rootjQuery;
// Handle HTML strings if (typeof selector === "string") { if (selector[0] === "<" && selector[selector.length - 1] === ">" && selector.length >= 3) {
// Assume that strings that start and end with <> are HTML and skip the regex check match = [null, selector, null];
} else { match = rquickExpr.exec(selector); }
// Match html or make sure no context is specified for #id if (match && (match[1] || !context)) {
// HANDLE: $(html) -> $(array) if (match[1]) { context = context instanceof jQuery ? context[0] : context;
// Option to run scripts is true for back-compat // Intentionally let the error be thrown if parseHTML is not present jQuery.merge(this, jQuery.parseHTML( match[1], context && context.nodeType ? context.ownerDocument || context : document, true ));
// HANDLE: $(html, props) if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) { for (match in context) {
// Properties of context are called as methods if possible if (jQuery.isFunction(this[match])) { this[match](context[match]);
// ...and otherwise set as attributes } else { this.attr(match, context[match]); } } }
return this;
// HANDLE: $(#id) } else { elem = document.getElementById(match[2]);
if (elem) {
// Inject the element directly into the jQuery object this[0] = elem; this.length = 1; } return this; }
// HANDLE: $(expr, $(...)) } else if (!context || context.jquery) { return (context || root).find(selector);
// HANDLE: $(expr, context) // (which is just equivalent to: $(context).find(expr) } else { return this.constructor(context).find(selector); }
// HANDLE: $(DOMElement) } else if (selector.nodeType) { this[0] = selector; this.length = 1; return this;
// HANDLE: $(function) // Shortcut for document ready } else if (jQuery.isFunction(selector)) { return root.ready !== undefined ? root.ready(selector) :
// Execute immediately if ready is not present selector(jQuery); }
return jQuery.makeArray(selector, this); };
// Give the init function the jQuery prototype for later instantiation init.prototype = jQuery.fn;
// Initialize central reference rootjQuery = jQuery(document);
var rparentsprev = /^(?:parents|prev(?:Until|All))/,
// Methods guaranteed to produce a unique set when starting from a unique set guaranteedUnique = { children: true, contents: true, next: true, prev: true };
jQuery.fn.extend({ has: function (target) { var targets = jQuery(target, this), l = targets.length;
return this.filter(function () { var i = 0; for (; i < l; i++) { if (jQuery.contains(this, targets[i])) { return true; } } }); },
closest: function (selectors, context) { var cur, i = 0, l = this.length, matched = [], targets = typeof selectors !== "string" && jQuery(selectors);
// Positional selectors never match, since there's no _selection_ context if (!rneedsContext.test(selectors)) { for (; i < l; i++) { for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
// Always skip document fragments if (cur.nodeType < 11 && (targets ? targets.index(cur) > -1 :
// Don't pass non-elements to Sizzle cur.nodeType === 1 && jQuery.find.matchesSelector(cur, selectors))) {
matched.push(cur); break; } } } }
return this.pushStack(matched.length > 1 ? jQuery.uniqueSort(matched) : matched); },
// Determine the position of an element within the set index: function (elem) {
// No argument, return index in parent if (!elem) { return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1; }
// Index in selector if (typeof elem === "string") { return indexOf.call(jQuery(elem), this[0]); }
// Locate the position of the desired element return indexOf.call(this,
// If it receives a jQuery object, the first element is used elem.jquery ? elem[0] : elem ); },
add: function (selector, context) { return this.pushStack( jQuery.uniqueSort( jQuery.merge(this.get(), jQuery(selector, context)) ) ); },
addBack: function (selector) { return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector) ); } });
function sibling(cur, dir) { while ((cur = cur[dir]) && cur.nodeType !== 1) {} return cur; }
jQuery.each({ parent: function (elem) { var parent = elem.parentNode; return parent && parent.nodeType !== 11 ? parent : null; }, parents: function (elem) { return dir(elem, "parentNode"); }, parentsUntil: function (elem, i, until) { return dir(elem, "parentNode", until); }, next: function (elem) { return sibling(elem, "nextSibling"); }, prev: function (elem) { return sibling(elem, "previousSibling"); }, nextAll: function (elem) { return dir(elem, "nextSibling"); }, prevAll: function (elem) { return dir(elem, "previousSibling"); }, nextUntil: function (elem, i, until) { return dir(elem, "nextSibling", until); }, prevUntil: function (elem, i, until) { return dir(elem, "previousSibling", until); }, siblings: function (elem) { return siblings((elem.parentNode || {}).firstChild, elem); }, children: function (elem) { return siblings(elem.firstChild); }, contents: function (elem) { if (nodeName(elem, "iframe")) { return elem.contentDocument; }
// Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only // Treat the template element as a regular one in browsers that // don't support it. if (nodeName(elem, "template")) { elem = elem.content || elem; }
return jQuery.merge([], elem.childNodes); } }, function (name, fn) { jQuery.fn[name] = function (until, selector) { var matched = jQuery.map(this, fn, until);
if (name.slice(-5) !== "Until") { selector = until; }
if (selector && typeof selector === "string") { matched = jQuery.filter(selector, matched); }
if (this.length > 1) {
// Remove duplicates if (!guaranteedUnique[name]) { jQuery.uniqueSort(matched); }
// Reverse order for parents* and prev-derivatives if (rparentsprev.test(name)) { matched.reverse(); } }
return this.pushStack(matched); }; }); var rnothtmlwhite = (/[^\x20\t\r\n\f]+/g);
// Convert String-formatted options into Object-formatted ones function createOptions(options) { var object = {}; jQuery.each(options.match(rnothtmlwhite) || [], function (_, flag) { object[flag] = true; }); return object; }
/* * Create a callback list using the following parameters: * * options: an optional list of space-separated options that will change how * the callback list behaves or a more traditional option object * * By default a callback list will act like an event callback list and can be * "fired" multiple times. * * Possible options: * * once: will ensure the callback list can only be fired once (like a Deferred) * * memory: will keep track of previous values and will call any callback added * after the list has been fired right away with the latest "memorized" * values (like a Deferred) * * unique: will ensure a callback can only be added once (no duplicate in the list) * * stopOnFalse: interrupt callings when a callback returns false * */ jQuery.Callbacks = function (options) {
// Convert options from String-formatted to Object-formatted if needed // (we check in cache first) options = typeof options === "string" ? createOptions(options) : jQuery.extend({}, options);
var // Flag to know if list is currently firing firing,
// Last fire value for non-forgettable lists memory,
// Flag to know if list was already fired fired,
// Flag to prevent firing locked,
// Actual callback list list = [],
// Queue of execution data for repeatable lists queue = [],
// Index of currently firing callback (modified by add/remove as needed) firingIndex = -1,
// Fire callbacks fire = function () {
// Enforce single-firing locked = locked || options.once;
// Execute callbacks for all pending executions, // respecting firingIndex overrides and runtime changes fired = firing = true; for (; queue.length; firingIndex = -1) { memory = queue.shift(); while (++firingIndex < list.length) {
// Run callback and check for early termination if (list[firingIndex].apply(memory[0], memory[1]) === false && options.stopOnFalse) {
// Jump to end and forget the data so .add doesn't re-fire firingIndex = list.length; memory = false; } } }
// Forget the data if we're done with it if (!options.memory) { memory = false; }
firing = false;
// Clean up if we're done firing for good if (locked) {
// Keep an empty list if we have data for future add calls if (memory) { list = [];
// Otherwise, this object is spent } else { list = ""; } } },
// Actual Callbacks object self = {
// Add a callback or a collection of callbacks to the list add: function () { if (list) {
// If we have memory from a past run, we should fire after adding if (memory && !firing) { firingIndex = list.length - 1; queue.push(memory); }
(function add(args) { jQuery.each(args, function (_, arg) { if (jQuery.isFunction(arg)) { if (!options.unique || !self.has(arg)) { list.push(arg); } } else if (arg && arg.length && jQuery.type(arg) !== "string") {
// Inspect recursively add(arg); } }); })(arguments);
if (memory && !firing) { fire(); } } return this; },
// Remove a callback from the list remove: function () { jQuery.each(arguments, function (_, arg) { var index; while ((index = jQuery.inArray(arg, list, index)) > -1) { list.splice(index, 1);
// Handle firing indexes if (index <= firingIndex) { firingIndex--; } } }); return this; },
// Check if a given callback is in the list. // If no argument is given, return whether or not list has callbacks attached. has: function (fn) { return fn ? jQuery.inArray(fn, list) > -1 : list.length > 0; },
// Remove all callbacks from the list empty: function () { if (list) { list = []; } return this; },
// Disable .fire and .add // Abort any current/pending executions // Clear all callbacks and values disable: function () { locked = queue = []; list = memory = ""; return this; }, disabled: function () { return !list; },
// Disable .fire // Also disable .add unless we have memory (since it would have no effect) // Abort any pending executions lock: function () { locked = queue = []; if (!memory && !firing) { list = memory = ""; } return this; }, locked: function () { return !!locked; },
// Call all callbacks with the given context and arguments fireWith: function (context, args) { if (!locked) { args = args || []; args = [context, args.slice ? args.slice() : args]; queue.push(args); if (!firing) { fire(); } } return this; },
// Call all the callbacks with the given arguments fire: function () { self.fireWith(this, arguments); return this; },
// To know if the callbacks have already been called at least once fired: function () { return !!fired; } };
return self; };
function Identity(v) { return v; }
function Thrower(ex) { throw ex; }
function adoptValue(value, resolve, reject, noValue) { var method;
try {
// Check for promise aspect first to privilege synchronous behavior if (value && jQuery.isFunction((method = value.promise))) { method.call(value).done(resolve).fail(reject);
// Other thenables } else if (value && jQuery.isFunction((method = value.then))) { method.call(value, resolve, reject);
// Other non-thenables } else {
// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: // * false: [ value ].slice( 0 ) => resolve( value ) // * true: [ value ].slice( 1 ) => resolve() resolve.apply(undefined, [value].slice(noValue)); }
// For Promises/A+, convert exceptions into rejections // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in // Deferred#then to conditionally suppress rejection. } catch (value) {
// Support: Android 4.0 only // Strict mode functions invoked without .call/.apply get global-object context reject.apply(undefined, [value]); } }
jQuery.extend({
Deferred: function (func) { var tuples = [
// action, add listener, callbacks, // ... .then handlers, argument index, [final state] ["notify", "progress", jQuery.Callbacks("memory"), jQuery.Callbacks("memory"), 2], ["resolve", "done", jQuery.Callbacks("once memory"), jQuery.Callbacks("once memory"), 0, "resolved"], ["reject", "fail", jQuery.Callbacks("once memory"), jQuery.Callbacks("once memory"), 1, "rejected"] ],
state = "pending", promise = { state: function () { return state; }, always: function () { deferred.done(arguments).fail(arguments); return this; }, "catch": function (fn) { return promise.then(null, fn); },
// Keep pipe for back-compat pipe: function ( /* fnDone, fnFail, fnProgress */ ) { var fns = arguments;
return jQuery.Deferred(function (newDefer) { jQuery.each(tuples, function (i, tuple) {
// Map tuples (progress, done, fail) to arguments (done, fail, progress) var fn = jQuery.isFunction(fns[tuple[4]]) && fns[tuple[4]];
// deferred.progress(function() { bind to newDefer or newDefer.notify }) // deferred.done(function() { bind to newDefer or newDefer.resolve }) // deferred.fail(function() { bind to newDefer or newDefer.reject }) deferred[tuple[1]](function () { var returned = fn && fn.apply(this, arguments); if (returned && jQuery.isFunction(returned.promise)) { returned.promise() .progress(newDefer.notify) .done(newDefer.resolve) .fail(newDefer.reject); } else { newDefer[tuple[0] + "With"]( this, fn ? [returned] : arguments ); } }); }); fns = null; }).promise(); }, then: function (onFulfilled, onRejected, onProgress) { var maxDepth = 0;
function resolve(depth, deferred, handler, special) { return function () { var that = this, args = arguments, mightThrow = function () { var returned, then;
// Support: Promises/A+ section 2.3.3.3.3 // https://promisesaplus.com/#point-59 // Ignore double-resolution attempts if (depth < maxDepth) { return; }
returned = handler.apply(that, args);
// Support: Promises/A+ section 2.3.1 // https://promisesaplus.com/#point-48 if (returned === deferred.promise()) { throw new TypeError("Thenable self-resolution"); }
// Support: Promises/A+ sections 2.3.3.1, 3.5 // https://promisesaplus.com/#point-54 // https://promisesaplus.com/#point-75 // Retrieve `then` only once then = returned &&
// Support: Promises/A+ section 2.3.4 // https://promisesaplus.com/#point-64 // Only check objects and functions for thenability (typeof returned === "object" || typeof returned === "function") && returned.then;
// Handle a returned thenable if (jQuery.isFunction(then)) {
// Special processors (notify) just wait for resolution if (special) { then.call( returned, resolve(maxDepth, deferred, Identity, special), resolve(maxDepth, deferred, Thrower, special) );
// Normal processors (resolve) also hook into progress } else {
// ...and disregard older resolution values maxDepth++;
then.call( returned, resolve(maxDepth, deferred, Identity, special), resolve(maxDepth, deferred, Thrower, special), resolve(maxDepth, deferred, Identity, deferred.notifyWith) ); }
// Handle all other returned values } else {
// Only substitute handlers pass on context // and multiple values (non-spec behavior) if (handler !== Identity) { that = undefined; args = [returned]; }
// Process the value(s) // Default process is resolve (special || deferred.resolveWith)(that, args); } },
// Only normal processors (resolve) catch and reject exceptions process = special ? mightThrow : function () { try { mightThrow(); } catch (e) {
if (jQuery.Deferred.exceptionHook) { jQuery.Deferred.exceptionHook(e, process.stackTrace); }
// Support: Promises/A+ section 2.3.3.3.4.1 // https://promisesaplus.com/#point-61 // Ignore post-resolution exceptions if (depth + 1 >= maxDepth) {
// Only substitute handlers pass on context // and multiple values (non-spec behavior) if (handler !== Thrower) { that = undefined; args = [e]; }
deferred.rejectWith(that, args); } } };
// Support: Promises/A+ section 2.3.3.3.1 // https://promisesaplus.com/#point-57 // Re-resolve promises immediately to dodge false rejection from // subsequent errors if (depth) { process(); } else {
// Call an optional hook to record the stack, in case of exception // since it's otherwise lost when execution goes async if (jQuery.Deferred.getStackHook) { process.stackTrace = jQuery.Deferred.getStackHook(); } window.setTimeout(process); } }; }
return jQuery.Deferred(function (newDefer) {
// progress_handlers.add( ... ) tuples[0][3].add( resolve( 0, newDefer, jQuery.isFunction(onProgress) ? onProgress : Identity, newDefer.notifyWith ) );
// fulfilled_handlers.add( ... ) tuples[1][3].add( resolve( 0, newDefer, jQuery.isFunction(onFulfilled) ? onFulfilled : Identity ) );
// rejected_handlers.add( ... ) tuples[2][3].add( resolve( 0, newDefer, jQuery.isFunction(onRejected) ? onRejected : Thrower ) ); }).promise(); },
// Get a promise for this deferred // If obj is provided, the promise aspect is added to the object promise: function (obj) { return obj != null ? jQuery.extend(obj, promise) : promise; } }, deferred = {};
// Add list-specific methods jQuery.each(tuples, function (i, tuple) { var list = tuple[2], stateString = tuple[5];
// promise.progress = list.add // promise.done = list.add // promise.fail = list.add promise[tuple[1]] = list.add;
// Handle state if (stateString) { list.add( function () {
// state = "resolved" (i.e., fulfilled) // state = "rejected" state = stateString; },
// rejected_callbacks.disable // fulfilled_callbacks.disable tuples[3 - i][2].disable,
// progress_callbacks.lock tuples[0][2].lock ); }
// progress_handlers.fire // fulfilled_handlers.fire // rejected_handlers.fire list.add(tuple[3].fire);
// deferred.notify = function() { deferred.notifyWith(...) } // deferred.resolve = function() { deferred.resolveWith(...) } // deferred.reject = function() { deferred.rejectWith(...) } deferred[tuple[0]] = function () { deferred[tuple[0] + "With"](this === deferred ? undefined : this, arguments); return this; };
// deferred.notifyWith = list.fireWith // deferred.resolveWith = list.fireWith // deferred.rejectWith = list.fireWith deferred[tuple[0] + "With"] = list.fireWith; });
// Make the deferred a promise promise.promise(deferred);
// Call given func if any if (func) { func.call(deferred, deferred); }
// All done! return deferred; },
// Deferred helper when: function (singleValue) { var
// count of uncompleted subordinates remaining = arguments.length,
// count of unprocessed arguments i = remaining,
// subordinate fulfillment data resolveContexts = Array(i), resolveValues = slice.call(arguments),
// the master Deferred master = jQuery.Deferred(),
// subordinate callback factory updateFunc = function (i) { return function (value) { resolveContexts[i] = this; resolveValues[i] = arguments.length > 1 ? slice.call(arguments) : value; if (!(--remaining)) { master.resolveWith(resolveContexts, resolveValues); } }; };
// Single- and empty arguments are adopted like Promise.resolve if (remaining <= 1) { adoptValue(singleValue, master.done(updateFunc(i)).resolve, master.reject, !remaining);
// Use .then() to unwrap secondary thenables (cf. gh-3000) if (master.state() === "pending" || jQuery.isFunction(resolveValues[i] && resolveValues[i].then)) {
return master.then(); } }
// Multiple arguments are aggregated like Promise.all array elements while (i--) { adoptValue(resolveValues[i], updateFunc(i), master.reject); }
return master.promise(); } });
// These usually indicate a programmer mistake during development, // warn about them ASAP rather than swallowing them by default. var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
jQuery.Deferred.exceptionHook = function (error, stack) {
// Support: IE 8 - 9 only // Console exists when dev tools are open, which can happen at any time if (window.console && window.console.warn && error && rerrorNames.test(error.name)) { window.console.warn("jQuery.Deferred exception: " + error.message, error.stack, stack); } };
jQuery.readyException = function (error) { window.setTimeout(function () { throw error; }); };
// The deferred used on DOM ready var readyList = jQuery.Deferred();
jQuery.fn.ready = function (fn) {
readyList .then(fn)
// Wrap jQuery.readyException in a function so that the lookup // happens at the time of error handling instead of callback // registration. .catch(function (error) { jQuery.readyException(error); });
return this; };
jQuery.extend({
// Is the DOM ready to be used? Set to true once it occurs. isReady: false,
// A counter to track how many items to wait for before // the ready event fires. See #6781 readyWait: 1,
// Handle when the DOM is ready ready: function (wait) {
// Abort if there are pending holds or we're already ready if (wait === true ? --jQuery.readyWait : jQuery.isReady) { return; }
// Remember that the DOM is ready jQuery.isReady = true;
// If a normal DOM Ready event fired, decrement, and wait if need be if (wait !== true && --jQuery.readyWait > 0) { return; }
// If there are functions bound, to execute readyList.resolveWith(document, [jQuery]); } });
jQuery.ready.then = readyList.then;
// The ready event handler and self cleanup method function completed() { document.removeEventListener("DOMContentLoaded", completed); window.removeEventListener("load", completed); jQuery.ready(); }
// Catch cases where $(document).ready() is called // after the browser event has already occurred. // Support: IE <=9 - 10 only // Older IE sometimes signals "interactive" too soon if (document.readyState === "complete" || (document.readyState !== "loading" && !document.documentElement.doScroll)) {
// Handle it asynchronously to allow scripts the opportunity to delay ready window.setTimeout(jQuery.ready);
} else {
// Use the handy event callback document.addEventListener("DOMContentLoaded", completed);
// A fallback to window.onload, that will always work window.addEventListener("load", completed); }
// Multifunctional method to get and set values of a collection // The value/s can optionally be executed if it's a function var access = function (elems, fn, key, value, chainable, emptyGet, raw) { var i = 0, len = elems.length, bulk = key == null;
// Sets many values if (jQuery.type(key) === "object") { chainable = true; for (i in key) { access(elems, fn, i, key[i], true, emptyGet, raw); }
// Sets one value } else if (value !== undefined) { chainable = true;
if (!jQuery.isFunction(value)) { raw = true; }
if (bulk) {
// Bulk operations run against the entire set if (raw) { fn.call(elems, value); fn = null;
// ...except when executing function values } else { bulk = fn; fn = function (elem, key, value) { return bulk.call(jQuery(elem), value); }; } }
if (fn) { for (; i < len; i++) { fn( elems[i], key, raw ? value : value.call(elems[i], i, fn(elems[i], key)) ); } } }
if (chainable) { return elems; }
// Gets if (bulk) { return fn.call(elems); }
return len ? fn(elems[0], key) : emptyGet; }; var acceptData = function (owner) {
// Accepts only: // - Node // - Node.ELEMENT_NODE // - Node.DOCUMENT_NODE // - Object // - Any return owner.nodeType === 1 || owner.nodeType === 9 || !(+owner.nodeType); };
function Data() { this.expando = jQuery.expando + Data.uid++; }
Data.uid = 1;
Data.prototype = {
cache: function (owner) {
// Check if the owner object already has a cache var value = owner[this.expando];
// If not, create one if (!value) { value = {};
// We can accept data for non-element nodes in modern browsers, // but we should not, see #8335. // Always return an empty object. if (acceptData(owner)) {
// If it is a node unlikely to be stringify-ed or looped over // use plain assignment if (owner.nodeType) { owner[this.expando] = value;
// Otherwise secure it in a non-enumerable property // configurable must be true to allow the property to be // deleted when data is removed } else { Object.defineProperty(owner, this.expando, { value: value, configurable: true }); } } }
return value; }, set: function (owner, data, value) { var prop, cache = this.cache(owner);
// Handle: [ owner, key, value ] args // Always use camelCase key (gh-2257) if (typeof data === "string") { cache[jQuery.camelCase(data)] = value;
// Handle: [ owner, { properties } ] args } else {
// Copy the properties one-by-one to the cache object for (prop in data) { cache[jQuery.camelCase(prop)] = data[prop]; } } return cache; }, get: function (owner, key) { return key === undefined ? this.cache(owner) :
// Always use camelCase key (gh-2257) owner[this.expando] && owner[this.expando][jQuery.camelCase(key)]; }, access: function (owner, key, value) {
// In cases where either: // // 1. No key was specified // 2. A string key was specified, but no value provided // // Take the "read" path and allow the get method to determine // which value to return, respectively either: // // 1. The entire cache object // 2. The data stored at the key // if (key === undefined || ((key && typeof key === "string") && value === undefined)) {
return this.get(owner, key); }
// When the key is not a string, or both a key and value // are specified, set or extend (existing objects) with either: // // 1. An object of properties // 2. A key and value // this.set(owner, key, value);
// Since the "set" path can have two possible entry points // return the expected data based on which path was taken[*] return value !== undefined ? value : key; }, remove: function (owner, key) { var i, cache = owner[this.expando];
if (cache === undefined) { return; }
if (key !== undefined) {
// Support array or space separated string of keys if (Array.isArray(key)) {
// If key is an array of keys... // We always set camelCase keys, so remove that. key = key.map(jQuery.camelCase); } else { key = jQuery.camelCase(key);
// If a key with the spaces exists, use it. // Otherwise, create an array by matching non-whitespace key = key in cache ? [key] : (key.match(rnothtmlwhite) || []); }
i = key.length;
while (i--) { delete cache[key[i]]; } }
// Remove the expando if there's no more data if (key === undefined || jQuery.isEmptyObject(cache)) {
// Support: Chrome <=35 - 45 // Webkit & Blink performance suffers when deleting properties // from DOM nodes, so set to undefined instead // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) if (owner.nodeType) { owner[this.expando] = undefined; } else { delete owner[this.expando]; } } }, hasData: function (owner) { var cache = owner[this.expando]; return cache !== undefined && !jQuery.isEmptyObject(cache); } }; var dataPriv = new Data();
var dataUser = new Data();
// Implementation Summary // // 1. Enforce API surface and semantic compatibility with 1.9.x branch // 2. Improve the module's maintainability by reducing the storage // paths to a single mechanism. // 3. Use the same single mechanism to support "private" and "user" data. // 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) // 5. Avoid exposing implementation details on user objects (eg. expando properties) // 6. Provide a clear path for implementation upgrade to WeakMap in 2014
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, rmultiDash = /[A-Z]/g;
function getData(data) { if (data === "true") { return true; }
if (data === "false") { return false; }
if (data === "null") { return null; }
// Only convert to a number if it doesn't change the string if (data === +data + "") { return +data; }
if (rbrace.test(data)) { return JSON.parse(data); }
return data; }
function dataAttr(elem, key, data) { var name;
// If nothing was found internally, try to fetch any // data from the HTML5 data-* attribute if (data === undefined && elem.nodeType === 1) { name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase(); data = elem.getAttribute(name);
if (typeof data === "string") { try { data = getData(data); } catch (e) {}
// Make sure we set the data so it isn't changed later dataUser.set(elem, key, data); } else { data = undefined; } } return data; }
jQuery.extend({ hasData: function (elem) { return dataUser.hasData(elem) || dataPriv.hasData(elem); },
data: function (elem, name, data) { return dataUser.access(elem, name, data); },
removeData: function (elem, name) { dataUser.remove(elem, name); },
// TODO: Now that all calls to _data and _removeData have been replaced // with direct calls to dataPriv methods, these can be deprecated. _data: function (elem, name, data) { return dataPriv.access(elem, name, data); },
_removeData: function (elem, name) { dataPriv.remove(elem, name); } });
jQuery.fn.extend({ data: function (key, value) { var i, name, data, elem = this[0], attrs = elem && elem.attributes;
// Gets all values if (key === undefined) { if (this.length) { data = dataUser.get(elem);
if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) { i = attrs.length; while (i--) {
// Support: IE 11 only // The attrs elements can be null (#14894) if (attrs[i]) { name = attrs[i].name; if (name.indexOf("data-") === 0) { name = jQuery.camelCase(name.slice(5)); dataAttr(elem, name, data[name]); } } } dataPriv.set(elem, "hasDataAttrs", true); } }
return data; }
// Sets multiple values if (typeof key === "object") { return this.each(function () { dataUser.set(this, key); }); }
return access(this, function (value) { var data;
// The calling jQuery object (element matches) is not empty // (and therefore has an element appears at this[ 0 ]) and the // `value` parameter was not undefined. An empty jQuery object // will result in `undefined` for elem = this[ 0 ] which will // throw an exception if an attempt to read a data cache is made. if (elem && value === undefined) {
// Attempt to get data from the cache // The key will always be camelCased in Data data = dataUser.get(elem, key); if (data !== undefined) { return data; }
// Attempt to "discover" the data in // HTML5 custom data-* attrs data = dataAttr(elem, key); if (data !== undefined) { return data; }
// We tried really hard, but the data doesn't exist. return; }
// Set the data... this.each(function () {
// We always store the camelCased key dataUser.set(this, key, value); }); }, null, value, arguments.length > 1, null, true); },
removeData: function (key) { return this.each(function () { dataUser.remove(this, key); }); } });
jQuery.extend({ queue: function (elem, type, data) { var queue;
if (elem) { type = (type || "fx") + "queue"; queue = dataPriv.get(elem, type);
// Speed up dequeue by getting out quickly if this is just a lookup if (data) { if (!queue || Array.isArray(data)) { queue = dataPriv.access(elem, type, jQuery.makeArray(data)); } else { queue.push(data); } } return queue || []; } },
dequeue: function (elem, type) { type = type || "fx";
var queue = jQuery.queue(elem, type), startLength = queue.length, fn = queue.shift(), hooks = jQuery._queueHooks(elem, type), next = function () { jQuery.dequeue(elem, type); };
// If the fx queue is dequeued, always remove the progress sentinel if (fn === "inprogress") { fn = queue.shift(); startLength--; }
if (fn) {
// Add a progress sentinel to prevent the fx queue from being // automatically dequeued if (type === "fx") { queue.unshift("inprogress"); }
// Clear up the last queue stop function delete hooks.stop; fn.call(elem, next, hooks); }
if (!startLength && hooks) { hooks.empty.fire(); } },
// Not public - generate a queueHooks object, or return the current one _queueHooks: function (elem, type) { var key = type + "queueHooks"; return dataPriv.get(elem, key) || dataPriv.access(elem, key, { empty: jQuery.Callbacks("once memory").add(function () { dataPriv.remove(elem, [type + "queue", key]); }) }); } });
jQuery.fn.extend({ queue: function (type, data) { var setter = 2;
if (typeof type !== "string") { data = type; type = "fx"; setter--; }
if (arguments.length < setter) { return jQuery.queue(this[0], type); }
return data === undefined ? this : this.each(function () { var queue = jQuery.queue(this, type, data);
// Ensure a hooks for this queue jQuery._queueHooks(this, type);
if (type === "fx" && queue[0] !== "inprogress") { jQuery.dequeue(this, type); } }); }, dequeue: function (type) { return this.each(function () { jQuery.dequeue(this, type); }); }, clearQueue: function (type) { return this.queue(type || "fx", []); },
// Get a promise resolved when queues of a certain type // are emptied (fx is the type by default) promise: function (type, obj) { var tmp, count = 1, defer = jQuery.Deferred(), elements = this, i = this.length, resolve = function () { if (!(--count)) { defer.resolveWith(elements, [elements]); } };
if (typeof type !== "string") { obj = type; type = undefined; } type = type || "fx";
while (i--) { tmp = dataPriv.get(elements[i], type + "queueHooks"); if (tmp && tmp.empty) { count++; tmp.empty.add(resolve); } } resolve(); return defer.promise(obj); } }); var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i");
var cssExpand = ["Top", "Right", "Bottom", "Left"];
var isHiddenWithinTree = function (elem, el) {
// isHiddenWithinTree might be called from jQuery#filter function; // in that case, element will be second argument elem = el || elem;
// Inline style trumps all return elem.style.display === "none" || elem.style.display === "" &&
// Otherwise, check computed style // Support: Firefox <=43 - 45 // Disconnected elements can have computed display: none, so first confirm that elem is // in the document. jQuery.contains(elem.ownerDocument, elem) &&
jQuery.css(elem, "display") === "none"; };
var swap = function (elem, options, callback, args) { var ret, name, old = {};
// Remember the old values, and insert the new ones for (name in options) { old[name] = elem.style[name]; elem.style[name] = options[name]; }
ret = callback.apply(elem, args || []);
// Revert the old values for (name in options) { elem.style[name] = old[name]; }
return ret; };
function adjustCSS(elem, prop, valueParts, tween) { var adjusted, scale = 1, maxIterations = 20, currentValue = tween ? function () { return tween.cur(); } : function () { return jQuery.css(elem, prop, ""); }, initial = currentValue(), unit = valueParts && valueParts[3] || (jQuery.cssNumber[prop] ? "" : "px"),
// Starting value computation is required for potential unit mismatches initialInUnit = (jQuery.cssNumber[prop] || unit !== "px" && +initial) && rcssNum.exec(jQuery.css(elem, prop));
if (initialInUnit && initialInUnit[3] !== unit) {
// Trust units reported by jQuery.css unit = unit || initialInUnit[3];
// Make sure we update the tween properties later on valueParts = valueParts || [];
// Iteratively approximate from a nonzero starting point initialInUnit = +initial || 1;
do {
// If previous iteration zeroed out, double until we get *something*. // Use string for doubling so we don't accidentally see scale as unchanged below scale = scale || ".5";
// Adjust and apply initialInUnit = initialInUnit / scale; jQuery.style(elem, prop, initialInUnit + unit);
// Update scale, tolerating zero or NaN from tween.cur() // Break the loop if scale is unchanged or perfect, or if we've just had enough. } while ( scale !== (scale = currentValue() / initial) && scale !== 1 && --maxIterations ); }
if (valueParts) { initialInUnit = +initialInUnit || +initial || 0;
// Apply relative offset (+=/-=) if specified adjusted = valueParts[1] ? initialInUnit + (valueParts[1] + 1) * valueParts[2] : +valueParts[2]; if (tween) { tween.unit = unit; tween.start = initialInUnit; tween.end = adjusted; } } return adjusted; }
var defaultDisplayMap = {};
function getDefaultDisplay(elem) { var temp, doc = elem.ownerDocument, nodeName = elem.nodeName, display = defaultDisplayMap[nodeName];
if (display) { return display; }
temp = doc.body.appendChild(doc.createElement(nodeName)); display = jQuery.css(temp, "display");
temp.parentNode.removeChild(temp);
if (display === "none") { display = "block"; } defaultDisplayMap[nodeName] = display;
return display; }
function showHide(elements, show) { var display, elem, values = [], index = 0, length = elements.length;
// Determine new display value for elements that need to change for (; index < length; index++) { elem = elements[index]; if (!elem.style) { continue; }
display = elem.style.display; if (show) {
// Since we force visibility upon cascade-hidden elements, an immediate (and slow) // check is required in this first loop unless we have a nonempty display value (either // inline or about-to-be-restored) if (display === "none") { values[index] = dataPriv.get(elem, "display") || null; if (!values[index]) { elem.style.display = ""; } } if (elem.style.display === "" && isHiddenWithinTree(elem)) { values[index] = getDefaultDisplay(elem); } } else { if (display !== "none") { values[index] = "none";
// Remember what we're overwriting dataPriv.set(elem, "display", display); } } }
// Set the display of the elements in a second loop to avoid constant reflow for (index = 0; index < length; index++) { if (values[index] != null) { elements[index].style.display = values[index]; } }
return elements; }
jQuery.fn.extend({ show: function () { return showHide(this, true); }, hide: function () { return showHide(this); }, toggle: function (state) { if (typeof state === "boolean") { return state ? this.show() : this.hide(); }
return this.each(function () { if (isHiddenWithinTree(this)) { jQuery(this).show(); } else { jQuery(this).hide(); } }); } }); var rcheckableType = (/^(?:checkbox|radio)$/i);
var rtagName = (/<([a-z][^\/\0>\x20\t\r\n\f]+)/i);
var rscriptType = (/^$|\/(?:java|ecma)script/i);
// We have to close these tags to support XHTML (#13200) var wrapMap = {
// Support: IE <=9 only option: [1, "<select multiple='multiple'>", "</select>"],
// XHTML parsers do not magically insert elements in the // same way that tag soup parsers do. So we cannot shorten // this by omitting <tbody> or other required elements.thead: [1, "
_default: [0, "", ""] };
// Support: IE <=9 only wrapMap.optgroup = wrapMap.option;
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; wrapMap.th = wrapMap.td;
function getAll(context, tag) {
// Support: IE <=9 - 11 only // Use typeof to avoid zero-argument method invocation on host objects (#15151) var ret;
if (typeof context.getElementsByTagName !== "undefined") { ret = context.getElementsByTagName(tag || "*");
} else if (typeof context.querySelectorAll !== "undefined") { ret = context.querySelectorAll(tag || "*");
} else { ret = []; }
if (tag === undefined || tag && nodeName(context, tag)) { return jQuery.merge([context], ret); }
return ret; }
// Mark scripts as having already been evaluated function setGlobalEval(elems, refElements) { var i = 0, l = elems.length;
for (; i < l; i++) { dataPriv.set( elems[i], "globalEval", !refElements || dataPriv.get(refElements[i], "globalEval") ); } }
var rhtml = /<|&#?\w+;/;
function buildFragment(elems, context, scripts, selection, ignored) { var elem, tmp, tag, wrap, contains, j, fragment = context.createDocumentFragment(), nodes = [], i = 0, l = elems.length;
for (; i < l; i++) { elem = elems[i];
if (elem || elem === 0) {
// Add nodes directly if (jQuery.type(elem) === "object") {
// Support: Android <=4.0 only, PhantomJS 1 only // push.apply(_, arraylike) throws on ancient WebKit jQuery.merge(nodes, elem.nodeType ? [elem] : elem);
// Convert non-html into a text node } else if (!rhtml.test(elem)) { nodes.push(context.createTextNode(elem));
// Convert html into DOM nodes } else { tmp = tmp || fragment.appendChild(context.createElement("div"));
// Deserialize a standard representation tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase(); wrap = wrapMap[tag] || wrapMap._default; tmp.innerHTML = wrap[1] + jQuery.htmlPrefilter(elem) + wrap[2];
// Descend through wrappers to the right content j = wrap[0]; while (j--) { tmp = tmp.lastChild; }
// Support: Android <=4.0 only, PhantomJS 1 only // push.apply(_, arraylike) throws on ancient WebKit jQuery.merge(nodes, tmp.childNodes);
// Remember the top-level container tmp = fragment.firstChild;
// Ensure the created nodes are orphaned (#12392) tmp.textContent = ""; } } }
// Remove wrapper from fragment fragment.textContent = "";
i = 0; while ((elem = nodes[i++])) {
// Skip elements already in the context collection (trac-4087) if (selection && jQuery.inArray(elem, selection) > -1) { if (ignored) { ignored.push(elem); } continue; }
contains = jQuery.contains(elem.ownerDocument, elem);
// Append to fragment tmp = getAll(fragment.appendChild(elem), "script");
// Preserve script evaluation history if (contains) { setGlobalEval(tmp); }
// Capture executables if (scripts) { j = 0; while ((elem = tmp[j++])) { if (rscriptType.test(elem.type || "")) { scripts.push(elem); } } } }
return fragment; }
(function () { var fragment = document.createDocumentFragment(), div = fragment.appendChild(document.createElement("div")), input = document.createElement("input");
// Support: Android 4.0 - 4.3 only // Check state lost if the name is set (#11217) // Support: Windows Web Apps (WWA) // `name` and `type` must use .setAttribute for WWA (#14901) input.setAttribute("type", "radio"); input.setAttribute("checked", "checked"); input.setAttribute("name", "t");
div.appendChild(input);
// Support: Android <=4.1 only // Older WebKit doesn't clone checked state correctly in fragments support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
// Support: IE <=11 only // Make sure textarea (and checkbox) defaultValue is properly cloned div.innerHTML = "<textarea>x</textarea>"; support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue; })(); var documentElement = document.documentElement;
var rkeyEvent = /^key/, rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
function returnTrue() { return true; }
function returnFalse() { return false; }
// Support: IE <=9 only // See #13393 for more info function safeActiveElement() { try { return document.activeElement; } catch (err) {} }
function on(elem, types, selector, data, fn, one) { var origFn, type;
// Types can be a map of types/handlers if (typeof types === "object") {
// ( types-Object, selector, data ) if (typeof selector !== "string") {
// ( types-Object, data ) data = data || selector; selector = undefined; } for (type in types) { on(elem, type, selector, data, types[type], one); } return elem; }
if (data == null && fn == null) {
// ( types, fn ) fn = selector; data = selector = undefined; } else if (fn == null) { if (typeof selector === "string") {
// ( types, selector, fn ) fn = data; data = undefined; } else {
// ( types, data, fn ) fn = data; data = selector; selector = undefined; } } if (fn === false) { fn = returnFalse; } else if (!fn) { return elem; }
if (one === 1) { origFn = fn; fn = function (event) {
// Can use an empty set, since event contains the info jQuery().off(event); return origFn.apply(this, arguments); };
// Use same guid so caller can remove using origFn fn.guid = origFn.guid || (origFn.guid = jQuery.guid++); } return elem.each(function () { jQuery.event.add(this, types, fn, data, selector); }); }
/* * Helper functions for managing events -- not part of the public interface. * Props to Dean Edwards' addEvent library for many of the ideas. */ jQuery.event = {
global: {},
add: function (elem, types, handler, data, selector) {
var handleObjIn, eventHandle, tmp, events, t, handleObj, special, handlers, type, namespaces, origType, elemData = dataPriv.get(elem);
// Don't attach events to noData or text/comment nodes (but allow plain objects) if (!elemData) { return; }
// Caller can pass in an object of custom data in lieu of the handler if (handler.handler) { handleObjIn = handler; handler = handleObjIn.handler; selector = handleObjIn.selector; }
// Ensure that invalid selectors throw exceptions at attach time // Evaluate against documentElement in case elem is a non-element node (e.g., document) if (selector) { jQuery.find.matchesSelector(documentElement, selector); }
// Make sure that the handler has a unique ID, used to find/remove it later if (!handler.guid) { handler.guid = jQuery.guid++; }
// Init the element's event structure and main handler, if this is the first if (!(events = elemData.events)) { events = elemData.events = {}; } if (!(eventHandle = elemData.handle)) { eventHandle = elemData.handle = function (e) {
// Discard the second event of a jQuery.event.trigger() and // when an event is called after a page has unloaded return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? jQuery.event.dispatch.apply(elem, arguments) : undefined; }; }
// Handle multiple events separated by a space types = (types || "").match(rnothtmlwhite) || [""]; t = types.length; while (t--) { tmp = rtypenamespace.exec(types[t]) || []; type = origType = tmp[1]; namespaces = (tmp[2] || "").split(".").sort();
// There *must* be a type, no attaching namespace-only handlers if (!type) { continue; }
// If event changes its type, use the special event handlers for the changed type special = jQuery.event.special[type] || {};
// If selector defined, determine special event api type, otherwise given type type = (selector ? special.delegateType : special.bindType) || type;
// Update special based on newly reset type special = jQuery.event.special[type] || {};
// handleObj is passed to all event handlers handleObj = jQuery.extend({ type: type, origType: origType, data: data, handler: handler, guid: handler.guid, selector: selector, needsContext: selector && jQuery.expr.match.needsContext.test(selector), namespace: namespaces.join(".") }, handleObjIn);
// Init the event handler queue if we're the first if (!(handlers = events[type])) { handlers = events[type] = []; handlers.delegateCount = 0;
// Only use addEventListener if the special events handler returns false if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
if (elem.addEventListener) { elem.addEventListener(type, eventHandle); } } }
if (special.add) { special.add.call(elem, handleObj);
if (!handleObj.handler.guid) { handleObj.handler.guid = handler.guid; } }
// Add to the element's handler list, delegates in front if (selector) { handlers.splice(handlers.delegateCount++, 0, handleObj); } else { handlers.push(handleObj); }
// Keep track of which events have ever been used, for event optimization jQuery.event.global[type] = true; }
},
// Detach an event or set of events from an element remove: function (elem, types, handler, selector, mappedTypes) {
var j, origCount, tmp, events, t, handleObj, special, handlers, type, namespaces, origType, elemData = dataPriv.hasData(elem) && dataPriv.get(elem);
if (!elemData || !(events = elemData.events)) { return; }
// Once for each type.namespace in types; type may be omitted types = (types || "").match(rnothtmlwhite) || [""]; t = types.length; while (t--) { tmp = rtypenamespace.exec(types[t]) || []; type = origType = tmp[1]; namespaces = (tmp[2] || "").split(".").sort();
// Unbind all events (on this namespace, if provided) for the element if (!type) { for (type in events) { jQuery.event.remove(elem, type + types[t], handler, selector, true); } continue; }
special = jQuery.event.special[type] || {}; type = (selector ? special.delegateType : special.bindType) || type; handlers = events[type] || []; tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
// Remove matching events origCount = j = handlers.length; while (j--) { handleObj = handlers[j];
if ((mappedTypes || origType === handleObj.origType) && (!handler || handler.guid === handleObj.guid) && (!tmp || tmp.test(handleObj.namespace)) && (!selector || selector === handleObj.selector || selector === "**" && handleObj.selector)) { handlers.splice(j, 1);
if (handleObj.selector) { handlers.delegateCount--; } if (special.remove) { special.remove.call(elem, handleObj); } } }
// Remove generic event handler if we removed something and no more handlers exist // (avoids potential for endless recursion during removal of special event handlers) if (origCount && !handlers.length) { if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
jQuery.removeEvent(elem, type, elemData.handle); }
delete events[type]; } }
// Remove data and the expando if it's no longer used if (jQuery.isEmptyObject(events)) { dataPriv.remove(elem, "handle events"); } },
dispatch: function (nativeEvent) {
// Make a writable jQuery.Event from the native event object var event = jQuery.event.fix(nativeEvent);
var i, j, ret, matched, handleObj, handlerQueue, args = new Array(arguments.length), handlers = (dataPriv.get(this, "events") || {})[event.type] || [], special = jQuery.event.special[event.type] || {};
// Use the fix-ed jQuery.Event rather than the (read-only) native event args[0] = event;
for (i = 1; i < arguments.length; i++) { args[i] = arguments[i]; }
event.delegateTarget = this;
// Call the preDispatch hook for the mapped type, and let it bail if desired if (special.preDispatch && special.preDispatch.call(this, event) === false) { return; }
// Determine handlers handlerQueue = jQuery.event.handlers.call(this, event, handlers);
// Run delegates first; they may want to stop propagation beneath us i = 0; while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) { event.currentTarget = matched.elem;
j = 0; while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {
// Triggered event must either 1) have no namespace, or 2) have namespace(s) // a subset or equal to those in the bound event (both can have no namespace). if (!event.rnamespace || event.rnamespace.test(handleObj.namespace)) {
event.handleObj = handleObj; event.data = handleObj.data;
ret = ((jQuery.event.special[handleObj.origType] || {}).handle || handleObj.handler).apply(matched.elem, args);
if (ret !== undefined) { if ((event.result = ret) === false) { event.preventDefault(); event.stopPropagation(); } } } } }
// Call the postDispatch hook for the mapped type if (special.postDispatch) { special.postDispatch.call(this, event); }
return event.result; },
handlers: function (event, handlers) { var i, handleObj, sel, matchedHandlers, matchedSelectors, handlerQueue = [], delegateCount = handlers.delegateCount, cur = event.target;
// Find delegate handlers if (delegateCount &&
// Support: IE <=9 // Black-hole SVG <use> instance trees (trac-13180) cur.nodeType &&
// Support: Firefox <=42 // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click // Support: IE 11 only // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) !(event.type === "click" && event.button >= 1)) {
for (; cur !== this; cur = cur.parentNode || this) {
// Don't check non-elements (#13208) // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) { matchedHandlers = []; matchedSelectors = {}; for (i = 0; i < delegateCount; i++) { handleObj = handlers[i];
// Don't conflict with Object.prototype properties (#13203) sel = handleObj.selector + " ";
if (matchedSelectors[sel] === undefined) { matchedSelectors[sel] = handleObj.needsContext ? jQuery(sel, this).index(cur) > -1 : jQuery.find(sel, this, null, [cur]).length; } if (matchedSelectors[sel]) { matchedHandlers.push(handleObj); } } if (matchedHandlers.length) { handlerQueue.push({ elem: cur, handlers: matchedHandlers }); } } } }
// Add the remaining (directly-bound) handlers cur = this; if (delegateCount < handlers.length) { handlerQueue.push({ elem: cur, handlers: handlers.slice(delegateCount) }); }
return handlerQueue; },
addProp: function (name, hook) { Object.defineProperty(jQuery.Event.prototype, name, { enumerable: true, configurable: true,
get: jQuery.isFunction(hook) ? function () { if (this.originalEvent) { return hook(this.originalEvent); } } : function () { if (this.originalEvent) { return this.originalEvent[name]; } },
set: function (value) { Object.defineProperty(this, name, { enumerable: true, configurable: true, writable: true, value: value }); } }); },
fix: function (originalEvent) { return originalEvent[jQuery.expando] ? originalEvent : new jQuery.Event(originalEvent); },
special: { load: {
// Prevent triggered image.load events from bubbling to window.load noBubble: true }, focus: {
// Fire native event if possible so blur/focus sequence is correct trigger: function () { if (this !== safeActiveElement() && this.focus) { this.focus(); return false; } }, delegateType: "focusin" }, blur: { trigger: function () { if (this === safeActiveElement() && this.blur) { this.blur(); return false; } }, delegateType: "focusout" }, click: {
// For checkbox, fire native event so checked state will be right trigger: function () { if (this.type === "checkbox" && this.click && nodeName(this, "input")) { this.click(); return false; } },
// For cross-browser consistency, don't fire native .click() on links _default: function (event) { return nodeName(event.target, "a"); } },
beforeunload: { postDispatch: function (event) {
// Support: Firefox 20+ // Firefox doesn't alert if the returnValue field is not set. if (event.result !== undefined && event.originalEvent) { event.originalEvent.returnValue = event.result; } } } } };
jQuery.removeEvent = function (elem, type, handle) {
// This "if" is needed for plain objects if (elem.removeEventListener) { elem.removeEventListener(type, handle); } };
jQuery.Event = function (src, props) {
// Allow instantiation without the 'new' keyword if (!(this instanceof jQuery.Event)) { return new jQuery.Event(src, props); }
// Event object if (src && src.type) { this.originalEvent = src; this.type = src.type;
// Events bubbling up the document may have been marked as prevented // by a handler lower down the tree; reflect the correct value. this.isDefaultPrevented = src.defaultPrevented || src.defaultPrevented === undefined &&
// Support: Android <=2.3 only src.returnValue === false ? returnTrue : returnFalse;
// Create target properties // Support: Safari <=6 - 7 only // Target should not be a text node (#504, #13143) this.target = (src.target && src.target.nodeType === 3) ? src.target.parentNode : src.target;
this.currentTarget = src.currentTarget; this.relatedTarget = src.relatedTarget;
// Event type } else { this.type = src; }
// Put explicitly provided properties onto the event object if (props) { jQuery.extend(this, props); }
// Create a timestamp if incoming event doesn't have one this.timeStamp = src && src.timeStamp || jQuery.now();
// Mark it as fixed this[jQuery.expando] = true; };
// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding // https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html jQuery.Event.prototype = { constructor: jQuery.Event, isDefaultPrevented: returnFalse, isPropagationStopped: returnFalse, isImmediatePropagationStopped: returnFalse, isSimulated: false,
preventDefault: function () { var e = this.originalEvent;
this.isDefaultPrevented = returnTrue;
if (e && !this.isSimulated) { e.preventDefault(); } }, stopPropagation: function () { var e = this.originalEvent;
this.isPropagationStopped = returnTrue;
if (e && !this.isSimulated) { e.stopPropagation(); } }, stopImmediatePropagation: function () { var e = this.originalEvent;
this.isImmediatePropagationStopped = returnTrue;
if (e && !this.isSimulated) { e.stopImmediatePropagation(); }
this.stopPropagation(); } };
// Includes all common event props including KeyEvent and MouseEvent specific props jQuery.each({ altKey: true, bubbles: true, cancelable: true, changedTouches: true, ctrlKey: true, detail: true, eventPhase: true, metaKey: true, pageX: true, pageY: true, shiftKey: true, view: true, "char": true, charCode: true, key: true, keyCode: true, button: true, buttons: true, clientX: true, clientY: true, offsetX: true, offsetY: true, pointerId: true, pointerType: true, screenX: true, screenY: true, targetTouches: true, toElement: true, touches: true,
which: function (event) { var button = event.button;
// Add which for key events if (event.which == null && rkeyEvent.test(event.type)) { return event.charCode != null ? event.charCode : event.keyCode; }
// Add which for click: 1 === left; 2 === middle; 3 === right if (!event.which && button !== undefined && rmouseEvent.test(event.type)) { if (button & 1) { return 1; }
if (button & 2) { return 3; }
if (button & 4) { return 2; }
return 0; }
return event.which; } }, jQuery.event.addProp);
// Create mouseenter/leave events using mouseover/out and event-time checks // so that event delegation works in jQuery. // Do the same for pointerenter/pointerleave and pointerover/pointerout // // Support: Safari 7 only // Safari sends mouseenter too often; see: // https://bugs.chromium.org/p/chromium/issues/detail?id=470258 // for the description of the bug (it existed in older Chrome versions as well). jQuery.each({ mouseenter: "mouseover", mouseleave: "mouseout", pointerenter: "pointerover", pointerleave: "pointerout" }, function (orig, fix) { jQuery.event.special[orig] = { delegateType: fix, bindType: fix,
handle: function (event) { var ret, target = this, related = event.relatedTarget, handleObj = event.handleObj;
// For mouseenter/leave call the handler if related is outside the target. // NB: No relatedTarget if the mouse left/entered the browser window if (!related || (related !== target && !jQuery.contains(target, related))) { event.type = handleObj.origType; ret = handleObj.handler.apply(this, arguments); event.type = fix; } return ret; } }; });
jQuery.fn.extend({
on: function (types, selector, data, fn) { return on(this, types, selector, data, fn); }, one: function (types, selector, data, fn) { return on(this, types, selector, data, fn, 1); }, off: function (types, selector, fn) { var handleObj, type; if (types && types.preventDefault && types.handleObj) {
// ( event ) dispatched jQuery.Event handleObj = types.handleObj; jQuery(types.delegateTarget).off( handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, handleObj.selector, handleObj.handler ); return this; } if (typeof types === "object") {
// ( types-object [, selector] ) for (type in types) { this.off(type, selector, types[type]); } return this; } if (selector === false || typeof selector === "function") {
// ( types [, fn] ) fn = selector; selector = undefined; } if (fn === false) { fn = returnFalse; } return this.each(function () { jQuery.event.remove(this, types, fn, selector); }); } });
var
/* eslint-disable max-len */
// See https://github.com/eslint/eslint/issues/3229 rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
/* eslint-enable */
// Support: IE <=10 - 11, Edge 12 - 13 // In IE/Edge using regex groups here causes severe slowdowns. // See https://connect.microsoft.com/IE/feedback/details/1736512/ rnoInnerhtml = /<script|<style|<link/i,
// checked="checked" or checked rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, rscriptTypeMasked = /^true\/(.*)/, rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
// Prefer a tbody over its parent table for containing new rows function manipulationTarget(elem, content) { if (nodeName(elem, "table") && nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) {
return jQuery(">tbody", elem)[0] || elem; }
return elem; }
// Replace/restore the type attribute of script elements for safe DOM manipulation function disableScript(elem) { elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type; return elem; }
function restoreScript(elem) { var match = rscriptTypeMasked.exec(elem.type);
if (match) { elem.type = match[1]; } else { elem.removeAttribute("type"); }
return elem; }
function cloneCopyEvent(src, dest) { var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
if (dest.nodeType !== 1) { return; }
// 1. Copy private data: events, handlers, etc. if (dataPriv.hasData(src)) { pdataOld = dataPriv.access(src); pdataCur = dataPriv.set(dest, pdataOld); events = pdataOld.events;
if (events) { delete pdataCur.handle; pdataCur.events = {};
for (type in events) { for (i = 0, l = events[type].length; i < l; i++) { jQuery.event.add(dest, type, events[type][i]); } } } }
// 2. Copy user data if (dataUser.hasData(src)) { udataOld = dataUser.access(src); udataCur = jQuery.extend({}, udataOld);
dataUser.set(dest, udataCur); } }
// Fix IE bugs, see support tests function fixInput(src, dest) { var nodeName = dest.nodeName.toLowerCase();
// Fails to persist the checked state of a cloned checkbox or radio button. if (nodeName === "input" && rcheckableType.test(src.type)) { dest.checked = src.checked;
// Fails to return the selected option to the default selected state when cloning options } else if (nodeName === "input" || nodeName === "textarea") { dest.defaultValue = src.defaultValue; } }
function domManip(collection, args, callback, ignored) {
// Flatten any nested arrays args = concat.apply([], args);
var fragment, first, scripts, hasScripts, node, doc, i = 0, l = collection.length, iNoClone = l - 1, value = args[0], isFunction = jQuery.isFunction(value);
// We can't cloneNode fragments that contain checked, in WebKit if (isFunction || (l > 1 && typeof value === "string" && !support.checkClone && rchecked.test(value))) { return collection.each(function (index) { var self = collection.eq(index); if (isFunction) { args[0] = value.call(this, index, self.html()); } domManip(self, args, callback, ignored); }); }
if (l) { fragment = buildFragment(args, collection[0].ownerDocument, false, collection, ignored); first = fragment.firstChild;
if (fragment.childNodes.length === 1) { fragment = first; }
// Require either new content or an interest in ignored elements to invoke the callback if (first || ignored) { scripts = jQuery.map(getAll(fragment, "script"), disableScript); hasScripts = scripts.length;
// Use the original fragment for the last item // instead of the first because it can end up // being emptied incorrectly in certain situations (#8070). for (; i < l; i++) { node = fragment;
if (i !== iNoClone) { node = jQuery.clone(node, true, true);
// Keep references to cloned scripts for later restoration if (hasScripts) {
// Support: Android <=4.0 only, PhantomJS 1 only // push.apply(_, arraylike) throws on ancient WebKit jQuery.merge(scripts, getAll(node, "script")); } }
callback.call(collection[i], node, i); }
if (hasScripts) { doc = scripts[scripts.length - 1].ownerDocument;
// Reenable scripts jQuery.map(scripts, restoreScript);
// Evaluate executable scripts on first document insertion for (i = 0; i < hasScripts; i++) { node = scripts[i]; if (rscriptType.test(node.type || "") && !dataPriv.access(node, "globalEval") && jQuery.contains(doc, node)) {
if (node.src) {
// Optional AJAX dependency, but won't run scripts if not present if (jQuery._evalUrl) { jQuery._evalUrl(node.src); } } else { DOMEval(node.textContent.replace(rcleanScript, ""), doc); } } } } } }
return collection; }
function remove(elem, selector, keepData) { var node, nodes = selector ? jQuery.filter(selector, elem) : elem, i = 0;
for (; (node = nodes[i]) != null; i++) { if (!keepData && node.nodeType === 1) { jQuery.cleanData(getAll(node)); }
if (node.parentNode) { if (keepData && jQuery.contains(node.ownerDocument, node)) { setGlobalEval(getAll(node, "script")); } node.parentNode.removeChild(node); } }
return elem; }
jQuery.extend({ htmlPrefilter: function (html) { return html.replace(rxhtmlTag, "<$1></$2>"); },
clone: function (elem, dataAndEvents, deepDataAndEvents) { var i, l, srcElements, destElements, clone = elem.cloneNode(true), inPage = jQuery.contains(elem.ownerDocument, elem);
// Fix IE cloning issues if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem)) {
// We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 destElements = getAll(clone); srcElements = getAll(elem);
for (i = 0, l = srcElements.length; i < l; i++) { fixInput(srcElements[i], destElements[i]); } }
// Copy the events from the original to the clone if (dataAndEvents) { if (deepDataAndEvents) { srcElements = srcElements || getAll(elem); destElements = destElements || getAll(clone);
for (i = 0, l = srcElements.length; i < l; i++) { cloneCopyEvent(srcElements[i], destElements[i]); } } else { cloneCopyEvent(elem, clone); } }
// Preserve script evaluation history destElements = getAll(clone, "script"); if (destElements.length > 0) { setGlobalEval(destElements, !inPage && getAll(elem, "script")); }
// Return the cloned set return clone; },
cleanData: function (elems) { var data, elem, type, special = jQuery.event.special, i = 0;
for (; (elem = elems[i]) !== undefined; i++) { if (acceptData(elem)) { if ((data = elem[dataPriv.expando])) { if (data.events) { for (type in data.events) { if (special[type]) { jQuery.event.remove(elem, type);
// This is a shortcut to avoid jQuery.event.remove's overhead } else { jQuery.removeEvent(elem, type, data.handle); } } }
// Support: Chrome <=35 - 45+ // Assign undefined instead of using delete, see Data#remove elem[dataPriv.expando] = undefined; } if (elem[dataUser.expando]) {
// Support: Chrome <=35 - 45+ // Assign undefined instead of using delete, see Data#remove elem[dataUser.expando] = undefined; } } } } });
jQuery.fn.extend({ detach: function (selector) { return remove(this, selector, true); },
remove: function (selector) { return remove(this, selector); },
text: function (value) { return access(this, function (value) { return value === undefined ? jQuery.text(this) : this.empty().each(function () { if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { this.textContent = value; } }); }, null, value, arguments.length); },
append: function () { return domManip(this, arguments, function (elem) { if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { var target = manipulationTarget(this, elem); target.appendChild(elem); } }); },
prepend: function () { return domManip(this, arguments, function (elem) { if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { var target = manipulationTarget(this, elem); target.insertBefore(elem, target.firstChild); } }); },
before: function () { return domManip(this, arguments, function (elem) { if (this.parentNode) { this.parentNode.insertBefore(elem, this); } }); },
after: function () { return domManip(this, arguments, function (elem) { if (this.parentNode) { this.parentNode.insertBefore(elem, this.nextSibling); } }); },
empty: function () { var elem, i = 0;
for (; (elem = this[i]) != null; i++) { if (elem.nodeType === 1) {
// Prevent memory leaks jQuery.cleanData(getAll(elem, false));
// Remove any remaining nodes elem.textContent = ""; } }
return this; },
clone: function (dataAndEvents, deepDataAndEvents) { dataAndEvents = dataAndEvents == null ? false : dataAndEvents; deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
return this.map(function () { return jQuery.clone(this, dataAndEvents, deepDataAndEvents); }); },
html: function (value) { return access(this, function (value) { var elem = this[0] || {}, i = 0, l = this.length;
if (value === undefined && elem.nodeType === 1) { return elem.innerHTML; }
// See if we can take a shortcut and just use innerHTML if (typeof value === "string" && !rnoInnerhtml.test(value) && !wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) {
value = jQuery.htmlPrefilter(value);
try { for (; i < l; i++) { elem = this[i] || {};
// Remove element nodes and prevent memory leaks if (elem.nodeType === 1) { jQuery.cleanData(getAll(elem, false)); elem.innerHTML = value; } }
elem = 0;
// If using innerHTML throws an exception, use the fallback method } catch (e) {} }
if (elem) { this.empty().append(value); } }, null, value, arguments.length); },
replaceWith: function () { var ignored = [];
// Make the changes, replacing each non-ignored context element with the new content return domManip(this, arguments, function (elem) { var parent = this.parentNode;
if (jQuery.inArray(this, ignored) < 0) { jQuery.cleanData(getAll(this)); if (parent) { parent.replaceChild(elem, this); } }
// Force callback invocation }, ignored); } });
jQuery.each({ appendTo: "append", prependTo: "prepend", insertBefore: "before", insertAfter: "after", replaceAll: "replaceWith" }, function (name, original) { jQuery.fn[name] = function (selector) { var elems, ret = [], insert = jQuery(selector), last = insert.length - 1, i = 0;
for (; i <= last; i++) { elems = i === last ? this : this.clone(true); jQuery(insert[i])[original](elems);
// Support: Android <=4.0 only, PhantomJS 1 only // .get() because push.apply(_, arraylike) throws on ancient WebKit push.apply(ret, elems.get()); }
return this.pushStack(ret); }; }); var rmargin = (/^margin/);
var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i");
var getStyles = function (elem) {
// Support: IE <=11 only, Firefox <=30 (#15098, #14150) // IE throws on elements created in popups // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" var view = elem.ownerDocument.defaultView;
if (!view || !view.opener) { view = window; }
return view.getComputedStyle(elem); };
(function () {
// Executing both pixelPosition & boxSizingReliable tests require only one layout // so they're executed at the same time to save the second computation. function computeStyleTests() {
// This is a singleton, we need to execute it only once if (!div) { return; }
div.style.cssText = "box-sizing:border-box;" + "position:relative;display:block;" + "margin:auto;border:1px;padding:1px;" + "top:1%;width:50%"; div.innerHTML = ""; documentElement.appendChild(container);
var divStyle = window.getComputedStyle(div); pixelPositionVal = divStyle.top !== "1%";
// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 reliableMarginLeftVal = divStyle.marginLeft === "2px"; boxSizingReliableVal = divStyle.width === "4px";
// Support: Android 4.0 - 4.3 only // Some styles come back with percentage values, even though they shouldn't div.style.marginRight = "50%"; pixelMarginRightVal = divStyle.marginRight === "4px";
documentElement.removeChild(container);
// Nullify the div so it wouldn't be stored in the memory and // it will also be a sign that checks already performed div = null; }
var pixelPositionVal, boxSizingReliableVal, pixelMarginRightVal, reliableMarginLeftVal, container = document.createElement("div"), div = document.createElement("div");
// Finish early in limited (non-browser) environments if (!div.style) { return; }
// Support: IE <=9 - 11 only // Style of cloned element affects source element cloned (#8908) div.style.backgroundClip = "content-box"; div.cloneNode(true).style.backgroundClip = ""; support.clearCloneStyle = div.style.backgroundClip === "content-box";
container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" + "padding:0;margin-top:1px;position:absolute"; container.appendChild(div);
jQuery.extend(support, { pixelPosition: function () { computeStyleTests(); return pixelPositionVal; }, boxSizingReliable: function () { computeStyleTests(); return boxSizingReliableVal; }, pixelMarginRight: function () { computeStyleTests(); return pixelMarginRightVal; }, reliableMarginLeft: function () { computeStyleTests(); return reliableMarginLeftVal; } }); })();
function curCSS(elem, name, computed) { var width, minWidth, maxWidth, ret,
// Support: Firefox 51+ // Retrieving style before computed somehow // fixes an issue with getting wrong values // on detached elements style = elem.style;
computed = computed || getStyles(elem);
// getPropertyValue is needed for: // .css('filter') (IE 9 only, #12537) // .css('--customProperty) (#3144) if (computed) { ret = computed.getPropertyValue(name) || computed[name];
if (ret === "" && !jQuery.contains(elem.ownerDocument, elem)) { ret = jQuery.style(elem, name); }
// A tribute to the "awesome hack by Dean Edwards" // Android Browser returns percentage for some values, // but width seems to be reliably pixels. // This is against the CSSOM draft spec: // https://drafts.csswg.org/cssom/#resolved-values if (!support.pixelMarginRight() && rnumnonpx.test(ret) && rmargin.test(name)) {
// Remember the original values width = style.width; minWidth = style.minWidth; maxWidth = style.maxWidth;
// Put in the new values to get a computed value out style.minWidth = style.maxWidth = style.width = ret; ret = computed.width;
// Revert the changed values style.width = width; style.minWidth = minWidth; style.maxWidth = maxWidth; } }
return ret !== undefined ?
// Support: IE <=9 - 11 only // IE returns zIndex value as an integer. ret + "" : ret; }
function addGetHookIf(conditionFn, hookFn) {
// Define the hook, we'll check on the first run if it's really needed. return { get: function () { if (conditionFn()) {
// Hook not needed (or it's not possible to use it due // to missing dependency), remove it. delete this.get; return; }
// Hook needed; redefine it so that the support test is not executed again. return (this.get = hookFn).apply(this, arguments); } }; }
var
// Swappable if display is none or starts with table // except "table", "table-cell", or "table-caption" // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display rdisplayswap = /^(none|table(?!-c[ea]).+)/, rcustomProp = /^--/, cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssNormalTransform = { letterSpacing: "0", fontWeight: "400" },
cssPrefixes = ["Webkit", "Moz", "ms"], emptyStyle = document.createElement("div").style;
// Return a css property mapped to a potentially vendor prefixed property function vendorPropName(name) {
// Shortcut for names that are not vendor prefixed if (name in emptyStyle) { return name; }
// Check for vendor prefixed names var capName = name[0].toUpperCase() + name.slice(1), i = cssPrefixes.length;
while (i--) { name = cssPrefixes[i] + capName; if (name in emptyStyle) { return name; } } }
// Return a property mapped along what jQuery.cssProps suggests or to // a vendor prefixed property. function finalPropName(name) { var ret = jQuery.cssProps[name]; if (!ret) { ret = jQuery.cssProps[name] = vendorPropName(name) || name; } return ret; }
function setPositiveNumber(elem, value, subtract) {
// Any relative (+/-) values have already been // normalized at this point var matches = rcssNum.exec(value); return matches ?
// Guard against undefined "subtract", e.g., when used as in cssHooks Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px") : value; }
function augmentWidthOrHeight(elem, name, extra, isBorderBox, styles) { var i, val = 0;
// If we already have the right measurement, avoid augmentation if (extra === (isBorderBox ? "border" : "content")) { i = 4;
// Otherwise initialize for horizontal or vertical properties } else { i = name === "width" ? 1 : 0; }
for (; i < 4; i += 2) {
// Both box models exclude margin, so add it if we want it if (extra === "margin") { val += jQuery.css(elem, extra + cssExpand[i], true, styles); }
if (isBorderBox) {
// border-box includes padding, so remove it if we want content if (extra === "content") { val -= jQuery.css(elem, "padding" + cssExpand[i], true, styles); }
// At this point, extra isn't border nor margin, so remove border if (extra !== "margin") { val -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles); } } else {
// At this point, extra isn't content, so add padding val += jQuery.css(elem, "padding" + cssExpand[i], true, styles);
// At this point, extra isn't content nor padding, so add border if (extra !== "padding") { val += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles); } } }
return val; }
function getWidthOrHeight(elem, name, extra) {
// Start with computed style var valueIsBorderBox, styles = getStyles(elem), val = curCSS(elem, name, styles), isBorderBox = jQuery.css(elem, "boxSizing", false, styles) === "border-box";
// Computed unit is not pixels. Stop here and return. if (rnumnonpx.test(val)) { return val; }
// Check for style in case a browser which returns unreliable values // for getComputedStyle silently falls back to the reliable elem.style valueIsBorderBox = isBorderBox && (support.boxSizingReliable() || val === elem.style[name]);
// Fall back to offsetWidth/Height when value is "auto" // This happens for inline elements with no explicit setting (gh-3571) if (val === "auto") { val = elem["offset" + name[0].toUpperCase() + name.slice(1)]; }
// Normalize "", auto, and prepare for extra val = parseFloat(val) || 0;
// Use the active box-sizing model to add/subtract irrelevant styles return (val + augmentWidthOrHeight( elem, name, extra || (isBorderBox ? "border" : "content"), valueIsBorderBox, styles ) ) + "px"; }
jQuery.extend({
// Add in style property hooks for overriding the default // behavior of getting and setting a style property cssHooks: { opacity: { get: function (elem, computed) { if (computed) {
// We should always get a number back from opacity var ret = curCSS(elem, "opacity"); return ret === "" ? "1" : ret; } } } },
// Don't automatically add "px" to these possibly-unitless properties cssNumber: { "animationIterationCount": true, "columnCount": true, "fillOpacity": true, "flexGrow": true, "flexShrink": true, "fontWeight": true, "lineHeight": true, "opacity": true, "order": true, "orphans": true, "widows": true, "zIndex": true, "zoom": true },
// Add in properties whose names you wish to fix before // setting or getting the value cssProps: { "float": "cssFloat" },
// Get and set the style property on a DOM Node style: function (elem, name, value, extra) {
// Don't set styles on text and comment nodes if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) { return; }
// Make sure that we're working with the right name var ret, type, hooks, origName = jQuery.camelCase(name), isCustomProp = rcustomProp.test(name), style = elem.style;
// Make sure that we're working with the right name. We don't // want to query the value if it is a CSS custom property // since they are user-defined. if (!isCustomProp) { name = finalPropName(origName); }
// Gets hook for the prefixed version, then unprefixed version hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
// Check if we're setting a value if (value !== undefined) { type = typeof value;
// Convert "+=" or "-=" to relative numbers (#7345) if (type === "string" && (ret = rcssNum.exec(value)) && ret[1]) { value = adjustCSS(elem, name, ret);
// Fixes bug #9237 type = "number"; }
// Make sure that null and NaN values aren't set (#7116) if (value == null || value !== value) { return; }
// If a number was passed in, add the unit (except for certain CSS properties) if (type === "number") { value += ret && ret[3] || (jQuery.cssNumber[origName] ? "" : "px"); }
// background-* props affect original clone's values if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) { style[name] = "inherit"; }
// If a hook was provided, use that value, otherwise just set the specified value if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== undefined) {
if (isCustomProp) { style.setProperty(name, value); } else { style[name] = value; } }
} else {
// If a hook was provided get the non-computed value from there if (hooks && "get" in hooks && (ret = hooks.get(elem, false, extra)) !== undefined) {
return ret; }
// Otherwise just get the value from the style object return style[name]; } },
css: function (elem, name, extra, styles) { var val, num, hooks, origName = jQuery.camelCase(name), isCustomProp = rcustomProp.test(name);
// Make sure that we're working with the right name. We don't // want to modify the value if it is a CSS custom property // since they are user-defined. if (!isCustomProp) { name = finalPropName(origName); }
// Try prefixed name followed by the unprefixed name hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
// If a hook was provided get the computed value from there if (hooks && "get" in hooks) { val = hooks.get(elem, true, extra); }
// Otherwise, if a way to get the computed value exists, use that if (val === undefined) { val = curCSS(elem, name, styles); }
// Convert "normal" to computed value if (val === "normal" && name in cssNormalTransform) { val = cssNormalTransform[name]; }
// Make numeric if forced or a qualifier was provided and val looks numeric if (extra === "" || extra) { num = parseFloat(val); return extra === true || isFinite(num) ? num || 0 : val; }
return val; } });
jQuery.each(["height", "width"], function (i, name) { jQuery.cssHooks[name] = { get: function (elem, computed, extra) { if (computed) {
// Certain elements can have dimension info if we invisibly show them // but it must have a current display style that would benefit return rdisplayswap.test(jQuery.css(elem, "display")) &&
// Support: Safari 8+ // Table columns in Safari have non-zero offsetWidth & zero // getBoundingClientRect().width unless display is changed. // Support: IE <=11 only // Running getBoundingClientRect on a disconnected node // in IE throws an error. (!elem.getClientRects().length || !elem.getBoundingClientRect().width) ? swap(elem, cssShow, function () { return getWidthOrHeight(elem, name, extra); }) : getWidthOrHeight(elem, name, extra); } },
set: function (elem, value, extra) { var matches, styles = extra && getStyles(elem), subtract = extra && augmentWidthOrHeight( elem, name, extra, jQuery.css(elem, "boxSizing", false, styles) === "border-box", styles );
// Convert to pixels if value adjustment is needed if (subtract && (matches = rcssNum.exec(value)) && (matches[3] || "px") !== "px") {
elem.style[name] = value; value = jQuery.css(elem, name); }
return setPositiveNumber(elem, value, subtract); } }; });
jQuery.cssHooks.marginLeft = addGetHookIf(support.reliableMarginLeft, function (elem, computed) { if (computed) { return (parseFloat(curCSS(elem, "marginLeft")) || elem.getBoundingClientRect().left - swap(elem, { marginLeft: 0 }, function () { return elem.getBoundingClientRect().left; }) ) + "px"; } } );
// These hooks are used by animate to expand properties jQuery.each({ margin: "", padding: "", border: "Width" }, function (prefix, suffix) { jQuery.cssHooks[prefix + suffix] = { expand: function (value) { var i = 0, expanded = {},
// Assumes a single number if not a string parts = typeof value === "string" ? value.split(" ") : [value];
for (; i < 4; i++) { expanded[prefix + cssExpand[i] + suffix] = parts[i] || parts[i - 2] || parts[0]; }
return expanded; } };
if (!rmargin.test(prefix)) { jQuery.cssHooks[prefix + suffix].set = setPositiveNumber; } });
jQuery.fn.extend({ css: function (name, value) { return access(this, function (elem, name, value) { var styles, len, map = {}, i = 0;
if (Array.isArray(name)) { styles = getStyles(elem); len = name.length;
for (; i < len; i++) { map[name[i]] = jQuery.css(elem, name[i], false, styles); }
return map; }
return value !== undefined ? jQuery.style(elem, name, value) : jQuery.css(elem, name); }, name, value, arguments.length > 1); } });
function Tween(elem, options, prop, end, easing) { return new Tween.prototype.init(elem, options, prop, end, easing); } jQuery.Tween = Tween;
Tween.prototype = { constructor: Tween, init: function (elem, options, prop, end, easing, unit) { this.elem = elem; this.prop = prop; this.easing = easing || jQuery.easing._default; this.options = options; this.start = this.now = this.cur(); this.end = end; this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px"); }, cur: function () { var hooks = Tween.propHooks[this.prop];
return hooks && hooks.get ? hooks.get(this) : Tween.propHooks._default.get(this); }, run: function (percent) { var eased, hooks = Tween.propHooks[this.prop];
if (this.options.duration) { this.pos = eased = jQuery.easing[this.easing]( percent, this.options.duration * percent, 0, 1, this.options.duration ); } else { this.pos = eased = percent; } this.now = (this.end - this.start) * eased + this.start;
if (this.options.step) { this.options.step.call(this.elem, this.now, this); }
if (hooks && hooks.set) { hooks.set(this); } else { Tween.propHooks._default.set(this); } return this; } };
Tween.prototype.init.prototype = Tween.prototype;
Tween.propHooks = { _default: { get: function (tween) { var result;
// Use a property on the element directly when it is not a DOM element, // or when there is no matching style property that exists. if (tween.elem.nodeType !== 1 || tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) { return tween.elem[tween.prop]; }
// Passing an empty string as a 3rd parameter to .css will automatically // attempt a parseFloat and fallback to a string if the parse fails. // Simple values such as "10px" are parsed to Float; // complex values such as "rotate(1rad)" are returned as-is. result = jQuery.css(tween.elem, tween.prop, "");
// Empty strings, null, undefined and "auto" are converted to 0. return !result || result === "auto" ? 0 : result; }, set: function (tween) {
// Use step hook for back compat. // Use cssHook if its there. // Use .style if available and use plain properties where available. if (jQuery.fx.step[tween.prop]) { jQuery.fx.step[tween.prop](tween); } else if (tween.elem.nodeType === 1 && (tween.elem.style[jQuery.cssProps[tween.prop]] != null || jQuery.cssHooks[tween.prop])) { jQuery.style(tween.elem, tween.prop, tween.now + tween.unit); } else { tween.elem[tween.prop] = tween.now; } } } };
// Support: IE <=9 only // Panic based approach to setting things on disconnected nodes Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { set: function (tween) { if (tween.elem.nodeType && tween.elem.parentNode) { tween.elem[tween.prop] = tween.now; } } };
jQuery.easing = { linear: function (p) { return p; }, swing: function (p) { return 0.5 - Math.cos(p * Math.PI) / 2; }, _default: "swing" };
jQuery.fx = Tween.prototype.init;
// Back compat <1.8 extension point jQuery.fx.step = {};
var fxNow, inProgress, rfxtypes = /^(?:toggle|show|hide)$/, rrun = /queueHooks$/;
function schedule() { if (inProgress) { if (document.hidden === false && window.requestAnimationFrame) { window.requestAnimationFrame(schedule); } else { window.setTimeout(schedule, jQuery.fx.interval); }
jQuery.fx.tick(); } }
// Animations created synchronously will run synchronously function createFxNow() { window.setTimeout(function () { fxNow = undefined; }); return (fxNow = jQuery.now()); }
// Generate parameters to create a standard animation function genFx(type, includeWidth) { var which, i = 0, attrs = { height: type };
// If we include width, step value is 1 to do all cssExpand values, // otherwise step value is 2 to skip over Left and Right includeWidth = includeWidth ? 1 : 0; for (; i < 4; i += 2 - includeWidth) { which = cssExpand[i]; attrs["margin" + which] = attrs["padding" + which] = type; }
if (includeWidth) { attrs.opacity = attrs.width = type; }
return attrs; }
function createTween(value, prop, animation) { var tween, collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]), index = 0, length = collection.length; for (; index < length; index++) { if ((tween = collection[index].call(animation, prop, value))) {
// We're done with this property return tween; } } }
function defaultPrefilter(elem, props, opts) { var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, isBox = "width" in props || "height" in props, anim = this, orig = {}, style = elem.style, hidden = elem.nodeType && isHiddenWithinTree(elem), dataShow = dataPriv.get(elem, "fxshow");
// Queue-skipping animations hijack the fx hooks if (!opts.queue) { hooks = jQuery._queueHooks(elem, "fx"); if (hooks.unqueued == null) { hooks.unqueued = 0; oldfire = hooks.empty.fire; hooks.empty.fire = function () { if (!hooks.unqueued) { oldfire(); } }; } hooks.unqueued++;
anim.always(function () {
// Ensure the complete handler is called before this completes anim.always(function () { hooks.unqueued--; if (!jQuery.queue(elem, "fx").length) { hooks.empty.fire(); } }); }); }
// Detect show/hide animations for (prop in props) { value = props[prop]; if (rfxtypes.test(value)) { delete props[prop]; toggle = toggle || value === "toggle"; if (value === (hidden ? "hide" : "show")) {
// Pretend to be hidden if this is a "show" and // there is still data from a stopped show/hide if (value === "show" && dataShow && dataShow[prop] !== undefined) { hidden = true;
// Ignore all other no-op show/hide data } else { continue; } } orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop); } }
// Bail out if this is a no-op like .hide().hide() propTween = !jQuery.isEmptyObject(props); if (!propTween && jQuery.isEmptyObject(orig)) { return; }
// Restrict "overflow" and "display" styles during box animations if (isBox && elem.nodeType === 1) {
// Support: IE <=9 - 11, Edge 12 - 13 // Record all 3 overflow attributes because IE does not infer the shorthand // from identically-valued overflowX and overflowY opts.overflow = [style.overflow, style.overflowX, style.overflowY];
// Identify a display type, preferring old show/hide data over the CSS cascade restoreDisplay = dataShow && dataShow.display; if (restoreDisplay == null) { restoreDisplay = dataPriv.get(elem, "display"); } display = jQuery.css(elem, "display"); if (display === "none") { if (restoreDisplay) { display = restoreDisplay; } else {
// Get nonempty value(s) by temporarily forcing visibility showHide([elem], true); restoreDisplay = elem.style.display || restoreDisplay; display = jQuery.css(elem, "display"); showHide([elem]); } }
// Animate inline elements as inline-block if (display === "inline" || display === "inline-block" && restoreDisplay != null) { if (jQuery.css(elem, "float") === "none") {
// Restore the original display value at the end of pure show/hide animations if (!propTween) { anim.done(function () { style.display = restoreDisplay; }); if (restoreDisplay == null) { display = style.display; restoreDisplay = display === "none" ? "" : display; } } style.display = "inline-block"; } } }
if (opts.overflow) { style.overflow = "hidden"; anim.always(function () { style.overflow = opts.overflow[0]; style.overflowX = opts.overflow[1]; style.overflowY = opts.overflow[2]; }); }
// Implement show/hide animations propTween = false; for (prop in orig) {
// General show/hide setup for this element animation if (!propTween) { if (dataShow) { if ("hidden" in dataShow) { hidden = dataShow.hidden; } } else { dataShow = dataPriv.access(elem, "fxshow", { display: restoreDisplay }); }
// Store hidden/visible for toggle so `.stop().toggle()` "reverses" if (toggle) { dataShow.hidden = !hidden; }
// Show elements before animating them if (hidden) { showHide([elem], true); }
/* eslint-disable no-loop-func */
anim.done(function () {
/* eslint-enable no-loop-func */
// The final step of a "hide" animation is actually hiding the element if (!hidden) { showHide([elem]); } dataPriv.remove(elem, "fxshow"); for (prop in orig) { jQuery.style(elem, prop, orig[prop]); } }); }
// Per-property setup propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim); if (!(prop in dataShow)) { dataShow[prop] = propTween.start; if (hidden) { propTween.end = propTween.start; propTween.start = 0; } } } }
function propFilter(props, specialEasing) { var index, name, easing, value, hooks;
// camelCase, specialEasing and expand cssHook pass for (index in props) { name = jQuery.camelCase(index); easing = specialEasing[name]; value = props[index]; if (Array.isArray(value)) { easing = value[1]; value = props[index] = value[0]; }
if (index !== name) { props[name] = value; delete props[index]; }
hooks = jQuery.cssHooks[name]; if (hooks && "expand" in hooks) { value = hooks.expand(value); delete props[name];
// Not quite $.extend, this won't overwrite existing keys. // Reusing 'index' because we have the correct "name" for (index in value) { if (!(index in props)) { props[index] = value[index]; specialEasing[index] = easing; } } } else { specialEasing[name] = easing; } } }
function Animation(elem, properties, options) { var result, stopped, index = 0, length = Animation.prefilters.length, deferred = jQuery.Deferred().always(function () {
// Don't match elem in the :animated selector delete tick.elem; }), tick = function () { if (stopped) { return false; } var currentTime = fxNow || createFxNow(), remaining = Math.max(0, animation.startTime + animation.duration - currentTime),
// Support: Android 2.3 only // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) temp = remaining / animation.duration || 0, percent = 1 - temp, index = 0, length = animation.tweens.length;
for (; index < length; index++) { animation.tweens[index].run(percent); }
deferred.notifyWith(elem, [animation, percent, remaining]);
// If there's more to do, yield if (percent < 1 && length) { return remaining; }
// If this was an empty animation, synthesize a final progress notification if (!length) { deferred.notifyWith(elem, [animation, 1, 0]); }
// Resolve the animation and report its conclusion deferred.resolveWith(elem, [animation]); return false; }, animation = deferred.promise({ elem: elem, props: jQuery.extend({}, properties), opts: jQuery.extend(true, { specialEasing: {}, easing: jQuery.easing._default }, options), originalProperties: properties, originalOptions: options, startTime: fxNow || createFxNow(), duration: options.duration, tweens: [], createTween: function (prop, end) { var tween = jQuery.Tween(elem, animation.opts, prop, end, animation.opts.specialEasing[prop] || animation.opts.easing); animation.tweens.push(tween); return tween; }, stop: function (gotoEnd) { var index = 0,
// If we are going to the end, we want to run all the tweens // otherwise we skip this part length = gotoEnd ? animation.tweens.length : 0; if (stopped) { return this; } stopped = true; for (; index < length; index++) { animation.tweens[index].run(1); }
// Resolve when we played the last frame; otherwise, reject if (gotoEnd) { deferred.notifyWith(elem, [animation, 1, 0]); deferred.resolveWith(elem, [animation, gotoEnd]); } else { deferred.rejectWith(elem, [animation, gotoEnd]); } return this; } }), props = animation.props;
propFilter(props, animation.opts.specialEasing);
for (; index < length; index++) { result = Animation.prefilters[index].call(animation, elem, props, animation.opts); if (result) { if (jQuery.isFunction(result.stop)) { jQuery._queueHooks(animation.elem, animation.opts.queue).stop = jQuery.proxy(result.stop, result); } return result; } }
jQuery.map(props, createTween, animation);
if (jQuery.isFunction(animation.opts.start)) { animation.opts.start.call(elem, animation); }
// Attach callbacks from options animation .progress(animation.opts.progress) .done(animation.opts.done, animation.opts.complete) .fail(animation.opts.fail) .always(animation.opts.always);
jQuery.fx.timer( jQuery.extend(tick, { elem: elem, anim: animation, queue: animation.opts.queue }) );
return animation; }
jQuery.Animation = jQuery.extend(Animation, {
tweeners: { "*": [function (prop, value) { var tween = this.createTween(prop, value); adjustCSS(tween.elem, prop, rcssNum.exec(value), tween); return tween;
}]
},
tweener: function (props, callback) { if (jQuery.isFunction(props)) { callback = props; props = ["*"]; } else { props = props.match(rnothtmlwhite); }
var prop, index = 0, length = props.length;
for (; index < length; index++) { prop = props[index]; Animation.tweeners[prop] = Animation.tweeners[prop] || []; Animation.tweeners[prop].unshift(callback); } },
prefilters: [defaultPrefilter],
prefilter: function (callback, prepend) { if (prepend) { Animation.prefilters.unshift(callback); } else { Animation.prefilters.push(callback); } } });
jQuery.speed = function (speed, easing, fn) { var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { complete: fn || !fn && easing || jQuery.isFunction(speed) && speed, duration: speed, easing: fn && easing || easing && !jQuery.isFunction(easing) && easing };
// Go to the end state if fx are off if (jQuery.fx.off) { opt.duration = 0;
} else { if (typeof opt.duration !== "number") { if (opt.duration in jQuery.fx.speeds) { opt.duration = jQuery.fx.speeds[opt.duration];
} else { opt.duration = jQuery.fx.speeds._default; } } }
// Normalize opt.queue - true/undefined/null -> "fx" if (opt.queue == null || opt.queue === true) { opt.queue = "fx"; }
// Queueing opt.old = opt.complete;
opt.complete = function () { if (jQuery.isFunction(opt.old)) { opt.old.call(this); }
if (opt.queue) { jQuery.dequeue(this, opt.queue); } };
return opt; };
jQuery.fn.extend({ fadeTo: function (speed, to, easing, callback) {
// Show any hidden elements after setting opacity to 0 return this.filter(isHiddenWithinTree).css("opacity", 0).show()
// Animate to the value specified .end().animate({ opacity: to }, speed, easing, callback); }, animate: function (prop, speed, easing, callback) { var empty = jQuery.isEmptyObject(prop), optall = jQuery.speed(speed, easing, callback), doAnimation = function () {
// Operate on a copy of prop so per-property easing won't be lost var anim = Animation(this, jQuery.extend({}, prop), optall);
// Empty animations, or finishing resolves immediately if (empty || dataPriv.get(this, "finish")) { anim.stop(true); } }; doAnimation.finish = doAnimation;
return empty || optall.queue === false ? this.each(doAnimation) : this.queue(optall.queue, doAnimation); }, stop: function (type, clearQueue, gotoEnd) { var stopQueue = function (hooks) { var stop = hooks.stop; delete hooks.stop; stop(gotoEnd); };
if (typeof type !== "string") { gotoEnd = clearQueue; clearQueue = type; type = undefined; } if (clearQueue && type !== false) { this.queue(type || "fx", []); }
return this.each(function () { var dequeue = true, index = type != null && type + "queueHooks", timers = jQuery.timers, data = dataPriv.get(this);
if (index) { if (data[index] && data[index].stop) { stopQueue(data[index]); } } else { for (index in data) { if (data[index] && data[index].stop && rrun.test(index)) { stopQueue(data[index]); } } }
for (index = timers.length; index--;) { if (timers[index].elem === this && (type == null || timers[index].queue === type)) {
timers[index].anim.stop(gotoEnd); dequeue = false; timers.splice(index, 1); } }
// Start the next in the queue if the last step wasn't forced. // Timers currently will call their complete callbacks, which // will dequeue but only if they were gotoEnd. if (dequeue || !gotoEnd) { jQuery.dequeue(this, type); } }); }, finish: function (type) { if (type !== false) { type = type || "fx"; } return this.each(function () { var index, data = dataPriv.get(this), queue = data[type + "queue"], hooks = data[type + "queueHooks"], timers = jQuery.timers, length = queue ? queue.length : 0;
// Enable finishing flag on private data data.finish = true;
// Empty the queue first jQuery.queue(this, type, []);
if (hooks && hooks.stop) { hooks.stop.call(this, true); }
// Look for any active animations, and finish them for (index = timers.length; index--;) { if (timers[index].elem === this && timers[index].queue === type) { timers[index].anim.stop(true); timers.splice(index, 1); } }
// Look for any animations in the old queue and finish them for (index = 0; index < length; index++) { if (queue[index] && queue[index].finish) { queue[index].finish.call(this); } }
// Turn off finishing flag delete data.finish; }); } });
jQuery.each(["toggle", "show", "hide"], function (i, name) { var cssFn = jQuery.fn[name]; jQuery.fn[name] = function (speed, easing, callback) { return speed == null || typeof speed === "boolean" ? cssFn.apply(this, arguments) : this.animate(genFx(name, true), speed, easing, callback); }; });
// Generate shortcuts for custom animations jQuery.each({ slideDown: genFx("show"), slideUp: genFx("hide"), slideToggle: genFx("toggle"), fadeIn: { opacity: "show" }, fadeOut: { opacity: "hide" }, fadeToggle: { opacity: "toggle" } }, function (name, props) { jQuery.fn[name] = function (speed, easing, callback) { return this.animate(props, speed, easing, callback); }; });
jQuery.timers = []; jQuery.fx.tick = function () { var timer, i = 0, timers = jQuery.timers;
fxNow = jQuery.now();
for (; i < timers.length; i++) { timer = timers[i];
// Run the timer and safely remove it when done (allowing for external removal) if (!timer() && timers[i] === timer) { timers.splice(i--, 1); } }
if (!timers.length) { jQuery.fx.stop(); } fxNow = undefined; };
jQuery.fx.timer = function (timer) { jQuery.timers.push(timer); jQuery.fx.start(); };
jQuery.fx.interval = 13; jQuery.fx.start = function () { if (inProgress) { return; }
inProgress = true; schedule(); };
jQuery.fx.stop = function () { inProgress = null; };
jQuery.fx.speeds = { slow: 600, fast: 200,
// Default speed _default: 400 };
// Based off of the plugin by Clint Helfers, with permission. // https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ jQuery.fn.delay = function (time, type) { time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; type = type || "fx";
return this.queue(type, function (next, hooks) { var timeout = window.setTimeout(next, time); hooks.stop = function () { window.clearTimeout(timeout); }; }); };
(function () { var input = document.createElement("input"), select = document.createElement("select"), opt = select.appendChild(document.createElement("option"));
input.type = "checkbox";
// Support: Android <=4.3 only // Default value for a checkbox should be "on" support.checkOn = input.value !== "";
// Support: IE <=11 only // Must access selectedIndex to make default options select support.optSelected = opt.selected;
// Support: IE <=11 only // An input loses its value after becoming a radio input = document.createElement("input"); input.value = "t"; input.type = "radio"; support.radioValue = input.value === "t"; })();
var boolHook, attrHandle = jQuery.expr.attrHandle;
jQuery.fn.extend({ attr: function (name, value) { return access(this, jQuery.attr, name, value, arguments.length > 1); },
removeAttr: function (name) { return this.each(function () { jQuery.removeAttr(this, name); }); } });
jQuery.extend({ attr: function (elem, name, value) { var ret, hooks, nType = elem.nodeType;
// Don't get/set attributes on text, comment and attribute nodes if (nType === 3 || nType === 8 || nType === 2) { return; }
// Fallback to prop when attributes are not supported if (typeof elem.getAttribute === "undefined") { return jQuery.prop(elem, name, value); }
// Attribute hooks are determined by the lowercase version // Grab necessary hook if one is defined if (nType !== 1 || !jQuery.isXMLDoc(elem)) { hooks = jQuery.attrHooks[name.toLowerCase()] || (jQuery.expr.match.bool.test(name) ? boolHook : undefined); }
if (value !== undefined) { if (value === null) { jQuery.removeAttr(elem, name); return; }
if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) { return ret; }
elem.setAttribute(name, value + ""); return value; }
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) { return ret; }
ret = jQuery.find.attr(elem, name);
// Non-existent attributes return null, we normalize to undefined return ret == null ? undefined : ret; },
attrHooks: { type: { set: function (elem, value) { if (!support.radioValue && value === "radio" && nodeName(elem, "input")) { var val = elem.value; elem.setAttribute("type", value); if (val) { elem.value = val; } return value; } } } },
removeAttr: function (elem, value) { var name, i = 0,
// Attribute names can contain non-HTML whitespace characters // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 attrNames = value && value.match(rnothtmlwhite);
if (attrNames && elem.nodeType === 1) { while ((name = attrNames[i++])) { elem.removeAttribute(name); } } } });
// Hooks for boolean attributes boolHook = { set: function (elem, value, name) { if (value === false) {
// Remove boolean attributes when set to false jQuery.removeAttr(elem, name); } else { elem.setAttribute(name, name); } return name; } };
jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (i, name) { var getter = attrHandle[name] || jQuery.find.attr;
attrHandle[name] = function (elem, name, isXML) { var ret, handle, lowercaseName = name.toLowerCase();
if (!isXML) {
// Avoid an infinite loop by temporarily removing this function from the getter handle = attrHandle[lowercaseName]; attrHandle[lowercaseName] = ret; ret = getter(elem, name, isXML) != null ? lowercaseName : null; attrHandle[lowercaseName] = handle; } return ret; }; });
var rfocusable = /^(?:input|select|textarea|button)$/i, rclickable = /^(?:a|area)$/i;
jQuery.fn.extend({ prop: function (name, value) { return access(this, jQuery.prop, name, value, arguments.length > 1); },
removeProp: function (name) { return this.each(function () { delete this[jQuery.propFix[name] || name]; }); } });
jQuery.extend({ prop: function (elem, name, value) { var ret, hooks, nType = elem.nodeType;
// Don't get/set properties on text, comment and attribute nodes if (nType === 3 || nType === 8 || nType === 2) { return; }
if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
// Fix name and attach hooks name = jQuery.propFix[name] || name; hooks = jQuery.propHooks[name]; }
if (value !== undefined) { if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) { return ret; }
return (elem[name] = value); }
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) { return ret; }
return elem[name]; },
propHooks: { tabIndex: { get: function (elem) {
// Support: IE <=9 - 11 only // elem.tabIndex doesn't always return the // correct value when it hasn't been explicitly set // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ // Use proper attribute retrieval(#12072) var tabindex = jQuery.find.attr(elem, "tabindex");
if (tabindex) { return parseInt(tabindex, 10); }
if ( rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href ) { return 0; }
return -1; } } },
propFix: { "for": "htmlFor", "class": "className" } });
// Support: IE <=11 only // Accessing the selectedIndex property // forces the browser to respect setting selected // on the option // The getter ensures a default option is selected // when in an optgroup // eslint rule "no-unused-expressions" is disabled for this code // since it considers such accessions noop if (!support.optSelected) { jQuery.propHooks.selected = { get: function (elem) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode; if (parent && parent.parentNode) { parent.parentNode.selectedIndex; } return null; }, set: function (elem) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode; if (parent) { parent.selectedIndex;
if (parent.parentNode) { parent.parentNode.selectedIndex; } } } }; }
jQuery.each([
"tabIndex", "readOnly", "maxLength", "cellSpacing", "cellPadding", "rowSpan", "colSpan", "useMap", "frameBorder", "contentEditable" ], function () {
jQuery.propFix[this.toLowerCase()] = this; });
// Strip and collapse whitespace according to HTML spec // https://html.spec.whatwg.org/multipage/infrastructure.html#strip-and-collapse-whitespace function stripAndCollapse(value) { var tokens = value.match(rnothtmlwhite) || []; return tokens.join(" "); }
function getClass(elem) { return elem.getAttribute && elem.getAttribute("class") || ""; }
jQuery.fn.extend({ addClass: function (value) { var classes, elem, cur, curValue, clazz, j, finalValue, i = 0;
if (jQuery.isFunction(value)) { return this.each(function (j) { jQuery(this).addClass(value.call(this, j, getClass(this))); }); }
if (typeof value === "string" && value) { classes = value.match(rnothtmlwhite) || [];
while ((elem = this[i++])) { curValue = getClass(elem); cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
if (cur) { j = 0; while ((clazz = classes[j++])) { if (cur.indexOf(" " + clazz + " ") < 0) { cur += clazz + " "; } }
// Only assign if different to avoid unneeded rendering. finalValue = stripAndCollapse(cur); if (curValue !== finalValue) { elem.setAttribute("class", finalValue); } } } }
return this; },
removeClass: function (value) { var classes, elem, cur, curValue, clazz, j, finalValue, i = 0;
if (jQuery.isFunction(value)) { return this.each(function (j) { jQuery(this).removeClass(value.call(this, j, getClass(this))); }); }
if (!arguments.length) { return this.attr("class", ""); }
if (typeof value === "string" && value) { classes = value.match(rnothtmlwhite) || [];
while ((elem = this[i++])) { curValue = getClass(elem);
// This expression is here for better compressibility (see addClass) cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
if (cur) { j = 0; while ((clazz = classes[j++])) {
// Remove *all* instances while (cur.indexOf(" " + clazz + " ") > -1) { cur = cur.replace(" " + clazz + " ", " "); } }
// Only assign if different to avoid unneeded rendering. finalValue = stripAndCollapse(cur); if (curValue !== finalValue) { elem.setAttribute("class", finalValue); } } } }
return this; },
toggleClass: function (value, stateVal) { var type = typeof value;
if (typeof stateVal === "boolean" && type === "string") { return stateVal ? this.addClass(value) : this.removeClass(value); }
if (jQuery.isFunction(value)) { return this.each(function (i) { jQuery(this).toggleClass( value.call(this, i, getClass(this), stateVal), stateVal ); }); }
return this.each(function () { var className, i, self, classNames;
if (type === "string") {
// Toggle individual class names i = 0; self = jQuery(this); classNames = value.match(rnothtmlwhite) || [];
while ((className = classNames[i++])) {
// Check each className given, space separated list if (self.hasClass(className)) { self.removeClass(className); } else { self.addClass(className); } }
// Toggle whole class name } else if (value === undefined || type === "boolean") { className = getClass(this); if (className) {
// Store className if set dataPriv.set(this, "__className__", className); }
// If the element has a class name or if we're passed `false`, // then remove the whole classname (if there was one, the above saved it). // Otherwise bring back whatever was previously saved (if anything), // falling back to the empty string if nothing was stored. if (this.setAttribute) { this.setAttribute("class", className || value === false ? "" : dataPriv.get(this, "__className__") || "" ); } } }); },
hasClass: function (selector) { var className, elem, i = 0;
className = " " + selector + " "; while ((elem = this[i++])) { if (elem.nodeType === 1 && (" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) { return true; } }
return false; } });
var rreturn = /\r/g;
jQuery.fn.extend({ val: function (value) { var hooks, ret, isFunction, elem = this[0];
if (!arguments.length) { if (elem) { hooks = jQuery.valHooks[elem.type] || jQuery.valHooks[elem.nodeName.toLowerCase()];
if (hooks && "get" in hooks && (ret = hooks.get(elem, "value")) !== undefined ) { return ret; }
ret = elem.value;
// Handle most common string cases if (typeof ret === "string") { return ret.replace(rreturn, ""); }
// Handle cases where value is null/undef or number return ret == null ? "" : ret; }
return; }
isFunction = jQuery.isFunction(value);
return this.each(function (i) { var val;
if (this.nodeType !== 1) { return; }
if (isFunction) { val = value.call(this, i, jQuery(this).val()); } else { val = value; }
// Treat null/undefined as ""; convert numbers to string if (val == null) { val = "";
} else if (typeof val === "number") { val += "";
} else if (Array.isArray(val)) { val = jQuery.map(val, function (value) { return value == null ? "" : value + ""; }); }
hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()];
// If set returns undefined, fall back to normal setting if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) { this.value = val; } }); } });
jQuery.extend({ valHooks: { option: { get: function (elem) {
var val = jQuery.find.attr(elem, "value"); return val != null ? val :
// Support: IE <=10 - 11 only // option.text throws exceptions (#14686, #14858) // Strip and collapse whitespace // https://html.spec.whatwg.org/#strip-and-collapse-whitespace stripAndCollapse(jQuery.text(elem)); } }, select: { get: function (elem) { var value, option, i, options = elem.options, index = elem.selectedIndex, one = elem.type === "select-one", values = one ? null : [], max = one ? index + 1 : options.length;
if (index < 0) { i = max;
} else { i = one ? index : 0; }
// Loop through all the selected options for (; i < max; i++) { option = options[i];
// Support: IE <=9 only // IE8-9 doesn't update selected after form reset (#2551) if ((option.selected || i === index) &&
// Don't return options that are disabled or in a disabled optgroup !option.disabled && (!option.parentNode.disabled || !nodeName(option.parentNode, "optgroup"))) {
// Get the specific value for the option value = jQuery(option).val();
// We don't need an array for one selects if (one) { return value; }
// Multi-Selects return an array values.push(value); } }
return values; },
set: function (elem, value) { var optionSet, option, options = elem.options, values = jQuery.makeArray(value), i = options.length;
while (i--) { option = options[i];
/* eslint-disable no-cond-assign */
if (option.selected = jQuery.inArray(jQuery.valHooks.option.get(option), values) > -1 ) { optionSet = true; }
/* eslint-enable no-cond-assign */ }
// Force browsers to behave consistently when non-matching value is set if (!optionSet) { elem.selectedIndex = -1; } return values; } } } });
// Radios and checkboxes getter/setter jQuery.each(["radio", "checkbox"], function () { jQuery.valHooks[this] = { set: function (elem, value) { if (Array.isArray(value)) { return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) > -1); } } }; if (!support.checkOn) { jQuery.valHooks[this].get = function (elem) { return elem.getAttribute("value") === null ? "on" : elem.value; }; } });
// Return jQuery for attributes-only inclusion
var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/;
jQuery.extend(jQuery.event, {
trigger: function (event, data, elem, onlyHandlers) {
var i, cur, tmp, bubbleType, ontype, handle, special, eventPath = [elem || document], type = hasOwn.call(event, "type") ? event.type : event, namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
cur = tmp = elem = elem || document;
// Don't do events on text and comment nodes if (elem.nodeType === 3 || elem.nodeType === 8) { return; }
// focus/blur morphs to focusin/out; ensure we're not firing them right now if (rfocusMorph.test(type + jQuery.event.triggered)) { return; }
if (type.indexOf(".") > -1) {
// Namespaced trigger; create a regexp to match event type in handle() namespaces = type.split("."); type = namespaces.shift(); namespaces.sort(); } ontype = type.indexOf(":") < 0 && "on" + type;
// Caller can pass in a jQuery.Event object, Object, or just an event type string event = event[jQuery.expando] ? event : new jQuery.Event(type, typeof event === "object" && event);
// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) event.isTrigger = onlyHandlers ? 2 : 3; event.namespace = namespaces.join("."); event.rnamespace = event.namespace ? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
// Clean up the event in case it is being reused event.result = undefined; if (!event.target) { event.target = elem; }
// Clone any incoming data and prepend the event, creating the handler arg list data = data == null ? [event] : jQuery.makeArray(data, [event]);
// Allow special events to draw outside the lines special = jQuery.event.special[type] || {}; if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) { return; }
// Determine event propagation path in advance, per W3C events spec (#9951) // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) if (!onlyHandlers && !special.noBubble && !jQuery.isWindow(elem)) {
bubbleType = special.delegateType || type; if (!rfocusMorph.test(bubbleType + type)) { cur = cur.parentNode; } for (; cur; cur = cur.parentNode) { eventPath.push(cur); tmp = cur; }
// Only add window if we got to document (e.g., not plain obj or detached DOM) if (tmp === (elem.ownerDocument || document)) { eventPath.push(tmp.defaultView || tmp.parentWindow || window); } }
// Fire handlers on the event path i = 0; while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
event.type = i > 1 ? bubbleType : special.bindType || type;
// jQuery handler handle = (dataPriv.get(cur, "events") || {})[event.type] && dataPriv.get(cur, "handle"); if (handle) { handle.apply(cur, data); }
// Native handler handle = ontype && cur[ontype]; if (handle && handle.apply && acceptData(cur)) { event.result = handle.apply(cur, data); if (event.result === false) { event.preventDefault(); } } } event.type = type;
// If nobody prevented the default action, do it now if (!onlyHandlers && !event.isDefaultPrevented()) {
if ((!special._default || special._default.apply(eventPath.pop(), data) === false) && acceptData(elem)) {
// Call a native DOM method on the target with the same name as the event. // Don't do default actions on window, that's where global variables be (#6170) if (ontype && jQuery.isFunction(elem[type]) && !jQuery.isWindow(elem)) {
// Don't re-trigger an onFOO event when we call its FOO() method tmp = elem[ontype];
if (tmp) { elem[ontype] = null; }
// Prevent re-triggering of the same event, since we already bubbled it above jQuery.event.triggered = type; elem[type](); jQuery.event.triggered = undefined;
if (tmp) { elem[ontype] = tmp; } } } }
return event.result; },
// Piggyback on a donor event to simulate a different one // Used only for `focus(in | out)` events simulate: function (type, elem, event) { var e = jQuery.extend( new jQuery.Event(), event, { type: type, isSimulated: true } );
jQuery.event.trigger(e, null, elem); }
});
jQuery.fn.extend({
trigger: function (type, data) { return this.each(function () { jQuery.event.trigger(type, data, this); }); }, triggerHandler: function (type, data) { var elem = this[0]; if (elem) { return jQuery.event.trigger(type, data, elem, true); } } });
jQuery.each(("blur focus focusin focusout resize scroll click dblclick " + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + "change select submit keydown keypress keyup contextmenu").split(" "), function (i, name) {
// Handle event binding jQuery.fn[name] = function (data, fn) { return arguments.length > 0 ? this.on(name, null, data, fn) : this.trigger(name); }; });
jQuery.fn.extend({ hover: function (fnOver, fnOut) { return this.mouseenter(fnOver).mouseleave(fnOut || fnOver); } });
support.focusin = "onfocusin" in window;
// Support: Firefox <=44 // Firefox doesn't have focus(in | out) events // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 // // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 // focus(in | out) events fire after focus & blur events, // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 if (!support.focusin) { jQuery.each({ focus: "focusin", blur: "focusout" }, function (orig, fix) {
// Attach a single capturing handler on the document while someone wants focusin/focusout var handler = function (event) { jQuery.event.simulate(fix, event.target, jQuery.event.fix(event)); };
jQuery.event.special[fix] = { setup: function () { var doc = this.ownerDocument || this, attaches = dataPriv.access(doc, fix);
if (!attaches) { doc.addEventListener(orig, handler, true); } dataPriv.access(doc, fix, (attaches || 0) + 1); }, teardown: function () { var doc = this.ownerDocument || this, attaches = dataPriv.access(doc, fix) - 1;
if (!attaches) { doc.removeEventListener(orig, handler, true); dataPriv.remove(doc, fix);
} else { dataPriv.access(doc, fix, attaches); } } }; }); } var location = window.location;
var nonce = jQuery.now();
var rquery = (/\?/);
// Cross-browser xml parsing jQuery.parseXML = function (data) { var xml; if (!data || typeof data !== "string") { return null; }
// Support: IE 9 - 11 only // IE throws on parseFromString with invalid input. try { xml = (new window.DOMParser()).parseFromString(data, "text/xml"); } catch (e) { xml = undefined; }
if (!xml || xml.getElementsByTagName("parsererror").length) { jQuery.error("Invalid XML: " + data); } return xml; };
var rbracket = /\[\]$/, rCRLF = /\r?\n/g, rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, rsubmittable = /^(?:input|select|textarea|keygen)/i;
function buildParams(prefix, obj, traditional, add) { var name;
if (Array.isArray(obj)) {
// Serialize array item. jQuery.each(obj, function (i, v) { if (traditional || rbracket.test(prefix)) {
// Treat each array item as a scalar. add(prefix, v);
} else {
// Item is non-scalar (array or object), encode its numeric index. buildParams( prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]", v, traditional, add ); } });
} else if (!traditional && jQuery.type(obj) === "object") {
// Serialize object item. for (name in obj) { buildParams(prefix + "[" + name + "]", obj[name], traditional, add); }
} else {
// Serialize scalar item. add(prefix, obj); } }
// Serialize an array of form elements or a set of // key/values into a query string jQuery.param = function (a, traditional) { var prefix, s = [], add = function (key, valueOrFunction) {
// If value is a function, invoke it and use its return value var value = jQuery.isFunction(valueOrFunction) ? valueOrFunction() : valueOrFunction;
s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value == null ? "" : value); };
// If an array was passed in, assume that it is an array of form elements. if (Array.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) {
// Serialize the form elements jQuery.each(a, function () { add(this.name, this.value); });
} else {
// If traditional, encode the "old" way (the way 1.3.2 or older // did it), otherwise encode params recursively. for (prefix in a) { buildParams(prefix, a[prefix], traditional, add); } }
// Return the resulting serialization return s.join("&"); };
jQuery.fn.extend({ serialize: function () { return jQuery.param(this.serializeArray()); }, serializeArray: function () { return this.map(function () {
// Can add propHook for "elements" to filter or add form elements var elements = jQuery.prop(this, "elements"); return elements ? jQuery.makeArray(elements) : this; }) .filter(function () { var type = this.type;
// Use .is( ":disabled" ) so that fieldset[disabled] works return this.name && !jQuery(this).is(":disabled") && rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) && (this.checked || !rcheckableType.test(type)); }) .map(function (i, elem) { var val = jQuery(this).val();
if (val == null) { return null; }
if (Array.isArray(val)) { return jQuery.map(val, function (val) { return { name: elem.name, value: val.replace(rCRLF, "\r\n") }; }); }
return { name: elem.name, value: val.replace(rCRLF, "\r\n") }; }).get(); } });
var r20 = /%20/g, rhash = /#.*$/, rantiCache = /([?&])_=[^&]*/, rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
// #7653, #8125, #8152: local protocol detection rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//,
/* Prefilters * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) * 2) These are called: * - BEFORE asking for a transport * - AFTER param serialization (s.data is a string if s.processData is true) * 3) key is the dataType * 4) the catchall symbol "*" can be used * 5) execution will start with transport dataType and THEN continue down to "*" if needed */ prefilters = {},
/* Transports bindings * 1) key is the dataType * 2) the catchall symbol "*" can be used * 3) selection will start with transport dataType and THEN go to "*" if needed */ transports = {},
// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression allTypes = "*/".concat("*"),
// Anchor tag for parsing the document origin originAnchor = document.createElement("a"); originAnchor.href = location.href;
// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport function addToPrefiltersOrTransports(structure) {
// dataTypeExpression is optional and defaults to "*" return function (dataTypeExpression, func) {
if (typeof dataTypeExpression !== "string") { func = dataTypeExpression; dataTypeExpression = "*"; }
var dataType, i = 0, dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || [];
if (jQuery.isFunction(func)) {
// For each dataType in the dataTypeExpression while ((dataType = dataTypes[i++])) {
// Prepend if requested if (dataType[0] === "+") { dataType = dataType.slice(1) || "*"; (structure[dataType] = structure[dataType] || []).unshift(func);
// Otherwise append } else { (structure[dataType] = structure[dataType] || []).push(func); } } } }; }
// Base inspection function for prefilters and transports function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
var inspected = {}, seekingTransport = (structure === transports);
function inspect(dataType) { var selected; inspected[dataType] = true; jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) { var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR); if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
options.dataTypes.unshift(dataTypeOrTransport); inspect(dataTypeOrTransport); return false; } else if (seekingTransport) { return !(selected = dataTypeOrTransport); } }); return selected; }
return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*"); }
// A special extend for ajax options // that takes "flat" options (not to be deep extended) // Fixes #9887 function ajaxExtend(target, src) { var key, deep, flatOptions = jQuery.ajaxSettings.flatOptions || {};
for (key in src) { if (src[key] !== undefined) { (flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key]; } } if (deep) { jQuery.extend(true, target, deep); }
return target; }
/* Handles responses to an ajax request: * - finds the right dataType (mediates between content-type and expected dataType) * - returns the corresponding response */ function ajaxHandleResponses(s, jqXHR, responses) {
var ct, type, finalDataType, firstDataType, contents = s.contents, dataTypes = s.dataTypes;
// Remove auto dataType and get content-type in the process while (dataTypes[0] === "*") { dataTypes.shift(); if (ct === undefined) { ct = s.mimeType || jqXHR.getResponseHeader("Content-Type"); } }
// Check if we're dealing with a known content-type if (ct) { for (type in contents) { if (contents[type] && contents[type].test(ct)) { dataTypes.unshift(type); break; } } }
// Check to see if we have a response for the expected dataType if (dataTypes[0] in responses) { finalDataType = dataTypes[0]; } else {
// Try convertible dataTypes for (type in responses) { if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) { finalDataType = type; break; } if (!firstDataType) { firstDataType = type; } }
// Or just use first one finalDataType = finalDataType || firstDataType; }
// If we found a dataType // We add the dataType to the list if needed // and return the corresponding response if (finalDataType) { if (finalDataType !== dataTypes[0]) { dataTypes.unshift(finalDataType); } return responses[finalDataType]; } }
/* Chain conversions given the request and the original response * Also sets the responseXXX fields on the jqXHR instance */ function ajaxConvert(s, response, jqXHR, isSuccess) { var conv2, current, conv, tmp, prev, converters = {},
// Work with a copy of dataTypes in case we need to modify it for conversion dataTypes = s.dataTypes.slice();
// Create converters map with lowercased keys if (dataTypes[1]) { for (conv in s.converters) { converters[conv.toLowerCase()] = s.converters[conv]; } }
current = dataTypes.shift();
// Convert to each sequential dataType while (current) {
if (s.responseFields[current]) { jqXHR[s.responseFields[current]] = response; }
// Apply the dataFilter if provided if (!prev && isSuccess && s.dataFilter) { response = s.dataFilter(response, s.dataType); }
prev = current; current = dataTypes.shift();
if (current) {
// There's only work to do if current dataType is non-auto if (current === "*") {
current = prev;
// Convert response if prev dataType is non-auto and differs from current } else if (prev !== "*" && prev !== current) {
// Seek a direct converter conv = converters[prev + " " + current] || converters["* " + current];
// If none found, seek a pair if (!conv) { for (conv2 in converters) {
// If conv2 outputs current tmp = conv2.split(" "); if (tmp[1] === current) {
// If prev can be converted to accepted input conv = converters[prev + " " + tmp[0]] || converters["* " + tmp[0]]; if (conv) {
// Condense equivalence converters if (conv === true) { conv = converters[conv2];
// Otherwise, insert the intermediate dataType } else if (converters[conv2] !== true) { current = tmp[0]; dataTypes.unshift(tmp[1]); } break; } } } }
// Apply converter (if not an equivalence) if (conv !== true) {
// Unless errors are allowed to bubble, catch and return them if (conv && s.throws) { response = conv(response); } else { try { response = conv(response); } catch (e) { return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; } } } } } }
return { state: "success", data: response }; }
jQuery.extend({
// Counter for holding the number of active queries active: 0,
// Last-Modified header cache for next request lastModified: {}, etag: {},
ajaxSettings: { url: location.href, type: "GET", isLocal: rlocalProtocol.test(location.protocol), global: true, processData: true, async: true, contentType: "application/x-www-form-urlencoded; charset=UTF-8",
/* timeout: 0, data: null, dataType: null, username: null, password: null, cache: null, throws: false, traditional: false, headers: {}, */
accepts: { "*": allTypes, text: "text/plain", html: "text/html", xml: "application/xml, text/xml", json: "application/json, text/javascript" },
contents: { xml: /\bxml\b/, html: /\bhtml/, json: /\bjson\b/ },
responseFields: { xml: "responseXML", text: "responseText", json: "responseJSON" },
// Data converters // Keys separate source (or catchall "*") and destination types with a single space converters: {
// Convert anything to text "* text": String,
// Text to html (true = no transformation) "text html": true,
// Evaluate text as a json expression "text json": JSON.parse,
// Parse text as xml "text xml": jQuery.parseXML },
// For options that shouldn't be deep extended: // you can add your own custom options here if // and when you create one that shouldn't be // deep extended (see ajaxExtend) flatOptions: { url: true, context: true } },
// Creates a full fledged settings object into target // with both ajaxSettings and settings fields. // If target is omitted, writes into ajaxSettings. ajaxSetup: function (target, settings) { return settings ?
// Building a settings object ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :
// Extending ajaxSettings ajaxExtend(jQuery.ajaxSettings, target); },
ajaxPrefilter: addToPrefiltersOrTransports(prefilters), ajaxTransport: addToPrefiltersOrTransports(transports),
// Main method ajax: function (url, options) {
// If url is an object, simulate pre-1.5 signature if (typeof url === "object") { options = url; url = undefined; }
// Force options to be an object options = options || {};
var transport,
// URL without anti-cache param cacheURL,
// Response headers responseHeadersString, responseHeaders,
// timeout handle timeoutTimer,
// Url cleanup var urlAnchor,
// Request state (becomes false upon send and true upon completion) completed,
// To know if global events are to be dispatched fireGlobals,
// Loop variable i,
// uncached part of the url uncached,
// Create the final options object s = jQuery.ajaxSetup({}, options),
// Callbacks context callbackContext = s.context || s,
// Context for global events is callbackContext if it is a DOM node or jQuery collection globalEventContext = s.context && (callbackContext.nodeType || callbackContext.jquery) ? jQuery(callbackContext) : jQuery.event,
// Deferreds deferred = jQuery.Deferred(), completeDeferred = jQuery.Callbacks("once memory"),
// Status-dependent callbacks statusCode = s.statusCode || {},
// Headers (they are sent all at once) requestHeaders = {}, requestHeadersNames = {},
// Default abort message strAbort = "canceled",
// Fake xhr jqXHR = { readyState: 0,
// Builds headers hashtable if needed getResponseHeader: function (key) { var match; if (completed) { if (!responseHeaders) { responseHeaders = {}; while ((match = rheaders.exec(responseHeadersString))) { responseHeaders[match[1].toLowerCase()] = match[2]; } } match = responseHeaders[key.toLowerCase()]; } return match == null ? null : match; },
// Raw string getAllResponseHeaders: function () { return completed ? responseHeadersString : null; },
// Caches the header setRequestHeader: function (name, value) { if (completed == null) { name = requestHeadersNames[name.toLowerCase()] = requestHeadersNames[name.toLowerCase()] || name; requestHeaders[name] = value; } return this; },
// Overrides response content-type header overrideMimeType: function (type) { if (completed == null) { s.mimeType = type; } return this; },
// Status-dependent callbacks statusCode: function (map) { var code; if (map) { if (completed) {
// Execute the appropriate callbacks jqXHR.always(map[jqXHR.status]); } else {
// Lazy-add the new callbacks in a way that preserves old ones for (code in map) { statusCode[code] = [statusCode[code], map[code]]; } } } return this; },
// Cancel the request abort: function (statusText) { var finalText = statusText || strAbort; if (transport) { transport.abort(finalText); } done(0, finalText); return this; } };
// Attach deferreds deferred.promise(jqXHR);
// Add protocol if not provided (prefilters might expect it) // Handle falsy url in the settings object (#10093: consistency with old signature) // We also use the url parameter if available s.url = ((url || s.url || location.href) + "") .replace(rprotocol, location.protocol + "//");
// Alias method option to type as per ticket #12004 s.type = options.method || options.type || s.method || s.type;
// Extract dataTypes list s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""];
// A cross-domain request is in order when the origin doesn't match the current origin. if (s.crossDomain == null) { urlAnchor = document.createElement("a");
// Support: IE <=8 - 11, Edge 12 - 13 // IE throws exception on accessing the href property if url is malformed, // e.g. http://example.com:80x/ try { urlAnchor.href = s.url;
// Support: IE <=8 - 11 only // Anchor's host property isn't correctly set when s.url is relative urlAnchor.href = urlAnchor.href; s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== urlAnchor.protocol + "//" + urlAnchor.host; } catch (e) {
// If there is an error parsing the URL, assume it is crossDomain, // it can be rejected by the transport if it is invalid s.crossDomain = true; } }
// Convert data if not already a string if (s.data && s.processData && typeof s.data !== "string") { s.data = jQuery.param(s.data, s.traditional); }
// Apply prefilters inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
// If request was aborted inside a prefilter, stop there if (completed) { return jqXHR; }
// We can fire global events as of now if asked to // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) fireGlobals = jQuery.event && s.global;
// Watch for a new set of requests if (fireGlobals && jQuery.active++ === 0) { jQuery.event.trigger("ajaxStart"); }
// Uppercase the type s.type = s.type.toUpperCase();
// Determine if request has content s.hasContent = !rnoContent.test(s.type);
// Save the URL in case we're toying with the If-Modified-Since // and/or If-None-Match header later on // Remove hash to simplify url manipulation cacheURL = s.url.replace(rhash, "");
// More options handling for requests with no content if (!s.hasContent) {
// Remember the hash so we can put it back uncached = s.url.slice(cacheURL.length);
// If data is available, append data to url if (s.data) { cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data;
// #9682: remove data so that it's not used in an eventual retry delete s.data; }
// Add or update anti-cache param if needed if (s.cache === false) { cacheURL = cacheURL.replace(rantiCache, "$1"); uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + (nonce++) + uncached; }
// Put hash and anti-cache on the URL that will be requested (gh-1732) s.url = cacheURL + uncached;
// Change '%20' to '+' if this is encoded form body content (gh-2658) } else if (s.data && s.processData && (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) { s.data = s.data.replace(r20, "+"); }
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. if (s.ifModified) { if (jQuery.lastModified[cacheURL]) { jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]); } if (jQuery.etag[cacheURL]) { jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]); } }
// Set the correct header, if data is being sent if (s.data && s.hasContent && s.contentType !== false || options.contentType) { jqXHR.setRequestHeader("Content-Type", s.contentType); }
// Set the Accepts header for the server, depending on the dataType jqXHR.setRequestHeader( "Accept", s.dataTypes[0] && s.accepts[s.dataTypes[0]] ? s.accepts[s.dataTypes[0]] + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") : s.accepts["*"] );
// Check for headers option for (i in s.headers) { jqXHR.setRequestHeader(i, s.headers[i]); }
// Allow custom headers/mimetypes and early abort if (s.beforeSend && (s.beforeSend.call(callbackContext, jqXHR, s) === false || completed)) {
// Abort if not done already and return return jqXHR.abort(); }
// Aborting is no longer a cancellation strAbort = "abort";
// Install callbacks on deferreds completeDeferred.add(s.complete); jqXHR.done(s.success); jqXHR.fail(s.error);
// Get transport transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
// If no transport, we auto-abort if (!transport) { done(-1, "No Transport"); } else { jqXHR.readyState = 1;
// Send global event if (fireGlobals) { globalEventContext.trigger("ajaxSend", [jqXHR, s]); }
// If request was aborted inside ajaxSend, stop there if (completed) { return jqXHR; }
// Timeout if (s.async && s.timeout > 0) { timeoutTimer = window.setTimeout(function () { jqXHR.abort("timeout"); }, s.timeout); }
try { completed = false; transport.send(requestHeaders, done); } catch (e) {
// Rethrow post-completion exceptions if (completed) { throw e; }
// Propagate others as results done(-1, e); } }
// Callback for when everything is done function done(status, nativeStatusText, responses, headers) { var isSuccess, success, error, response, modified, statusText = nativeStatusText;
// Ignore repeat invocations if (completed) { return; }
completed = true;
// Clear timeout if it exists if (timeoutTimer) { window.clearTimeout(timeoutTimer); }
// Dereference transport for early garbage collection // (no matter how long the jqXHR object will be used) transport = undefined;
// Cache response headers responseHeadersString = headers || "";
// Set readyState jqXHR.readyState = status > 0 ? 4 : 0;
// Determine if successful isSuccess = status >= 200 && status < 300 || status === 304;
// Get response data if (responses) { response = ajaxHandleResponses(s, jqXHR, responses); }
// Convert no matter what (that way responseXXX fields are always set) response = ajaxConvert(s, response, jqXHR, isSuccess);
// If successful, handle type chaining if (isSuccess) {
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. if (s.ifModified) { modified = jqXHR.getResponseHeader("Last-Modified"); if (modified) { jQuery.lastModified[cacheURL] = modified; } modified = jqXHR.getResponseHeader("etag"); if (modified) { jQuery.etag[cacheURL] = modified; } }
// if no content if (status === 204 || s.type === "HEAD") { statusText = "nocontent";
// if not modified } else if (status === 304) { statusText = "notmodified";
// If we have data, let's convert it } else { statusText = response.state; success = response.data; error = response.error; isSuccess = !error; } } else {
// Extract error from statusText and normalize for non-aborts error = statusText; if (status || !statusText) { statusText = "error"; if (status < 0) { status = 0; } } }
// Set data for the fake xhr object jqXHR.status = status; jqXHR.statusText = (nativeStatusText || statusText) + "";
// Success/Error if (isSuccess) { deferred.resolveWith(callbackContext, [success, statusText, jqXHR]); } else { deferred.rejectWith(callbackContext, [jqXHR, statusText, error]); }
// Status-dependent callbacks jqXHR.statusCode(statusCode); statusCode = undefined;
if (fireGlobals) { globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", [jqXHR, s, isSuccess ? success : error]); }
// Complete completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
if (fireGlobals) { globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
// Handle the global AJAX counter if (!(--jQuery.active)) { jQuery.event.trigger("ajaxStop"); } } }
return jqXHR; },
getJSON: function (url, data, callback) { return jQuery.get(url, data, callback, "json"); },
getScript: function (url, callback) { return jQuery.get(url, undefined, callback, "script"); } });
jQuery.each(["get", "post"], function (i, method) { jQuery[method] = function (url, data, callback, type) {
// Shift arguments if data argument was omitted if (jQuery.isFunction(data)) { type = type || callback; callback = data; data = undefined; }
// The url can be an options object (which then must have .url) return jQuery.ajax(jQuery.extend({ url: url, type: method, dataType: type, data: data, success: callback }, jQuery.isPlainObject(url) && url)); }; });
jQuery._evalUrl = function (url) { return jQuery.ajax({ url: url,
// Make this explicit, since user can override this through ajaxSetup (#11264) type: "GET", dataType: "script", cache: true, async: false, global: false, "throws": true }); };
jQuery.fn.extend({ wrapAll: function (html) { var wrap;
if (this[0]) { if (jQuery.isFunction(html)) { html = html.call(this[0]); }
// The elements to wrap the target around wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);
if (this[0].parentNode) { wrap.insertBefore(this[0]); }
wrap.map(function () { var elem = this;
while (elem.firstElementChild) { elem = elem.firstElementChild; }
return elem; }).append(this); }
return this; },
wrapInner: function (html) { if (jQuery.isFunction(html)) { return this.each(function (i) { jQuery(this).wrapInner(html.call(this, i)); }); }
return this.each(function () { var self = jQuery(this), contents = self.contents();
if (contents.length) { contents.wrapAll(html);
} else { self.append(html); } }); },
wrap: function (html) { var isFunction = jQuery.isFunction(html);
return this.each(function (i) { jQuery(this).wrapAll(isFunction ? html.call(this, i) : html); }); },
unwrap: function (selector) { this.parent(selector).not("body").each(function () { jQuery(this).replaceWith(this.childNodes); }); return this; } });
jQuery.expr.pseudos.hidden = function (elem) { return !jQuery.expr.pseudos.visible(elem); }; jQuery.expr.pseudos.visible = function (elem) { return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length); };
jQuery.ajaxSettings.xhr = function () { try { return new window.XMLHttpRequest(); } catch (e) {} };
var xhrSuccessStatus = {
// File protocol always yields status code 0, assume 200 0: 200,
// Support: IE <=9 only // #1450: sometimes IE returns 1223 when it should be 204 1223: 204 }, xhrSupported = jQuery.ajaxSettings.xhr();
support.cors = !!xhrSupported && ("withCredentials" in xhrSupported); support.ajax = xhrSupported = !!xhrSupported;
jQuery.ajaxTransport(function (options) { var callback, errorCallback;
// Cross domain only allowed if supported through XMLHttpRequest if (support.cors || xhrSupported && !options.crossDomain) { return { send: function (headers, complete) { var i, xhr = options.xhr();
xhr.open( options.type, options.url, options.async, options.username, options.password );
// Apply custom fields if provided if (options.xhrFields) { for (i in options.xhrFields) { xhr[i] = options.xhrFields[i]; } }
// Override mime type if needed if (options.mimeType && xhr.overrideMimeType) { xhr.overrideMimeType(options.mimeType); }
// X-Requested-With header // For cross-domain requests, seeing as conditions for a preflight are // akin to a jigsaw puzzle, we simply never set it to be sure. // (it can always be set on a per-request basis or even using ajaxSetup) // For same-domain requests, won't change header if already provided. if (!options.crossDomain && !headers["X-Requested-With"]) { headers["X-Requested-With"] = "XMLHttpRequest"; }
// Set headers for (i in headers) { xhr.setRequestHeader(i, headers[i]); }
// Callback callback = function (type) { return function () { if (callback) { callback = errorCallback = xhr.onload = xhr.onerror = xhr.onabort = xhr.onreadystatechange = null;
if (type === "abort") { xhr.abort(); } else if (type === "error") {
// Support: IE <=9 only // On a manual native abort, IE9 throws // errors on any property access that is not readyState if (typeof xhr.status !== "number") { complete(0, "error"); } else { complete(
// File: protocol always yields status 0; see #8605, #14207 xhr.status, xhr.statusText ); } } else { complete( xhrSuccessStatus[xhr.status] || xhr.status, xhr.statusText,
// Support: IE <=9 only // IE9 has no XHR2 but throws on binary (trac-11426) // For XHR2 non-text, let the caller handle it (gh-2498) (xhr.responseType || "text") !== "text" || typeof xhr.responseText !== "string" ? { binary: xhr.response } : { text: xhr.responseText }, xhr.getAllResponseHeaders() ); } } }; };
// Listen to events xhr.onload = callback(); errorCallback = xhr.onerror = callback("error");
// Support: IE 9 only // Use onreadystatechange to replace onabort // to handle uncaught aborts if (xhr.onabort !== undefined) { xhr.onabort = errorCallback; } else { xhr.onreadystatechange = function () {
// Check readyState before timeout as it changes if (xhr.readyState === 4) {
// Allow onerror to be called first, // but that will not handle a native abort // Also, save errorCallback to a variable // as xhr.onerror cannot be accessed window.setTimeout(function () { if (callback) { errorCallback(); } }); } }; }
// Create the abort callback callback = callback("abort");
try {
// Do send the request (this may raise an exception) xhr.send(options.hasContent && options.data || null); } catch (e) {
// #14683: Only rethrow if this hasn't been notified as an error yet if (callback) { throw e; } } },
abort: function () { if (callback) { callback(); } } }; } });
// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) jQuery.ajaxPrefilter(function (s) { if (s.crossDomain) { s.contents.script = false; } });
// Install script dataType jQuery.ajaxSetup({ accepts: { script: "text/javascript, application/javascript, " + "application/ecmascript, application/x-ecmascript" }, contents: { script: /\b(?:java|ecma)script\b/ }, converters: { "text script": function (text) { jQuery.globalEval(text); return text; } } });
// Handle cache's special case and crossDomain jQuery.ajaxPrefilter("script", function (s) { if (s.cache === undefined) { s.cache = false; } if (s.crossDomain) { s.type = "GET"; } });
// Bind script tag hack transport jQuery.ajaxTransport("script", function (s) {
// This transport only deals with cross domain requests if (s.crossDomain) { var script, callback; return { send: function (_, complete) { script = jQuery("<script>").prop({ charset: s.scriptCharset, src: s.url }).on( "load error", callback = function (evt) { script.remove(); callback = null; if (evt) { complete(evt.type === "error" ? 404 : 200, evt.type); } } );
// Use native DOM manipulation to avoid our domManip AJAX trickery document.head.appendChild(script[0]); }, abort: function () { if (callback) { callback(); } } }; } });
var oldCallbacks = [], rjsonp = /(=)\?(?=&|$)|\?\?/;
// Default jsonp settings jQuery.ajaxSetup({ jsonp: "callback", jsonpCallback: function () { var callback = oldCallbacks.pop() || (jQuery.expando + "_" + (nonce++)); this[callback] = true; return callback; } });
// Detect, normalize options and install callbacks for jsonp requests jQuery.ajaxPrefilter("json jsonp", function (s, originalSettings, jqXHR) {
var callbackName, overwritten, responseContainer, jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ? "url" : typeof s.data === "string" && (s.contentType || "") .indexOf("application/x-www-form-urlencoded") === 0 && rjsonp.test(s.data) && "data" );
// Handle iff the expected data type is "jsonp" or we have a parameter to set if (jsonProp || s.dataTypes[0] === "jsonp") {
// Get callback name, remembering preexisting value associated with it callbackName = s.jsonpCallback = jQuery.isFunction(s.jsonpCallback) ? s.jsonpCallback() : s.jsonpCallback;
// Insert callback into url or form data if (jsonProp) { s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName); } else if (s.jsonp !== false) { s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName; }
// Use data converter to retrieve json after script execution s.converters["script json"] = function () { if (!responseContainer) { jQuery.error(callbackName + " was not called"); } return responseContainer[0]; };
// Force json dataType s.dataTypes[0] = "json";
// Install callback overwritten = window[callbackName]; window[callbackName] = function () { responseContainer = arguments; };
// Clean-up function (fires after converters) jqXHR.always(function () {
// If previous value didn't exist - remove it if (overwritten === undefined) { jQuery(window).removeProp(callbackName);
// Otherwise restore preexisting value } else { window[callbackName] = overwritten; }
// Save back as free if (s[callbackName]) {
// Make sure that re-using the options doesn't screw things around s.jsonpCallback = originalSettings.jsonpCallback;
// Save the callback name for future use oldCallbacks.push(callbackName); }
// Call if it was a function and we have a response if (responseContainer && jQuery.isFunction(overwritten)) { overwritten(responseContainer[0]); }
responseContainer = overwritten = undefined; });
// Delegate to script return "script"; } });
// Support: Safari 8 only // In Safari 8 documents created via document.implementation.createHTMLDocument // collapse sibling forms: the second one becomes a child of the first one. // Because of that, this security measure has to be disabled in Safari 8. // https://bugs.webkit.org/show_bug.cgi?id=137337 support.createHTMLDocument = (function () { var body = document.implementation.createHTMLDocument("").body; body.innerHTML = "<form></form><form></form>"; return body.childNodes.length === 2; })();
// Argument "data" should be string of html // context (optional): If specified, the fragment will be created in this context, // defaults to document // keepScripts (optional): If true, will include scripts passed in the html string jQuery.parseHTML = function (data, context, keepScripts) { if (typeof data !== "string") { return []; } if (typeof context === "boolean") { keepScripts = context; context = false; }
var base, parsed, scripts;
if (!context) {
// Stop scripts or inline event handlers from being executed immediately // by using document.implementation if (support.createHTMLDocument) { context = document.implementation.createHTMLDocument("");
// Set the base href for the created document // so any parsed elements with URLs // are based on the document's URL (gh-2965) base = context.createElement("base"); base.href = document.location.href; context.head.appendChild(base); } else { context = document; } }
parsed = rsingleTag.exec(data); scripts = !keepScripts && [];
// Single tag if (parsed) { return [context.createElement(parsed[1])]; }
parsed = buildFragment([data], context, scripts);
if (scripts && scripts.length) { jQuery(scripts).remove(); }
return jQuery.merge([], parsed.childNodes); };
/** * Load a url into a page */ jQuery.fn.load = function (url, params, callback) { var selector, type, response, self = this, off = url.indexOf(" ");
if (off > -1) { selector = stripAndCollapse(url.slice(off)); url = url.slice(0, off); }
// If it's a function if (jQuery.isFunction(params)) {
// We assume that it's the callback callback = params; params = undefined;
// Otherwise, build a param string } else if (params && typeof params === "object") { type = "POST"; }
// If we have elements to modify, make the request if (self.length > 0) { jQuery.ajax({ url: url,
// If "type" variable is undefined, then "GET" method will be used. // Make value of this field explicit since // user can override it through ajaxSetup method type: type || "GET", dataType: "html", data: params }).done(function (responseText) {
// Save response for use in complete callback response = arguments;
self.html(selector ?
// If a selector was specified, locate the right elements in a dummy div // Exclude scripts to avoid IE 'Permission Denied' errorsjQuery("
// Otherwise use the full result responseText);
// If the request succeeds, this function gets "data", "status", "jqXHR" // but they are ignored because response was set above. // If it fails, this function gets "jqXHR", "status", "error" }).always(callback && function (jqXHR, status) { self.each(function () { callback.apply(this, response || [jqXHR.responseText, status, jqXHR]); }); }); }
return this; };
// Attach a bunch of functions for handling common AJAX events jQuery.each([
"ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend" ], function (i, type) {
jQuery.fn[type] = function (fn) { return this.on(type, fn); }; });
jQuery.expr.pseudos.animated = function (elem) { return jQuery.grep(jQuery.timers, function (fn) { return elem === fn.elem; }).length; };
jQuery.offset = { setOffset: function (elem, options, i) { var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, position = jQuery.css(elem, "position"), curElem = jQuery(elem), props = {};
// Set position first, in-case top/left are set even on static elem if (position === "static") { elem.style.position = "relative"; }
curOffset = curElem.offset(); curCSSTop = jQuery.css(elem, "top"); curCSSLeft = jQuery.css(elem, "left"); calculatePosition = (position === "absolute" || position === "fixed") && (curCSSTop + curCSSLeft).indexOf("auto") > -1;
// Need to be able to calculate position if either // top or left is auto and position is either absolute or fixed if (calculatePosition) { curPosition = curElem.position(); curTop = curPosition.top; curLeft = curPosition.left;
} else { curTop = parseFloat(curCSSTop) || 0; curLeft = parseFloat(curCSSLeft) || 0; }
if (jQuery.isFunction(options)) {
// Use jQuery.extend here to allow modification of coordinates argument (gh-1848) options = options.call(elem, i, jQuery.extend({}, curOffset)); }
if (options.top != null) { props.top = (options.top - curOffset.top) + curTop; } if (options.left != null) { props.left = (options.left - curOffset.left) + curLeft; }
if ("using" in options) { options.using.call(elem, props);
} else { curElem.css(props); } } };
jQuery.fn.extend({ offset: function (options) {
// Preserve chaining for setter if (arguments.length) { return options === undefined ? this : this.each(function (i) { jQuery.offset.setOffset(this, options, i); }); }
var doc, docElem, rect, win, elem = this[0];
if (!elem) { return; }
// Return zeros for disconnected and hidden (display: none) elements (gh-2310) // Support: IE <=11 only // Running getBoundingClientRect on a // disconnected node in IE throws an error if (!elem.getClientRects().length) { return { top: 0, left: 0 }; }
rect = elem.getBoundingClientRect();
doc = elem.ownerDocument; docElem = doc.documentElement; win = doc.defaultView;
return { top: rect.top + win.pageYOffset - docElem.clientTop, left: rect.left + win.pageXOffset - docElem.clientLeft }; },
position: function () { if (!this[0]) { return; }
var offsetParent, offset, elem = this[0], parentOffset = { top: 0, left: 0 };
// Fixed elements are offset from window (parentOffset = {top:0, left: 0}, // because it is its only offset parent if (jQuery.css(elem, "position") === "fixed") {
// Assume getBoundingClientRect is there when computed position is fixed offset = elem.getBoundingClientRect();
} else {
// Get *real* offsetParent offsetParent = this.offsetParent();
// Get correct offsets offset = this.offset(); if (!nodeName(offsetParent[0], "html")) { parentOffset = offsetParent.offset(); }
// Add offsetParent borders parentOffset = { top: parentOffset.top + jQuery.css(offsetParent[0], "borderTopWidth", true), left: parentOffset.left + jQuery.css(offsetParent[0], "borderLeftWidth", true) }; }
// Subtract parent offsets and element margins return { top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true), left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true) }; },
// This method will return documentElement in the following cases: // 1) For the element inside the iframe without offsetParent, this method will return // documentElement of the parent window // 2) For the hidden or detached element // 3) For body or html element, i.e. in case of the html node - it will return itself // // but those exceptions were never presented as a real life use-cases // and might be considered as more preferable results. // // This logic, however, is not guaranteed and can change at any point in the future offsetParent: function () { return this.map(function () { var offsetParent = this.offsetParent;
while (offsetParent && jQuery.css(offsetParent, "position") === "static") { offsetParent = offsetParent.offsetParent; }
return offsetParent || documentElement; }); } });
// Create scrollLeft and scrollTop methods jQuery.each({ scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function (method, prop) { var top = "pageYOffset" === prop;
jQuery.fn[method] = function (val) { return access(this, function (elem, method, val) {
// Coalesce documents and windows var win; if (jQuery.isWindow(elem)) { win = elem; } else if (elem.nodeType === 9) { win = elem.defaultView; }
if (val === undefined) { return win ? win[prop] : elem[method]; }
if (win) { win.scrollTo(!top ? val : win.pageXOffset, top ? val : win.pageYOffset );
} else { elem[method] = val; } }, method, val, arguments.length); }; });
// Support: Safari <=7 - 9.1, Chrome <=37 - 49 // Add the top/left cssHooks using jQuery.fn.position // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 // Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347 // getComputedStyle returns percent when specified for top/left/bottom/right; // rather than make the css module depend on the offset module, just check for it here jQuery.each(["top", "left"], function (i, prop) { jQuery.cssHooks[prop] = addGetHookIf(support.pixelPosition, function (elem, computed) { if (computed) { computed = curCSS(elem, prop);
// If curCSS returns percentage, fallback to offset return rnumnonpx.test(computed) ? jQuery(elem).position()[prop] + "px" : computed; } } ); });
// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods jQuery.each({ Height: "height", Width: "width" }, function (name, type) { jQuery.each({ padding: "inner" + name, content: type, "": "outer" + name }, function (defaultExtra, funcName) {
// Margin is only for outerHeight, outerWidth jQuery.fn[funcName] = function (margin, value) { var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"), extra = defaultExtra || (margin === true || value === true ? "margin" : "border");
return access(this, function (elem, type, value) { var doc;
if (jQuery.isWindow(elem)) {
// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729) return funcName.indexOf("outer") === 0 ? elem["inner" + name] : elem.document.documentElement["client" + name]; }
// Get document width or height if (elem.nodeType === 9) { doc = elem.documentElement;
// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], // whichever is greatest return Math.max( elem.body["scroll" + name], doc["scroll" + name], elem.body["offset" + name], doc["offset" + name], doc["client" + name] ); }
return value === undefined ?
// Get width or height on the element, requesting but not forcing parseFloat jQuery.css(elem, type, extra) :
// Set width or height on the element jQuery.style(elem, type, value, extra); }, type, chainable ? margin : undefined, chainable); }; }); });
jQuery.fn.extend({
bind: function (types, data, fn) { return this.on(types, null, data, fn); }, unbind: function (types, fn) { return this.off(types, null, fn); },
delegate: function (selector, types, data, fn) { return this.on(types, selector, data, fn); }, undelegate: function (selector, types, fn) {
// ( namespace ) or ( selector, types [, fn] ) return arguments.length === 1 ? this.off(selector, "**") : this.off(types, selector || "**", fn); } });
jQuery.holdReady = function (hold) { if (hold) { jQuery.readyWait++; } else { jQuery.ready(true); } }; jQuery.isArray = Array.isArray; jQuery.parseJSON = JSON.parse; jQuery.nodeName = nodeName;
// Register as a named AMD module, since jQuery can be concatenated with other // files that may use define, but not via a proper concatenation script that // understands anonymous AMD modules. A named AMD is safest and most robust // way to register. Lowercase jquery is used because AMD module names are // derived from file names, and jQuery is normally delivered in a lowercase // file name. Do this after creating the global so that if an AMD module wants // to call noConflict to hide this version of jQuery, it will work.
// Note that for maximum portability, libraries that are not jQuery should // declare themselves as anonymous modules, and avoid setting a global if an // AMD loader is present. jQuery is a special case. For more information, see // https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
if (typeof define === "function" && define.amd) { define("jquery", [], function () { return jQuery; }); }
var
// Map over jQuery in case of overwrite _jQuery = window.jQuery,
// Map over the $ in case of overwrite _$ = window.$;
jQuery.noConflict = function (deep) { if (window.$ === jQuery) { window.$ = _$; }
if (deep && window.jQuery === jQuery) { window.jQuery = _jQuery; }
return jQuery; };
// Expose jQuery and $ identifiers, even in AMD // (#7102#comment:10, https://github.com/jquery/jquery/pull/557) // and CommonJS for browser emulators (#13566) if (!noGlobal) { window.jQuery = window.$ = jQuery; }
return jQuery;
});
/*!
* Materialize v0.99.0 (http://materializecss.com) * Copyright 2014-2017 Materialize * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) */
// Check for jQuery. if (typeof (jQuery) === 'undefined') {
var jQuery; // Check if require is a defined function. if (typeof (require) === 'function') { jQuery = $ = require('jquery'); // Else use the dollar sign alias. } else { jQuery = $; }
}; /*
* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/ * Open source under the BSD License. * Copyright © 2008 George McGinley Smith * All rights reserved. * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE */
(function (factory) {
if (typeof define === "function" && define.amd) { define(['jquery'], function ($) { return factory($); }); } else if (typeof module === "object" && typeof module.exports === "object") { exports = factory(require('jquery')); } else { factory(jQuery); }
})(function ($) {
// Preserve the original jQuery "swing" easing as "jswing" $.easing['jswing'] = $.easing['swing'];
var pow = Math.pow, sqrt = Math.sqrt, sin = Math.sin, cos = Math.cos, PI = Math.PI, c1 = 1.70158, c2 = c1 * 1.525, c3 = c1 + 1, c4 = (2 * PI) / 3, c5 = (2 * PI) / 4.5;
// x is the fraction of animation progress, in the range 0..1 function bounceOut(x) { var n1 = 7.5625, d1 = 2.75; if (x < 1 / d1) { return n1 * x * x; } else if (x < 2 / d1) { return n1 * (x -= (1.5 / d1)) * x + .75; } else if (x < 2.5 / d1) { return n1 * (x -= (2.25 / d1)) * x + .9375; } else { return n1 * (x -= (2.625 / d1)) * x + .984375; } }
$.extend($.easing, { def: 'easeOutQuad', swing: function (x) { return $.easing[$.easing.def](x); }, easeInQuad: function (x) { return x * x; }, easeOutQuad: function (x) { return 1 - (1 - x) * (1 - x); }, easeInOutQuad: function (x) { return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2; }, easeInCubic: function (x) { return x * x * x; }, easeOutCubic: function (x) { return 1 - pow(1 - x, 3); }, easeInOutCubic: function (x) { return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2; }, easeInQuart: function (x) { return x * x * x * x; }, easeOutQuart: function (x) { return 1 - pow(1 - x, 4); }, easeInOutQuart: function (x) { return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2; }, easeInQuint: function (x) { return x * x * x * x * x; }, easeOutQuint: function (x) { return 1 - pow(1 - x, 5); }, easeInOutQuint: function (x) { return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2; }, easeInSine: function (x) { return 1 - cos(x * PI / 2); }, easeOutSine: function (x) { return sin(x * PI / 2); }, easeInOutSine: function (x) { return -(cos(PI * x) - 1) / 2; }, easeInExpo: function (x) { return x === 0 ? 0 : pow(2, 10 * x - 10); }, easeOutExpo: function (x) { return x === 1 ? 1 : 1 - pow(2, -10 * x); }, easeInOutExpo: function (x) { return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2; }, easeInCirc: function (x) { return 1 - sqrt(1 - pow(x, 2)); }, easeOutCirc: function (x) { return sqrt(1 - pow(x - 1, 2)); }, easeInOutCirc: function (x) { return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2; }, easeInElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4); }, easeOutElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1; }, easeInOutElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1; }, easeInBack: function (x) { return c3 * x * x * x - c1 * x * x; }, easeOutBack: function (x) { return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2); }, easeInOutBack: function (x) { return x < 0.5 ? (pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2; }, easeInBounce: function (x) { return 1 - bounceOut(1 - x); }, easeOutBounce: bounceOut, easeInOutBounce: function (x) { return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2; } });
});; // Custom Easing jQuery.extend(jQuery.easing, {
easeInOutMaterial: function (x, t, b, c, d) { if ((t /= d / 2) < 1) return c / 2 * t * t + b; return c / 4 * ((t -= 2) * t * t + 2) + b; }
});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (! function (e) {
function t(e) { var t = e.length, a = r.type(e); return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e } if (!e.jQuery) { var r = function (e, t) { return new r.fn.init(e, t) }; r.isWindow = function (e) { return null != e && e == e.window }, r.type = function (e) { return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e }, r.isArray = Array.isArray || function (e) { return "array" === r.type(e) }, r.isPlainObject = function (e) { var t; if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1; try { if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1 } catch (a) { return !1 } for (t in e); return void 0 === t || o.call(e, t) }, r.each = function (e, r, a) { var n, o = 0, i = e.length, s = t(e); if (a) { if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++); else for (o in e) if (n = r.apply(e[o], a), n === !1) break } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++); else for (o in e) if (n = r.call(e[o], o, e[o]), n === !1) break; return e }, r.data = function (e, t, n) { if (void 0 === n) { var o = e[r.expando], i = o && a[o]; if (void 0 === t) return i; if (i && t in i) return i[t] } else if (void 0 !== t) { var o = e[r.expando] || (e[r.expando] = ++r.uuid); return a[o] = a[o] || {}, a[o][t] = n, n } }, r.removeData = function (e, t) { var n = e[r.expando], o = n && a[n]; o && r.each(t, function (e, t) { delete o[t] }) }, r.extend = function () { var e, t, a, n, o, i, s = arguments[0] || {}, l = 1, u = arguments.length, c = !1; for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) if (null != (o = arguments[l])) for (n in o) e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a)); return s }, r.queue = function (e, a, n) { function o(e, r) { var a = r || []; return null != e && (t(Object(e)) ? ! function (e, t) { for (var r = +t.length, a = 0, n = e.length; r > a;) e[n++] = t[a++]; if (r !== r) for (; void 0 !== t[a];) e[n++] = t[a++]; return e.length = n, e }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a } if (e) { a = (a || "fx") + "queue"; var i = r.data(e, a); return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [] } }, r.dequeue = function (e, t) { r.each(e.nodeType ? [e] : e, function (e, a) { t = t || "fx"; var n = r.queue(a, t), o = n.shift(); "inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () { r.dequeue(a, t) })) }) }, r.fn = r.prototype = { init: function (e) { if (e.nodeType) return this[0] = e, this; throw new Error("Not a DOM node.") }, offset: function () { var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 }; return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) } }, position: function () { function e() { for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) e = e.offsetParent; return e || document } var t = this[0], e = e.apply(t), a = this.offset(), n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset(); return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left } } }; var a = {}; r.expando = "velocity" + (new Date).getTime(), r.uuid = 0; for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) n["[object " + s[l] + "]"] = s[l].toLowerCase(); r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r } }
}(window), function (e) {
"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e()
}(function () {
return function (e, t, r, a) { function n(e) { for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) { var n = e[t]; n && a.push(n) } return a }
function o(e) { return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e }
function i(e) { var t = f.data(e, "velocity"); return null === t ? a : t }
function s(e) { return function (t) { return Math.round(t * e) * (1 / e) } }
function l(e, r, a, n) { function o(e, t) { return 1 - 3 * t + 3 * e }
function i(e, t) { return 3 * t - 6 * e }
function s(e) { return 3 * e }
function l(e, t, r) { return ((o(t, r) * e + i(t, r)) * e + s(t)) * e }
function u(e, t, r) { return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t) }
function c(t, r) { for (var n = 0; m > n; ++n) { var o = u(r, e, a); if (0 === o) return r; var i = l(r, e, a) - t; r -= i / o } return r }
function p() { for (var t = 0; b > t; ++t) w[t] = l(t * x, e, a) }
function f(t, r, n) { var o, i, s = 0; do i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; while (Math.abs(o) > h && ++s < v); return i }
function d(t) { for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) r += x; --n; var i = (t - w[n]) / (w[n + 1] - w[n]), s = r + i * x, l = u(s, e, a); return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x) }
function g() { V = !0, (e != r || a != n) && p() } var m = 4, y = .001, h = 1e-7, v = 10, b = 11, x = 1 / (b - 1), S = "Float32Array" in t; if (4 !== arguments.length) return !1; for (var P = 0; 4 > P; ++P) if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1; e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0); var w = S ? new Float32Array(b) : new Array(b), V = !1, C = function (t) { return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n) }; C.getControlPoints = function () { return [{ x: e, y: r }, { x: a, y: n }] }; var T = "generateBezier(" + [e, r, a, n] + ")"; return C.toString = function () { return T }, C }
function u(e, t) { var r = e; return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r }
function c(e) { if (e) { var t = (new Date).getTime(), r = b.State.calls.length; r > 1e4 && (b.State.calls = n(b.State.calls)); for (var o = 0; r > o; o++) if (b.State.calls[o]) { var s = b.State.calls[o], l = s[0], u = s[2], d = s[3], g = !!d, y = null; d || (d = b.State.calls[o][3] = t - 16); for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) { var P = l[v], V = P.element; if (i(V)) { var C = !1; if (u.display !== a && null !== u.display && "none" !== u.display) { if ("flex" === u.display) { var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"]; f.each(T, function (e, t) { S.setPropertyValue(V, "display", t) }) } S.setPropertyValue(V, "display", u.display) } u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility); for (var k in P) if ("element" !== k) { var A, F = P[k], j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing; if (1 === h) A = F.endValue; else { var E = F.endValue - F.startValue; if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue } if (F.currentValue = A, "tween" === k) y = A; else { if (S.Hooks.registered[k]) { var H = S.Hooks.getRoot(k), N = i(V).rootPropertyValueCache[H]; N && (F.rootPropertyValue = N) } var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData); S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0) } } u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V) } } u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o) } } b.State.isTicking && w(c) }
function p(e, t) { if (!b.State.calls[e]) return !1; for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) { var p = r[u].element; if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) { i(p).isAnimating = !1, i(p).rootPropertyValueCache = {}; var d = !1; f.each(S.Lists.transforms3D, function (e, t) { var r = /^scale/.test(t) ? 1 : 0, n = i(p).transformCache[t]; i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]) }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating") } if (!t && o.complete && !o.loop && u === c - 1) try { o.complete.call(n, n) } catch (g) { setTimeout(function () { throw g }, 1) } s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) { /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100) }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue) } b.State.calls[e] = !1; for (var m = 0, y = b.State.calls.length; y > m; m++) if (b.State.calls[m] !== !1) { l = !0; break } l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []) } var f, d = function () { if (r.documentMode) return r.documentMode; for (var e = 7; e > 4; e--) { var t = r.createElement("div"); if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e } return a }(), g = function () { var e = 0; return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) { var r, a = (new Date).getTime(); return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () { t(a + r) }, r) } }(), m = { isString: function (e) { return "string" == typeof e }, isArray: Array.isArray || function (e) { return "[object Array]" === Object.prototype.toString.call(e) }, isFunction: function (e) { return "[object Function]" === Object.prototype.toString.call(e) }, isNode: function (e) { return e && e.nodeType }, isNodeList: function (e) { return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0) }, isWrapped: function (e) { return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e)) }, isSVG: function (e) { return t.SVGElement && e instanceof t.SVGElement }, isEmptyObject: function (e) { for (var t in e) return !1; return !0 } }, y = !1; if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity."); if (7 >= d) return void(jQuery.fn.velocity = jQuery.fn.animate); var h = 400, v = "swing", b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) { f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} }) }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 }; t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop"); var x = function () { function e(e) { return -e.tension * e.x - e.friction * e.v }
function t(t, r, a) { var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction }; return { dx: n.v, dv: e(n) } }
function r(r, a) { var n = { dx: r.v, dv: e(r) }, o = t(r, .5 * a, n), i = t(r, .5 * a, o), s = t(r, a, i), l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx), u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv); return r.x = r.x + l * a, r.v = r.v + u * a, r } return function a(e, t, n) { var o, i, s, l = { x: -1, v: 0, tension: null, friction: null }, u = [0], c = 0, p = 1e-4, f = .016; for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;); return o ? function (e) { return u[e * (u.length - 1) | 0] } : c } }(); b.Easings = { linear: function (e) { return e }, swing: function (e) { return .5 - Math.cos(e * Math.PI) / 2 }, spring: function (e) { return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e) } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) { b.Easings[t[0]] = l.apply(null, t[1]) }); var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () { for (var e = 0; e < S.Lists.colors.length; e++) { var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1"; S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t] } var r, a, n; if (d) for (r in S.Hooks.templates) { a = S.Hooks.templates[r], n = a[0].split(" "); var o = a[1].match(S.RegEx.valueSplit); "Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]) } for (r in S.Hooks.templates) { a = S.Hooks.templates[r], n = a[0].split(" "); for (var e in n) { var i = r + n[e], s = e; S.Hooks.registered[i] = [r, s] } } }, getRoot: function (e) { var t = S.Hooks.registered[e]; return t ? t[0] : e }, cleanRootPropertyValue: function (e, t) { return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t }, extractValue: function (e, t) { var r = S.Hooks.registered[e]; if (r) { var a = r[0], n = r[1]; return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n] } return t }, injectValue: function (e, t, r) { var a = S.Hooks.registered[e]; if (a) { var n, o, i = a[0], s = a[1]; return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ") } return r } }, Normalizations: { registered: { clip: function (e, t, r) { switch (e) { case "name": return "clip"; case "extract": var a; return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a; case "inject": return "rect(" + r + ")" } }, blur: function (e, t, r) { switch (e) { case "name": return b.State.isFirefox ? "filter" : "-webkit-filter"; case "extract": var a = parseFloat(r); if (!a && 0 !== a) { var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i); a = n ? n[1] : 0 } return a; case "inject": return parseFloat(r) ? "blur(" + r + ")" : "none" } }, opacity: function (e, t, r) { if (8 >= d) switch (e) { case "name": return "filter"; case "extract": var a = r.toString().match(/alpha\(opacity=(.*)\)/i); return r = a ? a[1] / 100 : 1; case "inject": return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")" } else switch (e) { case "name": return "opacity"; case "extract": return r; case "inject": return r } } }, register: function () { 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D)); for (var e = 0; e < S.Lists.transformsBase.length; e++) ! function () { var t = S.Lists.transformsBase[e]; S.Normalizations.registered[t] = function (e, r, n) { switch (e) { case "name": return "transform"; case "extract": return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, ""); case "inject": var o = !1; switch (t.substr(0, t.length - 1)) { case "translate": o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n); break; case "scal": case "scale": b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n); break; case "skew": o = !/(deg|\d)$/i.test(n); break; case "rotate": o = !/(deg|\d)$/i.test(n) } return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t] } } }(); for (var e = 0; e < S.Lists.colors.length; e++) ! function () { var t = S.Lists.colors[e]; S.Normalizations.registered[t] = function (e, r, n) { switch (e) { case "name": return t; case "extract": var o; if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n; else { var i, s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" }; /^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ") } return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o; case "inject": return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")" } } }() } }, Names: { camelCase: function (e) { return e.replace(/-(\w)/g, function (e, t) { return t.toUpperCase() }) }, SVGAttribute: function (e) { var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2"; return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e) }, prefixCheck: function (e) { if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0]; for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) { var n; if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) { return e.toUpperCase() }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0] } return [e, !1] } }, Values: { hexToRgb: function (e) { var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i, a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i; return e = e.replace(r, function (e, t, r, a) { return t + t + r + r + a + a }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0] }, isCSSNullValue: function (e) { return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e) }, getUnitType: function (e) { return /^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px" }, getDisplayType: function (e) { var t = e && e.tagName.toString().toLowerCase(); return /^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block" }, addClass: function (e, t) { e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t }, removeClass: function (e, t) { e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ") } }, getPropertyValue: function (e, r, n, o) { function s(e, r) { function n() { u && S.setPropertyValue(e, "display", "none") } var l = 0; if (8 >= d) l = f.css(e, r); else { var u = !1; if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) { if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0); return n(), c } if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0); return n(), p } } var g; g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n() } if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) { var m = s(e, "position"); ("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px") } return l } var l; if (S.Hooks.registered[r]) { var u = r, c = S.Hooks.getRoot(u); n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n) } else if (S.Normalizations.registered[r]) { var p, g; p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g) } if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) if (/^(height|width)$/i.test(r)) try { l = e.getBBox()[r] } catch (m) { l = 0 } else l = e.getAttribute(r); else l = s(e, S.Names.prefixCheck(r)[0]); return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l }, setPropertyValue: function (e, r, a, n, o) { var s = r; if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a); else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r]; else { if (S.Hooks.registered[r]) { var l = r, u = S.Hooks.getRoot(r); n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u } if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try { e.style[s] = a } catch (c) { b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]") } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a; b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a) } return [s, a] }, flushTransformCache: function (e) { function t(t) { return parseFloat(S.getPropertyValue(e, t)) } var r = ""; if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) { var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] }; f.each(i(e).transformCache, function (e) { /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]) }) } else { var n, o; f.each(i(e).transformCache, function (t) { return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void(r += t + n + " ")) }), o && (r = "perspective" + o + " " + r) } S.setPropertyValue(e, "transform", r) } }; S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) { var n = a; return e = o(e), f.each(e, function (e, o) { if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t)); else { var s = b.CSS.setPropertyValue(o, t, r); "transform" === s[0] && b.CSS.flushTransformCache(o), n = s } }), n }; var P = function () { function e() { return s ? k.promise || null : l }
function n() { function e(e) { function p(e, t) { var r = a, n = a, i = a; return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i] }
function d(e, t) { var r, a; return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) { return r = e, "" }), r || (r = S.Values.getUnitType(e)), [a, r] }
function h() { var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") }, a = e.position === L.lastPosition && e.myParent === L.lastParent, n = e.fontSize === L.lastFontSize; L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize; var s = 100, l = {}; if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight; else { var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div"); b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) { b.CSS.setPropertyValue(u, t, "hidden") }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) { b.CSS.setPropertyValue(u, t, s + "%") }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u) } return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l } if (s.begin && 0 === V) try { s.begin.call(g, g) } catch (x) { setTimeout(function () { throw x }, 1) } if ("scroll" === A) { var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top", j = parseFloat(s.offset) || 0; s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o) } else if ("reverse" === A) { if (!i(o).tweensContainer) return void f.dequeue(o, s.queue); "none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s); var E = f.extend(!0, {}, i(o).tweensContainer); for (var H in E) if ("element" !== H) { var N = E[H].startValue; E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o) } l = E } else if ("start" === A) { var E; i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) { if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) { var r = p(t, !0), n = r[0], o = r[1], i = r[2]; if (S.RegEx.isHex.test(n)) { for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) { var f = [l[c]]; o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f } delete y[e] } } }); for (var z in y) { var O = p(y[z]), q = O[0], $ = O[1], M = O[2]; z = S.Names.camelCase(z); var I = S.Hooks.getRoot(z), B = !1; if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) { (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z)); var W, G, Y, D = !1; if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) { return D = t, "" }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y; else if (Y !== G && 0 !== M) if (0 === q) G = Y; else { n = n || h(); var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y"; switch (Y) { case "%": M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight; break; case "px": break; default: M *= n[Y + "ToPx"] } switch (G) { case "%": M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight); break; case "px": break; default: M *= 1 / n[G + "ToPx"] } } switch (D) { case "+": q = M + q; break; case "-": q = M - q; break; case "*": q = M * q; break; case "/": q = M / q } l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o) } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.") } l.element = o } l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++) } var n, o = this, s = f.extend({}, b.defaults, v), l = {}; switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) { b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e } }), s.duration.toString().toLowerCase()) { case "fast": s.duration = 200; break; case "normal": s.duration = h; break; case "slow": s.duration = 600; break; default: s.duration = parseFloat(s.duration) || 1 } b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) { return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t)) }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o) } var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties)); if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) { x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]); var w = g.length, V = 0; if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) { var C = d + 1; v = {}; for (var T = C; T < arguments.length; T++) m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T] } var k = { promise: null, resolver: null, rejecter: null }; s && b.Promise && (k.promise = new b.Promise(function (e, t) { k.resolver = e, k.rejecter = t })); var A; switch (y) { case "scroll": A = "scroll"; break; case "reverse": A = "reverse"; break; case "finish": case "stop": f.each(g, function (e, t) { i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer) }); var F = []; return f.each(b.State.calls, function (e, t) { t && f.each(t[1], function (r, n) { var o = v === a ? "" : v; return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) { a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) { m.isFunction(t) && t(null, !0) }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) { t.endValue = t.currentValue }), F.push(e)) : "finish" === y && (t[2].duration = 1)) }) : !0 }) }), "stop" === y && (f.each(F, function (e, t) { p(t, !0) }), k.promise && k.resolver(g)), e(); default: if (!f.isPlainObject(y) || m.isEmptyObject(y)) { if (m.isString(y) && b.Redirects[y]) { var j = f.extend({}, v), E = j.duration, H = j.delay || 0; return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) { parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a) }), e() } var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting."; return k.promise ? k.rejecter(new Error(N)) : console.log(N), e() } A = "start" } var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null }, R = []; f.each(g, function (e, t) { m.isNode(t) && n.call(t) }); var z, j = f.extend({}, b.defaults, v); if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) { var q = { delay: j.delay, progress: j.progress }; O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q) } return e() } }; b = f.extend(P, b), b.animate = P; var w = t.requestAnimationFrame || g; return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () { r.hidden ? (w = function (e) { return setTimeout(function () { e(!0) }, 16) }, c()) : w = t.requestAnimationFrame || g }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) { b.Redirects["slide" + t] = function (e, r, n, o, i, s) { var l = f.extend({}, r), u = l.begin, c = l.complete, p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" }, d = {}; l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () { u && u.call(i, i); for (var r in p) { d[r] = e.style[r]; var a = b.CSS.getPropertyValue(e, r); p[r] = "Down" === t ? [a, 0] : [0, a] } d.overflow = e.style.overflow, e.style.overflow = "hidden" }, l.complete = function () { for (var t in d) e.style[t] = d[t]; c && c.call(i, i), s && s.resolver(i) }, b(e, p, l) } }), f.each(["In", "Out"], function (e, t) { b.Redirects["fade" + t] = function (e, r, n, o, i, s) { var l = f.extend({}, r), u = { opacity: "In" === t ? 1 : 0 }, c = l.complete; l.complete = n !== o - 1 ? l.begin = null : function () { c && c.call(i, i), s && s.resolver(i) }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l) } }), b }(window.jQuery || window.Zepto || window, window, document)
}));; ! function (a, b, c, d) {
"use strict";
function k(a, b, c) { return setTimeout(q(a, c), b) }
function l(a, b, c) { return Array.isArray(a) ? (m(a, c[b], c), !0) : !1 }
function m(a, b, c) { var e; if (a) if (a.forEach) a.forEach(b, c); else if (a.length !== d) for (e = 0; e < a.length;) b.call(c, a[e], e, a), e++; else for (e in a) a.hasOwnProperty(e) && b.call(c, a[e], e, a) }
function n(a, b, c) { for (var e = Object.keys(b), f = 0; f < e.length;)(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++; return a }
function o(a, b) { return n(a, b, !0) }
function p(a, b, c) { var e, d = b.prototype; e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c) }
function q(a, b) { return function () { return a.apply(b, arguments) } }
function r(a, b) { return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a }
function s(a, b) { return a === d ? b : a }
function t(a, b, c) { m(x(b), function (b) { a.addEventListener(b, c, !1) }) }
function u(a, b, c) { m(x(b), function (b) { a.removeEventListener(b, c, !1) }) }
function v(a, b) { for (; a;) { if (a == b) return !0; a = a.parentNode } return !1 }
function w(a, b) { return a.indexOf(b) > -1 }
function x(a) { return a.trim().split(/\s+/g) }
function y(a, b, c) { if (a.indexOf && !c) return a.indexOf(b); for (var d = 0; d < a.length;) { if (c && a[d][c] == b || !c && a[d] === b) return d; d++ } return -1 }
function z(a) { return Array.prototype.slice.call(a, 0) }
function A(a, b, c) { for (var d = [], e = [], f = 0; f < a.length;) { var g = b ? a[f][b] : a[f]; y(e, g) < 0 && d.push(a[f]), e[f] = g, f++ } return c && (d = b ? d.sort(function (a, c) { return a[b] > c[b] }) : d.sort()), d }
function B(a, b) { for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) { if (c = e[h], f = c ? c + g : b, f in a) return f; h++ } return d }
function D() { return C++ }
function E(a) { var b = a.ownerDocument; return b.defaultView || b.parentWindow }
function ab(a, b) { var c = this; this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) { r(a.options.enable, [a]) && c.handler(b) }, this.init() }
function bb(a) { var b, c = a.options.inputClass; return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb) }
function cb(a, b, c) { var d = c.pointers.length, e = c.changedPointers.length, f = b & O && 0 === d - e, g = b & (Q | R) && 0 === d - e; c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c }
function db(a, b) { var c = a.session, d = b.pointers, e = d.length; c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1); var f = c.firstInput, g = c.firstMultiple, h = g ? g.center : f.center, i = b.center = hb(d); b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b); var k = a.element; v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k }
function eb(a, b) { var c = b.center, d = a.offsetDelta || {}, e = a.prevDelta || {}, f = a.prevInput || {}; (b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y) }
function fb(a, b) { var f, g, h, j, c = a.lastInterval || b, e = b.timeStamp - c.timeStamp; if (b.eventType != R && (e > N || c.velocity === d)) { var k = c.deltaX - b.deltaX, l = c.deltaY - b.deltaY, m = ib(e, k, l); g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction; b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j }
function gb(a) { for (var b = [], c = 0; c < a.pointers.length;) b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++; return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY } }
function hb(a) { var b = a.length; if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) }; for (var c = 0, d = 0, e = 0; b > e;) c += a[e].clientX, d += a[e].clientY, e++; return { x: h(c / b), y: h(d / b) } }
function ib(a, b, c) { return { x: b / a || 0, y: c / a || 0 } }
function jb(a, b) { return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W }
function kb(a, b, c) { c || (c = $); var d = b[c[0]] - a[c[0]], e = b[c[1]] - a[c[1]]; return Math.sqrt(d * d + e * e) }
function lb(a, b, c) { c || (c = $); var d = b[c[0]] - a[c[0]], e = b[c[1]] - a[c[1]]; return 180 * Math.atan2(e, d) / Math.PI }
function mb(a, b) { return lb(b[1], b[0], _) - lb(a[1], a[0], _) }
function nb(a, b) { return kb(b[0], b[1], _) / kb(a[0], a[1], _) }
function rb() { this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments) }
function wb() { this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [] }
function Ab() { this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments) }
function Bb(a, b) { var c = z(a.touches), d = z(a.changedTouches); return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d] }
function Eb() { this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments) }
function Fb(a, b) { var c = z(a.touches), d = this.targetIds; if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c]; var e, f, g = z(a.changedTouches), h = [], i = this.target; if (f = c.filter(function (a) { return v(a.target, i) }), b === O) for (e = 0; e < f.length;) d[f[e].identifier] = !0, e++; for (e = 0; e < g.length;) d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++; return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0 }
function Gb() { ab.apply(this, arguments); var a = q(this.handler, this); this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a) }
function Pb(a, b) { this.manager = a, this.set(b) }
function Qb(a) { if (w(a, Mb)) return Mb; var b = w(a, Nb), c = w(a, Ob); return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb }
function Yb(a) { this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [] }
function Zb(a) { return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "" }
function $b(a) { return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "" }
function _b(a, b) { var c = b.manager; return c ? c.get(a) : a }
function ac() { Yb.apply(this, arguments) }
function bc() { ac.apply(this, arguments), this.pX = null, this.pY = null }
function cc() { ac.apply(this, arguments) }
function dc() { Yb.apply(this, arguments), this._timer = null, this._input = null }
function ec() { ac.apply(this, arguments) }
function fc() { ac.apply(this, arguments) }
function gc() { Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0 }
function hc(a, b) { return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b) }
function kc(a, b) { b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) { var b = this.add(new a[0](a[1])); a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]) }, this) }
function lc(a, b) { var c = a.element; m(a.options.cssProps, function (a, d) { c.style[B(c.style, d)] = b ? a : "" }) }
function mc(a, c) { var d = b.createEvent("Event"); d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d) } var e = ["", "webkit", "moz", "MS", "ms", "o"], f = b.createElement("div"), g = "function", h = Math.round, i = Math.abs, j = Date.now, C = 1, F = /mobile|tablet|ip(ad|hone|od)|android/i, G = "ontouchstart" in a, H = B(a, "PointerEvent") !== d, I = G && F.test(navigator.userAgent), J = "touch", K = "pen", L = "mouse", M = "kinect", N = 25, O = 1, P = 2, Q = 4, R = 8, S = 1, T = 2, U = 4, V = 8, W = 16, X = T | U, Y = V | W, Z = X | Y, $ = ["x", "y"], _ = ["clientX", "clientY"]; ab.prototype = { handler: function () {}, init: function () { this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler) }, destroy: function () { this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler) } }; var ob = { mousedown: O, mousemove: P, mouseup: Q }, pb = "mousedown", qb = "mousemove mouseup"; p(rb, ab, { handler: function (a) { var b = ob[a.type]; b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a })) } }); var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R }, tb = { 2: J, 3: K, 4: L, 5: M }, ub = "pointerdown", vb = "pointermove pointerup pointercancel"; a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) { var b = this.store, c = !1, d = a.type.toLowerCase().replace("ms", ""), e = sb[d], f = tb[a.pointerType] || a.pointerType, g = f == J, h = y(b, a.pointerId, "pointerId"); e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1)) } }); var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, yb = "touchstart", zb = "touchstart touchmove touchend touchcancel"; p(Ab, ab, { handler: function (a) { var b = xb[a.type]; if (b === O && (this.started = !0), this.started) { var c = Bb.call(this, a, b); b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }) } } }); var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, Db = "touchstart touchmove touchend touchcancel"; p(Eb, ab, { handler: function (a) { var b = Cb[a.type], c = Fb.call(this, a, b); c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }) } }), p(Gb, ab, { handler: function (a, b, c) { var d = c.pointerType == J, e = c.pointerType == L; if (d) this.mouse.allow = !1; else if (e && !this.mouse.allow) return; b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c) }, destroy: function () { this.touch.destroy(), this.mouse.destroy() } }); var Hb = B(f.style, "touchAction"), Ib = Hb !== d, Jb = "compute", Kb = "auto", Lb = "manipulation", Mb = "none", Nb = "pan-x", Ob = "pan-y"; Pb.prototype = { set: function (a) { a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim() }, update: function () { this.set(this.manager.options.touchAction) }, compute: function () { var a = []; return m(this.manager.recognizers, function (b) { r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction())) }), Qb(a.join(" ")) }, preventDefaults: function (a) { if (!Ib) { var b = a.srcEvent, c = a.offsetDirection; if (this.manager.session.prevented) return b.preventDefault(), void 0; var d = this.actions, e = w(d, Mb), f = w(d, Ob), g = w(d, Nb); return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0 } }, preventSrc: function (a) { this.manager.session.prevented = !0, a.preventDefault() } }; var Rb = 1, Sb = 2, Tb = 4, Ub = 8, Vb = Ub, Wb = 16, Xb = 32; Yb.prototype = { defaults: {}, set: function (a) { return n(this.options, a), this.manager && this.manager.touchAction.update(), this }, recognizeWith: function (a) { if (l(a, "recognizeWith", this)) return this; var b = this.simultaneous; return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this }, dropRecognizeWith: function (a) { return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this) }, requireFailure: function (a) { if (l(a, "requireFailure", this)) return this; var b = this.requireFail; return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this }, dropRequireFailure: function (a) { if (l(a, "dropRequireFailure", this)) return this; a = _b(a, this); var b = y(this.requireFail, a); return b > -1 && this.requireFail.splice(b, 1), this }, hasRequireFailures: function () { return this.requireFail.length > 0 }, canRecognizeWith: function (a) { return !!this.simultaneous[a.id] }, emit: function (a) { function d(d) { b.manager.emit(b.options.event + (d ? Zb(c) : ""), a) } var b = this, c = this.state; Ub > c && d(!0), d(), c >= Ub && d(!0) }, tryEmit: function (a) { return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0) }, canEmit: function () { for (var a = 0; a < this.requireFail.length;) { if (!(this.requireFail[a].state & (Xb | Rb))) return !1; a++ } return !0 }, recognize: function (a) { var b = n({}, a); return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0) }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) { var b = this.options.pointers; return 0 === b || a.pointers.length === b }, process: function (a) { var b = this.state, c = a.eventType, d = b & (Sb | Tb), e = this.attrTest(a); return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () { var a = this.options.direction, b = []; return a & X && b.push(Ob), a & Y && b.push(Nb), b }, directionTest: function (a) { var b = this.options, c = !0, d = a.distance, e = a.direction, f = a.deltaX, g = a.deltaY; return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction }, attrTest: function (a) { return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a)) }, emit: function (a) { this.pX = a.deltaX, this.pY = a.deltaY; var b = $b(a.direction); b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a) } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () { return [Mb] }, attrTest: function (a) { return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb) }, emit: function (a) { if (this._super.emit.call(this, a), 1 !== a.scale) { var b = a.scale < 1 ? "in" : "out"; this.manager.emit(this.options.event + b, a) } } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () { return [Kb] }, process: function (a) { var b = this.options, c = a.pointers.length === b.pointers, d = a.distance < b.threshold, e = a.deltaTime > b.time; if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset(); else if (a.eventType & O) this.reset(), this._timer = k(function () { this.state = Vb, this.tryEmit() }, b.time, this); else if (a.eventType & Q) return Vb; return Xb }, reset: function () { clearTimeout(this._timer) }, emit: function (a) { this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input))) } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () { return [Mb] }, attrTest: function (a) { return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb) } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () { return bc.prototype.getTouchAction.call(this) }, attrTest: function (a) { var c, b = this.options.direction; return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q }, emit: function (a) { var b = $b(a.direction); b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a) } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () { return [Lb] }, process: function (a) { var b = this.options, c = a.pointers.length === b.pointers, d = a.distance < b.threshold, e = a.deltaTime < b.time; if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout(); if (d && e && c) { if (a.eventType != Q) return this.failTimeout(); var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0, g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold; this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a; var h = this.count % b.taps; if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () { this.state = Vb, this.tryEmit() }, b.interval, this), Sb) : Vb } return Xb }, failTimeout: function () { return this._timer = k(function () { this.state = Xb }, this.options.interval, this), Xb }, reset: function () { clearTimeout(this._timer) }, emit: function () { this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input)) } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } }; var ic = 1, jc = 2; kc.prototype = { set: function (a) { return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this }, stop: function (a) { this.session.stopped = a ? jc : ic }, recognize: function (a) { var b = this.session; if (!b.stopped) { this.touchAction.preventDefaults(a); var c, d = this.recognizers, e = b.curRecognizer; (!e || e && e.state & Vb) && (e = b.curRecognizer = null); for (var f = 0; f < d.length;) c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++ } }, get: function (a) { if (a instanceof Yb) return a; for (var b = this.recognizers, c = 0; c < b.length; c++) if (b[c].options.event == a) return b[c]; return null }, add: function (a) { if (l(a, "add", this)) return this; var b = this.get(a.options.event); return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a }, remove: function (a) { if (l(a, "remove", this)) return this; var b = this.recognizers; return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this }, on: function (a, b) { var c = this.handlers; return m(x(a), function (a) { c[a] = c[a] || [], c[a].push(b) }), this }, off: function (a, b) { var c = this.handlers; return m(x(a), function (a) { b ? c[a].splice(y(c[a], b), 1) : delete c[a] }), this }, emit: function (a, b) { this.options.domEvents && mc(a, b); var c = this.handlers[a] && this.handlers[a].slice(); if (c && c.length) { b.type = a, b.preventDefault = function () { b.srcEvent.preventDefault() }; for (var d = 0; d < c.length;) c[d](b), d++ } }, destroy: function () { this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () { return hc }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc
}(window, document, "Hammer");; (function (factory) {
if (typeof define === 'function' && define.amd) { define(['jquery', 'hammerjs'], factory); } else if (typeof exports === 'object') { factory(require('jquery'), require('hammerjs')); } else { factory(jQuery, Hammer); }
}(function ($, Hammer) {
function hammerify(el, options) { var $el = $(el); if (!$el.data("hammer")) { $el.data("hammer", new Hammer($el[0], options)); } }
$.fn.hammer = function (options) { return this.each(function () { hammerify(this, options); }); };
// extend the emit method to also trigger jQuery events Hammer.Manager.prototype.emit = (function (originalEmit) { return function (type, data) { originalEmit.call(this, type, data); $(this.element).trigger({ type: type, gesture: data }); }; })(Hammer.Manager.prototype.emit);
}));; // Required for Meteor package, the use of window prevents export by Meteor (function (window) {
if (window.Package) { Materialize = {}; } else { window.Materialize = {}; }
})(window);
/*
* raf.js * https://github.com/ngryman/raf.js * * original requestAnimationFrame polyfill by Erik Möller * inspired from paul_irish gist and post * * Copyright (c) 2013 ngryman * Licensed under the MIT license. */
(function (window) {
var lastTime = 0, vendors = ['webkit', 'moz'], requestAnimationFrame = window.requestAnimationFrame, cancelAnimationFrame = window.cancelAnimationFrame, i = vendors.length;
// try to un-prefix existing raf while (--i >= 0 && !requestAnimationFrame) { requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; }
// polyfill with setTimeout fallback // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 if (!requestAnimationFrame || !cancelAnimationFrame) { requestAnimationFrame = function (callback) { var now = +Date.now(), nextTime = Math.max(lastTime + 16, now); return setTimeout(function () { callback(lastTime = nextTime); }, nextTime - now); };
cancelAnimationFrame = clearTimeout; }
// export to window window.requestAnimationFrame = requestAnimationFrame; window.cancelAnimationFrame = cancelAnimationFrame;
}(window));
/**
* Generate approximated selector string for a jQuery object * @param {jQuery} obj jQuery object to be parsed * @returns {string} */
Materialize.objectSelectorString = function (obj) {
var tagStr = obj.prop('tagName') || ; var idStr = obj.attr('id') || ; var classStr = obj.attr('class') || ; return (tagStr + idStr + classStr).replace(/\s/g, );
};
// Unique Random ID
Materialize.guid = (function () {
function s4() { return Math.floor((1 + Math.random()) * 0x10000) .toString(16) .substring(1); } return function () { return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4(); };
})();
/**
* Escapes hash from special characters * @param {string} hash String returned from this.hash * @returns {string} */
Materialize.escapeHash = function (hash) {
return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
};
Materialize.elementOrParentIsFixed = function (element) {
var $element = $(element); var $checkElements = $element.add($element.parents()); var isFixed = false; $checkElements.each(function () { if ($(this).css("position") === "fixed") { isFixed = true; return false; } }); return isFixed;
};
/**
* Get time in ms * @license https://raw.github.com/jashkenas/underscore/master/LICENSE * @type {function} * @return {number} */
var getTime = (Date.now || function () {
return new Date().getTime();
});
/**
* Returns a function, that, when invoked, will only be triggered at most once * during a given window of time. Normally, the throttled function will run * as much as it can, without ever going more than once per `wait` duration; * but if you'd like to disable the execution on the leading edge, pass * `{leading: false}`. To disable execution on the trailing edge, ditto. * @license https://raw.github.com/jashkenas/underscore/master/LICENSE * @param {function} func * @param {number} wait * @param {Object=} options * @returns {Function} */
Materialize.throttle = function (func, wait, options) {
var context, args, result; var timeout = null; var previous = 0; options || (options = {}); var later = function () { previous = options.leading === false ? 0 : getTime(); timeout = null; result = func.apply(context, args); context = args = null; }; return function () { var now = getTime(); if (!previous && options.leading === false) previous = now; var remaining = wait - (now - previous); context = this; args = arguments; if (remaining <= 0) { clearTimeout(timeout); timeout = null; previous = now; result = func.apply(context, args); context = args = null; } else if (!timeout && options.trailing !== false) { timeout = setTimeout(later, remaining); } return result; };
};
// Velocity has conflicts when loaded with jQuery, this will check for it
// First, check if in noConflict mode
var Vel;
if (jQuery) {
Vel = jQuery.Velocity;
} else if ($) {
Vel = $.Velocity;
} else {
Vel = Velocity;
}; (function ($) {
$.fn.collapsible = function (options, methodParam) { var defaults = { accordion: undefined, onOpen: undefined, onClose: undefined };
var methodName = options; options = $.extend(defaults, options);
return this.each(function () {
var $this = $(this);
var $panel_headers = $(this).find('> li > .collapsible-header');
var collapsible_type = $this.data("collapsible");
/**************** Helper Functions ****************/
// Accordion Open function accordionOpen(object) { $panel_headers = $this.find('> li > .collapsible-header'); if (object.hasClass('active')) { object.parent().addClass('active'); } else { object.parent().removeClass('active'); } if (object.parent().hasClass('active')) { object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ); } }); } else { object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ); } }); }
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
// Close previously open accordion elements. $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () { if ($(this).is(':visible')) { $(this).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ); execCallbacks($(this).siblings('.collapsible-header')); } }); } }); }
// Expandable Open function expandableOpen(object) { if (object.hasClass('active')) { object.parent().addClass('active'); } else { object.parent().removeClass('active'); } if (object.parent().hasClass('active')) { object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ); } }); } else { object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ); } }); } }
// Open collapsible. object: .collapsible-header function collapsibleOpen(object, noToggle) { if (!noToggle) { object.toggleClass('active'); }
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion accordionOpen(object); } else { // Handle Expandables expandableOpen(object); }
execCallbacks(object); }
// Handle callbacks function execCallbacks(object) { if (object.hasClass('active')) { if (typeof (options.onOpen) === "function") { options.onOpen.call(this, object.parent()); } } else { if (typeof (options.onClose) === "function") { options.onClose.call(this, object.parent()); } } }
/** * Check if object is children of panel header * @param {Object} object Jquery object * @return {Boolean} true if it is children */ function isChildrenOfPanelHeader(object) {
var panelHeader = getPanelHeader(object);
return panelHeader.length > 0; }
/** * Get panel header from a children element * @param {Object} object Jquery object * @return {Object} panel header object */ function getPanelHeader(object) {
return object.closest('li > .collapsible-header'); }
// Turn off any existing event handlers function removeEventHandlers() { $this.off('click.collapse', '> li > .collapsible-header'); }
/***** End Helper Functions *****/
// Methods if (methodName === 'destroy') { removeEventHandlers(); return; } else if (methodParam >= 0 && methodParam < $panel_headers.length) { var $curr_header = $panel_headers.eq(methodParam); if ($curr_header.length && (methodName === 'open' || (methodName === 'close' && $curr_header.hasClass('active')))) { collapsibleOpen($curr_header); } return; }
removeEventHandlers();
// Add click handler to only direct collapsible header children $this.on('click.collapse', '> li > .collapsible-header', function (e) { var element = $(e.target);
if (isChildrenOfPanelHeader(element)) { element = getPanelHeader(element); }
collapsibleOpen(element); });
// Open first active if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion collapsibleOpen($panel_headers.filter('.active').first(), true);
} else { // Handle Expandables $panel_headers.filter('.active').each(function () { collapsibleOpen($(this), true); }); }
}); };
$(document).ready(function () { $('.collapsible').collapsible(); });
}(jQuery));; (function ($) {
// Add posibility to scroll to selected option // usefull for select for example $.fn.scrollTo = function (elem) { $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); return this; };
$.fn.dropdown = function (options) { var defaults = { inDuration: 300, outDuration: 225, constrainWidth: true, // Constrains width of dropdown to the activator hover: false, gutter: 0, // Spacing from edge belowOrigin: false, alignment: 'left', stopPropagation: false };
// Open dropdown. if (options === "open") { this.each(function () { $(this).trigger('open'); }); return false; }
// Close dropdown. if (options === "close") { this.each(function () { $(this).trigger('close'); }); return false; }
this.each(function () { var origin = $(this); var curr_options = $.extend({}, defaults, options); var isFocused = false;
// Dropdown menu var activates = $("#" + origin.attr('data-activates'));
function updateOptions() { if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration'); if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration'); if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth'); if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover'); if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter'); if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin'); if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment'); if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation'); }
updateOptions();
// Attach dropdown to its activator origin.after(activates);
/* Helper function to position and resize dropdown. Used in hover and click handler. */ function placeDropdown(eventType) { // Check for simultaneous focus and click events. if (eventType === 'focus') { isFocused = true; }
// Check html data attributes updateOptions();
// Set Dropdown state activates.addClass('active'); origin.addClass('active');
// Constrain width if (curr_options.constrainWidth === true) { activates.css('width', origin.outerWidth());
} else { activates.css('white-space', 'nowrap'); }
// Offscreen detection var windowHeight = window.innerHeight; var originHeight = origin.innerHeight(); var offsetLeft = origin.offset().left; var offsetTop = origin.offset().top - $(window).scrollTop(); var currAlignment = curr_options.alignment; var gutterSpacing = 0; var leftPosition = 0;
// Below Origin var verticalOffset = 0; if (curr_options.belowOrigin === true) { verticalOffset = originHeight; }
// Check for scrolling positioned container. var scrollYOffset = 0; var scrollXOffset = 0; var wrapper = origin.parent(); if (!wrapper.is('body')) { if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { scrollYOffset = wrapper[0].scrollTop; } if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { scrollXOffset = wrapper[0].scrollLeft; } }
if (offsetLeft + activates.innerWidth() > $(window).width()) { // Dropdown goes past screen on right, force right alignment currAlignment = 'right';
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { // Dropdown goes past screen on left, force left alignment currAlignment = 'left'; } // Vertical bottom offscreen detection if (offsetTop + activates.innerHeight() > windowHeight) { // If going upwards still goes offscreen, just crop height of dropdown. if (offsetTop + originHeight - activates.innerHeight() < 0) { var adjustedHeight = windowHeight - offsetTop - verticalOffset; activates.css('max-height', adjustedHeight); } else { // Flow upwards. if (!verticalOffset) { verticalOffset += originHeight; } verticalOffset -= activates.innerHeight(); } }
// Handle edge alignment if (currAlignment === 'left') { gutterSpacing = curr_options.gutter; leftPosition = origin.position().left + gutterSpacing; } else if (currAlignment === 'right') { // Material icons fix activates .stop(true, true) .css({ opacity: 0, left: 0 })
var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth(); gutterSpacing = -curr_options.gutter; leftPosition = offsetRight + gutterSpacing; }
// Position dropdown activates.css({ position: 'absolute', top: origin.position().top + verticalOffset + scrollYOffset, left: leftPosition + scrollXOffset });
// Show dropdown activates .slideDown({ queue: false, duration: curr_options.inDuration, easing: 'easeOutCubic', complete: function () { $(this).css('height', ); } }) .animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
// Add click close handler to document setTimeout(function () { $(document).on('click.' + activates.attr('id'), function (e) { hideDropdown(); $(document).off('click.' + activates.attr('id')); }); }, 0); }
function hideDropdown() { // Check for simultaneous focus and click events. isFocused = false; activates.fadeOut(curr_options.outDuration); activates.removeClass('active'); origin.removeClass('active'); $(document).off('click.' + activates.attr('id')); setTimeout(function () { activates.css('max-height', ); }, curr_options.outDuration); }
// Hover if (curr_options.hover) { var open = false; origin.off('click.' + origin.attr('id')); // Hover handler to show dropdown origin.on('mouseenter', function (e) { // Mouse over if (open === false) { placeDropdown(); open = true; } }); origin.on('mouseleave', function (e) { // If hover on origin then to something other than dropdown content, then close var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element if (!$(toEl).closest('.dropdown-content').is(activates)) { activates.stop(true, true); hideDropdown(); open = false; } });
activates.on('mouseleave', function (e) { // Mouse out var toEl = e.toElement || e.relatedTarget; if (!$(toEl).closest('.dropdown-button').is(origin)) { activates.stop(true, true); hideDropdown(); open = false; } });
// Click } else { // Click handler to show dropdown origin.off('click.' + origin.attr('id')); origin.on('click.' + origin.attr('id'), function (e) { if (!isFocused) { if (origin[0] == e.currentTarget && !origin.hasClass('active') && ($(e.target).closest('.dropdown-content').length === 0)) { e.preventDefault(); // Prevents button click from moving window if (curr_options.stopPropagation) { e.stopPropagation(); } placeDropdown('click'); } // If origin is clicked and menu is open, close menu else if (origin.hasClass('active')) { hideDropdown(); $(document).off('click.' + activates.attr('id')); } } });
} // End else
// Listen to open and close event - useful for select component origin.on('open', function (e, eventType) { placeDropdown(eventType); }); origin.on('close', hideDropdown);
}); }; // End dropdown plugin
$(document).ready(function () { $('.dropdown-button').dropdown(); });
}(jQuery));; (function ($) {
var _stack = 0, _lastID = 0, _generateID = function () { _lastID++; return 'materialize-modal-overlay-' + _lastID; };
var methods = { init: function (options) { var defaults = { opacity: 0.5, inDuration: 350, outDuration: 250, ready: undefined, complete: undefined, dismissible: true, startingTop: '4%', endingTop: '10%' };
// Override defaults options = $.extend(defaults, options);
return this.each(function () { var $modal = $(this); var modal_id = $(this).attr("id") || '#' + $(this).data('target');
var closeModal = function () { var overlayID = $modal.data('overlay-id'); var $overlay = $('#' + overlayID); $modal.removeClass('open');
// Enable scrolling $('body').css({ overflow: , width: });
$modal.find('.modal-close').off('click.close'); $(document).off('keyup.modal' + overlayID);
$overlay.velocity({ opacity: 0 }, { duration: options.outDuration, queue: false, ease: "easeOutQuart" });
// Define Bottom Sheet animation var exitVelocityOptions = { duration: options.outDuration, queue: false, ease: "easeOutCubic", // Handle modal ready callback complete: function () { $(this).css({ display: "none" });
// Call complete callback if (typeof (options.complete) === "function") { options.complete.call(this, $modal); } $overlay.remove(); _stack--; } }; if ($modal.hasClass('bottom-sheet')) { $modal.velocity({ bottom: "-100%", opacity: 0 }, exitVelocityOptions); } else { $modal.velocity({ top: options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions ); } };
var openModal = function ($trigger) { var $body = $('body'); var oldWidth = $body.innerWidth(); $body.css('overflow', 'hidden'); $body.width(oldWidth);
if ($modal.hasClass('open')) { return; }
var overlayID = _generateID();var $overlay = $('');
var lStack = (++_stack);
// Store a reference of the overlay $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2); $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1); $modal.addClass('open');
$("body").append($overlay);
if (options.dismissible) { $overlay.click(function () { closeModal(); }); // Return on ESC $(document).on('keyup.modal' + overlayID, function (e) { if (e.keyCode === 27) { // ESC key closeModal(); } }); }
$modal.find(".modal-close").on('click.close', function (e) { closeModal(); });
$overlay.css({ display: "block", opacity: 0 });
$modal.css({ display: "block", opacity: 0 });
$overlay.velocity({ opacity: options.opacity }, { duration: options.inDuration, queue: false, ease: "easeOutCubic" }); $modal.data('associated-overlay', $overlay[0]);
// Define Bottom Sheet animation var enterVelocityOptions = { duration: options.inDuration, queue: false, ease: "easeOutCubic", // Handle modal ready callback complete: function () { if (typeof (options.ready) === "function") { options.ready.call(this, $modal, $trigger); } } }; if ($modal.hasClass('bottom-sheet')) { $modal.velocity({ bottom: "0", opacity: 1 }, enterVelocityOptions); } else { $.Velocity.hook($modal, "scaleX", 0.7); $modal.css({ top: options.startingTop }); $modal.velocity({ top: options.endingTop, opacity: 1, scaleX: '1' }, enterVelocityOptions); }
};
// Reset handlers $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]'); $(this).off('openModal'); $(this).off('closeModal');
// Close Handlers $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function (e) { options.startingTop = ($(this).offset().top - $(window).scrollTop()) / 1.15; openModal($(this)); e.preventDefault(); }); // done set on click
$(this).on('openModal', function () { var modal_id = $(this).attr("href") || '#' + $(this).data('target'); openModal(); });
$(this).on('closeModal', function () { closeModal(); }); }); // done return }, open: function () { methods.init.apply(this, arguments); $(this).trigger('openModal'); }, close: function () { $(this).trigger('closeModal'); } };
$.fn.modal = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal'); } };
})(jQuery);; (function ($) {
$.fn.materialbox = function () {
return this.each(function () {
if ($(this).hasClass('initialized')) { return; }
$(this).addClass('initialized');
var overlayActive = false; var doneAnimating = true; var inDuration = 275; var outDuration = 200; var origin = $(this);var placeholder = $('').addClass('material-placeholder');
var originalWidth = 0; var originalHeight = 0; var ancestorsChanged; var ancestor; var originInlineStyles = origin.attr('style'); origin.wrap(placeholder);
// Start click handler origin.on('click', function () { var placeholder = origin.parent('.material-placeholder'); var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var originalWidth = origin.width(); var originalHeight = origin.height();
// If already modal, return to original if (doneAnimating === false) { returnToOriginal(); return false; } else if (overlayActive && doneAnimating === true) { returnToOriginal(); return false; }
// Set states doneAnimating = false; origin.addClass('active'); overlayActive = true;
// Set positioning for placeholder placeholder.css({ width: placeholder[0].getBoundingClientRect().width, height: placeholder[0].getBoundingClientRect().height, position: 'relative', top: 0, left: 0 });
// Find ancestor with overflow: hidden; and remove it ancestorsChanged = undefined; ancestor = placeholder[0].parentNode; var count = 0; while (ancestor !== null && !$(ancestor).is(document)) { var curr = $(ancestor); if (curr.css('overflow') !== 'visible') { curr.css('overflow', 'visible'); if (ancestorsChanged === undefined) { ancestorsChanged = curr; } else { ancestorsChanged = ancestorsChanged.add(curr); } } ancestor = ancestor.parentNode; }
// Set css on origin origin.css({ position: 'absolute', 'z-index': 1000, 'will-change': 'left, top, width, height' }) .data('width', originalWidth) .data('height', originalHeight);
// Add overlayvar overlay = $('')
.css({ opacity: 0 }) .click(function () { if (doneAnimating === true) returnToOriginal(); });
// Put before in origin image to preserve z-index layering. origin.before(overlay);
// Set dimensions if needed var overlayOffset = overlay[0].getBoundingClientRect(); overlay.css({ width: windowWidth, height: windowHeight, left: -1 * overlayOffset.left, top: -1 * overlayOffset.top })
// Animate Overlay overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
// Add and animate caption if it exists if (origin.data('caption') !== "") {var $photo_caption = $('');
$photo_caption.text(origin.data('caption')); $('body').append($photo_caption); $photo_caption.css({ "display": "inline" }); $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); }
// Resize Image var ratio = 0; var widthPercent = originalWidth / windowWidth; var heightPercent = originalHeight / windowHeight; var newWidth = 0; var newHeight = 0;
if (widthPercent > heightPercent) { ratio = originalHeight / originalWidth; newWidth = windowWidth * 0.9; newHeight = windowWidth * 0.9 * ratio; } else { ratio = originalWidth / originalHeight; newWidth = (windowHeight * 0.9) * ratio; newHeight = windowHeight * 0.9; }
// Animate image + set z-index if (origin.hasClass('responsive-img')) { origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false, complete: function () { origin.css({ left: 0, top: 0 }) .velocity({ height: newHeight, width: newWidth, left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 }, { duration: inDuration, queue: false, easing: 'easeOutQuad', complete: function () { doneAnimating = true; } }); } // End Complete }); // End Velocity } else { origin.css('left', 0) .css('top', 0) .velocity({ height: newHeight, width: newWidth, left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 }, { duration: inDuration, queue: false, easing: 'easeOutQuad', complete: function () { doneAnimating = true; } }); // End Velocity }
// Handle Exit triggers $(window).on('scroll.materialbox', function () { if (overlayActive) { returnToOriginal(); } });
$(window).on('resize.materialbox', function () { if (overlayActive) { returnToOriginal(); } });
$(document).on('keyup.materialbox', function (e) { // ESC key if (e.keyCode === 27 && doneAnimating === true && overlayActive) { returnToOriginal(); } });
}); // End click handler
// This function returns the modaled image to the original spot function returnToOriginal() {
doneAnimating = false;
var placeholder = origin.parent('.material-placeholder'); var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var originalWidth = origin.data('width'); var originalHeight = origin.data('height');
origin.velocity("stop", true); $('#materialbox-overlay').velocity("stop", true); $('.materialbox-caption').velocity("stop", true);
// disable exit handlers $(window).off('scroll.materialbox'); $(document).off('keyup.materialbox'); $(window).off('resize.materialbox');
$('#materialbox-overlay').velocity({ opacity: 0 }, { duration: outDuration, // Delay prevents animation overlapping queue: false, easing: 'easeOutQuad', complete: function () { // Remove Overlay overlayActive = false; $(this).remove(); } });
// Resize Image origin.velocity({ width: originalWidth, height: originalHeight, left: 0, top: 0 }, { duration: outDuration, queue: false, easing: 'easeOutQuad', complete: function () { placeholder.css({ height: , width: , position: , top: , left: });
origin.removeAttr('style'); origin.attr('style', originInlineStyles);
// Remove class origin.removeClass('active'); doneAnimating = true;
// Remove overflow overrides on ancestors if (ancestorsChanged) { ancestorsChanged.css('overflow', ); } } });
// Remove Caption + reset css settings on image $('.materialbox-caption').velocity({ opacity: 0 }, { duration: outDuration, // Delay prevents animation overlapping queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } });
} }); };
$(document).ready(function () { $('.materialboxed').materialbox(); });
}(jQuery));; (function ($) {
$.fn.parallax = function () { var window_width = $(window).width(); // Parallax Scripts return this.each(function (i) { var $this = $(this); $this.addClass('parallax');
function updateParallax(initial) { var container_height; if (window_width < 601) { container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height(); } else { container_height = ($this.height() > 0) ? $this.height() : 500; } var $img = $this.children("img").first(); var img_height = $img.height(); var parallax_dist = img_height - container_height; var bottom = $this.offset().top + container_height; var top = $this.offset().top; var scrollTop = $(window).scrollTop(); var windowHeight = window.innerHeight; var windowBottom = scrollTop + windowHeight; var percentScrolled = (windowBottom - top) / (container_height + windowHeight); var parallax = Math.round((parallax_dist * percentScrolled));
if (initial) { $img.css('display', 'block'); } if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) { $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); }
}
// Wait for image load $this.children("img").one("load", function () { updateParallax(true); }).each(function () { if (this.complete) $(this).trigger("load"); });
$(window).scroll(function () { window_width = $(window).width(); updateParallax(false); });
$(window).resize(function () { window_width = $(window).width(); updateParallax(false); });
});
};
}(jQuery));; (function ($) {
var methods = { init: function (options) { var defaults = { onShow: null, swipeable: false, responsiveThreshold: Infinity, // breakpoint for swipeable }; options = $.extend(defaults, options); var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
// For each set of tabs, we want to keep track of // which tab is active and its associated content var $this = $(this), window_width = $(window).width();
var $active, $content, $links = $this.find('li.tab a'), $tabs_width = $this.width(), $tabs_content = $(), $tabs_wrapper, $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, $indicator, index = prev_index = 0, clicked = false, clickedTimeout, transition = 300;
// Finds right attribute for indicator based on active tab. // el: jQuery Object var calcRightPos = function (el) { return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft()); };
// Finds left attribute for indicator based on active tab. // el: jQuery Object var calcLeftPos = function (el) { return Math.floor(el.position().left + $this.scrollLeft()); };
// Animates Indicator to active tab. // prev_index: Number var animateIndicator = function (prev_index) { if ((index - prev_index) >= 0) { $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
} else { $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); } };
// Change swipeable according to responsive threshold if (options.swipeable) { if (window_width > options.responsiveThreshold) { options.swipeable = false; } }
// If the location.hash matches one of the links, use that as the active tab. $active = $($links.filter('[href="' + location.hash + '"]'));
// If no match is found, use the first link or any with class 'active' as the initial active tab. if ($active.length === 0) { $active = $(this).find('li.tab a.active').first(); } if ($active.length === 0) { $active = $(this).find('li.tab a').first(); }
$active.addClass('active'); index = $links.index($active); if (index < 0) { index = 0; }
if ($active[0] !== undefined) { $content = $($active[0].hash); $content.addClass('active'); }
// append indicator then set indicator width to tab width if (!$this.find('.indicator').length) {$this.append('');
} $indicator = $this.find('.indicator');
// we make sure that the indicator is at the end of the tabs $this.append($indicator);
if ($this.is(":visible")) { // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); // $indicator.css({"left": index * $tab_width}); setTimeout(function () { $indicator.css({ "right": calcRightPos($active) }); $indicator.css({ "left": calcLeftPos($active) }); }, 0); } $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () { $tabs_width = $this.width(); $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; if (index < 0) { index = 0; } if ($tab_width !== 0 && $tabs_width !== 0) { $indicator.css({ "right": calcRightPos($active) }); $indicator.css({ "left": calcLeftPos($active) }); } });
// Initialize Tabs Content. if (options.swipeable) { // TODO: Duplicate calls with swipeable? handle multiple div wrapping. $links.each(function () { var $curr_content = $(Materialize.escapeHash(this.hash)); $curr_content.addClass('carousel-item'); $tabs_content = $tabs_content.add($curr_content); });$tabs_wrapper = $tabs_content.wrapAll('');
$tabs_content.css('display', ); $('.tabs-content.carousel').carousel({ fullWidth: true, noWrap: true, onCycleTo: function (item) { if (!clicked) { var prev_index = index; index = $tabs_wrapper.index(item); $active = $links.eq(index); animateIndicator(prev_index); if (typeof (options.onShow) === "function") { options.onShow.call($this[0], $content); } } }, }); } else { // Hide the remaining content $links.not($active).each(function () { $(Materialize.escapeHash(this.hash)).hide(); }); }
// Bind the click event handler $this.off('click.tabs').on('click.tabs', 'a', function (e) { if ($(this).parent().hasClass('disabled')) { e.preventDefault(); return; }
// Act as regular link if target attribute is specified. if (!!$(this).attr("target")) { return; }
clicked = true; $tabs_width = $this.width(); $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
// Make the old tab inactive. $active.removeClass('active'); var $oldContent = $content
// Update the variables with the new link and content $active = $(this); $content = $(Materialize.escapeHash(this.hash)); $links = $this.find('li.tab a'); var activeRect = $active.position();
// Make the tab active. $active.addClass('active'); prev_index = index; index = $links.index($(this)); if (index < 0) { index = 0; } // Change url to current tab // window.location.hash = $active.attr('href');
// Swap content if (options.swipeable) { if ($tabs_content.length) { $tabs_content.carousel('set', index, function () { if (typeof (options.onShow) === "function") { options.onShow.call($this[0], $content); } }); } } else { if ($content !== undefined) { $content.show(); $content.addClass('active'); if (typeof (options.onShow) === "function") { options.onShow.call(this, $content); } }
if ($oldContent !== undefined && !$oldContent.is($content)) { $oldContent.hide(); $oldContent.removeClass('active'); } }
// Reset clicked state clickedTimeout = setTimeout(function () { clicked = false; }, transition);
// Update indicator animateIndicator(prev_index);
// Prevent the anchor's default click action e.preventDefault(); }); });
}, select_tab: function (id) { this.find('a[href="#' + id + '"]').trigger('click'); } };
$.fn.tabs = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs'); } };
$(document).ready(function () { $('ul.tabs').tabs(); });
}(jQuery));; (function ($) {
$.fn.tooltip = function (options) { var timeout = null, margin = 5;
// Defaults var defaults = { delay: 350, tooltip: , position: 'bottom', html: false };
// Remove tooltip from the activator if (options === "remove") { this.each(function () { $('#' + $(this).attr('data-tooltip-id')).remove(); $(this).off('mouseenter.tooltip mouseleave.tooltip'); }); return false; }
options = $.extend(defaults, options);
return this.each(function () { var tooltipId = Materialize.guid(); var origin = $(this);
// Destroy old tooltip if (origin.attr('data-tooltip-id')) { $('#' + origin.attr('data-tooltip-id')).remove(); }
origin.attr('data-tooltip-id', tooltipId);
// Get attributes. var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop; var setAttributes = function () { allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; tooltipDelay = origin.attr('data-delay'); tooltipDelay = (tooltipDelay === undefined || tooltipDelay === ) ? options.delay : tooltipDelay; tooltipPosition = origin.attr('data-position'); tooltipPosition = (tooltipPosition === undefined || tooltipPosition === ) ? options.position : tooltipPosition; tooltipText = origin.attr('data-tooltip'); tooltipText = (tooltipText === undefined || tooltipText === ) ? options.tooltip : tooltipText; }; setAttributes();
var renderTooltipEl = function () {var tooltip = $('');
// Create Text span if (allowHtml) { tooltipText = $('').html(tooltipText); } else { tooltipText = $('').text(tooltipText); }
// Create tooltip tooltip.append(tooltipText) .appendTo($('body')) .attr('id', tooltipId);
// Create backdropbackdrop = $('');
backdrop.appendTo(tooltip); return tooltip; }; tooltipEl = renderTooltipEl();
// Destroy previously binded events origin.off('mouseenter.tooltip mouseleave.tooltip'); // Mouse In var started = false, timeoutRef; origin.on({ 'mouseenter.tooltip': function (e) { var showTooltip = function () { setAttributes(); started = true; tooltipEl.velocity('stop'); backdrop.velocity('stop'); tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
// Tooltip positioning var originWidth = origin.outerWidth(); var originHeight = origin.outerHeight(); var tooltipHeight = tooltipEl.outerHeight(); var tooltipWidth = tooltipEl.outerWidth(); var tooltipVerticalMovement = '0px'; var tooltipHorizontalMovement = '0px'; var backdropOffsetWidth = backdrop[0].offsetWidth; var backdropOffsetHeight = backdrop[0].offsetHeight; var scaleXFactor = 8; var scaleYFactor = 8; var scaleFactor = 0; var targetTop, targetLeft, newCoordinates;
if (tooltipPosition === "top") { // Top Position targetTop = origin.offset().top - tooltipHeight - margin; targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipVerticalMovement = '-10px'; backdrop.css({ bottom: 0, left: 0, borderRadius: '14px 14px 0 0', transformOrigin: '50% 100%', marginTop: tooltipHeight, marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2) }); } // Left Position else if (tooltipPosition === "left") { targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; targetLeft = origin.offset().left - tooltipWidth - margin; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '-10px'; backdrop.css({ top: '-7px', right: 0, width: '14px', height: '14px', borderRadius: '14px 0 0 14px', transformOrigin: '95% 50%', marginTop: tooltipHeight / 2, marginLeft: tooltipWidth }); } // Right Position else if (tooltipPosition === "right") { targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; targetLeft = origin.offset().left + originWidth + margin; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '+10px'; backdrop.css({ top: '-7px', left: 0, width: '14px', height: '14px', borderRadius: '0 14px 14px 0', transformOrigin: '5% 50%', marginTop: tooltipHeight / 2, marginLeft: '0px' }); } else { // Bottom Position targetTop = origin.offset().top + origin.outerHeight() + margin; targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipVerticalMovement = '+10px'; backdrop.css({ top: 0, left: 0, marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2) }); }
// Set tooptip css placement tooltipEl.css({ top: newCoordinates.y, left: newCoordinates.x });
// Calculate Scale to fill scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); scaleFactor = Math.max(scaleXFactor, scaleYFactor);
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }) .velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false }); backdrop.css({ visibility: 'visible' }) .velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }) .velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' }); };
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
// Mouse Out }, 'mouseleave.tooltip': function () { // Reset State started = false; clearTimeout(timeoutRef);
// Animate back setTimeout(function () { if (started !== true) { tooltipEl.velocity({ opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false }); backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, { duration: 225, queue: false, complete: function () { backdrop.css({ visibility: 'hidden' }); tooltipEl.css({ visibility: 'hidden' }); started = false; } }); } }, 225); } }); }); };
var repositionWithinScreen = function (x, y, width, height) { var newX = x; var newY = y;
if (newX < 0) { newX = 4; } else if (newX + width > window.innerWidth) { newX -= newX + width - window.innerWidth; }
if (newY < 0) { newY = 4; } else if (newY + height > window.innerHeight + $(window).scrollTop) { newY -= newY + height - window.innerHeight; }
return { x: newX, y: newY }; };
$(document).ready(function () { $('.tooltipped').tooltip(); });
}(jQuery));; /*!
* Waves v0.6.4 * http://fian.my.id/Waves * * Copyright 2014 Alfiana E. Sibuea and other contributors * Released under the MIT license * https://github.com/fians/Waves/blob/master/LICENSE */
(function (window) {
'use strict';
var Waves = Waves || {}; var $$ = document.querySelectorAll.bind(document);
// Find exact position of element function isWindow(obj) { return obj !== null && obj === obj.window; }
function getWindow(elem) { return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; }
function offset(elem) { var docElem, win, box = { top: 0, left: 0 }, doc = elem && elem.ownerDocument;
docElem = doc.documentElement;
if (typeof elem.getBoundingClientRect !== typeof undefined) { box = elem.getBoundingClientRect(); } win = getWindow(doc); return { top: box.top + win.pageYOffset - docElem.clientTop, left: box.left + win.pageXOffset - docElem.clientLeft }; }
function convertStyle(obj) { var style = ;
for (var a in obj) { if (obj.hasOwnProperty(a)) { style += (a + ':' + obj[a] + ';'); } }
return style; }
var Effect = {
// Effect delay duration: 750,
show: function (e, element) {
// Disable right click if (e.button === 2) { return false; }
var el = element || this;
// Create ripple var ripple = document.createElement('div'); ripple.className = 'waves-ripple'; el.appendChild(ripple);
// Get click coordinate and element witdh var pos = offset(el); var relativeY = (e.pageY - pos.top); var relativeX = (e.pageX - pos.left); var scale = 'scale(' + ((el.clientWidth / 100) * 10) + ')';
// Support for touch devices if ('touches' in e) { relativeY = (e.touches[0].pageY - pos.top); relativeX = (e.touches[0].pageX - pos.left); }
// Attach data to element ripple.setAttribute('data-hold', Date.now()); ripple.setAttribute('data-scale', scale); ripple.setAttribute('data-x', relativeX); ripple.setAttribute('data-y', relativeY);
// Set ripple position var rippleStyle = { 'top': relativeY + 'px', 'left': relativeX + 'px' };
ripple.className = ripple.className + ' waves-notransition'; ripple.setAttribute('style', convertStyle(rippleStyle)); ripple.className = ripple.className.replace('waves-notransition', );
// Scale the ripple rippleStyle['-webkit-transform'] = scale; rippleStyle['-moz-transform'] = scale; rippleStyle['-ms-transform'] = scale; rippleStyle['-o-transform'] = scale; rippleStyle.transform = scale; rippleStyle.opacity = '1';
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; rippleStyle['transition-duration'] = Effect.duration + 'ms';
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
ripple.setAttribute('style', convertStyle(rippleStyle)); },
hide: function (e) { TouchHandler.touchup(e);
var el = this; var width = el.clientWidth * 1.4;
// Get first ripple var ripple = null; var ripples = el.getElementsByClassName('waves-ripple'); if (ripples.length > 0) { ripple = ripples[ripples.length - 1]; } else { return false; }
var relativeX = ripple.getAttribute('data-x'); var relativeY = ripple.getAttribute('data-y'); var scale = ripple.getAttribute('data-scale');
// Get delay beetween mousedown and mouse leave var diff = Date.now() - Number(ripple.getAttribute('data-hold')); var delay = 350 - diff;
if (delay < 0) { delay = 0; }
// Fade out ripple after delay setTimeout(function () { var style = { 'top': relativeY + 'px', 'left': relativeX + 'px', 'opacity': '0',
// Duration '-webkit-transition-duration': Effect.duration + 'ms', '-moz-transition-duration': Effect.duration + 'ms', '-o-transition-duration': Effect.duration + 'ms', 'transition-duration': Effect.duration + 'ms', '-webkit-transform': scale, '-moz-transform': scale, '-ms-transform': scale, '-o-transform': scale, 'transform': scale, };
ripple.setAttribute('style', convertStyle(style));
setTimeout(function () { try { el.removeChild(ripple); } catch (e) { return false; } }, Effect.duration); }, delay); },
// Little hack to make <input> can perform waves effect wrapInput: function (elements) { for (var a = 0; a < elements.length; a++) { var el = elements[a];
if (el.tagName.toLowerCase() === 'input') { var parent = el.parentNode;
// If input already have parent just pass through if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { continue; }
// Put element class and style to the specified parent var wrapper = document.createElement('i'); wrapper.className = el.className + ' waves-input-wrapper';
var elementStyle = el.getAttribute('style');
if (!elementStyle) { elementStyle = ; }
wrapper.setAttribute('style', elementStyle);
el.className = 'waves-button-input'; el.removeAttribute('style');
// Put element as child parent.replaceChild(wrapper, el); wrapper.appendChild(el); } } } };
/** * Disable mousedown event for 500ms during and after touch */ var TouchHandler = { /* uses an integer rather than bool so there's no issues with * needing to clear timeouts if another touch event occurred * within the 500ms. Cannot mouseup between touchstart and * touchend, nor in the 500ms after touchend. */ touches: 0, allowEvent: function (e) { var allow = true;
if (e.type === 'touchstart') { TouchHandler.touches += 1; //push } else if (e.type === 'touchend' || e.type === 'touchcancel') { setTimeout(function () { if (TouchHandler.touches > 0) { TouchHandler.touches -= 1; //pop after 500ms } }, 500); } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { allow = false; }
return allow; }, touchup: function (e) { TouchHandler.allowEvent(e); } };
/** * Delegated click handler for .waves-effect element. * returns null when .waves-effect element not in "click tree" */ function getWavesEffectElement(e) { if (TouchHandler.allowEvent(e) === false) { return null; }
var element = null; var target = e.target || e.srcElement;
while (target.parentElement !== null) { if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { element = target; break; } else if (target.className.indexOf('waves-effect') !== -1) { element = target; break; } target = target.parentElement; }
return element; }
/** * Bubble the click and show effect if .waves-effect elem was found */ function showEffect(e) { var element = getWavesEffectElement(e);
if (element !== null) { Effect.show(e, element);
if ('ontouchstart' in window) { element.addEventListener('touchend', Effect.hide, false); element.addEventListener('touchcancel', Effect.hide, false); }
element.addEventListener('mouseup', Effect.hide, false); element.addEventListener('mouseleave', Effect.hide, false); } }
Waves.displayEffect = function (options) { options = options || {};
if ('duration' in options) { Effect.duration = options.duration; }
//Wrap input inside tag Effect.wrapInput($$('.waves-effect'));
if ('ontouchstart' in window) { document.body.addEventListener('touchstart', showEffect, false); }
document.body.addEventListener('mousedown', showEffect, false); };
/** * Attach Waves to an input element (or any element which doesn't * bubble mouseup/mousedown events). * Intended to be used with dynamically loaded forms/inputs, or * where the user doesn't want a delegated click handler. */ Waves.attach = function (element) { //FUTURE: automatically add waves classes and allow users // to specify them with an options param? Eg. light/classic/button if (element.tagName.toLowerCase() === 'input') { Effect.wrapInput([element]); element = element.parentElement; }
if ('ontouchstart' in window) { element.addEventListener('touchstart', showEffect, false); }
element.addEventListener('mousedown', showEffect, false); };
window.Waves = Waves;
document.addEventListener('DOMContentLoaded', function () { Waves.displayEffect(); }, false);
})(window);; Materialize.toast = function (message, displayLength, className, completeCallback) {
className = className || "";
var container = document.getElementById('toast-container');
// Create toast container if it does not exist if (container === null) { // create notification container container = document.createElement('div'); container.id = 'toast-container'; document.body.appendChild(container); }
// Select and append toast var newToast = createToast(message);
// only append toast if message is not undefined if (message) { container.appendChild(newToast); }
newToast.style.opacity = 0;
// Animate toast in Vel(newToast, { translateY: '-35px', opacity: 1 }, { duration: 300, easing: 'easeOutCubic', queue: false });
// Allows timer to be pause while being panned var timeLeft = displayLength; var counterInterval; if (timeLeft != null) { counterInterval = setInterval(function () { if (newToast.parentNode === null) window.clearInterval(counterInterval);
// If toast is not being dragged, decrease its time remaining if (!newToast.classList.contains('panning')) { timeLeft -= 20; }
if (timeLeft <= 0) { // Animate toast out Vel(newToast, { "opacity": 0, marginTop: '-40px' }, { duration: 375, easing: 'easeOutExpo', queue: false, complete: function () { // Call the optional callback if (typeof (completeCallback) === "function") completeCallback(); // Remove toast after it times out this[0].parentNode.removeChild(this[0]); } }); window.clearInterval(counterInterval); } }, 20); }
function createToast(html) {
// Create toast var toast = document.createElement('div'); toast.classList.add('toast'); if (className) { var classes = className.split(' ');
for (var i = 0, count = classes.length; i < count; i++) { toast.classList.add(classes[i]); } } // If type of parameter is HTML Element if (typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName === "string") { toast.appendChild(html); } else if (html instanceof jQuery) { // Check if it is jQuery object toast.appendChild(html[0]); } else { // Insert as text; toast.innerHTML = html; } // Bind hammer var hammerHandler = new Hammer(toast, { prevent_default: false }); hammerHandler.on('pan', function (e) { var deltaX = e.deltaX; var activationDistance = 80;
// Change toast state if (!toast.classList.contains('panning')) { toast.classList.add('panning'); }
var opacityPercent = 1 - Math.abs(deltaX / activationDistance); if (opacityPercent < 0) opacityPercent = 0;
Vel(toast, { left: deltaX, opacity: opacityPercent }, { duration: 50, queue: false, easing: 'easeOutQuad' });
});
hammerHandler.on('panend', function (e) { var deltaX = e.deltaX; var activationDistance = 80;
// If toast dragged past activation point if (Math.abs(deltaX) > activationDistance) { Vel(toast, { marginTop: '-40px' }, { duration: 375, easing: 'easeOutExpo', queue: false, complete: function () { if (typeof (completeCallback) === "function") { completeCallback(); } toast.parentNode.removeChild(toast); } });
} else { toast.classList.remove('panning'); // Put toast back into original position Vel(toast, { left: 0, opacity: 1 }, { duration: 300, easing: 'easeOutExpo', queue: false });
} });
return toast; }
};; (function ($) {
var methods = { init: function (options) { var defaults = { menuWidth: 300, edge: 'left', closeOnClick: false, draggable: true, onOpen: null, onClose: null }; options = $.extend(defaults, options);
$(this).each(function () { var $this = $(this); var menuId = $this.attr('data-activates'); var menu = $("#" + menuId);
// Set to width if (options.menuWidth != 300) { menu.css('width', options.menuWidth); }
// Add Touch Area var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); if (options.draggable) { // Regenerate dragTarget if ($dragTarget.length) { $dragTarget.remove(); }$dragTarget = $('').attr('data-sidenav', menuId);
$('body').append($dragTarget); } else { $dragTarget = $(); }
if (options.edge == 'left') { menu.css('transform', 'translateX(-100%)'); $dragTarget.css({ 'left': 0 }); // Add Touch Area } else { menu.addClass('right-aligned') // Change text-alignment to right .css('transform', 'translateX(100%)'); $dragTarget.css({ 'right': 0 }); // Add Touch Area }
// If fixed sidenav, bring menu out if (menu.hasClass('fixed')) { if (window.innerWidth > 992) { menu.css('transform', 'translateX(0)'); } }
// Window resize to reset on large screens fixed if (menu.hasClass('fixed')) { $(window).resize(function () { if (window.innerWidth > 992) { // Close menu if window is resized bigger than 992 and user has fixed sidenav if ($('#sidenav-overlay').length !== 0 && menuOut) { removeMenu(true); } else { // menu.removeAttr('style'); menu.css('transform', 'translateX(0%)'); // menu.css('width', options.menuWidth); } } else if (menuOut === false) { if (options.edge === 'left') { menu.css('transform', 'translateX(-100%)'); } else { menu.css('transform', 'translateX(100%)'); }
}
}); }
// if closeOnClick, then add close event for all a tags in side sideNav if (options.closeOnClick === true) { menu.on("click.itemclick", "a:not(.collapsible-header)", function () { if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) { removeMenu(); } }); }
var removeMenu = function (restoreNav) { panning = false; menuOut = false; // Reenable scrolling $('body').css({ overflow: , width: });
$('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } }); if (options.edge === 'left') { // Reset phantom div $dragTarget.css({ width: , right: , left: '0' }); menu.velocity({ 'translateX': '-100%' }, { duration: 200, queue: false, easing: 'easeOutCubic', complete: function () { if (restoreNav === true) { // Restore Fixed sidenav menu.removeAttr('style'); menu.css('width', options.menuWidth); } }
}); } else { // Reset phantom div $dragTarget.css({ width: , right: '0', left: }); menu.velocity({ 'translateX': '100%' }, { duration: 200, queue: false, easing: 'easeOutCubic', complete: function () { if (restoreNav === true) { // Restore Fixed sidenav menu.removeAttr('style'); menu.css('width', options.menuWidth); } } }); }
// Callback if (typeof (options.onClose) === 'function') { options.onClose.call(this, menu); } }
// Touch Event var panning = false; var menuOut = false;
if (options.draggable) { $dragTarget.on('click', function () { if (menuOut) { removeMenu(); } });
$dragTarget.hammer({ prevent_default: false }).on('pan', function (e) {
if (e.gesture.pointerType == "touch") {
var direction = e.gesture.direction; var x = e.gesture.center.x; var y = e.gesture.center.y; var velocityX = e.gesture.velocityX;
// Vertical scroll bugfix if (x === 0 && y === 0) { return; }
// Disable Scrolling var $body = $('body'); var $overlay = $('#sidenav-overlay'); var oldWidth = $body.innerWidth(); $body.css('overflow', 'hidden'); $body.width(oldWidth);
// If overlay does not exist, create one and if it is clicked, close menu if ($overlay.length === 0) {$overlay = $('');
$overlay.css('opacity', 0).click(function () { removeMenu(); });
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable if (typeof (options.onOpen) === 'function') { options.onOpen.call(this, menu); }
$('body').append($overlay); }
// Keep within boundaries if (options.edge === 'left') { if (x > options.menuWidth) { x = options.menuWidth; } else if (x < 0) { x = 0; } }
if (options.edge === 'left') { // Left Direction if (x < (options.menuWidth / 2)) { menuOut = false; } // Right Direction else if (x >= (options.menuWidth / 2)) { menuOut = true; } menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); } else { // Left Direction if (x < (window.innerWidth - options.menuWidth / 2)) { menuOut = true; } // Right Direction else if (x >= (window.innerWidth - options.menuWidth / 2)) { menuOut = false; } var rightPos = (x - options.menuWidth / 2); if (rightPos < 0) { rightPos = 0; }
menu.css('transform', 'translateX(' + rightPos + 'px)'); }
// Percentage overlay var overlayPerc; if (options.edge === 'left') { overlayPerc = x / options.menuWidth; $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); } else { overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); } }
}).on('panend', function (e) {
if (e.gesture.pointerType == "touch") { var $overlay = $('#sidenav-overlay'); var velocityX = e.gesture.velocityX; var x = e.gesture.center.x; var leftPos = x - options.menuWidth; var rightPos = x - options.menuWidth / 2; if (leftPos > 0) { leftPos = 0; } if (rightPos < 0) { rightPos = 0; } panning = false;
if (options.edge === 'left') { // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) { // Return menu to open if (leftPos !== 0) { menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); }
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); $dragTarget.css({ width: '50%', right: 0, left: }); menuOut = true; } else if (!menuOut || velocityX > 0.3) { // Enable Scrolling $('body').css({ overflow: , width: }); // Slide menu closed menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { // Run 'onClose' when sidenav is closed via touch/swipe if applicable if (typeof (options.onClose) === 'function') { options.onClose.call(this, menu); }
$(this).remove(); } }); $dragTarget.css({ width: '10px', right: , left: 0 }); } } else { if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) { // Return menu to open if (rightPos !== 0) { menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); }
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); $dragTarget.css({ width: '50%', right: , left: 0 }); menuOut = true; } else if (!menuOut || velocityX < -0.3) { // Enable Scrolling $('body').css({ overflow: , width: });
// Slide menu closed menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } }); $dragTarget.css({ width: '10px', right: 0, left: }); } }
} }); }
$this.off('click.sidenav').on('click.sidenav', function () { if (menuOut === true) { menuOut = false; panning = false; removeMenu(); } else {
// Disable Scrolling var $body = $('body');var $overlay = $('');
var oldWidth = $body.innerWidth(); $body.css('overflow', 'hidden'); $body.width(oldWidth);
// Push current drag target on top of DOM tree $('body').append($dragTarget);
if (options.edge === 'left') { $dragTarget.css({ width: '50%', right: 0, left: }); menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } else { $dragTarget.css({ width: '50%', right: , left: 0 }); menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); }
$overlay.css('opacity', 0) .click(function () { menuOut = false; panning = false; removeMenu(); $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } });
}); $('body').append($overlay); $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { menuOut = true; panning = false; } });
// Callback if (typeof (options.onOpen) === 'function') { options.onOpen.call(this, menu); } }
return false; }); });
}, destroy: function () { var $overlay = $('#sidenav-overlay'); var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); $overlay.trigger('click'); $dragTarget.remove(); $(this).off('click'); $overlay.remove(); }, show: function () { this.trigger('click'); }, hide: function () { $('#sidenav-overlay').trigger('click'); } };
$.fn.sideNav = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav'); } }; // Plugin end
}(jQuery));; /**
* Extend jquery with a scrollspy plugin. * This watches the window scroll and fires events when elements are scrolled into viewport. * * throttle() and getTime() taken from Underscore.js * https://github.com/jashkenas/underscore * * @author Copyright 2013 John Smart * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE * @see https://github.com/thesmart * @version 0.1.2 */
(function ($) {
var jWindow = $(window); var elements = []; var elementsInView = []; var isSpying = false; var ticks = 0; var unique_id = 1; var offset = { top: 0, right: 0, bottom: 0, left: 0, }
/** * Find elements that are within the boundary * @param {number} top * @param {number} right * @param {number} bottom * @param {number} left * @return {jQuery} A collection of elements */ function findElements(top, right, bottom, left) { var hits = $(); $.each(elements, function (i, element) { if (element.height() > 0) { var elTop = element.offset().top, elLeft = element.offset().left, elRight = elLeft + element.width(), elBottom = elTop + element.height();
var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
if (isIntersect) { hits.push(element); } } });
return hits; }
/** * Called when the user scrolls the window */ function onScroll(scrollOffset) { // unique tick id ++ticks;
// viewport rectangle var top = jWindow.scrollTop(), left = jWindow.scrollLeft(), right = left + jWindow.width(), bottom = top + jWindow.height();
// determine which elements are in view var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left); $.each(intersections, function (i, element) {
var lastTick = element.data('scrollSpy:ticks'); if (typeof lastTick != 'number') { // entered into view element.triggerHandler('scrollSpy:enter'); }
// update tick id element.data('scrollSpy:ticks', ticks); });
// determine which elements are no longer in view $.each(elementsInView, function (i, element) { var lastTick = element.data('scrollSpy:ticks'); if (typeof lastTick == 'number' && lastTick !== ticks) { // exited from view element.triggerHandler('scrollSpy:exit'); element.data('scrollSpy:ticks', null); } });
// remember elements in view for next tick elementsInView = intersections; }
/** * Called when window is resized */ function onWinSize() { jWindow.trigger('scrollSpy:winSize'); }
/**
* Enables ScrollSpy using a selector * @param {jQuery|string} selector The elements collection, or a selector * @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms offsetTop : number -> offset from top. Default: 0 offsetRight : number -> offset from right. Default: 0 offsetBottom : number -> offset from bottom. Default: 0 offsetLeft : number -> offset from left. Default: 0
activeClass : string -> Class name to be added to the active link. Default: active * @returns {jQuery} */
$.scrollSpy = function (selector, options) { var defaults = { throttle: 100, scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll activeClass: 'active', getActiveElement: function (id) { return 'a[href="#' + id + '"]'; } }; options = $.extend(defaults, options);
var visible = []; selector = $(selector); selector.each(function (i, element) { elements.push($(element)); $(element).data("scrollSpy:id", i); // Smooth scroll to section $('a[href="#' + $(element).attr('id') + '"]').click(function (e) { e.preventDefault(); var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' }); }); });
offset.top = options.offsetTop || 0; offset.right = options.offsetRight || 0; offset.bottom = options.offsetBottom || 0; offset.left = options.offsetLeft || 0;
var throttledScroll = Materialize.throttle(function () { onScroll(options.scrollOffset); }, options.throttle || 100); var readyScroll = function () { $(document).ready(throttledScroll); };
if (!isSpying) { jWindow.on('scroll', readyScroll); jWindow.on('resize', readyScroll); isSpying = true; }
// perform a scan once, after current execution context, and after dom is ready setTimeout(readyScroll, 0);
selector.on('scrollSpy:enter', function () { visible = $.grep(visible, function (value) { return value.height() != 0; });
var $this = $(this);
if (visible[0]) { $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { visible.unshift($(this)); } else { visible.push($(this)); } } else { visible.push($(this)); }
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); }); selector.on('scrollSpy:exit', function () { visible = $.grep(visible, function (value) { return value.height() != 0; });
if (visible[0]) { $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); var $this = $(this); visible = $.grep(visible, function (value) { return value.attr('id') != $this.attr('id'); }); if (visible[0]) { // Check if empty $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); } } });
return selector; };
/** * Listen for window resize events * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms * @returns {jQuery} $(window) */ $.winSizeSpy = function (options) { $.winSizeSpy = function () { return jWindow; }; // lock from multiple calls options = options || { throttle: 100 }; return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); };
/** * Enables ScrollSpy on a collection of elements * e.g. $('.scrollSpy').scrollSpy() * @param {Object=} options Optional. throttle : number -> scrollspy throttling. Default: 100 ms offsetTop : number -> offset from top. Default: 0 offsetRight : number -> offset from right. Default: 0 offsetBottom : number -> offset from bottom. Default: 0 offsetLeft : number -> offset from left. Default: 0 * @returns {jQuery} */ $.fn.scrollSpy = function (options) { return $.scrollSpy($(this), options); };
})(jQuery);; (function ($) {
$(document).ready(function () {
// Function to update labels of text fields Materialize.updateTextFields = function () { var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; $(input_selector).each(function (index, element) { var $this = $(this); if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { $this.siblings('label').addClass('active'); } else if ($(element)[0].validity) { $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); } else { $this.siblings('label').removeClass('active'); } }); };
// Text based inputs var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
// Add active if form auto complete $(document).on('change', input_selector, function () { if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { $(this).siblings('label').addClass('active'); } validate_field($(this)); });
// Add active if input element has been pre-populated on document ready $(document).ready(function () { Materialize.updateTextFields(); });
// HTML DOM FORM RESET handling $(document).on('reset', function (e) { var formReset = $(e.target); if (formReset.is('form')) { formReset.find(input_selector).removeClass('valid').removeClass('invalid'); formReset.find(input_selector).each(function () { if ($(this).attr('value') === ) { $(this).siblings('label').removeClass('active'); } });
// Reset select formReset.find('select.initialized').each(function () { var reset_text = formReset.find('option[selected]').text(); formReset.siblings('input.select-dropdown').val(reset_text); }); } });
// Add active when element has focus $(document).on('focus', input_selector, function () { $(this).siblings('label, .prefix').addClass('active'); });
$(document).on('blur', input_selector, function () { var $inputElement = $(this); var selector = ".prefix";
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { selector += ", label"; }
$inputElement.siblings(selector).removeClass('active');
validate_field($inputElement); });
window.validate_field = function (object) { var hasLength = object.attr('data-length') !== undefined; var lenAttr = parseInt(object.attr('data-length')); var len = object.val().length;
if (object.val().length === 0 && object[0].validity.badInput === false) { if (object.hasClass('validate')) { object.removeClass('valid'); object.removeClass('invalid'); } } else { if (object.hasClass('validate')) { // Check for character counter attributes if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) { object.removeClass('invalid'); object.addClass('valid'); } else { object.removeClass('valid'); object.addClass('invalid'); } } } };
// Radio and Checkbox focus class var radio_checkbox = 'input[type=radio], input[type=checkbox]'; $(document).on('keyup.radio', radio_checkbox, function (e) { // TAB, check if tabbing to radio or checkbox. if (e.which === 9) { $(this).addClass('tabbed'); var $this = $(this); $this.one('blur', function (e) {
$(this).removeClass('tabbed'); }); return; } });
// Textarea Auto Resize var hiddenDiv = $('.hiddendiv').first(); if (!hiddenDiv.length) {hiddenDiv = $('');
$('body').append(hiddenDiv); } var text_area_selector = '.materialize-textarea';
function textareaAutoResize($textarea) { // Set font properties of hiddenDiv
var fontFamily = $textarea.css('font-family'); var fontSize = $textarea.css('font-size'); var lineHeight = $textarea.css('line-height');
if (fontSize) { hiddenDiv.css('font-size', fontSize); } if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
// Set original-height, if none if (!$textarea.data('original-height')) { $textarea.data('original-height', $textarea.height()); }
if ($textarea.attr('wrap') === 'off') { hiddenDiv.css('overflow-wrap', 'normal') .css('white-space', 'pre'); }
hiddenDiv.text($textarea.val() + '\n'); var content = hiddenDiv.html().replace(/\n/g, '
'); hiddenDiv.html(content);
// When textarea is hidden, width goes crazy. // Approximate with half of window size
if ($textarea.is(':visible')) { hiddenDiv.css('width', $textarea.width()); } else { hiddenDiv.css('width', $(window).width() / 2); }
/** * Resize if the new height is greater than the * original height of the textarea */ if ($textarea.data('original-height') <= hiddenDiv.height()) { $textarea.css('height', hiddenDiv.height()); } else if ($textarea.val().length < $textarea.data('previous-length')) { /** * In case the new height is less than original height, it * means the textarea has less text than before * So we set the height to the original one */ $textarea.css('height', $textarea.data('original-height')); } $textarea.data('previous-length', $textarea.val().length); }
$(text_area_selector).each(function () { var $textarea = $(this); /** * Instead of resizing textarea on document load, * store the original height and the original length */ $textarea.data('original-height', $textarea.height()); $textarea.data('previous-length', $textarea.val().length); });
$('body').on('keyup keydown autoresize', text_area_selector, function () { textareaAutoResize($(this)); });
// File Input Path $(document).on('change', '.file-field input[type="file"]', function () { var file_field = $(this).closest('.file-field'); var path_input = file_field.find('input.file-path'); var files = $(this)[0].files; var file_names = []; for (var i = 0; i < files.length; i++) { file_names.push(files[i].name); } path_input.val(file_names.join(", ")); path_input.trigger('change'); });
/**************** * Range Input * ****************/
var range_type = 'input[type=range]'; var range_mousedown = false; var left;
$(range_type).each(function () {
var thumb = $('');
$(this).after(thumb);
});
var showRangeBubble = function (thumb) { var paddingLeft = parseInt(thumb.parent().css('padding-left')); var marginLeft = (-7 + paddingLeft) + 'px'; thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' }); };
var calcRangeOffset = function (range) { var width = range.width() - 15; var max = parseFloat(range.attr('max')); var min = parseFloat(range.attr('min')); var percent = (parseFloat(range.val()) - min) / (max - min); return percent * width; }
var range_wrapper = '.range-field'; $(document).on('change', range_type, function (e) { var thumb = $(this).siblings('.thumb'); thumb.find('.value').html($(this).val());
if (!thumb.hasClass('active')) { showRangeBubble(thumb); }
var offsetLeft = calcRangeOffset($(this)); thumb.addClass('active').css('left', offsetLeft); });
$(document).on('mousedown touchstart', range_type, function (e) { var thumb = $(this).siblings('.thumb');
// If thumb indicator does not exist yet, create it
if (thumb.length <= 0) {
thumb = $('');
$(this).after(thumb);
}
// Set indicator value thumb.find('.value').html($(this).val());
range_mousedown = true; $(this).addClass('active');
if (!thumb.hasClass('active')) { showRangeBubble(thumb); }
if (e.type !== 'input') { var offsetLeft = calcRangeOffset($(this)); thumb.addClass('active').css('left', offsetLeft); } });
$(document).on('mouseup touchend', range_wrapper, function () { range_mousedown = false; $(this).removeClass('active'); });
$(document).on('input mousemove touchmove', range_wrapper, function (e) { var thumb = $(this).children('.thumb'); var left; var input = $(this).find(range_type);
if (range_mousedown) { if (!thumb.hasClass('active')) { showRangeBubble(thumb); }
var offsetLeft = calcRangeOffset(input); thumb.addClass('active').css('left', offsetLeft); thumb.find('.value').html(thumb.siblings(range_type).val()); } });
$(document).on('mouseout touchleave', range_wrapper, function () { if (!range_mousedown) {
var thumb = $(this).children('.thumb'); var paddingLeft = parseInt($(this).css('padding-left')); var marginLeft = (7 + paddingLeft) + 'px';
if (thumb.hasClass('active')) { thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 }); } thumb.removeClass('active'); } });
/************************** * Auto complete plugin * *************************/ $.fn.autocomplete = function (options) { // Defaults var defaults = { data: {}, limit: Infinity, onAutocomplete: null, minLength: 1 };
options = $.extend(defaults, options);
return this.each(function () { var $input = $(this); var data = options.data, count = 0, activeIndex = -1, oldVal, $inputDiv = $input.closest('.input-field'); // Div to append on
// Check if data isn't empty if (!$.isEmptyObject(data)) {var $autocomplete = $('
var $oldAutocomplete;
// Append autocomplete element. // Prevent double structure init. if ($inputDiv.length) { $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); if (!$oldAutocomplete.length) { $inputDiv.append($autocomplete); // Set ul in body } } else { $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); if (!$oldAutocomplete.length) { $input.after($autocomplete); } } if ($oldAutocomplete.length) { $autocomplete = $oldAutocomplete; }
// Highlight partial match.
var highlight = function (string, $el) {
var img = $el.find('img');
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
matchEnd = matchStart + string.length - 1,
beforeMatch = $el.text().slice(0, matchStart),
matchText = $el.text().slice(matchStart, matchEnd + 1),
afterMatch = $el.text().slice(matchEnd + 1);
$el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
if (img.length) {
$el.prepend(img);
}
};
// Reset current element position var resetCurrentElement = function () { activeIndex = -1; $autocomplete.find('.active').removeClass('active'); }
// Remove autocomplete elements var removeAutocomplete = function () { $autocomplete.empty(); resetCurrentElement(); oldVal = undefined; };
$input.off('blur.autocomplete').on('blur.autocomplete', function () { removeAutocomplete(); });
// Perform search $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { // Reset count. count = 0; var val = $input.val().toLowerCase();
// Don't capture enter or arrow key usage. if (e.which === 13 || e.which === 38 || e.which === 40) { return; }
// Check if the input isn't empty if (oldVal !== val) { removeAutocomplete();
if (val.length >= options.minLength) { for (var key in data) { if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1 && key.toLowerCase() !== val) { // Break if past limit if (count >= options.limit) { break; }var autocompleteOption = $('');
if (!!data[key]) { autocompleteOption.append('<img src="' + data[key] + '" class="right circle">' + key + ''); } else { autocompleteOption.append('' + key + ''); }
$autocomplete.append(autocompleteOption); highlight(val, autocompleteOption); count++; } } } }
// Update oldVal oldVal = val; });
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { // Arrow keys and enter key usage var keyCode = e.which, liElement, numItems = $autocomplete.children('li').length, $active = $autocomplete.children('.active').first();
// select element on Enter if (keyCode === 13 && activeIndex >= 0) { liElement = $autocomplete.children('li').eq(activeIndex); if (liElement.length) { liElement.trigger('mousedown.autocomplete'); e.preventDefault(); } return; }
// Capture up and down key if (keyCode === 38 || keyCode === 40) { e.preventDefault();
if (keyCode === 38 && activeIndex > 0) { activeIndex--; }
if (keyCode === 40 && activeIndex < (numItems - 1)) { activeIndex++; }
$active.removeClass('active'); if (activeIndex >= 0) { $autocomplete.children('li').eq(activeIndex).addClass('active'); } } });
// Set input value $autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { var text = $(this).text().trim(); $input.val(text); $input.trigger('change'); removeAutocomplete();
// Handle onAutocomplete callback. if (typeof (options.onAutocomplete) === "function") { options.onAutocomplete.call(this, text); } }); } }); };
}); // End of $(document).ready
/******************* * Select Plugin * ******************/ $.fn.material_select = function (callback) { $(this).each(function () { var $select = $(this);
if ($select.hasClass('browser-default')) { return; // Continue to next (return false breaks out of entire loop) }
var multiple = $select.attr('multiple') ? true : false, lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
if (lastID) { $select.parent().find('span.caret').remove(); $select.parent().find('input').remove();
$select.unwrap(); $('ul#select-options-' + lastID).remove(); }
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state. if (callback === 'destroy') { $select.data('select-id', null).removeClass('initialized'); return; }
var uniqueID = Materialize.guid(); $select.data('select-id', uniqueID);var wrapper = $('');
wrapper.addClass($select.attr('class'));var options = $('
selectChildren = $select.children('option, optgroup'), valuesSelected = [], optionsHover = false;
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
// Function that renders and appends the option taking into // account type and possible image icon. var appendOptionWithIcon = function (select, option, type) { // Add disabled attr if disabled var disabledClass = (option.is(':disabled')) ? 'disabled ' : ; var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ; var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ;
// add icons var icon_url = option.data('icon'); var classes = option.attr('class'); if (!!icon_url) { var classString = ; if (!!classes) classString = ' class="' + classes + '"';
// Check for multiple type.options.append($('
return true; }
// Check for multiple type.options.append($('
};
/* Create dropdown structure. */ if (selectChildren.length) { selectChildren.each(function () { if ($(this).is('option')) { // Direct descendant option. if (multiple) { appendOptionWithIcon($select, $(this), 'multiple');
} else { appendOptionWithIcon($select, $(this)); } } else if ($(this).is('optgroup')) { // Optgroup. var selectOptions = $(this).children('option');options.append($('
selectOptions.each(function () { appendOptionWithIcon($select, $(this), 'optgroup-option'); }); } }); }
options.find('li:not(.optgroup)').each(function (i) { $(this).click(function (e) { // Check if option element is disabled if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { var selected = true;
if (multiple) { $('input[type="checkbox"]', this).prop('checked', function (i, v) { return !v; }); selected = toggleEntryFromArray(valuesSelected, i, $select); $newSelect.trigger('focus'); } else { options.find('li').removeClass('active'); $(this).toggleClass('active'); $newSelect.val($(this).text()); }
activateOption(options, $(this)); $select.find('option').eq(i).prop('selected', selected); // Trigger onchange() event $select.trigger('change'); if (typeof callback !== 'undefined') callback(); }
e.stopPropagation(); }); });
// Wrap Elements
$select.wrap(wrapper);
// Add Select Display Element
var dropdownIcon = $('▼');
if ($select.is(':disabled'))
dropdownIcon.addClass('disabled');
// escape double quotes var sanitizedLabelHtml = label.replace(/"/g, '"');
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : ) + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>'); $select.before($newSelect); $newSelect.before(dropdownIcon);
$newSelect.after(options); // Check if section element is disabled if (!$select.is(':disabled')) { $newSelect.dropdown({ 'hover': false }); }
// Copy tabindex if ($select.attr('tabindex')) { $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); }
$select.addClass('initialized');
$newSelect.on({ 'focus': function () { if ($('ul.select-dropdown').not(options[0]).is(':visible')) { $('input.select-dropdown').trigger('close'); } if (!options.is(':visible')) { $(this).trigger('open', ['focus']); var label = $(this).val(); if (multiple && label.indexOf(',') >= 0) { label = label.split(',')[0]; }
var selectedOption = options.find('li').filter(function () { return $(this).text().toLowerCase() === label.toLowerCase(); })[0]; activateOption(options, selectedOption, true); } }, 'click': function (e) { e.stopPropagation(); } });
$newSelect.on('blur', function () { if (!multiple) { $(this).trigger('close'); } options.find('li.selected').removeClass('selected'); });
options.hover(function () { optionsHover = true; }, function () { optionsHover = false; });
$(window).on({ 'click': function () { multiple && (optionsHover || $newSelect.trigger('close')); } });
// Add initial multiple selections. if (multiple) { $select.find("option:selected:not(:disabled)").each(function () { var index = $(this).index();
toggleEntryFromArray(valuesSelected, index, $select); options.find("li").eq(index).find(":checkbox").prop("checked", true); }); }
/** * Make option as selected and scroll to selected position * @param {jQuery} collection Select options jQuery element * @param {Element} newOption element of the new option * @param {Boolean} firstActivation If on first activation of select */ var activateOption = function (collection, newOption, firstActivation) { if (newOption) { collection.find('li.selected').removeClass('selected'); var option = $(newOption); option.addClass('selected'); if (!multiple || !!firstActivation) { options.scrollTo(option); } } };
// Allow user to search by typing // this array is cleared after 1 second var filterQuery = [], onKeyDown = function (e) { // TAB - switch to another input if (e.which == 9) { $newSelect.trigger('close'); return; }
// ARROW DOWN WHEN SELECT IS CLOSED - open select options if (e.which == 40 && !options.is(':visible')) { $newSelect.trigger('open'); return; }
// ENTER WHEN SELECT IS CLOSED - submit form if (e.which == 13 && !options.is(':visible')) { return; }
e.preventDefault();
// CASE WHEN USER TYPE LETTERS var letter = String.fromCharCode(e.which).toLowerCase(), nonLetters = [9, 13, 27, 38, 40]; if (letter && (nonLetters.indexOf(e.which) === -1)) { filterQuery.push(letter);
var string = filterQuery.join(), newOption = options.find('li').filter(function () { return $(this).text().toLowerCase().indexOf(string) === 0; })[0];
if (newOption) { activateOption(options, newOption); } }
// ENTER - select option and close when select options are opened if (e.which == 13) { var activeOption = options.find('li.selected:not(.disabled)')[0]; if (activeOption) { $(activeOption).trigger('click'); if (!multiple) { $newSelect.trigger('close'); } } }
// ARROW DOWN - move to next not disabled option if (e.which == 40) { if (options.find('li.selected').length) { newOption = options.find('li.selected').next('li:not(.disabled)')[0]; } else { newOption = options.find('li:not(.disabled)')[0]; } activateOption(options, newOption); }
// ESC - close options if (e.which == 27) { $newSelect.trigger('close'); }
// ARROW UP - move to previous not disabled option if (e.which == 38) { newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; if (newOption) activateOption(options, newOption); }
// Automaticaly clean filter query so user can search again by starting letters setTimeout(function () { filterQuery = []; }, 1000); };
$newSelect.on('keydown', onKeyDown); });
function toggleEntryFromArray(entriesArray, entryIndex, select) { var index = entriesArray.indexOf(entryIndex), notAdded = index === -1;
if (notAdded) { entriesArray.push(entryIndex); } else { entriesArray.splice(index, 1); }
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
// use notAdded instead of true (to detect if the option is selected or not) select.find('option').eq(entryIndex).prop('selected', notAdded); setValueToInput(entriesArray, select);
return notAdded; }
function setValueToInput(entriesArray, select) { var value = ;
for (var i = 0, count = entriesArray.length; i < count; i++) { var text = select.find('option').eq(entriesArray[i]).text();
i === 0 ? value += text : value += ', ' + text; }
if (value === ) { value = select.find('option:disabled').eq(0).text(); }
select.siblings('input.select-dropdown').val(value); } };
}(jQuery));; (function ($) {
var methods = {
init: function (options) { var defaults = { indicators: true, height: 400, transition: 500, interval: 6000 }; options = $.extend(defaults, options);
return this.each(function () {
// For each slider, we want to keep track of // which slide is active and its associated content var $this = $(this); var $slider = $this.find('ul.slides').first(); var $slides = $slider.find('> li'); var $active_index = $slider.find('.active').index(); var $active, $indicators, $interval; if ($active_index != -1) { $active = $slides.eq($active_index); }
// Transitions the caption depending on alignment function captionTransition(caption, duration) { if (caption.hasClass("center-align")) { caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false }); } else if (caption.hasClass("right-align")) { caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false }); } else if (caption.hasClass("left-align")) { caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false }); } }
// This function will transition the slide to any index of the next slide function moveToSlide(index) { // Wrap around indices. if (index >= $slides.length) index = 0; else if (index < 0) index = $slides.length - 1;
$active_index = $slider.find('.active').index();
// Only do if index changes if ($active_index != index) { $active = $slides.eq($active_index); $caption = $active.find('.caption');
$active.removeClass('active'); $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad', complete: function () { $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false }); } }); captionTransition($caption, options.transition);
// Update indicators if (options.indicators) { $indicators.eq($active_index).removeClass('active'); }
$slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' }); $slides.eq(index).addClass('active');
// Update indicators if (options.indicators) { $indicators.eq(index).addClass('active'); } } }
// Set height of slider // If fullscreen, do nothing if (!$this.hasClass('fullscreen')) { if (options.indicators) { // Add height if indicators are present $this.height(options.height + 40); } else { $this.height(options.height); } $slider.height(options.height); }
// Set initial positions of captions $slides.find('.caption').each(function () { captionTransition($(this), 0); });
// Move img src into background-image $slides.find('img').each(function () { var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; if ($(this).attr('src') !== placeholderBase64) { $(this).css('background-image', 'url("' + $(this).attr('src') + '")'); $(this).attr('src', placeholderBase64); } });
// dynamically add indicators if (options.indicators) {$indicators = $('
$slides.each(function (index) {var $indicator = $('');
// Handle clicks on indicators $indicator.click(function () { var $parent = $slider.parent(); var curr_index = $parent.find($(this)).index(); moveToSlide(curr_index);
// reset interval clearInterval($interval); $interval = setInterval( function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval ); }); $indicators.append($indicator); }); $this.append($indicators); $indicators = $this.find('ul.indicators').find('li.indicator-item'); }
if ($active) { $active.show(); } else { $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$active_index = 0; $active = $slides.eq($active_index);
// Update indicators if (options.indicators) { $indicators.eq($active_index).addClass('active'); } }
// Adjust height to current slide $active.find('img').each(function () { $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); });
// auto scroll $interval = setInterval( function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index + 1);
}, options.transition + options.interval );
// HammerJS, Swipe navigation
// Touch Event var panning = false; var swipeLeft = false; var swipeRight = false;
$this.hammer({ prevent_default: false }).on('pan', function (e) { if (e.gesture.pointerType === "touch") {
// reset interval clearInterval($interval);
var direction = e.gesture.direction; var x = e.gesture.deltaX; var velocityX = e.gesture.velocityX; var velocityY = e.gesture.velocityY;
$curr_slide = $slider.find('.active'); if (Math.abs(velocityX) > Math.abs(velocityY)) { $curr_slide.velocity({ translateX: x }, { duration: 50, queue: false, easing: 'easeOutQuad' }); }
// Swipe Left if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) { swipeRight = true; } // Swipe Right else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) { swipeLeft = true; }
// Make Slide Behind active slide visible var next_slide; if (swipeLeft) { next_slide = $curr_slide.next(); if (next_slide.length === 0) { next_slide = $slides.first(); } next_slide.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } if (swipeRight) { next_slide = $curr_slide.prev(); if (next_slide.length === 0) { next_slide = $slides.last(); } next_slide.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); }
}
}).on('panend', function (e) { if (e.gesture.pointerType === "touch") {
$curr_slide = $slider.find('.active'); panning = false; curr_index = $slider.find('.active').index();
if (!swipeRight && !swipeLeft || $slides.length <= 1) { // Return to original spot $curr_slide.velocity({ translateX: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } else if (swipeLeft) { moveToSlide(curr_index + 1); $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); } }); } else if (swipeRight) { moveToSlide(curr_index - 1); $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); } }); } swipeLeft = false; swipeRight = false;
// Restart interval clearInterval($interval); $interval = setInterval( function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval ); } });
$this.on('sliderPause', function () { clearInterval($interval); });
$this.on('sliderStart', function () { clearInterval($interval); $interval = setInterval( function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval ); });
$this.on('sliderNext', function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index + 1); });
$this.on('sliderPrev', function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index - 1); });
});
}, pause: function () { $(this).trigger('sliderPause'); }, start: function () { $(this).trigger('sliderStart'); }, next: function () { $(this).trigger('sliderNext'); }, prev: function () { $(this).trigger('sliderPrev'); } };
$.fn.slider = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip'); } }; // Plugin end
}(jQuery));; (function ($) {
$(document).ready(function () {
$(document).on('click.card', '.card', function (e) { if ($(this).find('> .card-reveal').length) { var $card = $(e.target).closest('.card'); if ($card.data('initialOverflow') === undefined) { $card.data( 'initialOverflow', $card.css('overflow') === undefined ? : $card.css('overflow') ); } if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { // Make Reveal animate down and display none $(this).find('.card-reveal').velocity({ translateY: 0 }, { duration: 225, queue: false, easing: 'easeInOutQuad', complete: function () { $(this).css({ display: 'none' }); $card.css('overflow', $card.data('initialOverflow')); } }); } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) { $card.css('overflow', 'hidden'); $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' }); } } });
});
}(jQuery));; (function ($) {
var materialChipsDefaults = { data: [], placeholder: , secondaryPlaceholder: , autocompleteOptions: {}, };
$(document).ready(function () { // Handle removal of static chips. $(document).on('click', '.chip .close', function (e) { var $chips = $(this).closest('.chips'); if ($chips.attr('data-initialized')) { return; } $(this).closest('.chip').remove(); }); });
$.fn.material_chip = function (options) { var self = this; this.$el = $(this); this.$document = $(document); this.SELS = { CHIPS: '.chips', CHIP: '.chip', INPUT: 'input', DELETE: '.material-icons', SELECTED_CHIP: '.selected', };
if ('data' === options) { return this.$el.data('chips'); }
var curr_options = $.extend({}, materialChipsDefaults, options); self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
// Initialize this.init = function () { var i = 0; var chips; self.$el.each(function () { var $chips = $(this); var chipId = Materialize.guid(); self.chipId = chipId;
if (!curr_options.data || !(curr_options.data instanceof Array)) { curr_options.data = []; } $chips.data('chips', curr_options.data); $chips.attr('data-index', i); $chips.attr('data-initialized', true);
if (!$chips.hasClass(self.SELS.CHIPS)) { $chips.addClass('chips'); }
self.chips($chips, chipId); i++; }); };
this.handleEvents = function () { var SELS = self.SELS;
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) { $(e.target).find(SELS.INPUT).focus(); });
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) { var $chip = $(e.target); if ($chip.length) { var wasSelected = $chip.hasClass('selected'); var $chips = $chip.closest(SELS.CHIPS); $(SELS.CHIP).removeClass('selected');
if (!wasSelected) { self.selectChip($chip.index(), $chips); } } });
self.$document.off('keydown.chips').on('keydown.chips', function (e) { if ($(e.target).is('input, textarea')) { return; }
// delete var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); var $chips = $chip.closest(SELS.CHIPS); var length = $chip.siblings(SELS.CHIP).length; var index;
if (!$chip.length) { return; }
if (e.which === 8 || e.which === 46) { e.preventDefault();
index = $chip.index(); self.deleteChip(index, $chips);
var selectIndex = null; if ((index + 1) < length) { selectIndex = index; } else if (index === length || (index + 1) === length) { selectIndex = length - 1; }
if (selectIndex < 0) selectIndex = null;
if (null !== selectIndex) { self.selectChip(selectIndex, $chips); } if (!length) $chips.find('input').focus();
// left } else if (e.which === 37) { index = $chip.index() - 1; if (index < 0) { return; } $(SELS.CHIP).removeClass('selected'); self.selectChip(index, $chips);
// right } else if (e.which === 39) { index = $chip.index() + 1; $(SELS.CHIP).removeClass('selected'); if (index > length) { $chips.find('input').focus(); return; } self.selectChip(index, $chips); } });
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $currChips = $(e.target).closest(SELS.CHIPS); $currChips.addClass('focus'); $currChips.siblings('label, .prefix').addClass('active'); $(SELS.CHIP).removeClass('selected'); });
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $currChips = $(e.target).closest(SELS.CHIPS); $currChips.removeClass('focus');
// Remove active if empty if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { $currChips.siblings('label').removeClass('active'); } $currChips.siblings('.prefix').removeClass('active'); });
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $target = $(e.target); var $chips = $target.closest(SELS.CHIPS); var chipsLength = $chips.children(SELS.CHIP).length;
// enter if (13 === e.which) { // Override enter if autocompleting. if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) { return; }
e.preventDefault(); self.addChip({ tag: $target.val() }, $chips); $target.val(); return; }
// delete or left if ((8 === e.keyCode || 37 === e.keyCode) && === $target.val() && chipsLength) { e.preventDefault(); self.selectChip(chipsLength - 1, $chips); $target.blur(); return; } });
// Click on delete icon in chip. self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) { var $target = $(e.target); var $chips = $target.closest(SELS.CHIPS); var $chip = $target.closest(SELS.CHIP); e.stopPropagation(); self.deleteChip($chip.index(), $chips); $chips.find('input').focus(); }); };
this.chips = function ($chips, chipId) { $chips.empty(); $chips.data('chips').forEach(function (elem) { $chips.append(self.renderChip(elem)); }); $chips.append($('<input id="' + chipId + '" class="input" placeholder="">')); self.setPlaceholder($chips);
// Set for attribute for label var label = $chips.next('label'); if (label.length) { label.attr('for', chipId);
if ($chips.data('chips') !== undefined && $chips.data('chips').length) { label.addClass('active'); } }
// Setup autocomplete if needed. var input = $('#' + chipId); if (self.hasAutocomplete) { curr_options.autocompleteOptions.onAutocomplete = function (val) { self.addChip({ tag: val }, $chips); input.val(); input.focus(); } input.autocomplete(curr_options.autocompleteOptions); } };
/** * Render chip jQuery element. * @param {Object} elem * @return {jQuery} */ this.renderChip = function (elem) { if (!elem.tag) return;var $renderedChip = $('');
$renderedChip.text(elem.tag); if (elem.image) { $renderedChip.prepend($('<img />').attr('src', elem.image)) } $renderedChip.append($('<i class="material-icons close">close')); return $renderedChip; };
this.setPlaceholder = function ($chips) { if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) { $chips.find('input').prop('placeholder', curr_options.placeholder);
} else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) { $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); } };
this.isValid = function ($chips, elem) { var chips = $chips.data('chips'); var exists = false; for (var i = 0; i < chips.length; i++) { if (chips[i].tag === elem.tag) { exists = true; return; } } return !== elem.tag && !exists; };
this.addChip = function (elem, $chips) { if (!self.isValid($chips, elem)) { return; } var $renderedChip = self.renderChip(elem); var newData = []; var oldData = $chips.data('chips'); for (var i = 0; i < oldData.length; i++) { newData.push(oldData[i]); } newData.push(elem);
$chips.data('chips', newData); $renderedChip.insertBefore($chips.find('input')); $chips.trigger('chip.add', elem); self.setPlaceholder($chips); };
this.deleteChip = function (chipIndex, $chips) { var chip = $chips.data('chips')[chipIndex]; $chips.find('.chip').eq(chipIndex).remove();
var newData = []; var oldData = $chips.data('chips'); for (var i = 0; i < oldData.length; i++) { if (i !== chipIndex) { newData.push(oldData[i]); } }
$chips.data('chips', newData); $chips.trigger('chip.delete', chip); self.setPlaceholder($chips); };
this.selectChip = function (chipIndex, $chips) { var $chip = $chips.find('.chip').eq(chipIndex); if ($chip && false === $chip.hasClass('selected')) { $chip.addClass('selected'); $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); } };
this.getChipsElement = function (index, $chips) { return $chips.eq(index); };
// init this.init();
this.handleEvents(); };
}(jQuery));; (function ($) {
$.fn.pushpin = function (options) { // Defaults var defaults = { top: 0, bottom: Infinity, offset: 0 };
// Remove pushpin event and classes if (options === "remove") { this.each(function () { if (id = $(this).data('pushpin-id')) { $(window).off('scroll.' + id); $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); } }); return false; }
options = $.extend(defaults, options);
$index = 0; return this.each(function () { var $uniqueId = Materialize.guid(), $this = $(this), $original_offset = $(this).offset().top;
function removePinClasses(object) { object.removeClass('pin-top'); object.removeClass('pinned'); object.removeClass('pin-bottom'); }
function updateElements(objects, scrolled) { objects.each(function () { // Add position fixed (because its between top and bottom) if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { removePinClasses($(this)); $(this).css('top', options.offset); $(this).addClass('pinned'); }
// Add pin-top (when scrolled position is above top) if (scrolled < options.top && !$(this).hasClass('pin-top')) { removePinClasses($(this)); $(this).css('top', 0); $(this).addClass('pin-top'); }
// Add pin-bottom (when scrolled position is below bottom) if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { removePinClasses($(this)); $(this).addClass('pin-bottom'); $(this).css('top', options.bottom - $original_offset); } }); }
$(this).data('pushpin-id', $uniqueId); updateElements($this, $(window).scrollTop()); $(window).on('scroll.' + $uniqueId, function () { var $scrolled = $(window).scrollTop() + options.offset; updateElements($this, $scrolled); });
});
};
}(jQuery));; (function ($) {
$(document).ready(function () {
// jQuery reverse $.fn.reverse = [].reverse;
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { var $this = $(this); openFABMenu($this); }); $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { var $this = $(this); closeFABMenu($this); });
// Toggle-on-click behaviour. $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) { var $this = $(this); var $menu = $this.parent(); if ($menu.hasClass('active')) { closeFABMenu($menu); } else { openFABMenu($menu); } });
// Toolbar transition behaviour. $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) { var $this = $(this); var $menu = $this.parent(); FABtoToolbar($menu); });
});
$.fn.extend({ openFAB: function () { openFABMenu($(this)); }, closeFAB: function () { closeFABMenu($(this)); }, openToolbar: function () { FABtoToolbar($(this)); }, closeToolbar: function () { toolbarToFAB($(this)); } });
var openFABMenu = function (btn) { var $this = btn; if ($this.hasClass('active') === false) {
// Get direction option var horizontal = $this.hasClass('horizontal'); var offsetY, offsetX;
if (horizontal === true) { offsetX = 40; } else { offsetY = 40; }
$this.addClass('active'); $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
var time = 0; $this.find('ul .btn-floating').reverse().each(function () { $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time }); time += 40; }); } };
var closeFABMenu = function (btn) { var $this = btn; // Get direction option var horizontal = $this.hasClass('horizontal'); var offsetY, offsetX;
if (horizontal === true) { offsetX = 40; } else { offsetY = 40; }
$this.removeClass('active'); var time = 0; $this.find('ul .btn-floating').velocity("stop", true); $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 }); };
/** * Transform FAB into toolbar * @param {Object} object jQuery object */ var FABtoToolbar = function (btn) { if (btn.attr('data-open') === "true") { return; }
var offsetX, offsetY, scaleFactor; var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var btnRect = btn[0].getBoundingClientRect(); var anchor = btn.find('> a').first(); var menu = btn.find('> ul').first();var backdrop = $('');
var fabColor = anchor.css('background-color'); anchor.append(backdrop);
offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2); offsetY = windowHeight - btnRect.bottom; scaleFactor = windowWidth / backdrop.width(); btn.attr('data-origin-bottom', btnRect.bottom); btn.attr('data-origin-left', btnRect.left); btn.attr('data-origin-width', btnRect.width);
// Set initial state btn.addClass('active'); btn.attr('data-open', true); btn.css({ 'text-align': 'center', width: '100%', bottom: 0, left: 0, transform: 'translateX(' + offsetX + 'px)', transition: 'none' }); anchor.css({ transform: 'translateY(' + -offsetY + 'px)', transition: 'none' }); backdrop.css({ 'background-color': fabColor });
setTimeout(function () { btn.css({ transform: , transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' }); anchor.css({ overflow: 'visible', transform: , transition: 'transform .2s' });
setTimeout(function () { btn.css({ overflow: 'hidden', 'background-color': fabColor }); backdrop.css({ transform: 'scale(' + scaleFactor + ')', transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' }); menu.find('> li > a').css({ opacity: 1 });
// Scroll to close. $(window).on('scroll.fabToolbarClose', function () { toolbarToFAB(btn); $(window).off('scroll.fabToolbarClose'); $(document).off('click.fabToolbarClose'); });
$(document).on('click.fabToolbarClose', function (e) { if (!$(e.target).closest(menu).length) { toolbarToFAB(btn); $(window).off('scroll.fabToolbarClose'); $(document).off('click.fabToolbarClose'); } }); }, 100); }, 0); };
/** * Transform toolbar back into FAB * @param {Object} object jQuery object */ var toolbarToFAB = function (btn) { if (btn.attr('data-open') !== "true") { return; }
var offsetX, offsetY, scaleFactor; var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var btnWidth = btn.attr('data-origin-width'); var btnBottom = btn.attr('data-origin-bottom'); var btnLeft = btn.attr('data-origin-left'); var anchor = btn.find('> .btn-floating').first(); var menu = btn.find('> ul').first(); var backdrop = btn.find('.fab-backdrop'); var fabColor = anchor.css('background-color');
offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2); offsetY = windowHeight - btnBottom; scaleFactor = windowWidth / backdrop.width();
// Hide backdrop btn.removeClass('active'); btn.attr('data-open', false); btn.css({ 'background-color': 'transparent', transition: 'none' }); anchor.css({ transition: 'none' }); backdrop.css({ transform: 'scale(0)', 'background-color': fabColor }); menu.find('> li > a').css({ opacity: });
setTimeout(function () { backdrop.remove();
// Set initial state. btn.css({ 'text-align': , width: , bottom: , left: , overflow: , 'background-color': , transform: 'translate3d(' + -offsetX + 'px,0,0)' }); anchor.css({ overflow: , transform: 'translate3d(0,' + offsetY + 'px,0)' });
setTimeout(function () { btn.css({ transform: 'translate3d(0,0,0)', transition: 'transform .2s' }); anchor.css({ transform: 'translate3d(0,0,0)', transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' }); }, 20); }, 200); };
}(jQuery));;
(function ($) {
// Image transition function Materialize.fadeInImage = function (selectorOrEl) { var element; if (typeof (selectorOrEl) === 'string') { element = $(selectorOrEl); } else if (typeof (selectorOrEl) === 'object') { element = selectorOrEl; } else { return; } element.css({ opacity: 0 }); $(element).velocity({ opacity: 1 }, { duration: 650, queue: false, easing: 'easeOutSine' }); $(element).velocity({ opacity: 1 }, { duration: 1300, queue: false, easing: 'swing', step: function (now, fx) { fx.start = 100; var grayscale_setting = now / 100; var brightness_setting = 150 - (100 - now) / 1.75;
if (brightness_setting < 100) { brightness_setting = 100; } if (now >= 0) { $(this).css({ "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)", "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)" }); } } }); };
// Horizontal staggered list Materialize.showStaggeredList = function (selectorOrEl) { var element; if (typeof (selectorOrEl) === 'string') { element = $(selectorOrEl); } else if (typeof (selectorOrEl) === 'object') { element = selectorOrEl; } else { return; } var time = 0; element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
element.find('li').each(function () { $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] }); time += 120; }); };
$(document).ready(function () { // Hardcoded .staggered-list scrollFire // var staggeredListOptions = []; // $('ul.staggered-list').each(function (i) {
// var label = 'scrollFire-' + i; // $(this).addClass(label); // staggeredListOptions.push( // {selector: 'ul.staggered-list.' + label, // offset: 200, // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); // }); // scrollFire(staggeredListOptions);
// HammerJS, Swipe navigation
// Touch Event var swipeLeft = false; var swipeRight = false;
// Dismissible Collections $('.dismissable').each(function () { $(this).hammer({ prevent_default: false }).on('pan', function (e) { if (e.gesture.pointerType === "touch") { var $this = $(this); var direction = e.gesture.direction; var x = e.gesture.deltaX; var velocityX = e.gesture.velocityX;
$this.velocity({ translateX: x }, { duration: 50, queue: false, easing: 'easeOutQuad' });
// Swipe Left if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) { swipeLeft = true; }
// Swipe Right if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) { swipeRight = true; } } }).on('panend', function (e) { // Reset if collection is moved back into original position if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) { swipeRight = false; swipeLeft = false; }
if (e.gesture.pointerType === "touch") { var $this = $(this); if (swipeLeft || swipeRight) { var fullWidth; if (swipeLeft) { fullWidth = $this.innerWidth(); } else { fullWidth = -1 * $this.innerWidth(); }
$this.velocity({ translateX: fullWidth, }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () { $this.css('border', 'none'); $this.velocity({ height: 0, padding: 0, }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { $this.remove(); } }); } }); } else { $this.velocity({ translateX: 0, }, { duration: 100, queue: false, easing: 'easeOutQuad' }); } swipeLeft = false; swipeRight = false; } });
});
// time = 0 // // Vertical Staggered list // $('ul.staggered-list.vertical li').velocity( // { translateY: "100px"}, // { duration: 0 });
// $('ul.staggered-list.vertical li').each(function() { // $(this).velocity( // { opacity: "1", translateY: "0"}, // { duration: 800, delay: time, easing: [60, 25] }); // time += 120; // });
// // Fade in and Scale // $('.fade-in.scale').velocity( // { scaleX: .4, scaleY: .4, translateX: -600}, // { duration: 0}); // $('.fade-in').each(function() { // $(this).velocity( // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, // { duration: 800, easing: [60, 10] }); // }); });
}(jQuery));; (function ($) {
var scrollFireEventsHandled = false;
// Input: Array of JSON objects {selector, offset, callback} Materialize.scrollFire = function (options) { var onScroll = function () { var windowScroll = window.pageYOffset + window.innerHeight;
for (var i = 0; i < options.length; i++) { // Get options from each line var value = options[i]; var selector = value.selector, offset = value.offset, callback = value.callback;
var currentElement = document.querySelector(selector); if (currentElement !== null) { var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
if (windowScroll > (elementOffset + offset)) { if (value.done !== true) { if (typeof (callback) === 'function') { callback.call(this, currentElement); } else if (typeof (callback) === 'string') { var callbackFunc = new Function(callback); callbackFunc(currentElement); } value.done = true; } } } } };
var throttledScroll = Materialize.throttle(function () { onScroll(); }, options.throttle || 100);
if (!scrollFireEventsHandled) { window.addEventListener("scroll", throttledScroll); window.addEventListener("resize", throttledScroll); scrollFireEventsHandled = true; }
// perform a scan once, after current execution context, and after dom is ready setTimeout(throttledScroll, 0); };
})(jQuery);; /*!
* pickadate.js v3.5.0, 2014/04/13 * By Amsul, http://amsul.ca * Hosted on http://amsul.github.io/pickadate.js * Licensed under MIT */
(function (factory) {
// AMD. if (typeof define == 'function' && define.amd) define('picker', ['jquery'], factory)
// Node.js/browserify. else if (typeof exports == 'object') module.exports = factory(require('jquery'))
// Browser globals. else this.Picker = factory(jQuery)
}(function ($) {
var $window = $(window) var $document = $(document) var $html = $(document.documentElement)
/** * The picker constructor that creates a blank picker. */ function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
// If there’s no element, return the picker constructor. if (!ELEMENT) return PickerConstructor
var IS_DEFAULT_THEME = false,
// The state of the picker. STATE = { id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date())) },
// Merge the defaults and options passed. SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
// Merge the default classes with the settings classes. CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
// The element node wrapper into a jQuery object. $ELEMENT = $(ELEMENT),
// Pseudo picker constructor. PickerInstance = function () { return this.start() },
// The picker prototype. P = PickerInstance.prototype = {
constructor: PickerInstance,
$node: $ELEMENT,
/** * Initialize everything */ start: function () {
// If it’s already started, do nothing. if (STATE && STATE.start) return P
// Update the picker states. STATE.methods = {} STATE.start = true STATE.open = false STATE.type = ELEMENT.type
// Confirm focus state, convert into text input to remove UA stylings, // and set as readonly to prevent keyboard popup. ELEMENT.autofocus = ELEMENT == getActiveElement() ELEMENT.readOnly = !SETTINGS.editable ELEMENT.id = ELEMENT.id || STATE.id if (ELEMENT.type != 'text') { ELEMENT.type = 'text' }
// Create a new picker component with the settings. P.component = new COMPONENT(P, SETTINGS)
// Create the picker root with a holder and then prepare it. P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"')) prepareElementRoot()
// If there’s a format for the hidden input element, create the element. if (SETTINGS.formatSubmit) { prepareElementHidden() }
// Prepare the input element. prepareElement()
// Insert the root as specified in the settings. if (SETTINGS.container) $(SETTINGS.container).append(P.$root) else $ELEMENT.after(P.$root)
// Bind the default component and settings events. P.on({ start: P.component.onStart, render: P.component.onRender, stop: P.component.onStop, open: P.component.onOpen, close: P.component.onClose, set: P.component.onSet }).on({ start: SETTINGS.onStart, render: SETTINGS.onRender, stop: SETTINGS.onStop, open: SETTINGS.onOpen, close: SETTINGS.onClose, set: SETTINGS.onSet })
// Once we’re all set, check the theme in use. IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0])
// If the element has autofocus, open the picker. if (ELEMENT.autofocus) { P.open() }
// Trigger queued the “start” and “render” events. return P.trigger('start').trigger('render') }, //start
/** * Render a new picker */ render: function (entireComponent) {
// Insert a new component holder in the root or box. if (entireComponent) P.$root.html(createWrappedComponent()) else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open))
// Trigger the queued “render” events. return P.trigger('render') }, //render
/** * Destroy everything */ stop: function () {
// If it’s already stopped, do nothing. if (!STATE.start) return P
// Then close the picker. P.close()
// Remove the hidden field. if (P._hidden) { P._hidden.parentNode.removeChild(P._hidden) }
// Remove the root. P.$root.remove()
// Remove the input class, remove the stored data, and unbind // the events (after a tick for IE - see `P.close`). $ELEMENT.removeClass(CLASSES.input).removeData(NAME) setTimeout(function () { $ELEMENT.off('.' + STATE.id) }, 0)
// Restore the element state ELEMENT.type = STATE.type ELEMENT.readOnly = false
// Trigger the queued “stop” events. P.trigger('stop')
// Reset the picker states. STATE.methods = {} STATE.start = false
return P }, //stop
/** * Open up the picker */ open: function (dontGiveFocus) {
// If it’s already open, do nothing. if (STATE.open) return P
// Add the “active” class. $ELEMENT.addClass(CLASSES.active) aria(ELEMENT, 'expanded', true)
// * A Firefox bug, when `html` has `overflow:hidden`, results in // killing transitions :(. So add the “opened” state on the next tick. // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 setTimeout(function () {
// Add the “opened” class to the picker root. P.$root.addClass(CLASSES.opened) aria(P.$root[0], 'hidden', false)
}, 0)
// If we have to give focus, bind the element and doc events. if (dontGiveFocus !== false) {
// Set it as open. STATE.open = true
// Prevent the page from scrolling. if (IS_DEFAULT_THEME) { $html. css('overflow', 'hidden'). css('padding-right', '+=' + getScrollbarWidth()) }
// Pass focus to the root element’s jQuery object. // * Workaround for iOS8 to bring the picker’s root into view. P.$root.eq(0).focus()
// Bind the document events. $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
var target = event.target
// If the target of the event is not the element, close the picker picker. // * Don’t worry about clicks or focusins on the root because those don’t bubble up. // Also, for Firefox, a click on an `option` element bubbles up directly // to the doc. So make sure the target wasn't the doc. // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, // which causes the picker to unexpectedly close when right-clicking it. So make // sure the event wasn’t a right-click. if (target != ELEMENT && target != document && event.which != 3) {
// If the target was the holder that covers the screen, // keep the element focused to maintain tabindex. P.close(target === P.$root.children()[0]) }
}).on('keydown.' + STATE.id, function (event) {
var // Get the keycode. keycode = event.keyCode,
// Translate that to a selection change. keycodeToMove = P.component.key[keycode],
// Grab the target. target = event.target
// On escape, close the picker and give focus. if (keycode == 27) { P.close(true) }
// Check if there is a key movement or “enter” keypress on the element. else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
// Prevent the default action to stop page movement. event.preventDefault()
// Trigger the key movement action. if (keycodeToMove) { PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]) }
// On “enter”, if the highlighted item isn’t disabled, set the value and close. else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) { P.set('select', P.component.item.highlight).close() } }
// If the target is within the root and “enter” is pressed, // prevent the default action and trigger a click on the target instead. else if ($.contains(P.$root[0], target) && keycode == 13) { event.preventDefault() target.click() } }) }
// Trigger the queued “open” events. return P.trigger('open') }, //open
/** * Close the picker */ close: function (giveFocus) {
// If we need to give focus, do it before changing states. if (giveFocus) { // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| // The focus is triggered *after* the close has completed - causing it // to open again. So unbind and rebind the event at the next tick. P.$root.off('focus.toOpen').eq(0).focus() setTimeout(function () { P.$root.on('focus.toOpen', handleFocusToOpenEvent) }, 0) }
// Remove the “active” class. $ELEMENT.removeClass(CLASSES.active) aria(ELEMENT, 'expanded', false)
// * A Firefox bug, when `html` has `overflow:hidden`, results in // killing transitions :(. So remove the “opened” state on the next tick. // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 setTimeout(function () {
// Remove the “opened” and “focused” class from the picker root. P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused) aria(P.$root[0], 'hidden', true)
}, 0)
// If it’s already closed, do nothing more. if (!STATE.open) return P
// Set it as closed. STATE.open = false
// Allow the page to scroll. if (IS_DEFAULT_THEME) { $html. css('overflow', ). css('padding-right', '-=' + getScrollbarWidth()) }
// Unbind the document events. $document.off('.' + STATE.id)
// Trigger the queued “close” events. return P.trigger('close') }, //close
/** * Clear the values */ clear: function (options) { return P.set('clear', null, options) }, //clear
/** * Set something */ set: function (thing, value, options) {
var thingItem, thingValue, thingIsObject = $.isPlainObject(thing), thingObject = thingIsObject ? thing : {}
// Make sure we have usable options. options = thingIsObject && $.isPlainObject(value) ? value : options || {}
if (thing) {
// If the thing isn’t an object, make it one. if (!thingIsObject) { thingObject[thing] = value }
// Go through the things of items to set. for (thingItem in thingObject) {
// Grab the value of the thing. thingValue = thingObject[thingItem]
// First, if the item exists and there’s a value, set it. if (thingItem in P.component.item) { if (thingValue === undefined) thingValue = null P.component.set(thingItem, thingValue, options) }
// Then, check to update the element value and broadcast a change. if (thingItem == 'select' || thingItem == 'clear') { $ELEMENT. val(thingItem == 'clear' ? : P.get(thingItem, SETTINGS.format)). trigger('change') } }
// Render a new picker. P.render() }
// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. return options.muted ? P : P.trigger('set', thingObject) }, //set
/** * Get something */ get: function (thing, format) {
// Make sure there’s something to get. thing = thing || 'value'
// If a picker state exists, return that. if (STATE[thing] != null) { return STATE[thing] }
// Return the submission value, if that. if (thing == 'valueSubmit') { if (P._hidden) { return P._hidden.value } thing = 'value' }
// Return the value, if that. if (thing == 'value') { return ELEMENT.value }
// Check if a component item exists, return that. if (thing in P.component.item) { if (typeof format == 'string') { var thingValue = P.component.get(thing) return thingValue ? PickerConstructor._.trigger( P.component.formats.toString, P.component, [format, thingValue] ) : } return P.component.get(thing) } }, //get
/** * Bind events on the things. */ on: function (thing, method, internal) {
var thingName, thingMethod, thingIsObject = $.isPlainObject(thing), thingObject = thingIsObject ? thing : {}
if (thing) {
// If the thing isn’t an object, make it one. if (!thingIsObject) { thingObject[thing] = method }
// Go through the things to bind to. for (thingName in thingObject) {
// Grab the method of the thing. thingMethod = thingObject[thingName]
// If it was an internal binding, prefix it. if (internal) { thingName = '_' + thingName }
// Make sure the thing methods collection exists. STATE.methods[thingName] = STATE.methods[thingName] || []
// Add the method to the relative method collection. STATE.methods[thingName].push(thingMethod) } }
return P }, //on
/** * Unbind events on the things. */ off: function () { var i, thingName, names = arguments; for (i = 0, namesCount = names.length; i < namesCount; i += 1) { thingName = names[i] if (thingName in STATE.methods) { delete STATE.methods[thingName] } } return P },
/** * Fire off method events. */ trigger: function (name, data) { var _trigger = function (name) { var methodList = STATE.methods[name] if (methodList) { methodList.map(function (method) { PickerConstructor._.trigger(method, P, [data]) }) } } _trigger('_' + name) _trigger(name) return P } //trigger } //PickerInstance.prototype
/** * Wrap the picker holder components together. */ function createWrappedComponent() {
// Create a picker wrapper holder return PickerConstructor._.node('div',
// Create a picker wrapper node PickerConstructor._.node('div',
// Create a picker frame PickerConstructor._.node('div',
// Create a picker box node PickerConstructor._.node('div',
// Create the components nodes. P.component.nodes(STATE.open),
// The picker box class CLASSES.box ),
// Picker wrap class CLASSES.wrap ),
// Picker frame class CLASSES.frame ),
// Picker holder class CLASSES.holder ) //endreturn } //createWrappedComponent
/** * Prepare the input element with all bindings. */ function prepareElement() {
$ELEMENT.
// Store the picker data by component name. data(NAME, P).
// Add the “input” class name. addClass(CLASSES.input).
// Remove the tabindex. attr('tabindex', -1).
// If there’s a `data-value`, update the value of the element. val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value )
// Only bind keydown events if the element isn’t editable. if (!SETTINGS.editable) {
$ELEMENT.
// On focus/click, focus onto the root to open it up. on('focus.' + STATE.id + ' click.' + STATE.id, function (event) { event.preventDefault() P.$root.eq(0).focus() }).
// Handle keyboard event based on the picker being opened or not. on('keydown.' + STATE.id, handleKeydownEvent) }
// Update the aria attributes. aria(ELEMENT, { haspopup: true, expanded: false, readonly: false, owns: ELEMENT.id + '_root' }) }
/** * Prepare the root picker element with all bindings. */ function prepareElementRoot() {
P.$root.
on({
// For iOS8. keydown: handleKeydownEvent,
// When something within the root is focused, stop from bubbling // to the doc and remove the “focused” state from the root. focusin: function (event) { P.$root.removeClass(CLASSES.focused) event.stopPropagation() },
// When something within the root holder is clicked, stop it // from bubbling to the doc. 'mousedown click': function (event) {
var target = event.target
// Make sure the target isn’t the root holder so it can bubble up. if (target != P.$root.children()[0]) {
event.stopPropagation()
// * For mousedown events, cancel the default action in order to // prevent cases where focus is shifted onto external elements // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). // Also, for Firefox, don’t prevent action on the `option` element. if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
event.preventDefault()
// Re-focus onto the root so that users can click away // from elements focused within the picker. P.$root.eq(0).focus() } } } }).
// Add/remove the “target” class on focus and blur. on({ focus: function () { $ELEMENT.addClass(CLASSES.target) }, blur: function () { $ELEMENT.removeClass(CLASSES.target) } }).
// Open the picker and adjust the root “focused” state on('focus.toOpen', handleFocusToOpenEvent).
// If there’s a click on an actionable element, carry out the actions. on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
var $target = $(this), targetData = $target.data(), targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
// * For IE, non-focusable elements can be active elements as well // (http://stackoverflow.com/a/2684561). activeElement = getActiveElement() activeElement = activeElement && (activeElement.type || activeElement.href)
// If it’s disabled or nothing inside is actively focused, re-focus the element. if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) { P.$root.eq(0).focus() }
// If something is superficially changed, update the `highlight` based on the `nav`. if (!targetDisabled && targetData.nav) { P.set('highlight', P.component.item.highlight, { nav: targetData.nav }) }
// If something is picked, set `select` then close with focus. else if (!targetDisabled && 'pick' in targetData) { P.set('select', targetData.pick) }
// If a “clear” button is pressed, empty the values and close with focus. else if (targetData.clear) { P.clear().close(true) } else if (targetData.close) { P.close(true) }
}) //P.$root
aria(P.$root[0], 'hidden', true) }
/** * Prepare the hidden input element along with all bindings. */ function prepareElementHidden() {
var name
if (SETTINGS.hiddenName === true) { name = ELEMENT.name ELEMENT.name = } else { name = [ typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : , typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit' ] name = name[0] + ELEMENT.name + name[1] }
P._hidden = $( '<input ' + 'type=hidden ' +
// Create the name using the original input’s with a prefix and suffix. 'name="' + name + '"' +
// If the element has a value, set the hidden value as well. ( $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : ) + '>' )[0]
$ELEMENT.
// If the value changes, update the hidden input with the correct format. on('change.' + STATE.id, function () { P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : })
// Insert the hidden input as specified in the settings. if (SETTINGS.container) $(SETTINGS.container).append(P._hidden) else $ELEMENT.after(P._hidden) }
// For iOS8. function handleKeydownEvent(event) {
var keycode = event.keyCode,
// Check if one of the delete keys was pressed. isKeycodeDelete = /^(8|46)$/.test(keycode)
// For some reason IE clears the input value on “escape”. if (keycode == 27) { P.close() return false }
// Check if `space` or `delete` was pressed or the picker is closed with a key movement. if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
// Prevent it from moving the page and bubbling to doc. event.preventDefault() event.stopPropagation()
// If `delete` was pressed, clear the values and close the picker. // Otherwise open the picker. if (isKeycodeDelete) { P.clear().close() } else { P.open() } } }
// Separated for IE function handleFocusToOpenEvent(event) {
// Stop the event from propagating to the doc. event.stopPropagation()
// If it’s a focus event, add the “focused” class to the root. if (event.type == 'focus') { P.$root.addClass(CLASSES.focused) }
// And then finally open the picker. P.open() }
// Return a new picker instance. return new PickerInstance() } //PickerConstructor
/** * The default classes and prefix to use for the HTML classes. */ PickerConstructor.klasses = function (prefix) { prefix = prefix || 'picker' return {
picker: prefix, opened: prefix + '--opened', focused: prefix + '--focused',
input: prefix + '__input', active: prefix + '__input--active', target: prefix + '__input--target',
holder: prefix + '__holder',
frame: prefix + '__frame', wrap: prefix + '__wrap',
box: prefix + '__box' } } //PickerConstructor.klasses
/** * Check if the default theme is being used. */ function isUsingDefaultTheme(element) {
var theme, prop = 'position'
// For IE. if (element.currentStyle) { theme = element.currentStyle[prop] }
// For normal browsers. else if (window.getComputedStyle) { theme = getComputedStyle(element)[prop] }
return theme == 'fixed' }
/** * Get the width of the browser’s scrollbar. * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js */ function getScrollbarWidth() {
if ($html.height() <= $window.height()) { return 0 }
var $outer = $('<div style="visibility:hidden;width:100px" />'). appendTo('body')
// Get the width without scrollbars. var widthWithoutScroll = $outer[0].offsetWidth
// Force adding scrollbars. $outer.css('overflow', 'scroll')
// Add the inner div. var $inner = $('<div style="width:100%" />').appendTo($outer)
// Get the width with scrollbars. var widthWithScroll = $inner[0].offsetWidth
// Remove the divs. $outer.remove()
// Return the difference between the widths. return widthWithoutScroll - widthWithScroll }
/** * PickerConstructor helper methods. */ PickerConstructor._ = {
/** * Create a group of nodes. Expects: * ` { min: {Integer}, max: {Integer}, i: {Integer}, node: {String}, item: {Function} } * ` */ group: function (groupObject) {
var // Scope for the looped object loopObjectScope,
// Create the nodes list nodesList = ,
// The counter starts from the `min` counter = PickerConstructor._.trigger(groupObject.min, groupObject)
// Loop from the `min` to `max`, incrementing by `i` for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
// Trigger the `item` function within scope of the object loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter])
// Splice the subgroup and create nodes out of the sub nodes nodesList += PickerConstructor._.node( groupObject.node, loopObjectScope[0], // the node loopObjectScope[1], // the classes loopObjectScope[2] // the attributes ) }
// Return the list of nodes return nodesList }, //group
/** * Create a dom node string */ node: function (wrapper, item, klass, attribute) {
// If the item is false-y, just return an empty string if (!item) return
// If the item is an array, do a join item = $.isArray(item) ? item.join() : item
// Check for the class klass = klass ? ' class="' + klass + '"' :
// Check for any attributes attribute = attribute ? ' ' + attribute :
// Return the wrapped item return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>' }, //node
/** * Lead numbers below 10 with a zero. */ lead: function (number) { return (number < 10 ? '0' : ) + number },
/** * Trigger a function otherwise return the value. */ trigger: function (callback, scope, args) { return typeof callback == 'function' ? callback.apply(scope, args || []) : callback },
/** * If the second character is a digit, length is 2 otherwise 1. */ digits: function (string) { return (/\d/).test(string[1]) ? 2 : 1 },
/** * Tell if something is a date object. */ isDate: function (value) { return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate()) },
/** * Tell if something is an integer. */ isInteger: function (value) { return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0 },
/** * Create ARIA attribute strings. */ ariaAttr: ariaAttr } //PickerConstructor._
/** * Extend the picker with a component and defaults. */ PickerConstructor.extend = function (name, Component) {
// Extend jQuery. $.fn[name] = function (options, action) {
// Grab the component data. var componentData = this.data(name)
// If the picker is requested, return the data object. if (options == 'picker') { return componentData }
// If the component data exists and `options` is a string, carry out the action. if (componentData && typeof options == 'string') { return PickerConstructor._.trigger(componentData[options], componentData, [action]) }
// Otherwise go through each matched element and if the component // doesn’t exist, create a new picker using `this` element // and merging the defaults and options with a deep copy. return this.each(function () { var $this = $(this) if (!$this.data(name)) { new PickerConstructor(this, name, Component, options) } }) }
// Set the defaults. $.fn[name].defaults = Component.defaults } //PickerConstructor.extend
function aria(element, attribute, value) { if ($.isPlainObject(attribute)) { for (var key in attribute) { ariaSet(element, key, attribute[key]) } } else { ariaSet(element, attribute, value) } }
function ariaSet(element, attribute, value) { element.setAttribute( (attribute == 'role' ? : 'aria-') + attribute, value ) }
function ariaAttr(attribute, data) { if (!$.isPlainObject(attribute)) { attribute = { attribute: data } } data = for (var key in attribute) { var attr = (key == 'role' ? : 'aria-') + key, attrVal = attribute[key] data += attrVal == null ? : attr + '="' + attribute[key] + '"' } return data }
// IE8 bug throws an error for activeElements within iframes. function getActiveElement() { try { return document.activeElement } catch (err) {} }
// Expose the picker constructor. return PickerConstructor
}));
/*!
* Date picker for pickadate.js v3.5.0 * http://amsul.github.io/pickadate.js/date.htm */
(function (factory) {
// AMD. if (typeof define == 'function' && define.amd) define(['picker', 'jquery'], factory)
// Node.js/browserify. else if (typeof exports == 'object') module.exports = factory(require('./picker.js'), require('jquery'))
// Browser globals. else factory(Picker, jQuery)
}(function (Picker, $) {
/** * Globals and constants */ var DAYS_IN_WEEK = 7, WEEKS_IN_CALENDAR = 6, _ = Picker._;
/** * The date picker constructor */ function DatePicker(picker, settings) {
var calendar = this, element = picker.$node[0], elementValue = element.value, elementDataValue = picker.$node.data('value'), valueString = elementDataValue || elementValue, formatString = elementDataValue ? settings.formatSubmit : settings.format, isRTL = function () {
return element.currentStyle ?
// For IE. element.currentStyle.direction == 'rtl' :
// For normal browsers. getComputedStyle(picker.$root[0]).direction == 'rtl' }
calendar.settings = settings calendar.$node = picker.$node
// The queue of methods that will be used to build item objects. calendar.queue = { min: 'measure create', max: 'measure create', now: 'now create', select: 'parse create validate', highlight: 'parse navigate create validate', view: 'parse create validate viewset', disable: 'deactivate', enable: 'activate' }
// The component's item object. calendar.item = {}
calendar.item.clear = null calendar.item.disable = (settings.disable || []).slice(0) calendar.item.enable = -(function (collectionDisabled) { return collectionDisabled[0] === true ? collectionDisabled.shift() : -1 })(calendar.item.disable)
calendar. set('min', settings.min). set('max', settings.max). set('now')
// When there’s a value, set the `select`, which in turn // also sets the `highlight` and `view`. if (valueString) { calendar.set('select', valueString, { format: formatString }) }
// If there’s no value, default to highlighting “today”. else { calendar. set('select', null). set('highlight', calendar.item.now) }
// The keycode to movement mapping. calendar.key = { 40: 7, // Down 38: -7, // Up 39: function () { return isRTL() ? -1 : 1 }, // Right 37: function () { return isRTL() ? 1 : -1 }, // Left go: function (timeChange) { var highlightedObject = calendar.item.highlight, targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange) calendar.set( 'highlight', targetDate, { interval: timeChange } ) this.render() } }
// Bind some picker events. picker. on('render', function () { picker.$root.find('.' + settings.klass.selectMonth).on('change', function () { var value = this.value if (value) { picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]) picker.$root.find('.' + settings.klass.selectMonth).trigger('focus') } }) picker.$root.find('.' + settings.klass.selectYear).on('change', function () { var value = this.value if (value) { picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]) picker.$root.find('.' + settings.klass.selectYear).trigger('focus') } }) }, 1). on('open', function () { var includeToday = if (calendar.disabled(calendar.get('now'))) { includeToday = ':not(.' + settings.klass.buttonToday + ')' } picker.$root.find('button' + includeToday + ', select').attr('disabled', false) }, 1). on('close', function () { picker.$root.find('button, select').attr('disabled', true) }, 1)
} //DatePicker
/** * Set a datepicker item object. */ DatePicker.prototype.set = function (type, value, options) {
var calendar = this, calendarItem = calendar.item
// If the value is `null` just set it immediately. if (value === null) { if (type == 'clear') type = 'select' calendarItem[type] = value return calendar }
// Otherwise go through the queue of methods, and invoke the functions. // Update this as the time unit, and set the final value as this item. // * In the case of `enable`, keep the queue but set `disable` instead. // And in the case of `flip`, keep the queue but set `enable` instead. calendarItem[(type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type)] = calendar.queue[type].split(' ').map(function (method) { value = calendar[method](type, value, options) return value }).pop()
// Check if we need to cascade through more updates. if (type == 'select') { calendar.set('highlight', calendarItem.select, options) } else if (type == 'highlight') { calendar.set('view', calendarItem.highlight, options) } else if (type.match(/^(flip|min|max|disable|enable)$/)) { if (calendarItem.select && calendar.disabled(calendarItem.select)) { calendar.set('select', calendarItem.select, options) } if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) { calendar.set('highlight', calendarItem.highlight, options) } }
return calendar } //DatePicker.prototype.set
/** * Get a datepicker item object. */ DatePicker.prototype.get = function (type) { return this.item[type] } //DatePicker.prototype.get
/** * Create a picker date object. */ DatePicker.prototype.create = function (type, value, options) {
var isInfiniteValue, calendar = this
// If there’s no value, use the type as the value. value = value === undefined ? type : value
// If it’s infinity, update the value. if (value == -Infinity || value == Infinity) { isInfiniteValue = value }
// If it’s an object, use the native date object. else if ($.isPlainObject(value) && _.isInteger(value.pick)) { value = value.obj }
// If it’s an array, convert it into a date and make sure // that it’s a valid date – otherwise default to today. else if ($.isArray(value)) { value = new Date(value[0], value[1], value[2]) value = _.isDate(value) ? value : calendar.create().obj }
// If it’s a number or date object, make a normalized date. else if (_.isInteger(value) || _.isDate(value)) { value = calendar.normalize(new Date(value), options) }
// If it’s a literal true or any other case, set it to now. else /*if ( value === true )*/ { value = calendar.now(type, value, options) }
// Return the compiled object. return { year: isInfiniteValue || value.getFullYear(), month: isInfiniteValue || value.getMonth(), date: isInfiniteValue || value.getDate(), day: isInfiniteValue || value.getDay(), obj: isInfiniteValue || value, pick: isInfiniteValue || value.getTime() } } //DatePicker.prototype.create
/** * Create a range limit object using an array, date object, * literal “true”, or integer relative to another time. */ DatePicker.prototype.createRange = function (from, to) {
var calendar = this, createDate = function (date) { if (date === true || $.isArray(date) || _.isDate(date)) { return calendar.create(date) } return date }
// Create objects if possible. if (!_.isInteger(from)) { from = createDate(from) } if (!_.isInteger(to)) { to = createDate(to) }
// Create relative dates. if (_.isInteger(from) && $.isPlainObject(to)) { from = [to.year, to.month, to.date + from]; } else if (_.isInteger(to) && $.isPlainObject(from)) { to = [from.year, from.month, from.date + to]; }
return { from: createDate(from), to: createDate(to) } } //DatePicker.prototype.createRange
/** * Check if a date unit falls within a date range object. */ DatePicker.prototype.withinRange = function (range, dateUnit) { range = this.createRange(range.from, range.to) return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick }
/** * Check if two date range objects overlap. */ DatePicker.prototype.overlapRanges = function (one, two) {
var calendar = this
// Convert the ranges into comparable dates. one = calendar.createRange(one.from, one.to) two = calendar.createRange(two.from, two.to)
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to) }
/** * Get the date today. */ DatePicker.prototype.now = function (type, value, options) { value = new Date() if (options && options.rel) { value.setDate(value.getDate() + options.rel) } return this.normalize(value, options) }
/** * Navigate to next/prev month. */ DatePicker.prototype.navigate = function (type, value, options) {
var targetDateObject, targetYear, targetMonth, targetDate, isTargetArray = $.isArray(value), isTargetObject = $.isPlainObject(value), viewsetObject = this.item.view /*, safety = 100*/
if (isTargetArray || isTargetObject) {
if (isTargetObject) { targetYear = value.year targetMonth = value.month targetDate = value.date } else { targetYear = +value[0] targetMonth = +value[1] targetDate = +value[2] }
// If we’re navigating months but the view is in a different // month, navigate to the view’s year and month. if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) { targetYear = viewsetObject.year targetMonth = viewsetObject.month }
// Figure out the expected target year and month. targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1) targetYear = targetDateObject.getFullYear() targetMonth = targetDateObject.getMonth()
// If the month we’re going to doesn’t have enough days, // keep decreasing the date until we reach the month’s last date. while ( /*safety &&*/ new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) { targetDate -= 1 /*safety -= 1 if ( !safety ) { throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' }*/ }
value = [targetYear, targetMonth, targetDate] }
return value } //DatePicker.prototype.navigate
/** * Normalize a date by setting the hours to midnight. */ DatePicker.prototype.normalize = function (value /*, options*/ ) { value.setHours(0, 0, 0, 0) return value }
/** * Measure the range of dates. */ DatePicker.prototype.measure = function (type, value /*, options*/ ) {
var calendar = this
// If it’s anything false-y, remove the limits. if (!value) { value = type == 'min' ? -Infinity : Infinity }
// If it’s a string, parse it. else if (typeof value == 'string') { value = calendar.parse(type, value) }
// If it's an integer, get a date relative to today. else if (_.isInteger(value)) { value = calendar.now(type, value, { rel: value }) }
return value } ///DatePicker.prototype.measure
/** * Create a viewset object based on navigation. */ DatePicker.prototype.viewset = function (type, dateObject /*, options*/ ) { return this.create([dateObject.year, dateObject.month, 1]) }
/** * Validate a date as enabled and shift if needed. */ DatePicker.prototype.validate = function (type, dateObject, options) {
var calendar = this,
// Keep a reference to the original date. originalDateObject = dateObject,
// Make sure we have an interval. interval = options && options.interval ? options.interval : 1,
// Check if the calendar enabled dates are inverted. isFlippedBase = calendar.item.enable === -1,
// Check if we have any enabled dates after/before now. hasEnabledBeforeTarget, hasEnabledAfterTarget,
// The min & max limits. minLimitObject = calendar.item.min, maxLimitObject = calendar.item.max,
// Check if we’ve reached the limit during shifting. reachedMin, reachedMax,
// Check if the calendar is inverted and at least one weekday is enabled. hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
// If there’s a date, check where it is relative to the target. if ($.isArray(value)) { var dateTime = calendar.create(value).pick if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true }
// Return only integers for enabled weekdays. return _.isInteger(value) }).length /*,
safety = 100*/
// Cases to validate for: // [1] Not inverted and date disabled. // [2] Inverted and some dates enabled. // [3] Not inverted and out of range. // // Cases to **not** validate for: // • Navigating months. // • Not inverted and date enabled. // • Inverted and all dates disabled. // • ..and anything else. if (!options || !options.nav) if ( /* 1 */ (!isFlippedBase && calendar.disabled(dateObject)) || /* 2 */ (isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget)) || /* 3 */ (!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) ) {
// When inverted, flip the direction if there aren’t any enabled weekdays // and there are no enabled dates in the direction of the interval. if (isFlippedBase && !hasEnabledWeekdays && ((!hasEnabledAfterTarget && interval > 0) || (!hasEnabledBeforeTarget && interval < 0))) { interval *= -1 }
// Keep looping until we reach an enabled date. while ( /*safety &&*/ calendar.disabled(dateObject)) {
/*safety -= 1 if ( !safety ) { throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' }*/
// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) { dateObject = originalDateObject interval = interval > 0 ? 1 : -1 }
// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. if (dateObject.pick <= minLimitObject.pick) { reachedMin = true interval = 1 dateObject = calendar.create([ minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1) ]) } else if (dateObject.pick >= maxLimitObject.pick) { reachedMax = true interval = -1 dateObject = calendar.create([ maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1) ]) }
// If we’ve reached both limits, just break out of the loop. if (reachedMin && reachedMax) { break }
// Finally, create the shifted date using the interval and keep looping. dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]) }
} //endif
// Return the date object settled on. return dateObject } //DatePicker.prototype.validate
/** * Check if a date is disabled. */ DatePicker.prototype.disabled = function (dateToVerify) {
var calendar = this,
// Filter through the disabled dates to check if this is one. isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
// If the date is a number, match the weekday with 0index and `firstDay` check. if (_.isInteger(dateToDisable)) { return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7 }
// If it’s an array or a native JS date, create and match the exact date. if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) { return dateToVerify.pick === calendar.create(dateToDisable).pick }
// If it’s an object, match a date within the “from” and “to” range. if ($.isPlainObject(dateToDisable)) { return calendar.withinRange(dateToDisable, dateToVerify) } })
// If this date matches a disabled date, confirm it’s not inverted. isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) { return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted }).length
// Check the calendar “enabled” flag and respectively flip the // disabled state. Then also check if it’s beyond the min/max limits. return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick
} //DatePicker.prototype.disabled
/** * Parse a string into a usable type. */ DatePicker.prototype.parse = function (type, value, options) {
var calendar = this, parsingObject = {}
// If it’s already parsed, we’re good. if (!value || typeof value != 'string') { return value }
// We need a `.format` to parse the value with. if (!(options && options.format)) { options = options || {} options.format = calendar.settings.format }
// Convert the format into an array and then map through it. calendar.formats.toArray(options.format).map(function (label) {
var // Grab the formatting label. formattingLabel = calendar.formats[label],
// The format length is from the formatting label function or the // label length without the escaping exclamation (!) mark. formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, ).length
// If there's a format label, split the value up to the format length. // Then add it to the parsing object with appropriate label. if (formattingLabel) { parsingObject[label] = value.substr(0, formatLength) }
// Update the value as the substring from format length to end. value = value.substr(formatLength) })
// Compensate for month 0index. return [ parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d ] } //DatePicker.prototype.parse
/** * Various formats to display the object in. */ DatePicker.prototype.formats = (function () {
// Return the length of the first word in a collection. function getWordLengthFromCollection(string, collection, dateObject) {
// Grab the first word from the string. var word = string.match(/\w+/)[0]
// If there's no month index, add it to the date object if (!dateObject.mm && !dateObject.m) { dateObject.m = collection.indexOf(word) + 1 }
// Return the length of the word. return word.length }
// Get the length of the first word in a string. function getFirstWordLength(string) { return string.match(/\w+/)[0].length }
return {
d: function (string, dateObject) {
// If there's string, then get the digits length. // Otherwise return the selected date. return string ? _.digits(string) : dateObject.date }, dd: function (string, dateObject) {
// If there's a string, then the length is always 2. // Otherwise return the selected date with a leading zero. return string ? 2 : _.lead(dateObject.date) }, ddd: function (string, dateObject) {
// If there's a string, then get the length of the first word. // Otherwise return the short selected weekday. return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day] }, dddd: function (string, dateObject) {
// If there's a string, then get the length of the first word. // Otherwise return the full selected weekday. return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day] }, m: function (string, dateObject) {
// If there's a string, then get the length of the digits // Otherwise return the selected month with 0index compensation. return string ? _.digits(string) : dateObject.month + 1 }, mm: function (string, dateObject) {
// If there's a string, then the length is always 2. // Otherwise return the selected month with 0index and leading zero. return string ? 2 : _.lead(dateObject.month + 1) }, mmm: function (string, dateObject) {
var collection = this.settings.monthsShort
// If there's a string, get length of the relevant month from the short // months collection. Otherwise return the selected month from that collection. return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month] }, mmmm: function (string, dateObject) {
var collection = this.settings.monthsFull
// If there's a string, get length of the relevant month from the full // months collection. Otherwise return the selected month from that collection. return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month] }, yy: function (string, dateObject) {
// If there's a string, then the length is always 2. // Otherwise return the selected year by slicing out the first 2 digits. return string ? 2 : ( + dateObject.year).slice(2) }, yyyy: function (string, dateObject) {
// If there's a string, then the length is always 4. // Otherwise return the selected year. return string ? 4 : dateObject.year },
// Create an array by splitting the formatting string passed. toArray: function (formatString) { return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g) },
// Format an object into a string using the formatting options. toString: function (formatString, itemObject) { var calendar = this return calendar.formats.toArray(formatString).map(function (label) { return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, ) }).join() } } })() //DatePicker.prototype.formats
/** * Check if two date units are the exact. */ DatePicker.prototype.isDateExact = function (one, two) {
var calendar = this
// When we’re working with weekdays, do a direct comparison. if ( (_.isInteger(one) && _.isInteger(two)) || (typeof one == 'boolean' && typeof two == 'boolean') ) { return one === two }
// When we’re working with date representations, compare the “pick” value. if ( (_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two)) ) { return calendar.create(one).pick === calendar.create(two).pick }
// When we’re working with range objects, compare the “from” and “to”. if ($.isPlainObject(one) && $.isPlainObject(two)) { return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to) }
return false }
/** * Check if two date units overlap. */ DatePicker.prototype.isDateOverlap = function (one, two) {
var calendar = this, firstDay = calendar.settings.firstDay ? 1 : 0
// When we’re working with a weekday index, compare the days. if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) { one = one % 7 + firstDay return one === calendar.create(two).day + 1 } if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) { two = two % 7 + firstDay return two === calendar.create(one).day + 1 }
// When we’re working with range objects, check if the ranges overlap. if ($.isPlainObject(one) && $.isPlainObject(two)) { return calendar.overlapRanges(one, two) }
return false }
/** * Flip the “enabled” state. */ DatePicker.prototype.flipEnable = function (val) { var itemObject = this.item itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1) }
/** * Mark a collection of dates as “disabled”. */ DatePicker.prototype.deactivate = function (type, datesToDisable) {
var calendar = this, disabledItems = calendar.item.disable.slice(0)
// If we’re flipping, that’s all we need to do. if (datesToDisable == 'flip') { calendar.flipEnable() } else if (datesToDisable === false) { calendar.flipEnable(1) disabledItems = [] } else if (datesToDisable === true) { calendar.flipEnable(-1) disabledItems = [] }
// Otherwise go through the dates to disable. else {
datesToDisable.map(function (unitToDisable) {
var matchFound
// When we have disabled items, check for matches. // If something is matched, immediately break out. for (var index = 0; index < disabledItems.length; index += 1) { if (calendar.isDateExact(unitToDisable, disabledItems[index])) { matchFound = true break } }
// If nothing was found, add the validated unit to the collection. if (!matchFound) { if ( _.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || ($.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) ) { disabledItems.push(unitToDisable) } } }) }
// Return the updated collection. return disabledItems } //DatePicker.prototype.deactivate
/** * Mark a collection of dates as “enabled”. */ DatePicker.prototype.activate = function (type, datesToEnable) {
var calendar = this, disabledItems = calendar.item.disable, disabledItemsCount = disabledItems.length
// If we’re flipping, that’s all we need to do. if (datesToEnable == 'flip') { calendar.flipEnable() } else if (datesToEnable === true) { calendar.flipEnable(1) disabledItems = [] } else if (datesToEnable === false) { calendar.flipEnable(-1) disabledItems = [] }
// Otherwise go through the disabled dates. else {
datesToEnable.map(function (unitToEnable) {
var matchFound, disabledUnit, index, isExactRange
// Go through the disabled items and try to find a match. for (index = 0; index < disabledItemsCount; index += 1) {
disabledUnit = disabledItems[index]
// When an exact match is found, remove it from the collection. if (calendar.isDateExact(disabledUnit, unitToEnable)) { matchFound = disabledItems[index] = null isExactRange = true break }
// When an overlapped match is found, add the “inverted” state to it. else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) { if ($.isPlainObject(unitToEnable)) { unitToEnable.inverted = true matchFound = unitToEnable } else if ($.isArray(unitToEnable)) { matchFound = unitToEnable if (!matchFound[3]) matchFound.push('inverted') } else if (_.isDate(unitToEnable)) { matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'] } break } }
// If a match was found, remove a previous duplicate entry. if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) { if (calendar.isDateExact(disabledItems[index], unitToEnable)) { disabledItems[index] = null break } }
// In the event that we’re dealing with an exact range of dates, // make sure there are no “inverted” dates because of it. if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) { if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) { disabledItems[index] = null break } }
// If something is still matched, add it into the collection. if (matchFound) { disabledItems.push(matchFound) } }) }
// Return the updated collection. return disabledItems.filter(function (val) { return val != null }) } //DatePicker.prototype.activate
/** * Create a string for the nodes in the picker. */ DatePicker.prototype.nodes = function (isOpen) {
var calendar = this, settings = calendar.settings, calendarItem = calendar.item, nowObject = calendarItem.now, selectedObject = calendarItem.select, highlightedObject = calendarItem.highlight, viewsetObject = calendarItem.view, disabledCollection = calendarItem.disable, minLimitObject = calendarItem.min, maxLimitObject = calendarItem.max,
// Create the calendar table head using a copy of weekday labels collection. // * We do a copy so we don't mutate the original array. tableHead = (function (collection, fullCollection) {
// If the first day should be Monday, move Sunday to the end. if (settings.firstDay) { collection.push(collection.shift()) fullCollection.push(fullCollection.shift()) }
// Create and return the table head group. return _.node( 'thead', _.node( 'tr', _.group({ min: 0, max: DAYS_IN_WEEK - 1, i: 1, node: 'th', item: function (counter) { return [ collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"' ] } }) ) ) //endreturn
// Materialize modified })((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead
// Create the nav for next/prev month. createMonthNav = function (next) {
// Otherwise, return the created month tag. return _.node( 'div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
// If the focused month is outside the range, disabled the button. (next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month) || (!next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month) ? ' ' + settings.klass.navDisabled : ), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({ role: 'button', controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"' ) //endreturn }, //createMonthNav
// Create the month label. //Materialize modified createMonthLabel = function (override) {
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
// Materialize modified if (override == "short_months") { monthsCollection = settings.monthsShort; }
// If there are months to select, add a dropdown menu. if (settings.selectMonths && override == undefined) {
return _.node('select', _.group({ min: 0, max: 11, i: 1, node: 'option', item: function (loopedMonth) {
return [
// The looped month and no classes. monthsCollection[loopedMonth], 0,
// Set the value and selected index. 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : ) + ( ( (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month) || (viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month) ) ? ' disabled' : ) ] } }), settings.klass.selectMonth + ' browser-default', (isOpen ? : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"' ) }
// Materialize modified if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month]; else return monthsCollection[viewsetObject.month];
// If there's a need for a month selector return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month) }, //createMonthLabel
// Create the year label. // Materialize modified createYearLabel = function (override) {
var focusedYear = viewsetObject.year,
// If years selector is set to a literal "true", set it to 5. Otherwise // divide in half to get half before and half after focused year. numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2)
// If there are years to select, add a dropdown menu. if (numberYears) {
var minYear = minLimitObject.year, maxYear = maxLimitObject.year, lowestYear = focusedYear - numberYears, highestYear = focusedYear + numberYears
// If the min year is greater than the lowest year, increase the highest year // by the difference and set the lowest year to the min year. if (minYear > lowestYear) { highestYear += minYear - lowestYear lowestYear = minYear }
// If the max year is less than the highest year, decrease the lowest year // by the lower of the two: available and needed years. Then set the // highest year to the max year. if (maxYear < highestYear) {
var availableYears = lowestYear - minYear, neededYears = highestYear - maxYear
lowestYear -= availableYears > neededYears ? neededYears : availableYears highestYear = maxYear }
if (settings.selectYears && override == undefined) { return _.node('select', _.group({ min: lowestYear, max: highestYear, i: 1, node: 'option', item: function (loopedYear) { return [
// The looped year and no classes. loopedYear, 0,
// Set the value and selected index. 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : ) ] } }), settings.klass.selectYear + ' browser-default', (isOpen ? : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"' ) } }
// Materialize modified if (override == "raw") return _.node('div', focusedYear)
// Otherwise just return the year focused return _.node('div', focusedYear, settings.klass.year) } //createYearLabel
// Materialize modified createDayLabel = function () { if (selectedObject != null) return selectedObject.date else return nowObject.date } createWeekdayLabel = function () { var display_day;
if (selectedObject != null) display_day = selectedObject.day; else display_day = nowObject.day; var weekday = settings.weekdaysShort[display_day]; return weekday }
// Create and return the entire calendar.
return _.node( // Date presentation View 'div', _.node( // Div for Year 'div', createYearLabel("raw"), settings.klass.year_display ) + _.node( 'span', createWeekdayLabel() + ', ', "picker__weekday-display" ) + _.node( // Div for short Month 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display ) + _.node( // Div for Day 'span', createDayLabel(), settings.klass.day_display ), settings.klass.date_display ) + // Calendar container _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header ) + _.node( 'table', tableHead + _.node( 'tbody', _.group({ min: 0, max: WEEKS_IN_CALENDAR - 1, i: 1, node: 'tr', item: function (rowCounter) {
// If Monday is the first day and the month starts on Sunday, shift the date back a week. var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0
return [
_.group({
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index max: function () { return this.min + DAYS_IN_WEEK - 1 }, i: 1, node: 'td', item: function (targetDate) {
// Convert the time date from a relative date to a target date. targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)])
var isSelected = selectedObject && selectedObject.pick == targetDate.pick, isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate])
return [
_.node(
'div', targetDate.date, (function (klasses) {
// Add the `infocus` or `outfocus` classes based on month in view. klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus)
// Add the `today` class if needed. if (nowObject.pick == targetDate.pick) { klasses.push(settings.klass.now) }
// Add the `selected` class if something's selected and the time matches. if (isSelected) { klasses.push(settings.klass.selected) }
// Add the `highlighted` class if something's highlighted and the time matches. if (isHighlighted) { klasses.push(settings.klass.highlighted) }
// Add the `disabled` class if something's disabled and the object matches. if (isDisabled) { klasses.push(settings.klass.disabled) }
return klasses.join(' ') })([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ role: 'gridcell', label: formattedDate, selected: isSelected && calendar.$node.val() === formattedDate ? true : null, activedescendant: isHighlighted ? true : null, disabled: isDisabled ? true : null })
), , _.ariaAttr({
role: 'presentation' })
] //endreturn
} })
] //endreturn
} }) ), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ role: 'grid', controls: calendar.$node[0].id, readonly: true }) ), settings.klass.calendar_container) // end calendar
+
// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. _.node( 'div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer ), 'picker__container__wrapper' ) //endreturn } //DatePicker.prototype.nodes
/** * The date picker defaults. */ DatePicker.defaults = (function (prefix) {
return {
// The title label to use for the month nav buttons labelMonthNext: 'Next month', labelMonthPrev: 'Previous month',
// The title label to use for the dropdown selectors labelMonthSelect: 'Select a month', labelYearSelect: 'Select a year',
// Months and weekdays monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'], monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
// Materialize modified weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
// Today and clear today: 'Today', clear: 'Clear', close: 'Ok',
// The format to show on the `input` element format: 'd mmmm, yyyy',
// Classes klass: {
table: prefix + 'table',
header: prefix + 'header',
// Materialize Added klasses date_display: prefix + 'date-display', day_display: prefix + 'day-display', month_display: prefix + 'month-display', year_display: prefix + 'year-display', calendar_container: prefix + 'calendar-container', // end
navPrev: prefix + 'nav--prev', navNext: prefix + 'nav--next', navDisabled: prefix + 'nav--disabled',
month: prefix + 'month', year: prefix + 'year',
selectMonth: prefix + 'select--month', selectYear: prefix + 'select--year',
weekdays: prefix + 'weekday',
day: prefix + 'day', disabled: prefix + 'day--disabled', selected: prefix + 'day--selected', highlighted: prefix + 'day--highlighted', now: prefix + 'day--today', infocus: prefix + 'day--infocus', outfocus: prefix + 'day--outfocus',
footer: prefix + 'footer',
buttonClear: prefix + 'button--clear', buttonToday: prefix + 'button--today', buttonClose: prefix + 'button--close' } } })(Picker.klasses().picker + '__')
/** * Extend the picker to add the date picker. */ Picker.extend('pickadate', DatePicker)
}));;
/*!
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) * Copyright 2014 Wang Shenwei. * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) * * Further modified * Copyright 2015 Ching Yaw Hao. */
(function () {
var $ = window.jQuery, $win = $(window), $doc = $(document);
// Can I use inline svg ? var svgNS = 'http://www.w3.org/2000/svg', svgSupported = 'SVGAngle' in window && (function () { var supported, el = document.createElement('div'); el.innerHTML = '<svg/>'; supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; el.innerHTML = ; return supported; })();
// Can I use transition ? var transitionSupported = (function () { var style = document.createElement('div').style; return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style; })();
// Listen touch events in touch screen device, instead of mouse events in desktop. var touchSupported = 'ontouchstart' in window, mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ), mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ), mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : );
// Vibrate the device if supported var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
function createSvgElement(name) { return document.createElementNS(svgNS, name); }
function leadingZero(num) { return (num < 10 ? '0' : ) + num; }
// Get a unique id var idCounter = 0;
function uniqueId(prefix) { var id = ++idCounter + ; return prefix ? prefix + id : id; }
// Clock size var dialRadius = 135, outerRadius = 105, // innerRadius = 80 on 12 hour clock innerRadius = 80, tickRadius = 20, diameter = dialRadius * 2, duration = transitionSupported ? 350 : 1;
// Popover template var tpl = ['
'', ':', '',
'].join();
// ClockPicker function ClockPicker(element, options) { var popover = $(tpl), plate = popover.find('.clockpicker-plate'), holder = popover.find('.picker__holder'), hoursView = popover.find('.clockpicker-hours'), minutesView = popover.find('.clockpicker-minutes'), amPmBlock = popover.find('.clockpicker-am-pm-block'), isInput = element.prop('tagName') === 'INPUT', input = isInput ? element : element.find('input'), label = $("label[for=" + input.attr("id") + "]"), self = this;
this.id = uniqueId('cp'); this.element = element; this.holder = holder; this.options = options; this.isAppended = false; this.isShown = false; this.currentView = 'hours'; this.isInput = isInput; this.input = input; this.label = label; this.popover = popover; this.plate = plate; this.hoursView = hoursView; this.minutesView = minutesView; this.amPmBlock = amPmBlock; this.spanHours = popover.find('.clockpicker-span-hours'); this.spanMinutes = popover.find('.clockpicker-span-minutes'); this.spanAmPm = popover.find('.clockpicker-span-am-pm'); this.footer = popover.find('.picker__footer'); this.amOrPm = "PM";
// Setup for for 12 hour clock if option is selected if (options.twelvehour) { if (!options.ampmclickable) { this.spanAmPm.empty();$('
} else { this.spanAmPm.empty();$('
self.spanAmPm.children('#click-am').addClass("text-primary"); self.spanAmPm.children('#click-pm').removeClass("text-primary"); self.amOrPm = "AM"; }).appendTo(this.spanAmPm);$('
self.spanAmPm.children('#click-pm').addClass("text-primary"); self.spanAmPm.children('#click-am').removeClass("text-primary"); self.amOrPm = 'PM'; }).appendTo(this.spanAmPm); } }
// Add buttons to footer $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer); $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer); $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
this.spanHours.click($.proxy(this.toggleView, this, 'hours')); this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
// Show or toggle input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
// Build ticksvar tickTpl = $(''),
i, tick, radian, radius;
// Hours view if (options.twelvehour) { for (i = 1; i < 13; i += 1) { tick = tickTpl.clone(); radian = i / 6 * Math.PI; radius = outerRadius; tick.css({ left: dialRadius + Math.sin(radian) * radius - tickRadius, top: dialRadius - Math.cos(radian) * radius - tickRadius }); tick.html(i === 0 ? '00' : i); hoursView.append(tick); tick.on(mousedownEvent, mousedown); } } else { for (i = 0; i < 24; i += 1) { tick = tickTpl.clone(); radian = i / 6 * Math.PI; var inner = i > 0 && i < 13; radius = inner ? innerRadius : outerRadius; tick.css({ left: dialRadius + Math.sin(radian) * radius - tickRadius, top: dialRadius - Math.cos(radian) * radius - tickRadius }); tick.html(i === 0 ? '00' : i); hoursView.append(tick); tick.on(mousedownEvent, mousedown); } }
// Minutes view for (i = 0; i < 60; i += 5) { tick = tickTpl.clone(); radian = i / 30 * Math.PI; tick.css({ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, top: dialRadius - Math.cos(radian) * outerRadius - tickRadius }); tick.html(leadingZero(i)); minutesView.append(tick); tick.on(mousedownEvent, mousedown); }
// Clicking on minutes view space plate.on(mousedownEvent, function (e) { if ($(e.target).closest('.clockpicker-tick').length === 0) { mousedown(e, true); } });
// Mousedown or touchstart function mousedown(e, space) { var offset = plate.offset(), isTouch = /^touch/.test(e.type), x0 = offset.left + dialRadius, y0 = offset.top + dialRadius, dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, z = Math.sqrt(dx * dx + dy * dy), moved = false;
// When clicking on minutes view space, check the mouse position if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { return; } e.preventDefault();
// Set cursor style of body after 200ms var movingTimer = setTimeout(function () { self.popover.addClass('clockpicker-moving'); }, 200);
// Clock self.setHand(dx, dy, !space, true);
// Mousemove on document $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) { e.preventDefault(); var isTouch = /^touch/.test(e.type), x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; if (!moved && x === dx && y === dy) { // Clicking in chrome on windows will trigger a mousemove event return; } moved = true; self.setHand(x, y, false, true); });
// Mouseup on document $doc.off(mouseupEvent).on(mouseupEvent, function (e) { $doc.off(mouseupEvent); e.preventDefault(); var isTouch = /^touch/.test(e.type), x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; if ((space || moved) && x === dx && y === dy) { self.setHand(x, y); }
if (self.currentView === 'hours') { self.toggleView('minutes', duration / 2); } else if (options.autoclose) { self.minutesView.addClass('clockpicker-dial-out'); setTimeout(function () { self.done(); }, duration / 2); } plate.prepend(canvas);
// Reset cursor style of body clearTimeout(movingTimer); self.popover.removeClass('clockpicker-moving');
// Unbind mousemove event $doc.off(mousemoveEvent); }); }
if (svgSupported) { // Draw clock hands and others var canvas = popover.find('.clockpicker-canvas'), svg = createSvgElement('svg'); svg.setAttribute('class', 'clockpicker-svg'); svg.setAttribute('width', diameter); svg.setAttribute('height', diameter); var g = createSvgElement('g'); g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); var bearing = createSvgElement('circle'); bearing.setAttribute('class', 'clockpicker-canvas-bearing'); bearing.setAttribute('cx', 0); bearing.setAttribute('cy', 0); bearing.setAttribute('r', 4); var hand = createSvgElement('line'); hand.setAttribute('x1', 0); hand.setAttribute('y1', 0); var bg = createSvgElement('circle'); bg.setAttribute('class', 'clockpicker-canvas-bg'); bg.setAttribute('r', tickRadius); g.appendChild(hand); g.appendChild(bg); g.appendChild(bearing); svg.appendChild(g); canvas.append(svg);
this.hand = hand; this.bg = bg; this.bearing = bearing; this.g = g; this.canvas = canvas; }
raiseCallback(this.options.init); }
function raiseCallback(callbackFunction) { if (callbackFunction && typeof callbackFunction === "function") callbackFunction(); }
// Default options ClockPicker.DEFAULTS = { 'default': , // default time, 'now' or '13:14' e.g. fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') donetext: 'Ok', // done button text cleartext: 'Clear', canceltext: 'Cancel', autoclose: false, // auto close when minute is selected ampmclickable: true, // set am/pm button on itself darktheme: false, // set to dark theme twelvehour: true, // change to 12 hour AM/PM clock from 24 hour vibrate: true // vibrate the device when dragging clock hand };
// Show or hide popover ClockPicker.prototype.toggle = function () { this[this.isShown ? 'hide' : 'show'](); };
// Set popover position ClockPicker.prototype.locate = function () { var element = this.element, popover = this.popover, offset = element.offset(), width = element.outerWidth(), height = element.outerHeight(), align = this.options.align, self = this;
popover.show(); };
// Show popover ClockPicker.prototype.show = function (e) { // Not show again if (this.isShown) { return; } raiseCallback(this.options.beforeShow); $(':input').each(function () { $(this).attr('tabindex', -1); }) var self = this; // Initialize this.input.blur(); this.popover.addClass('picker--opened'); this.input.addClass('picker__input picker__input--active'); $(document.body).css('overflow', 'hidden'); // Get the time var value = ((this.input.prop('value') || this.options['default'] || ) + ).split(':'); if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { if (value[1].indexOf("AM") > 0) { this.amOrPm = 'AM'; } else { this.amOrPm = 'PM'; } value[1] = value[1].replace("AM", "").replace("PM", ""); } if (value[0] === 'now') { var now = new Date(+new Date() + this.options.fromnow); value = [
now.getHours(), now.getMinutes() ];
} this.hours = +value[0] || 0; this.minutes = +value[1] || 0; this.spanHours.html(this.hours); this.spanMinutes.html(leadingZero(this.minutes)); if (!this.isAppended) { // Append popover to body this.popover.insertAfter(this.input); if (this.options.twelvehour) { if (this.amOrPm === 'PM') { this.spanAmPm.children('#click-pm').addClass("text-primary"); this.spanAmPm.children('#click-am').removeClass("text-primary"); } else { this.spanAmPm.children('#click-am').addClass("text-primary"); this.spanAmPm.children('#click-pm').removeClass("text-primary"); } } // Reset position when resize $win.on('resize.clockpicker' + this.id, function () { if (self.isShown) { self.locate(); } }); this.isAppended = true; } // Toggle to hours view this.toggleView('hours'); // Set position this.locate(); this.isShown = true; // Hide when clicking or tabbing on any element except the clock and input $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) { var target = $(e.target); if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { self.hide(); } }); // Hide when ESC is pressed $doc.on('keyup.clockpicker.' + this.id, function (e) { if (e.keyCode === 27) { self.hide(); } }); raiseCallback(this.options.afterShow); }; // Hide popover ClockPicker.prototype.hide = function () { raiseCallback(this.options.beforeHide); this.input.removeClass('picker__input picker__input--active'); this.popover.removeClass('picker--opened'); $(document.body).css('overflow', 'visible'); this.isShown = false; $(':input').each(function (index) { $(this).attr('tabindex', index + 1); }); // Unbinding events on document $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); $doc.off('keyup.clockpicker.' + this.id); this.popover.hide(); raiseCallback(this.options.afterHide); }; // Toggle to hours or minutes view ClockPicker.prototype.toggleView = function (view, delay) { var raiseAfterHourSelect = false; if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { raiseCallback(this.options.beforeHourSelect); raiseAfterHourSelect = true; } var isHours = view === 'hours', nextView = isHours ? this.hoursView : this.minutesView, hideView = isHours ? this.minutesView : this.hoursView; this.currentView = view;
this.spanHours.toggleClass('text-primary', isHours); this.spanMinutes.toggleClass('text-primary', !isHours);
// Let's make transitions hideView.addClass('clockpicker-dial-out'); nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
// Reset clock hand this.resetClock(delay);
// After transitions ended clearTimeout(this.toggleViewTimer); this.toggleViewTimer = setTimeout(function () { hideView.css('visibility', 'hidden'); }, duration);
if (raiseAfterHourSelect) { raiseCallback(this.options.afterHourSelect); } };
// Reset clock hand ClockPicker.prototype.resetClock = function (delay) { var view = this.currentView, value = this[view], isHours = view === 'hours', unit = Math.PI / (isHours ? 6 : 30), radian = value * unit, radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, x = Math.sin(radian) * radius, y = -Math.cos(radian) * radius, self = this;
if (svgSupported && delay) { self.canvas.addClass('clockpicker-canvas-out'); setTimeout(function () { self.canvas.removeClass('clockpicker-canvas-out'); self.setHand(x, y); }, delay); } else this.setHand(x, y); };
// Set clock hand to (x, y) ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) { var radian = Math.atan2(x, -y), isHours = this.currentView === 'hours', unit = Math.PI / (isHours || roundBy5 ? 6 : 30), z = Math.sqrt(x * x + y * y), options = this.options, inner = isHours && z < (outerRadius + innerRadius) / 2, radius = inner ? innerRadius : outerRadius, value;
if (options.twelvehour) { radius = outerRadius; }
// Radian should in range [0, 2PI] if (radian < 0) { radian = Math.PI * 2 + radian; }
// Get the round value value = Math.round(radian / unit);
// Get the round radian radian = value * unit;
// Correct the hours or minutes if (options.twelvehour) { if (isHours) { if (value === 0) value = 12; } else { if (roundBy5) value *= 5; if (value === 60) value = 0; } } else { if (isHours) { if (value === 12) value = 0; value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12; } else { if (roundBy5) value *= 5; if (value === 60) value = 0; } }
// Once hours or minutes changed, vibrate the device if (this[this.currentView] !== value) { if (vibrate && this.options.vibrate) { // Do not vibrate too frequently if (!this.vibrateTimer) { navigator[vibrate](10); this.vibrateTimer = setTimeout($.proxy(function () { this.vibrateTimer = null; }, this), 100); } } }
this[this.currentView] = value; if (isHours) { this['spanHours'].html(value); } else { this['spanMinutes'].html(leadingZero(value)); }
// If svg is not supported, just add an active class to the tick if (!svgSupported) { this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () { var tick = $(this); tick.toggleClass('active', value === +tick.html()); }); return; }
// Set clock hand and others' position var cx1 = Math.sin(radian) * (radius - tickRadius), cy1 = -Math.cos(radian) * (radius - tickRadius), cx2 = Math.sin(radian) * radius, cy2 = -Math.cos(radian) * radius; this.hand.setAttribute('x2', cx1); this.hand.setAttribute('y2', cy1); this.bg.setAttribute('cx', cx2); this.bg.setAttribute('cy', cy2); };
// Hours and minutes are selected ClockPicker.prototype.done = function () { raiseCallback(this.options.beforeDone); this.hide(); this.label.addClass('active');
var last = this.input.prop('value'), value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); if (this.options.twelvehour) { value = value + this.amOrPm; }
this.input.prop('value', value); if (value !== last) { this.input.triggerHandler('change'); if (!this.isInput) { this.element.trigger('change'); } }
if (this.options.autoclose) this.input.trigger('blur');
raiseCallback(this.options.afterDone); };
// Clear input field ClockPicker.prototype.clear = function () { this.hide(); this.label.removeClass('active');
var last = this.input.prop('value'), value = ;
this.input.prop('value', value); if (value !== last) { this.input.triggerHandler('change'); if (!this.isInput) { this.element.trigger('change'); } }
if (this.options.autoclose) { this.input.trigger('blur'); } };
// Remove clockpicker from input ClockPicker.prototype.remove = function () { this.element.removeData('clockpicker'); this.input.off('focus.clockpicker click.clockpicker'); if (this.isShown) { this.hide(); } if (this.isAppended) { $win.off('resize.clockpicker' + this.id); this.popover.remove(); } };
// Extends $.fn.clockpicker $.fn.pickatime = function (option) { var args = Array.prototype.slice.call(arguments, 1); return this.each(function () { var $this = $(this), data = $this.data('clockpicker'); if (!data) { var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); $this.data('clockpicker', new ClockPicker($this, options)); } else { // Manual operatsions. show, hide, remove, e.g. if (typeof data[option] === 'function') { data[option].apply(data, args); } } }); };
}());; (function ($) {
$.fn.characterCounter = function () { return this.each(function () { var $input = $(this); var $counterElement = $input.parent().find('span[class="character-counter"]');
// character counter has already been added appended to the parent container if ($counterElement.length) { return; }
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
if (itHasLengthAttribute) { $input.on('input', updateCounter); $input.on('focus', updateCounter); $input.on('blur', removeCounterElement);
addCounterElement($input); }
}); };
function updateCounter() { var maxLength = +$(this).attr('data-length'), actualLength = +$(this).val().length, isValidLength = actualLength <= maxLength;
$(this).parent().find('span[class="character-counter"]') .html(actualLength + '/' + maxLength);
addInputStyle(isValidLength, $(this)); }
function addCounterElement($input) { var $counterElement = $input.parent().find('span[class="character-counter"]');
if ($counterElement.length) { return; }
$counterElement = $('<span/>') .addClass('character-counter') .css('float', 'right') .css('font-size', '12px') .css('height', 1);
$input.parent().append($counterElement); }
function removeCounterElement() { $(this).parent().find('span[class="character-counter"]').html(); }
function addInputStyle(isValidLength, $input) { var inputHasInvalidClass = $input.hasClass('invalid'); if (isValidLength && inputHasInvalidClass) { $input.removeClass('invalid'); } else if (!isValidLength && !inputHasInvalidClass) { $input.removeClass('valid'); $input.addClass('invalid'); } }
$(document).ready(function () { $('input, textarea').characterCounter(); });
}(jQuery));; (function ($) {
var methods = {
init: function (options) { var defaults = { duration: 200, // ms dist: -100, // zoom scale TODO: make this more intuitive as an option shift: 0, // spacing for center image padding: 0, // Padding between non center items fullWidth: false, // Change to full width styles indicators: false, // Toggle indicators noWrap: false, // Don't wrap around and cycle through items. onCycleTo: null // Callback for when a new slide is cycled to. }; options = $.extend(defaults, options); var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i; var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;var $indicators = $('
var scrollingTimeout = null; var oneTimeCallback = null;
// Initialize var view = $(this); var showIndicators = view.attr('data-indicators') || options.indicators;
// Options var setCarouselHeight = function () { var firstImage = view.find('.carousel-item img').first(); if (firstImage.length) { if (firstImage.prop('complete')) { view.css('height', firstImage.height()); } else { firstImage.on('load', function () { view.css('height', $(this).height()); }); } } else { var imageHeight = view.find('.carousel-item').first().height(); view.css('height', imageHeight); } };
if (options.fullWidth) { options.dist = 0; setCarouselHeight();
// Offset fixed items when indicators. if (showIndicators) { view.find('.carousel-fixed-item').addClass('with-indicators'); } }
// Don't double initialize. if (view.hasClass('initialized')) { // Recalculate variables $(window).trigger('resize');
// Redraw carousel. $(this).trigger('carouselNext', [0.000001]); return true; }
view.addClass('initialized'); pressed = false; offset = target = 0; images = []; item_width = view.find('.carousel-item').first().innerWidth(); item_height = view.find('.carousel-item').first().innerHeight(); dim = item_width * 2 + options.padding;
view.find('.carousel-item').each(function (i) { images.push($(this)[0]); if (showIndicators) {var $indicator = $('');
// Add active to first by default. if (i === 0) { $indicator.addClass('active'); }
// Handle clicks on indicators. $indicator.click(function (e) { e.stopPropagation();
var index = $(this).index(); cycleTo(index); }); $indicators.append($indicator); } });
if (showIndicators) { view.append($indicators); } count = images.length;
function setupEvents() { if (typeof window.ontouchstart !== 'undefined') { view[0].addEventListener('touchstart', tap); view[0].addEventListener('touchmove', drag); view[0].addEventListener('touchend', release); } view[0].addEventListener('mousedown', tap); view[0].addEventListener('mousemove', drag); view[0].addEventListener('mouseup', release); view[0].addEventListener('mouseleave', release); view[0].addEventListener('click', click); }
function xpos(e) { // touch event if (e.targetTouches && (e.targetTouches.length >= 1)) { return e.targetTouches[0].clientX; }
// mouse event return e.clientX; }
function ypos(e) { // touch event if (e.targetTouches && (e.targetTouches.length >= 1)) { return e.targetTouches[0].clientY; }
// mouse event return e.clientY; }
function wrap(x) { return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x; }
function scroll(x) { // Track scrolling state scrolling = true; if (!view.hasClass('scrolling')) { view.addClass('scrolling'); } if (scrollingTimeout != null) { window.clearTimeout(scrollingTimeout); } scrollingTimeout = window.setTimeout(function () { scrolling = false; view.removeClass('scrolling'); }, options.duration);
// Start actual scroll var i, half, delta, dir, tween, el, alignment, xTranslation; var lastCenter = center;
offset = (typeof x === 'number') ? x : offset; center = Math.floor((offset + dim / 2) / dim); delta = offset - center * dim; dir = (delta < 0) ? 1 : -1; tween = -dir * delta * 2 / dim; half = count >> 1;
if (!options.fullWidth) { alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; } else { alignment = 'translateX(0)'; }
// Set indicator active if (showIndicators) { var diff = (center % count); var activeIndicator = $indicators.find('.indicator-item.active'); if (activeIndicator.index() !== diff) { activeIndicator.removeClass('active'); $indicators.find('.indicator-item').eq(diff).addClass('active'); } }
// center // Don't show wrapped items. if (!options.noWrap || (center >= 0 && center < count)) { el = images[wrap(center)];
// Add active class to center item. if (!$(el).hasClass('active')) { view.find('.carousel-item').removeClass('active'); $(el).addClass('active'); } el.style[xform] = alignment + ' translateX(' + (-delta / 2) + 'px)' + ' translateX(' + (dir * options.shift * tween * i) + 'px)' + ' translateZ(' + (options.dist * tween) + 'px)'; el.style.zIndex = 0; if (options.fullWidth) { tweenedOpacity = 1; } else { tweenedOpacity = 1 - 0.2 * tween; } el.style.opacity = tweenedOpacity; el.style.display = 'block'; }
for (i = 1; i <= half; ++i) { // right side if (options.fullWidth) { zTranslation = options.dist; tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1; } else { zTranslation = options.dist * (i * 2 + tween * dir); tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); } // Don't show wrapped items. if (!options.noWrap || center + i < count) { el = images[wrap(center + i)]; el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; el.style.zIndex = -i; el.style.opacity = tweenedOpacity; el.style.display = 'block'; }
// left side if (options.fullWidth) { zTranslation = options.dist; tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1; } else { zTranslation = options.dist * (i * 2 - tween * dir); tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); } // Don't show wrapped items. if (!options.noWrap || center - i >= 0) { el = images[wrap(center - i)]; el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; el.style.zIndex = -i; el.style.opacity = tweenedOpacity; el.style.display = 'block'; } }
// center // Don't show wrapped items. if (!options.noWrap || (center >= 0 && center < count)) { el = images[wrap(center)]; el.style[xform] = alignment + ' translateX(' + (-delta / 2) + 'px)' + ' translateX(' + (dir * options.shift * tween) + 'px)' + ' translateZ(' + (options.dist * tween) + 'px)'; el.style.zIndex = 0; if (options.fullWidth) { tweenedOpacity = 1; } else { tweenedOpacity = 1 - 0.2 * tween; } el.style.opacity = tweenedOpacity; el.style.display = 'block'; }
// onCycleTo callback if (lastCenter !== center && typeof (options.onCycleTo) === "function") { var $curr_item = view.find('.carousel-item').eq(wrap(center)); options.onCycleTo.call(this, $curr_item, dragged); }
// One time callback if (typeof (oneTimeCallback) === "function") { oneTimeCallback.call(this, $curr_item, dragged); oneTimeCallback = null; } }
function track() { var now, elapsed, delta, v;
now = Date.now(); elapsed = now - timestamp; timestamp = now; delta = offset - frame; frame = offset;
v = 1000 * delta / (1 + elapsed); velocity = 0.8 * v + 0.2 * velocity; }
function autoScroll() { var elapsed, delta;
if (amplitude) { elapsed = Date.now() - timestamp; delta = amplitude * Math.exp(-elapsed / options.duration); if (delta > 2 || delta < -2) { scroll(target - delta); requestAnimationFrame(autoScroll); } else { scroll(target); } } }
function click(e) { // Disable clicks if carousel was dragged. if (dragged) { e.preventDefault(); e.stopPropagation(); return false;
} else if (!options.fullWidth) { var clickedIndex = $(e.target).closest('.carousel-item').index(); var diff = wrap(center) - clickedIndex;
// Disable clicks if carousel was shifted by click if (diff !== 0) { e.preventDefault(); e.stopPropagation(); } cycleTo(clickedIndex); } }
function cycleTo(n) { var diff = (center % count) - n;
// Account for wraparound. if (!options.noWrap) { if (diff < 0) { if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
} else if (diff > 0) { if (Math.abs(diff - count) < diff) { diff -= count; } } }
// Call prev or next accordingly. if (diff < 0) { view.trigger('carouselNext', [Math.abs(diff)]);
} else if (diff > 0) { view.trigger('carouselPrev', [diff]); } }
function tap(e) { if (e.type === 'mousedown') { e.preventDefault(); } pressed = true; dragged = false; vertical_dragged = false; reference = xpos(e); referenceY = ypos(e);
velocity = amplitude = 0; frame = offset; timestamp = Date.now(); clearInterval(ticker); ticker = setInterval(track, 100); }
function drag(e) { var x, delta, deltaY; if (pressed) { x = xpos(e); y = ypos(e); delta = reference - x; deltaY = Math.abs(referenceY - y); if (deltaY < 30 && !vertical_dragged) { // If vertical scrolling don't allow dragging. if (delta > 2 || delta < -2) { dragged = true; reference = x; scroll(offset + delta); }
} else if (dragged) { // If dragging don't allow vertical scroll. e.preventDefault(); e.stopPropagation(); return false;
} else { // Vertical scrolling. vertical_dragged = true; } }
if (dragged) { // If dragging don't allow vertical scroll. e.preventDefault(); e.stopPropagation(); return false; } }
function release(e) { if (pressed) { pressed = false; } else { return; }
clearInterval(ticker); target = offset; if (velocity > 10 || velocity < -10) { amplitude = 0.9 * velocity; target = offset + amplitude; } target = Math.round(target / dim) * dim;
// No wrap of items. if (options.noWrap) { if (target >= dim * (count - 1)) { target = dim * (count - 1); } else if (target < 0) { target = 0; } } amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll);
if (dragged) { e.preventDefault(); e.stopPropagation(); } return false; }
xform = 'transform'; ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { var e = prefix + 'Transform'; if (typeof document.body.style[e] !== 'undefined') { xform = e; return false; } return true; });
$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, function () { if (options.fullWidth) { item_width = view.find('.carousel-item').first().innerWidth(); item_height = view.find('.carousel-item').first().innerHeight(); dim = item_width * 2 + options.padding; offset = center * 2 * item_width; target = offset; } else { scroll(); } });
setupEvents(); scroll(offset);
$(this).on('carouselNext', function (e, n, callback) { if (n === undefined) { n = 1; } if (typeof (callback) === "function") { oneTimeCallback = callback; }
target = (dim * Math.round(offset / dim)) + (dim * n); if (offset !== target) { amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll); } });
$(this).on('carouselPrev', function (e, n, callback) { if (n === undefined) { n = 1; } if (typeof (callback) === "function") { oneTimeCallback = callback; }
target = (dim * Math.round(offset / dim)) - (dim * n); if (offset !== target) { amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll); } });
$(this).on('carouselSet', function (e, n, callback) { if (n === undefined) { n = 0; } if (typeof (callback) === "function") { oneTimeCallback = callback; }
cycleTo(n); });
});
}, next: function (n, callback) { $(this).trigger('carouselNext', [n, callback]); }, prev: function (n, callback) { $(this).trigger('carouselPrev', [n, callback]); }, set: function (n, callback) { $(this).trigger('carouselSet', [n, callback]); } };
$.fn.carousel = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel'); } }; // Plugin end
}(jQuery));; (function ($) {
var methods = { init: function (options) { return this.each(function () { var origin = $('#' + $(this).attr('data-activates')); var screen = $('body');
// Creating tap target var tapTargetEl = $(this); var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
// Creating wrapper if (!tapTargetWrapper.length) {tapTargetWrapper = tapTargetEl.wrap($('')).parent();
}
// Creating content if (!tapTargetContentEl.length) {tapTargetContentEl = $('');
tapTargetEl.append(tapTargetContentEl); }
// Creating foreground wave if (!tapTargetWave.length) {tapTargetWave = $('');
// Creating origin if (!tapTargetOriginEl.length) { tapTargetOriginEl = origin.clone(true, true); tapTargetOriginEl.addClass('tap-target-origin'); tapTargetOriginEl.removeAttr('id'); tapTargetOriginEl.removeAttr('style'); tapTargetWave.append(tapTargetOriginEl); }
tapTargetWrapper.append(tapTargetWave); }
// Open var openTapTarget = function () { if (tapTargetWrapper.is('.open')) { return; }
// Adding open class tapTargetWrapper.addClass('open');
setTimeout(function () { tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) { closeTapTarget(); tapTargetOriginEl.off('click.tapTarget'); });
$(document).off('click.tapTarget').on('click.tapTarget', function (e) { closeTapTarget(); $(document).off('click.tapTarget'); });
var throttledCalc = Materialize.throttle(function () { calculateTapTarget(); }, 200); $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); }, 0); };
// Close var closeTapTarget = function () { if (!tapTargetWrapper.is('.open')) { return; }
tapTargetWrapper.removeClass('open'); tapTargetOriginEl.off('click.tapTarget') $(document).off('click.tapTarget'); $(window).off('resize.tapTarget'); };
// Pre calculate var calculateTapTarget = function () { // Element or parent is fixed position? var isFixed = origin.css('position') === 'fixed'; if (!isFixed) { var parents = origin.parents(); for (var i = 0; i < parents.length; i++) { isFixed = $(parents[i]).css('position') == 'fixed'; if (isFixed) { break; } } }
// Calculating origin var originWidth = origin.outerWidth(); var originHeight = origin.outerHeight(); var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
// Calculating screen var windowWidth = $(window).width(); var windowHeight = $(window).height(); var centerX = windowWidth / 2; var centerY = windowHeight / 2; var isLeft = originLeft <= centerX; var isRight = originLeft > centerX; var isTop = originTop <= centerY; var isBottom = originTop > centerY; var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75; var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
// Calculating tap target var tapTargetWidth = tapTargetEl.outerWidth(); var tapTargetHeight = tapTargetEl.outerHeight(); var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2; var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2; var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
// Calculating content var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth; var tapTargetTextHeight = tapTargetHeight / 2; var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0; var tapTargetTextBottom = 0; var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0; var tapTargetTextRight = 0; var tapTargetTextPadding = originWidth; var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
// Calculating wave var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2; var tapTargetWaveHeight = tapTargetWaveWidth; var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2; var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
// Setting tap target var tapTargetWrapperCssObj = {}; tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ; tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ; tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ; tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ; tapTargetWrapperCssObj.position = tapTargetPosition; tapTargetWrapper.css(tapTargetWrapperCssObj);
// Setting content tapTargetContentEl.css({ width: tapTargetTextWidth, height: tapTargetTextHeight, top: tapTargetTextTop, right: tapTargetTextRight, bottom: tapTargetTextBottom, left: tapTargetTextLeft, padding: tapTargetTextPadding, verticalAlign: tapTargetTextAlign });
// Setting wave tapTargetWave.css({ top: tapTargetWaveTop, left: tapTargetWaveLeft, width: tapTargetWaveWidth, height: tapTargetWaveHeight }); }
if (options == 'open') { calculateTapTarget(); openTapTarget(); }
if (options == 'close') closeTapTarget(); }); }, open: function () {}, close: function () {} };
$.fn.tapTarget = function (methodOrOptions) { if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target'); };}(jQuery));