Difference between revisions of "Team:SYSU-CHINA/js/vendor.js"

Revision as of 07:34, 25 October 2017 (view source) CindyLiu (Talk | contribs) (Created page with "/******/ (function(modules) { // webpackBootstrap /******/ // The module cache /******/ var installedModules = {}; /******/ // The require function →‎****: function __we...")		Latest revision as of 08:48, 25 October 2017 (view source) CindyLiu (Talk | contribs)
Line 1:		Line 1:
−	/******/ (function(modules) { // webpackBootstrap	+	!function(t){function e(n){if(r[n])return r[n].exports;var o=r[n]={exports:{},id:n,loaded:!1};return t[n].call(o.exports,o,o.exports,e),o.loaded=!0,o.exports}var n=window.webpackJsonp;window.webpackJsonp=function(i,a){for(var s,u,c=0,l=[];c<i.length;c++)u=i[c],o[u]&&l.push.apply(l,o[u]),o[u]=0;for(s in a)t[s]=a[s];for(n&&n(i,a);l.length;)l.shift().call(null,e);if(a[0])return r[0]=0,e(0)};var r={},o={1:0};return e.e=function(t,n){if(0===o[t])return n.call(null,e);if(void 0!==o[t])o[t].push(n);else{o[t]=[n];var r=document.getElementsByTagName("head")[0],i=document.createElement("script");i.type="text/javascript",i.charset="utf-8",i.async=!0,i.src=e.p+""+t+".ca91e93d.js",r.appendChild(i)}},e.m=t,e.c=r,e.p="/dist/",e(0)}({0:function(t,e,n){n(2),n(4),t.exports=n(33)},2:function(t,e,n){(function(e,n){/*!
−	/******/ // The module cache	+
−	/******/ var installedModules = {};	+
−		+
−	/******/ // The require function	+
−	/******/ function __webpack_require__(moduleId) {	+
−		+
−	/******/ // Check if module is in cache	+
−	/******/ if(installedModules[moduleId])	+
−	/******/ return installedModules[moduleId].exports;	+
−		+
−	/******/ // Create a new module (and put it into the cache)	+
−	/******/ var module = installedModules[moduleId] = {	+
−	/******/ exports: {},	+
−	/******/ id: moduleId,	+
−	/******/ loaded: false	+
−	/******/ };	+
−		+
−	/******/ // Execute the module function	+
−	/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);	+
−		+
−	/******/ // Flag the module as loaded	+
−	/******/ module.loaded = true;	+
−		+
−	/******/ // Return the exports of the module	+
−	/******/ return module.exports;	+
−	/******/ }	+
−		+
−		+
−	/******/ // expose the modules object (__webpack_modules__)	+
−	/******/ __webpack_require__.m = modules;	+
−		+
−	/******/ // expose the module cache	+
−	/******/ __webpack_require__.c = installedModules;	+
−		+
−	/******/ // __webpack_public_path__	+
−	/******/ __webpack_require__.p = "/dist/";	+
−		+
−	/******/ // Load entry module and return exports	+
−	/******/ return __webpack_require__(0);	+
−	/******/ })	+
−	/************************************************************************/	+
−	/******/ ({	+
−		+
−	/***/ 0:	+
−	/***/ function(module, exports, __webpack_require__) {	+
−		+
−	__webpack_require__(2);	+
−	__webpack_require__(4);	+
−	module.exports = __webpack_require__(698);	+
−		+
−		+
−	/***/ },	+
−		+
−	/***/ 2:	+
−	/***/ function(module, exports, __webpack_require__) {	+
−		+
−	/* WEBPACK VAR INJECTION */(function(process, global) {/*!	+
	* Vue.js v2.1.8		* Vue.js v2.1.8
	* (c) 2014-2016 Evan You		* (c) 2014-2016 Evan You
	* Released under the MIT License.		* Released under the MIT License.
	*/		*/
−	'use strict';	+	"use strict";function r(t){return null==t?"":"object"==typeof t?JSON.stringify(t,null,2):String(t)}function o(t){var e=parseFloat(t,10);return e||0===e?e:t}function i(t,e){for(var n=Object.create(null),r=t.split(","),o=0;o<r.length;o++)n[r[o]]=!0;return e?function(t){return n[t.toLowerCase()]}:function(t){return n[t]}}function a(t,e){if(t.length){var n=t.indexOf(e);if(n>-1)return t.splice(n,1)}}function s(t,e){return kn.call(t,e)}function u(t){return"string"==typeof t||"number"==typeof t}function c(t){var e=Object.create(null);return function(n){var r=e[n];return r||(e[n]=t(n))}}function l(t,e){function n(n){var r=arguments.length;return r?r>1?t.apply(e,arguments):t.call(e,n):t.call(e)}return n._length=t.length,n}function p(t,e){e=e||0;for(var n=t.length-e,r=new Array(n);n--;)r[n]=t[n+e];return r}function f(t,e){for(var n in e)t[n]=e[n];return t}function d(t){return null!==t&&"object"==typeof t}function h(t){return Sn.call(t)===Tn}function v(t){for(var e={},n=0;n<t.length;n++)t[n]&&f(e,t[n]);return e}function m(){}function y(t){return t.reduce(function(t,e){return t.concat(e.staticKeys||[])},[]).join(",")}function g(t,e){var n=d(t),r=d(e);return n&&r?JSON.stringify(t)===JSON.stringify(e):!n&&!r&&String(t)===String(e)}function _(t,e){for(var n=0;n<t.length;n++)if(g(t[n],e))return n;return-1}function b(t){var e=(t+"").charCodeAt(0);return 36===e||95===e}function w(t,e,n,r){Object.defineProperty(t,e,{value:n,enumerable:!!r,writable:!0,configurable:!0})}function E(t){if(!Rn.test(t)){var e=t.split(".");return function(t){for(var n=0;n<e.length;n++){if(!t)return;t=t[e[n]]}return t}}}function O(t){return/native code/.test(t.toString())}function x(t){Qn.target&&tr.push(Qn.target),Qn.target=t}function k(){Qn.target=tr.pop()}function N(t,e){t.__proto__=e}function C(t,e,n){for(var r=0,o=n.length;r<o;r++){var i=n[r];w(t,i,e[i])}}function A(t,e){if(d(t)){var n;return s(t,"__ob__")&&t.__ob__ instanceof ir?n=t.__ob__:or.shouldConvert&&!zn()&&(Array.isArray(t)||h(t))&&Object.isExtensible(t)&&!t._isVue&&(n=new ir(t)),e&&n&&n.vmCount++,n}}function $(t,n,r,o){var i=new Qn,a=Object.getOwnPropertyDescriptor(t,n);if(!a||a.configurable!==!1){var s=a&&a.get,u=a&&a.set,c=A(r);Object.defineProperty(t,n,{enumerable:!0,configurable:!0,get:function(){var e=s?s.call(t):r;return Qn.target&&(i.depend(),c&&c.dep.depend(),Array.isArray(e)&&T(e)),e},set:function(n){var a=s?s.call(t):r;n===a||n!==n&&a!==a||("production"!==e.env.NODE_ENV&&o&&o(),u?u.call(t,n):r=n,c=A(n),i.notify())}})}}function D(t,n,r){if(Array.isArray(t))return t.length=Math.max(t.length,n),t.splice(n,1,r),r;if(s(t,n))return void(t[n]=r);var o=t.__ob__;return t._isVue||o&&o.vmCount?void("production"!==e.env.NODE_ENV&&Yn("Avoid adding reactive properties to a Vue instance or its root $data at runtime - declare it upfront in the data option.")):o?($(o.value,n,r),o.dep.notify(),r):void(t[n]=r)}function S(t,n){var r=t.__ob__;return t._isVue||r&&r.vmCount?void("production"!==e.env.NODE_ENV&&Yn("Avoid deleting properties on a Vue instance or its root $data - just set it to null.")):void(s(t,n)&&(delete t[n],r&&r.dep.notify()))}function T(t){for(var e=void 0,n=0,r=t.length;n<r;n++)e=t[n],e&&e.__ob__&&e.__ob__.dep.depend(),Array.isArray(e)&&T(e)}function j(t,e){if(!e)return t;for(var n,r,o,i=Object.keys(e),a=0;a<i.length;a++)n=i[a],r=t[n],o=e[n],s(t,n)?h(r)&&h(o)&&j(r,o):D(t,n,o);return t}function V(t,e){return e?t?t.concat(e):Array.isArray(e)?e:[e]:t}function P(t,e){var n=Object.create(t||null);return e?f(n,e):n}function R(t){for(var e in t.components){var n=e.toLowerCase();(xn(n)||Pn.isReservedTag(n))&&Yn("Do not use built-in or reserved HTML elements as component id: "+e)}}function L(t){var n=t.props;if(n){var r,o,i,a={};if(Array.isArray(n))for(r=n.length;r--;)o=n[r],"string"==typeof o?(i=Cn(o),a[i]={type:null}):"production"!==e.env.NODE_ENV&&Yn("props must be strings when using array syntax.");else if(h(n))for(var s in n)o=n[s],i=Cn(s),a[i]=h(o)?o:{type:o};t.props=a}}function M(t){var e=t.directives;if(e)for(var n in e){var r=e[n];"function"==typeof r&&(e[n]={bind:r,update:r})}}function I(t,n,r){function o(e){var o=ar[e]||ur;p[e]=o(t[e],n[e],r,e)}"production"!==e.env.NODE_ENV&&R(n),L(n),M(n);var i=n.extends;if(i&&(t="function"==typeof i?I(t,i.options,r):I(t,i,r)),n.mixins)for(var a=0,u=n.mixins.length;a<u;a++){var c=n.mixins[a];c.prototype instanceof Wt&&(c=c.options),t=I(t,c,r)}var l,p={};for(l in t)o(l);for(l in n)s(t,l)||o(l);return p}function U(t,n,r,o){if("string"==typeof r){var i=t[n];if(s(i,r))return i[r];var a=Cn(r);if(s(i,a))return i[a];var u=An(a);if(s(i,u))return i[u];var c=i[r]||i[a]||i[u];return"production"!==e.env.NODE_ENV&&o&&!c&&Yn("Failed to resolve "+n.slice(0,-1)+": "+r,t),c}}function q(t,n,r,o){var i=n[t],a=!s(r,t),u=r[t];if(J(Boolean,i.type)&&(a&&!s(i,"default")?u=!1:J(String,i.type)||""!==u&&u!==Dn(t)||(u=!0)),void 0===u){u=B(o,i,t);var c=or.shouldConvert;or.shouldConvert=!0,A(u),or.shouldConvert=c}return"production"!==e.env.NODE_ENV&&F(i,t,u,o,a),u}function B(t,n,r){if(s(n,"default")){var o=n.default;return d(o)&&"production"!==e.env.NODE_ENV&&Yn('Invalid default value for prop "'+r+'": Props with type Object/Array must use a factory function to return the default value.',t),t&&t.$options.propsData&&void 0===t.$options.propsData[r]&&void 0!==t[r]?t[r]:"function"==typeof o&&n.type!==Function?o.call(t):o}}function F(t,e,n,r,o){if(t.required&&o)return void Yn('Missing required prop: "'+e+'"',r);if(null!=n||t.required){var i=t.type,a=!i||i===!0,s=[];if(i){Array.isArray(i)||(i=[i]);for(var u=0;u<i.length&&!a;u++){var c=H(n,i[u]);s.push(c.expectedType||""),a=c.valid}}if(!a)return void Yn('Invalid prop: type check failed for prop "'+e+'". Expected '+s.map(An).join(", ")+", got "+Object.prototype.toString.call(n).slice(8,-1)+".",r);var l=t.validator;l&&(l(n)||Yn('Invalid prop: custom validator check failed for prop "'+e+'".',r))}}function H(t,e){var n,r=z(e);return n="String"===r?typeof t==(r="string"):"Number"===r?typeof t==(r="number"):"Boolean"===r?typeof t==(r="boolean"):"Function"===r?typeof t==(r="function"):"Object"===r?h(t):"Array"===r?Array.isArray(t):t instanceof e,{valid:n,expectedType:r}}function z(t){var e=t&&t.toString().match(/^\s*function (\w+)/);return e&&e[1]}function J(t,e){if(!Array.isArray(e))return z(e)===z(t);for(var n=0,r=e.length;n<r;n++)if(z(e[n])===z(t))return!0;return!1}function K(){mr.length=0,yr={},"production"!==e.env.NODE_ENV&&(gr={}),_r=br=!1}function W(){for(br=!0,mr.sort(function(t,e){return t.id-e.id}),wr=0;wr<mr.length;wr++){var t=mr[wr],n=t.id;if(yr[n]=null,t.run(),"production"!==e.env.NODE_ENV&&null!=yr[n]&&(gr[n]=(gr[n]||0)+1,gr[n]>Pn._maxUpdateCount)){Yn("You may have an infinite update loop "+(t.user?'in watcher with expression "'+t.expression+'"':"in a component render function."),t.vm);break}}Jn&&Pn.devtools&&Jn.emit("flush"),K()}function Y(t){var e=t.id;if(null==yr[e]){if(yr[e]=!0,br){for(var n=mr.length-1;n>=0&&mr[n].id>t.id;)n--;mr.splice(Math.max(n,wr)+1,0,t)}else mr.push(t);_r||(_r=!0,Kn(W))}}function Z(t){kr.clear(),G(t,kr)}function G(t,e){var n,r,o=Array.isArray(t);if((o||d(t))&&Object.isExtensible(t)){if(t.__ob__){var i=t.__ob__.dep.id;if(e.has(i))return;e.add(i)}if(o)for(n=t.length;n--;)G(t[n],e);else for(r=Object.keys(t),n=r.length;n--;)G(t[r[n]],e)}}function X(t){t._watchers=[];var e=t.$options;e.props&&Q(t,e.props),e.methods&&rt(t,e.methods),e.data?tt(t):A(t._data={},!0),e.computed&&et(t,e.computed),e.watch&&ot(t,e.watch)}function Q(t,n){var r=t.$options.propsData||{},o=t.$options._propKeys=Object.keys(n),i=!t.$parent;or.shouldConvert=i;for(var a=function(i){var a=o[i];"production"!==e.env.NODE_ENV?(Nr[a]&&Yn('"'+a+'" is a reserved attribute and cannot be used as component prop.',t),$(t,a,q(a,n,r,t),function(){t.$parent&&!or.isSettingProps&&Yn("Avoid mutating a prop directly since the value will be overwritten whenever the parent component re-renders. Instead, use a data or computed property based on the prop's value. Prop being mutated: \""+a+'"',t)})):$(t,a,q(a,n,r,t))},s=0;s<o.length;s++)a(s);or.shouldConvert=!0}function tt(t){var n=t.$options.data;n=t._data="function"==typeof n?n.call(t):n||{},h(n)||(n={},"production"!==e.env.NODE_ENV&&Yn("data functions should return an object:\nhttps://vuejs.org/v2/guide/components.html#data-Must-Be-a-Function",t));for(var r=Object.keys(n),o=t.$options.props,i=r.length;i--;)o&&s(o,r[i])?"production"!==e.env.NODE_ENV&&Yn('The data property "'+r[i]+'" is already declared as a prop. Use prop default value instead.',t):st(t,r[i]);A(n,!0)}function et(t,n){for(var r in n){"production"!==e.env.NODE_ENV&&r in t&&Yn('existing instance property "'+r+'" will be overwritten by a computed property with the same name.',t);var o=n[r];"function"==typeof o?(Cr.get=nt(o,t),Cr.set=m):(Cr.get=o.get?o.cache!==!1?nt(o.get,t):l(o.get,t):m,Cr.set=o.set?l(o.set,t):m),Object.defineProperty(t,r,Cr)}}function nt(t,e){var n=new Or(e,t,m,{lazy:!0});return function(){return n.dirty&&n.evaluate(),Qn.target&&n.depend(),n.value}}function rt(t,n){for(var r in n)t[r]=null==n[r]?m:l(n[r],t),"production"!==e.env.NODE_ENV&&null==n[r]&&Yn('method "'+r+'" has an undefined value in the component definition. Did you reference the function correctly?',t)}function ot(t,e){for(var n in e){var r=e[n];if(Array.isArray(r))for(var o=0;o<r.length;o++)it(t,n,r[o]);else it(t,n,r)}}function it(t,e,n){var r;h(n)&&(r=n,n=n.handler),"string"==typeof n&&(n=t[n]),t.$watch(e,n,r)}function at(t){var n={};n.get=function(){return this._data},"production"!==e.env.NODE_ENV&&(n.set=function(t){Yn("Avoid replacing instance root $data. Use nested data properties instead.",this)}),Object.defineProperty(t.prototype,"$data",n),t.prototype.$set=D,t.prototype.$delete=S,t.prototype.$watch=function(t,e,n){var r=this;n=n||{},n.user=!0;var o=new Or(r,t,e,n);return n.immediate&&e.call(r,o.value),function(){o.teardown()}}}function st(t,e){b(e)||Object.defineProperty(t,e,{configurable:!0,enumerable:!0,get:function(){return t._data[e]},set:function(n){t._data[e]=n}})}function ut(t){return new Ar(void 0,void 0,void 0,String(t))}function ct(t){var e=new Ar(t.tag,t.data,t.children,t.text,t.elm,t.context,t.componentOptions);return e.ns=t.ns,e.isStatic=t.isStatic,e.key=t.key,e.isCloned=!0,e}function lt(t){for(var e=new Array(t.length),n=0;n<t.length;n++)e[n]=ct(t[n]);return e}function pt(t,e,n,r){r+=e;var o=t.__injected||(t.__injected={});if(!o[r]){o[r]=!0;var i=t[e];i?t[e]=function(){i.apply(this,arguments),n.apply(this,arguments)}:t[e]=n}}function ft(t,n,r,o,i){var a,s,u,c,l,p,f;for(a in t)if(s=t[a],u=n[a],s)if(u){if(s!==u)if(Array.isArray(u)){u.length=s.length;for(var d=0;d<u.length;d++)u[d]=s[d];t[a]=u}else u.fn=s,t[a]=u}else f="~"===a.charAt(0),l=f?a.slice(1):a,p="!"===l.charAt(0),l=p?l.slice(1):l,Array.isArray(s)?r(l,s.invoker=dt(s),f,p):(s.invoker||(c=s,s=t[a]={},s.fn=c,s.invoker=ht(s)),r(l,s.invoker,f,p));else"production"!==e.env.NODE_ENV&&Yn('Invalid handler for event "'+a+'": got '+String(s),i);for(a in n)t[a]||(f="~"===a.charAt(0),l=f?a.slice(1):a,p="!"===l.charAt(0),l=p?l.slice(1):l,o(l,n[a].invoker,p))}function dt(t){return function(e){for(var n=arguments,r=1===arguments.length,o=0;o<t.length;o++)r?t[o](e):t[o].apply(null,n)}}function ht(t){return function(e){var n=1===arguments.length;n?t.fn(e):t.fn.apply(null,arguments)}}function vt(t){for(var e=0;e<t.length;e++)if(Array.isArray(t[e]))return Array.prototype.concat.apply([],t);return t}function mt(t){return u(t)?[ut(t)]:Array.isArray(t)?yt(t):void 0}function yt(t,e){var n,r,o,i=[];for(n=0;n<t.length;n++)r=t[n],null!=r&&"boolean"!=typeof r&&(o=i[i.length-1],Array.isArray(r)?i.push.apply(i,yt(r,(e||"")+"_"+n)):u(r)?o&&o.text?o.text+=String(r):""!==r&&i.push(ut(r)):r.text&&o&&o.text?i[i.length-1]=ut(o.text+r.text):(r.tag&&null==r.key&&null!=e&&(r.key="__vlist"+e+"_"+n+"__"),i.push(r)));return i}function gt(t){return t&&t.filter(function(t){return t&&t.componentOptions})[0]}function _t(t){t._events=Object.create(null),t._hasHookEvent=!1;var e=t.$options._parentListeners;e&&Et(t,e)}function bt(t,e,n){n?xr.$once(t,e):xr.$on(t,e)}function wt(t,e){xr.$off(t,e)}function Et(t,e,n){xr=t,ft(e,n||{},bt,wt,t)}function Ot(t){var e=/^hook:/;t.prototype.$on=function(t,n){var r=this;return(r._events[t]||(r._events[t]=[])).push(n),e.test(t)&&(r._hasHookEvent=!0),r},t.prototype.$once=function(t,e){function n(){r.$off(t,n),e.apply(r,arguments)}var r=this;return n.fn=e,r.$on(t,n),r},t.prototype.$off=function(t,e){var n=this;if(!arguments.length)return n._events=Object.create(null),n;var r=n._events[t];if(!r)return n;if(1===arguments.length)return n._events[t]=null,n;for(var o,i=r.length;i--;)if(o=r[i],o===e||o.fn===e){r.splice(i,1);break}return n},t.prototype.$emit=function(t){var e=this,n=e._events[t];if(n){n=n.length>1?p(n):n;for(var r=p(arguments,1),o=0,i=n.length;o<i;o++)n[o].apply(e,r)}return e}}function xt(t){var e=t.$options,n=e.parent;if(n&&!e.abstract){for(;n.$options.abstract&&n.$parent;)n=n.$parent;n.$children.push(t)}t.$parent=n,t.$root=n?n.$root:t,t.$children=[],t.$refs={},t._watcher=null,t._inactive=!1,t._isMounted=!1,t._isDestroyed=!1,t._isBeingDestroyed=!1}function kt(t){t.prototype._mount=function(t,n){var r=this;return r.$el=t,r.$options.render||(r.$options.render=$r,"production"!==e.env.NODE_ENV&&(r.$options.template&&"#"!==r.$options.template.charAt(0)?Yn("You are using the runtime-only build of Vue where the template option is not available. Either pre-compile the templates into render functions, or use the compiler-included build.",r):Yn("Failed to mount component: template or render function not defined.",r))),Nt(r,"beforeMount"),r._watcher=new Or(r,function(){r._update(r._render(),n)},m),n=!1,null==r.$vnode&&(r._isMounted=!0,Nt(r,"mounted")),r},t.prototype._update=function(t,e){var n=this;n._isMounted&&Nt(n,"beforeUpdate");var r=n.$el,o=n._vnode,i=Dr;Dr=n,n._vnode=t,o?n.$el=n.__patch__(o,t):n.$el=n.__patch__(n.$el,t,e,!1,n.$options._parentElm,n.$options._refElm),Dr=i,r&&(r.__vue__=null),n.$el&&(n.$el.__vue__=n),n.$vnode&&n.$parent&&n.$vnode===n.$parent._vnode&&(n.$parent.$el=n.$el),n._isMounted&&Nt(n,"updated")},t.prototype._updateFromParent=function(t,n,r,o){var i=this,a=!(!i.$options._renderChildren&&!o);if(i.$options._parentVnode=r,i.$vnode=r,i._vnode&&(i._vnode.parent=r),i.$options._renderChildren=o,t&&i.$options.props){or.shouldConvert=!1,"production"!==e.env.NODE_ENV&&(or.isSettingProps=!0);for(var s=i.$options._propKeys||[],u=0;u<s.length;u++){var c=s[u];i[c]=q(c,i.$options.props,t,i)}or.shouldConvert=!0,"production"!==e.env.NODE_ENV&&(or.isSettingProps=!1),i.$options.propsData=t}if(n){var l=i.$options._parentListeners;i.$options._parentListeners=n,Et(i,n,l)}a&&(i.$slots=Ht(o,r.context),i.$forceUpdate())},t.prototype.$forceUpdate=function(){var t=this;t._watcher&&t._watcher.update()},t.prototype.$destroy=function(){var t=this;if(!t._isBeingDestroyed){Nt(t,"beforeDestroy"),t._isBeingDestroyed=!0;var e=t.$parent;!e||e._isBeingDestroyed||t.$options.abstract||a(e.$children,t),t._watcher&&t._watcher.teardown();for(var n=t._watchers.length;n--;)t._watchers[n].teardown();t._data.__ob__&&t._data.__ob__.vmCount--,t._isDestroyed=!0,Nt(t,"destroyed"),t.$off(),t.$el&&(t.$el.__vue__=null),t.__patch__(t._vnode,null)}}}function Nt(t,e){var n=t.$options[e];if(n)for(var r=0,o=n.length;r<o;r++)n[r].call(t);t._hasHookEvent&&t.$emit("hook:"+e)}function Ct(t,n,r,o,i){if(t){var a=r.$options._base;if(d(t)&&(t=a.extend(t)),"function"!=typeof t)return void("production"!==e.env.NODE_ENV&&Yn("Invalid Component definition: "+String(t),r));if(!t.cid)if(t.resolved)t=t.resolved;else if(t=Vt(t,a,function(){r.$forceUpdate()}),!t)return;Kt(t),n=n||{};var s=Pt(n,t);if(t.options.functional)return At(t,s,n,r,o);var u=n.on;n.on=n.nativeOn,t.options.abstract&&(n={}),Lt(n);var c=t.options.name||i,l=new Ar("vue-component-"+t.cid+(c?"-"+c:""),n,void 0,void 0,void 0,r,{Ctor:t,propsData:s,listeners:u,tag:i,children:o});return l}}function At(t,e,n,r,o){var i={},a=t.options.props;if(a)for(var s in a)i[s]=q(s,a,e);var u=Object.create(r),c=function(t,e,n,r){return It(u,t,e,n,r,!0)},l=t.options.render.call(null,c,{props:i,data:n,parent:r,children:o,slots:function(){return Ht(o,r)}});return l instanceof Ar&&(l.functionalContext=r,n.slot&&((l.data||(l.data={})).slot=n.slot)),l}function $t(t,e,n,r){var o=t.componentOptions,i={_isComponent:!0,parent:e,propsData:o.propsData,_componentTag:o.tag,_parentVnode:t,_parentListeners:o.listeners,_renderChildren:o.children,_parentElm:n||null,_refElm:r||null},a=t.data.inlineTemplate;return a&&(i.render=a.render,i.staticRenderFns=a.staticRenderFns),new o.Ctor(i)}function Dt(t,e,n,r){if(!t.child||t.child._isDestroyed){var o=t.child=$t(t,Dr,n,r);o.$mount(e?t.elm:void 0,e)}else if(t.data.keepAlive){var i=t;St(i,i)}}function St(t,e){var n=e.componentOptions,r=e.child=t.child;r._updateFromParent(n.propsData,n.listeners,e,n.children)}function Tt(t){t.child._isMounted||(t.child._isMounted=!0,Nt(t.child,"mounted")),t.data.keepAlive&&(t.child._inactive=!1,Nt(t.child,"activated"))}function jt(t){t.child._isDestroyed||(t.data.keepAlive?(t.child._inactive=!0,Nt(t.child,"deactivated")):t.child.$destroy())}function Vt(t,n,r){if(!t.requested){t.requested=!0;var o=t.pendingCallbacks=[r],i=!0,a=function(e){if(d(e)&&(e=n.extend(e)),t.resolved=e,!i)for(var r=0,a=o.length;r<a;r++)o[r](e)},s=function(n){"production"!==e.env.NODE_ENV&&Yn("Failed to resolve async component: "+String(t)+(n?"\nReason: "+n:""))},u=t(a,s);return u&&"function"==typeof u.then&&!t.resolved&&u.then(a,s),i=!1,t.resolved}t.pendingCallbacks.push(r)}function Pt(t,e){var n=e.options.props;if(n){var r={},o=t.attrs,i=t.props,a=t.domProps;if(o||i||a)for(var s in n){var u=Dn(s);Rt(r,i,s,u,!0)||Rt(r,o,s,u)||Rt(r,a,s,u)}return r}}function Rt(t,e,n,r,o){if(e){if(s(e,n))return t[n]=e[n],o||delete e[n],!0;if(s(e,r))return t[n]=e[r],o||delete e[r],!0}return!1}function Lt(t){t.hook||(t.hook={});for(var e=0;e<Tr.length;e++){var n=Tr[e],r=t.hook[n],o=Sr[n];t.hook[n]=r?Mt(o,r):o}}function Mt(t,e){return function(n,r,o,i){t(n,r,o,i),e(n,r,o,i)}}function It(t,e,n,r,o,i){return(Array.isArray(n)||u(n))&&(o=r,r=n,n=void 0),i&&(o=Vr),Ut(t,e,n,r,o)}function Ut(t,n,r,o,i){if(r&&r.__ob__)return"production"!==e.env.NODE_ENV&&Yn("Avoid using observed data object as vnode data: "+JSON.stringify(r)+"\nAlways create fresh vnode data objects in each render!",t),$r();if(!n)return $r();Array.isArray(o)&&"function"==typeof o[0]&&(r=r||{},r.scopedSlots={default:o[0]},o.length=0),i===Vr?o=mt(o):i===jr&&(o=vt(o));var a,s;if("string"==typeof n){var u;s=Pn.getTagNamespace(n),a=Pn.isReservedTag(n)?new Ar(Pn.parsePlatformTagName(n),r,o,void 0,void 0,t):(u=U(t.$options,"components",n))?Ct(u,r,t,o,n):new Ar(n,r,o,void 0,void 0,t)}else a=Ct(n,r,t,o);return a?(s&&qt(a,s),a):$r()}function qt(t,e){if(t.ns=e,"foreignObject"!==t.tag&&t.children)for(var n=0,r=t.children.length;n<r;n++){var o=t.children[n];o.tag&&!o.ns&&qt(o,e)}}function Bt(t){t.$vnode=null,t._vnode=null,t._staticTrees=null;var e=t.$options._parentVnode,n=e&&e.context;t.$slots=Ht(t.$options._renderChildren,n),t.$scopedSlots={},t._c=function(e,n,r,o){return It(t,e,n,r,o,!1)},t.$createElement=function(e,n,r,o){return It(t,e,n,r,o,!0)},t.$options.el&&t.$mount(t.$options.el)}function Ft(t){function n(t,e,n){if(Array.isArray(t))for(var r=0;r<t.length;r++)t[r]&&"string"!=typeof t[r]&&i(t[r],e+"_"+r,n);else i(t,e,n)}function i(t,e,n){t.isStatic=!0,t.key=e,t.isOnce=n}t.prototype.$nextTick=function(t){return Kn(t,this)},t.prototype._render=function(){var t=this,n=t.$options,r=n.render,o=n.staticRenderFns,i=n._parentVnode;if(t._isMounted)for(var a in t.$slots)t.$slots[a]=lt(t.$slots[a]);i&&i.data.scopedSlots&&(t.$scopedSlots=i.data.scopedSlots),o&&!t._staticTrees&&(t._staticTrees=[]),t.$vnode=i;var s;try{s=r.call(t._renderProxy,t.$createElement)}catch(n){if(!Pn.errorHandler)throw"production"!==e.env.NODE_ENV&&Yn("Error when rendering "+Wn(t)+":"),n;Pn.errorHandler.call(null,n,t),s=t._vnode}return s instanceof Ar||("production"!==e.env.NODE_ENV&&Array.isArray(s)&&Yn("Multiple root nodes returned from render function. Render function should return a single root node.",t),s=$r()),s.parent=i,s},t.prototype._s=r,t.prototype._v=ut,t.prototype._n=o,t.prototype._e=$r,t.prototype._q=g,t.prototype._i=_,t.prototype._m=function(t,e){var r=this._staticTrees[t];return r&&!e?Array.isArray(r)?lt(r):ct(r):(r=this._staticTrees[t]=this.$options.staticRenderFns[t].call(this._renderProxy),n(r,"__static__"+t,!1),r)},t.prototype._o=function(t,e,r){return n(t,"__once__"+e+(r?"_"+r:""),!0),t},t.prototype._f=function(t){return U(this.$options,"filters",t,!0)||Vn},t.prototype._l=function(t,e){var n,r,o,i,a;if(Array.isArray(t)||"string"==typeof t)for(n=new Array(t.length),r=0,o=t.length;r<o;r++)n[r]=e(t[r],r);else if("number"==typeof t)for(n=new Array(t),r=0;r<t;r++)n[r]=e(r+1,r);else if(d(t))for(i=Object.keys(t),n=new Array(i.length),r=0,o=i.length;r<o;r++)a=i[r],n[r]=e(t[a],a,r);return n},t.prototype._t=function(t,n,r,o){var i=this.$scopedSlots[t];if(i)return r=r||{},o&&f(r,o),i(r)||n;var a=this.$slots[t];return a&&"production"!==e.env.NODE_ENV&&(a._rendered&&Yn('Duplicate presence of slot "'+t+'" found in the same render tree - this will likely cause render errors.',this),a._rendered=!0),a||n},t.prototype._b=function(t,n,r,o){if(r)if(d(r)){Array.isArray(r)&&(r=v(r));for(var i in r)if("class"===i||"style"===i)t[i]=r[i];else{var a=o||Pn.mustUseProp(n,i)?t.domProps||(t.domProps={}):t.attrs||(t.attrs={});a[i]=r[i]}}else"production"!==e.env.NODE_ENV&&Yn("v-bind without argument expects an Object or Array value",this);return t},t.prototype._k=function(t,e,n){var r=Pn.keyCodes[e]||n;return Array.isArray(r)?r.indexOf(t)===-1:r!==t}}function Ht(t,e){var n={};if(!t)return n;for(var r,o,i=[],a=0,s=t.length;a<s;a++)if(o=t[a],(o.context===e||o.functionalContext===e)&&o.data&&(r=o.data.slot)){var u=n[r]||(n[r]=[]);"template"===o.tag?u.push.apply(u,o.children):u.push(o)}else i.push(o);return i.length&&(1!==i.length||" "!==i[0].text&&!i[0].isComment)&&(n.default=i),n}function zt(t){t.prototype._init=function(t){var n=this;n._uid=Pr++,n._isVue=!0,t&&t._isComponent?Jt(n,t):n.$options=I(Kt(n.constructor),t||{},n),"production"!==e.env.NODE_ENV?sr(n):n._renderProxy=n,n._self=n,xt(n),_t(n),Nt(n,"beforeCreate"),X(n),Nt(n,"created"),Bt(n)}}function Jt(t,e){var n=t.$options=Object.create(t.constructor.options);n.parent=e.parent,n.propsData=e.propsData,n._parentVnode=e._parentVnode,n._parentListeners=e._parentListeners,n._renderChildren=e._renderChildren,n._componentTag=e._componentTag,n._parentElm=e._parentElm,n._refElm=e._refElm,e.render&&(n.render=e.render,n.staticRenderFns=e.staticRenderFns)}function Kt(t){var e=t.options;if(t.super){var n=t.super.options,r=t.superOptions,o=t.extendOptions;n!==r&&(t.superOptions=n,o.render=e.render,o.staticRenderFns=e.staticRenderFns,o._scopeId=e._scopeId,e=t.options=I(n,o),e.name&&(e.components[e.name]=t))}return e}function Wt(t){"production"===e.env.NODE_ENV||this instanceof Wt||Yn("Vue is a constructor and should be called with the `new` keyword"),this._init(t)}function Yt(t){t.use=function(t){if(!t.installed){var e=p(arguments,1);return e.unshift(this),"function"==typeof t.install?t.install.apply(t,e):t.apply(null,e),t.installed=!0,this}}}function Zt(t){t.mixin=function(t){this.options=I(this.options,t)}}function Gt(t){t.cid=0;var n=1;t.extend=function(t){t=t||{};var r=this,o=r.cid,i=t._Ctor||(t._Ctor={});if(i[o])return i[o];var a=t.name||r.options.name;"production"!==e.env.NODE_ENV&&(/^[a-zA-Z][\w-]*$/.test(a)||Yn('Invalid component name: "'+a+'". Component names can only contain alphanumeric characters and the hyphen, and must start with a letter.'));var s=function(t){this._init(t)};return s.prototype=Object.create(r.prototype),s.prototype.constructor=s,s.cid=n++,s.options=I(r.options,t),s.super=r,s.extend=r.extend,s.mixin=r.mixin,s.use=r.use,Pn._assetTypes.forEach(function(t){s[t]=r[t]}),a&&(s.options.components[a]=s),s.superOptions=r.options,s.extendOptions=t,i[o]=s,s}}function Xt(t){Pn._assetTypes.forEach(function(n){t[n]=function(t,r){return r?("production"!==e.env.NODE_ENV&&"component"===n&&Pn.isReservedTag(t)&&Yn("Do not use built-in or reserved HTML elements as component id: "+t),"component"===n&&h(r)&&(r.name=r.name||t,r=this.options._base.extend(r)),"directive"===n&&"function"==typeof r&&(r={bind:r,update:r}),this.options[n+"s"][t]=r,r):this.options[n+"s"][t]}})}function Qt(t,e){return"string"==typeof t?t.split(",").indexOf(e)>-1:t.test(e)}function te(t){var n={};n.get=function(){return Pn},"production"!==e.env.NODE_ENV&&(n.set=function(){Yn("Do not replace the Vue.config object, set individual fields instead.")}),Object.defineProperty(t,"config",n),t.util=cr,t.set=D,t.delete=S,t.nextTick=Kn,t.options=Object.create(null),Pn._assetTypes.forEach(function(e){t.options[e+"s"]=Object.create(null)}),t.options._base=t,f(t.options.components,Mr),Yt(t),Zt(t),Gt(t),Xt(t)}function ee(t){for(var e=t.data,n=t,r=t;r.child;)r=r.child._vnode,r.data&&(e=ne(r.data,e));for(;n=n.parent;)n.data&&(e=ne(e,n.data));return re(e)}function ne(t,e){return{staticClass:oe(t.staticClass,e.staticClass),class:t.class?[t.class,e.class]:e.class}}function re(t){var e=t.class,n=t.staticClass;return n||e?oe(n,ie(e)):""}function oe(t,e){return t?e?t+" "+e:t:e||""}function ie(t){var e="";if(!t)return e;if("string"==typeof t)return t;if(Array.isArray(t)){for(var n,r=0,o=t.length;r<o;r++)t[r]&&(n=ie(t[r]))&&(e+=n+" ");return e.slice(0,-1)}if(d(t)){for(var i in t)t[i]&&(e+=i+" ");return e.slice(0,-1)}return e}function ae(t){return Gr(t)?"svg":"math"===t?"math":void 0}function se(t){if(!Mn)return!0;if(Xr(t))return!1;if(t=t.toLowerCase(),null!=Qr[t])return Qr[t];var e=document.createElement(t);return t.indexOf("-")>-1?Qr[t]=e.constructor===window.HTMLUnknownElement||e.constructor===window.HTMLElement:Qr[t]=/HTMLUnknownElement/.test(e.toString())}function ue(t){if("string"==typeof t){var n=t;if(t=document.querySelector(t),!t)return"production"!==e.env.NODE_ENV&&Yn("Cannot find element: "+n),document.createElement("div")}return t}function ce(t,e){var n=document.createElement(t);return"select"!==t?n:(e.data&&e.data.attrs&&"multiple"in e.data.attrs&&n.setAttribute("multiple","multiple"),n)}function le(t,e){return document.createElementNS(Yr[t],e)}function pe(t){return document.createTextNode(t)}function fe(t){return document.createComment(t)}function de(t,e,n){t.insertBefore(e,n)}function he(t,e){t.removeChild(e)}function ve(t,e){t.appendChild(e)}function me(t){return t.parentNode}function ye(t){return t.nextSibling}function ge(t){return t.tagName}function _e(t,e){t.textContent=e}function be(t,e,n){t.setAttribute(e,n)}function we(t,e){var n=t.data.ref;if(n){var r=t.context,o=t.child||t.elm,i=r.$refs;e?Array.isArray(i[n])?a(i[n],o):i[n]===o&&(i[n]=void 0):t.data.refInFor?Array.isArray(i[n])&&i[n].indexOf(o)<0?i[n].push(o):i[n]=[o]:i[n]=o}}function Ee(t){return null==t}function Oe(t){return null!=t}function xe(t,e){return t.key===e.key&&t.tag===e.tag&&t.isComment===e.isComment&&!t.data==!e.data}function ke(t,e,n){var r,o,i={};for(r=e;r<=n;++r)o=t[r].key,Oe(o)&&(i[o]=r);return i}function Ne(t){function n(t){return new Ar($.tagName(t).toLowerCase(),{},[],void 0,t)}function r(t,e){function n(){0===--n.listeners&&o(t)}return n.listeners=e,n}function o(t){var e=$.parentNode(t);e&&$.removeChild(e,t)}function a(t,n,r,o,i){if(t.isRootInsert=!i,!s(t,n,r,o)){var a=t.data,u=t.children,c=t.tag;Oe(c)?("production"!==e.env.NODE_ENV&&(a&&a.pre&&D++,D||t.ns||Pn.ignoredElements.length&&Pn.ignoredElements.indexOf(c)>-1||!Pn.isUnknownElement(c)||Yn("Unknown custom element: <"+c+'> - did you register the component correctly? For recursive components, make sure to provide the "name" option.',t.context)),t.elm=t.ns?$.createElementNS(t.ns,c):$.createElement(c,t),v(t),p(t,u,n),Oe(a)&&d(t,n),l(r,t.elm,o),"production"!==e.env.NODE_ENV&&a&&a.pre&&D--):t.isComment?(t.elm=$.createComment(t.text),l(r,t.elm,o)):(t.elm=$.createTextNode(t.text),l(r,t.elm,o))}}function s(t,e,n,r){var o=t.data;if(Oe(o)){var i=Oe(t.child)&&o.keepAlive;if(Oe(o=o.hook)&&Oe(o=o.init)&&o(t,!1,n,r),Oe(t.child))return h(t,e),i&&c(t,e,n,r),!0}}function c(t,e,n,r){for(var o,i=t;i.child;)if(i=i.child._vnode,Oe(o=i.data)&&Oe(o=o.transition)){for(o=0;o<C.activate.length;++o)C.activate[o](no,i);e.push(i);break}l(n,t.elm,r)}function l(t,e,n){t&&(n?$.insertBefore(t,e,n):$.appendChild(t,e))}function p(t,e,n){if(Array.isArray(e))for(var r=0;r<e.length;++r)a(e[r],n,t.elm,null,!0);else u(t.text)&&$.appendChild(t.elm,$.createTextNode(t.text))}function f(t){for(;t.child;)t=t.child._vnode;return Oe(t.tag)}function d(t,e){for(var n=0;n<C.create.length;++n)C.create[n](no,t);k=t.data.hook,Oe(k)&&(k.create&&k.create(no,t),k.insert&&e.push(t))}function h(t,e){t.data.pendingInsert&&e.push.apply(e,t.data.pendingInsert),t.elm=t.child.$el,f(t)?(d(t,e),v(t)):(we(t),e.push(t))}function v(t){var e;Oe(e=t.context)&&Oe(e=e.$options._scopeId)&&$.setAttribute(t.elm,e,""),Oe(e=Dr)&&e!==t.context&&Oe(e=e.$options._scopeId)&&$.setAttribute(t.elm,e,"")}function m(t,e,n,r,o,i){for(;r<=o;++r)a(n[r],i,t,e)}function y(t){var e,n,r=t.data;if(Oe(r))for(Oe(e=r.hook)&&Oe(e=e.destroy)&&e(t),e=0;e<C.destroy.length;++e)C.destroy[e](t);if(Oe(e=t.children))for(n=0;n<t.children.length;++n)y(t.children[n])}function g(t,e,n,r){for(;n<=r;++n){var i=e[n];Oe(i)&&(Oe(i.tag)?(_(i),y(i)):o(i.elm))}}function _(t,e){if(e||Oe(t.data)){var n=C.remove.length+1;for(e?e.listeners+=n:e=r(t.elm,n),Oe(k=t.child)&&Oe(k=k._vnode)&&Oe(k.data)&&_(k,e),k=0;k<C.remove.length;++k)C.remove[k](t,e);Oe(k=t.data.hook)&&Oe(k=k.remove)?k(t,e):e()}else o(t.elm)}function b(t,n,r,o,i){for(var s,u,c,l,p=0,f=0,d=n.length-1,h=n[0],v=n[d],y=r.length-1,_=r[0],b=r[y],E=!i;p<=d&&f<=y;)Ee(h)?h=n[++p]:Ee(v)?v=n[--d]:xe(h,_)?(w(h,_,o),h=n[++p],_=r[++f]):xe(v,b)?(w(v,b,o),v=n[--d],b=r[--y]):xe(h,b)?(w(h,b,o),E&&$.insertBefore(t,h.elm,$.nextSibling(v.elm)),h=n[++p],b=r[--y]):xe(v,_)?(w(v,_,o),E&&$.insertBefore(t,v.elm,h.elm),v=n[--d],_=r[++f]):(Ee(s)&&(s=ke(n,p,d)),u=Oe(_.key)?s[_.key]:null,Ee(u)?(a(_,o,t,h.elm),_=r[++f]):(c=n[u],"production"===e.env.NODE_ENV||c||Yn("It seems there are duplicate keys that is causing an update error. Make sure each v-for item has a unique key."),xe(c,_)?(w(c,_,o),n[u]=void 0,E&&$.insertBefore(t,_.elm,h.elm),_=r[++f]):(a(_,o,t,h.elm),_=r[++f])));p>d?(l=Ee(r[y+1])?null:r[y+1].elm,m(t,l,r,f,y,o)):f>y&&g(t,n,p,d)}function w(t,e,n,r){if(t!==e){if(e.isStatic&&t.isStatic&&e.key===t.key&&(e.isCloned||e.isOnce))return e.elm=t.elm,void(e.child=t.child);var o,i=e.data,a=Oe(i);a&&Oe(o=i.hook)&&Oe(o=o.prepatch)&&o(t,e);var s=e.elm=t.elm,u=t.children,c=e.children;if(a&&f(e)){for(o=0;o<C.update.length;++o)C.update[o](t,e);Oe(o=i.hook)&&Oe(o=o.update)&&o(t,e)}Ee(e.text)?Oe(u)&&Oe(c)?u!==c&&b(s,u,c,n,r):Oe(c)?(Oe(t.text)&&$.setTextContent(s,""),m(s,null,c,0,c.length-1,n)):Oe(u)?g(s,u,0,u.length-1):Oe(t.text)&&$.setTextContent(s,""):t.text!==e.text&&$.setTextContent(s,e.text),a&&Oe(o=i.hook)&&Oe(o=o.postpatch)&&o(t,e)}}function E(t,e,n){if(n&&t.parent)t.parent.data.pendingInsert=e;else for(var r=0;r<e.length;++r)e[r].data.hook.insert(e[r])}function O(t,n,r){if("production"!==e.env.NODE_ENV&&!x(t,n))return!1;n.elm=t;var o=n.tag,i=n.data,a=n.children;if(Oe(i)&&(Oe(k=i.hook)&&Oe(k=k.init)&&k(n,!0),Oe(k=n.child)))return h(n,r),!0;if(Oe(o)){if(Oe(a))if(t.hasChildNodes()){for(var s=!0,u=t.firstChild,c=0;c<a.length;c++){if(!u||!O(u,a[c],r)){s=!1;break}u=u.nextSibling}if(!s||u)return"production"===e.env.NODE_ENV||"undefined"==typeof console||S||(S=!0,console.warn("Parent: ",t),console.warn("Mismatching childNodes vs. VNodes: ",t.childNodes,a)),!1}else p(n,a,r);if(Oe(i))for(var l in i)if(!T(l)){d(n,r);break}}else t.data!==n.text&&(t.data=n.text);return!0}function x(t,e){return e.tag?0===e.tag.indexOf("vue-component")||e.tag.toLowerCase()===(t.tagName&&t.tagName.toLowerCase()):t.nodeType===(e.isComment?8:3)}var k,N,C={},A=t.modules,$=t.nodeOps;for(k=0;k<ro.length;++k)for(C[ro[k]]=[],N=0;N<A.length;++N)void 0!==A[N][ro[k]]&&C[ro[k]].push(A[N][ro[k]]);
−		+	var D=0,S=!1,T=i("attrs,style,class,staticClass,staticStyle,key");return function(t,r,o,i,s,u){if(!r)return void(t&&y(t));var c,l,p=!1,d=[];if(t){var h=Oe(t.nodeType);if(!h&&xe(t,r))w(t,r,d,i);else{if(h){if(1===t.nodeType&&t.hasAttribute("server-rendered")&&(t.removeAttribute("server-rendered"),o=!0),o){if(O(t,r,d))return E(r,d,!0),t;"production"!==e.env.NODE_ENV&&Yn("The client-side rendered virtual DOM tree is not matching server-rendered content. This is likely caused by incorrect HTML markup, for example nesting block-level elements inside <p>, or missing <tbody>. Bailing hydration and performing full client-side render.")}t=n(t)}if(c=t.elm,l=$.parentNode(c),a(r,d,l,$.nextSibling(c)),r.parent){for(var v=r.parent;v;)v.elm=r.elm,v=v.parent;if(f(r))for(var m=0;m<C.create.length;++m)C.create[m](no,r.parent)}null!==l?g(l,[t],0,0):Oe(t.tag)&&y(t)}}else p=!0,a(r,d,s,u);return E(r,d,p),r.elm}}function Ce(t,e){(t.data.directives||e.data.directives)&&Ae(t,e)}function Ae(t,e){var n,r,o,i=t===no,a=e===no,s=$e(t.data.directives,t.context),u=$e(e.data.directives,e.context),c=[],l=[];for(n in u)r=s[n],o=u[n],r?(o.oldValue=r.value,Se(o,"update",e,t),o.def&&o.def.componentUpdated&&l.push(o)):(Se(o,"bind",e,t),o.def&&o.def.inserted&&c.push(o));if(c.length){var p=function(){for(var n=0;n<c.length;n++)Se(c[n],"inserted",e,t)};i?pt(e.data.hook||(e.data.hook={}),"insert",p,"dir-insert"):p()}if(l.length&&pt(e.data.hook||(e.data.hook={}),"postpatch",function(){for(var n=0;n<l.length;n++)Se(l[n],"componentUpdated",e,t)},"dir-postpatch"),!i)for(n in s)u[n]||Se(s[n],"unbind",t,t,a)}function $e(t,e){var n=Object.create(null);if(!t)return n;var r,o;for(r=0;r<t.length;r++)o=t[r],o.modifiers||(o.modifiers=io),n[De(o)]=o,o.def=U(e.$options,"directives",o.name,!0);return n}function De(t){return t.rawName||t.name+"."+Object.keys(t.modifiers||{}).join(".")}function Se(t,e,n,r,o){var i=t.def&&t.def[e];i&&i(n.elm,t,n,r,o)}function Te(t,e){if(t.data.attrs||e.data.attrs){var n,r,o,i=e.elm,a=t.data.attrs||{},s=e.data.attrs||{};s.__ob__&&(s=e.data.attrs=f({},s));for(n in s)r=s[n],o=a[n],o!==r&&je(i,n,r);qn&&s.value!==a.value&&je(i,"value",s.value);for(n in a)null==s[n]&&(Jr(n)?i.removeAttributeNS(zr,Kr(n)):Fr(n)||i.removeAttribute(n))}}function je(t,e,n){Hr(e)?Wr(n)?t.removeAttribute(e):t.setAttribute(e,e):Fr(e)?t.setAttribute(e,Wr(n)||"false"===n?"false":"true"):Jr(e)?Wr(n)?t.removeAttributeNS(zr,Kr(e)):t.setAttributeNS(zr,e,n):Wr(n)?t.removeAttribute(e):t.setAttribute(e,n)}function Ve(t,e){var n=e.elm,r=e.data,o=t.data;if(r.staticClass||r.class||o&&(o.staticClass||o.class)){var i=ee(e),a=n._transitionClasses;a&&(i=oe(i,ie(a))),i!==n._prevClass&&(n.setAttribute("class",i),n._prevClass=i)}}function Pe(t,e,n,r){if(n){var o=e;e=function(n){Re(t,e,r),1===arguments.length?o(n):o.apply(null,arguments)}}Ir.addEventListener(t,e,r)}function Re(t,e,n){Ir.removeEventListener(t,e,n)}function Le(t,e){if(t.data.on||e.data.on){var n=e.data.on||{},r=t.data.on||{};Ir=e.elm,ft(n,r,Pe,Re,e.context)}}function Me(t,e){if(t.data.domProps||e.data.domProps){var n,r,o=e.elm,i=t.data.domProps||{},a=e.data.domProps||{};a.__ob__&&(a=e.data.domProps=f({},a));for(n in i)null==a[n]&&(o[n]="");for(n in a)if(r=a[n],("textContent"!==n&&"innerHTML"!==n||(e.children&&(e.children.length=0),r!==i[n]))&&("checked"!==n||Ue(o,r)))if("value"===n){o._value=r;var s=null==r?"":String(r);Ie(o,e,s)&&(o.value=s)}else o[n]=r}}function Ie(t,e,n){return!(t.composing||"option"!==e.tag&&!Ue(t,n)&&!qe(e,n))}function Ue(t,e){return document.activeElement!==t&&t.value!==e}function qe(t,e){var n=t.elm.value,r=t.elm._vModifiers;return r&&r.number||"number"===t.elm.type?o(n)!==o(e):r&&r.trim?n.trim()!==e.trim():n!==e}function Be(t){var e=Fe(t.style);return t.staticStyle?f(t.staticStyle,e):e}function Fe(t){return Array.isArray(t)?v(t):"string"==typeof t?po(t):t}function He(t,e){var n,r={};if(e)for(var o=t;o.child;)o=o.child._vnode,o.data&&(n=Be(o.data))&&f(r,n);(n=Be(t.data))&&f(r,n);for(var i=t;i=i.parent;)i.data&&(n=Be(i.data))&&f(r,n);return r}function ze(t,e){var n=e.data,r=t.data;if(n.staticStyle||n.style||r.staticStyle||r.style){var o,i,a=e.elm,s=t.data.staticStyle,u=t.data.style||{},c=s||u,l=Fe(e.data.style)||{};e.data.style=l.__ob__?f({},l):l;var p=He(e,!0);for(i in c)null==p[i]&&vo(a,i,"");for(i in p)o=p[i],o!==c[i]&&vo(a,i,null==o?"":o)}}function Je(t,e){if(e&&e.trim())if(t.classList)e.indexOf(" ")>-1?e.split(/\s+/).forEach(function(e){return t.classList.add(e)}):t.classList.add(e);else{var n=" "+t.getAttribute("class")+" ";n.indexOf(" "+e+" ")<0&&t.setAttribute("class",(n+e).trim())}}function Ke(t,e){if(e&&e.trim())if(t.classList)e.indexOf(" ")>-1?e.split(/\s+/).forEach(function(e){return t.classList.remove(e)}):t.classList.remove(e);else{for(var n=" "+t.getAttribute("class")+" ",r=" "+e+" ";n.indexOf(r)>=0;)n=n.replace(r," ");t.setAttribute("class",n.trim())}}function We(t){No(function(){No(t)})}function Ye(t,e){(t._transitionClasses||(t._transitionClasses=[])).push(e),Je(t,e)}function Ze(t,e){t._transitionClasses&&a(t._transitionClasses,e),Ke(t,e)}function Ge(t,e,n){var r=Xe(t,e),o=r.type,i=r.timeout,a=r.propCount;if(!o)return n();var s=o===bo?Oo:ko,u=0,c=function(){t.removeEventListener(s,l),n()},l=function(e){e.target===t&&++u>=a&&c()};setTimeout(function(){u<a&&c()},i+1),t.addEventListener(s,l)}function Xe(t,e){var n,r=window.getComputedStyle(t),o=r[Eo+"Delay"].split(", "),i=r[Eo+"Duration"].split(", "),a=Qe(o,i),s=r[xo+"Delay"].split(", "),u=r[xo+"Duration"].split(", "),c=Qe(s,u),l=0,p=0;e===bo?a>0&&(n=bo,l=a,p=i.length):e===wo?c>0&&(n=wo,l=c,p=u.length):(l=Math.max(a,c),n=l>0?a>c?bo:wo:null,p=n?n===bo?i.length:u.length:0);var f=n===bo&&Co.test(r[Eo+"Property"]);return{type:n,timeout:l,propCount:p,hasTransform:f}}function Qe(t,e){for(;t.length<e.length;)t=t.concat(t);return Math.max.apply(null,e.map(function(e,n){return tn(e)+tn(t[n])}))}function tn(t){return 1e3*Number(t.slice(0,-1))}function en(t,e){var n=t.elm;n._leaveCb&&(n._leaveCb.cancelled=!0,n._leaveCb());var r=rn(t.data.transition);if(r&&!n._enterCb&&1===n.nodeType){for(var o=r.css,i=r.type,a=r.enterClass,s=r.enterToClass,u=r.enterActiveClass,c=r.appearClass,l=r.appearToClass,p=r.appearActiveClass,f=r.beforeEnter,d=r.enter,h=r.afterEnter,v=r.enterCancelled,m=r.beforeAppear,y=r.appear,g=r.afterAppear,_=r.appearCancelled,b=Dr,w=Dr.$vnode;w&&w.parent;)w=w.parent,b=w.context;var E=!b._isMounted||!t.isRootInsert;if(!E||y||""===y){var O=E?c:a,x=E?p:u,k=E?l:s,N=E?m||f:f,C=E&&"function"==typeof y?y:d,A=E?g||h:h,$=E?_||v:v,D=o!==!1&&!qn,S=C&&(C._length||C.length)>1,T=n._enterCb=on(function(){D&&(Ze(n,k),Ze(n,x)),T.cancelled?(D&&Ze(n,O),$&&$(n)):A&&A(n),n._enterCb=null});t.data.show||pt(t.data.hook||(t.data.hook={}),"insert",function(){var e=n.parentNode,r=e&&e._pending&&e._pending[t.key];r&&r.context===t.context&&r.tag===t.tag&&r.elm._leaveCb&&r.elm._leaveCb(),C&&C(n,T)},"transition-insert"),N&&N(n),D&&(Ye(n,O),Ye(n,x),We(function(){Ye(n,k),Ze(n,O),T.cancelled||S||Ge(n,i,T)})),t.data.show&&(e&&e(),C&&C(n,T)),D||S||T()}}}function nn(t,e){function n(){y.cancelled||(t.data.show||((r.parentNode._pending||(r.parentNode._pending={}))[t.key]=t),l&&l(r),v&&(Ye(r,s),Ye(r,c),We(function(){Ye(r,u),Ze(r,s),y.cancelled||m||Ge(r,a,y)})),p&&p(r,y),v||m||y())}var r=t.elm;r._enterCb&&(r._enterCb.cancelled=!0,r._enterCb());var o=rn(t.data.transition);if(!o)return e();if(!r._leaveCb&&1===r.nodeType){var i=o.css,a=o.type,s=o.leaveClass,u=o.leaveToClass,c=o.leaveActiveClass,l=o.beforeLeave,p=o.leave,f=o.afterLeave,d=o.leaveCancelled,h=o.delayLeave,v=i!==!1&&!qn,m=p&&(p._length||p.length)>1,y=r._leaveCb=on(function(){r.parentNode&&r.parentNode._pending&&(r.parentNode._pending[t.key]=null),v&&(Ze(r,u),Ze(r,c)),y.cancelled?(v&&Ze(r,s),d&&d(r)):(e(),f&&f(r)),r._leaveCb=null});h?h(n):n()}}function rn(t){if(t){if("object"==typeof t){var e={};return t.css!==!1&&f(e,Ao(t.name||"v")),f(e,t),e}return"string"==typeof t?Ao(t):void 0}}function on(t){var e=!1;return function(){e||(e=!0,t())}}function an(t,e){e.data.show||en(e)}function sn(t,n,r){var o=n.value,i=t.multiple;if(i&&!Array.isArray(o))return void("production"!==e.env.NODE_ENV&&Yn('<select multiple v-model="'+n.expression+'"> expects an Array value for its binding, but got '+Object.prototype.toString.call(o).slice(8,-1),r));for(var a,s,u=0,c=t.options.length;u<c;u++)if(s=t.options[u],i)a=_(o,cn(s))>-1,s.selected!==a&&(s.selected=a);else if(g(cn(s),o))return void(t.selectedIndex!==u&&(t.selectedIndex=u));i||(t.selectedIndex=-1)}function un(t,e){for(var n=0,r=e.length;n<r;n++)if(g(cn(e[n]),t))return!1;return!0}function cn(t){return"_value"in t?t._value:t.value}function ln(t){t.target.composing=!0}function pn(t){t.target.composing=!1,fn(t.target,"input")}function fn(t,e){var n=document.createEvent("HTMLEvents");n.initEvent(e,!0,!0),t.dispatchEvent(n)}function dn(t){return!t.child||t.data&&t.data.transition?t:dn(t.child._vnode)}function hn(t){var e=t&&t.componentOptions;return e&&e.Ctor.options.abstract?hn(gt(e.children)):t}function vn(t){var e={},n=t.$options;for(var r in n.propsData)e[r]=t[r];var o=n._parentListeners;for(var i in o)e[Cn(i)]=o[i].fn;return e}function mn(t,e){return/\d-keep-alive$/.test(e.tag)?t("keep-alive"):null}function yn(t){for(;t=t.parent;)if(t.data.transition)return!0}function gn(t,e){return e.key===t.key&&e.tag===t.tag}function _n(t){t.elm._moveCb&&t.elm._moveCb(),t.elm._enterCb&&t.elm._enterCb()}function bn(t){t.data.newPos=t.elm.getBoundingClientRect()}function wn(t){var e=t.data.pos,n=t.data.newPos,r=e.left-n.left,o=e.top-n.top;if(r||o){t.data.moved=!0;var i=t.elm.style;i.transform=i.WebkitTransform="translate("+r+"px,"+o+"px)",i.transitionDuration="0s"}}var En,On,xn=i("slot,component",!0),kn=Object.prototype.hasOwnProperty,Nn=/-(\w)/g,Cn=c(function(t){return t.replace(Nn,function(t,e){return e?e.toUpperCase():""})}),An=c(function(t){return t.charAt(0).toUpperCase()+t.slice(1)}),$n=/([^-])([A-Z])/g,Dn=c(function(t){return t.replace($n,"$1-$2").replace($n,"$1-$2").toLowerCase()}),Sn=Object.prototype.toString,Tn="[object Object]",jn=function(){return!1},Vn=function(t){return t},Pn={optionMergeStrategies:Object.create(null),silent:!1,devtools:"production"!==e.env.NODE_ENV,errorHandler:null,ignoredElements:[],keyCodes:Object.create(null),isReservedTag:jn,isUnknownElement:jn,getTagNamespace:m,parsePlatformTagName:Vn,mustUseProp:jn,_assetTypes:["component","directive","filter"],_lifecycleHooks:["beforeCreate","created","beforeMount","mounted","beforeUpdate","updated","beforeDestroy","destroyed","activated","deactivated"],_maxUpdateCount:100},Rn=/[^\w.$]/,Ln="__proto__"in{},Mn="undefined"!=typeof window,In=Mn&&window.navigator.userAgent.toLowerCase(),Un=In&&/msie|trident/.test(In),qn=In&&In.indexOf("msie 9.0")>0,Bn=In&&In.indexOf("edge/")>0,Fn=In&&In.indexOf("android")>0,Hn=In&&/iphone|ipad|ipod|ios/.test(In),zn=function(){return void 0===En&&(En=!Mn&&"undefined"!=typeof n&&"server"===n.process.env.VUE_ENV),En},Jn=Mn&&window.__VUE_DEVTOOLS_GLOBAL_HOOK__,Kn=function(){function t(){r=!1;var t=n.slice(0);n.length=0;for(var e=0;e<t.length;e++)t[e]()}var e,n=[],r=!1;if("undefined"!=typeof Promise&&O(Promise)){var o=Promise.resolve(),i=function(t){console.error(t)};e=function(){o.then(t).catch(i),Hn&&setTimeout(m)}}else if("undefined"==typeof MutationObserver||!O(MutationObserver)&&"[object MutationObserverConstructor]"!==MutationObserver.toString())e=function(){setTimeout(t,0)};else{var a=1,s=new MutationObserver(t),u=document.createTextNode(String(a));s.observe(u,{characterData:!0}),e=function(){a=(a+1)%2,u.data=String(a)}}return function(t,o){var i;if(n.push(function(){t&&t.call(o),i&&i(o)}),r||(r=!0,e()),!t&&"undefined"!=typeof Promise)return new Promise(function(t){i=t})}}();On="undefined"!=typeof Set&&O(Set)?Set:function(){function t(){this.set=Object.create(null)}return t.prototype.has=function(t){return this.set[t]===!0},t.prototype.add=function(t){this.set[t]=!0},t.prototype.clear=function(){this.set=Object.create(null)},t}();var Wn,Yn=m;if("production"!==e.env.NODE_ENV){var Zn="undefined"!=typeof console;Yn=function(t,e){Zn&&!Pn.silent&&console.error("[Vue warn]: "+t+" "+(e?Gn(Wn(e)):""))},Wn=function(t){if(t.$root===t)return"root instance";var e=t._isVue?t.$options.name||t.$options._componentTag:t.name;return(e?"component <"+e+">":"anonymous component")+(t._isVue&&t.$options.__file?" at "+t.$options.__file:"")};var Gn=function(t){return"anonymous component"===t&&(t+=' - use the "name" option for better debugging messages.'),"\n(found in "+t+")"}}var Xn=0,Qn=function(){this.id=Xn++,this.subs=[]};Qn.prototype.addSub=function(t){this.subs.push(t)},Qn.prototype.removeSub=function(t){a(this.subs,t)},Qn.prototype.depend=function(){Qn.target&&Qn.target.addDep(this)},Qn.prototype.notify=function(){for(var t=this.subs.slice(),e=0,n=t.length;e<n;e++)t[e].update()},Qn.target=null;var tr=[],er=Array.prototype,nr=Object.create(er);["push","pop","shift","unshift","splice","sort","reverse"].forEach(function(t){var e=er[t];w(nr,t,function(){for(var n=arguments,r=arguments.length,o=new Array(r);r--;)o[r]=n[r];var i,a=e.apply(this,o),s=this.__ob__;switch(t){case"push":i=o;break;case"unshift":i=o;break;case"splice":i=o.slice(2)}return i&&s.observeArray(i),s.dep.notify(),a})});var rr=Object.getOwnPropertyNames(nr),or={shouldConvert:!0,isSettingProps:!1},ir=function(t){if(this.value=t,this.dep=new Qn,this.vmCount=0,w(t,"__ob__",this),Array.isArray(t)){var e=Ln?N:C;e(t,nr,rr),this.observeArray(t)}else this.walk(t)};ir.prototype.walk=function(t){for(var e=Object.keys(t),n=0;n<e.length;n++)$(t,e[n],t[e[n]])},ir.prototype.observeArray=function(t){for(var e=0,n=t.length;e<n;e++)A(t[e])};var ar=Pn.optionMergeStrategies;"production"!==e.env.NODE_ENV&&(ar.el=ar.propsData=function(t,e,n,r){return n||Yn('option "'+r+'" can only be used during instance creation with the `new` keyword.'),ur(t,e)}),ar.data=function(t,n,r){return r?t||n?function(){var e="function"==typeof n?n.call(r):n,o="function"==typeof t?t.call(r):void 0;return e?j(e,o):o}:void 0:n?"function"!=typeof n?("production"!==e.env.NODE_ENV&&Yn('The "data" option should be a function that returns a per-instance value in component definitions.',r),t):t?function(){return j(n.call(this),t.call(this))}:n:t},Pn._lifecycleHooks.forEach(function(t){ar[t]=V}),Pn._assetTypes.forEach(function(t){ar[t+"s"]=P}),ar.watch=function(t,e){if(!e)return t;if(!t)return e;var n={};f(n,t);for(var r in e){var o=n[r],i=e[r];o&&!Array.isArray(o)&&(o=[o]),n[r]=o?o.concat(i):[i]}return n},ar.props=ar.methods=ar.computed=function(t,e){if(!e)return t;if(!t)return e;var n=Object.create(null);return f(n,t),f(n,e),n};var sr,ur=function(t,e){return void 0===e?t:e},cr=Object.freeze({defineReactive:$,_toString:r,toNumber:o,makeMap:i,isBuiltInTag:xn,remove:a,hasOwn:s,isPrimitive:u,cached:c,camelize:Cn,capitalize:An,hyphenate:Dn,bind:l,toArray:p,extend:f,isObject:d,isPlainObject:h,toObject:v,noop:m,no:jn,identity:Vn,genStaticKeys:y,looseEqual:g,looseIndexOf:_,isReserved:b,def:w,parsePath:E,hasProto:Ln,inBrowser:Mn,UA:In,isIE:Un,isIE9:qn,isEdge:Bn,isAndroid:Fn,isIOS:Hn,isServerRendering:zn,devtools:Jn,nextTick:Kn,get _Set(){return On},mergeOptions:I,resolveAsset:U,get warn(){return Yn},get formatComponentName(){return Wn},validateProp:q});if("production"!==e.env.NODE_ENV){var lr=i("Infinity,undefined,NaN,isFinite,isNaN,parseFloat,parseInt,decodeURI,decodeURIComponent,encodeURI,encodeURIComponent,Math,Number,Date,Array,Object,Boolean,String,RegExp,Map,Set,JSON,Intl,require"),pr=function(t,e){Yn('Property or method "'+e+'" is not defined on the instance but referenced during render. Make sure to declare reactive data properties in the data option.',t)},fr="undefined"!=typeof Proxy&&Proxy.toString().match(/native code/);if(fr){var dr=i("stop,prevent,self,ctrl,shift,alt,meta");Pn.keyCodes=new Proxy(Pn.keyCodes,{set:function(t,e,n){return dr(e)?(Yn("Avoid overwriting built-in modifier in config.keyCodes: ."+e),!1):(t[e]=n,!0)}})}var hr={has:function t(e,n){var t=n in e,r=lr(n)||"_"===n.charAt(0);return t||r||pr(e,n),t||!r}},vr={get:function(t,e){return"string"!=typeof e||e in t||pr(t,e),t[e]}};sr=function(t){if(fr){var e=t.$options,n=e.render&&e.render._withStripped?vr:hr;t._renderProxy=new Proxy(t,n)}else t._renderProxy=t}}var mr=[],yr={},gr={},_r=!1,br=!1,wr=0,Er=0,Or=function(t,n,r,o){this.vm=t,t._watchers.push(this),o?(this.deep=!!o.deep,this.user=!!o.user,this.lazy=!!o.lazy,this.sync=!!o.sync):this.deep=this.user=this.lazy=this.sync=!1,this.cb=r,this.id=++Er,this.active=!0,this.dirty=this.lazy,this.deps=[],this.newDeps=[],this.depIds=new On,this.newDepIds=new On,this.expression="production"!==e.env.NODE_ENV?n.toString():"","function"==typeof n?this.getter=n:(this.getter=E(n),this.getter||(this.getter=function(){},"production"!==e.env.NODE_ENV&&Yn('Failed watching path: "'+n+'" Watcher only accepts simple dot-delimited paths. For full control, use a function instead.',t))),this.value=this.lazy?void 0:this.get()};Or.prototype.get=function(){x(this);var t=this.getter.call(this.vm,this.vm);return this.deep&&Z(t),k(),this.cleanupDeps(),t},Or.prototype.addDep=function(t){var e=t.id;this.newDepIds.has(e)||(this.newDepIds.add(e),this.newDeps.push(t),this.depIds.has(e)||t.addSub(this))},Or.prototype.cleanupDeps=function(){for(var t=this,e=this.deps.length;e--;){var n=t.deps[e];t.newDepIds.has(n.id)||n.removeSub(t)}var r=this.depIds;this.depIds=this.newDepIds,this.newDepIds=r,this.newDepIds.clear(),r=this.deps,this.deps=this.newDeps,this.newDeps=r,this.newDeps.length=0},Or.prototype.update=function(){this.lazy?this.dirty=!0:this.sync?this.run():Y(this)},Or.prototype.run=function(){if(this.active){var t=this.get();if(t!==this.value||d(t)||this.deep){var n=this.value;if(this.value=t,this.user)try{this.cb.call(this.vm,t,n)}catch(t){if(!Pn.errorHandler)throw"production"!==e.env.NODE_ENV&&Yn('Error in watcher "'+this.expression+'"',this.vm),t;Pn.errorHandler.call(null,t,this.vm)}else this.cb.call(this.vm,t,n)}}},Or.prototype.evaluate=function(){this.value=this.get(),this.dirty=!1},Or.prototype.depend=function(){for(var t=this,e=this.deps.length;e--;)t.deps[e].depend()},Or.prototype.teardown=function(){var t=this;if(this.active){this.vm._isBeingDestroyed||a(this.vm._watchers,this);for(var e=this.deps.length;e--;)t.deps[e].removeSub(t);this.active=!1}};var xr,kr=new On,Nr={key:1,ref:1,slot:1},Cr={enumerable:!0,configurable:!0,get:m,set:m},Ar=function(t,e,n,r,o,i,a){this.tag=t,this.data=e,this.children=n,this.text=r,this.elm=o,this.ns=void 0,this.context=i,this.functionalContext=void 0,this.key=e&&e.key,this.componentOptions=a,this.child=void 0,this.parent=void 0,this.raw=!1,this.isStatic=!1,this.isRootInsert=!0,this.isComment=!1,this.isCloned=!1,this.isOnce=!1},$r=function(){var t=new Ar;return t.text="",t.isComment=!0,t},Dr=null,Sr={init:Dt,prepatch:St,insert:Tt,destroy:jt},Tr=Object.keys(Sr),jr=1,Vr=2,Pr=0;zt(Wt),at(Wt),Ot(Wt),kt(Wt),Ft(Wt);var Rr=[String,RegExp],Lr={name:"keep-alive",abstract:!0,props:{include:Rr,exclude:Rr},created:function(){this.cache=Object.create(null)},render:function(){var t=gt(this.$slots.default);if(t&&t.componentOptions){var e=t.componentOptions,n=e.Ctor.options.name||e.tag;if(n&&(this.include&&!Qt(this.include,n)||this.exclude&&Qt(this.exclude,n)))return t;var r=null==t.key?e.Ctor.cid+(e.tag?"::"+e.tag:""):t.key;this.cache[r]?t.child=this.cache[r].child:this.cache[r]=t,t.data.keepAlive=!0}return t},destroyed:function(){var t=this;for(var e in this.cache){var n=t.cache[e];Nt(n.child,"deactivated"),n.child.$destroy()}}},Mr={KeepAlive:Lr};te(Wt),Object.defineProperty(Wt.prototype,"$isServer",{get:zn}),Wt.version="2.1.8";var Ir,Ur,qr=i("input,textarea,option,select"),Br=function(t,e){return"value"===e&&qr(t)||"selected"===e&&"option"===t||"checked"===e&&"input"===t||"muted"===e&&"video"===t},Fr=i("contenteditable,draggable,spellcheck"),Hr=i("allowfullscreen,async,autofocus,autoplay,checked,compact,controls,declare,default,defaultchecked,defaultmuted,defaultselected,defer,disabled,enabled,formnovalidate,hidden,indeterminate,inert,ismap,itemscope,loop,multiple,muted,nohref,noresize,noshade,novalidate,nowrap,open,pauseonexit,readonly,required,reversed,scoped,seamless,selected,sortable,translate,truespeed,typemustmatch,visible"),zr="http://www.w3.org/1999/xlink",Jr=function(t){return":"===t.charAt(5)&&"xlink"===t.slice(0,5)},Kr=function(t){return Jr(t)?t.slice(6,t.length):""},Wr=function(t){return null==t||t===!1},Yr={svg:"http://www.w3.org/2000/svg",math:"http://www.w3.org/1998/Math/MathML"},Zr=i("html,body,base,head,link,meta,style,title,address,article,aside,footer,header,h1,h2,h3,h4,h5,h6,hgroup,nav,section,div,dd,dl,dt,figcaption,figure,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,rtc,ruby,s,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,output,progress,select,textarea,details,dialog,menu,menuitem,summary,content,element,shadow,template"),Gr=i("svg,animate,circle,clippath,cursor,defs,desc,ellipse,filter,font-face,g,glyph,image,line,marker,mask,missing-glyph,path,pattern,polygon,polyline,rect,switch,symbol,text,textpath,tspan,use,view",!0),Xr=function(t){return Zr(t)||Gr(t)},Qr=Object.create(null),to=Object.freeze({createElement:ce,createElementNS:le,createTextNode:pe,createComment:fe,insertBefore:de,removeChild:he,appendChild:ve,parentNode:me,nextSibling:ye,tagName:ge,setTextContent:_e,setAttribute:be}),eo={create:function(t,e){we(e)},update:function(t,e){t.data.ref!==e.data.ref&&(we(t,!0),we(e))},destroy:function(t){we(t,!0)}},no=new Ar("",{},[]),ro=["create","activate","update","remove","destroy"],oo={create:Ce,update:Ce,destroy:function(t){Ce(t,no)}},io=Object.create(null),ao=[eo,oo],so={create:Te,update:Te},uo={create:Ve,update:Ve},co={create:Le,update:Le},lo={create:Me,update:Me},po=c(function(t){var e={},n=/;(?![^(]*\))/g,r=/:(.+)/;return t.split(n).forEach(function(t){if(t){var n=t.split(r);n.length>1&&(e[n[0].trim()]=n[1].trim())}}),e}),fo=/^--/,ho=/\s*!important$/,vo=function(t,e,n){fo.test(e)?t.style.setProperty(e,n):ho.test(n)?t.style.setProperty(e,n.replace(ho,""),"important"):t.style[yo(e)]=n},mo=["Webkit","Moz","ms"],yo=c(function(t){if(Ur=Ur||document.createElement("div"),t=Cn(t),"filter"!==t&&t in Ur.style)return t;for(var e=t.charAt(0).toUpperCase()+t.slice(1),n=0;n<mo.length;n++){var r=mo[n]+e;if(r in Ur.style)return r}}),go={create:ze,update:ze},_o=Mn&&!qn,bo="transition",wo="animation",Eo="transition",Oo="transitionend",xo="animation",ko="animationend";_o&&(void 0===window.ontransitionend&&void 0!==window.onwebkittransitionend&&(Eo="WebkitTransition",Oo="webkitTransitionEnd"),void 0===window.onanimationend&&void 0!==window.onwebkitanimationend&&(xo="WebkitAnimation",ko="webkitAnimationEnd"));var No=Mn&&window.requestAnimationFrame||setTimeout,Co=/\b(transform|all)(,|$)/,Ao=c(function(t){return{enterClass:t+"-enter",leaveClass:t+"-leave",appearClass:t+"-enter",enterToClass:t+"-enter-to",leaveToClass:t+"-leave-to",appearToClass:t+"-enter-to",enterActiveClass:t+"-enter-active",leaveActiveClass:t+"-leave-active",appearActiveClass:t+"-enter-active"}}),$o=Mn?{create:an,activate:an,remove:function(t,e){t.data.show?e():nn(t,e)}}:{},Do=[so,uo,co,lo,go,$o],So=Do.concat(ao),To=Ne({nodeOps:to,modules:So}),jo=/^input|select|textarea|vue-component-[0-9]+(-[0-9a-zA-Z_-]*)?$/;qn&&document.addEventListener("selectionchange",function(){var t=document.activeElement;t&&t.vmodel&&fn(t,"input")});var Vo={inserted:function(t,n,r){if("production"!==e.env.NODE_ENV&&(jo.test(r.tag)||Yn("v-model is not supported on element type: <"+r.tag+">. If you are working with contenteditable, it's recommended to wrap a library dedicated for that purpose inside a custom component.",r.context)),"select"===r.tag){var o=function(){sn(t,n,r.context)};o(),(Un||Bn)&&setTimeout(o,0)}else"textarea"!==r.tag&&"text"!==t.type||(t._vModifiers=n.modifiers,n.modifiers.lazy||(Fn||(t.addEventListener("compositionstart",ln),t.addEventListener("compositionend",pn)),qn&&(t.vmodel=!0)))},componentUpdated:function(t,e,n){if("select"===n.tag){sn(t,e,n.context);var r=t.multiple?e.value.some(function(e){return un(e,t.options)}):e.value!==e.oldValue&&un(e.value,t.options);r&&fn(t,"change")}}},Po={bind:function(t,e,n){var r=e.value;n=dn(n);var o=n.data&&n.data.transition,i=t.__vOriginalDisplay="none"===t.style.display?"":t.style.display;r&&o&&!qn?(n.data.show=!0,en(n,function(){t.style.display=i})):t.style.display=r?i:"none"},update:function(t,e,n){var r=e.value,o=e.oldValue;if(r!==o){n=dn(n);var i=n.data&&n.data.transition;i&&!qn?(n.data.show=!0,r?en(n,function(){t.style.display=t.__vOriginalDisplay}):nn(n,function(){t.style.display="none"})):t.style.display=r?t.__vOriginalDisplay:"none"}},unbind:function(t,e,n,r,o){o||(t.style.display=t.__vOriginalDisplay)}},Ro={model:Vo,show:Po},Lo={name:String,appear:Boolean,css:Boolean,mode:String,type:String,enterClass:String,leaveClass:String,enterToClass:String,leaveToClass:String,enterActiveClass:String,leaveActiveClass:String,appearClass:String,appearActiveClass:String,appearToClass:String},Mo={name:"transition",props:Lo,abstract:!0,render:function(t){var n=this,r=this.$slots.default;if(r&&(r=r.filter(function(t){return t.tag}),r.length)){"production"!==e.env.NODE_ENV&&r.length>1&&Yn("<transition> can only be used on a single element. Use <transition-group> for lists.",this.$parent);var o=this.mode;"production"!==e.env.NODE_ENV&&o&&"in-out"!==o&&"out-in"!==o&&Yn("invalid <transition> mode: "+o,this.$parent);var i=r[0];if(yn(this.$vnode))return i;var a=hn(i);if(!a)return i;if(this._leaving)return mn(t,i);var s=a.key=null==a.key||a.isStatic?"__v"+(a.tag+this._uid)+"__":a.key,u=(a.data||(a.data={})).transition=vn(this),c=this._vnode,l=hn(c);if(a.data.directives&&a.data.directives.some(function(t){return"show"===t.name})&&(a.data.show=!0),l&&l.data&&!gn(a,l)){var p=l&&(l.data.transition=f({},u));if("out-in"===o)return this._leaving=!0,pt(p,"afterLeave",function(){n._leaving=!1,n.$forceUpdate()},s),mn(t,i);if("in-out"===o){var d,h=function(){d()};pt(u,"afterEnter",h,s),pt(u,"enterCancelled",h,s),pt(p,"delayLeave",function(t){d=t},s)}}return i}}},Io=f({tag:String,moveClass:String},Lo);delete Io.mode;var Uo={props:Io,render:function(t){for(var n=this.tag||this.$vnode.data.tag||"span",r=Object.create(null),o=this.prevChildren=this.children,i=this.$slots.default||[],a=this.children=[],s=vn(this),u=0;u<i.length;u++){var c=i[u];if(c.tag)if(null!=c.key&&0!==String(c.key).indexOf("__vlist"))a.push(c),r[c.key]=c,(c.data||(c.data={})).transition=s;else if("production"!==e.env.NODE_ENV){var l=c.componentOptions,p=l?l.Ctor.options.name||l.tag:c.tag;Yn("<transition-group> children must be keyed: <"+p+">")}}if(o){for(var f=[],d=[],h=0;h<o.length;h++){var v=o[h];v.data.transition=s,v.data.pos=v.elm.getBoundingClientRect(),r[v.key]?f.push(v):d.push(v)}this.kept=t(n,null,f),this.removed=d}return t(n,null,a)},beforeUpdate:function(){this.__patch__(this._vnode,this.kept,!1,!0),this._vnode=this.kept},updated:function(){var t=this.prevChildren,e=this.moveClass||(this.name||"v")+"-move";if(t.length&&this.hasMove(t[0].elm,e)){t.forEach(_n),t.forEach(bn),t.forEach(wn);document.body.offsetHeight;t.forEach(function(t){if(t.data.moved){var n=t.elm,r=n.style;Ye(n,e),r.transform=r.WebkitTransform=r.transitionDuration="",n.addEventListener(Oo,n._moveCb=function t(r){r&&!/transform$/.test(r.propertyName)||(n.removeEventListener(Oo,t),n._moveCb=null,Ze(n,e))})}})}},methods:{hasMove:function(t,e){if(!_o)return!1;if(null!=this._hasMove)return this._hasMove;Ye(t,e);var n=Xe(t);return Ze(t,e),this._hasMove=n.hasTransform}}},qo={Transition:Mo,TransitionGroup:Uo};Wt.config.isUnknownElement=se,Wt.config.isReservedTag=Xr,Wt.config.getTagNamespace=ae,Wt.config.mustUseProp=Br,f(Wt.options.directives,Ro),f(Wt.options.components,qo),Wt.prototype.__patch__=Mn?To:m,Wt.prototype.$mount=function(t,e){return t=t&&Mn?ue(t):void 0,this._mount(t,e)},"production"!==e.env.NODE_ENV&&Mn&&"undefined"!=typeof console&&console[console.info?"info":"log"]("You are running Vue in development mode.\nMake sure to turn on production mode when deploying for production.\nSee more tips at https://vuejs.org/guide/deployment.html"),setTimeout(function(){Pn.devtools&&(Jn?Jn.emit("init",Wt):"production"!==e.env.NODE_ENV&&Mn&&!Bn&&/Chrome\/\d+/.test(window.navigator.userAgent)&&console[console.info?"info":"log"]("Download the Vue Devtools extension for a better development experience:\nhttps://github.com/vuejs/vue-devtools"))},0),t.exports=Wt}).call(e,n(3),function(){return this}())},3:function(t,e){function n(){throw new Error("setTimeout has not been defined")}function r(){throw new Error("clearTimeout has not been defined")}function o(t){if(l===setTimeout)return setTimeout(t,0);if((l===n||!l)&&setTimeout)return l=setTimeout,setTimeout(t,0);try{return l(t,0)}catch(e){try{return l.call(null,t,0)}catch(e){return l.call(this,t,0)}}}function i(t){if(p===clearTimeout)return clearTimeout(t);if((p===r||!p)&&clearTimeout)return p=clearTimeout,clearTimeout(t);try{return p(t)}catch(e){try{return p.call(null,t)}catch(e){return p.call(this,t)}}}function a(){v&&d&&(v=!1,d.length?h=d.concat(h):m=-1,h.length&&s())}function s(){if(!v){var t=o(a);v=!0;for(var e=h.length;e;){for(d=h,h=[];++m<e;)d&&d[m].run();m=-1,e=h.length}d=null,v=!1,i(t)}}function u(t,e){this.fun=t,this.array=e}function c(){}var l,p,f=t.exports={};!function(){try{l="function"==typeof setTimeout?setTimeout:n}catch(t){l=n}try{p="function"==typeof clearTimeout?clearTimeout:r}catch(t){p=r}}();var d,h=[],v=!1,m=-1;f.nextTick=function(t){var e=new Array(arguments.length-1);if(arguments.length>1)for(var n=1;n<arguments.length;n++)e[n-1]=arguments[n];h.push(new u(t,e)),1!==h.length||v||o(s)},u.prototype.run=function(){this.fun.apply(null,this.array)},f.title="browser",f.browser=!0,f.env={},f.argv=[],f.version="",f.versions={},f.on=c,f.addListener=c,f.once=c,f.off=c,f.removeListener=c,f.removeAllListeners=c,f.emit=c,f.binding=function(t){throw new Error("process.binding is not supported")},f.cwd=function(){return"/"},f.chdir=function(t){throw new Error("process.chdir is not supported")},f.umask=function(){return 0}},4:function(t,e,n){(function(e){/**
−	/*  */	+
−		+
−	/**	+
−	* Convert a value to a string that is actually rendered.	+
−	*/	+
−	function _toString (val) {	+
−	return val == null	+
−	? ''	+
−	: typeof val === 'object'	+
−	? JSON.stringify(val, null, 2)	+
−	: String(val)	+
−	}	+
−		+
−	/**	+
−	* Convert a input value to a number for persistence.	+
−	* If the conversion fails, return original string.	+
−	*/	+
−	function toNumber (val) {	+
−	var n = parseFloat(val, 10);	+
−	return (n || n === 0) ? n : val	+
−	}	+
−		+
−	/**	+
−	* Make a map and return a function for checking if a key	+
−	* is in that map.	+
−	*/	+
−	function makeMap (	+
−	str,	+
−	expectsLowerCase	+
−	) {	+
−	var map = Object.create(null);	+
−	var list = str.split(',');	+
−	for (var i = 0; i < list.length; i++) {	+
−	map[list[i]] = true;	+
−	}	+
−	return expectsLowerCase	+
−	? function (val) { return map[val.toLowerCase()]; }	+
−	: function (val) { return map[val]; }	+
−	}	+
−		+
−	/**	+
−	* Check if a tag is a built-in tag.	+
−	*/	+
−	var isBuiltInTag = makeMap('slot,component', true);	+
−		+
−	/**	+
−	* Remove an item from an array	+
−	*/	+
−	function remove$1 (arr, item) {	+
−	if (arr.length) {	+
−	var index = arr.indexOf(item);	+
−	if (index > -1) {	+
−	return arr.splice(index, 1)	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Check whether the object has the property.	+
−	*/	+
−	var hasOwnProperty = Object.prototype.hasOwnProperty;	+
−	function hasOwn (obj, key) {	+
−	return hasOwnProperty.call(obj, key)	+
−	}	+
−		+
−	/**	+
−	* Check if value is primitive	+
−	*/	+
−	function isPrimitive (value) {	+
−	return typeof value === 'string' || typeof value === 'number'	+
−	}	+
−		+
−	/**	+
−	* Create a cached version of a pure function.	+
−	*/	+
−	function cached (fn) {	+
−	var cache = Object.create(null);	+
−	return (function cachedFn (str) {	+
−	var hit = cache[str];	+
−	return hit || (cache[str] = fn(str))	+
−	})	+
−	}	+
−		+
−	/**	+
−	* Camelize a hyphen-delmited string.	+
−	*/	+
−	var camelizeRE = /-(\w)/g;	+
−	var camelize = cached(function (str) {	+
−	return str.replace(camelizeRE, function (_, c) { return c ? c.toUpperCase() : ''; })	+
−	});	+
−		+
−	/**	+
−	* Capitalize a string.	+
−	*/	+
−	var capitalize = cached(function (str) {	+
−	return str.charAt(0).toUpperCase() + str.slice(1)	+
−	});	+
−		+
−	/**	+
−	* Hyphenate a camelCase string.	+
−	*/	+
−	var hyphenateRE = /([^-])([A-Z])/g;	+
−	var hyphenate = cached(function (str) {	+
−	return str	+
−	.replace(hyphenateRE, '$1-$2')	+
−	.replace(hyphenateRE, '$1-$2')	+
−	.toLowerCase()	+
−	});	+
−		+
−	/**	+
−	* Simple bind, faster than native	+
−	*/	+
−	function bind$1 (fn, ctx) {	+
−	function boundFn (a) {	+
−	var l = arguments.length;	+
−	return l	+
−	? l > 1	+
−	? fn.apply(ctx, arguments)	+
−	: fn.call(ctx, a)	+
−	: fn.call(ctx)	+
−	}	+
−	// record original fn length	+
−	boundFn._length = fn.length;	+
−	return boundFn	+
−	}	+
−		+
−	/**	+
−	* Convert an Array-like object to a real Array.	+
−	*/	+
−	function toArray (list, start) {	+
−	start = start || 0;	+
−	var i = list.length - start;	+
−	var ret = new Array(i);	+
−	while (i--) {	+
−	ret[i] = list[i + start];	+
−	}	+
−	return ret	+
−	}	+
−		+
−	/**	+
−	* Mix properties into target object.	+
−	*/	+
−	function extend (to, _from) {	+
−	for (var key in _from) {	+
−	to[key] = _from[key];	+
−	}	+
−	return to	+
−	}	+
−		+
−	/**	+
−	* Quick object check - this is primarily used to tell	+
−	* Objects from primitive values when we know the value	+
−	* is a JSON-compliant type.	+
−	*/	+
−	function isObject (obj) {	+
−	return obj !== null && typeof obj === 'object'	+
−	}	+
−		+
−	/**	+
−	* Strict object type check. Only returns true	+
−	* for plain JavaScript objects.	+
−	*/	+
−	var toString = Object.prototype.toString;	+
−	var OBJECT_STRING = '[object Object]';	+
−	function isPlainObject (obj) {	+
−	return toString.call(obj) === OBJECT_STRING	+
−	}	+
−		+
−	/**	+
−	* Merge an Array of Objects into a single Object.	+
−	*/	+
−	function toObject (arr) {	+
−	var res = {};	+
−	for (var i = 0; i < arr.length; i++) {	+
−	if (arr[i]) {	+
−	extend(res, arr[i]);	+
−	}	+
−	}	+
−	return res	+
−	}	+
−		+
−	/**	+
−	* Perform no operation.	+
−	*/	+
−	function noop () {}	+
−		+
−	/**	+
−	* Always return false.	+
−	*/	+
−	var no = function () { return false; };	+
−		+
−	/**	+
−	* Return same value	+
−	*/	+
−	var identity = function (_) { return _; };	+
−		+
−	/**	+
−	* Generate a static keys string from compiler modules.	+
−	*/	+
−	function genStaticKeys (modules) {	+
−	return modules.reduce(function (keys, m) {	+
−	return keys.concat(m.staticKeys || [])	+
−	}, []).join(',')	+
−	}	+
−		+
−	/**	+
−	* Check if two values are loosely equal - that is,	+
−	* if they are plain objects, do they have the same shape?	+
−	*/	+
−	function looseEqual (a, b) {	+
−	var isObjectA = isObject(a);	+
−	var isObjectB = isObject(b);	+
−	if (isObjectA && isObjectB) {	+
−	return JSON.stringify(a) === JSON.stringify(b)	+
−	} else if (!isObjectA && !isObjectB) {	+
−	return String(a) === String(b)	+
−	} else {	+
−	return false	+
−	}	+
−	}	+
−		+
−	function looseIndexOf (arr, val) {	+
−	for (var i = 0; i < arr.length; i++) {	+
−	if (looseEqual(arr[i], val)) { return i }	+
−	}	+
−	return -1	+
−	}	+
−		+
−	/*  */	+
−		+
−	var config = {	+
−	/**	+
−	* Option merge strategies (used in core/util/options)	+
−	*/	+
−	optionMergeStrategies: Object.create(null),	+
−		+
−	/**	+
−	* Whether to suppress warnings.	+
−	*/	+
−	silent: false,	+
−		+
−	/**	+
−	* Whether to enable devtools	+
−	*/	+
−	devtools: process.env.NODE_ENV !== 'production',	+
−		+
−	/**	+
−	* Error handler for watcher errors	+
−	*/	+
−	errorHandler: null,	+
−		+
−	/**	+
−	* Ignore certain custom elements	+
−	*/	+
−	ignoredElements: [],	+
−		+
−	/**	+
−	* Custom user key aliases for v-on	+
−	*/	+
−	keyCodes: Object.create(null),	+
−		+
−	/**	+
−	* Check if a tag is reserved so that it cannot be registered as a	+
−	* component. This is platform-dependent and may be overwritten.	+
−	*/	+
−	isReservedTag: no,	+
−		+
−	/**	+
−	* Check if a tag is an unknown element.	+
−	* Platform-dependent.	+
−	*/	+
−	isUnknownElement: no,	+
−		+
−	/**	+
−	* Get the namespace of an element	+
−	*/	+
−	getTagNamespace: noop,	+
−		+
−	/**	+
−	* Parse the real tag name for the specific platform.	+
−	*/	+
−	parsePlatformTagName: identity,	+
−		+
−	/**	+
−	* Check if an attribute must be bound using property, e.g. value	+
−	* Platform-dependent.	+
−	*/	+
−	mustUseProp: no,	+
−		+
−	/**	+
−	* List of asset types that a component can own.	+
−	*/	+
−	_assetTypes: [	+
−	'component',	+
−	'directive',	+
−	'filter'	+
−	],	+
−		+
−	/**	+
−	* List of lifecycle hooks.	+
−	*/	+
−	_lifecycleHooks: [	+
−	'beforeCreate',	+
−	'created',	+
−	'beforeMount',	+
−	'mounted',	+
−	'beforeUpdate',	+
−	'updated',	+
−	'beforeDestroy',	+
−	'destroyed',	+
−	'activated',	+
−	'deactivated'	+
−	],	+
−		+
−	/**	+
−	* Max circular updates allowed in a scheduler flush cycle.	+
−	*/	+
−	_maxUpdateCount: 100	+
−	};	+
−		+
−	/*  */	+
−		+
−	/**	+
−	* Check if a string starts with $ or _	+
−	*/	+
−	function isReserved (str) {	+
−	var c = (str + '').charCodeAt(0);	+
−	return c === 0x24 || c === 0x5F	+
−	}	+
−		+
−	/**	+
−	* Define a property.	+
−	*/	+
−	function def (obj, key, val, enumerable) {	+
−	Object.defineProperty(obj, key, {	+
−	value: val,	+
−	enumerable: !!enumerable,	+
−	writable: true,	+
−	configurable: true	+
−	});	+
−	}	+
−		+
−	/**	+
−	* Parse simple path.	+
−	*/	+
−	var bailRE = /[^\w.$]/;	+
−	function parsePath (path) {	+
−	if (bailRE.test(path)) {	+
−	return	+
−	} else {	+
−	var segments = path.split('.');	+
−	return function (obj) {	+
−	for (var i = 0; i < segments.length; i++) {	+
−	if (!obj) { return }	+
−	obj = obj[segments[i]];	+
−	}	+
−	return obj	+
−	}	+
−	}	+
−	}	+
−		+
−	/*  */	+
−	/* globals MutationObserver */	+
−		+
−	// can we use __proto__?	+
−	var hasProto = '__proto__' in {};	+
−		+
−	// Browser environment sniffing	+
−	var inBrowser = typeof window !== 'undefined';	+
−	var UA = inBrowser && window.navigator.userAgent.toLowerCase();	+
−	var isIE = UA && /msie|trident/.test(UA);	+
−	var isIE9 = UA && UA.indexOf('msie 9.0') > 0;	+
−	var isEdge = UA && UA.indexOf('edge/') > 0;	+
−	var isAndroid = UA && UA.indexOf('android') > 0;	+
−	var isIOS = UA && /iphone|ipad|ipod|ios/.test(UA);	+
−		+
−	// this needs to be lazy-evaled because vue may be required before	+
−	// vue-server-renderer can set VUE_ENV	+
−	var _isServer;	+
−	var isServerRendering = function () {	+
−	if (_isServer === undefined) {	+
−	/* istanbul ignore if */	+
−	if (!inBrowser && typeof global !== 'undefined') {	+
−	// detect presence of vue-server-renderer and avoid	+
−	// Webpack shimming the process	+
−	_isServer = global['process'].env.VUE_ENV === 'server';	+
−	} else {	+
−	_isServer = false;	+
−	}	+
−	}	+
−	return _isServer	+
−	};	+
−		+
−	// detect devtools	+
−	var devtools = inBrowser && window.__VUE_DEVTOOLS_GLOBAL_HOOK__;	+
−		+
−	/* istanbul ignore next */	+
−	function isNative (Ctor) {	+
−	return /native code/.test(Ctor.toString())	+
−	}	+
−		+
−	/**	+
−	* Defer a task to execute it asynchronously.	+
−	*/	+
−	var nextTick = (function () {	+
−	var callbacks = [];	+
−	var pending = false;	+
−	var timerFunc;	+
−		+
−	function nextTickHandler () {	+
−	pending = false;	+
−	var copies = callbacks.slice(0);	+
−	callbacks.length = 0;	+
−	for (var i = 0; i < copies.length; i++) {	+
−	copies[i]();	+
−	}	+
−	}	+
−		+
−	// the nextTick behavior leverages the microtask queue, which can be accessed	+
−	// via either native Promise.then or MutationObserver.	+
−	// MutationObserver has wider support, however it is seriously bugged in	+
−	// UIWebView in iOS >= 9.3.3 when triggered in touch event handlers. It	+
−	// completely stops working after triggering a few times... so, if native	+
−	// Promise is available, we will use it:	+
−	/* istanbul ignore if */	+
−	if (typeof Promise !== 'undefined' && isNative(Promise)) {	+
−	var p = Promise.resolve();	+
−	var logError = function (err) { console.error(err); };	+
−	timerFunc = function () {	+
−	p.then(nextTickHandler).catch(logError);	+
−	// in problematic UIWebViews, Promise.then doesn't completely break, but	+
−	// it can get stuck in a weird state where callbacks are pushed into the	+
−	// microtask queue but the queue isn't being flushed, until the browser	+
−	// needs to do some other work, e.g. handle a timer. Therefore we can	+
−	// "force" the microtask queue to be flushed by adding an empty timer.	+
−	if (isIOS) { setTimeout(noop); }	+
−	};	+
−	} else if (typeof MutationObserver !== 'undefined' && (	+
−	isNative(MutationObserver) ||	+
−	// PhantomJS and iOS 7.x	+
−	MutationObserver.toString() === '[object MutationObserverConstructor]'	+
−	)) {	+
−	// use MutationObserver where native Promise is not available,	+
−	// e.g. PhantomJS IE11, iOS7, Android 4.4	+
−	var counter = 1;	+
−	var observer = new MutationObserver(nextTickHandler);	+
−	var textNode = document.createTextNode(String(counter));	+
−	observer.observe(textNode, {	+
−	characterData: true	+
−	});	+
−	timerFunc = function () {	+
−	counter = (counter + 1) % 2;	+
−	textNode.data = String(counter);	+
−	};	+
−	} else {	+
−	// fallback to setTimeout	+
−	/* istanbul ignore next */	+
−	timerFunc = function () {	+
−	setTimeout(nextTickHandler, 0);	+
−	};	+
−	}	+
−		+
−	return function queueNextTick (cb, ctx) {	+
−	var _resolve;	+
−	callbacks.push(function () {	+
−	if (cb) { cb.call(ctx); }	+
−	if (_resolve) { _resolve(ctx); }	+
−	});	+
−	if (!pending) {	+
−	pending = true;	+
−	timerFunc();	+
−	}	+
−	if (!cb && typeof Promise !== 'undefined') {	+
−	return new Promise(function (resolve) {	+
−	_resolve = resolve;	+
−	})	+
−	}	+
−	}	+
−	})();	+
−		+
−	var _Set;	+
−	/* istanbul ignore if */	+
−	if (typeof Set !== 'undefined' && isNative(Set)) {	+
−	// use native Set when available.	+
−	_Set = Set;	+
−	} else {	+
−	// a non-standard Set polyfill that only works with primitive keys.	+
−	_Set = (function () {	+
−	function Set () {	+
−	this.set = Object.create(null);	+
−	}	+
−	Set.prototype.has = function has (key) {	+
−	return this.set[key] === true	+
−	};	+
−	Set.prototype.add = function add (key) {	+
−	this.set[key] = true;	+
−	};	+
−	Set.prototype.clear = function clear () {	+
−	this.set = Object.create(null);	+
−	};	+
−		+
−	return Set;	+
−	}());	+
−	}	+
−		+
−	var warn = noop;	+
−	var formatComponentName;	+
−		+
−	if (process.env.NODE_ENV !== 'production') {	+
−	var hasConsole = typeof console !== 'undefined';	+
−		+
−	warn = function (msg, vm) {	+
−	if (hasConsole && (!config.silent)) {	+
−	console.error("[Vue warn]: " + msg + " " + (	+
−	vm ? formatLocation(formatComponentName(vm)) : ''	+
−	));	+
−	}	+
−	};	+
−		+
−	formatComponentName = function (vm) {	+
−	if (vm.$root === vm) {	+
−	return 'root instance'	+
−	}	+
−	var name = vm._isVue	+
−	? vm.$options.name || vm.$options._componentTag	+
−	: vm.name;	+
−	return (	+
−	(name ? ("component <" + name + ">") : "anonymous component") +	+
−	(vm._isVue && vm.$options.__file ? (" at " + (vm.$options.__file)) : '')	+
−	)	+
−	};	+
−		+
−	var formatLocation = function (str) {	+
−	if (str === 'anonymous component') {	+
−	str += " - use the \"name\" option for better debugging messages.";	+
−	}	+
−	return ("\n(found in " + str + ")")	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var uid$1 = 0;	+
−		+
−	/**	+
−	* A dep is an observable that can have multiple	+
−	* directives subscribing to it.	+
−	*/	+
−	var Dep = function Dep () {	+
−	this.id = uid$1++;	+
−	this.subs = [];	+
−	};	+
−		+
−	Dep.prototype.addSub = function addSub (sub) {	+
−	this.subs.push(sub);	+
−	};	+
−		+
−	Dep.prototype.removeSub = function removeSub (sub) {	+
−	remove$1(this.subs, sub);	+
−	};	+
−		+
−	Dep.prototype.depend = function depend () {	+
−	if (Dep.target) {	+
−	Dep.target.addDep(this);	+
−	}	+
−	};	+
−		+
−	Dep.prototype.notify = function notify () {	+
−	// stablize the subscriber list first	+
−	var subs = this.subs.slice();	+
−	for (var i = 0, l = subs.length; i < l; i++) {	+
−	subs[i].update();	+
−	}	+
−	};	+
−		+
−	// the current target watcher being evaluated.	+
−	// this is globally unique because there could be only one	+
−	// watcher being evaluated at any time.	+
−	Dep.target = null;	+
−	var targetStack = [];	+
−		+
−	function pushTarget (_target) {	+
−	if (Dep.target) { targetStack.push(Dep.target); }	+
−	Dep.target = _target;	+
−	}	+
−		+
−	function popTarget () {	+
−	Dep.target = targetStack.pop();	+
−	}	+
−		+
−	/*	+
−	* not type checking this file because flow doesn't play well with	+
−	* dynamically accessing methods on Array prototype	+
−	*/	+
−		+
−	var arrayProto = Array.prototype;	+
−	var arrayMethods = Object.create(arrayProto);[	+
−	'push',	+
−	'pop',	+
−	'shift',	+
−	'unshift',	+
−	'splice',	+
−	'sort',	+
−	'reverse'	+
−	]	+
−	.forEach(function (method) {	+
−	// cache original method	+
−	var original = arrayProto[method];	+
−	def(arrayMethods, method, function mutator () {	+
−	var arguments$1 = arguments;	+
−		+
−	// avoid leaking arguments:	+
−	// http://jsperf.com/closure-with-arguments	+
−	var i = arguments.length;	+
−	var args = new Array(i);	+
−	while (i--) {	+
−	args[i] = arguments$1[i];	+
−	}	+
−	var result = original.apply(this, args);	+
−	var ob = this.__ob__;	+
−	var inserted;	+
−	switch (method) {	+
−	case 'push':	+
−	inserted = args;	+
−	break	+
−	case 'unshift':	+
−	inserted = args;	+
−	break	+
−	case 'splice':	+
−	inserted = args.slice(2);	+
−	break	+
−	}	+
−	if (inserted) { ob.observeArray(inserted); }	+
−	// notify change	+
−	ob.dep.notify();	+
−	return result	+
−	});	+
−	});	+
−		+
−	/*  */	+
−		+
−	var arrayKeys = Object.getOwnPropertyNames(arrayMethods);	+
−		+
−	/**	+
−	* By default, when a reactive property is set, the new value is	+
−	* also converted to become reactive. However when passing down props,	+
−	* we don't want to force conversion because the value may be a nested value	+
−	* under a frozen data structure. Converting it would defeat the optimization.	+
−	*/	+
−	var observerState = {	+
−	shouldConvert: true,	+
−	isSettingProps: false	+
−	};	+
−		+
−	/**	+
−	* Observer class that are attached to each observed	+
−	* object. Once attached, the observer converts target	+
−	* object's property keys into getter/setters that	+
−	* collect dependencies and dispatches updates.	+
−	*/	+
−	var Observer = function Observer (value) {	+
−	this.value = value;	+
−	this.dep = new Dep();	+
−	this.vmCount = 0;	+
−	def(value, '__ob__', this);	+
−	if (Array.isArray(value)) {	+
−	var augment = hasProto	+
−	? protoAugment	+
−	: copyAugment;	+
−	augment(value, arrayMethods, arrayKeys);	+
−	this.observeArray(value);	+
−	} else {	+
−	this.walk(value);	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Walk through each property and convert them into	+
−	* getter/setters. This method should only be called when	+
−	* value type is Object.	+
−	*/	+
−	Observer.prototype.walk = function walk (obj) {	+
−	var keys = Object.keys(obj);	+
−	for (var i = 0; i < keys.length; i++) {	+
−	defineReactive$$1(obj, keys[i], obj[keys[i]]);	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Observe a list of Array items.	+
−	*/	+
−	Observer.prototype.observeArray = function observeArray (items) {	+
−	for (var i = 0, l = items.length; i < l; i++) {	+
−	observe(items[i]);	+
−	}	+
−	};	+
−		+
−	// helpers	+
−		+
−	/**	+
−	* Augment an target Object or Array by intercepting	+
−	* the prototype chain using __proto__	+
−	*/	+
−	function protoAugment (target, src) {	+
−	/* eslint-disable no-proto */	+
−	target.__proto__ = src;	+
−	/* eslint-enable no-proto */	+
−	}	+
−		+
−	/**	+
−	* Augment an target Object or Array by defining	+
−	* hidden properties.	+
−	*/	+
−	/* istanbul ignore next */	+
−	function copyAugment (target, src, keys) {	+
−	for (var i = 0, l = keys.length; i < l; i++) {	+
−	var key = keys[i];	+
−	def(target, key, src[key]);	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Attempt to create an observer instance for a value,	+
−	* returns the new observer if successfully observed,	+
−	* or the existing observer if the value already has one.	+
−	*/	+
−	function observe (value, asRootData) {	+
−	if (!isObject(value)) {	+
−	return	+
−	}	+
−	var ob;	+
−	if (hasOwn(value, '__ob__') && value.__ob__ instanceof Observer) {	+
−	ob = value.__ob__;	+
−	} else if (	+
−	observerState.shouldConvert &&	+
−	!isServerRendering() &&	+
−	(Array.isArray(value) || isPlainObject(value)) &&	+
−	Object.isExtensible(value) &&	+
−	!value._isVue	+
−	) {	+
−	ob = new Observer(value);	+
−	}	+
−	if (asRootData && ob) {	+
−	ob.vmCount++;	+
−	}	+
−	return ob	+
−	}	+
−		+
−	/**	+
−	* Define a reactive property on an Object.	+
−	*/	+
−	function defineReactive$$1 (	+
−	obj,	+
−	key,	+
−	val,	+
−	customSetter	+
−	) {	+
−	var dep = new Dep();	+
−		+
−	var property = Object.getOwnPropertyDescriptor(obj, key);	+
−	if (property && property.configurable === false) {	+
−	return	+
−	}	+
−		+
−	// cater for pre-defined getter/setters	+
−	var getter = property && property.get;	+
−	var setter = property && property.set;	+
−		+
−	var childOb = observe(val);	+
−	Object.defineProperty(obj, key, {	+
−	enumerable: true,	+
−	configurable: true,	+
−	get: function reactiveGetter () {	+
−	var value = getter ? getter.call(obj) : val;	+
−	if (Dep.target) {	+
−	dep.depend();	+
−	if (childOb) {	+
−	childOb.dep.depend();	+
−	}	+
−	if (Array.isArray(value)) {	+
−	dependArray(value);	+
−	}	+
−	}	+
−	return value	+
−	},	+
−	set: function reactiveSetter (newVal) {	+
−	var value = getter ? getter.call(obj) : val;	+
−	/* eslint-disable no-self-compare */	+
−	if (newVal === value || (newVal !== newVal && value !== value)) {	+
−	return	+
−	}	+
−	/* eslint-enable no-self-compare */	+
−	if (process.env.NODE_ENV !== 'production' && customSetter) {	+
−	customSetter();	+
−	}	+
−	if (setter) {	+
−	setter.call(obj, newVal);	+
−	} else {	+
−	val = newVal;	+
−	}	+
−	childOb = observe(newVal);	+
−	dep.notify();	+
−	}	+
−	});	+
−	}	+
−		+
−	/**	+
−	* Set a property on an object. Adds the new property and	+
−	* triggers change notification if the property doesn't	+
−	* already exist.	+
−	*/	+
−	function set$1 (obj, key, val) {	+
−	if (Array.isArray(obj)) {	+
−	obj.length = Math.max(obj.length, key);	+
−	obj.splice(key, 1, val);	+
−	return val	+
−	}	+
−	if (hasOwn(obj, key)) {	+
−	obj[key] = val;	+
−	return	+
−	}	+
−	var ob = obj.__ob__;	+
−	if (obj._isVue || (ob && ob.vmCount)) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'Avoid adding reactive properties to a Vue instance or its root $data ' +	+
−	'at runtime - declare it upfront in the data option.'	+
−	);	+
−	return	+
−	}	+
−	if (!ob) {	+
−	obj[key] = val;	+
−	return	+
−	}	+
−	defineReactive$$1(ob.value, key, val);	+
−	ob.dep.notify();	+
−	return val	+
−	}	+
−		+
−	/**	+
−	* Delete a property and trigger change if necessary.	+
−	*/	+
−	function del (obj, key) {	+
−	var ob = obj.__ob__;	+
−	if (obj._isVue || (ob && ob.vmCount)) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'Avoid deleting properties on a Vue instance or its root $data ' +	+
−	'- just set it to null.'	+
−	);	+
−	return	+
−	}	+
−	if (!hasOwn(obj, key)) {	+
−	return	+
−	}	+
−	delete obj[key];	+
−	if (!ob) {	+
−	return	+
−	}	+
−	ob.dep.notify();	+
−	}	+
−		+
−	/**	+
−	* Collect dependencies on array elements when the array is touched, since	+
−	* we cannot intercept array element access like property getters.	+
−	*/	+
−	function dependArray (value) {	+
−	for (var e = (void 0), i = 0, l = value.length; i < l; i++) {	+
−	e = value[i];	+
−	e && e.__ob__ && e.__ob__.dep.depend();	+
−	if (Array.isArray(e)) {	+
−	dependArray(e);	+
−	}	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	/**	+
−	* Option overwriting strategies are functions that handle	+
−	* how to merge a parent option value and a child option	+
−	* value into the final value.	+
−	*/	+
−	var strats = config.optionMergeStrategies;	+
−		+
−	/**	+
−	* Options with restrictions	+
−	*/	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	strats.el = strats.propsData = function (parent, child, vm, key) {	+
−	if (!vm) {	+
−	warn(	+
−	"option \"" + key + "\" can only be used during instance " +	+
−	'creation with the `new` keyword.'	+
−	);	+
−	}	+
−	return defaultStrat(parent, child)	+
−	};	+
−	}	+
−		+
−	/**	+
−	* Helper that recursively merges two data objects together.	+
−	*/	+
−	function mergeData (to, from) {	+
−	if (!from) { return to }	+
−	var key, toVal, fromVal;	+
−	var keys = Object.keys(from);	+
−	for (var i = 0; i < keys.length; i++) {	+
−	key = keys[i];	+
−	toVal = to[key];	+
−	fromVal = from[key];	+
−	if (!hasOwn(to, key)) {	+
−	set$1(to, key, fromVal);	+
−	} else if (isPlainObject(toVal) && isPlainObject(fromVal)) {	+
−	mergeData(toVal, fromVal);	+
−	}	+
−	}	+
−	return to	+
−	}	+
−		+
−	/**	+
−	* Data	+
−	*/	+
−	strats.data = function (	+
−	parentVal,	+
−	childVal,	+
−	vm	+
−	) {	+
−	if (!vm) {	+
−	// in a Vue.extend merge, both should be functions	+
−	if (!childVal) {	+
−	return parentVal	+
−	}	+
−	if (typeof childVal !== 'function') {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'The "data" option should be a function ' +	+
−	'that returns a per-instance value in component ' +	+
−	'definitions.',	+
−	vm	+
−	);	+
−	return parentVal	+
−	}	+
−	if (!parentVal) {	+
−	return childVal	+
−	}	+
−	// when parentVal & childVal are both present,	+
−	// we need to return a function that returns the	+
−	// merged result of both functions... no need to	+
−	// check if parentVal is a function here because	+
−	// it has to be a function to pass previous merges.	+
−	return function mergedDataFn () {	+
−	return mergeData(	+
−	childVal.call(this),	+
−	parentVal.call(this)	+
−	)	+
−	}	+
−	} else if (parentVal || childVal) {	+
−	return function mergedInstanceDataFn () {	+
−	// instance merge	+
−	var instanceData = typeof childVal === 'function'	+
−	? childVal.call(vm)	+
−	: childVal;	+
−	var defaultData = typeof parentVal === 'function'	+
−	? parentVal.call(vm)	+
−	: undefined;	+
−	if (instanceData) {	+
−	return mergeData(instanceData, defaultData)	+
−	} else {	+
−	return defaultData	+
−	}	+
−	}	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Hooks and param attributes are merged as arrays.	+
−	*/	+
−	function mergeHook (	+
−	parentVal,	+
−	childVal	+
−	) {	+
−	return childVal	+
−	? parentVal	+
−	? parentVal.concat(childVal)	+
−	: Array.isArray(childVal)	+
−	? childVal	+
−	: [childVal]	+
−	: parentVal	+
−	}	+
−		+
−	config._lifecycleHooks.forEach(function (hook) {	+
−	strats[hook] = mergeHook;	+
−	});	+
−		+
−	/**	+
−	* Assets	+
−	*	+
−	* When a vm is present (instance creation), we need to do	+
−	* a three-way merge between constructor options, instance	+
−	* options and parent options.	+
−	*/	+
−	function mergeAssets (parentVal, childVal) {	+
−	var res = Object.create(parentVal || null);	+
−	return childVal	+
−	? extend(res, childVal)	+
−	: res	+
−	}	+
−		+
−	config._assetTypes.forEach(function (type) {	+
−	strats[type + 's'] = mergeAssets;	+
−	});	+
−		+
−	/**	+
−	* Watchers.	+
−	*	+
−	* Watchers hashes should not overwrite one	+
−	* another, so we merge them as arrays.	+
−	*/	+
−	strats.watch = function (parentVal, childVal) {	+
−	/* istanbul ignore if */	+
−	if (!childVal) { return parentVal }	+
−	if (!parentVal) { return childVal }	+
−	var ret = {};	+
−	extend(ret, parentVal);	+
−	for (var key in childVal) {	+
−	var parent = ret[key];	+
−	var child = childVal[key];	+
−	if (parent && !Array.isArray(parent)) {	+
−	parent = [parent];	+
−	}	+
−	ret[key] = parent	+
−	? parent.concat(child)	+
−	: [child];	+
−	}	+
−	return ret	+
−	};	+
−		+
−	/**	+
−	* Other object hashes.	+
−	*/	+
−	strats.props =	+
−	strats.methods =	+
−	strats.computed = function (parentVal, childVal) {	+
−	if (!childVal) { return parentVal }	+
−	if (!parentVal) { return childVal }	+
−	var ret = Object.create(null);	+
−	extend(ret, parentVal);	+
−	extend(ret, childVal);	+
−	return ret	+
−	};	+
−		+
−	/**	+
−	* Default strategy.	+
−	*/	+
−	var defaultStrat = function (parentVal, childVal) {	+
−	return childVal === undefined	+
−	? parentVal	+
−	: childVal	+
−	};	+
−		+
−	/**	+
−	* Validate component names	+
−	*/	+
−	function checkComponents (options) {	+
−	for (var key in options.components) {	+
−	var lower = key.toLowerCase();	+
−	if (isBuiltInTag(lower) || config.isReservedTag(lower)) {	+
−	warn(	+
−	'Do not use built-in or reserved HTML elements as component ' +	+
−	'id: ' + key	+
−	);	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Ensure all props option syntax are normalized into the	+
−	* Object-based format.	+
−	*/	+
−	function normalizeProps (options) {	+
−	var props = options.props;	+
−	if (!props) { return }	+
−	var res = {};	+
−	var i, val, name;	+
−	if (Array.isArray(props)) {	+
−	i = props.length;	+
−	while (i--) {	+
−	val = props[i];	+
−	if (typeof val === 'string') {	+
−	name = camelize(val);	+
−	res[name] = { type: null };	+
−	} else if (process.env.NODE_ENV !== 'production') {	+
−	warn('props must be strings when using array syntax.');	+
−	}	+
−	}	+
−	} else if (isPlainObject(props)) {	+
−	for (var key in props) {	+
−	val = props[key];	+
−	name = camelize(key);	+
−	res[name] = isPlainObject(val)	+
−	? val	+
−	: { type: val };	+
−	}	+
−	}	+
−	options.props = res;	+
−	}	+
−		+
−	/**	+
−	* Normalize raw function directives into object format.	+
−	*/	+
−	function normalizeDirectives (options) {	+
−	var dirs = options.directives;	+
−	if (dirs) {	+
−	for (var key in dirs) {	+
−	var def = dirs[key];	+
−	if (typeof def === 'function') {	+
−	dirs[key] = { bind: def, update: def };	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Merge two option objects into a new one.	+
−	* Core utility used in both instantiation and inheritance.	+
−	*/	+
−	function mergeOptions (	+
−	parent,	+
−	child,	+
−	vm	+
−	) {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	checkComponents(child);	+
−	}	+
−	normalizeProps(child);	+
−	normalizeDirectives(child);	+
−	var extendsFrom = child.extends;	+
−	if (extendsFrom) {	+
−	parent = typeof extendsFrom === 'function'	+
−	? mergeOptions(parent, extendsFrom.options, vm)	+
−	: mergeOptions(parent, extendsFrom, vm);	+
−	}	+
−	if (child.mixins) {	+
−	for (var i = 0, l = child.mixins.length; i < l; i++) {	+
−	var mixin = child.mixins[i];	+
−	if (mixin.prototype instanceof Vue$2) {	+
−	mixin = mixin.options;	+
−	}	+
−	parent = mergeOptions(parent, mixin, vm);	+
−	}	+
−	}	+
−	var options = {};	+
−	var key;	+
−	for (key in parent) {	+
−	mergeField(key);	+
−	}	+
−	for (key in child) {	+
−	if (!hasOwn(parent, key)) {	+
−	mergeField(key);	+
−	}	+
−	}	+
−	function mergeField (key) {	+
−	var strat = strats[key] || defaultStrat;	+
−	options[key] = strat(parent[key], child[key], vm, key);	+
−	}	+
−	return options	+
−	}	+
−		+
−	/**	+
−	* Resolve an asset.	+
−	* This function is used because child instances need access	+
−	* to assets defined in its ancestor chain.	+
−	*/	+
−	function resolveAsset (	+
−	options,	+
−	type,	+
−	id,	+
−	warnMissing	+
−	) {	+
−	/* istanbul ignore if */	+
−	if (typeof id !== 'string') {	+
−	return	+
−	}	+
−	var assets = options[type];	+
−	// check local registration variations first	+
−	if (hasOwn(assets, id)) { return assets[id] }	+
−	var camelizedId = camelize(id);	+
−	if (hasOwn(assets, camelizedId)) { return assets[camelizedId] }	+
−	var PascalCaseId = capitalize(camelizedId);	+
−	if (hasOwn(assets, PascalCaseId)) { return assets[PascalCaseId] }	+
−	// fallback to prototype chain	+
−	var res = assets[id] || assets[camelizedId] || assets[PascalCaseId];	+
−	if (process.env.NODE_ENV !== 'production' && warnMissing && !res) {	+
−	warn(	+
−	'Failed to resolve ' + type.slice(0, -1) + ': ' + id,	+
−	options	+
−	);	+
−	}	+
−	return res	+
−	}	+
−		+
−	/*  */	+
−		+
−	function validateProp (	+
−	key,	+
−	propOptions,	+
−	propsData,	+
−	vm	+
−	) {	+
−	var prop = propOptions[key];	+
−	var absent = !hasOwn(propsData, key);	+
−	var value = propsData[key];	+
−	// handle boolean props	+
−	if (isType(Boolean, prop.type)) {	+
−	if (absent && !hasOwn(prop, 'default')) {	+
−	value = false;	+
−	} else if (!isType(String, prop.type) && (value === '' || value === hyphenate(key))) {	+
−	value = true;	+
−	}	+
−	}	+
−	// check default value	+
−	if (value === undefined) {	+
−	value = getPropDefaultValue(vm, prop, key);	+
−	// since the default value is a fresh copy,	+
−	// make sure to observe it.	+
−	var prevShouldConvert = observerState.shouldConvert;	+
−	observerState.shouldConvert = true;	+
−	observe(value);	+
−	observerState.shouldConvert = prevShouldConvert;	+
−	}	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	assertProp(prop, key, value, vm, absent);	+
−	}	+
−	return value	+
−	}	+
−		+
−	/**	+
−	* Get the default value of a prop.	+
−	*/	+
−	function getPropDefaultValue (vm, prop, key) {	+
−	// no default, return undefined	+
−	if (!hasOwn(prop, 'default')) {	+
−	return undefined	+
−	}	+
−	var def = prop.default;	+
−	// warn against non-factory defaults for Object & Array	+
−	if (isObject(def)) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'Invalid default value for prop "' + key + '": ' +	+
−	'Props with type Object/Array must use a factory function ' +	+
−	'to return the default value.',	+
−	vm	+
−	);	+
−	}	+
−	// the raw prop value was also undefined from previous render,	+
−	// return previous default value to avoid unnecessary watcher trigger	+
−	if (vm && vm.$options.propsData &&	+
−	vm.$options.propsData[key] === undefined &&	+
−	vm[key] !== undefined) {	+
−	return vm[key]	+
−	}	+
−	// call factory function for non-Function types	+
−	return typeof def === 'function' && prop.type !== Function	+
−	? def.call(vm)	+
−	: def	+
−	}	+
−		+
−	/**	+
−	* Assert whether a prop is valid.	+
−	*/	+
−	function assertProp (	+
−	prop,	+
−	name,	+
−	value,	+
−	vm,	+
−	absent	+
−	) {	+
−	if (prop.required && absent) {	+
−	warn(	+
−	'Missing required prop: "' + name + '"',	+
−	vm	+
−	);	+
−	return	+
−	}	+
−	if (value == null && !prop.required) {	+
−	return	+
−	}	+
−	var type = prop.type;	+
−	var valid = !type || type === true;	+
−	var expectedTypes = [];	+
−	if (type) {	+
−	if (!Array.isArray(type)) {	+
−	type = [type];	+
−	}	+
−	for (var i = 0; i < type.length && !valid; i++) {	+
−	var assertedType = assertType(value, type[i]);	+
−	expectedTypes.push(assertedType.expectedType || '');	+
−	valid = assertedType.valid;	+
−	}	+
−	}	+
−	if (!valid) {	+
−	warn(	+
−	'Invalid prop: type check failed for prop "' + name + '".' +	+
−	' Expected ' + expectedTypes.map(capitalize).join(', ') +	+
−	', got ' + Object.prototype.toString.call(value).slice(8, -1) + '.',	+
−	vm	+
−	);	+
−	return	+
−	}	+
−	var validator = prop.validator;	+
−	if (validator) {	+
−	if (!validator(value)) {	+
−	warn(	+
−	'Invalid prop: custom validator check failed for prop "' + name + '".',	+
−	vm	+
−	);	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Assert the type of a value	+
−	*/	+
−	function assertType (value, type) {	+
−	var valid;	+
−	var expectedType = getType(type);	+
−	if (expectedType === 'String') {	+
−	valid = typeof value === (expectedType = 'string');	+
−	} else if (expectedType === 'Number') {	+
−	valid = typeof value === (expectedType = 'number');	+
−	} else if (expectedType === 'Boolean') {	+
−	valid = typeof value === (expectedType = 'boolean');	+
−	} else if (expectedType === 'Function') {	+
−	valid = typeof value === (expectedType = 'function');	+
−	} else if (expectedType === 'Object') {	+
−	valid = isPlainObject(value);	+
−	} else if (expectedType === 'Array') {	+
−	valid = Array.isArray(value);	+
−	} else {	+
−	valid = value instanceof type;	+
−	}	+
−	return {	+
−	valid: valid,	+
−	expectedType: expectedType	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Use function string name to check built-in types,	+
−	* because a simple equality check will fail when running	+
−	* across different vms / iframes.	+
−	*/	+
−	function getType (fn) {	+
−	var match = fn && fn.toString().match(/^\s*function (\w+)/);	+
−	return match && match[1]	+
−	}	+
−		+
−	function isType (type, fn) {	+
−	if (!Array.isArray(fn)) {	+
−	return getType(fn) === getType(type)	+
−	}	+
−	for (var i = 0, len = fn.length; i < len; i++) {	+
−	if (getType(fn[i]) === getType(type)) {	+
−	return true	+
−	}	+
−	}	+
−	/* istanbul ignore next */	+
−	return false	+
−	}	+
−		+
−		+
−		+
−	var util = Object.freeze({	+
−	defineReactive: defineReactive$$1,	+
−	_toString: _toString,	+
−	toNumber: toNumber,	+
−	makeMap: makeMap,	+
−	isBuiltInTag: isBuiltInTag,	+
−	remove: remove$1,	+
−	hasOwn: hasOwn,	+
−	isPrimitive: isPrimitive,	+
−	cached: cached,	+
−	camelize: camelize,	+
−	capitalize: capitalize,	+
−	hyphenate: hyphenate,	+
−	bind: bind$1,	+
−	toArray: toArray,	+
−	extend: extend,	+
−	isObject: isObject,	+
−	isPlainObject: isPlainObject,	+
−	toObject: toObject,	+
−	noop: noop,	+
−	no: no,	+
−	identity: identity,	+
−	genStaticKeys: genStaticKeys,	+
−	looseEqual: looseEqual,	+
−	looseIndexOf: looseIndexOf,	+
−	isReserved: isReserved,	+
−	def: def,	+
−	parsePath: parsePath,	+
−	hasProto: hasProto,	+
−	inBrowser: inBrowser,	+
−	UA: UA,	+
−	isIE: isIE,	+
−	isIE9: isIE9,	+
−	isEdge: isEdge,	+
−	isAndroid: isAndroid,	+
−	isIOS: isIOS,	+
−	isServerRendering: isServerRendering,	+
−	devtools: devtools,	+
−	nextTick: nextTick,	+
−	get _Set () { return _Set; },	+
−	mergeOptions: mergeOptions,	+
−	resolveAsset: resolveAsset,	+
−	get warn () { return warn; },	+
−	get formatComponentName () { return formatComponentName; },	+
−	validateProp: validateProp	+
−	});	+
−		+
−	/* not type checking this file because flow doesn't play well with Proxy */	+
−		+
−	var initProxy;	+
−		+
−	if (process.env.NODE_ENV !== 'production') {	+
−	var allowedGlobals = makeMap(	+
−	'Infinity,undefined,NaN,isFinite,isNaN,' +	+
−	'parseFloat,parseInt,decodeURI,decodeURIComponent,encodeURI,encodeURIComponent,' +	+
−	'Math,Number,Date,Array,Object,Boolean,String,RegExp,Map,Set,JSON,Intl,' +	+
−	'require' // for Webpack/Browserify	+
−	);	+
−		+
−	var warnNonPresent = function (target, key) {	+
−	warn(	+
−	"Property or method \"" + key + "\" is not defined on the instance but " +	+
−	"referenced during render. Make sure to declare reactive data " +	+
−	"properties in the data option.",	+
−	target	+
−	);	+
−	};	+
−		+
−	var hasProxy =	+
−	typeof Proxy !== 'undefined' &&	+
−	Proxy.toString().match(/native code/);	+
−		+
−	if (hasProxy) {	+
−	var isBuiltInModifier = makeMap('stop,prevent,self,ctrl,shift,alt,meta');	+
−	config.keyCodes = new Proxy(config.keyCodes, {	+
−	set: function set (target, key, value) {	+
−	if (isBuiltInModifier(key)) {	+
−	warn(("Avoid overwriting built-in modifier in config.keyCodes: ." + key));	+
−	return false	+
−	} else {	+
−	target[key] = value;	+
−	return true	+
−	}	+
−	}	+
−	});	+
−	}	+
−		+
−	var hasHandler = {	+
−	has: function has (target, key) {	+
−	var has = key in target;	+
−	var isAllowed = allowedGlobals(key) || key.charAt(0) === '_';	+
−	if (!has && !isAllowed) {	+
−	warnNonPresent(target, key);	+
−	}	+
−	return has || !isAllowed	+
−	}	+
−	};	+
−		+
−	var getHandler = {	+
−	get: function get (target, key) {	+
−	if (typeof key === 'string' && !(key in target)) {	+
−	warnNonPresent(target, key);	+
−	}	+
−	return target[key]	+
−	}	+
−	};	+
−		+
−	initProxy = function initProxy (vm) {	+
−	if (hasProxy) {	+
−	// determine which proxy handler to use	+
−	var options = vm.$options;	+
−	var handlers = options.render && options.render._withStripped	+
−	? getHandler	+
−	: hasHandler;	+
−	vm._renderProxy = new Proxy(vm, handlers);	+
−	} else {	+
−	vm._renderProxy = vm;	+
−	}	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var queue = [];	+
−	var has$1 = {};	+
−	var circular = {};	+
−	var waiting = false;	+
−	var flushing = false;	+
−	var index = 0;	+
−		+
−	/**	+
−	* Reset the scheduler's state.	+
−	*/	+
−	function resetSchedulerState () {	+
−	queue.length = 0;	+
−	has$1 = {};	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	circular = {};	+
−	}	+
−	waiting = flushing = false;	+
−	}	+
−		+
−	/**	+
−	* Flush both queues and run the watchers.	+
−	*/	+
−	function flushSchedulerQueue () {	+
−	flushing = true;	+
−		+
−	// Sort queue before flush.	+
−	// This ensures that:	+
−	// 1. Components are updated from parent to child. (because parent is always	+
−	//    created before the child)	+
−	// 2. A component's user watchers are run before its render watcher (because	+
−	//    user watchers are created before the render watcher)	+
−	// 3. If a component is destroyed during a parent component's watcher run,	+
−	//    its watchers can be skipped.	+
−	queue.sort(function (a, b) { return a.id - b.id; });	+
−		+
−	// do not cache length because more watchers might be pushed	+
−	// as we run existing watchers	+
−	for (index = 0; index < queue.length; index++) {	+
−	var watcher = queue[index];	+
−	var id = watcher.id;	+
−	has$1[id] = null;	+
−	watcher.run();	+
−	// in dev build, check and stop circular updates.	+
−	if (process.env.NODE_ENV !== 'production' && has$1[id] != null) {	+
−	circular[id] = (circular[id] || 0) + 1;	+
−	if (circular[id] > config._maxUpdateCount) {	+
−	warn(	+
−	'You may have an infinite update loop ' + (	+
−	watcher.user	+
−	? ("in watcher with expression \"" + (watcher.expression) + "\"")	+
−	: "in a component render function."	+
−	),	+
−	watcher.vm	+
−	);	+
−	break	+
−	}	+
−	}	+
−	}	+
−		+
−	// devtool hook	+
−	/* istanbul ignore if */	+
−	if (devtools && config.devtools) {	+
−	devtools.emit('flush');	+
−	}	+
−		+
−	resetSchedulerState();	+
−	}	+
−		+
−	/**	+
−	* Push a watcher into the watcher queue.	+
−	* Jobs with duplicate IDs will be skipped unless it's	+
−	* pushed when the queue is being flushed.	+
−	*/	+
−	function queueWatcher (watcher) {	+
−	var id = watcher.id;	+
−	if (has$1[id] == null) {	+
−	has$1[id] = true;	+
−	if (!flushing) {	+
−	queue.push(watcher);	+
−	} else {	+
−	// if already flushing, splice the watcher based on its id	+
−	// if already past its id, it will be run next immediately.	+
−	var i = queue.length - 1;	+
−	while (i >= 0 && queue[i].id > watcher.id) {	+
−	i--;	+
−	}	+
−	queue.splice(Math.max(i, index) + 1, 0, watcher);	+
−	}	+
−	// queue the flush	+
−	if (!waiting) {	+
−	waiting = true;	+
−	nextTick(flushSchedulerQueue);	+
−	}	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var uid$2 = 0;	+
−		+
−	/**	+
−	* A watcher parses an expression, collects dependencies,	+
−	* and fires callback when the expression value changes.	+
−	* This is used for both the $watch() api and directives.	+
−	*/	+
−	var Watcher = function Watcher (	+
−	vm,	+
−	expOrFn,	+
−	cb,	+
−	options	+
−	) {	+
−	this.vm = vm;	+
−	vm._watchers.push(this);	+
−	// options	+
−	if (options) {	+
−	this.deep = !!options.deep;	+
−	this.user = !!options.user;	+
−	this.lazy = !!options.lazy;	+
−	this.sync = !!options.sync;	+
−	} else {	+
−	this.deep = this.user = this.lazy = this.sync = false;	+
−	}	+
−	this.cb = cb;	+
−	this.id = ++uid$2; // uid for batching	+
−	this.active = true;	+
−	this.dirty = this.lazy; // for lazy watchers	+
−	this.deps = [];	+
−	this.newDeps = [];	+
−	this.depIds = new _Set();	+
−	this.newDepIds = new _Set();	+
−	this.expression = process.env.NODE_ENV !== 'production'	+
−	? expOrFn.toString()	+
−	: '';	+
−	// parse expression for getter	+
−	if (typeof expOrFn === 'function') {	+
−	this.getter = expOrFn;	+
−	} else {	+
−	this.getter = parsePath(expOrFn);	+
−	if (!this.getter) {	+
−	this.getter = function () {};	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"Failed watching path: \"" + expOrFn + "\" " +	+
−	'Watcher only accepts simple dot-delimited paths. ' +	+
−	'For full control, use a function instead.',	+
−	vm	+
−	);	+
−	}	+
−	}	+
−	this.value = this.lazy	+
−	? undefined	+
−	: this.get();	+
−	};	+
−		+
−	/**	+
−	* Evaluate the getter, and re-collect dependencies.	+
−	*/	+
−	Watcher.prototype.get = function get () {	+
−	pushTarget(this);	+
−	var value = this.getter.call(this.vm, this.vm);	+
−	// "touch" every property so they are all tracked as	+
−	// dependencies for deep watching	+
−	if (this.deep) {	+
−	traverse(value);	+
−	}	+
−	popTarget();	+
−	this.cleanupDeps();	+
−	return value	+
−	};	+
−		+
−	/**	+
−	* Add a dependency to this directive.	+
−	*/	+
−	Watcher.prototype.addDep = function addDep (dep) {	+
−	var id = dep.id;	+
−	if (!this.newDepIds.has(id)) {	+
−	this.newDepIds.add(id);	+
−	this.newDeps.push(dep);	+
−	if (!this.depIds.has(id)) {	+
−	dep.addSub(this);	+
−	}	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Clean up for dependency collection.	+
−	*/	+
−	Watcher.prototype.cleanupDeps = function cleanupDeps () {	+
−	var this$1 = this;	+
−		+
−	var i = this.deps.length;	+
−	while (i--) {	+
−	var dep = this$1.deps[i];	+
−	if (!this$1.newDepIds.has(dep.id)) {	+
−	dep.removeSub(this$1);	+
−	}	+
−	}	+
−	var tmp = this.depIds;	+
−	this.depIds = this.newDepIds;	+
−	this.newDepIds = tmp;	+
−	this.newDepIds.clear();	+
−	tmp = this.deps;	+
−	this.deps = this.newDeps;	+
−	this.newDeps = tmp;	+
−	this.newDeps.length = 0;	+
−	};	+
−		+
−	/**	+
−	* Subscriber interface.	+
−	* Will be called when a dependency changes.	+
−	*/	+
−	Watcher.prototype.update = function update () {	+
−	/* istanbul ignore else */	+
−	if (this.lazy) {	+
−	this.dirty = true;	+
−	} else if (this.sync) {	+
−	this.run();	+
−	} else {	+
−	queueWatcher(this);	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Scheduler job interface.	+
−	* Will be called by the scheduler.	+
−	*/	+
−	Watcher.prototype.run = function run () {	+
−	if (this.active) {	+
−	var value = this.get();	+
−	if (	+
−	value !== this.value ||	+
−	// Deep watchers and watchers on Object/Arrays should fire even	+
−	// when the value is the same, because the value may	+
−	// have mutated.	+
−	isObject(value) ||	+
−	this.deep	+
−	) {	+
−	// set new value	+
−	var oldValue = this.value;	+
−	this.value = value;	+
−	if (this.user) {	+
−	try {	+
−	this.cb.call(this.vm, value, oldValue);	+
−	} catch (e) {	+
−	/* istanbul ignore else */	+
−	if (config.errorHandler) {	+
−	config.errorHandler.call(null, e, this.vm);	+
−	} else {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	("Error in watcher \"" + (this.expression) + "\""),	+
−	this.vm	+
−	);	+
−	throw e	+
−	}	+
−	}	+
−	} else {	+
−	this.cb.call(this.vm, value, oldValue);	+
−	}	+
−	}	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Evaluate the value of the watcher.	+
−	* This only gets called for lazy watchers.	+
−	*/	+
−	Watcher.prototype.evaluate = function evaluate () {	+
−	this.value = this.get();	+
−	this.dirty = false;	+
−	};	+
−		+
−	/**	+
−	* Depend on all deps collected by this watcher.	+
−	*/	+
−	Watcher.prototype.depend = function depend () {	+
−	var this$1 = this;	+
−		+
−	var i = this.deps.length;	+
−	while (i--) {	+
−	this$1.deps[i].depend();	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Remove self from all dependencies' subscriber list.	+
−	*/	+
−	Watcher.prototype.teardown = function teardown () {	+
−	var this$1 = this;	+
−		+
−	if (this.active) {	+
−	// remove self from vm's watcher list	+
−	// this is a somewhat expensive operation so we skip it	+
−	// if the vm is being destroyed.	+
−	if (!this.vm._isBeingDestroyed) {	+
−	remove$1(this.vm._watchers, this);	+
−	}	+
−	var i = this.deps.length;	+
−	while (i--) {	+
−	this$1.deps[i].removeSub(this$1);	+
−	}	+
−	this.active = false;	+
−	}	+
−	};	+
−		+
−	/**	+
−	* Recursively traverse an object to evoke all converted	+
−	* getters, so that every nested property inside the object	+
−	* is collected as a "deep" dependency.	+
−	*/	+
−	var seenObjects = new _Set();	+
−	function traverse (val) {	+
−	seenObjects.clear();	+
−	_traverse(val, seenObjects);	+
−	}	+
−		+
−	function _traverse (val, seen) {	+
−	var i, keys;	+
−	var isA = Array.isArray(val);	+
−	if ((!isA && !isObject(val)) || !Object.isExtensible(val)) {	+
−	return	+
−	}	+
−	if (val.__ob__) {	+
−	var depId = val.__ob__.dep.id;	+
−	if (seen.has(depId)) {	+
−	return	+
−	}	+
−	seen.add(depId);	+
−	}	+
−	if (isA) {	+
−	i = val.length;	+
−	while (i--) { _traverse(val[i], seen); }	+
−	} else {	+
−	keys = Object.keys(val);	+
−	i = keys.length;	+
−	while (i--) { _traverse(val[keys[i]], seen); }	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initState (vm) {	+
−	vm._watchers = [];	+
−	var opts = vm.$options;	+
−	if (opts.props) { initProps(vm, opts.props); }	+
−	if (opts.methods) { initMethods(vm, opts.methods); }	+
−	if (opts.data) {	+
−	initData(vm);	+
−	} else {	+
−	observe(vm._data = {}, true /* asRootData */);	+
−	}	+
−	if (opts.computed) { initComputed(vm, opts.computed); }	+
−	if (opts.watch) { initWatch(vm, opts.watch); }	+
−	}	+
−		+
−	var isReservedProp = { key: 1, ref: 1, slot: 1 };	+
−		+
−	function initProps (vm, props) {	+
−	var propsData = vm.$options.propsData || {};	+
−	var keys = vm.$options._propKeys = Object.keys(props);	+
−	var isRoot = !vm.$parent;	+
−	// root instance props should be converted	+
−	observerState.shouldConvert = isRoot;	+
−	var loop = function ( i ) {	+
−	var key = keys[i];	+
−	/* istanbul ignore else */	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (isReservedProp[key]) {	+
−	warn(	+
−	("\"" + key + "\" is a reserved attribute and cannot be used as component prop."),	+
−	vm	+
−	);	+
−	}	+
−	defineReactive$$1(vm, key, validateProp(key, props, propsData, vm), function () {	+
−	if (vm.$parent && !observerState.isSettingProps) {	+
−	warn(	+
−	"Avoid mutating a prop directly since the value will be " +	+
−	"overwritten whenever the parent component re-renders. " +	+
−	"Instead, use a data or computed property based on the prop's " +	+
−	"value. Prop being mutated: \"" + key + "\"",	+
−	vm	+
−	);	+
−	}	+
−	});	+
−	} else {	+
−	defineReactive$$1(vm, key, validateProp(key, props, propsData, vm));	+
−	}	+
−	};	+
−		+
−	for (var i = 0; i < keys.length; i++) loop( i );	+
−	observerState.shouldConvert = true;	+
−	}	+
−		+
−	function initData (vm) {	+
−	var data = vm.$options.data;	+
−	data = vm._data = typeof data === 'function'	+
−	? data.call(vm)	+
−	: data || {};	+
−	if (!isPlainObject(data)) {	+
−	data = {};	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'data functions should return an object:\n' +	+
−	'https://vuejs.org/v2/guide/components.html#data-Must-Be-a-Function',	+
−	vm	+
−	);	+
−	}	+
−	// proxy data on instance	+
−	var keys = Object.keys(data);	+
−	var props = vm.$options.props;	+
−	var i = keys.length;	+
−	while (i--) {	+
−	if (props && hasOwn(props, keys[i])) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"The data property \"" + (keys[i]) + "\" is already declared as a prop. " +	+
−	"Use prop default value instead.",	+
−	vm	+
−	);	+
−	} else {	+
−	proxy(vm, keys[i]);	+
−	}	+
−	}	+
−	// observe data	+
−	observe(data, true /* asRootData */);	+
−	}	+
−		+
−	var computedSharedDefinition = {	+
−	enumerable: true,	+
−	configurable: true,	+
−	get: noop,	+
−	set: noop	+
−	};	+
−		+
−	function initComputed (vm, computed) {	+
−	for (var key in computed) {	+
−	/* istanbul ignore if */	+
−	if (process.env.NODE_ENV !== 'production' && key in vm) {	+
−	warn(	+
−	"existing instance property \"" + key + "\" will be " +	+
−	"overwritten by a computed property with the same name.",	+
−	vm	+
−	);	+
−	}	+
−	var userDef = computed[key];	+
−	if (typeof userDef === 'function') {	+
−	computedSharedDefinition.get = makeComputedGetter(userDef, vm);	+
−	computedSharedDefinition.set = noop;	+
−	} else {	+
−	computedSharedDefinition.get = userDef.get	+
−	? userDef.cache !== false	+
−	? makeComputedGetter(userDef.get, vm)	+
−	: bind$1(userDef.get, vm)	+
−	: noop;	+
−	computedSharedDefinition.set = userDef.set	+
−	? bind$1(userDef.set, vm)	+
−	: noop;	+
−	}	+
−	Object.defineProperty(vm, key, computedSharedDefinition);	+
−	}	+
−	}	+
−		+
−	function makeComputedGetter (getter, owner) {	+
−	var watcher = new Watcher(owner, getter, noop, {	+
−	lazy: true	+
−	});	+
−	return function computedGetter () {	+
−	if (watcher.dirty) {	+
−	watcher.evaluate();	+
−	}	+
−	if (Dep.target) {	+
−	watcher.depend();	+
−	}	+
−	return watcher.value	+
−	}	+
−	}	+
−		+
−	function initMethods (vm, methods) {	+
−	for (var key in methods) {	+
−	vm[key] = methods[key] == null ? noop : bind$1(methods[key], vm);	+
−	if (process.env.NODE_ENV !== 'production' && methods[key] == null) {	+
−	warn(	+
−	"method \"" + key + "\" has an undefined value in the component definition. " +	+
−	"Did you reference the function correctly?",	+
−	vm	+
−	);	+
−	}	+
−	}	+
−	}	+
−		+
−	function initWatch (vm, watch) {	+
−	for (var key in watch) {	+
−	var handler = watch[key];	+
−	if (Array.isArray(handler)) {	+
−	for (var i = 0; i < handler.length; i++) {	+
−	createWatcher(vm, key, handler[i]);	+
−	}	+
−	} else {	+
−	createWatcher(vm, key, handler);	+
−	}	+
−	}	+
−	}	+
−		+
−	function createWatcher (vm, key, handler) {	+
−	var options;	+
−	if (isPlainObject(handler)) {	+
−	options = handler;	+
−	handler = handler.handler;	+
−	}	+
−	if (typeof handler === 'string') {	+
−	handler = vm[handler];	+
−	}	+
−	vm.$watch(key, handler, options);	+
−	}	+
−		+
−	function stateMixin (Vue) {	+
−	// flow somehow has problems with directly declared definition object	+
−	// when using Object.defineProperty, so we have to procedurally build up	+
−	// the object here.	+
−	var dataDef = {};	+
−	dataDef.get = function () {	+
−	return this._data	+
−	};	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	dataDef.set = function (newData) {	+
−	warn(	+
−	'Avoid replacing instance root $data. ' +	+
−	'Use nested data properties instead.',	+
−	this	+
−	);	+
−	};	+
−	}	+
−	Object.defineProperty(Vue.prototype, '$data', dataDef);	+
−		+
−	Vue.prototype.$set = set$1;	+
−	Vue.prototype.$delete = del;	+
−		+
−	Vue.prototype.$watch = function (	+
−	expOrFn,	+
−	cb,	+
−	options	+
−	) {	+
−	var vm = this;	+
−	options = options || {};	+
−	options.user = true;	+
−	var watcher = new Watcher(vm, expOrFn, cb, options);	+
−	if (options.immediate) {	+
−	cb.call(vm, watcher.value);	+
−	}	+
−	return function unwatchFn () {	+
−	watcher.teardown();	+
−	}	+
−	};	+
−	}	+
−		+
−	function proxy (vm, key) {	+
−	if (!isReserved(key)) {	+
−	Object.defineProperty(vm, key, {	+
−	configurable: true,	+
−	enumerable: true,	+
−	get: function proxyGetter () {	+
−	return vm._data[key]	+
−	},	+
−	set: function proxySetter (val) {	+
−	vm._data[key] = val;	+
−	}	+
−	});	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var VNode = function VNode (	+
−	tag,	+
−	data,	+
−	children,	+
−	text,	+
−	elm,	+
−	context,	+
−	componentOptions	+
−	) {	+
−	this.tag = tag;	+
−	this.data = data;	+
−	this.children = children;	+
−	this.text = text;	+
−	this.elm = elm;	+
−	this.ns = undefined;	+
−	this.context = context;	+
−	this.functionalContext = undefined;	+
−	this.key = data && data.key;	+
−	this.componentOptions = componentOptions;	+
−	this.child = undefined;	+
−	this.parent = undefined;	+
−	this.raw = false;	+
−	this.isStatic = false;	+
−	this.isRootInsert = true;	+
−	this.isComment = false;	+
−	this.isCloned = false;	+
−	this.isOnce = false;	+
−	};	+
−		+
−	var createEmptyVNode = function () {	+
−	var node = new VNode();	+
−	node.text = '';	+
−	node.isComment = true;	+
−	return node	+
−	};	+
−		+
−	function createTextVNode (val) {	+
−	return new VNode(undefined, undefined, undefined, String(val))	+
−	}	+
−		+
−	// optimized shallow clone	+
−	// used for static nodes and slot nodes because they may be reused across	+
−	// multiple renders, cloning them avoids errors when DOM manipulations rely	+
−	// on their elm reference.	+
−	function cloneVNode (vnode) {	+
−	var cloned = new VNode(	+
−	vnode.tag,	+
−	vnode.data,	+
−	vnode.children,	+
−	vnode.text,	+
−	vnode.elm,	+
−	vnode.context,	+
−	vnode.componentOptions	+
−	);	+
−	cloned.ns = vnode.ns;	+
−	cloned.isStatic = vnode.isStatic;	+
−	cloned.key = vnode.key;	+
−	cloned.isCloned = true;	+
−	return cloned	+
−	}	+
−		+
−	function cloneVNodes (vnodes) {	+
−	var res = new Array(vnodes.length);	+
−	for (var i = 0; i < vnodes.length; i++) {	+
−	res[i] = cloneVNode(vnodes[i]);	+
−	}	+
−	return res	+
−	}	+
−		+
−	/*  */	+
−		+
−	function mergeVNodeHook (def, hookKey, hook, key) {	+
−	key = key + hookKey;	+
−	var injectedHash = def.__injected || (def.__injected = {});	+
−	if (!injectedHash[key]) {	+
−	injectedHash[key] = true;	+
−	var oldHook = def[hookKey];	+
−	if (oldHook) {	+
−	def[hookKey] = function () {	+
−	oldHook.apply(this, arguments);	+
−	hook.apply(this, arguments);	+
−	};	+
−	} else {	+
−	def[hookKey] = hook;	+
−	}	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	function updateListeners (	+
−	on,	+
−	oldOn,	+
−	add,	+
−	remove$$1,	+
−	vm	+
−	) {	+
−	var name, cur, old, fn, event, capture, once;	+
−	for (name in on) {	+
−	cur = on[name];	+
−	old = oldOn[name];	+
−	if (!cur) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"Invalid handler for event \"" + name + "\": got " + String(cur),	+
−	vm	+
−	);	+
−	} else if (!old) {	+
−	once = name.charAt(0) === '~'; // Prefixed last, checked first	+
−	event = once ? name.slice(1) : name;	+
−	capture = event.charAt(0) === '!';	+
−	event = capture ? event.slice(1) : event;	+
−	if (Array.isArray(cur)) {	+
−	add(event, (cur.invoker = arrInvoker(cur)), once, capture);	+
−	} else {	+
−	if (!cur.invoker) {	+
−	fn = cur;	+
−	cur = on[name] = {};	+
−	cur.fn = fn;	+
−	cur.invoker = fnInvoker(cur);	+
−	}	+
−	add(event, cur.invoker, once, capture);	+
−	}	+
−	} else if (cur !== old) {	+
−	if (Array.isArray(old)) {	+
−	old.length = cur.length;	+
−	for (var i = 0; i < old.length; i++) { old[i] = cur[i]; }	+
−	on[name] = old;	+
−	} else {	+
−	old.fn = cur;	+
−	on[name] = old;	+
−	}	+
−	}	+
−	}	+
−	for (name in oldOn) {	+
−	if (!on[name]) {	+
−	once = name.charAt(0) === '~'; // Prefixed last, checked first	+
−	event = once ? name.slice(1) : name;	+
−	capture = event.charAt(0) === '!';	+
−	event = capture ? event.slice(1) : event;	+
−	remove$$1(event, oldOn[name].invoker, capture);	+
−	}	+
−	}	+
−	}	+
−		+
−	function arrInvoker (arr) {	+
−	return function (ev) {	+
−	var arguments$1 = arguments;	+
−		+
−	var single = arguments.length === 1;	+
−	for (var i = 0; i < arr.length; i++) {	+
−	single ? arr[i](ev) : arr[i].apply(null, arguments$1);	+
−	}	+
−	}	+
−	}	+
−		+
−	function fnInvoker (o) {	+
−	return function (ev) {	+
−	var single = arguments.length === 1;	+
−	single ? o.fn(ev) : o.fn.apply(null, arguments);	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	// The template compiler attempts to minimize the need for normalization by	+
−	// statically analyzing the template at compile time.	+
−	//	+
−	// For plain HTML markup, normalization can be completely skipped because the	+
−	// generated render function is guaranteed to return Array<VNode>. There are	+
−	// two cases where extra normalization is needed:	+
−		+
−	// 1. When the children contains components - because a functional component	+
−	// may return an Array instead of a single root. In this case, just a simple	+
−	// nomralization is needed - if any child is an Array, we flatten the whole	+
−	// thing with Array.prototype.concat. It is guaranteed to be only 1-level deep	+
−	// because functional components already normalize their own children.	+
−	function simpleNormalizeChildren (children) {	+
−	for (var i = 0; i < children.length; i++) {	+
−	if (Array.isArray(children[i])) {	+
−	return Array.prototype.concat.apply([], children)	+
−	}	+
−	}	+
−	return children	+
−	}	+
−		+
−	// 2. When the children contains constrcuts that always generated nested Arrays,	+
−	// e.g. <template>, <slot>, v-for, or when the children is provided by user	+
−	// with hand-written render functions / JSX. In such cases a full normalization	+
−	// is needed to cater to all possible types of children values.	+
−	function normalizeChildren (children) {	+
−	return isPrimitive(children)	+
−	? [createTextVNode(children)]	+
−	: Array.isArray(children)	+
−	? normalizeArrayChildren(children)	+
−	: undefined	+
−	}	+
−		+
−	function normalizeArrayChildren (children, nestedIndex) {	+
−	var res = [];	+
−	var i, c, last;	+
−	for (i = 0; i < children.length; i++) {	+
−	c = children[i];	+
−	if (c == null || typeof c === 'boolean') { continue }	+
−	last = res[res.length - 1];	+
−	//  nested	+
−	if (Array.isArray(c)) {	+
−	res.push.apply(res, normalizeArrayChildren(c, ((nestedIndex || '') + "_" + i)));	+
−	} else if (isPrimitive(c)) {	+
−	if (last && last.text) {	+
−	last.text += String(c);	+
−	} else if (c !== '') {	+
−	// convert primitive to vnode	+
−	res.push(createTextVNode(c));	+
−	}	+
−	} else {	+
−	if (c.text && last && last.text) {	+
−	res[res.length - 1] = createTextVNode(last.text + c.text);	+
−	} else {	+
−	// default key for nested array children (likely generated by v-for)	+
−	if (c.tag && c.key == null && nestedIndex != null) {	+
−	c.key = "__vlist" + nestedIndex + "_" + i + "__";	+
−	}	+
−	res.push(c);	+
−	}	+
−	}	+
−	}	+
−	return res	+
−	}	+
−		+
−	/*  */	+
−		+
−	function getFirstComponentChild (children) {	+
−	return children && children.filter(function (c) { return c && c.componentOptions; })[0]	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initEvents (vm) {	+
−	vm._events = Object.create(null);	+
−	vm._hasHookEvent = false;	+
−	// init parent attached events	+
−	var listeners = vm.$options._parentListeners;	+
−	if (listeners) {	+
−	updateComponentListeners(vm, listeners);	+
−	}	+
−	}	+
−		+
−	var target;	+
−		+
−	function add$1 (event, fn, once) {	+
−	if (once) {	+
−	target.$once(event, fn);	+
−	} else {	+
−	target.$on(event, fn);	+
−	}	+
−	}	+
−		+
−	function remove$2 (event, fn) {	+
−	target.$off(event, fn);	+
−	}	+
−		+
−	function updateComponentListeners (	+
−	vm,	+
−	listeners,	+
−	oldListeners	+
−	) {	+
−	target = vm;	+
−	updateListeners(listeners, oldListeners || {}, add$1, remove$2, vm);	+
−	}	+
−		+
−	function eventsMixin (Vue) {	+
−	var hookRE = /^hook:/;	+
−	Vue.prototype.$on = function (event, fn) {	+
−	var vm = this;(vm._events[event] || (vm._events[event] = [])).push(fn);	+
−	// optimize hook:event cost by using a boolean flag marked at registration	+
−	// instead of a hash lookup	+
−	if (hookRE.test(event)) {	+
−	vm._hasHookEvent = true;	+
−	}	+
−	return vm	+
−	};	+
−		+
−	Vue.prototype.$once = function (event, fn) {	+
−	var vm = this;	+
−	function on () {	+
−	vm.$off(event, on);	+
−	fn.apply(vm, arguments);	+
−	}	+
−	on.fn = fn;	+
−	vm.$on(event, on);	+
−	return vm	+
−	};	+
−		+
−	Vue.prototype.$off = function (event, fn) {	+
−	var vm = this;	+
−	// all	+
−	if (!arguments.length) {	+
−	vm._events = Object.create(null);	+
−	return vm	+
−	}	+
−	// specific event	+
−	var cbs = vm._events[event];	+
−	if (!cbs) {	+
−	return vm	+
−	}	+
−	if (arguments.length === 1) {	+
−	vm._events[event] = null;	+
−	return vm	+
−	}	+
−	// specific handler	+
−	var cb;	+
−	var i = cbs.length;	+
−	while (i--) {	+
−	cb = cbs[i];	+
−	if (cb === fn || cb.fn === fn) {	+
−	cbs.splice(i, 1);	+
−	break	+
−	}	+
−	}	+
−	return vm	+
−	};	+
−		+
−	Vue.prototype.$emit = function (event) {	+
−	var vm = this;	+
−	var cbs = vm._events[event];	+
−	if (cbs) {	+
−	cbs = cbs.length > 1 ? toArray(cbs) : cbs;	+
−	var args = toArray(arguments, 1);	+
−	for (var i = 0, l = cbs.length; i < l; i++) {	+
−	cbs[i].apply(vm, args);	+
−	}	+
−	}	+
−	return vm	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−	var activeInstance = null;	+
−		+
−	function initLifecycle (vm) {	+
−	var options = vm.$options;	+
−		+
−	// locate first non-abstract parent	+
−	var parent = options.parent;	+
−	if (parent && !options.abstract) {	+
−	while (parent.$options.abstract && parent.$parent) {	+
−	parent = parent.$parent;	+
−	}	+
−	parent.$children.push(vm);	+
−	}	+
−		+
−	vm.$parent = parent;	+
−	vm.$root = parent ? parent.$root : vm;	+
−		+
−	vm.$children = [];	+
−	vm.$refs = {};	+
−		+
−	vm._watcher = null;	+
−	vm._inactive = false;	+
−	vm._isMounted = false;	+
−	vm._isDestroyed = false;	+
−	vm._isBeingDestroyed = false;	+
−	}	+
−		+
−	function lifecycleMixin (Vue) {	+
−	Vue.prototype._mount = function (	+
−	el,	+
−	hydrating	+
−	) {	+
−	var vm = this;	+
−	vm.$el = el;	+
−	if (!vm.$options.render) {	+
−	vm.$options.render = createEmptyVNode;	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	/* istanbul ignore if */	+
−	if (vm.$options.template && vm.$options.template.charAt(0) !== '#') {	+
−	warn(	+
−	'You are using the runtime-only build of Vue where the template ' +	+
−	'option is not available. Either pre-compile the templates into ' +	+
−	'render functions, or use the compiler-included build.',	+
−	vm	+
−	);	+
−	} else {	+
−	warn(	+
−	'Failed to mount component: template or render function not defined.',	+
−	vm	+
−	);	+
−	}	+
−	}	+
−	}	+
−	callHook(vm, 'beforeMount');	+
−	vm._watcher = new Watcher(vm, function () {	+
−	vm._update(vm._render(), hydrating);	+
−	}, noop);	+
−	hydrating = false;	+
−	// manually mounted instance, call mounted on self	+
−	// mounted is called for render-created child components in its inserted hook	+
−	if (vm.$vnode == null) {	+
−	vm._isMounted = true;	+
−	callHook(vm, 'mounted');	+
−	}	+
−	return vm	+
−	};	+
−		+
−	Vue.prototype._update = function (vnode, hydrating) {	+
−	var vm = this;	+
−	if (vm._isMounted) {	+
−	callHook(vm, 'beforeUpdate');	+
−	}	+
−	var prevEl = vm.$el;	+
−	var prevVnode = vm._vnode;	+
−	var prevActiveInstance = activeInstance;	+
−	activeInstance = vm;	+
−	vm._vnode = vnode;	+
−	// Vue.prototype.__patch__ is injected in entry points	+
−	// based on the rendering backend used.	+
−	if (!prevVnode) {	+
−	// initial render	+
−	vm.$el = vm.__patch__(	+
−	vm.$el, vnode, hydrating, false /* removeOnly */,	+
−	vm.$options._parentElm,	+
−	vm.$options._refElm	+
−	);	+
−	} else {	+
−	// updates	+
−	vm.$el = vm.__patch__(prevVnode, vnode);	+
−	}	+
−	activeInstance = prevActiveInstance;	+
−	// update __vue__ reference	+
−	if (prevEl) {	+
−	prevEl.__vue__ = null;	+
−	}	+
−	if (vm.$el) {	+
−	vm.$el.__vue__ = vm;	+
−	}	+
−	// if parent is an HOC, update its $el as well	+
−	if (vm.$vnode && vm.$parent && vm.$vnode === vm.$parent._vnode) {	+
−	vm.$parent.$el = vm.$el;	+
−	}	+
−	if (vm._isMounted) {	+
−	callHook(vm, 'updated');	+
−	}	+
−	};	+
−		+
−	Vue.prototype._updateFromParent = function (	+
−	propsData,	+
−	listeners,	+
−	parentVnode,	+
−	renderChildren	+
−	) {	+
−	var vm = this;	+
−	var hasChildren = !!(vm.$options._renderChildren || renderChildren);	+
−	vm.$options._parentVnode = parentVnode;	+
−	vm.$vnode = parentVnode; // update vm's placeholder node without re-render	+
−	if (vm._vnode) { // update child tree's parent	+
−	vm._vnode.parent = parentVnode;	+
−	}	+
−	vm.$options._renderChildren = renderChildren;	+
−	// update props	+
−	if (propsData && vm.$options.props) {	+
−	observerState.shouldConvert = false;	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	observerState.isSettingProps = true;	+
−	}	+
−	var propKeys = vm.$options._propKeys || [];	+
−	for (var i = 0; i < propKeys.length; i++) {	+
−	var key = propKeys[i];	+
−	vm[key] = validateProp(key, vm.$options.props, propsData, vm);	+
−	}	+
−	observerState.shouldConvert = true;	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	observerState.isSettingProps = false;	+
−	}	+
−	vm.$options.propsData = propsData;	+
−	}	+
−	// update listeners	+
−	if (listeners) {	+
−	var oldListeners = vm.$options._parentListeners;	+
−	vm.$options._parentListeners = listeners;	+
−	updateComponentListeners(vm, listeners, oldListeners);	+
−	}	+
−	// resolve slots + force update if has children	+
−	if (hasChildren) {	+
−	vm.$slots = resolveSlots(renderChildren, parentVnode.context);	+
−	vm.$forceUpdate();	+
−	}	+
−	};	+
−		+
−	Vue.prototype.$forceUpdate = function () {	+
−	var vm = this;	+
−	if (vm._watcher) {	+
−	vm._watcher.update();	+
−	}	+
−	};	+
−		+
−	Vue.prototype.$destroy = function () {	+
−	var vm = this;	+
−	if (vm._isBeingDestroyed) {	+
−	return	+
−	}	+
−	callHook(vm, 'beforeDestroy');	+
−	vm._isBeingDestroyed = true;	+
−	// remove self from parent	+
−	var parent = vm.$parent;	+
−	if (parent && !parent._isBeingDestroyed && !vm.$options.abstract) {	+
−	remove$1(parent.$children, vm);	+
−	}	+
−	// teardown watchers	+
−	if (vm._watcher) {	+
−	vm._watcher.teardown();	+
−	}	+
−	var i = vm._watchers.length;	+
−	while (i--) {	+
−	vm._watchers[i].teardown();	+
−	}	+
−	// remove reference from data ob	+
−	// frozen object may not have observer.	+
−	if (vm._data.__ob__) {	+
−	vm._data.__ob__.vmCount--;	+
−	}	+
−	// call the last hook...	+
−	vm._isDestroyed = true;	+
−	callHook(vm, 'destroyed');	+
−	// turn off all instance listeners.	+
−	vm.$off();	+
−	// remove __vue__ reference	+
−	if (vm.$el) {	+
−	vm.$el.__vue__ = null;	+
−	}	+
−	// invoke destroy hooks on current rendered tree	+
−	vm.__patch__(vm._vnode, null);	+
−	};	+
−	}	+
−		+
−	function callHook (vm, hook) {	+
−	var handlers = vm.$options[hook];	+
−	if (handlers) {	+
−	for (var i = 0, j = handlers.length; i < j; i++) {	+
−	handlers[i].call(vm);	+
−	}	+
−	}	+
−	if (vm._hasHookEvent) {	+
−	vm.$emit('hook:' + hook);	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var hooks = { init: init, prepatch: prepatch, insert: insert, destroy: destroy$1 };	+
−	var hooksToMerge = Object.keys(hooks);	+
−		+
−	function createComponent (	+
−	Ctor,	+
−	data,	+
−	context,	+
−	children,	+
−	tag	+
−	) {	+
−	if (!Ctor) {	+
−	return	+
−	}	+
−		+
−	var baseCtor = context.$options._base;	+
−	if (isObject(Ctor)) {	+
−	Ctor = baseCtor.extend(Ctor);	+
−	}	+
−		+
−	if (typeof Ctor !== 'function') {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	warn(("Invalid Component definition: " + (String(Ctor))), context);	+
−	}	+
−	return	+
−	}	+
−		+
−	// async component	+
−	if (!Ctor.cid) {	+
−	if (Ctor.resolved) {	+
−	Ctor = Ctor.resolved;	+
−	} else {	+
−	Ctor = resolveAsyncComponent(Ctor, baseCtor, function () {	+
−	// it's ok to queue this on every render because	+
−	// $forceUpdate is buffered by the scheduler.	+
−	context.$forceUpdate();	+
−	});	+
−	if (!Ctor) {	+
−	// return nothing if this is indeed an async component	+
−	// wait for the callback to trigger parent update.	+
−	return	+
−	}	+
−	}	+
−	}	+
−		+
−	// resolve constructor options in case global mixins are applied after	+
−	// component constructor creation	+
−	resolveConstructorOptions(Ctor);	+
−		+
−	data = data || {};	+
−		+
−	// extract props	+
−	var propsData = extractProps(data, Ctor);	+
−		+
−	// functional component	+
−	if (Ctor.options.functional) {	+
−	return createFunctionalComponent(Ctor, propsData, data, context, children)	+
−	}	+
−		+
−	// extract listeners, since these needs to be treated as	+
−	// child component listeners instead of DOM listeners	+
−	var listeners = data.on;	+
−	// replace with listeners with .native modifier	+
−	data.on = data.nativeOn;	+
−		+
−	if (Ctor.options.abstract) {	+
−	// abstract components do not keep anything	+
−	// other than props & listeners	+
−	data = {};	+
−	}	+
−		+
−	// merge component management hooks onto the placeholder node	+
−	mergeHooks(data);	+
−		+
−	// return a placeholder vnode	+
−	var name = Ctor.options.name || tag;	+
−	var vnode = new VNode(	+
−	("vue-component-" + (Ctor.cid) + (name ? ("-" + name) : '')),	+
−	data, undefined, undefined, undefined, context,	+
−	{ Ctor: Ctor, propsData: propsData, listeners: listeners, tag: tag, children: children }	+
−	);	+
−	return vnode	+
−	}	+
−		+
−	function createFunctionalComponent (	+
−	Ctor,	+
−	propsData,	+
−	data,	+
−	context,	+
−	children	+
−	) {	+
−	var props = {};	+
−	var propOptions = Ctor.options.props;	+
−	if (propOptions) {	+
−	for (var key in propOptions) {	+
−	props[key] = validateProp(key, propOptions, propsData);	+
−	}	+
−	}	+
−	// ensure the createElement function in functional components	+
−	// gets a unique context - this is necessary for correct named slot check	+
−	var _context = Object.create(context);	+
−	var h = function (a, b, c, d) { return createElement(_context, a, b, c, d, true); };	+
−	var vnode = Ctor.options.render.call(null, h, {	+
−	props: props,	+
−	data: data,	+
−	parent: context,	+
−	children: children,	+
−	slots: function () { return resolveSlots(children, context); }	+
−	});	+
−	if (vnode instanceof VNode) {	+
−	vnode.functionalContext = context;	+
−	if (data.slot) {	+
−	(vnode.data || (vnode.data = {})).slot = data.slot;	+
−	}	+
−	}	+
−	return vnode	+
−	}	+
−		+
−	function createComponentInstanceForVnode (	+
−	vnode, // we know it's MountedComponentVNode but flow doesn't	+
−	parent, // activeInstance in lifecycle state	+
−	parentElm,	+
−	refElm	+
−	) {	+
−	var vnodeComponentOptions = vnode.componentOptions;	+
−	var options = {	+
−	_isComponent: true,	+
−	parent: parent,	+
−	propsData: vnodeComponentOptions.propsData,	+
−	_componentTag: vnodeComponentOptions.tag,	+
−	_parentVnode: vnode,	+
−	_parentListeners: vnodeComponentOptions.listeners,	+
−	_renderChildren: vnodeComponentOptions.children,	+
−	_parentElm: parentElm || null,	+
−	_refElm: refElm || null	+
−	};	+
−	// check inline-template render functions	+
−	var inlineTemplate = vnode.data.inlineTemplate;	+
−	if (inlineTemplate) {	+
−	options.render = inlineTemplate.render;	+
−	options.staticRenderFns = inlineTemplate.staticRenderFns;	+
−	}	+
−	return new vnodeComponentOptions.Ctor(options)	+
−	}	+
−		+
−	function init (	+
−	vnode,	+
−	hydrating,	+
−	parentElm,	+
−	refElm	+
−	) {	+
−	if (!vnode.child || vnode.child._isDestroyed) {	+
−	var child = vnode.child = createComponentInstanceForVnode(	+
−	vnode,	+
−	activeInstance,	+
−	parentElm,	+
−	refElm	+
−	);	+
−	child.$mount(hydrating ? vnode.elm : undefined, hydrating);	+
−	} else if (vnode.data.keepAlive) {	+
−	// kept-alive components, treat as a patch	+
−	var mountedNode = vnode; // work around flow	+
−	prepatch(mountedNode, mountedNode);	+
−	}	+
−	}	+
−		+
−	function prepatch (	+
−	oldVnode,	+
−	vnode	+
−	) {	+
−	var options = vnode.componentOptions;	+
−	var child = vnode.child = oldVnode.child;	+
−	child._updateFromParent(	+
−	options.propsData, // updated props	+
−	options.listeners, // updated listeners	+
−	vnode, // new parent vnode	+
−	options.children // new children	+
−	);	+
−	}	+
−		+
−	function insert (vnode) {	+
−	if (!vnode.child._isMounted) {	+
−	vnode.child._isMounted = true;	+
−	callHook(vnode.child, 'mounted');	+
−	}	+
−	if (vnode.data.keepAlive) {	+
−	vnode.child._inactive = false;	+
−	callHook(vnode.child, 'activated');	+
−	}	+
−	}	+
−		+
−	function destroy$1 (vnode) {	+
−	if (!vnode.child._isDestroyed) {	+
−	if (!vnode.data.keepAlive) {	+
−	vnode.child.$destroy();	+
−	} else {	+
−	vnode.child._inactive = true;	+
−	callHook(vnode.child, 'deactivated');	+
−	}	+
−	}	+
−	}	+
−		+
−	function resolveAsyncComponent (	+
−	factory,	+
−	baseCtor,	+
−	cb	+
−	) {	+
−	if (factory.requested) {	+
−	// pool callbacks	+
−	factory.pendingCallbacks.push(cb);	+
−	} else {	+
−	factory.requested = true;	+
−	var cbs = factory.pendingCallbacks = [cb];	+
−	var sync = true;	+
−		+
−	var resolve = function (res) {	+
−	if (isObject(res)) {	+
−	res = baseCtor.extend(res);	+
−	}	+
−	// cache resolved	+
−	factory.resolved = res;	+
−	// invoke callbacks only if this is not a synchronous resolve	+
−	// (async resolves are shimmed as synchronous during SSR)	+
−	if (!sync) {	+
−	for (var i = 0, l = cbs.length; i < l; i++) {	+
−	cbs[i](res);	+
−	}	+
−	}	+
−	};	+
−		+
−	var reject = function (reason) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"Failed to resolve async component: " + (String(factory)) +	+
−	(reason ? ("\nReason: " + reason) : '')	+
−	);	+
−	};	+
−		+
−	var res = factory(resolve, reject);	+
−		+
−	// handle promise	+
−	if (res && typeof res.then === 'function' && !factory.resolved) {	+
−	res.then(resolve, reject);	+
−	}	+
−		+
−	sync = false;	+
−	// return in case resolved synchronously	+
−	return factory.resolved	+
−	}	+
−	}	+
−		+
−	function extractProps (data, Ctor) {	+
−	// we are only extracting raw values here.	+
−	// validation and default values are handled in the child	+
−	// component itself.	+
−	var propOptions = Ctor.options.props;	+
−	if (!propOptions) {	+
−	return	+
−	}	+
−	var res = {};	+
−	var attrs = data.attrs;	+
−	var props = data.props;	+
−	var domProps = data.domProps;	+
−	if (attrs || props || domProps) {	+
−	for (var key in propOptions) {	+
−	var altKey = hyphenate(key);	+
−	checkProp(res, props, key, altKey, true) ||	+
−	checkProp(res, attrs, key, altKey) ||	+
−	checkProp(res, domProps, key, altKey);	+
−	}	+
−	}	+
−	return res	+
−	}	+
−		+
−	function checkProp (	+
−	res,	+
−	hash,	+
−	key,	+
−	altKey,	+
−	preserve	+
−	) {	+
−	if (hash) {	+
−	if (hasOwn(hash, key)) {	+
−	res[key] = hash[key];	+
−	if (!preserve) {	+
−	delete hash[key];	+
−	}	+
−	return true	+
−	} else if (hasOwn(hash, altKey)) {	+
−	res[key] = hash[altKey];	+
−	if (!preserve) {	+
−	delete hash[altKey];	+
−	}	+
−	return true	+
−	}	+
−	}	+
−	return false	+
−	}	+
−		+
−	function mergeHooks (data) {	+
−	if (!data.hook) {	+
−	data.hook = {};	+
−	}	+
−	for (var i = 0; i < hooksToMerge.length; i++) {	+
−	var key = hooksToMerge[i];	+
−	var fromParent = data.hook[key];	+
−	var ours = hooks[key];	+
−	data.hook[key] = fromParent ? mergeHook$1(ours, fromParent) : ours;	+
−	}	+
−	}	+
−		+
−	function mergeHook$1 (one, two) {	+
−	return function (a, b, c, d) {	+
−	one(a, b, c, d);	+
−	two(a, b, c, d);	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var SIMPLE_NORMALIZE = 1;	+
−	var ALWAYS_NORMALIZE = 2;	+
−		+
−	// wrapper function for providing a more flexible interface	+
−	// without getting yelled at by flow	+
−	function createElement (	+
−	context,	+
−	tag,	+
−	data,	+
−	children,	+
−	normalizationType,	+
−	alwaysNormalize	+
−	) {	+
−	if (Array.isArray(data) || isPrimitive(data)) {	+
−	normalizationType = children;	+
−	children = data;	+
−	data = undefined;	+
−	}	+
−	if (alwaysNormalize) { normalizationType = ALWAYS_NORMALIZE; }	+
−	return _createElement(context, tag, data, children, normalizationType)	+
−	}	+
−		+
−	function _createElement (	+
−	context,	+
−	tag,	+
−	data,	+
−	children,	+
−	normalizationType	+
−	) {	+
−	if (data && data.__ob__) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"Avoid using observed data object as vnode data: " + (JSON.stringify(data)) + "\n" +	+
−	'Always create fresh vnode data objects in each render!',	+
−	context	+
−	);	+
−	return createEmptyVNode()	+
−	}	+
−	if (!tag) {	+
−	// in case of component :is set to falsy value	+
−	return createEmptyVNode()	+
−	}	+
−	// support single function children as default scoped slot	+
−	if (Array.isArray(children) &&	+
−	typeof children[0] === 'function') {	+
−	data = data || {};	+
−	data.scopedSlots = { default: children[0] };	+
−	children.length = 0;	+
−	}	+
−	if (normalizationType === ALWAYS_NORMALIZE) {	+
−	children = normalizeChildren(children);	+
−	} else if (normalizationType === SIMPLE_NORMALIZE) {	+
−	children = simpleNormalizeChildren(children);	+
−	}	+
−	var vnode, ns;	+
−	if (typeof tag === 'string') {	+
−	var Ctor;	+
−	ns = config.getTagNamespace(tag);	+
−	if (config.isReservedTag(tag)) {	+
−	// platform built-in elements	+
−	vnode = new VNode(	+
−	config.parsePlatformTagName(tag), data, children,	+
−	undefined, undefined, context	+
−	);	+
−	} else if ((Ctor = resolveAsset(context.$options, 'components', tag))) {	+
−	// component	+
−	vnode = createComponent(Ctor, data, context, children, tag);	+
−	} else {	+
−	// unknown or unlisted namespaced elements	+
−	// check at runtime because it may get assigned a namespace when its	+
−	// parent normalizes children	+
−	vnode = new VNode(	+
−	tag, data, children,	+
−	undefined, undefined, context	+
−	);	+
−	}	+
−	} else {	+
−	// direct component options / constructor	+
−	vnode = createComponent(tag, data, context, children);	+
−	}	+
−	if (vnode) {	+
−	if (ns) { applyNS(vnode, ns); }	+
−	return vnode	+
−	} else {	+
−	return createEmptyVNode()	+
−	}	+
−	}	+
−		+
−	function applyNS (vnode, ns) {	+
−	vnode.ns = ns;	+
−	if (vnode.tag === 'foreignObject') {	+
−	// use default namespace inside foreignObject	+
−	return	+
−	}	+
−	if (vnode.children) {	+
−	for (var i = 0, l = vnode.children.length; i < l; i++) {	+
−	var child = vnode.children[i];	+
−	if (child.tag && !child.ns) {	+
−	applyNS(child, ns);	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initRender (vm) {	+
−	vm.$vnode = null; // the placeholder node in parent tree	+
−	vm._vnode = null; // the root of the child tree	+
−	vm._staticTrees = null;	+
−	var parentVnode = vm.$options._parentVnode;	+
−	var renderContext = parentVnode && parentVnode.context;	+
−	vm.$slots = resolveSlots(vm.$options._renderChildren, renderContext);	+
−	vm.$scopedSlots = {};	+
−	// bind the createElement fn to this instance	+
−	// so that we get proper render context inside it.	+
−	// args order: tag, data, children, normalizationType, alwaysNormalize	+
−	// internal version is used by render functions compiled from templates	+
−	vm._c = function (a, b, c, d) { return createElement(vm, a, b, c, d, false); };	+
−	// normalization is always applied for the public version, used in	+
−	// user-written render functions.	+
−	vm.$createElement = function (a, b, c, d) { return createElement(vm, a, b, c, d, true); };	+
−	if (vm.$options.el) {	+
−	vm.$mount(vm.$options.el);	+
−	}	+
−	}	+
−		+
−	function renderMixin (Vue) {	+
−	Vue.prototype.$nextTick = function (fn) {	+
−	return nextTick(fn, this)	+
−	};	+
−		+
−	Vue.prototype._render = function () {	+
−	var vm = this;	+
−	var ref = vm.$options;	+
−	var render = ref.render;	+
−	var staticRenderFns = ref.staticRenderFns;	+
−	var _parentVnode = ref._parentVnode;	+
−		+
−	if (vm._isMounted) {	+
−	// clone slot nodes on re-renders	+
−	for (var key in vm.$slots) {	+
−	vm.$slots[key] = cloneVNodes(vm.$slots[key]);	+
−	}	+
−	}	+
−		+
−	if (_parentVnode && _parentVnode.data.scopedSlots) {	+
−	vm.$scopedSlots = _parentVnode.data.scopedSlots;	+
−	}	+
−		+
−	if (staticRenderFns && !vm._staticTrees) {	+
−	vm._staticTrees = [];	+
−	}	+
−	// set parent vnode. this allows render functions to have access	+
−	// to the data on the placeholder node.	+
−	vm.$vnode = _parentVnode;	+
−	// render self	+
−	var vnode;	+
−	try {	+
−	vnode = render.call(vm._renderProxy, vm.$createElement);	+
−	} catch (e) {	+
−	/* istanbul ignore else */	+
−	if (config.errorHandler) {	+
−	config.errorHandler.call(null, e, vm);	+
−	} else {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	warn(("Error when rendering " + (formatComponentName(vm)) + ":"));	+
−	}	+
−	throw e	+
−	}	+
−	// return previous vnode to prevent render error causing blank component	+
−	vnode = vm._vnode;	+
−	}	+
−	// return empty vnode in case the render function errored out	+
−	if (!(vnode instanceof VNode)) {	+
−	if (process.env.NODE_ENV !== 'production' && Array.isArray(vnode)) {	+
−	warn(	+
−	'Multiple root nodes returned from render function. Render function ' +	+
−	'should return a single root node.',	+
−	vm	+
−	);	+
−	}	+
−	vnode = createEmptyVNode();	+
−	}	+
−	// set parent	+
−	vnode.parent = _parentVnode;	+
−	return vnode	+
−	};	+
−		+
−	// toString for mustaches	+
−	Vue.prototype._s = _toString;	+
−	// convert text to vnode	+
−	Vue.prototype._v = createTextVNode;	+
−	// number conversion	+
−	Vue.prototype._n = toNumber;	+
−	// empty vnode	+
−	Vue.prototype._e = createEmptyVNode;	+
−	// loose equal	+
−	Vue.prototype._q = looseEqual;	+
−	// loose indexOf	+
−	Vue.prototype._i = looseIndexOf;	+
−		+
−	// render static tree by index	+
−	Vue.prototype._m = function renderStatic (	+
−	index,	+
−	isInFor	+
−	) {	+
−	var tree = this._staticTrees[index];	+
−	// if has already-rendered static tree and not inside v-for,	+
−	// we can reuse the same tree by doing a shallow clone.	+
−	if (tree && !isInFor) {	+
−	return Array.isArray(tree)	+
−	? cloneVNodes(tree)	+
−	: cloneVNode(tree)	+
−	}	+
−	// otherwise, render a fresh tree.	+
−	tree = this._staticTrees[index] = this.$options.staticRenderFns[index].call(this._renderProxy);	+
−	markStatic(tree, ("__static__" + index), false);	+
−	return tree	+
−	};	+
−		+
−	// mark node as static (v-once)	+
−	Vue.prototype._o = function markOnce (	+
−	tree,	+
−	index,	+
−	key	+
−	) {	+
−	markStatic(tree, ("__once__" + index + (key ? ("_" + key) : "")), true);	+
−	return tree	+
−	};	+
−		+
−	function markStatic (tree, key, isOnce) {	+
−	if (Array.isArray(tree)) {	+
−	for (var i = 0; i < tree.length; i++) {	+
−	if (tree[i] && typeof tree[i] !== 'string') {	+
−	markStaticNode(tree[i], (key + "_" + i), isOnce);	+
−	}	+
−	}	+
−	} else {	+
−	markStaticNode(tree, key, isOnce);	+
−	}	+
−	}	+
−		+
−	function markStaticNode (node, key, isOnce) {	+
−	node.isStatic = true;	+
−	node.key = key;	+
−	node.isOnce = isOnce;	+
−	}	+
−		+
−	// filter resolution helper	+
−	Vue.prototype._f = function resolveFilter (id) {	+
−	return resolveAsset(this.$options, 'filters', id, true) || identity	+
−	};	+
−		+
−	// render v-for	+
−	Vue.prototype._l = function renderList (	+
−	val,	+
−	render	+
−	) {	+
−	var ret, i, l, keys, key;	+
−	if (Array.isArray(val) || typeof val === 'string') {	+
−	ret = new Array(val.length);	+
−	for (i = 0, l = val.length; i < l; i++) {	+
−	ret[i] = render(val[i], i);	+
−	}	+
−	} else if (typeof val === 'number') {	+
−	ret = new Array(val);	+
−	for (i = 0; i < val; i++) {	+
−	ret[i] = render(i + 1, i);	+
−	}	+
−	} else if (isObject(val)) {	+
−	keys = Object.keys(val);	+
−	ret = new Array(keys.length);	+
−	for (i = 0, l = keys.length; i < l; i++) {	+
−	key = keys[i];	+
−	ret[i] = render(val[key], key, i);	+
−	}	+
−	}	+
−	return ret	+
−	};	+
−		+
−	// renderSlot	+
−	Vue.prototype._t = function (	+
−	name,	+
−	fallback,	+
−	props,	+
−	bindObject	+
−	) {	+
−	var scopedSlotFn = this.$scopedSlots[name];	+
−	if (scopedSlotFn) { // scoped slot	+
−	props = props || {};	+
−	if (bindObject) {	+
−	extend(props, bindObject);	+
−	}	+
−	return scopedSlotFn(props) || fallback	+
−	} else {	+
−	var slotNodes = this.$slots[name];	+
−	// warn duplicate slot usage	+
−	if (slotNodes && process.env.NODE_ENV !== 'production') {	+
−	slotNodes._rendered && warn(	+
−	"Duplicate presence of slot \"" + name + "\" found in the same render tree " +	+
−	"- this will likely cause render errors.",	+
−	this	+
−	);	+
−	slotNodes._rendered = true;	+
−	}	+
−	return slotNodes || fallback	+
−	}	+
−	};	+
−		+
−	// apply v-bind object	+
−	Vue.prototype._b = function bindProps (	+
−	data,	+
−	tag,	+
−	value,	+
−	asProp	+
−	) {	+
−	if (value) {	+
−	if (!isObject(value)) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'v-bind without argument expects an Object or Array value',	+
−	this	+
−	);	+
−	} else {	+
−	if (Array.isArray(value)) {	+
−	value = toObject(value);	+
−	}	+
−	for (var key in value) {	+
−	if (key === 'class' || key === 'style') {	+
−	data[key] = value[key];	+
−	} else {	+
−	var hash = asProp || config.mustUseProp(tag, key)	+
−	? data.domProps || (data.domProps = {})	+
−	: data.attrs || (data.attrs = {});	+
−	hash[key] = value[key];	+
−	}	+
−	}	+
−	}	+
−	}	+
−	return data	+
−	};	+
−		+
−	// check v-on keyCodes	+
−	Vue.prototype._k = function checkKeyCodes (	+
−	eventKeyCode,	+
−	key,	+
−	builtInAlias	+
−	) {	+
−	var keyCodes = config.keyCodes[key] || builtInAlias;	+
−	if (Array.isArray(keyCodes)) {	+
−	return keyCodes.indexOf(eventKeyCode) === -1	+
−	} else {	+
−	return keyCodes !== eventKeyCode	+
−	}	+
−	};	+
−	}	+
−		+
−	function resolveSlots (	+
−	children,	+
−	context	+
−	) {	+
−	var slots = {};	+
−	if (!children) {	+
−	return slots	+
−	}	+
−	var defaultSlot = [];	+
−	var name, child;	+
−	for (var i = 0, l = children.length; i < l; i++) {	+
−	child = children[i];	+
−	// named slots should only be respected if the vnode was rendered in the	+
−	// same context.	+
−	if ((child.context === context || child.functionalContext === context) &&	+
−	child.data && (name = child.data.slot)) {	+
−	var slot = (slots[name] || (slots[name] = []));	+
−	if (child.tag === 'template') {	+
−	slot.push.apply(slot, child.children);	+
−	} else {	+
−	slot.push(child);	+
−	}	+
−	} else {	+
−	defaultSlot.push(child);	+
−	}	+
−	}	+
−	// ignore single whitespace	+
−	if (defaultSlot.length && !(	+
−	defaultSlot.length === 1 &&	+
−	(defaultSlot[0].text === ' ' || defaultSlot[0].isComment)	+
−	)) {	+
−	slots.default = defaultSlot;	+
−	}	+
−	return slots	+
−	}	+
−		+
−	/*  */	+
−		+
−	var uid = 0;	+
−		+
−	function initMixin (Vue) {	+
−	Vue.prototype._init = function (options) {	+
−	var vm = this;	+
−	// a uid	+
−	vm._uid = uid++;	+
−	// a flag to avoid this being observed	+
−	vm._isVue = true;	+
−	// merge options	+
−	if (options && options._isComponent) {	+
−	// optimize internal component instantiation	+
−	// since dynamic options merging is pretty slow, and none of the	+
−	// internal component options needs special treatment.	+
−	initInternalComponent(vm, options);	+
−	} else {	+
−	vm.$options = mergeOptions(	+
−	resolveConstructorOptions(vm.constructor),	+
−	options || {},	+
−	vm	+
−	);	+
−	}	+
−	/* istanbul ignore else */	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	initProxy(vm);	+
−	} else {	+
−	vm._renderProxy = vm;	+
−	}	+
−	// expose real self	+
−	vm._self = vm;	+
−	initLifecycle(vm);	+
−	initEvents(vm);	+
−	callHook(vm, 'beforeCreate');	+
−	initState(vm);	+
−	callHook(vm, 'created');	+
−	initRender(vm);	+
−	};	+
−	}	+
−		+
−	function initInternalComponent (vm, options) {	+
−	var opts = vm.$options = Object.create(vm.constructor.options);	+
−	// doing this because it's faster than dynamic enumeration.	+
−	opts.parent = options.parent;	+
−	opts.propsData = options.propsData;	+
−	opts._parentVnode = options._parentVnode;	+
−	opts._parentListeners = options._parentListeners;	+
−	opts._renderChildren = options._renderChildren;	+
−	opts._componentTag = options._componentTag;	+
−	opts._parentElm = options._parentElm;	+
−	opts._refElm = options._refElm;	+
−	if (options.render) {	+
−	opts.render = options.render;	+
−	opts.staticRenderFns = options.staticRenderFns;	+
−	}	+
−	}	+
−		+
−	function resolveConstructorOptions (Ctor) {	+
−	var options = Ctor.options;	+
−	if (Ctor.super) {	+
−	var superOptions = Ctor.super.options;	+
−	var cachedSuperOptions = Ctor.superOptions;	+
−	var extendOptions = Ctor.extendOptions;	+
−	if (superOptions !== cachedSuperOptions) {	+
−	// super option changed	+
−	Ctor.superOptions = superOptions;	+
−	extendOptions.render = options.render;	+
−	extendOptions.staticRenderFns = options.staticRenderFns;	+
−	extendOptions._scopeId = options._scopeId;	+
−	options = Ctor.options = mergeOptions(superOptions, extendOptions);	+
−	if (options.name) {	+
−	options.components[options.name] = Ctor;	+
−	}	+
−	}	+
−	}	+
−	return options	+
−	}	+
−		+
−	function Vue$2 (options) {	+
−	if (process.env.NODE_ENV !== 'production' &&	+
−	!(this instanceof Vue$2)) {	+
−	warn('Vue is a constructor and should be called with the `new` keyword');	+
−	}	+
−	this._init(options);	+
−	}	+
−		+
−	initMixin(Vue$2);	+
−	stateMixin(Vue$2);	+
−	eventsMixin(Vue$2);	+
−	lifecycleMixin(Vue$2);	+
−	renderMixin(Vue$2);	+
−		+
−	/*  */	+
−		+
−	function initUse (Vue) {	+
−	Vue.use = function (plugin) {	+
−	/* istanbul ignore if */	+
−	if (plugin.installed) {	+
−	return	+
−	}	+
−	// additional parameters	+
−	var args = toArray(arguments, 1);	+
−	args.unshift(this);	+
−	if (typeof plugin.install === 'function') {	+
−	plugin.install.apply(plugin, args);	+
−	} else {	+
−	plugin.apply(null, args);	+
−	}	+
−	plugin.installed = true;	+
−	return this	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initMixin$1 (Vue) {	+
−	Vue.mixin = function (mixin) {	+
−	this.options = mergeOptions(this.options, mixin);	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initExtend (Vue) {	+
−	/**	+
−	* Each instance constructor, including Vue, has a unique	+
−	* cid. This enables us to create wrapped "child	+
−	* constructors" for prototypal inheritance and cache them.	+
−	*/	+
−	Vue.cid = 0;	+
−	var cid = 1;	+
−		+
−	/**	+
−	* Class inheritance	+
−	*/	+
−	Vue.extend = function (extendOptions) {	+
−	extendOptions = extendOptions || {};	+
−	var Super = this;	+
−	var SuperId = Super.cid;	+
−	var cachedCtors = extendOptions._Ctor || (extendOptions._Ctor = {});	+
−	if (cachedCtors[SuperId]) {	+
−	return cachedCtors[SuperId]	+
−	}	+
−	var name = extendOptions.name || Super.options.name;	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (!/^[a-zA-Z][\w-]*$/.test(name)) {	+
−	warn(	+
−	'Invalid component name: "' + name + '". Component names ' +	+
−	'can only contain alphanumeric characters and the hyphen, ' +	+
−	'and must start with a letter.'	+
−	);	+
−	}	+
−	}	+
−	var Sub = function VueComponent (options) {	+
−	this._init(options);	+
−	};	+
−	Sub.prototype = Object.create(Super.prototype);	+
−	Sub.prototype.constructor = Sub;	+
−	Sub.cid = cid++;	+
−	Sub.options = mergeOptions(	+
−	Super.options,	+
−	extendOptions	+
−	);	+
−	Sub['super'] = Super;	+
−	// allow further extension/mixin/plugin usage	+
−	Sub.extend = Super.extend;	+
−	Sub.mixin = Super.mixin;	+
−	Sub.use = Super.use;	+
−	// create asset registers, so extended classes	+
−	// can have their private assets too.	+
−	config._assetTypes.forEach(function (type) {	+
−	Sub[type] = Super[type];	+
−	});	+
−	// enable recursive self-lookup	+
−	if (name) {	+
−	Sub.options.components[name] = Sub;	+
−	}	+
−	// keep a reference to the super options at extension time.	+
−	// later at instantiation we can check if Super's options have	+
−	// been updated.	+
−	Sub.superOptions = Super.options;	+
−	Sub.extendOptions = extendOptions;	+
−	// cache constructor	+
−	cachedCtors[SuperId] = Sub;	+
−	return Sub	+
−	};	+
−	}	+
−		+
−	/*  */	+
−		+
−	function initAssetRegisters (Vue) {	+
−	/**	+
−	* Create asset registration methods.	+
−	*/	+
−	config._assetTypes.forEach(function (type) {	+
−	Vue[type] = function (	+
−	id,	+
−	definition	+
−	) {	+
−	if (!definition) {	+
−	return this.options[type + 's'][id]	+
−	} else {	+
−	/* istanbul ignore if */	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (type === 'component' && config.isReservedTag(id)) {	+
−	warn(	+
−	'Do not use built-in or reserved HTML elements as component ' +	+
−	'id: ' + id	+
−	);	+
−	}	+
−	}	+
−	if (type === 'component' && isPlainObject(definition)) {	+
−	definition.name = definition.name || id;	+
−	definition = this.options._base.extend(definition);	+
−	}	+
−	if (type === 'directive' && typeof definition === 'function') {	+
−	definition = { bind: definition, update: definition };	+
−	}	+
−	this.options[type + 's'][id] = definition;	+
−	return definition	+
−	}	+
−	};	+
−	});	+
−	}	+
−		+
−	/*  */	+
−		+
−	var patternTypes = [String, RegExp];	+
−		+
−	function matches (pattern, name) {	+
−	if (typeof pattern === 'string') {	+
−	return pattern.split(',').indexOf(name) > -1	+
−	} else {	+
−	return pattern.test(name)	+
−	}	+
−	}	+
−		+
−	var KeepAlive = {	+
−	name: 'keep-alive',	+
−	abstract: true,	+
−	props: {	+
−	include: patternTypes,	+
−	exclude: patternTypes	+
−	},	+
−	created: function created () {	+
−	this.cache = Object.create(null);	+
−	},	+
−	render: function render () {	+
−	var vnode = getFirstComponentChild(this.$slots.default);	+
−	if (vnode && vnode.componentOptions) {	+
−	var opts = vnode.componentOptions;	+
−	// check pattern	+
−	var name = opts.Ctor.options.name || opts.tag;	+
−	if (name && (	+
−	(this.include && !matches(this.include, name)) ||	+
−	(this.exclude && matches(this.exclude, name))	+
−	)) {	+
−	return vnode	+
−	}	+
−	var key = vnode.key == null	+
−	// same constructor may get registered as different local components	+
−	// so cid alone is not enough (#3269)	+
−	? opts.Ctor.cid + (opts.tag ? ("::" + (opts.tag)) : '')	+
−	: vnode.key;	+
−	if (this.cache[key]) {	+
−	vnode.child = this.cache[key].child;	+
−	} else {	+
−	this.cache[key] = vnode;	+
−	}	+
−	vnode.data.keepAlive = true;	+
−	}	+
−	return vnode	+
−	},	+
−	destroyed: function destroyed () {	+
−	var this$1 = this;	+
−		+
−	for (var key in this.cache) {	+
−	var vnode = this$1.cache[key];	+
−	callHook(vnode.child, 'deactivated');	+
−	vnode.child.$destroy();	+
−	}	+
−	}	+
−	};	+
−		+
−	var builtInComponents = {	+
−	KeepAlive: KeepAlive	+
−	};	+
−		+
−	/*  */	+
−		+
−	function initGlobalAPI (Vue) {	+
−	// config	+
−	var configDef = {};	+
−	configDef.get = function () { return config; };	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	configDef.set = function () {	+
−	warn(	+
−	'Do not replace the Vue.config object, set individual fields instead.'	+
−	);	+
−	};	+
−	}	+
−	Object.defineProperty(Vue, 'config', configDef);	+
−	Vue.util = util;	+
−	Vue.set = set$1;	+
−	Vue.delete = del;	+
−	Vue.nextTick = nextTick;	+
−		+
−	Vue.options = Object.create(null);	+
−	config._assetTypes.forEach(function (type) {	+
−	Vue.options[type + 's'] = Object.create(null);	+
−	});	+
−		+
−	// this is used to identify the "base" constructor to extend all plain-object	+
−	// components with in Weex's multi-instance scenarios.	+
−	Vue.options._base = Vue;	+
−		+
−	extend(Vue.options.components, builtInComponents);	+
−		+
−	initUse(Vue);	+
−	initMixin$1(Vue);	+
−	initExtend(Vue);	+
−	initAssetRegisters(Vue);	+
−	}	+
−		+
−	initGlobalAPI(Vue$2);	+
−		+
−	Object.defineProperty(Vue$2.prototype, '$isServer', {	+
−	get: isServerRendering	+
−	});	+
−		+
−	Vue$2.version = '2.1.8';	+
−		+
−	/*  */	+
−		+
−	// attributes that should be using props for binding	+
−	var acceptValue = makeMap('input,textarea,option,select');	+
−	var mustUseProp = function (tag, attr) {	+
−	return (	+
−	(attr === 'value' && acceptValue(tag)) ||	+
−	(attr === 'selected' && tag === 'option') ||	+
−	(attr === 'checked' && tag === 'input') ||	+
−	(attr === 'muted' && tag === 'video')	+
−	)	+
−	};	+
−		+
−	var isEnumeratedAttr = makeMap('contenteditable,draggable,spellcheck');	+
−		+
−	var isBooleanAttr = makeMap(	+
−	'allowfullscreen,async,autofocus,autoplay,checked,compact,controls,declare,' +	+
−	'default,defaultchecked,defaultmuted,defaultselected,defer,disabled,' +	+
−	'enabled,formnovalidate,hidden,indeterminate,inert,ismap,itemscope,loop,multiple,' +	+
−	'muted,nohref,noresize,noshade,novalidate,nowrap,open,pauseonexit,readonly,' +	+
−	'required,reversed,scoped,seamless,selected,sortable,translate,' +	+
−	'truespeed,typemustmatch,visible'	+
−	);	+
−		+
−	var xlinkNS = 'http://www.w3.org/1999/xlink';	+
−		+
−	var isXlink = function (name) {	+
−	return name.charAt(5) === ':' && name.slice(0, 5) === 'xlink'	+
−	};	+
−		+
−	var getXlinkProp = function (name) {	+
−	return isXlink(name) ? name.slice(6, name.length) : ''	+
−	};	+
−		+
−	var isFalsyAttrValue = function (val) {	+
−	return val == null || val === false	+
−	};	+
−		+
−	/*  */	+
−		+
−	function genClassForVnode (vnode) {	+
−	var data = vnode.data;	+
−	var parentNode = vnode;	+
−	var childNode = vnode;	+
−	while (childNode.child) {	+
−	childNode = childNode.child._vnode;	+
−	if (childNode.data) {	+
−	data = mergeClassData(childNode.data, data);	+
−	}	+
−	}	+
−	while ((parentNode = parentNode.parent)) {	+
−	if (parentNode.data) {	+
−	data = mergeClassData(data, parentNode.data);	+
−	}	+
−	}	+
−	return genClassFromData(data)	+
−	}	+
−		+
−	function mergeClassData (child, parent) {	+
−	return {	+
−	staticClass: concat(child.staticClass, parent.staticClass),	+
−	class: child.class	+
−	? [child.class, parent.class]	+
−	: parent.class	+
−	}	+
−	}	+
−		+
−	function genClassFromData (data) {	+
−	var dynamicClass = data.class;	+
−	var staticClass = data.staticClass;	+
−	if (staticClass || dynamicClass) {	+
−	return concat(staticClass, stringifyClass(dynamicClass))	+
−	}	+
−	/* istanbul ignore next */	+
−	return ''	+
−	}	+
−		+
−	function concat (a, b) {	+
−	return a ? b ? (a + ' ' + b) : a : (b || '')	+
−	}	+
−		+
−	function stringifyClass (value) {	+
−	var res = '';	+
−	if (!value) {	+
−	return res	+
−	}	+
−	if (typeof value === 'string') {	+
−	return value	+
−	}	+
−	if (Array.isArray(value)) {	+
−	var stringified;	+
−	for (var i = 0, l = value.length; i < l; i++) {	+
−	if (value[i]) {	+
−	if ((stringified = stringifyClass(value[i]))) {	+
−	res += stringified + ' ';	+
−	}	+
−	}	+
−	}	+
−	return res.slice(0, -1)	+
−	}	+
−	if (isObject(value)) {	+
−	for (var key in value) {	+
−	if (value[key]) { res += key + ' '; }	+
−	}	+
−	return res.slice(0, -1)	+
−	}	+
−	/* istanbul ignore next */	+
−	return res	+
−	}	+
−		+
−	/*  */	+
−		+
−	var namespaceMap = {	+
−	svg: 'http://www.w3.org/2000/svg',	+
−	math: 'http://www.w3.org/1998/Math/MathML'	+
−	};	+
−		+
−	var isHTMLTag = makeMap(	+
−	'html,body,base,head,link,meta,style,title,' +	+
−	'address,article,aside,footer,header,h1,h2,h3,h4,h5,h6,hgroup,nav,section,' +	+
−	'div,dd,dl,dt,figcaption,figure,hr,img,li,main,ol,p,pre,ul,' +	+
−	'a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,rtc,ruby,' +	+
−	's,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,' +	+
−	'embed,object,param,source,canvas,script,noscript,del,ins,' +	+
−	'caption,col,colgroup,table,thead,tbody,td,th,tr,' +	+
−	'button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,' +	+
−	'output,progress,select,textarea,' +	+
−	'details,dialog,menu,menuitem,summary,' +	+
−	'content,element,shadow,template'	+
−	);	+
−		+
−	// this map is intentionally selective, only covering SVG elements that may	+
−	// contain child elements.	+
−	var isSVG = makeMap(	+
−	'svg,animate,circle,clippath,cursor,defs,desc,ellipse,filter,' +	+
−	'font-face,g,glyph,image,line,marker,mask,missing-glyph,path,pattern,' +	+
−	'polygon,polyline,rect,switch,symbol,text,textpath,tspan,use,view',	+
−	true	+
−	);	+
−		+
−		+
−		+
−	var isReservedTag = function (tag) {	+
−	return isHTMLTag(tag) || isSVG(tag)	+
−	};	+
−		+
−	function getTagNamespace (tag) {	+
−	if (isSVG(tag)) {	+
−	return 'svg'	+
−	}	+
−	// basic support for MathML	+
−	// note it doesn't support other MathML elements being component roots	+
−	if (tag === 'math') {	+
−	return 'math'	+
−	}	+
−	}	+
−		+
−	var unknownElementCache = Object.create(null);	+
−	function isUnknownElement (tag) {	+
−	/* istanbul ignore if */	+
−	if (!inBrowser) {	+
−	return true	+
−	}	+
−	if (isReservedTag(tag)) {	+
−	return false	+
−	}	+
−	tag = tag.toLowerCase();	+
−	/* istanbul ignore if */	+
−	if (unknownElementCache[tag] != null) {	+
−	return unknownElementCache[tag]	+
−	}	+
−	var el = document.createElement(tag);	+
−	if (tag.indexOf('-') > -1) {	+
−	// http://stackoverflow.com/a/28210364/1070244	+
−	return (unknownElementCache[tag] = (	+
−	el.constructor === window.HTMLUnknownElement ||	+
−	el.constructor === window.HTMLElement	+
−	))	+
−	} else {	+
−	return (unknownElementCache[tag] = /HTMLUnknownElement/.test(el.toString()))	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	/**	+
−	* Query an element selector if it's not an element already.	+
−	*/	+
−	function query (el) {	+
−	if (typeof el === 'string') {	+
−	var selector = el;	+
−	el = document.querySelector(el);	+
−	if (!el) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	'Cannot find element: ' + selector	+
−	);	+
−	return document.createElement('div')	+
−	}	+
−	}	+
−	return el	+
−	}	+
−		+
−	/*  */	+
−		+
−	function createElement$1 (tagName, vnode) {	+
−	var elm = document.createElement(tagName);	+
−	if (tagName !== 'select') {	+
−	return elm	+
−	}	+
−	if (vnode.data && vnode.data.attrs && 'multiple' in vnode.data.attrs) {	+
−	elm.setAttribute('multiple', 'multiple');	+
−	}	+
−	return elm	+
−	}	+
−		+
−	function createElementNS (namespace, tagName) {	+
−	return document.createElementNS(namespaceMap[namespace], tagName)	+
−	}	+
−		+
−	function createTextNode (text) {	+
−	return document.createTextNode(text)	+
−	}	+
−		+
−	function createComment (text) {	+
−	return document.createComment(text)	+
−	}	+
−		+
−	function insertBefore (parentNode, newNode, referenceNode) {	+
−	parentNode.insertBefore(newNode, referenceNode);	+
−	}	+
−		+
−	function removeChild (node, child) {	+
−	node.removeChild(child);	+
−	}	+
−		+
−	function appendChild (node, child) {	+
−	node.appendChild(child);	+
−	}	+
−		+
−	function parentNode (node) {	+
−	return node.parentNode	+
−	}	+
−		+
−	function nextSibling (node) {	+
−	return node.nextSibling	+
−	}	+
−		+
−	function tagName (node) {	+
−	return node.tagName	+
−	}	+
−		+
−	function setTextContent (node, text) {	+
−	node.textContent = text;	+
−	}	+
−		+
−	function setAttribute (node, key, val) {	+
−	node.setAttribute(key, val);	+
−	}	+
−		+
−		+
−	var nodeOps = Object.freeze({	+
−	createElement: createElement$1,	+
−	createElementNS: createElementNS,	+
−	createTextNode: createTextNode,	+
−	createComment: createComment,	+
−	insertBefore: insertBefore,	+
−	removeChild: removeChild,	+
−	appendChild: appendChild,	+
−	parentNode: parentNode,	+
−	nextSibling: nextSibling,	+
−	tagName: tagName,	+
−	setTextContent: setTextContent,	+
−	setAttribute: setAttribute	+
−	});	+
−		+
−	/*  */	+
−		+
−	var ref = {	+
−	create: function create (_, vnode) {	+
−	registerRef(vnode);	+
−	},	+
−	update: function update (oldVnode, vnode) {	+
−	if (oldVnode.data.ref !== vnode.data.ref) {	+
−	registerRef(oldVnode, true);	+
−	registerRef(vnode);	+
−	}	+
−	},	+
−	destroy: function destroy (vnode) {	+
−	registerRef(vnode, true);	+
−	}	+
−	};	+
−		+
−	function registerRef (vnode, isRemoval) {	+
−	var key = vnode.data.ref;	+
−	if (!key) { return }	+
−		+
−	var vm = vnode.context;	+
−	var ref = vnode.child || vnode.elm;	+
−	var refs = vm.$refs;	+
−	if (isRemoval) {	+
−	if (Array.isArray(refs[key])) {	+
−	remove$1(refs[key], ref);	+
−	} else if (refs[key] === ref) {	+
−	refs[key] = undefined;	+
−	}	+
−	} else {	+
−	if (vnode.data.refInFor) {	+
−	if (Array.isArray(refs[key]) && refs[key].indexOf(ref) < 0) {	+
−	refs[key].push(ref);	+
−	} else {	+
−	refs[key] = [ref];	+
−	}	+
−	} else {	+
−	refs[key] = ref;	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Virtual DOM patching algorithm based on Snabbdom by	+
−	* Simon Friis Vindum (@paldepind)	+
−	* Licensed under the MIT License	+
−	* https://github.com/paldepind/snabbdom/blob/master/LICENSE	+
−	*	+
−	* modified by Evan You (@yyx990803)	+
−	*	+
−		+
−	/*	+
−	* Not type-checking this because this file is perf-critical and the cost	+
−	* of making flow understand it is not worth it.	+
−	*/	+
−		+
−	var emptyNode = new VNode('', {}, []);	+
−		+
−	var hooks$1 = ['create', 'activate', 'update', 'remove', 'destroy'];	+
−		+
−	function isUndef (s) {	+
−	return s == null	+
−	}	+
−		+
−	function isDef (s) {	+
−	return s != null	+
−	}	+
−		+
−	function sameVnode (vnode1, vnode2) {	+
−	return (	+
−	vnode1.key === vnode2.key &&	+
−	vnode1.tag === vnode2.tag &&	+
−	vnode1.isComment === vnode2.isComment &&	+
−	!vnode1.data === !vnode2.data	+
−	)	+
−	}	+
−		+
−	function createKeyToOldIdx (children, beginIdx, endIdx) {	+
−	var i, key;	+
−	var map = {};	+
−	for (i = beginIdx; i <= endIdx; ++i) {	+
−	key = children[i].key;	+
−	if (isDef(key)) { map[key] = i; }	+
−	}	+
−	return map	+
−	}	+
−		+
−	function createPatchFunction (backend) {	+
−	var i, j;	+
−	var cbs = {};	+
−		+
−	var modules = backend.modules;	+
−	var nodeOps = backend.nodeOps;	+
−		+
−	for (i = 0; i < hooks$1.length; ++i) {	+
−	cbs[hooks$1[i]] = [];	+
−	for (j = 0; j < modules.length; ++j) {	+
−	if (modules[j][hooks$1[i]] !== undefined) { cbs[hooks$1[i]].push(modules[j][hooks$1[i]]); }	+
−	}	+
−	}	+
−		+
−	function emptyNodeAt (elm) {	+
−	return new VNode(nodeOps.tagName(elm).toLowerCase(), {}, [], undefined, elm)	+
−	}	+
−		+
−	function createRmCb (childElm, listeners) {	+
−	function remove$$1 () {	+
−	if (--remove$$1.listeners === 0) {	+
−	removeNode(childElm);	+
−	}	+
−	}	+
−	remove$$1.listeners = listeners;	+
−	return remove$$1	+
−	}	+
−		+
−	function removeNode (el) {	+
−	var parent = nodeOps.parentNode(el);	+
−	// element may have already been removed due to v-html / v-text	+
−	if (parent) {	+
−	nodeOps.removeChild(parent, el);	+
−	}	+
−	}	+
−		+
−	var inPre = 0;	+
−	function createElm (vnode, insertedVnodeQueue, parentElm, refElm, nested) {	+
−	vnode.isRootInsert = !nested; // for transition enter check	+
−	if (createComponent(vnode, insertedVnodeQueue, parentElm, refElm)) {	+
−	return	+
−	}	+
−		+
−	var data = vnode.data;	+
−	var children = vnode.children;	+
−	var tag = vnode.tag;	+
−	if (isDef(tag)) {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (data && data.pre) {	+
−	inPre++;	+
−	}	+
−	if (	+
−	!inPre &&	+
−	!vnode.ns &&	+
−	!(config.ignoredElements.length && config.ignoredElements.indexOf(tag) > -1) &&	+
−	config.isUnknownElement(tag)	+
−	) {	+
−	warn(	+
−	'Unknown custom element: <' + tag + '> - did you ' +	+
−	'register the component correctly? For recursive components, ' +	+
−	'make sure to provide the "name" option.',	+
−	vnode.context	+
−	);	+
−	}	+
−	}	+
−	vnode.elm = vnode.ns	+
−	? nodeOps.createElementNS(vnode.ns, tag)	+
−	: nodeOps.createElement(tag, vnode);	+
−	setScope(vnode);	+
−		+
−	/* istanbul ignore if */	+
−	{	+
−	createChildren(vnode, children, insertedVnodeQueue);	+
−	if (isDef(data)) {	+
−	invokeCreateHooks(vnode, insertedVnodeQueue);	+
−	}	+
−	insert(parentElm, vnode.elm, refElm);	+
−	}	+
−		+
−	if (process.env.NODE_ENV !== 'production' && data && data.pre) {	+
−	inPre--;	+
−	}	+
−	} else if (vnode.isComment) {	+
−	vnode.elm = nodeOps.createComment(vnode.text);	+
−	insert(parentElm, vnode.elm, refElm);	+
−	} else {	+
−	vnode.elm = nodeOps.createTextNode(vnode.text);	+
−	insert(parentElm, vnode.elm, refElm);	+
−	}	+
−	}	+
−		+
−	function createComponent (vnode, insertedVnodeQueue, parentElm, refElm) {	+
−	var i = vnode.data;	+
−	if (isDef(i)) {	+
−	var isReactivated = isDef(vnode.child) && i.keepAlive;	+
−	if (isDef(i = i.hook) && isDef(i = i.init)) {	+
−	i(vnode, false /* hydrating */, parentElm, refElm);	+
−	}	+
−	// after calling the init hook, if the vnode is a child component	+
−	// it should've created a child instance and mounted it. the child	+
−	// component also has set the placeholder vnode's elm.	+
−	// in that case we can just return the element and be done.	+
−	if (isDef(vnode.child)) {	+
−	initComponent(vnode, insertedVnodeQueue);	+
−	if (isReactivated) {	+
−	reactivateComponent(vnode, insertedVnodeQueue, parentElm, refElm);	+
−	}	+
−	return true	+
−	}	+
−	}	+
−	}	+
−		+
−	function reactivateComponent (vnode, insertedVnodeQueue, parentElm, refElm) {	+
−	var i;	+
−	// hack for #4339: a reactivated component with inner transition	+
−	// does not trigger because the inner node's created hooks are not called	+
−	// again. It's not ideal to involve module-specific logic in here but	+
−	// there doesn't seem to be a better way to do it.	+
−	var innerNode = vnode;	+
−	while (innerNode.child) {	+
−	innerNode = innerNode.child._vnode;	+
−	if (isDef(i = innerNode.data) && isDef(i = i.transition)) {	+
−	for (i = 0; i < cbs.activate.length; ++i) {	+
−	cbs.activate[i](emptyNode, innerNode);	+
−	}	+
−	insertedVnodeQueue.push(innerNode);	+
−	break	+
−	}	+
−	}	+
−	// unlike a newly created component,	+
−	// a reactivated keep-alive component doesn't insert itself	+
−	insert(parentElm, vnode.elm, refElm);	+
−	}	+
−		+
−	function insert (parent, elm, ref) {	+
−	if (parent) {	+
−	if (ref) {	+
−	nodeOps.insertBefore(parent, elm, ref);	+
−	} else {	+
−	nodeOps.appendChild(parent, elm);	+
−	}	+
−	}	+
−	}	+
−		+
−	function createChildren (vnode, children, insertedVnodeQueue) {	+
−	if (Array.isArray(children)) {	+
−	for (var i = 0; i < children.length; ++i) {	+
−	createElm(children[i], insertedVnodeQueue, vnode.elm, null, true);	+
−	}	+
−	} else if (isPrimitive(vnode.text)) {	+
−	nodeOps.appendChild(vnode.elm, nodeOps.createTextNode(vnode.text));	+
−	}	+
−	}	+
−		+
−	function isPatchable (vnode) {	+
−	while (vnode.child) {	+
−	vnode = vnode.child._vnode;	+
−	}	+
−	return isDef(vnode.tag)	+
−	}	+
−		+
−	function invokeCreateHooks (vnode, insertedVnodeQueue) {	+
−	for (var i$1 = 0; i$1 < cbs.create.length; ++i$1) {	+
−	cbs.create[i$1](emptyNode, vnode);	+
−	}	+
−	i = vnode.data.hook; // Reuse variable	+
−	if (isDef(i)) {	+
−	if (i.create) { i.create(emptyNode, vnode); }	+
−	if (i.insert) { insertedVnodeQueue.push(vnode); }	+
−	}	+
−	}	+
−		+
−	function initComponent (vnode, insertedVnodeQueue) {	+
−	if (vnode.data.pendingInsert) {	+
−	insertedVnodeQueue.push.apply(insertedVnodeQueue, vnode.data.pendingInsert);	+
−	}	+
−	vnode.elm = vnode.child.$el;	+
−	if (isPatchable(vnode)) {	+
−	invokeCreateHooks(vnode, insertedVnodeQueue);	+
−	setScope(vnode);	+
−	} else {	+
−	// empty component root.	+
−	// skip all element-related modules except for ref (#3455)	+
−	registerRef(vnode);	+
−	// make sure to invoke the insert hook	+
−	insertedVnodeQueue.push(vnode);	+
−	}	+
−	}	+
−		+
−	// set scope id attribute for scoped CSS.	+
−	// this is implemented as a special case to avoid the overhead	+
−	// of going through the normal attribute patching process.	+
−	function setScope (vnode) {	+
−	var i;	+
−	if (isDef(i = vnode.context) && isDef(i = i.$options._scopeId)) {	+
−	nodeOps.setAttribute(vnode.elm, i, '');	+
−	}	+
−	if (isDef(i = activeInstance) &&	+
−	i !== vnode.context &&	+
−	isDef(i = i.$options._scopeId)) {	+
−	nodeOps.setAttribute(vnode.elm, i, '');	+
−	}	+
−	}	+
−		+
−	function addVnodes (parentElm, refElm, vnodes, startIdx, endIdx, insertedVnodeQueue) {	+
−	for (; startIdx <= endIdx; ++startIdx) {	+
−	createElm(vnodes[startIdx], insertedVnodeQueue, parentElm, refElm);	+
−	}	+
−	}	+
−		+
−	function invokeDestroyHook (vnode) {	+
−	var i, j;	+
−	var data = vnode.data;	+
−	if (isDef(data)) {	+
−	if (isDef(i = data.hook) && isDef(i = i.destroy)) { i(vnode); }	+
−	for (i = 0; i < cbs.destroy.length; ++i) { cbs.destroy[i](vnode); }	+
−	}	+
−	if (isDef(i = vnode.children)) {	+
−	for (j = 0; j < vnode.children.length; ++j) {	+
−	invokeDestroyHook(vnode.children[j]);	+
−	}	+
−	}	+
−	}	+
−		+
−	function removeVnodes (parentElm, vnodes, startIdx, endIdx) {	+
−	for (; startIdx <= endIdx; ++startIdx) {	+
−	var ch = vnodes[startIdx];	+
−	if (isDef(ch)) {	+
−	if (isDef(ch.tag)) {	+
−	removeAndInvokeRemoveHook(ch);	+
−	invokeDestroyHook(ch);	+
−	} else { // Text node	+
−	removeNode(ch.elm);	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	function removeAndInvokeRemoveHook (vnode, rm) {	+
−	if (rm || isDef(vnode.data)) {	+
−	var listeners = cbs.remove.length + 1;	+
−	if (!rm) {	+
−	// directly removing	+
−	rm = createRmCb(vnode.elm, listeners);	+
−	} else {	+
−	// we have a recursively passed down rm callback	+
−	// increase the listeners count	+
−	rm.listeners += listeners;	+
−	}	+
−	// recursively invoke hooks on child component root node	+
−	if (isDef(i = vnode.child) && isDef(i = i._vnode) && isDef(i.data)) {	+
−	removeAndInvokeRemoveHook(i, rm);	+
−	}	+
−	for (i = 0; i < cbs.remove.length; ++i) {	+
−	cbs.remove[i](vnode, rm);	+
−	}	+
−	if (isDef(i = vnode.data.hook) && isDef(i = i.remove)) {	+
−	i(vnode, rm);	+
−	} else {	+
−	rm();	+
−	}	+
−	} else {	+
−	removeNode(vnode.elm);	+
−	}	+
−	}	+
−		+
−	function updateChildren (parentElm, oldCh, newCh, insertedVnodeQueue, removeOnly) {	+
−	var oldStartIdx = 0;	+
−	var newStartIdx = 0;	+
−	var oldEndIdx = oldCh.length - 1;	+
−	var oldStartVnode = oldCh[0];	+
−	var oldEndVnode = oldCh[oldEndIdx];	+
−	var newEndIdx = newCh.length - 1;	+
−	var newStartVnode = newCh[0];	+
−	var newEndVnode = newCh[newEndIdx];	+
−	var oldKeyToIdx, idxInOld, elmToMove, refElm;	+
−		+
−	// removeOnly is a special flag used only by <transition-group>	+
−	// to ensure removed elements stay in correct relative positions	+
−	// during leaving transitions	+
−	var canMove = !removeOnly;	+
−		+
−	while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {	+
−	if (isUndef(oldStartVnode)) {	+
−	oldStartVnode = oldCh[++oldStartIdx]; // Vnode has been moved left	+
−	} else if (isUndef(oldEndVnode)) {	+
−	oldEndVnode = oldCh[--oldEndIdx];	+
−	} else if (sameVnode(oldStartVnode, newStartVnode)) {	+
−	patchVnode(oldStartVnode, newStartVnode, insertedVnodeQueue);	+
−	oldStartVnode = oldCh[++oldStartIdx];	+
−	newStartVnode = newCh[++newStartIdx];	+
−	} else if (sameVnode(oldEndVnode, newEndVnode)) {	+
−	patchVnode(oldEndVnode, newEndVnode, insertedVnodeQueue);	+
−	oldEndVnode = oldCh[--oldEndIdx];	+
−	newEndVnode = newCh[--newEndIdx];	+
−	} else if (sameVnode(oldStartVnode, newEndVnode)) { // Vnode moved right	+
−	patchVnode(oldStartVnode, newEndVnode, insertedVnodeQueue);	+
−	canMove && nodeOps.insertBefore(parentElm, oldStartVnode.elm, nodeOps.nextSibling(oldEndVnode.elm));	+
−	oldStartVnode = oldCh[++oldStartIdx];	+
−	newEndVnode = newCh[--newEndIdx];	+
−	} else if (sameVnode(oldEndVnode, newStartVnode)) { // Vnode moved left	+
−	patchVnode(oldEndVnode, newStartVnode, insertedVnodeQueue);	+
−	canMove && nodeOps.insertBefore(parentElm, oldEndVnode.elm, oldStartVnode.elm);	+
−	oldEndVnode = oldCh[--oldEndIdx];	+
−	newStartVnode = newCh[++newStartIdx];	+
−	} else {	+
−	if (isUndef(oldKeyToIdx)) { oldKeyToIdx = createKeyToOldIdx(oldCh, oldStartIdx, oldEndIdx); }	+
−	idxInOld = isDef(newStartVnode.key) ? oldKeyToIdx[newStartVnode.key] : null;	+
−	if (isUndef(idxInOld)) { // New element	+
−	createElm(newStartVnode, insertedVnodeQueue, parentElm, oldStartVnode.elm);	+
−	newStartVnode = newCh[++newStartIdx];	+
−	} else {	+
−	elmToMove = oldCh[idxInOld];	+
−	/* istanbul ignore if */	+
−	if (process.env.NODE_ENV !== 'production' && !elmToMove) {	+
−	warn(	+
−	'It seems there are duplicate keys that is causing an update error. ' +	+
−	'Make sure each v-for item has a unique key.'	+
−	);	+
−	}	+
−	if (sameVnode(elmToMove, newStartVnode)) {	+
−	patchVnode(elmToMove, newStartVnode, insertedVnodeQueue);	+
−	oldCh[idxInOld] = undefined;	+
−	canMove && nodeOps.insertBefore(parentElm, newStartVnode.elm, oldStartVnode.elm);	+
−	newStartVnode = newCh[++newStartIdx];	+
−	} else {	+
−	// same key but different element. treat as new element	+
−	createElm(newStartVnode, insertedVnodeQueue, parentElm, oldStartVnode.elm);	+
−	newStartVnode = newCh[++newStartIdx];	+
−	}	+
−	}	+
−	}	+
−	}	+
−	if (oldStartIdx > oldEndIdx) {	+
−	refElm = isUndef(newCh[newEndIdx + 1]) ? null : newCh[newEndIdx + 1].elm;	+
−	addVnodes(parentElm, refElm, newCh, newStartIdx, newEndIdx, insertedVnodeQueue);	+
−	} else if (newStartIdx > newEndIdx) {	+
−	removeVnodes(parentElm, oldCh, oldStartIdx, oldEndIdx);	+
−	}	+
−	}	+
−		+
−	function patchVnode (oldVnode, vnode, insertedVnodeQueue, removeOnly) {	+
−	if (oldVnode === vnode) {	+
−	return	+
−	}	+
−	// reuse element for static trees.	+
−	// note we only do this if the vnode is cloned -	+
−	// if the new node is not cloned it means the render functions have been	+
−	// reset by the hot-reload-api and we need to do a proper re-render.	+
−	if (vnode.isStatic &&	+
−	oldVnode.isStatic &&	+
−	vnode.key === oldVnode.key &&	+
−	(vnode.isCloned || vnode.isOnce)) {	+
−	vnode.elm = oldVnode.elm;	+
−	vnode.child = oldVnode.child;	+
−	return	+
−	}	+
−	var i;	+
−	var data = vnode.data;	+
−	var hasData = isDef(data);	+
−	if (hasData && isDef(i = data.hook) && isDef(i = i.prepatch)) {	+
−	i(oldVnode, vnode);	+
−	}	+
−	var elm = vnode.elm = oldVnode.elm;	+
−	var oldCh = oldVnode.children;	+
−	var ch = vnode.children;	+
−	if (hasData && isPatchable(vnode)) {	+
−	for (i = 0; i < cbs.update.length; ++i) { cbs.update[i](oldVnode, vnode); }	+
−	if (isDef(i = data.hook) && isDef(i = i.update)) { i(oldVnode, vnode); }	+
−	}	+
−	if (isUndef(vnode.text)) {	+
−	if (isDef(oldCh) && isDef(ch)) {	+
−	if (oldCh !== ch) { updateChildren(elm, oldCh, ch, insertedVnodeQueue, removeOnly); }	+
−	} else if (isDef(ch)) {	+
−	if (isDef(oldVnode.text)) { nodeOps.setTextContent(elm, ''); }	+
−	addVnodes(elm, null, ch, 0, ch.length - 1, insertedVnodeQueue);	+
−	} else if (isDef(oldCh)) {	+
−	removeVnodes(elm, oldCh, 0, oldCh.length - 1);	+
−	} else if (isDef(oldVnode.text)) {	+
−	nodeOps.setTextContent(elm, '');	+
−	}	+
−	} else if (oldVnode.text !== vnode.text) {	+
−	nodeOps.setTextContent(elm, vnode.text);	+
−	}	+
−	if (hasData) {	+
−	if (isDef(i = data.hook) && isDef(i = i.postpatch)) { i(oldVnode, vnode); }	+
−	}	+
−	}	+
−		+
−	function invokeInsertHook (vnode, queue, initial) {	+
−	// delay insert hooks for component root nodes, invoke them after the	+
−	// element is really inserted	+
−	if (initial && vnode.parent) {	+
−	vnode.parent.data.pendingInsert = queue;	+
−	} else {	+
−	for (var i = 0; i < queue.length; ++i) {	+
−	queue[i].data.hook.insert(queue[i]);	+
−	}	+
−	}	+
−	}	+
−		+
−	var bailed = false;	+
−	// list of modules that can skip create hook during hydration because they	+
−	// are already rendered on the client or has no need for initialization	+
−	var isRenderedModule = makeMap('attrs,style,class,staticClass,staticStyle,key');	+
−		+
−	// Note: this is a browser-only function so we can assume elms are DOM nodes.	+
−	function hydrate (elm, vnode, insertedVnodeQueue) {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (!assertNodeMatch(elm, vnode)) {	+
−	return false	+
−	}	+
−	}	+
−	vnode.elm = elm;	+
−	var tag = vnode.tag;	+
−	var data = vnode.data;	+
−	var children = vnode.children;	+
−	if (isDef(data)) {	+
−	if (isDef(i = data.hook) && isDef(i = i.init)) { i(vnode, true /* hydrating */); }	+
−	if (isDef(i = vnode.child)) {	+
−	// child component. it should have hydrated its own tree.	+
−	initComponent(vnode, insertedVnodeQueue);	+
−	return true	+
−	}	+
−	}	+
−	if (isDef(tag)) {	+
−	if (isDef(children)) {	+
−	// empty element, allow client to pick up and populate children	+
−	if (!elm.hasChildNodes()) {	+
−	createChildren(vnode, children, insertedVnodeQueue);	+
−	} else {	+
−	var childrenMatch = true;	+
−	var childNode = elm.firstChild;	+
−	for (var i$1 = 0; i$1 < children.length; i$1++) {	+
−	if (!childNode || !hydrate(childNode, children[i$1], insertedVnodeQueue)) {	+
−	childrenMatch = false;	+
−	break	+
−	}	+
−	childNode = childNode.nextSibling;	+
−	}	+
−	// if childNode is not null, it means the actual childNodes list is	+
−	// longer than the virtual children list.	+
−	if (!childrenMatch || childNode) {	+
−	if (process.env.NODE_ENV !== 'production' &&	+
−	typeof console !== 'undefined' &&	+
−	!bailed) {	+
−	bailed = true;	+
−	console.warn('Parent: ', elm);	+
−	console.warn('Mismatching childNodes vs. VNodes: ', elm.childNodes, children);	+
−	}	+
−	return false	+
−	}	+
−	}	+
−	}	+
−	if (isDef(data)) {	+
−	for (var key in data) {	+
−	if (!isRenderedModule(key)) {	+
−	invokeCreateHooks(vnode, insertedVnodeQueue);	+
−	break	+
−	}	+
−	}	+
−	}	+
−	} else if (elm.data !== vnode.text) {	+
−	elm.data = vnode.text;	+
−	}	+
−	return true	+
−	}	+
−		+
−	function assertNodeMatch (node, vnode) {	+
−	if (vnode.tag) {	+
−	return (	+
−	vnode.tag.indexOf('vue-component') === 0 ||	+
−	vnode.tag.toLowerCase() === (node.tagName && node.tagName.toLowerCase())	+
−	)	+
−	} else {	+
−	return node.nodeType === (vnode.isComment ? 8 : 3)	+
−	}	+
−	}	+
−		+
−	return function patch (oldVnode, vnode, hydrating, removeOnly, parentElm, refElm) {	+
−	if (!vnode) {	+
−	if (oldVnode) { invokeDestroyHook(oldVnode); }	+
−	return	+
−	}	+
−		+
−	var elm, parent;	+
−	var isInitialPatch = false;	+
−	var insertedVnodeQueue = [];	+
−		+
−	if (!oldVnode) {	+
−	// empty mount (likely as component), create new root element	+
−	isInitialPatch = true;	+
−	createElm(vnode, insertedVnodeQueue, parentElm, refElm);	+
−	} else {	+
−	var isRealElement = isDef(oldVnode.nodeType);	+
−	if (!isRealElement && sameVnode(oldVnode, vnode)) {	+
−	// patch existing root node	+
−	patchVnode(oldVnode, vnode, insertedVnodeQueue, removeOnly);	+
−	} else {	+
−	if (isRealElement) {	+
−	// mounting to a real element	+
−	// check if this is server-rendered content and if we can perform	+
−	// a successful hydration.	+
−	if (oldVnode.nodeType === 1 && oldVnode.hasAttribute('server-rendered')) {	+
−	oldVnode.removeAttribute('server-rendered');	+
−	hydrating = true;	+
−	}	+
−	if (hydrating) {	+
−	if (hydrate(oldVnode, vnode, insertedVnodeQueue)) {	+
−	invokeInsertHook(vnode, insertedVnodeQueue, true);	+
−	return oldVnode	+
−	} else if (process.env.NODE_ENV !== 'production') {	+
−	warn(	+
−	'The client-side rendered virtual DOM tree is not matching ' +	+
−	'server-rendered content. This is likely caused by incorrect ' +	+
−	'HTML markup, for example nesting block-level elements inside ' +	+
−	'<p>, or missing <tbody>. Bailing hydration and performing ' +	+
−	'full client-side render.'	+
−	);	+
−	}	+
−	}	+
−	// either not server-rendered, or hydration failed.	+
−	// create an empty node and replace it	+
−	oldVnode = emptyNodeAt(oldVnode);	+
−	}	+
−	// replacing existing element	+
−	elm = oldVnode.elm;	+
−	parent = nodeOps.parentNode(elm);	+
−	createElm(vnode, insertedVnodeQueue, parent, nodeOps.nextSibling(elm));	+
−		+
−	if (vnode.parent) {	+
−	// component root element replaced.	+
−	// update parent placeholder node element, recursively	+
−	var ancestor = vnode.parent;	+
−	while (ancestor) {	+
−	ancestor.elm = vnode.elm;	+
−	ancestor = ancestor.parent;	+
−	}	+
−	if (isPatchable(vnode)) {	+
−	for (var i = 0; i < cbs.create.length; ++i) {	+
−	cbs.create[i](emptyNode, vnode.parent);	+
−	}	+
−	}	+
−	}	+
−		+
−	if (parent !== null) {	+
−	removeVnodes(parent, [oldVnode], 0, 0);	+
−	} else if (isDef(oldVnode.tag)) {	+
−	invokeDestroyHook(oldVnode);	+
−	}	+
−	}	+
−	}	+
−		+
−	invokeInsertHook(vnode, insertedVnodeQueue, isInitialPatch);	+
−	return vnode.elm	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var directives = {	+
−	create: updateDirectives,	+
−	update: updateDirectives,	+
−	destroy: function unbindDirectives (vnode) {	+
−	updateDirectives(vnode, emptyNode);	+
−	}	+
−	};	+
−		+
−	function updateDirectives (oldVnode, vnode) {	+
−	if (oldVnode.data.directives || vnode.data.directives) {	+
−	_update(oldVnode, vnode);	+
−	}	+
−	}	+
−		+
−	function _update (oldVnode, vnode) {	+
−	var isCreate = oldVnode === emptyNode;	+
−	var isDestroy = vnode === emptyNode;	+
−	var oldDirs = normalizeDirectives$1(oldVnode.data.directives, oldVnode.context);	+
−	var newDirs = normalizeDirectives$1(vnode.data.directives, vnode.context);	+
−		+
−	var dirsWithInsert = [];	+
−	var dirsWithPostpatch = [];	+
−		+
−	var key, oldDir, dir;	+
−	for (key in newDirs) {	+
−	oldDir = oldDirs[key];	+
−	dir = newDirs[key];	+
−	if (!oldDir) {	+
−	// new directive, bind	+
−	callHook$1(dir, 'bind', vnode, oldVnode);	+
−	if (dir.def && dir.def.inserted) {	+
−	dirsWithInsert.push(dir);	+
−	}	+
−	} else {	+
−	// existing directive, update	+
−	dir.oldValue = oldDir.value;	+
−	callHook$1(dir, 'update', vnode, oldVnode);	+
−	if (dir.def && dir.def.componentUpdated) {	+
−	dirsWithPostpatch.push(dir);	+
−	}	+
−	}	+
−	}	+
−		+
−	if (dirsWithInsert.length) {	+
−	var callInsert = function () {	+
−	for (var i = 0; i < dirsWithInsert.length; i++) {	+
−	callHook$1(dirsWithInsert[i], 'inserted', vnode, oldVnode);	+
−	}	+
−	};	+
−	if (isCreate) {	+
−	mergeVNodeHook(vnode.data.hook || (vnode.data.hook = {}), 'insert', callInsert, 'dir-insert');	+
−	} else {	+
−	callInsert();	+
−	}	+
−	}	+
−		+
−	if (dirsWithPostpatch.length) {	+
−	mergeVNodeHook(vnode.data.hook || (vnode.data.hook = {}), 'postpatch', function () {	+
−	for (var i = 0; i < dirsWithPostpatch.length; i++) {	+
−	callHook$1(dirsWithPostpatch[i], 'componentUpdated', vnode, oldVnode);	+
−	}	+
−	}, 'dir-postpatch');	+
−	}	+
−		+
−	if (!isCreate) {	+
−	for (key in oldDirs) {	+
−	if (!newDirs[key]) {	+
−	// no longer present, unbind	+
−	callHook$1(oldDirs[key], 'unbind', oldVnode, oldVnode, isDestroy);	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	var emptyModifiers = Object.create(null);	+
−		+
−	function normalizeDirectives$1 (	+
−	dirs,	+
−	vm	+
−	) {	+
−	var res = Object.create(null);	+
−	if (!dirs) {	+
−	return res	+
−	}	+
−	var i, dir;	+
−	for (i = 0; i < dirs.length; i++) {	+
−	dir = dirs[i];	+
−	if (!dir.modifiers) {	+
−	dir.modifiers = emptyModifiers;	+
−	}	+
−	res[getRawDirName(dir)] = dir;	+
−	dir.def = resolveAsset(vm.$options, 'directives', dir.name, true);	+
−	}	+
−	return res	+
−	}	+
−		+
−	function getRawDirName (dir) {	+
−	return dir.rawName || ((dir.name) + "." + (Object.keys(dir.modifiers || {}).join('.')))	+
−	}	+
−		+
−	function callHook$1 (dir, hook, vnode, oldVnode, isDestroy) {	+
−	var fn = dir.def && dir.def[hook];	+
−	if (fn) {	+
−	fn(vnode.elm, dir, vnode, oldVnode, isDestroy);	+
−	}	+
−	}	+
−		+
−	var baseModules = [	+
−	ref,	+
−	directives	+
−	];	+
−		+
−	/*  */	+
−		+
−	function updateAttrs (oldVnode, vnode) {	+
−	if (!oldVnode.data.attrs && !vnode.data.attrs) {	+
−	return	+
−	}	+
−	var key, cur, old;	+
−	var elm = vnode.elm;	+
−	var oldAttrs = oldVnode.data.attrs || {};	+
−	var attrs = vnode.data.attrs || {};	+
−	// clone observed objects, as the user probably wants to mutate it	+
−	if (attrs.__ob__) {	+
−	attrs = vnode.data.attrs = extend({}, attrs);	+
−	}	+
−		+
−	for (key in attrs) {	+
−	cur = attrs[key];	+
−	old = oldAttrs[key];	+
−	if (old !== cur) {	+
−	setAttr(elm, key, cur);	+
−	}	+
−	}	+
−	// #4391: in IE9, setting type can reset value for input[type=radio]	+
−	/* istanbul ignore if */	+
−	if (isIE9 && attrs.value !== oldAttrs.value) {	+
−	setAttr(elm, 'value', attrs.value);	+
−	}	+
−	for (key in oldAttrs) {	+
−	if (attrs[key] == null) {	+
−	if (isXlink(key)) {	+
−	elm.removeAttributeNS(xlinkNS, getXlinkProp(key));	+
−	} else if (!isEnumeratedAttr(key)) {	+
−	elm.removeAttribute(key);	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	function setAttr (el, key, value) {	+
−	if (isBooleanAttr(key)) {	+
−	// set attribute for blank value	+
−	// e.g. <option disabled>Select one</option>	+
−	if (isFalsyAttrValue(value)) {	+
−	el.removeAttribute(key);	+
−	} else {	+
−	el.setAttribute(key, key);	+
−	}	+
−	} else if (isEnumeratedAttr(key)) {	+
−	el.setAttribute(key, isFalsyAttrValue(value) || value === 'false' ? 'false' : 'true');	+
−	} else if (isXlink(key)) {	+
−	if (isFalsyAttrValue(value)) {	+
−	el.removeAttributeNS(xlinkNS, getXlinkProp(key));	+
−	} else {	+
−	el.setAttributeNS(xlinkNS, key, value);	+
−	}	+
−	} else {	+
−	if (isFalsyAttrValue(value)) {	+
−	el.removeAttribute(key);	+
−	} else {	+
−	el.setAttribute(key, value);	+
−	}	+
−	}	+
−	}	+
−		+
−	var attrs = {	+
−	create: updateAttrs,	+
−	update: updateAttrs	+
−	};	+
−		+
−	/*  */	+
−		+
−	function updateClass (oldVnode, vnode) {	+
−	var el = vnode.elm;	+
−	var data = vnode.data;	+
−	var oldData = oldVnode.data;	+
−	if (!data.staticClass && !data.class &&	+
−	(!oldData || (!oldData.staticClass && !oldData.class))) {	+
−	return	+
−	}	+
−		+
−	var cls = genClassForVnode(vnode);	+
−		+
−	// handle transition classes	+
−	var transitionClass = el._transitionClasses;	+
−	if (transitionClass) {	+
−	cls = concat(cls, stringifyClass(transitionClass));	+
−	}	+
−		+
−	// set the class	+
−	if (cls !== el._prevClass) {	+
−	el.setAttribute('class', cls);	+
−	el._prevClass = cls;	+
−	}	+
−	}	+
−		+
−	var klass = {	+
−	create: updateClass,	+
−	update: updateClass	+
−	};	+
−		+
−	/*  */	+
−		+
−	var target$1;	+
−		+
−	function add$2 (event, handler, once, capture) {	+
−	if (once) {	+
−	var oldHandler = handler;	+
−	handler = function (ev) {	+
−	remove$3(event, handler, capture);	+
−	arguments.length === 1	+
−	? oldHandler(ev)	+
−	: oldHandler.apply(null, arguments);	+
−	};	+
−	}	+
−	target$1.addEventListener(event, handler, capture);	+
−	}	+
−		+
−	function remove$3 (event, handler, capture) {	+
−	target$1.removeEventListener(event, handler, capture);	+
−	}	+
−		+
−	function updateDOMListeners (oldVnode, vnode) {	+
−	if (!oldVnode.data.on && !vnode.data.on) {	+
−	return	+
−	}	+
−	var on = vnode.data.on || {};	+
−	var oldOn = oldVnode.data.on || {};	+
−	target$1 = vnode.elm;	+
−	updateListeners(on, oldOn, add$2, remove$3, vnode.context);	+
−	}	+
−		+
−	var events = {	+
−	create: updateDOMListeners,	+
−	update: updateDOMListeners	+
−	};	+
−		+
−	/*  */	+
−		+
−	function updateDOMProps (oldVnode, vnode) {	+
−	if (!oldVnode.data.domProps && !vnode.data.domProps) {	+
−	return	+
−	}	+
−	var key, cur;	+
−	var elm = vnode.elm;	+
−	var oldProps = oldVnode.data.domProps || {};	+
−	var props = vnode.data.domProps || {};	+
−	// clone observed objects, as the user probably wants to mutate it	+
−	if (props.__ob__) {	+
−	props = vnode.data.domProps = extend({}, props);	+
−	}	+
−		+
−	for (key in oldProps) {	+
−	if (props[key] == null) {	+
−	elm[key] = '';	+
−	}	+
−	}	+
−	for (key in props) {	+
−	cur = props[key];	+
−	// ignore children if the node has textContent or innerHTML,	+
−	// as these will throw away existing DOM nodes and cause removal errors	+
−	// on subsequent patches (#3360)	+
−	if (key === 'textContent' || key === 'innerHTML') {	+
−	if (vnode.children) { vnode.children.length = 0; }	+
−	if (cur === oldProps[key]) { continue }	+
−	}	+
−	// #4521: if a click event triggers update before the change event is	+
−	// dispatched on a checkbox/radio input, the input's checked state will	+
−	// be reset and fail to trigger another update.	+
−	/* istanbul ignore next */	+
−	if (key === 'checked' && !isDirty(elm, cur)) {	+
−	continue	+
−	}	+
−	if (key === 'value') {	+
−	// store value as _value as well since	+
−	// non-string values will be stringified	+
−	elm._value = cur;	+
−	// avoid resetting cursor position when value is the same	+
−	var strCur = cur == null ? '' : String(cur);	+
−	if (shouldUpdateValue(elm, vnode, strCur)) {	+
−	elm.value = strCur;	+
−	}	+
−	} else {	+
−	elm[key] = cur;	+
−	}	+
−	}	+
−	}	+
−		+
−	// check platforms/web/util/attrs.js acceptValue	+
−		+
−		+
−	function shouldUpdateValue (	+
−	elm,	+
−	vnode,	+
−	checkVal	+
−	) {	+
−	if (!elm.composing && (	+
−	vnode.tag === 'option' ||	+
−	isDirty(elm, checkVal) ||	+
−	isInputChanged(vnode, checkVal)	+
−	)) {	+
−	return true	+
−	}	+
−	return false	+
−	}	+
−		+
−	function isDirty (elm, checkVal) {	+
−	return document.activeElement !== elm && elm.value !== checkVal	+
−	}	+
−		+
−	function isInputChanged (vnode, newVal) {	+
−	var value = vnode.elm.value;	+
−	var modifiers = vnode.elm._vModifiers; // injected by v-model runtime	+
−	if ((modifiers && modifiers.number) || vnode.elm.type === 'number') {	+
−	return toNumber(value) !== toNumber(newVal)	+
−	}	+
−	if (modifiers && modifiers.trim) {	+
−	return value.trim() !== newVal.trim()	+
−	}	+
−	return value !== newVal	+
−	}	+
−		+
−	var domProps = {	+
−	create: updateDOMProps,	+
−	update: updateDOMProps	+
−	};	+
−		+
−	/*  */	+
−		+
−	var parseStyleText = cached(function (cssText) {	+
−	var res = {};	+
−	var listDelimiter = /;(?![^(]*\))/g;	+
−	var propertyDelimiter = /:(.+)/;	+
−	cssText.split(listDelimiter).forEach(function (item) {	+
−	if (item) {	+
−	var tmp = item.split(propertyDelimiter);	+
−	tmp.length > 1 && (res[tmp[0].trim()] = tmp[1].trim());	+
−	}	+
−	});	+
−	return res	+
−	});	+
−		+
−	// merge static and dynamic style data on the same vnode	+
−	function normalizeStyleData (data) {	+
−	var style = normalizeStyleBinding(data.style);	+
−	// static style is pre-processed into an object during compilation	+
−	// and is always a fresh object, so it's safe to merge into it	+
−	return data.staticStyle	+
−	? extend(data.staticStyle, style)	+
−	: style	+
−	}	+
−		+
−	// normalize possible array / string values into Object	+
−	function normalizeStyleBinding (bindingStyle) {	+
−	if (Array.isArray(bindingStyle)) {	+
−	return toObject(bindingStyle)	+
−	}	+
−	if (typeof bindingStyle === 'string') {	+
−	return parseStyleText(bindingStyle)	+
−	}	+
−	return bindingStyle	+
−	}	+
−		+
−	/**	+
−	* parent component style should be after child's	+
−	* so that parent component's style could override it	+
−	*/	+
−	function getStyle (vnode, checkChild) {	+
−	var res = {};	+
−	var styleData;	+
−		+
−	if (checkChild) {	+
−	var childNode = vnode;	+
−	while (childNode.child) {	+
−	childNode = childNode.child._vnode;	+
−	if (childNode.data && (styleData = normalizeStyleData(childNode.data))) {	+
−	extend(res, styleData);	+
−	}	+
−	}	+
−	}	+
−		+
−	if ((styleData = normalizeStyleData(vnode.data))) {	+
−	extend(res, styleData);	+
−	}	+
−		+
−	var parentNode = vnode;	+
−	while ((parentNode = parentNode.parent)) {	+
−	if (parentNode.data && (styleData = normalizeStyleData(parentNode.data))) {	+
−	extend(res, styleData);	+
−	}	+
−	}	+
−	return res	+
−	}	+
−		+
−	/*  */	+
−		+
−	var cssVarRE = /^--/;	+
−	var importantRE = /\s*!important$/;	+
−	var setProp = function (el, name, val) {	+
−	/* istanbul ignore if */	+
−	if (cssVarRE.test(name)) {	+
−	el.style.setProperty(name, val);	+
−	} else if (importantRE.test(val)) {	+
−	el.style.setProperty(name, val.replace(importantRE, ''), 'important');	+
−	} else {	+
−	el.style[normalize(name)] = val;	+
−	}	+
−	};	+
−		+
−	var prefixes = ['Webkit', 'Moz', 'ms'];	+
−		+
−	var testEl;	+
−	var normalize = cached(function (prop) {	+
−	testEl = testEl || document.createElement('div');	+
−	prop = camelize(prop);	+
−	if (prop !== 'filter' && (prop in testEl.style)) {	+
−	return prop	+
−	}	+
−	var upper = prop.charAt(0).toUpperCase() + prop.slice(1);	+
−	for (var i = 0; i < prefixes.length; i++) {	+
−	var prefixed = prefixes[i] + upper;	+
−	if (prefixed in testEl.style) {	+
−	return prefixed	+
−	}	+
−	}	+
−	});	+
−		+
−	function updateStyle (oldVnode, vnode) {	+
−	var data = vnode.data;	+
−	var oldData = oldVnode.data;	+
−		+
−	if (!data.staticStyle && !data.style &&	+
−	!oldData.staticStyle && !oldData.style) {	+
−	return	+
−	}	+
−		+
−	var cur, name;	+
−	var el = vnode.elm;	+
−	var oldStaticStyle = oldVnode.data.staticStyle;	+
−	var oldStyleBinding = oldVnode.data.style || {};	+
−		+
−	// if static style exists, stylebinding already merged into it when doing normalizeStyleData	+
−	var oldStyle = oldStaticStyle || oldStyleBinding;	+
−		+
−	var style = normalizeStyleBinding(vnode.data.style) || {};	+
−		+
−	vnode.data.style = style.__ob__ ? extend({}, style) : style;	+
−		+
−	var newStyle = getStyle(vnode, true);	+
−		+
−	for (name in oldStyle) {	+
−	if (newStyle[name] == null) {	+
−	setProp(el, name, '');	+
−	}	+
−	}	+
−	for (name in newStyle) {	+
−	cur = newStyle[name];	+
−	if (cur !== oldStyle[name]) {	+
−	// ie9 setting to null has no effect, must use empty string	+
−	setProp(el, name, cur == null ? '' : cur);	+
−	}	+
−	}	+
−	}	+
−		+
−	var style = {	+
−	create: updateStyle,	+
−	update: updateStyle	+
−	};	+
−		+
−	/*  */	+
−		+
−	/**	+
−	* Add class with compatibility for SVG since classList is not supported on	+
−	* SVG elements in IE	+
−	*/	+
−	function addClass (el, cls) {	+
−	/* istanbul ignore if */	+
−	if (!cls || !cls.trim()) {	+
−	return	+
−	}	+
−		+
−	/* istanbul ignore else */	+
−	if (el.classList) {	+
−	if (cls.indexOf(' ') > -1) {	+
−	cls.split(/\s+/).forEach(function (c) { return el.classList.add(c); });	+
−	} else {	+
−	el.classList.add(cls);	+
−	}	+
−	} else {	+
−	var cur = ' ' + el.getAttribute('class') + ' ';	+
−	if (cur.indexOf(' ' + cls + ' ') < 0) {	+
−	el.setAttribute('class', (cur + cls).trim());	+
−	}	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Remove class with compatibility for SVG since classList is not supported on	+
−	* SVG elements in IE	+
−	*/	+
−	function removeClass (el, cls) {	+
−	/* istanbul ignore if */	+
−	if (!cls || !cls.trim()) {	+
−	return	+
−	}	+
−		+
−	/* istanbul ignore else */	+
−	if (el.classList) {	+
−	if (cls.indexOf(' ') > -1) {	+
−	cls.split(/\s+/).forEach(function (c) { return el.classList.remove(c); });	+
−	} else {	+
−	el.classList.remove(cls);	+
−	}	+
−	} else {	+
−	var cur = ' ' + el.getAttribute('class') + ' ';	+
−	var tar = ' ' + cls + ' ';	+
−	while (cur.indexOf(tar) >= 0) {	+
−	cur = cur.replace(tar, ' ');	+
−	}	+
−	el.setAttribute('class', cur.trim());	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var hasTransition = inBrowser && !isIE9;	+
−	var TRANSITION = 'transition';	+
−	var ANIMATION = 'animation';	+
−		+
−	// Transition property/event sniffing	+
−	var transitionProp = 'transition';	+
−	var transitionEndEvent = 'transitionend';	+
−	var animationProp = 'animation';	+
−	var animationEndEvent = 'animationend';	+
−	if (hasTransition) {	+
−	/* istanbul ignore if */	+
−	if (window.ontransitionend === undefined &&	+
−	window.onwebkittransitionend !== undefined) {	+
−	transitionProp = 'WebkitTransition';	+
−	transitionEndEvent = 'webkitTransitionEnd';	+
−	}	+
−	if (window.onanimationend === undefined &&	+
−	window.onwebkitanimationend !== undefined) {	+
−	animationProp = 'WebkitAnimation';	+
−	animationEndEvent = 'webkitAnimationEnd';	+
−	}	+
−	}	+
−		+
−	var raf = (inBrowser && window.requestAnimationFrame) || setTimeout;	+
−	function nextFrame (fn) {	+
−	raf(function () {	+
−	raf(fn);	+
−	});	+
−	}	+
−		+
−	function addTransitionClass (el, cls) {	+
−	(el._transitionClasses || (el._transitionClasses = [])).push(cls);	+
−	addClass(el, cls);	+
−	}	+
−		+
−	function removeTransitionClass (el, cls) {	+
−	if (el._transitionClasses) {	+
−	remove$1(el._transitionClasses, cls);	+
−	}	+
−	removeClass(el, cls);	+
−	}	+
−		+
−	function whenTransitionEnds (	+
−	el,	+
−	expectedType,	+
−	cb	+
−	) {	+
−	var ref = getTransitionInfo(el, expectedType);	+
−	var type = ref.type;	+
−	var timeout = ref.timeout;	+
−	var propCount = ref.propCount;	+
−	if (!type) { return cb() }	+
−	var event = type === TRANSITION ? transitionEndEvent : animationEndEvent;	+
−	var ended = 0;	+
−	var end = function () {	+
−	el.removeEventListener(event, onEnd);	+
−	cb();	+
−	};	+
−	var onEnd = function (e) {	+
−	if (e.target === el) {	+
−	if (++ended >= propCount) {	+
−	end();	+
−	}	+
−	}	+
−	};	+
−	setTimeout(function () {	+
−	if (ended < propCount) {	+
−	end();	+
−	}	+
−	}, timeout + 1);	+
−	el.addEventListener(event, onEnd);	+
−	}	+
−		+
−	var transformRE = /\b(transform|all)(,|$)/;	+
−		+
−	function getTransitionInfo (el, expectedType) {	+
−	var styles = window.getComputedStyle(el);	+
−	var transitioneDelays = styles[transitionProp + 'Delay'].split(', ');	+
−	var transitionDurations = styles[transitionProp + 'Duration'].split(', ');	+
−	var transitionTimeout = getTimeout(transitioneDelays, transitionDurations);	+
−	var animationDelays = styles[animationProp + 'Delay'].split(', ');	+
−	var animationDurations = styles[animationProp + 'Duration'].split(', ');	+
−	var animationTimeout = getTimeout(animationDelays, animationDurations);	+
−		+
−	var type;	+
−	var timeout = 0;	+
−	var propCount = 0;	+
−	/* istanbul ignore if */	+
−	if (expectedType === TRANSITION) {	+
−	if (transitionTimeout > 0) {	+
−	type = TRANSITION;	+
−	timeout = transitionTimeout;	+
−	propCount = transitionDurations.length;	+
−	}	+
−	} else if (expectedType === ANIMATION) {	+
−	if (animationTimeout > 0) {	+
−	type = ANIMATION;	+
−	timeout = animationTimeout;	+
−	propCount = animationDurations.length;	+
−	}	+
−	} else {	+
−	timeout = Math.max(transitionTimeout, animationTimeout);	+
−	type = timeout > 0	+
−	? transitionTimeout > animationTimeout	+
−	? TRANSITION	+
−	: ANIMATION	+
−	: null;	+
−	propCount = type	+
−	? type === TRANSITION	+
−	? transitionDurations.length	+
−	: animationDurations.length	+
−	: 0;	+
−	}	+
−	var hasTransform =	+
−	type === TRANSITION &&	+
−	transformRE.test(styles[transitionProp + 'Property']);	+
−	return {	+
−	type: type,	+
−	timeout: timeout,	+
−	propCount: propCount,	+
−	hasTransform: hasTransform	+
−	}	+
−	}	+
−		+
−	function getTimeout (delays, durations) {	+
−	/* istanbul ignore next */	+
−	while (delays.length < durations.length) {	+
−	delays = delays.concat(delays);	+
−	}	+
−		+
−	return Math.max.apply(null, durations.map(function (d, i) {	+
−	return toMs(d) + toMs(delays[i])	+
−	}))	+
−	}	+
−		+
−	function toMs (s) {	+
−	return Number(s.slice(0, -1)) * 1000	+
−	}	+
−		+
−	/*  */	+
−		+
−	function enter (vnode, toggleDisplay) {	+
−	var el = vnode.elm;	+
−		+
−	// call leave callback now	+
−	if (el._leaveCb) {	+
−	el._leaveCb.cancelled = true;	+
−	el._leaveCb();	+
−	}	+
−		+
−	var data = resolveTransition(vnode.data.transition);	+
−	if (!data) {	+
−	return	+
−	}	+
−		+
−	/* istanbul ignore if */	+
−	if (el._enterCb || el.nodeType !== 1) {	+
−	return	+
−	}	+
−		+
−	var css = data.css;	+
−	var type = data.type;	+
−	var enterClass = data.enterClass;	+
−	var enterToClass = data.enterToClass;	+
−	var enterActiveClass = data.enterActiveClass;	+
−	var appearClass = data.appearClass;	+
−	var appearToClass = data.appearToClass;	+
−	var appearActiveClass = data.appearActiveClass;	+
−	var beforeEnter = data.beforeEnter;	+
−	var enter = data.enter;	+
−	var afterEnter = data.afterEnter;	+
−	var enterCancelled = data.enterCancelled;	+
−	var beforeAppear = data.beforeAppear;	+
−	var appear = data.appear;	+
−	var afterAppear = data.afterAppear;	+
−	var appearCancelled = data.appearCancelled;	+
−		+
−	// activeInstance will always be the <transition> component managing this	+
−	// transition. One edge case to check is when the <transition> is placed	+
−	// as the root node of a child component. In that case we need to check	+
−	// <transition>'s parent for appear check.	+
−	var context = activeInstance;	+
−	var transitionNode = activeInstance.$vnode;	+
−	while (transitionNode && transitionNode.parent) {	+
−	transitionNode = transitionNode.parent;	+
−	context = transitionNode.context;	+
−	}	+
−		+
−	var isAppear = !context._isMounted || !vnode.isRootInsert;	+
−		+
−	if (isAppear && !appear && appear !== '') {	+
−	return	+
−	}	+
−		+
−	var startClass = isAppear ? appearClass : enterClass;	+
−	var activeClass = isAppear ? appearActiveClass : enterActiveClass;	+
−	var toClass = isAppear ? appearToClass : enterToClass;	+
−	var beforeEnterHook = isAppear ? (beforeAppear || beforeEnter) : beforeEnter;	+
−	var enterHook = isAppear ? (typeof appear === 'function' ? appear : enter) : enter;	+
−	var afterEnterHook = isAppear ? (afterAppear || afterEnter) : afterEnter;	+
−	var enterCancelledHook = isAppear ? (appearCancelled || enterCancelled) : enterCancelled;	+
−		+
−	var expectsCSS = css !== false && !isIE9;	+
−	var userWantsControl =	+
−	enterHook &&	+
−	// enterHook may be a bound method which exposes	+
−	// the length of original fn as _length	+
−	(enterHook._length || enterHook.length) > 1;	+
−		+
−	var cb = el._enterCb = once(function () {	+
−	if (expectsCSS) {	+
−	removeTransitionClass(el, toClass);	+
−	removeTransitionClass(el, activeClass);	+
−	}	+
−	if (cb.cancelled) {	+
−	if (expectsCSS) {	+
−	removeTransitionClass(el, startClass);	+
−	}	+
−	enterCancelledHook && enterCancelledHook(el);	+
−	} else {	+
−	afterEnterHook && afterEnterHook(el);	+
−	}	+
−	el._enterCb = null;	+
−	});	+
−		+
−	if (!vnode.data.show) {	+
−	// remove pending leave element on enter by injecting an insert hook	+
−	mergeVNodeHook(vnode.data.hook || (vnode.data.hook = {}), 'insert', function () {	+
−	var parent = el.parentNode;	+
−	var pendingNode = parent && parent._pending && parent._pending[vnode.key];	+
−	if (pendingNode &&	+
−	pendingNode.context === vnode.context &&	+
−	pendingNode.tag === vnode.tag &&	+
−	pendingNode.elm._leaveCb) {	+
−	pendingNode.elm._leaveCb();	+
−	}	+
−	enterHook && enterHook(el, cb);	+
−	}, 'transition-insert');	+
−	}	+
−		+
−	// start enter transition	+
−	beforeEnterHook && beforeEnterHook(el);	+
−	if (expectsCSS) {	+
−	addTransitionClass(el, startClass);	+
−	addTransitionClass(el, activeClass);	+
−	nextFrame(function () {	+
−	addTransitionClass(el, toClass);	+
−	removeTransitionClass(el, startClass);	+
−	if (!cb.cancelled && !userWantsControl) {	+
−	whenTransitionEnds(el, type, cb);	+
−	}	+
−	});	+
−	}	+
−		+
−	if (vnode.data.show) {	+
−	toggleDisplay && toggleDisplay();	+
−	enterHook && enterHook(el, cb);	+
−	}	+
−		+
−	if (!expectsCSS && !userWantsControl) {	+
−	cb();	+
−	}	+
−	}	+
−		+
−	function leave (vnode, rm) {	+
−	var el = vnode.elm;	+
−		+
−	// call enter callback now	+
−	if (el._enterCb) {	+
−	el._enterCb.cancelled = true;	+
−	el._enterCb();	+
−	}	+
−		+
−	var data = resolveTransition(vnode.data.transition);	+
−	if (!data) {	+
−	return rm()	+
−	}	+
−		+
−	/* istanbul ignore if */	+
−	if (el._leaveCb || el.nodeType !== 1) {	+
−	return	+
−	}	+
−		+
−	var css = data.css;	+
−	var type = data.type;	+
−	var leaveClass = data.leaveClass;	+
−	var leaveToClass = data.leaveToClass;	+
−	var leaveActiveClass = data.leaveActiveClass;	+
−	var beforeLeave = data.beforeLeave;	+
−	var leave = data.leave;	+
−	var afterLeave = data.afterLeave;	+
−	var leaveCancelled = data.leaveCancelled;	+
−	var delayLeave = data.delayLeave;	+
−		+
−	var expectsCSS = css !== false && !isIE9;	+
−	var userWantsControl =	+
−	leave &&	+
−	// leave hook may be a bound method which exposes	+
−	// the length of original fn as _length	+
−	(leave._length || leave.length) > 1;	+
−		+
−	var cb = el._leaveCb = once(function () {	+
−	if (el.parentNode && el.parentNode._pending) {	+
−	el.parentNode._pending[vnode.key] = null;	+
−	}	+
−	if (expectsCSS) {	+
−	removeTransitionClass(el, leaveToClass);	+
−	removeTransitionClass(el, leaveActiveClass);	+
−	}	+
−	if (cb.cancelled) {	+
−	if (expectsCSS) {	+
−	removeTransitionClass(el, leaveClass);	+
−	}	+
−	leaveCancelled && leaveCancelled(el);	+
−	} else {	+
−	rm();	+
−	afterLeave && afterLeave(el);	+
−	}	+
−	el._leaveCb = null;	+
−	});	+
−		+
−	if (delayLeave) {	+
−	delayLeave(performLeave);	+
−	} else {	+
−	performLeave();	+
−	}	+
−		+
−	function performLeave () {	+
−	// the delayed leave may have already been cancelled	+
−	if (cb.cancelled) {	+
−	return	+
−	}	+
−	// record leaving element	+
−	if (!vnode.data.show) {	+
−	(el.parentNode._pending || (el.parentNode._pending = {}))[vnode.key] = vnode;	+
−	}	+
−	beforeLeave && beforeLeave(el);	+
−	if (expectsCSS) {	+
−	addTransitionClass(el, leaveClass);	+
−	addTransitionClass(el, leaveActiveClass);	+
−	nextFrame(function () {	+
−	addTransitionClass(el, leaveToClass);	+
−	removeTransitionClass(el, leaveClass);	+
−	if (!cb.cancelled && !userWantsControl) {	+
−	whenTransitionEnds(el, type, cb);	+
−	}	+
−	});	+
−	}	+
−	leave && leave(el, cb);	+
−	if (!expectsCSS && !userWantsControl) {	+
−	cb();	+
−	}	+
−	}	+
−	}	+
−		+
−	function resolveTransition (def$$1) {	+
−	if (!def$$1) {	+
−	return	+
−	}	+
−	/* istanbul ignore else */	+
−	if (typeof def$$1 === 'object') {	+
−	var res = {};	+
−	if (def$$1.css !== false) {	+
−	extend(res, autoCssTransition(def$$1.name || 'v'));	+
−	}	+
−	extend(res, def$$1);	+
−	return res	+
−	} else if (typeof def$$1 === 'string') {	+
−	return autoCssTransition(def$$1)	+
−	}	+
−	}	+
−		+
−	var autoCssTransition = cached(function (name) {	+
−	return {	+
−	enterClass: (name + "-enter"),	+
−	leaveClass: (name + "-leave"),	+
−	appearClass: (name + "-enter"),	+
−	enterToClass: (name + "-enter-to"),	+
−	leaveToClass: (name + "-leave-to"),	+
−	appearToClass: (name + "-enter-to"),	+
−	enterActiveClass: (name + "-enter-active"),	+
−	leaveActiveClass: (name + "-leave-active"),	+
−	appearActiveClass: (name + "-enter-active")	+
−	}	+
−	});	+
−		+
−	function once (fn) {	+
−	var called = false;	+
−	return function () {	+
−	if (!called) {	+
−	called = true;	+
−	fn();	+
−	}	+
−	}	+
−	}	+
−		+
−	function _enter (_, vnode) {	+
−	if (!vnode.data.show) {	+
−	enter(vnode);	+
−	}	+
−	}	+
−		+
−	var transition = inBrowser ? {	+
−	create: _enter,	+
−	activate: _enter,	+
−	remove: function remove (vnode, rm) {	+
−	/* istanbul ignore else */	+
−	if (!vnode.data.show) {	+
−	leave(vnode, rm);	+
−	} else {	+
−	rm();	+
−	}	+
−	}	+
−	} : {};	+
−		+
−	var platformModules = [	+
−	attrs,	+
−	klass,	+
−	events,	+
−	domProps,	+
−	style,	+
−	transition	+
−	];	+
−		+
−	/*  */	+
−		+
−	// the directive module should be applied last, after all	+
−	// built-in modules have been applied.	+
−	var modules = platformModules.concat(baseModules);	+
−		+
−	var patch$1 = createPatchFunction({ nodeOps: nodeOps, modules: modules });	+
−		+
−	/**	+
−	* Not type checking this file because flow doesn't like attaching	+
−	* properties to Elements.	+
−	*/	+
−		+
−	var modelableTagRE = /^input|select|textarea|vue-component-[0-9]+(-[0-9a-zA-Z_-]*)?$/;	+
−		+
−	/* istanbul ignore if */	+
−	if (isIE9) {	+
−	// http://www.matts411.com/post/internet-explorer-9-oninput/	+
−	document.addEventListener('selectionchange', function () {	+
−	var el = document.activeElement;	+
−	if (el && el.vmodel) {	+
−	trigger(el, 'input');	+
−	}	+
−	});	+
−	}	+
−		+
−	var model = {	+
−	inserted: function inserted (el, binding, vnode) {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (!modelableTagRE.test(vnode.tag)) {	+
−	warn(	+
−	"v-model is not supported on element type: <" + (vnode.tag) + ">. " +	+
−	'If you are working with contenteditable, it\'s recommended to ' +	+
−	'wrap a library dedicated for that purpose inside a custom component.',	+
−	vnode.context	+
−	);	+
−	}	+
−	}	+
−	if (vnode.tag === 'select') {	+
−	var cb = function () {	+
−	setSelected(el, binding, vnode.context);	+
−	};	+
−	cb();	+
−	/* istanbul ignore if */	+
−	if (isIE || isEdge) {	+
−	setTimeout(cb, 0);	+
−	}	+
−	} else if (vnode.tag === 'textarea' || el.type === 'text') {	+
−	el._vModifiers = binding.modifiers;	+
−	if (!binding.modifiers.lazy) {	+
−	if (!isAndroid) {	+
−	el.addEventListener('compositionstart', onCompositionStart);	+
−	el.addEventListener('compositionend', onCompositionEnd);	+
−	}	+
−	/* istanbul ignore if */	+
−	if (isIE9) {	+
−	el.vmodel = true;	+
−	}	+
−	}	+
−	}	+
−	},	+
−	componentUpdated: function componentUpdated (el, binding, vnode) {	+
−	if (vnode.tag === 'select') {	+
−	setSelected(el, binding, vnode.context);	+
−	// in case the options rendered by v-for have changed,	+
−	// it's possible that the value is out-of-sync with the rendered options.	+
−	// detect such cases and filter out values that no longer has a matching	+
−	// option in the DOM.	+
−	var needReset = el.multiple	+
−	? binding.value.some(function (v) { return hasNoMatchingOption(v, el.options); })	+
−	: binding.value !== binding.oldValue && hasNoMatchingOption(binding.value, el.options);	+
−	if (needReset) {	+
−	trigger(el, 'change');	+
−	}	+
−	}	+
−	}	+
−	};	+
−		+
−	function setSelected (el, binding, vm) {	+
−	var value = binding.value;	+
−	var isMultiple = el.multiple;	+
−	if (isMultiple && !Array.isArray(value)) {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	"<select multiple v-model=\"" + (binding.expression) + "\"> " +	+
−	"expects an Array value for its binding, but got " + (Object.prototype.toString.call(value).slice(8, -1)),	+
−	vm	+
−	);	+
−	return	+
−	}	+
−	var selected, option;	+
−	for (var i = 0, l = el.options.length; i < l; i++) {	+
−	option = el.options[i];	+
−	if (isMultiple) {	+
−	selected = looseIndexOf(value, getValue(option)) > -1;	+
−	if (option.selected !== selected) {	+
−	option.selected = selected;	+
−	}	+
−	} else {	+
−	if (looseEqual(getValue(option), value)) {	+
−	if (el.selectedIndex !== i) {	+
−	el.selectedIndex = i;	+
−	}	+
−	return	+
−	}	+
−	}	+
−	}	+
−	if (!isMultiple) {	+
−	el.selectedIndex = -1;	+
−	}	+
−	}	+
−		+
−	function hasNoMatchingOption (value, options) {	+
−	for (var i = 0, l = options.length; i < l; i++) {	+
−	if (looseEqual(getValue(options[i]), value)) {	+
−	return false	+
−	}	+
−	}	+
−	return true	+
−	}	+
−		+
−	function getValue (option) {	+
−	return '_value' in option	+
−	? option._value	+
−	: option.value	+
−	}	+
−		+
−	function onCompositionStart (e) {	+
−	e.target.composing = true;	+
−	}	+
−		+
−	function onCompositionEnd (e) {	+
−	e.target.composing = false;	+
−	trigger(e.target, 'input');	+
−	}	+
−		+
−	function trigger (el, type) {	+
−	var e = document.createEvent('HTMLEvents');	+
−	e.initEvent(type, true, true);	+
−	el.dispatchEvent(e);	+
−	}	+
−		+
−	/*  */	+
−		+
−	// recursively search for possible transition defined inside the component root	+
−	function locateNode (vnode) {	+
−	return vnode.child && (!vnode.data || !vnode.data.transition)	+
−	? locateNode(vnode.child._vnode)	+
−	: vnode	+
−	}	+
−		+
−	var show = {	+
−	bind: function bind (el, ref, vnode) {	+
−	var value = ref.value;	+
−		+
−	vnode = locateNode(vnode);	+
−	var transition = vnode.data && vnode.data.transition;	+
−	var originalDisplay = el.__vOriginalDisplay =	+
−	el.style.display === 'none' ? '' : el.style.display;	+
−	if (value && transition && !isIE9) {	+
−	vnode.data.show = true;	+
−	enter(vnode, function () {	+
−	el.style.display = originalDisplay;	+
−	});	+
−	} else {	+
−	el.style.display = value ? originalDisplay : 'none';	+
−	}	+
−	},	+
−		+
−	update: function update (el, ref, vnode) {	+
−	var value = ref.value;	+
−	var oldValue = ref.oldValue;	+
−		+
−	/* istanbul ignore if */	+
−	if (value === oldValue) { return }	+
−	vnode = locateNode(vnode);	+
−	var transition = vnode.data && vnode.data.transition;	+
−	if (transition && !isIE9) {	+
−	vnode.data.show = true;	+
−	if (value) {	+
−	enter(vnode, function () {	+
−	el.style.display = el.__vOriginalDisplay;	+
−	});	+
−	} else {	+
−	leave(vnode, function () {	+
−	el.style.display = 'none';	+
−	});	+
−	}	+
−	} else {	+
−	el.style.display = value ? el.__vOriginalDisplay : 'none';	+
−	}	+
−	},	+
−		+
−	unbind: function unbind (	+
−	el,	+
−	binding,	+
−	vnode,	+
−	oldVnode,	+
−	isDestroy	+
−	) {	+
−	if (!isDestroy) {	+
−	el.style.display = el.__vOriginalDisplay;	+
−	}	+
−	}	+
−	};	+
−		+
−	var platformDirectives = {	+
−	model: model,	+
−	show: show	+
−	};	+
−		+
−	/*  */	+
−		+
−	// Provides transition support for a single element/component.	+
−	// supports transition mode (out-in / in-out)	+
−		+
−	var transitionProps = {	+
−	name: String,	+
−	appear: Boolean,	+
−	css: Boolean,	+
−	mode: String,	+
−	type: String,	+
−	enterClass: String,	+
−	leaveClass: String,	+
−	enterToClass: String,	+
−	leaveToClass: String,	+
−	enterActiveClass: String,	+
−	leaveActiveClass: String,	+
−	appearClass: String,	+
−	appearActiveClass: String,	+
−	appearToClass: String	+
−	};	+
−		+
−	// in case the child is also an abstract component, e.g. <keep-alive>	+
−	// we want to recursively retrieve the real component to be rendered	+
−	function getRealChild (vnode) {	+
−	var compOptions = vnode && vnode.componentOptions;	+
−	if (compOptions && compOptions.Ctor.options.abstract) {	+
−	return getRealChild(getFirstComponentChild(compOptions.children))	+
−	} else {	+
−	return vnode	+
−	}	+
−	}	+
−		+
−	function extractTransitionData (comp) {	+
−	var data = {};	+
−	var options = comp.$options;	+
−	// props	+
−	for (var key in options.propsData) {	+
−	data[key] = comp[key];	+
−	}	+
−	// events.	+
−	// extract listeners and pass them directly to the transition methods	+
−	var listeners = options._parentListeners;	+
−	for (var key$1 in listeners) {	+
−	data[camelize(key$1)] = listeners[key$1].fn;	+
−	}	+
−	return data	+
−	}	+
−		+
−	function placeholder (h, rawChild) {	+
−	return /\d-keep-alive$/.test(rawChild.tag)	+
−	? h('keep-alive')	+
−	: null	+
−	}	+
−		+
−	function hasParentTransition (vnode) {	+
−	while ((vnode = vnode.parent)) {	+
−	if (vnode.data.transition) {	+
−	return true	+
−	}	+
−	}	+
−	}	+
−		+
−	function isSameChild (child, oldChild) {	+
−	return oldChild.key === child.key && oldChild.tag === child.tag	+
−	}	+
−		+
−	var Transition = {	+
−	name: 'transition',	+
−	props: transitionProps,	+
−	abstract: true,	+
−	render: function render (h) {	+
−	var this$1 = this;	+
−		+
−	var children = this.$slots.default;	+
−	if (!children) {	+
−	return	+
−	}	+
−		+
−	// filter out text nodes (possible whitespaces)	+
−	children = children.filter(function (c) { return c.tag; });	+
−	/* istanbul ignore if */	+
−	if (!children.length) {	+
−	return	+
−	}	+
−		+
−	// warn multiple elements	+
−	if (process.env.NODE_ENV !== 'production' && children.length > 1) {	+
−	warn(	+
−	'<transition> can only be used on a single element. Use ' +	+
−	'<transition-group> for lists.',	+
−	this.$parent	+
−	);	+
−	}	+
−		+
−	var mode = this.mode;	+
−		+
−	// warn invalid mode	+
−	if (process.env.NODE_ENV !== 'production' &&	+
−	mode && mode !== 'in-out' && mode !== 'out-in') {	+
−	warn(	+
−	'invalid <transition> mode: ' + mode,	+
−	this.$parent	+
−	);	+
−	}	+
−		+
−	var rawChild = children[0];	+
−		+
−	// if this is a component root node and the component's	+
−	// parent container node also has transition, skip.	+
−	if (hasParentTransition(this.$vnode)) {	+
−	return rawChild	+
−	}	+
−		+
−	// apply transition data to child	+
−	// use getRealChild() to ignore abstract components e.g. keep-alive	+
−	var child = getRealChild(rawChild);	+
−	/* istanbul ignore if */	+
−	if (!child) {	+
−	return rawChild	+
−	}	+
−		+
−	if (this._leaving) {	+
−	return placeholder(h, rawChild)	+
−	}	+
−		+
−	var key = child.key = child.key == null || child.isStatic	+
−	? ("__v" + (child.tag + this._uid) + "__")	+
−	: child.key;	+
−	var data = (child.data || (child.data = {})).transition = extractTransitionData(this);	+
−	var oldRawChild = this._vnode;	+
−	var oldChild = getRealChild(oldRawChild);	+
−		+
−	// mark v-show	+
−	// so that the transition module can hand over the control to the directive	+
−	if (child.data.directives && child.data.directives.some(function (d) { return d.name === 'show'; })) {	+
−	child.data.show = true;	+
−	}	+
−		+
−	if (oldChild && oldChild.data && !isSameChild(child, oldChild)) {	+
−	// replace old child transition data with fresh one	+
−	// important for dynamic transitions!	+
−	var oldData = oldChild && (oldChild.data.transition = extend({}, data));	+
−	// handle transition mode	+
−	if (mode === 'out-in') {	+
−	// return placeholder node and queue update when leave finishes	+
−	this._leaving = true;	+
−	mergeVNodeHook(oldData, 'afterLeave', function () {	+
−	this$1._leaving = false;	+
−	this$1.$forceUpdate();	+
−	}, key);	+
−	return placeholder(h, rawChild)	+
−	} else if (mode === 'in-out') {	+
−	var delayedLeave;	+
−	var performLeave = function () { delayedLeave(); };	+
−	mergeVNodeHook(data, 'afterEnter', performLeave, key);	+
−	mergeVNodeHook(data, 'enterCancelled', performLeave, key);	+
−	mergeVNodeHook(oldData, 'delayLeave', function (leave) {	+
−	delayedLeave = leave;	+
−	}, key);	+
−	}	+
−	}	+
−		+
−	return rawChild	+
−	}	+
−	};	+
−		+
−	/*  */	+
−		+
−	// Provides transition support for list items.	+
−	// supports move transitions using the FLIP technique.	+
−		+
−	// Because the vdom's children update algorithm is "unstable" - i.e.	+
−	// it doesn't guarantee the relative positioning of removed elements,	+
−	// we force transition-group to update its children into two passes:	+
−	// in the first pass, we remove all nodes that need to be removed,	+
−	// triggering their leaving transition; in the second pass, we insert/move	+
−	// into the final disired state. This way in the second pass removed	+
−	// nodes will remain where they should be.	+
−		+
−	var props = extend({	+
−	tag: String,	+
−	moveClass: String	+
−	}, transitionProps);	+
−		+
−	delete props.mode;	+
−		+
−	var TransitionGroup = {	+
−	props: props,	+
−		+
−	render: function render (h) {	+
−	var tag = this.tag || this.$vnode.data.tag || 'span';	+
−	var map = Object.create(null);	+
−	var prevChildren = this.prevChildren = this.children;	+
−	var rawChildren = this.$slots.default || [];	+
−	var children = this.children = [];	+
−	var transitionData = extractTransitionData(this);	+
−		+
−	for (var i = 0; i < rawChildren.length; i++) {	+
−	var c = rawChildren[i];	+
−	if (c.tag) {	+
−	if (c.key != null && String(c.key).indexOf('__vlist') !== 0) {	+
−	children.push(c);	+
−	map[c.key] = c	+
−	;(c.data || (c.data = {})).transition = transitionData;	+
−	} else if (process.env.NODE_ENV !== 'production') {	+
−	var opts = c.componentOptions;	+
−	var name = opts	+
−	? (opts.Ctor.options.name || opts.tag)	+
−	: c.tag;	+
−	warn(("<transition-group> children must be keyed: <" + name + ">"));	+
−	}	+
−	}	+
−	}	+
−		+
−	if (prevChildren) {	+
−	var kept = [];	+
−	var removed = [];	+
−	for (var i$1 = 0; i$1 < prevChildren.length; i$1++) {	+
−	var c$1 = prevChildren[i$1];	+
−	c$1.data.transition = transitionData;	+
−	c$1.data.pos = c$1.elm.getBoundingClientRect();	+
−	if (map[c$1.key]) {	+
−	kept.push(c$1);	+
−	} else {	+
−	removed.push(c$1);	+
−	}	+
−	}	+
−	this.kept = h(tag, null, kept);	+
−	this.removed = removed;	+
−	}	+
−		+
−	return h(tag, null, children)	+
−	},	+
−		+
−	beforeUpdate: function beforeUpdate () {	+
−	// force removing pass	+
−	this.__patch__(	+
−	this._vnode,	+
−	this.kept,	+
−	false, // hydrating	+
−	true // removeOnly (!important, avoids unnecessary moves)	+
−	);	+
−	this._vnode = this.kept;	+
−	},	+
−		+
−	updated: function updated () {	+
−	var children = this.prevChildren;	+
−	var moveClass = this.moveClass || ((this.name || 'v') + '-move');	+
−	if (!children.length || !this.hasMove(children[0].elm, moveClass)) {	+
−	return	+
−	}	+
−		+
−	// we divide the work into three loops to avoid mixing DOM reads and writes	+
−	// in each iteration - which helps prevent layout thrashing.	+
−	children.forEach(callPendingCbs);	+
−	children.forEach(recordPosition);	+
−	children.forEach(applyTranslation);	+
−		+
−	// force reflow to put everything in position	+
−	var f = document.body.offsetHeight; // eslint-disable-line	+
−		+
−	children.forEach(function (c) {	+
−	if (c.data.moved) {	+
−	var el = c.elm;	+
−	var s = el.style;	+
−	addTransitionClass(el, moveClass);	+
−	s.transform = s.WebkitTransform = s.transitionDuration = '';	+
−	el.addEventListener(transitionEndEvent, el._moveCb = function cb (e) {	+
−	if (!e || /transform$/.test(e.propertyName)) {	+
−	el.removeEventListener(transitionEndEvent, cb);	+
−	el._moveCb = null;	+
−	removeTransitionClass(el, moveClass);	+
−	}	+
−	});	+
−	}	+
−	});	+
−	},	+
−		+
−	methods: {	+
−	hasMove: function hasMove (el, moveClass) {	+
−	/* istanbul ignore if */	+
−	if (!hasTransition) {	+
−	return false	+
−	}	+
−	if (this._hasMove != null) {	+
−	return this._hasMove	+
−	}	+
−	addTransitionClass(el, moveClass);	+
−	var info = getTransitionInfo(el);	+
−	removeTransitionClass(el, moveClass);	+
−	return (this._hasMove = info.hasTransform)	+
−	}	+
−	}	+
−	};	+
−		+
−	function callPendingCbs (c) {	+
−	/* istanbul ignore if */	+
−	if (c.elm._moveCb) {	+
−	c.elm._moveCb();	+
−	}	+
−	/* istanbul ignore if */	+
−	if (c.elm._enterCb) {	+
−	c.elm._enterCb();	+
−	}	+
−	}	+
−		+
−	function recordPosition (c) {	+
−	c.data.newPos = c.elm.getBoundingClientRect();	+
−	}	+
−		+
−	function applyTranslation (c) {	+
−	var oldPos = c.data.pos;	+
−	var newPos = c.data.newPos;	+
−	var dx = oldPos.left - newPos.left;	+
−	var dy = oldPos.top - newPos.top;	+
−	if (dx || dy) {	+
−	c.data.moved = true;	+
−	var s = c.elm.style;	+
−	s.transform = s.WebkitTransform = "translate(" + dx + "px," + dy + "px)";	+
−	s.transitionDuration = '0s';	+
−	}	+
−	}	+
−		+
−	var platformComponents = {	+
−	Transition: Transition,	+
−	TransitionGroup: TransitionGroup	+
−	};	+
−		+
−	/*  */	+
−		+
−	// install platform specific utils	+
−	Vue$2.config.isUnknownElement = isUnknownElement;	+
−	Vue$2.config.isReservedTag = isReservedTag;	+
−	Vue$2.config.getTagNamespace = getTagNamespace;	+
−	Vue$2.config.mustUseProp = mustUseProp;	+
−		+
−	// install platform runtime directives & components	+
−	extend(Vue$2.options.directives, platformDirectives);	+
−	extend(Vue$2.options.components, platformComponents);	+
−		+
−	// install platform patch function	+
−	Vue$2.prototype.__patch__ = inBrowser ? patch$1 : noop;	+
−		+
−	// wrap mount	+
−	Vue$2.prototype.$mount = function (	+
−	el,	+
−	hydrating	+
−	) {	+
−	el = el && inBrowser ? query(el) : undefined;	+
−	return this._mount(el, hydrating)	+
−	};	+
−		+
−	if (process.env.NODE_ENV !== 'production' &&	+
−	inBrowser && typeof console !== 'undefined') {	+
−	console[console.info ? 'info' : 'log'](	+
−	"You are running Vue in development mode.\n" +	+
−	"Make sure to turn on production mode when deploying for production.\n" +	+
−	"See more tips at https://vuejs.org/guide/deployment.html"	+
−	);	+
−	}	+
−		+
−	// devtools global hook	+
−	/* istanbul ignore next */	+
−	setTimeout(function () {	+
−	if (config.devtools) {	+
−	if (devtools) {	+
−	devtools.emit('init', Vue$2);	+
−	} else if (	+
−	process.env.NODE_ENV !== 'production' &&	+
−	inBrowser && !isEdge && /Chrome\/\d+/.test(window.navigator.userAgent)	+
−	) {	+
−	console[console.info ? 'info' : 'log'](	+
−	'Download the Vue Devtools extension for a better development experience:\n' +	+
−	'https://github.com/vuejs/vue-devtools'	+
−	);	+
−	}	+
−	}	+
−	}, 0);	+
−		+
−	module.exports = Vue$2;	+
−		+
−	/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(3), (function() { return this; }())))	+
−		+
−	/***/ },	+
−		+
−	/***/ 3:	+
−	/***/ function(module, exports) {	+
−		+
−	// shim for using process in browser	+
−	var process = module.exports = {};	+
−		+
−	// cached from whatever global is present so that test runners that stub it	+
−	// don't break things.  But we need to wrap it in a try catch in case it is	+
−	// wrapped in strict mode code which doesn't define any globals.  It's inside a	+
−	// function because try/catches deoptimize in certain engines.	+
−		+
−	var cachedSetTimeout;	+
−	var cachedClearTimeout;	+
−		+
−	function defaultSetTimout() {	+
−	throw new Error('setTimeout has not been defined');	+
−	}	+
−	function defaultClearTimeout () {	+
−	throw new Error('clearTimeout has not been defined');	+
−	}	+
−	(function () {	+
−	try {	+
−	if (typeof setTimeout === 'function') {	+
−	cachedSetTimeout = setTimeout;	+
−	} else {	+
−	cachedSetTimeout = defaultSetTimout;	+
−	}	+
−	} catch (e) {	+
−	cachedSetTimeout = defaultSetTimout;	+
−	}	+
−	try {	+
−	if (typeof clearTimeout === 'function') {	+
−	cachedClearTimeout = clearTimeout;	+
−	} else {	+
−	cachedClearTimeout = defaultClearTimeout;	+
−	}	+
−	} catch (e) {	+
−	cachedClearTimeout = defaultClearTimeout;	+
−	}	+
−	} ())	+
−	function runTimeout(fun) {	+
−	if (cachedSetTimeout === setTimeout) {	+
−	//normal enviroments in sane situations	+
−	return setTimeout(fun, 0);	+
−	}	+
−	// if setTimeout wasn't available but was latter defined	+
−	if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {	+
−	cachedSetTimeout = setTimeout;	+
−	return setTimeout(fun, 0);	+
−	}	+
−	try {	+
−	// when when somebody has screwed with setTimeout but no I.E. maddness	+
−	return cachedSetTimeout(fun, 0);	+
−	} catch(e){	+
−	try {	+
−	// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally	+
−	return cachedSetTimeout.call(null, fun, 0);	+
−	} catch(e){	+
−	// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error	+
−	return cachedSetTimeout.call(this, fun, 0);	+
−	}	+
−	}	+
−		+
−		+
−	}	+
−	function runClearTimeout(marker) {	+
−	if (cachedClearTimeout === clearTimeout) {	+
−	//normal enviroments in sane situations	+
−	return clearTimeout(marker);	+
−	}	+
−	// if clearTimeout wasn't available but was latter defined	+
−	if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {	+
−	cachedClearTimeout = clearTimeout;	+
−	return clearTimeout(marker);	+
−	}	+
−	try {	+
−	// when when somebody has screwed with setTimeout but no I.E. maddness	+
−	return cachedClearTimeout(marker);	+
−	} catch (e){	+
−	try {	+
−	// When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally	+
−	return cachedClearTimeout.call(null, marker);	+
−	} catch (e){	+
−	// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.	+
−	// Some versions of I.E. have different rules for clearTimeout vs setTimeout	+
−	return cachedClearTimeout.call(this, marker);	+
−	}	+
−	}	+
−		+
−		+
−		+
−	}	+
−	var queue = [];	+
−	var draining = false;	+
−	var currentQueue;	+
−	var queueIndex = -1;	+
−		+
−	function cleanUpNextTick() {	+
−	if (!draining || !currentQueue) {	+
−	return;	+
−	}	+
−	draining = false;	+
−	if (currentQueue.length) {	+
−	queue = currentQueue.concat(queue);	+
−	} else {	+
−	queueIndex = -1;	+
−	}	+
−	if (queue.length) {	+
−	drainQueue();	+
−	}	+
−	}	+
−		+
−	function drainQueue() {	+
−	if (draining) {	+
−	return;	+
−	}	+
−	var timeout = runTimeout(cleanUpNextTick);	+
−	draining = true;	+
−		+
−	var len = queue.length;	+
−	while(len) {	+
−	currentQueue = queue;	+
−	queue = [];	+
−	while (++queueIndex < len) {	+
−	if (currentQueue) {	+
−	currentQueue[queueIndex].run();	+
−	}	+
−	}	+
−	queueIndex = -1;	+
−	len = queue.length;	+
−	}	+
−	currentQueue = null;	+
−	draining = false;	+
−	runClearTimeout(timeout);	+
−	}	+
−		+
−	process.nextTick = function (fun) {	+
−	var args = new Array(arguments.length - 1);	+
−	if (arguments.length > 1) {	+
−	for (var i = 1; i < arguments.length; i++) {	+
−	args[i - 1] = arguments[i];	+
−	}	+
−	}	+
−	queue.push(new Item(fun, args));	+
−	if (queue.length === 1 && !draining) {	+
−	runTimeout(drainQueue);	+
−	}	+
−	};	+
−		+
−	// v8 likes predictible objects	+
−	function Item(fun, array) {	+
−	this.fun = fun;	+
−	this.array = array;	+
−	}	+
−	Item.prototype.run = function () {	+
−	this.fun.apply(null, this.array);	+
−	};	+
−	process.title = 'browser';	+
−	process.browser = true;	+
−	process.env = {};	+
−	process.argv = [];	+
−	process.version = ''; // empty string to avoid regexp issues	+
−	process.versions = {};	+
−		+
−	function noop() {}	+
−		+
−	process.on = noop;	+
−	process.addListener = noop;	+
−	process.once = noop;	+
−	process.off = noop;	+
−	process.removeListener = noop;	+
−	process.removeAllListeners = noop;	+
−	process.emit = noop;	+
−		+
−	process.binding = function (name) {	+
−	throw new Error('process.binding is not supported');	+
−	};	+
−		+
−	process.cwd = function () { return '/' };	+
−	process.chdir = function (dir) {	+
−	throw new Error('process.chdir is not supported');	+
−	};	+
−	process.umask = function() { return 0; };	+
−		+
−		+
−	/***/ },	+
−		+
−	/***/ 4:	+
−	/***/ function(module, exports, __webpack_require__) {	+
−		+
−	/* WEBPACK VAR INJECTION */(function(process) {/**	+
	* vue-router v2.1.1		* vue-router v2.1.1
	* (c) 2016 Evan You		* (c) 2016 Evan You
	* @license MIT		* @license MIT
	*/		*/
−	'use strict';	+	"use strict";function n(t,e){if(!t)throw new Error("[vue-router] "+e)}function r(t,e){t||"undefined"!=typeof console&&console.warn("[vue-router] "+e)}function o(t,n){if(void 0===n&&(n={}),t){var o;try{o=i(t)}catch(t){"production"!==e.env.NODE_ENV&&r(!1,t.message),o={}}for(var a in n)o[a]=n[a];return o}return n}function i(t){var e={};return(t=t.trim().replace(/^(\?|#|&)/,""))?(t.split("&").forEach(function(t){var n=t.replace(/\+/g," ").split("="),r=_t(n.shift()),o=n.length>0?_t(n.join("=")):null;void 0===e[r]?e[r]=o:Array.isArray(e[r])?e[r].push(o):e[r]=[e[r],o]}),e):e}function a(t){var e=t?Object.keys(t).map(function(e){var n=t[e];if(void 0===n)return"";if(null===n)return gt(e);if(Array.isArray(n)){var r=[];return n.slice().forEach(function(t){void 0!==t&&(null===t?r.push(gt(e)):r.push(gt(e)+"="+gt(t)))}),r.join("&")}return gt(e)+"="+gt(n)}).filter(function(t){return t.length>0}).join("&"):null;return e?"?"+e:""}function s(t,e,n){var r={name:e.name||t&&t.name,meta:t&&t.meta||{},path:e.path||"/",hash:e.hash||"",query:e.query||{},params:e.params||{},fullPath:c(e),matched:t?u(t):[]};return n&&(r.redirectedFrom=c(n)),Object.freeze(r)}function u(t){for(var e=[];t;)e.unshift(t),t=t.parent;return e}function c(t){var e=t.path,n=t.query;void 0===n&&(n={});var r=t.hash;return void 0===r&&(r=""),(e||"/")+a(n)+r}function l(t,e){return e===bt?t===e:!!e&&(t.path&&e.path?t.path.replace(wt,"")===e.path.replace(wt,"")&&t.hash===e.hash&&p(t.query,e.query):!(!t.name||!e.name)&&(t.name===e.name&&t.hash===e.hash&&p(t.query,e.query)&&p(t.params,e.params)))}function p(t,e){void 0===t&&(t={}),void 0===e&&(e={});var n=Object.keys(t),r=Object.keys(e);return n.length===r.length&&n.every(function(n){return String(t[n])===String(e[n])})}function f(t,e){return 0===t.path.indexOf(e.path.replace(/\/$/,""))&&(!e.hash||t.hash===e.hash)&&d(t.query,e.query)}function d(t,e){for(var n in e)if(!(n in t))return!1;return!0}function h(t){if(!(t.metaKey||t.ctrlKey||t.shiftKey||t.defaultPrevented||0!==t.button)){var e=t.target.getAttribute("target");if(!/\b_blank\b/i.test(e))return t.preventDefault(),!0}}function v(t){if(t)for(var e,n=0;n<t.length;n++){if(e=t[n],"a"===e.tag)return e;if(e.children&&(e=v(e.children)))return e}}function m(t){if(!m.installed){m.installed=!0,mt=t,Object.defineProperty(t.prototype,"$router",{get:function(){return this.$root._router}}),Object.defineProperty(t.prototype,"$route",{get:function(){return this.$root._route}}),t.mixin({beforeCreate:function(){this.$options.router&&(this._router=this.$options.router,this._router.init(this),t.util.defineReactive(this,"_route",this._router.history.current))}}),t.component("router-view",yt),t.component("router-link",Ot);var e=t.config.optionMergeStrategies;e.beforeRouteEnter=e.beforeRouteLeave=e.created}}function y(t,e,n){if("/"===t.charAt(0))return t;if("?"===t.charAt(0)||"#"===t.charAt(0))return e+t;var r=e.split("/");n&&r[r.length-1]||r.pop();for(var o=t.replace(/^\//,"").split("/"),i=0;i<o.length;i++){var a=o[i];"."!==a&&(".."===a?r.pop():r.push(a))}return""!==r[0]&&r.unshift(""),r.join("/")}function g(t){var e="",n="",r=t.indexOf("#");r>=0&&(e=t.slice(r),t=t.slice(0,r));var o=t.indexOf("?");return o>=0&&(n=t.slice(o+1),t=t.slice(0,o)),{path:t,query:n,hash:e}}function _(t){return t.replace(/\/\//g,"/")}function b(t){var e=Object.create(null),n=Object.create(null);return t.forEach(function(t){w(e,n,t)}),{pathMap:e,nameMap:n}}function w(t,o,i,a,s){var u=i.path,c=i.name;"production"!==e.env.NODE_ENV&&(n(null!=u,'"path" is required in a route configuration.'),n("string"!=typeof i.component,'route config "component" for path: '+String(u||c)+" cannot be a string id. Use an actual component instead."));var l={path:E(u,a),components:i.components||{default:i.component},instances:{},name:c,parent:a,matchAs:s,redirect:i.redirect,beforeEnter:i.beforeEnter,meta:i.meta||{}};i.children&&("production"!==e.env.NODE_ENV&&i.name&&i.children.some(function(t){return/^\/?$/.test(t.path)})&&r(!1,"Named Route '"+i.name+"' has a default child route.\n          When navigating to this named route (:to=\"{name: '"+i.name+"'\"), the default child route will not be rendered.\n          Remove the name from this route and use the name of the default child route for named links instead."),i.children.forEach(function(e){w(t,o,e,l)})),void 0!==i.alias&&(Array.isArray(i.alias)?i.alias.forEach(function(e){w(t,o,{path:e},a,l.path)}):w(t,o,{path:i.alias},a,l.path)),t[l.path]||(t[l.path]=l),c&&(o[c]?"production"!==e.env.NODE_ENV&&r(!1,'Duplicate named routes definition: { name: "'+c+'", path: "'+l.path+'" }'):o[c]=l)}function E(t,e){return t=t.replace(/\/$/,""),"/"===t[0]?t:null==e?t:_(e.path+"/"+t)}function O(t,e){for(var n,r=[],o=0,i=0,a="",s=e&&e.delimiter||"/";null!=(n=St.exec(t));){var u=n[0],c=n[1],l=n.index;if(a+=t.slice(i,l),i=l+u.length,c)a+=c[1];else{var p=t[i],f=n[2],d=n[3],h=n[4],v=n[5],m=n[6],y=n[7];a&&(r.push(a),a="");var g=null!=f&&null!=p&&p!==f,_="+"===m||"*"===m,b="?"===m||"*"===m,w=n[2]||s,E=h||v;r.push({name:d||o++,prefix:f||"",delimiter:w,optional:b,repeat:_,partial:g,asterisk:!!y,pattern:E?$(E):y?".*":"[^"+A(w)+"]+?"})}}return i<t.length&&(a+=t.substr(i)),a&&r.push(a),r}function x(t,e){return C(O(t,e))}function k(t){return encodeURI(t).replace(/[\/?#]/g,function(t){return"%"+t.charCodeAt(0).toString(16).toUpperCase()})}function N(t){return encodeURI(t).replace(/[?#]/g,function(t){return"%"+t.charCodeAt(0).toString(16).toUpperCase()})}function C(t){for(var e=new Array(t.length),n=0;n<t.length;n++)"object"==typeof t[n]&&(e[n]=new RegExp("^(?:"+t[n].pattern+")$"));return function(n,r){for(var o="",i=n||{},a=r||{},s=a.pretty?k:encodeURIComponent,u=0;u<t.length;u++){var c=t[u];if("string"!=typeof c){var l,p=i[c.name];if(null==p){if(c.optional){c.partial&&(o+=c.prefix);continue}throw new TypeError('Expected "'+c.name+'" to be defined')}if(kt(p)){if(!c.repeat)throw new TypeError('Expected "'+c.name+'" to not repeat, but received `'+JSON.stringify(p)+"`");if(0===p.length){if(c.optional)continue;throw new TypeError('Expected "'+c.name+'" to not be empty')}for(var f=0;f<p.length;f++){if(l=s(p[f]),!e[u].test(l))throw new TypeError('Expected all "'+c.name+'" to match "'+c.pattern+'", but received `'+JSON.stringify(l)+"`");o+=(0===f?c.prefix:c.delimiter)+l}}else{if(l=c.asterisk?N(p):s(p),!e[u].test(l))throw new TypeError('Expected "'+c.name+'" to match "'+c.pattern+'", but received "'+l+'"');o+=c.prefix+l}}else o+=c}return o}}function A(t){return t.replace(/([.+*?=^!:${}()[\]|\/\\])/g,"\\$1")}function $(t){return t.replace(/([=!:$\/()])/g,"\\$1")}function D(t,e){return t.keys=e,t}function S(t){return t.sensitive?"":"i"}function T(t,e){var n=t.source.match(/\((?!\?)/g);if(n)for(var r=0;r<n.length;r++)e.push({name:r,prefix:null,delimiter:null,optional:!1,repeat:!1,partial:!1,asterisk:!1,pattern:null});return D(t,e)}function j(t,e,n){for(var r=[],o=0;o<t.length;o++)r.push(R(t[o],e,n).source);var i=new RegExp("(?:"+r.join("|")+")",S(n));return D(i,e)}function V(t,e,n){return P(O(t,n),e,n)}function P(t,e,n){kt(e)||(n=e||n,e=[]),n=n||{};for(var r=n.strict,o=n.end!==!1,i="",a=0;a<t.length;a++){var s=t[a];if("string"==typeof s)i+=A(s);else{var u=A(s.prefix),c="(?:"+s.pattern+")";e.push(s),s.repeat&&(c+="(?:"+u+c+")*"),c=s.optional?s.partial?u+"("+c+")?":"(?:"+u+"("+c+"))?":u+"("+c+")",i+=c}}var l=A(n.delimiter||"/"),p=i.slice(-l.length)===l;return r||(i=(p?i.slice(0,-l.length):i)+"(?:"+l+"(?=$))?"),i+=o?"$":r&&p?"":"(?="+l+"|$)",D(new RegExp("^"+i,S(n)),e)}function R(t,e,n){return kt(e)||(n=e||n,e=[]),n=n||{},t instanceof RegExp?T(t,e):kt(t)?j(t,e,n):V(t,e,n)}function L(t){var e,n,r=Tt[t];return r?(e=r.keys,n=r.regexp):(e=[],n=Nt(t,e),Tt[t]={keys:e,regexp:n}),{keys:e,regexp:n}}function M(t,n,o){try{var i=jt[t]||(jt[t]=Nt.compile(t));return i(n||{},{pretty:!0})}catch(t){return"production"!==e.env.NODE_ENV&&r(!1,"missing param for "+o+": "+t.message),""}}function I(t,n,i){var a="string"==typeof t?{path:t}:t;if(a.name||a._normalized)return a;if(!a.path&&a.params&&n){a=U({},a),a._normalized=!0;var s=U(U({},n.params),a.params);if(n.name)a.name=n.name,a.params=s;else if(n.matched){var u=n.matched[n.matched.length-1].path;a.path=M(u,s,"path "+n.path)}else"production"!==e.env.NODE_ENV&&r(!1,"relative params navigation requires a current route.");return a}var c=g(a.path||""),l=n&&n.path||"/",p=c.path?y(c.path,l,i||a.append):n&&n.path||"/",f=o(c.query,a.query),d=a.hash||c.hash;return d&&"#"!==d.charAt(0)&&(d="#"+d),{_normalized:!0,path:p,query:f,hash:d}}function U(t,e){for(var n in e)t[n]=e[n];return t}function q(t){function o(t,e,n){var r=I(t,e),o=r.name;if(o){var i=p[o],a=L(i.path).keys.filter(function(t){return!t.optional}).map(function(t){return t.name});if("object"!=typeof r.params&&(r.params={}),e&&"object"==typeof e.params)for(var s in e.params)!(s in r.params)&&a.indexOf(s)>-1&&(r.params[s]=e.params[s]);if(i)return r.path=M(i.path,r.params,'named route "'+o+'"'),u(i,r,n)}else if(r.path){r.params={};for(var c in l)if(B(c,r.params,r.path))return u(l[c],r,n)}return u(null,r)}function i(t,i){var a=t.redirect,c="function"==typeof a?a(s(t,i)):a;if("string"==typeof c&&(c={path:c}),!c||"object"!=typeof c)return"production"!==e.env.NODE_ENV&&r(!1,"invalid redirect option: "+JSON.stringify(c)),u(null,i);var l=c,f=l.name,d=l.path,h=i.query,v=i.hash,m=i.params;if(h=l.hasOwnProperty("query")?l.query:h,v=l.hasOwnProperty("hash")?l.hash:v,m=l.hasOwnProperty("params")?l.params:m,f){var y=p[f];return"production"!==e.env.NODE_ENV&&n(y,'redirect failed: named route "'+f+'" not found.'),o({_normalized:!0,name:f,query:h,hash:v,params:m},void 0,i)}if(d){var g=F(d,t),_=M(g,m,'redirect route with path "'+g+'"');return o({_normalized:!0,path:_,query:h,hash:v},void 0,i)}return r(!1,"invalid redirect option: "+JSON.stringify(c)),u(null,i)}function a(t,e,n){var r=M(n,e.params,'aliased route with path "'+n+'"'),i=o({_normalized:!0,path:r});if(i){var a=i.matched,s=a[a.length-1];return e.params=i.params,u(s,e)}return u(null,e)}function u(t,e,n){return t&&t.redirect?i(t,n||e):t&&t.matchAs?a(t,e,t.matchAs):s(t,e,n)}var c=b(t),l=c.pathMap,p=c.nameMap;return o}function B(t,e,n){var r=L(t),o=r.regexp,i=r.keys,a=n.match(o);if(!a)return!1;if(!e)return!0;for(var s=1,u=a.length;s<u;++s){var c=i[s-1],l="string"==typeof a[s]?decodeURIComponent(a[s]):a[s];c&&(e[c.name]=l)}return!0}function F(t,e){return y(t,e.parent?e.parent.path:"/",!0)}function H(t,e,n){var r=function(o){o>=t.length?n():t[o]?e(t[o],function(){r(o+1)}):r(o+1)};r(0)}function z(t){if(!t)if(Vt){var e=document.querySelector("base");t=e?e.getAttribute("href"):"/"}else t="/";return"/"!==t.charAt(0)&&(t="/"+t),t.replace(/\/$/,"")}function J(t,e){var n,r=Math.max(t.length,e.length);for(n=0;n<r&&t[n]===e[n];n++);return{activated:e.slice(n),deactivated:t.slice(n)}}function K(t,e){return"function"!=typeof t&&(t=mt.extend(t)),t.options[e]}function W(t){return et(tt(t,function(t,e){var n=K(t,"beforeRouteLeave");if(n)return Array.isArray(n)?n.map(function(t){return Y(t,e)}):Y(n,e)}).reverse())}function Y(t,e){return function(){return t.apply(e,arguments)}}function Z(t,e,n){return et(tt(t,function(t,r,o,i){var a=K(t,"beforeRouteEnter");if(a)return Array.isArray(a)?a.map(function(t){return G(t,e,o,i,n)}):G(a,e,o,i,n)}))}function G(t,e,n,r,o){return function(i,a,s){return t(i,a,function(t){s(t),"function"==typeof t&&e.push(function(){X(t,n.instances,r,o)})})}}function X(t,e,n,r){e[n]?t(e[n]):r()&&setTimeout(function(){X(t,e,n,r)},16)}function Q(t){return tt(t,function(t,e,n,o){if("function"==typeof t&&!t.options)return function(e,i,a){var s=function(t){n.components[o]=t,a()},u=function(t){r(!1,"Failed to resolve async component "+o+": "+t),a(!1)},c=t(s,u);c&&"function"==typeof c.then&&c.then(s,u)}})}function tt(t,e){return et(t.map(function(t){return Object.keys(t.components).map(function(n){return e(t.components[n],t.instances[n],t,n)})}))}function et(t){return Array.prototype.concat.apply([],t)}function nt(t){t&&(Lt[t]={x:window.pageXOffset,y:window.pageYOffset})}function rt(t){if(t)return Lt[t]}function ot(t){var e=document.documentElement.getBoundingClientRect(),n=t.getBoundingClientRect();return{x:n.left-e.left,y:n.top-e.top}}function it(t){return st(t.x)||st(t.y)}function at(t){return{x:st(t.x)?t.x:window.pageXOffset,y:st(t.y)?t.y:window.pageYOffset}}function st(t){return"number"==typeof t}function ut(t){var e=window.location.pathname;return t&&0===e.indexOf(t)&&(e=e.slice(t.length)),(e||"/")+window.location.search+window.location.hash}function ct(t,e){var n=window.history;try{e?n.replaceState({key:It},"",t):(It=Mt(),n.pushState({key:It},"",t)),nt(It)}catch(n){window.location[e?"assign":"replace"](t)}}function lt(t){ct(t,!0)}function pt(){var t=ft();return"/"===t.charAt(0)||(ht("/"+t),!1)}function ft(){var t=window.location.href,e=t.indexOf("#");return e===-1?"":t.slice(e+1)}function dt(t){window.location.hash=t}function ht(t){var e=window.location.href.indexOf("#");window.location.replace(window.location.href.slice(0,e>=0?e:0)+"#"+t)}function vt(t,e,n){var r="hash"===n?"#"+e:e;return t?_(t+"/"+r):r}var mt,yt={name:"router-view",functional:!0,props:{name:{type:String,default:"default"}},render:function(t,e){var n=e.props,r=e.children,o=e.parent,i=e.data;i.routerView=!0;for(var a=o.$route,s=o._routerViewCache||(o._routerViewCache={}),u=0,c=!1;o;)o.$vnode&&o.$vnode.data.routerView&&u++,o._inactive&&(c=!0),o=o.$parent;i.routerViewDepth=u;var l=a.matched[u];if(!l)return t();var p=n.name,f=c?s[p]:s[p]=l.components[p];if(!c){var d=i.hook||(i.hook={});d.init=function(t){l.instances[p]=t.child},d.prepatch=function(t,e){l.instances[p]=e.child},d.destroy=function(t){l.instances[p]===t.child&&(l.instances[p]=void 0)}}return t(f,i,r)}},gt=encodeURIComponent,_t=decodeURIComponent,bt=s(null,{path:"/"}),wt=/\/$/,Et=[String,Object],Ot={name:"router-link",props:{to:{type:Et,required:!0},tag:{type:String,default:"a"},exact:Boolean,append:Boolean,replace:Boolean,activeClass:String,event:{type:[String,Array],default:"click"}},render:function(t){var e=this,n=this.$router,r=this.$route,o=n.resolve(this.to,r,this.append),i=o.normalizedTo,a=o.resolved,u=o.href,c={},p=this.activeClass||n.options.linkActiveClass||"router-link-active",d=i.path?s(null,i):a;c[p]=this.exact?l(r,d):f(r,d);var m=function(t){h(t)&&(e.replace?n.replace(i):n.push(i))},y={click:h};Array.isArray(this.event)?this.event.forEach(function(t){y[t]=m}):y[this.event]=m;var g={class:c};if("a"===this.tag)g.on=y,g.attrs={href:u};else{var _=v(this.$slots.default);if(_){_.isStatic=!1;var b=mt.util.extend,w=_.data=b({},_.data);w.on=y;var E=_.data.attrs=b({},_.data.attrs);E.href=u}else g.on=y}return t(this.tag,g,this.$slots.default)}},xt=Array.isArray||function(t){return"[object Array]"==Object.prototype.toString.call(t)},kt=xt,Nt=R,Ct=O,At=x,$t=C,Dt=P,St=new RegExp(["(\\\\.)","([\\/.])?(?:(?:\\:(\\w+)(?:\\(((?:\\\\.|[^\\\\()])+)\\))?|\\(((?:\\\\.|[^\\\\()])+)\\))([+*?])?|(\\*))"].join("|"),"g");Nt.parse=Ct,Nt.compile=At,Nt.tokensToFunction=$t,Nt.tokensToRegExp=Dt;var Tt=Object.create(null),jt=Object.create(null),Vt="undefined"!=typeof window,Pt=Vt&&function(){var t=window.navigator.userAgent;return(t.indexOf("Android 2.")===-1&&t.indexOf("Android 4.0")===-1||t.indexOf("Mobile Safari")===-1||t.indexOf("Chrome")!==-1||t.indexOf("Windows Phone")!==-1)&&(window.history&&"pushState"in window.history)}(),Rt=function(t,e){this.router=t,this.base=z(e),this.current=bt,this.pending=null};Rt.prototype.listen=function(t){this.cb=t},Rt.prototype.transitionTo=function(t,e,n){var r=this,o=this.router.match(t,this.current);this.confirmTransition(o,function(){r.updateRoute(o),e&&e(o),r.ensureURL()},n)},Rt.prototype.confirmTransition=function(t,e,n){var r=this,o=this.current,i=function(){n&&n()};if(l(t,o))return this.ensureURL(),i();var a=J(this.current.matched,t.matched),s=a.deactivated,u=a.activated,c=[].concat(W(s),this.router.beforeHooks,u.map(function(t){return t.beforeEnter}),Q(u));this.pending=t;var p=function(e,n){return r.pending!==t?i():void e(t,o,function(t){t===!1?(r.ensureURL(!0),i()):"string"==typeof t||"object"==typeof t?("object"==typeof t&&t.replace?r.replace(t):r.push(t),i()):n(t)})};H(c,p,function(){var n=[],o=Z(u,n,function(){return r.current===t});H(o,p,function(){return r.pending!==t?i():(r.pending=null,e(t),void(r.router.app&&r.router.app.$nextTick(function(){n.forEach(function(t){return t()})})))})})},Rt.prototype.updateRoute=function(t){var e=this.current;this.current=t,this.cb&&this.cb(t),this.router.afterHooks.forEach(function(n){n&&n(t,e)})};var Lt=Object.create(null),Mt=function(){return String(Date.now())},It=Mt(),Ut=function(t){function r(e,n){var r=this;t.call(this,e,n);var o=e.options.scrollBehavior;window.addEventListener("popstate",function(t){It=t.state&&t.state.key;var e=r.current;r.transitionTo(ut(r.base),function(t){o&&r.handleScroll(t,e,!0)})}),o&&window.addEventListener("scroll",function(){nt(It)})}return t&&(r.__proto__=t),r.prototype=Object.create(t&&t.prototype),r.prototype.constructor=r,r.prototype.go=function(t){window.history.go(t)},r.prototype.push=function(t){var e=this,n=this.current;this.transitionTo(t,function(t){ct(_(e.base+t.fullPath)),e.handleScroll(t,n,!1)})},r.prototype.replace=function(t){var e=this,n=this.current;this.transitionTo(t,function(t){lt(_(e.base+t.fullPath)),e.handleScroll(t,n,!1)})},r.prototype.ensureURL=function(t){if(ut(this.base)!==this.current.fullPath){var e=_(this.base+this.current.fullPath);t?ct(e):lt(e)}},r.prototype.handleScroll=function(t,r,o){var i=this.router;if(i.app){var a=i.options.scrollBehavior;a&&("production"!==e.env.NODE_ENV&&n("function"==typeof a,"scrollBehavior must be a function"),i.app.$nextTick(function(){var e=rt(It),n=a(t,r,o?e:null);if(n){var i="object"==typeof n;if(i&&"string"==typeof n.selector){var s=document.querySelector(n.selector);s?e=ot(s):it(n)&&(e=at(n))}else i&&it(n)&&(e=at(n));e&&window.scrollTo(e.x,e.y)}}))}},r}(Rt),qt=function(t){function e(e,n,r){t.call(this,e,n),r&&this.checkFallback()||pt()}return t&&(e.__proto__=t),e.prototype=Object.create(t&&t.prototype),e.prototype.constructor=e,e.prototype.checkFallback=function(){var t=ut(this.base);if(!/^\/#/.test(t))return window.location.replace(_(this.base+"/#"+t)),!0},e.prototype.onHashChange=function(){pt()&&this.transitionTo(ft(),function(t){ht(t.fullPath)})},e.prototype.push=function(t){this.transitionTo(t,function(t){dt(t.fullPath)})},e.prototype.replace=function(t){this.transitionTo(t,function(t){ht(t.fullPath)})},e.prototype.go=function(t){window.history.go(t)},e.prototype.ensureURL=function(t){var e=this.current.fullPath;ft()!==e&&(t?dt(e):ht(e))},e}(Rt),Bt=function(t){function e(e){t.call(this,e),this.stack=[],this.index=-1}return t&&(e.__proto__=t),e.prototype=Object.create(t&&t.prototype),e.prototype.constructor=e,e.prototype.push=function(t){var e=this;this.transitionTo(t,function(t){e.stack=e.stack.slice(0,e.index+1).concat(t),e.index++})},e.prototype.replace=function(t){var e=this;this.transitionTo(t,function(t){e.stack=e.stack.slice(0,e.index).concat(t)})},e.prototype.go=function(t){var e=this,n=this.index+t;if(!(n<0||n>=this.stack.length)){var r=this.stack[n];this.confirmTransition(r,function(){e.index=n,e.updateRoute(r)})}},e.prototype.ensureURL=function(){},e}(Rt),Ft=function(t){void 0===t&&(t={}),this.app=null,this.options=t,this.beforeHooks=[],this.afterHooks=[],this.match=q(t.routes||[]);var r=t.mode||"hash";switch(this.fallback="history"===r&&!Pt,this.fallback&&(r="hash"),Vt||(r="abstract"),this.mode=r,r){case"history":this.history=new Ut(this,t.base);break;case"hash":this.history=new qt(this,t.base,this.fallback);break;case"abstract":this.history=new Bt(this);break;default:"production"!==e.env.NODE_ENV&&n(!1,"invalid mode: "+r)}},Ht={currentRoute:{}};Ht.currentRoute.get=function(){return this.history&&this.history.current},Ft.prototype.init=function(t){var r=this;"production"!==e.env.NODE_ENV&&n(m.installed,"not installed. Make sure to call `Vue.use(VueRouter)` before creating root instance."),this.app=t;var o=this.history;if(o instanceof Ut)o.transitionTo(ut(o.base));else if(o instanceof qt){var i=function(){window.addEventListener("hashchange",function(){o.onHashChange()})};o.transitionTo(ft(),i,i)}o.listen(function(t){r.app._route=t})},Ft.prototype.beforeEach=function(t){this.beforeHooks.push(t)},Ft.prototype.afterEach=function(t){this.afterHooks.push(t)},Ft.prototype.push=function(t){this.history.push(t)},Ft.prototype.replace=function(t){this.history.replace(t)},Ft.prototype.go=function(t){this.history.go(t)},Ft.prototype.back=function(){this.go(-1)},Ft.prototype.forward=function(){this.go(1)},Ft.prototype.getMatchedComponents=function(t){var e=t?this.resolve(t).resolved:this.currentRoute;return e?[].concat.apply([],e.matched.map(function(t){return Object.keys(t.components).map(function(e){return t.components[e]})})):[]},Ft.prototype.resolve=function(t,e,n){var r=I(t,e||this.history.current,n),o=this.match(r,e),i=o.redirectedFrom||o.fullPath,a=this.history.base,s=vt(a,i,this.mode);return{normalizedTo:r,resolved:o,href:s}},Object.defineProperties(Ft.prototype,Ht),Ft.install=m,Vt&&window.Vue&&window.Vue.use(Ft),t.exports=Ft}).call(e,n(3))},33:function(t,e){"use strict";var n={PORT:"3000",NODE_ENV:"test"};e.config=n}});
−		+
−	var View = {	+
−	name: 'router-view',	+
−	functional: true,	+
−	props: {	+
−	name: {	+
−	type: String,	+
−	default: 'default'	+
−	}	+
−	},	+
−	render: function render (h, ref) {	+
−	var props = ref.props;	+
−	var children = ref.children;	+
−	var parent = ref.parent;	+
−	var data = ref.data;	+
−		+
−	data.routerView = true	+
−		+
−	var route = parent.$route	+
−	var cache = parent._routerViewCache || (parent._routerViewCache = {})	+
−	var depth = 0	+
−	var inactive = false	+
−		+
−	while (parent) {	+
−	if (parent.$vnode && parent.$vnode.data.routerView) {	+
−	depth++	+
−	}	+
−	if (parent._inactive) {	+
−	inactive = true	+
−	}	+
−	parent = parent.$parent	+
−	}	+
−		+
−	data.routerViewDepth = depth	+
−	var matched = route.matched[depth]	+
−	if (!matched) {	+
−	return h()	+
−	}	+
−		+
−	var name = props.name	+
−	var component = inactive	+
−	? cache[name]	+
−	: (cache[name] = matched.components[name])	+
−		+
−	if (!inactive) {	+
−	var hooks = data.hook || (data.hook = {})	+
−	hooks.init = function (vnode) {	+
−	matched.instances[name] = vnode.child	+
−	}	+
−	hooks.prepatch = function (oldVnode, vnode) {	+
−	matched.instances[name] = vnode.child	+
−	}	+
−	hooks.destroy = function (vnode) {	+
−	if (matched.instances[name] === vnode.child) {	+
−	matched.instances[name] = undefined	+
−	}	+
−	}	+
−	}	+
−		+
−	return h(component, data, children)	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	function assert (condition, message) {	+
−	if (!condition) {	+
−	throw new Error(("[vue-router] " + message))	+
−	}	+
−	}	+
−		+
−	function warn (condition, message) {	+
−	if (!condition) {	+
−	typeof console !== 'undefined' && console.warn(("[vue-router] " + message))	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	var encode = encodeURIComponent	+
−	var decode = decodeURIComponent	+
−		+
−	function resolveQuery (	+
−	query,	+
−	extraQuery	+
−	) {	+
−	if ( extraQuery === void 0 ) extraQuery = {};	+
−		+
−	if (query) {	+
−	var parsedQuery	+
−	try {	+
−	parsedQuery = parseQuery(query)	+
−	} catch (e) {	+
−	process.env.NODE_ENV !== 'production' && warn(false, e.message)	+
−	parsedQuery = {}	+
−	}	+
−	for (var key in extraQuery) {	+
−	parsedQuery[key] = extraQuery[key]	+
−	}	+
−	return parsedQuery	+
−	} else {	+
−	return extraQuery	+
−	}	+
−	}	+
−		+
−	function parseQuery (query) {	+
−	var res = {}	+
−		+
−	query = query.trim().replace(/^(\?|#|&)/, '')	+
−		+
−	if (!query) {	+
−	return res	+
−	}	+
−		+
−	query.split('&').forEach(function (param) {	+
−	var parts = param.replace(/\+/g, ' ').split('=')	+
−	var key = decode(parts.shift())	+
−	var val = parts.length > 0	+
−	? decode(parts.join('='))	+
−	: null	+
−		+
−	if (res[key] === undefined) {	+
−	res[key] = val	+
−	} else if (Array.isArray(res[key])) {	+
−	res[key].push(val)	+
−	} else {	+
−	res[key] = [res[key], val]	+
−	}	+
−	})	+
−		+
−	return res	+
−	}	+
−		+
−	function stringifyQuery (obj) {	+
−	var res = obj ? Object.keys(obj).map(function (key) {	+
−	var val = obj[key]	+
−		+
−	if (val === undefined) {	+
−	return ''	+
−	}	+
−		+
−	if (val === null) {	+
−	return encode(key)	+
−	}	+
−		+
−	if (Array.isArray(val)) {	+
−	var result = []	+
−	val.slice().forEach(function (val2) {	+
−	if (val2 === undefined) {	+
−	return	+
−	}	+
−	if (val2 === null) {	+
−	result.push(encode(key))	+
−	} else {	+
−	result.push(encode(key) + '=' + encode(val2))	+
−	}	+
−	})	+
−	return result.join('&')	+
−	}	+
−		+
−	return encode(key) + '=' + encode(val)	+
−	}).filter(function (x) { return x.length > 0; }).join('&') : null	+
−	return res ? ("?" + res) : ''	+
−	}	+
−		+
−	/*  */	+
−		+
−	function createRoute (	+
−	record,	+
−	location,	+
−	redirectedFrom	+
−	) {	+
−	var route = {	+
−	name: location.name || (record && record.name),	+
−	meta: (record && record.meta) || {},	+
−	path: location.path || '/',	+
−	hash: location.hash || '',	+
−	query: location.query || {},	+
−	params: location.params || {},	+
−	fullPath: getFullPath(location),	+
−	matched: record ? formatMatch(record) : []	+
−	}	+
−	if (redirectedFrom) {	+
−	route.redirectedFrom = getFullPath(redirectedFrom)	+
−	}	+
−	return Object.freeze(route)	+
−	}	+
−		+
−	// the starting route that represents the initial state	+
−	var START = createRoute(null, {	+
−	path: '/'	+
−	})	+
−		+
−	function formatMatch (record) {	+
−	var res = []	+
−	while (record) {	+
−	res.unshift(record)	+
−	record = record.parent	+
−	}	+
−	return res	+
−	}	+
−		+
−	function getFullPath (ref) {	+
−	var path = ref.path;	+
−	var query = ref.query; if ( query === void 0 ) query = {};	+
−	var hash = ref.hash; if ( hash === void 0 ) hash = '';	+
−		+
−	return (path || '/') + stringifyQuery(query) + hash	+
−	}	+
−		+
−	var trailingSlashRE = /\/$/	+
−	function isSameRoute (a, b) {	+
−	if (b === START) {	+
−	return a === b	+
−	} else if (!b) {	+
−	return false	+
−	} else if (a.path && b.path) {	+
−	return (	+
−	a.path.replace(trailingSlashRE, '') === b.path.replace(trailingSlashRE, '') &&	+
−	a.hash === b.hash &&	+
−	isObjectEqual(a.query, b.query)	+
−	)	+
−	} else if (a.name && b.name) {	+
−	return (	+
−	a.name === b.name &&	+
−	a.hash === b.hash &&	+
−	isObjectEqual(a.query, b.query) &&	+
−	isObjectEqual(a.params, b.params)	+
−	)	+
−	} else {	+
−	return false	+
−	}	+
−	}	+
−		+
−	function isObjectEqual (a, b) {	+
−	if ( a === void 0 ) a = {};	+
−	if ( b === void 0 ) b = {};	+
−		+
−	var aKeys = Object.keys(a)	+
−	var bKeys = Object.keys(b)	+
−	if (aKeys.length !== bKeys.length) {	+
−	return false	+
−	}	+
−	return aKeys.every(function (key) { return String(a[key]) === String(b[key]); })	+
−	}	+
−		+
−	function isIncludedRoute (current, target) {	+
−	return (	+
−	current.path.indexOf(target.path.replace(/\/$/, '')) === 0 &&	+
−	(!target.hash || current.hash === target.hash) &&	+
−	queryIncludes(current.query, target.query)	+
−	)	+
−	}	+
−		+
−	function queryIncludes (current, target) {	+
−	for (var key in target) {	+
−	if (!(key in current)) {	+
−	return false	+
−	}	+
−	}	+
−	return true	+
−	}	+
−		+
−	/*  */	+
−		+
−	// work around weird flow bug	+
−	var toTypes = [String, Object]	+
−		+
−	var Link = {	+
−	name: 'router-link',	+
−	props: {	+
−	to: {	+
−	type: toTypes,	+
−	required: true	+
−	},	+
−	tag: {	+
−	type: String,	+
−	default: 'a'	+
−	},	+
−	exact: Boolean,	+
−	append: Boolean,	+
−	replace: Boolean,	+
−	activeClass: String,	+
−	event: {	+
−	type: [String, Array],	+
−	default: 'click'	+
−	}	+
−	},	+
−	render: function render (h) {	+
−	var this$1 = this;	+
−		+
−	var router = this.$router	+
−	var current = this.$route	+
−	var ref = router.resolve(this.to, current, this.append);	+
−	var normalizedTo = ref.normalizedTo;	+
−	var resolved = ref.resolved;	+
−	var href = ref.href;	+
−	var classes = {}	+
−	var activeClass = this.activeClass || router.options.linkActiveClass || 'router-link-active'	+
−	var compareTarget = normalizedTo.path ? createRoute(null, normalizedTo) : resolved	+
−	classes[activeClass] = this.exact	+
−	? isSameRoute(current, compareTarget)	+
−	: isIncludedRoute(current, compareTarget)	+
−		+
−	var handler = function (e) {	+
−	if (guardEvent(e)) {	+
−	if (this$1.replace) {	+
−	router.replace(normalizedTo)	+
−	} else {	+
−	router.push(normalizedTo)	+
−	}	+
−	}	+
−	}	+
−		+
−	var on = { click: guardEvent }	+
−	if (Array.isArray(this.event)) {	+
−	this.event.forEach(function (e) { on[e] = handler })	+
−	} else {	+
−	on[this.event] = handler	+
−	}	+
−		+
−	var data = {	+
−	class: classes	+
−	}	+
−		+
−	if (this.tag === 'a') {	+
−	data.on = on	+
−	data.attrs = { href: href }	+
−	} else {	+
−	// find the first <a> child and apply listener and href	+
−	var a = findAnchor(this.$slots.default)	+
−	if (a) {	+
−	// in case the <a> is a static node	+
−	a.isStatic = false	+
−	var extend = _Vue.util.extend	+
−	var aData = a.data = extend({}, a.data)	+
−	aData.on = on	+
−	var aAttrs = a.data.attrs = extend({}, a.data.attrs)	+
−	aAttrs.href = href	+
−	} else {	+
−	// doesn't have <a> child, apply listener to self	+
−	data.on = on	+
−	}	+
−	}	+
−		+
−	return h(this.tag, data, this.$slots.default)	+
−	}	+
−	}	+
−		+
−	function guardEvent (e) {	+
−	// don't redirect with control keys	+
−	/* istanbul ignore if */	+
−	if (e.metaKey || e.ctrlKey || e.shiftKey) { return }	+
−	// don't redirect when preventDefault called	+
−	/* istanbul ignore if */	+
−	if (e.defaultPrevented) { return }	+
−	// don't redirect on right click	+
−	/* istanbul ignore if */	+
−	if (e.button !== 0) { return }	+
−	// don't redirect if `target="_blank"`	+
−	/* istanbul ignore if */	+
−	var target = e.target.getAttribute('target')	+
−	if (/\b_blank\b/i.test(target)) { return }	+
−		+
−	e.preventDefault()	+
−	return true	+
−	}	+
−		+
−	function findAnchor (children) {	+
−	if (children) {	+
−	var child	+
−	for (var i = 0; i < children.length; i++) {	+
−	child = children[i]	+
−	if (child.tag === 'a') {	+
−	return child	+
−	}	+
−	if (child.children && (child = findAnchor(child.children))) {	+
−	return child	+
−	}	+
−	}	+
−	}	+
−	}	+
−		+
−	var _Vue	+
−		+
−	function install (Vue) {	+
−	if (install.installed) { return }	+
−	install.installed = true	+
−		+
−	_Vue = Vue	+
−		+
−	Object.defineProperty(Vue.prototype, '$router', {	+
−	get: function get () { return this.$root._router }	+
−	})	+
−		+
−	Object.defineProperty(Vue.prototype, '$route', {	+
−	get: function get$1 () { return this.$root._route }	+
−	})	+
−		+
−	Vue.mixin({	+
−	beforeCreate: function beforeCreate () {	+
−	if (this.$options.router) {	+
−	this._router = this.$options.router	+
−	this._router.init(this)	+
−	Vue.util.defineReactive(this, '_route', this._router.history.current)	+
−	}	+
−	}	+
−	})	+
−		+
−	Vue.component('router-view', View)	+
−	Vue.component('router-link', Link)	+
−		+
−	var strats = Vue.config.optionMergeStrategies	+
−	// use the same hook merging strategy for route hooks	+
−	strats.beforeRouteEnter = strats.beforeRouteLeave = strats.created	+
−	}	+
−		+
−	/*  */	+
−		+
−	function resolvePath (	+
−	relative,	+
−	base,	+
−	append	+
−	) {	+
−	if (relative.charAt(0) === '/') {	+
−	return relative	+
−	}	+
−		+
−	if (relative.charAt(0) === '?' || relative.charAt(0) === '#') {	+
−	return base + relative	+
−	}	+
−		+
−	var stack = base.split('/')	+
−		+
−	// remove trailing segment if:	+
−	// - not appending	+
−	// - appending to trailing slash (last segment is empty)	+
−	if (!append || !stack[stack.length - 1]) {	+
−	stack.pop()	+
−	}	+
−		+
−	// resolve relative path	+
−	var segments = relative.replace(/^\//, '').split('/')	+
−	for (var i = 0; i < segments.length; i++) {	+
−	var segment = segments[i]	+
−	if (segment === '.') {	+
−	continue	+
−	} else if (segment === '..') {	+
−	stack.pop()	+
−	} else {	+
−	stack.push(segment)	+
−	}	+
−	}	+
−		+
−	// ensure leading slash	+
−	if (stack[0] !== '') {	+
−	stack.unshift('')	+
−	}	+
−		+
−	return stack.join('/')	+
−	}	+
−		+
−	function parsePath (path) {	+
−	var hash = ''	+
−	var query = ''	+
−		+
−	var hashIndex = path.indexOf('#')	+
−	if (hashIndex >= 0) {	+
−	hash = path.slice(hashIndex)	+
−	path = path.slice(0, hashIndex)	+
−	}	+
−		+
−	var queryIndex = path.indexOf('?')	+
−	if (queryIndex >= 0) {	+
−	query = path.slice(queryIndex + 1)	+
−	path = path.slice(0, queryIndex)	+
−	}	+
−		+
−	return {	+
−	path: path,	+
−	query: query,	+
−	hash: hash	+
−	}	+
−	}	+
−		+
−	function cleanPath (path) {	+
−	return path.replace(/\/\//g, '/')	+
−	}	+
−		+
−	/*  */	+
−		+
−	function createRouteMap (routes) {	+
−	var pathMap = Object.create(null)	+
−	var nameMap = Object.create(null)	+
−		+
−	routes.forEach(function (route) {	+
−	addRouteRecord(pathMap, nameMap, route)	+
−	})	+
−		+
−	return {	+
−	pathMap: pathMap,	+
−	nameMap: nameMap	+
−	}	+
−	}	+
−		+
−	function addRouteRecord (	+
−	pathMap,	+
−	nameMap,	+
−	route,	+
−	parent,	+
−	matchAs	+
−	) {	+
−	var path = route.path;	+
−	var name = route.name;	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	assert(path != null, "\"path\" is required in a route configuration.")	+
−	assert(	+
−	typeof route.component !== 'string',	+
−	"route config \"component\" for path: " + (String(path || name)) + " cannot be a " +	+
−	"string id. Use an actual component instead."	+
−	)	+
−	}	+
−		+
−	var record = {	+
−	path: normalizePath(path, parent),	+
−	components: route.components || { default: route.component },	+
−	instances: {},	+
−	name: name,	+
−	parent: parent,	+
−	matchAs: matchAs,	+
−	redirect: route.redirect,	+
−	beforeEnter: route.beforeEnter,	+
−	meta: route.meta || {}	+
−	}	+
−		+
−	if (route.children) {	+
−	// Warn if route is named and has a default child route.	+
−	// If users navigate to this route by name, the default child will	+
−	// not be rendered (GH Issue #629)	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	if (route.name && route.children.some(function (child) { return /^\/?$/.test(child.path); })) {	+
−	warn(false, ("Named Route '" + (route.name) + "' has a default child route.\n          When navigating to this named route (:to=\"{name: '" + (route.name) + "'\"), the default child route will not be rendered.\n          Remove the name from this route and use the name of the default child route for named links instead.")	+
−	)	+
−	}	+
−	}	+
−	route.children.forEach(function (child) {	+
−	addRouteRecord(pathMap, nameMap, child, record)	+
−	})	+
−	}	+
−		+
−	if (route.alias !== undefined) {	+
−	if (Array.isArray(route.alias)) {	+
−	route.alias.forEach(function (alias) {	+
−	addRouteRecord(pathMap, nameMap, { path: alias }, parent, record.path)	+
−	})	+
−	} else {	+
−	addRouteRecord(pathMap, nameMap, { path: route.alias }, parent, record.path)	+
−	}	+
−	}	+
−		+
−	if (!pathMap[record.path]) {	+
−	pathMap[record.path] = record	+
−	}	+
−	if (name) {	+
−	if (!nameMap[name]) {	+
−	nameMap[name] = record	+
−	} else if (process.env.NODE_ENV !== 'production') {	+
−	warn(false, ("Duplicate named routes definition: { name: \"" + name + "\", path: \"" + (record.path) + "\" }"))	+
−	}	+
−	}	+
−	}	+
−		+
−	function normalizePath (path, parent) {	+
−	path = path.replace(/\/$/, '')	+
−	if (path[0] === '/') { return path }	+
−	if (parent == null) { return path }	+
−	return cleanPath(((parent.path) + "/" + path))	+
−	}	+
−		+
−	var __moduleExports = Array.isArray || function (arr) {	+
−	return Object.prototype.toString.call(arr) == '[object Array]';	+
−	};	+
−		+
−	var isarray = __moduleExports	+
−		+
−	/**	+
−	* Expose `pathToRegexp`.	+
−	*/	+
−	var index = pathToRegexp	+
−	var parse_1 = parse	+
−	var compile_1 = compile	+
−	var tokensToFunction_1 = tokensToFunction	+
−	var tokensToRegExp_1 = tokensToRegExp	+
−		+
−	/**	+
−	* The main path matching regexp utility.	+
−	*	+
−	* @type {RegExp}	+
−	*/	+
−	var PATH_REGEXP = new RegExp([	+
−	// Match escaped characters that would otherwise appear in future matches.	+
−	// This allows the user to escape special characters that won't transform.	+
−	'(\\\\.)',	+
−	// Match Express-style parameters and un-named parameters with a prefix	+
−	// and optional suffixes. Matches appear as:	+
−	//	+
−	// "/:test(\\d+)?" => ["/", "test", "\d+", undefined, "?", undefined]	+
−	// "/route(\\d+)"  => [undefined, undefined, undefined, "\d+", undefined, undefined]	+
−	// "/*"            => ["/", undefined, undefined, undefined, undefined, "*"]	+
−	'([\\/.])?(?:(?:\\:(\\w+)(?:\\(((?:\\\\.|[^\\\\()])+)\\))?|\\(((?:\\\\.|[^\\\\()])+)\\))([+*?])?|(\\*))'	+
−	].join('|'), 'g')	+
−		+
−	/**	+
−	* Parse a string for the raw tokens.	+
−	*	+
−	* @param  {string}  str	+
−	* @param  {Object=} options	+
−	* @return {!Array}	+
−	*/	+
−	function parse (str, options) {	+
−	var tokens = []	+
−	var key = 0	+
−	var index = 0	+
−	var path = ''	+
−	var defaultDelimiter = options && options.delimiter || '/'	+
−	var res	+
−		+
−	while ((res = PATH_REGEXP.exec(str)) != null) {	+
−	var m = res[0]	+
−	var escaped = res[1]	+
−	var offset = res.index	+
−	path += str.slice(index, offset)	+
−	index = offset + m.length	+
−		+
−	// Ignore already escaped sequences.	+
−	if (escaped) {	+
−	path += escaped[1]	+
−	continue	+
−	}	+
−		+
−	var next = str[index]	+
−	var prefix = res[2]	+
−	var name = res[3]	+
−	var capture = res[4]	+
−	var group = res[5]	+
−	var modifier = res[6]	+
−	var asterisk = res[7]	+
−		+
−	// Push the current path onto the tokens.	+
−	if (path) {	+
−	tokens.push(path)	+
−	path = ''	+
−	}	+
−		+
−	var partial = prefix != null && next != null && next !== prefix	+
−	var repeat = modifier === '+' || modifier === '*'	+
−	var optional = modifier === '?' || modifier === '*'	+
−	var delimiter = res[2] || defaultDelimiter	+
−	var pattern = capture || group	+
−		+
−	tokens.push({	+
−	name: name || key++,	+
−	prefix: prefix || '',	+
−	delimiter: delimiter,	+
−	optional: optional,	+
−	repeat: repeat,	+
−	partial: partial,	+
−	asterisk: !!asterisk,	+
−	pattern: pattern ? escapeGroup(pattern) : (asterisk ? '.*' : '[^' + escapeString(delimiter) + ']+?')	+
−	})	+
−	}	+
−		+
−	// Match any characters still remaining.	+
−	if (index < str.length) {	+
−	path += str.substr(index)	+
−	}	+
−		+
−	// If the path exists, push it onto the end.	+
−	if (path) {	+
−	tokens.push(path)	+
−	}	+
−		+
−	return tokens	+
−	}	+
−		+
−	/**	+
−	* Compile a string to a template function for the path.	+
−	*	+
−	* @param  {string}            str	+
−	* @param  {Object=}            options	+
−	* @return {!function(Object=, Object=)}	+
−	*/	+
−	function compile (str, options) {	+
−	return tokensToFunction(parse(str, options))	+
−	}	+
−		+
−	/**	+
−	* Prettier encoding of URI path segments.	+
−	*	+
−	* @param  {string}	+
−	* @return {string}	+
−	*/	+
−	function encodeURIComponentPretty (str) {	+
−	return encodeURI(str).replace(/[\/?#]/g, function (c) {	+
−	return '%' + c.charCodeAt(0).toString(16).toUpperCase()	+
−	})	+
−	}	+
−		+
−	/**	+
−	* Encode the asterisk parameter. Similar to `pretty`, but allows slashes.	+
−	*	+
−	* @param  {string}	+
−	* @return {string}	+
−	*/	+
−	function encodeAsterisk (str) {	+
−	return encodeURI(str).replace(/[?#]/g, function (c) {	+
−	return '%' + c.charCodeAt(0).toString(16).toUpperCase()	+
−	})	+
−	}	+
−		+
−	/**	+
−	* Expose a method for transforming tokens into the path function.	+
−	*/	+
−	function tokensToFunction (tokens) {	+
−	// Compile all the tokens into regexps.	+
−	var matches = new Array(tokens.length)	+
−		+
−	// Compile all the patterns before compilation.	+
−	for (var i = 0; i < tokens.length; i++) {	+
−	if (typeof tokens[i] === 'object') {	+
−	matches[i] = new RegExp('^(?:' + tokens[i].pattern + ')$')	+
−	}	+
−	}	+
−		+
−	return function (obj, opts) {	+
−	var path = ''	+
−	var data = obj || {}	+
−	var options = opts || {}	+
−	var encode = options.pretty ? encodeURIComponentPretty : encodeURIComponent	+
−		+
−	for (var i = 0; i < tokens.length; i++) {	+
−	var token = tokens[i]	+
−		+
−	if (typeof token === 'string') {	+
−	path += token	+
−		+
−	continue	+
−	}	+
−		+
−	var value = data[token.name]	+
−	var segment	+
−		+
−	if (value == null) {	+
−	if (token.optional) {	+
−	// Prepend partial segment prefixes.	+
−	if (token.partial) {	+
−	path += token.prefix	+
−	}	+
−		+
−	continue	+
−	} else {	+
−	throw new TypeError('Expected "' + token.name + '" to be defined')	+
−	}	+
−	}	+
−		+
−	if (isarray(value)) {	+
−	if (!token.repeat) {	+
−	throw new TypeError('Expected "' + token.name + '" to not repeat, but received `' + JSON.stringify(value) + '`')	+
−	}	+
−		+
−	if (value.length === 0) {	+
−	if (token.optional) {	+
−	continue	+
−	} else {	+
−	throw new TypeError('Expected "' + token.name + '" to not be empty')	+
−	}	+
−	}	+
−		+
−	for (var j = 0; j < value.length; j++) {	+
−	segment = encode(value[j])	+
−		+
−	if (!matches[i].test(segment)) {	+
−	throw new TypeError('Expected all "' + token.name + '" to match "' + token.pattern + '", but received `' + JSON.stringify(segment) + '`')	+
−	}	+
−		+
−	path += (j === 0 ? token.prefix : token.delimiter) + segment	+
−	}	+
−		+
−	continue	+
−	}	+
−		+
−	segment = token.asterisk ? encodeAsterisk(value) : encode(value)	+
−		+
−	if (!matches[i].test(segment)) {	+
−	throw new TypeError('Expected "' + token.name + '" to match "' + token.pattern + '", but received "' + segment + '"')	+
−	}	+
−		+
−	path += token.prefix + segment	+
−	}	+
−		+
−	return path	+
−	}	+
−	}	+
−		+
−	/**	+
−	* Escape a regular expression string.	+
−	*	+
−	* @param  {string} str	+
−	* @return {string}	+
−	*/	+
−	function escapeString (str) {	+
−	return str.replace(/([.+*?=^!:${}()[\]|\/\\])/g, '\\$1')	+
−	}	+
−		+
−	/**	+
−	* Escape the capturing group by escaping special characters and meaning.	+
−	*	+
−	* @param  {string} group	+
−	* @return {string}	+
−	*/	+
−	function escapeGroup (group) {	+
−	return group.replace(/([=!:$\/()])/g, '\\$1')	+
−	}	+
−		+
−	/**	+
−	* Attach the keys as a property of the regexp.	+
−	*	+
−	* @param  {!RegExp} re	+
−	* @param  {Array}  keys	+
−	* @return {!RegExp}	+
−	*/	+
−	function attachKeys (re, keys) {	+
−	re.keys = keys	+
−	return re	+
−	}	+
−		+
−	/**	+
−	* Get the flags for a regexp from the options.	+
−	*	+
−	* @param  {Object} options	+
−	* @return {string}	+
−	*/	+
−	function flags (options) {	+
−	return options.sensitive ? '' : 'i'	+
−	}	+
−		+
−	/**	+
−	* Pull out keys from a regexp.	+
−	*	+
−	* @param  {!RegExp} path	+
−	* @param  {!Array}  keys	+
−	* @return {!RegExp}	+
−	*/	+
−	function regexpToRegexp (path, keys) {	+
−	// Use a negative lookahead to match only capturing groups.	+
−	var groups = path.source.match(/\((?!\?)/g)	+
−		+
−	if (groups) {	+
−	for (var i = 0; i < groups.length; i++) {	+
−	keys.push({	+
−	name: i,	+
−	prefix: null,	+
−	delimiter: null,	+
−	optional: false,	+
−	repeat: false,	+
−	partial: false,	+
−	asterisk: false,	+
−	pattern: null	+
−	})	+
−	}	+
−	}	+
−		+
−	return attachKeys(path, keys)	+
−	}	+
−		+
−	/**	+
−	* Transform an array into a regexp.	+
−	*	+
−	* @param  {!Array}  path	+
−	* @param  {Array}  keys	+
−	* @param  {!Object} options	+
−	* @return {!RegExp}	+
−	*/	+
−	function arrayToRegexp (path, keys, options) {	+
−	var parts = []	+
−		+
−	for (var i = 0; i < path.length; i++) {	+
−	parts.push(pathToRegexp(path[i], keys, options).source)	+
−	}	+
−		+
−	var regexp = new RegExp('(?:' + parts.join('|') + ')', flags(options))	+
−		+
−	return attachKeys(regexp, keys)	+
−	}	+
−		+
−	/**	+
−	* Create a path regexp from string input.	+
−	*	+
−	* @param  {string}  path	+
−	* @param  {!Array}  keys	+
−	* @param  {!Object} options	+
−	* @return {!RegExp}	+
−	*/	+
−	function stringToRegexp (path, keys, options) {	+
−	return tokensToRegExp(parse(path, options), keys, options)	+
−	}	+
−		+
−	/**	+
−	* Expose a function for taking tokens and returning a RegExp.	+
−	*	+
−	* @param  {!Array}          tokens	+
−	* @param  {(Array|Object)=} keys	+
−	* @param  {Object=}        options	+
−	* @return {!RegExp}	+
−	*/	+
−	function tokensToRegExp (tokens, keys, options) {	+
−	if (!isarray(keys)) {	+
−	options = /** @type {!Object} */ (keys || options)	+
−	keys = []	+
−	}	+
−		+
−	options = options || {}	+
−		+
−	var strict = options.strict	+
−	var end = options.end !== false	+
−	var route = ''	+
−		+
−	// Iterate over the tokens and create our regexp string.	+
−	for (var i = 0; i < tokens.length; i++) {	+
−	var token = tokens[i]	+
−		+
−	if (typeof token === 'string') {	+
−	route += escapeString(token)	+
−	} else {	+
−	var prefix = escapeString(token.prefix)	+
−	var capture = '(?:' + token.pattern + ')'	+
−		+
−	keys.push(token)	+
−		+
−	if (token.repeat) {	+
−	capture += '(?:' + prefix + capture + ')*'	+
−	}	+
−		+
−	if (token.optional) {	+
−	if (!token.partial) {	+
−	capture = '(?:' + prefix + '(' + capture + '))?'	+
−	} else {	+
−	capture = prefix + '(' + capture + ')?'	+
−	}	+
−	} else {	+
−	capture = prefix + '(' + capture + ')'	+
−	}	+
−		+
−	route += capture	+
−	}	+
−	}	+
−		+
−	var delimiter = escapeString(options.delimiter || '/')	+
−	var endsWithDelimiter = route.slice(-delimiter.length) === delimiter	+
−		+
−	// In non-strict mode we allow a slash at the end of match. If the path to	+
−	// match already ends with a slash, we remove it for consistency. The slash	+
−	// is valid at the end of a path match, not in the middle. This is important	+
−	// in non-ending mode, where "/test/" shouldn't match "/test//route".	+
−	if (!strict) {	+
−	route = (endsWithDelimiter ? route.slice(0, -delimiter.length) : route) + '(?:' + delimiter + '(?=$))?'	+
−	}	+
−		+
−	if (end) {	+
−	route += '$'	+
−	} else {	+
−	// In non-ending mode, we need the capturing groups to match as much as	+
−	// possible by using a positive lookahead to the end or next path segment.	+
−	route += strict && endsWithDelimiter ? '' : '(?=' + delimiter + '|$)'	+
−	}	+
−		+
−	return attachKeys(new RegExp('^' + route, flags(options)), keys)	+
−	}	+
−		+
−	/**	+
−	* Normalize the given path string, returning a regular expression.	+
−	*	+
−	* An empty array can be passed in for the keys, which will hold the	+
−	* placeholder key descriptions. For example, using `/user/:id`, `keys` will	+
−	* contain `[{ name: 'id', delimiter: '/', optional: false, repeat: false }]`.	+
−	*	+
−	* @param  {(string|RegExp|Array)} path	+
−	* @param  {(Array|Object)=}      keys	+
−	* @param  {Object=}              options	+
−	* @return {!RegExp}	+
−	*/	+
−	function pathToRegexp (path, keys, options) {	+
−	if (!isarray(keys)) {	+
−	options = /** @type {!Object} */ (keys || options)	+
−	keys = []	+
−	}	+
−		+
−	options = options || {}	+
−		+
−	if (path instanceof RegExp) {	+
−	return regexpToRegexp(path, /** @type {!Array} */ (keys))	+
−	}	+
−		+
−	if (isarray(path)) {	+
−	return arrayToRegexp(/** @type {!Array} */ (path), /** @type {!Array} */ (keys), options)	+
−	}	+
−		+
−	return stringToRegexp(/** @type {string} */ (path), /** @type {!Array} */ (keys), options)	+
−	}	+
−		+
−	index.parse = parse_1;	+
−	index.compile = compile_1;	+
−	index.tokensToFunction = tokensToFunction_1;	+
−	index.tokensToRegExp = tokensToRegExp_1;	+
−		+
−	/*  */	+
−		+
−	var regexpCache = Object.create(null)	+
−		+
−	function getRouteRegex (path) {	+
−	var hit = regexpCache[path]	+
−	var keys, regexp	+
−		+
−	if (hit) {	+
−	keys = hit.keys	+
−	regexp = hit.regexp	+
−	} else {	+
−	keys = []	+
−	regexp = index(path, keys)	+
−	regexpCache[path] = { keys: keys, regexp: regexp }	+
−	}	+
−		+
−	return { keys: keys, regexp: regexp }	+
−	}	+
−		+
−	var regexpCompileCache = Object.create(null)	+
−		+
−	function fillParams (	+
−	path,	+
−	params,	+
−	routeMsg	+
−	) {	+
−	try {	+
−	var filler =	+
−	regexpCompileCache[path] ||	+
−	(regexpCompileCache[path] = index.compile(path))	+
−	return filler(params || {}, { pretty: true })	+
−	} catch (e) {	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	warn(false, ("missing param for " + routeMsg + ": " + (e.message)))	+
−	}	+
−	return ''	+
−	}	+
−	}	+
−		+
−	/*  */	+
−		+
−	function normalizeLocation (	+
−	raw,	+
−	current,	+
−	append	+
−	) {	+
−	var next = typeof raw === 'string' ? { path: raw } : raw	+
−	// named target	+
−	if (next.name || next._normalized) {	+
−	return next	+
−	}	+
−		+
−	// relative params	+
−	if (!next.path && next.params && current) {	+
−	next = assign({}, next)	+
−	next._normalized = true	+
−	var params = assign(assign({}, current.params), next.params)	+
−	if (current.name) {	+
−	next.name = current.name	+
−	next.params = params	+
−	} else if (current.matched) {	+
−	var rawPath = current.matched[current.matched.length - 1].path	+
−	next.path = fillParams(rawPath, params, ("path " + (current.path)))	+
−	} else if (process.env.NODE_ENV !== 'production') {	+
−	warn(false, "relative params navigation requires a current route.")	+
−	}	+
−	return next	+
−	}	+
−		+
−	var parsedPath = parsePath(next.path || '')	+
−	var basePath = (current && current.path) || '/'	+
−	var path = parsedPath.path	+
−	? resolvePath(parsedPath.path, basePath, append || next.append)	+
−	: (current && current.path) || '/'	+
−	var query = resolveQuery(parsedPath.query, next.query)	+
−	var hash = next.hash || parsedPath.hash	+
−	if (hash && hash.charAt(0) !== '#') {	+
−	hash = "#" + hash	+
−	}	+
−		+
−	return {	+
−	_normalized: true,	+
−	path: path,	+
−	query: query,	+
−	hash: hash	+
−	}	+
−	}	+
−		+
−	function assign (a, b) {	+
−	for (var key in b) {	+
−	a[key] = b[key]	+
−	}	+
−	return a	+
−	}	+
−		+
−	/*  */	+
−		+
−	function createMatcher (routes) {	+
−	var ref = createRouteMap(routes);	+
−	var pathMap = ref.pathMap;	+
−	var nameMap = ref.nameMap;	+
−		+
−	function match (	+
−	raw,	+
−	currentRoute,	+
−	redirectedFrom	+
−	) {	+
−	var location = normalizeLocation(raw, currentRoute)	+
−	var name = location.name;	+
−		+
−	if (name) {	+
−	var record = nameMap[name]	+
−	var paramNames = getRouteRegex(record.path).keys	+
−	.filter(function (key) { return !key.optional; })	+
−	.map(function (key) { return key.name; })	+
−		+
−	if (typeof location.params !== 'object') {	+
−	location.params = {}	+
−	}	+
−		+
−	if (currentRoute && typeof currentRoute.params === 'object') {	+
−	for (var key in currentRoute.params) {	+
−	if (!(key in location.params) && paramNames.indexOf(key) > -1) {	+
−	location.params[key] = currentRoute.params[key]	+
−	}	+
−	}	+
−	}	+
−		+
−	if (record) {	+
−	location.path = fillParams(record.path, location.params, ("named route \"" + name + "\""))	+
−	return _createRoute(record, location, redirectedFrom)	+
−	}	+
−	} else if (location.path) {	+
−	location.params = {}	+
−	for (var path in pathMap) {	+
−	if (matchRoute(path, location.params, location.path)) {	+
−	return _createRoute(pathMap[path], location, redirectedFrom)	+
−	}	+
−	}	+
−	}	+
−	// no match	+
−	return _createRoute(null, location)	+
−	}	+
−		+
−	function redirect (	+
−	record,	+
−	location	+
−	) {	+
−	var originalRedirect = record.redirect	+
−	var redirect = typeof originalRedirect === 'function'	+
−	? originalRedirect(createRoute(record, location))	+
−	: originalRedirect	+
−		+
−	if (typeof redirect === 'string') {	+
−	redirect = { path: redirect }	+
−	}	+
−		+
−	if (!redirect || typeof redirect !== 'object') {	+
−	process.env.NODE_ENV !== 'production' && warn(	+
−	false, ("invalid redirect option: " + (JSON.stringify(redirect)))	+
−	)	+
−	return _createRoute(null, location)	+
−	}	+
−		+
−	var re = redirect	+
−	var name = re.name;	+
−	var path = re.path;	+
−	var query = location.query;	+
−	var hash = location.hash;	+
−	var params = location.params;	+
−	query = re.hasOwnProperty('query') ? re.query : query	+
−	hash = re.hasOwnProperty('hash') ? re.hash : hash	+
−	params = re.hasOwnProperty('params') ? re.params : params	+
−		+
−	if (name) {	+
−	// resolved named direct	+
−	var targetRecord = nameMap[name]	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	assert(targetRecord, ("redirect failed: named route \"" + name + "\" not found."))	+
−	}	+
−	return match({	+
−	_normalized: true,	+
−	name: name,	+
−	query: query,	+
−	hash: hash,	+
−	params: params	+
−	}, undefined, location)	+
−	} else if (path) {	+
−	// 1. resolve relative redirect	+
−	var rawPath = resolveRecordPath(path, record)	+
−	// 2. resolve params	+
−	var resolvedPath = fillParams(rawPath, params, ("redirect route with path \"" + rawPath + "\""))	+
−	// 3. rematch with existing query and hash	+
−	return match({	+
−	_normalized: true,	+
−	path: resolvedPath,	+
−	query: query,	+
−	hash: hash	+
−	}, undefined, location)	+
−	} else {	+
−	warn(false, ("invalid redirect option: " + (JSON.stringify(redirect))))	+
−	return _createRoute(null, location)	+
−	}	+
−	}	+
−		+
−	function alias (	+
−	record,	+
−	location,	+
−	matchAs	+
−	) {	+
−	var aliasedPath = fillParams(matchAs, location.params, ("aliased route with path \"" + matchAs + "\""))	+
−	var aliasedMatch = match({	+
−	_normalized: true,	+
−	path: aliasedPath	+
−	})	+
−	if (aliasedMatch) {	+
−	var matched = aliasedMatch.matched	+
−	var aliasedRecord = matched[matched.length - 1]	+
−	location.params = aliasedMatch.params	+
−	return _createRoute(aliasedRecord, location)	+
−	}	+
−	return _createRoute(null, location)	+
−	}	+
−		+
−	function _createRoute (	+
−	record,	+
−	location,	+
−	redirectedFrom	+
−	) {	+
−	if (record && record.redirect) {	+
−	return redirect(record, redirectedFrom || location)	+
−	}	+
−	if (record && record.matchAs) {	+
−	return alias(record, location, record.matchAs)	+
−	}	+
−	return createRoute(record, location, redirectedFrom)	+
−	}	+
−		+
−	return match	+
−	}	+
−		+
−	function matchRoute (	+
−	path,	+
−	params,	+
−	pathname	+
−	) {	+
−	var ref = getRouteRegex(path);	+
−	var regexp = ref.regexp;	+
−	var keys = ref.keys;	+
−	var m = pathname.match(regexp)	+
−		+
−	if (!m) {	+
−	return false	+
−	} else if (!params) {	+
−	return true	+
−	}	+
−		+
−	for (var i = 1, len = m.length; i < len; ++i) {	+
−	var key = keys[i - 1]	+
−	var val = typeof m[i] === 'string' ? decodeURIComponent(m[i]) : m[i]	+
−	if (key) { params[key.name] = val }	+
−	}	+
−		+
−	return true	+
−	}	+
−		+
−	function resolveRecordPath (path, record) {	+
−	return resolvePath(path, record.parent ? record.parent.path : '/', true)	+
−	}	+
−		+
−	/*  */	+
−		+
−	var inBrowser = typeof window !== 'undefined'	+
−		+
−	var supportsHistory = inBrowser && (function () {	+
−	var ua = window.navigator.userAgent	+
−		+
−	if (	+
−	(ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) &&	+
−	ua.indexOf('Mobile Safari') !== -1 &&	+
−	ua.indexOf('Chrome') === -1 &&	+
−	ua.indexOf('Windows Phone') === -1	+
−	) {	+
−	return false	+
−	}	+
−		+
−	return window.history && 'pushState' in window.history	+
−	})()	+
−		+
−	/*  */	+
−		+
−	function runQueue (queue, fn, cb) {	+
−	var step = function (index) {	+
−	if (index >= queue.length) {	+
−	cb()	+
−	} else {	+
−	if (queue[index]) {	+
−	fn(queue[index], function () {	+
−	step(index + 1)	+
−	})	+
−	} else {	+
−	step(index + 1)	+
−	}	+
−	}	+
−	}	+
−	step(0)	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var History = function History (router, base) {	+
−	this.router = router	+
−	this.base = normalizeBase(base)	+
−	// start with a route object that stands for "nowhere"	+
−	this.current = START	+
−	this.pending = null	+
−	};	+
−		+
−	History.prototype.listen = function listen (cb) {	+
−	this.cb = cb	+
−	};	+
−		+
−	History.prototype.transitionTo = function transitionTo (location, onComplete, onAbort) {	+
−	var this$1 = this;	+
−		+
−	var route = this.router.match(location, this.current)	+
−	this.confirmTransition(route, function () {	+
−	this$1.updateRoute(route)	+
−	onComplete && onComplete(route)	+
−	this$1.ensureURL()	+
−	}, onAbort)	+
−	};	+
−		+
−	History.prototype.confirmTransition = function confirmTransition (route, onComplete, onAbort) {	+
−	var this$1 = this;	+
−		+
−	var current = this.current	+
−	var abort = function () { onAbort && onAbort() }	+
−	if (isSameRoute(route, current)) {	+
−	this.ensureURL()	+
−	return abort()	+
−	}	+
−		+
−	var ref = resolveQueue(this.current.matched, route.matched);	+
−	var deactivated = ref.deactivated;	+
−	var activated = ref.activated;	+
−		+
−	var queue = [].concat(	+
−	// in-component leave guards	+
−	extractLeaveGuards(deactivated),	+
−	// global before hooks	+
−	this.router.beforeHooks,	+
−	// enter guards	+
−	activated.map(function (m) { return m.beforeEnter; }),	+
−	// async components	+
−	resolveAsyncComponents(activated)	+
−	)	+
−		+
−	this.pending = route	+
−	var iterator = function (hook, next) {	+
−	if (this$1.pending !== route) {	+
−	return abort()	+
−	}	+
−	hook(route, current, function (to) {	+
−	if (to === false) {	+
−	// next(false) -> abort navigation, ensure current URL	+
−	this$1.ensureURL(true)	+
−	abort()	+
−	} else if (typeof to === 'string' || typeof to === 'object') {	+
−	// next('/') or next({ path: '/' }) -> redirect	+
−	(typeof to === 'object' && to.replace) ? this$1.replace(to) : this$1.push(to)	+
−	abort()	+
−	} else {	+
−	// confirm transition and pass on the value	+
−	next(to)	+
−	}	+
−	})	+
−	}	+
−		+
−	runQueue(queue, iterator, function () {	+
−	var postEnterCbs = []	+
−	var enterGuards = extractEnterGuards(activated, postEnterCbs, function () {	+
−	return this$1.current === route	+
−	})	+
−	// wait until async components are resolved before	+
−	// extracting in-component enter guards	+
−	runQueue(enterGuards, iterator, function () {	+
−	if (this$1.pending !== route) {	+
−	return abort()	+
−	}	+
−	this$1.pending = null	+
−	onComplete(route)	+
−	if (this$1.router.app) {	+
−	this$1.router.app.$nextTick(function () {	+
−	postEnterCbs.forEach(function (cb) { return cb(); })	+
−	})	+
−	}	+
−	})	+
−	})	+
−	};	+
−		+
−	History.prototype.updateRoute = function updateRoute (route) {	+
−	var prev = this.current	+
−	this.current = route	+
−	this.cb && this.cb(route)	+
−	this.router.afterHooks.forEach(function (hook) {	+
−	hook && hook(route, prev)	+
−	})	+
−	};	+
−		+
−	function normalizeBase (base) {	+
−	if (!base) {	+
−	if (inBrowser) {	+
−	// respect <base> tag	+
−	var baseEl = document.querySelector('base')	+
−	base = baseEl ? baseEl.getAttribute('href') : '/'	+
−	} else {	+
−	base = '/'	+
−	}	+
−	}	+
−	// make sure there's the starting slash	+
−	if (base.charAt(0) !== '/') {	+
−	base = '/' + base	+
−	}	+
−	// remove trailing slash	+
−	return base.replace(/\/$/, '')	+
−	}	+
−		+
−	function resolveQueue (	+
−	current,	+
−	next	+
−	) {	+
−	var i	+
−	var max = Math.max(current.length, next.length)	+
−	for (i = 0; i < max; i++) {	+
−	if (current[i] !== next[i]) {	+
−	break	+
−	}	+
−	}	+
−	return {	+
−	activated: next.slice(i),	+
−	deactivated: current.slice(i)	+
−	}	+
−	}	+
−		+
−	function extractGuard (	+
−	def,	+
−	key	+
−	) {	+
−	if (typeof def !== 'function') {	+
−	// extend now so that global mixins are applied.	+
−	def = _Vue.extend(def)	+
−	}	+
−	return def.options[key]	+
−	}	+
−		+
−	function extractLeaveGuards (matched) {	+
−	return flatten(flatMapComponents(matched, function (def, instance) {	+
−	var guard = extractGuard(def, 'beforeRouteLeave')	+
−	if (guard) {	+
−	return Array.isArray(guard)	+
−	? guard.map(function (guard) { return wrapLeaveGuard(guard, instance); })	+
−	: wrapLeaveGuard(guard, instance)	+
−	}	+
−	}).reverse())	+
−	}	+
−		+
−	function wrapLeaveGuard (	+
−	guard,	+
−	instance	+
−	) {	+
−	return function routeLeaveGuard () {	+
−	return guard.apply(instance, arguments)	+
−	}	+
−	}	+
−		+
−	function extractEnterGuards (	+
−	matched,	+
−	cbs,	+
−	isValid	+
−	) {	+
−	return flatten(flatMapComponents(matched, function (def, _, match, key) {	+
−	var guard = extractGuard(def, 'beforeRouteEnter')	+
−	if (guard) {	+
−	return Array.isArray(guard)	+
−	? guard.map(function (guard) { return wrapEnterGuard(guard, cbs, match, key, isValid); })	+
−	: wrapEnterGuard(guard, cbs, match, key, isValid)	+
−	}	+
−	}))	+
−	}	+
−		+
−	function wrapEnterGuard (	+
−	guard,	+
−	cbs,	+
−	match,	+
−	key,	+
−	isValid	+
−	) {	+
−	return function routeEnterGuard (to, from, next) {	+
−	return guard(to, from, function (cb) {	+
−	next(cb)	+
−	if (typeof cb === 'function') {	+
−	cbs.push(function () {	+
−	// #750	+
−	// if a router-view is wrapped with an out-in transition,	+
−	// the instance may not have been registered at this time.	+
−	// we will need to poll for registration until current route	+
−	// is no longer valid.	+
−	poll(cb, match.instances, key, isValid)	+
−	})	+
−	}	+
−	})	+
−	}	+
−	}	+
−		+
−	function poll (	+
−	cb, // somehow flow cannot infer this is a function	+
−	instances,	+
−	key,	+
−	isValid	+
−	) {	+
−	if (instances[key]) {	+
−	cb(instances[key])	+
−	} else if (isValid()) {	+
−	setTimeout(function () {	+
−	poll(cb, instances, key, isValid)	+
−	}, 16)	+
−	}	+
−	}	+
−		+
−	function resolveAsyncComponents (matched) {	+
−	return flatMapComponents(matched, function (def, _, match, key) {	+
−	// if it's a function and doesn't have Vue options attached,	+
−	// assume it's an async component resolve function.	+
−	// we are not using Vue's default async resolving mechanism because	+
−	// we want to halt the navigation until the incoming component has been	+
−	// resolved.	+
−	if (typeof def === 'function' && !def.options) {	+
−	return function (to, from, next) {	+
−	var resolve = function (resolvedDef) {	+
−	match.components[key] = resolvedDef	+
−	next()	+
−	}	+
−		+
−	var reject = function (reason) {	+
−	warn(false, ("Failed to resolve async component " + key + ": " + reason))	+
−	next(false)	+
−	}	+
−		+
−	var res = def(resolve, reject)	+
−	if (res && typeof res.then === 'function') {	+
−	res.then(resolve, reject)	+
−	}	+
−	}	+
−	}	+
−	})	+
−	}	+
−		+
−	function flatMapComponents (	+
−	matched,	+
−	fn	+
−	) {	+
−	return flatten(matched.map(function (m) {	+
−	return Object.keys(m.components).map(function (key) { return fn(	+
−	m.components[key],	+
−	m.instances[key],	+
−	m, key	+
−	); })	+
−	}))	+
−	}	+
−		+
−	function flatten (arr) {	+
−	return Array.prototype.concat.apply([], arr)	+
−	}	+
−		+
−	/*  */	+
−		+
−	var positionStore = Object.create(null)	+
−		+
−	function saveScrollPosition (key) {	+
−	if (!key) { return }	+
−	positionStore[key] = {	+
−	x: window.pageXOffset,	+
−	y: window.pageYOffset	+
−	}	+
−	}	+
−		+
−	function getScrollPosition (key) {	+
−	if (!key) { return }	+
−	return positionStore[key]	+
−	}	+
−		+
−	function getElementPosition (el) {	+
−	var docRect = document.documentElement.getBoundingClientRect()	+
−	var elRect = el.getBoundingClientRect()	+
−	return {	+
−	x: elRect.left - docRect.left,	+
−	y: elRect.top - docRect.top	+
−	}	+
−	}	+
−		+
−	function isValidPosition (obj) {	+
−	return isNumber(obj.x) || isNumber(obj.y)	+
−	}	+
−		+
−	function normalizePosition (obj) {	+
−	return {	+
−	x: isNumber(obj.x) ? obj.x : window.pageXOffset,	+
−	y: isNumber(obj.y) ? obj.y : window.pageYOffset	+
−	}	+
−	}	+
−		+
−	function isNumber (v) {	+
−	return typeof v === 'number'	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var genKey = function () { return String(Date.now()); }	+
−	var _key = genKey()	+
−		+
−	var HTML5History = (function (History) {	+
−	function HTML5History (router, base) {	+
−	var this$1 = this;	+
−		+
−	History.call(this, router, base)	+
−		+
−	var expectScroll = router.options.scrollBehavior	+
−	window.addEventListener('popstate', function (e) {	+
−	_key = e.state && e.state.key	+
−	var current = this$1.current	+
−	this$1.transitionTo(getLocation(this$1.base), function (next) {	+
−	if (expectScroll) {	+
−	this$1.handleScroll(next, current, true)	+
−	}	+
−	})	+
−	})	+
−		+
−	if (expectScroll) {	+
−	window.addEventListener('scroll', function () {	+
−	saveScrollPosition(_key)	+
−	})	+
−	}	+
−	}	+
−		+
−	if ( History ) HTML5History.__proto__ = History;	+
−	HTML5History.prototype = Object.create( History && History.prototype );	+
−	HTML5History.prototype.constructor = HTML5History;	+
−		+
−	HTML5History.prototype.go = function go (n) {	+
−	window.history.go(n)	+
−	};	+
−		+
−	HTML5History.prototype.push = function push (location) {	+
−	var this$1 = this;	+
−		+
−	var current = this.current	+
−	this.transitionTo(location, function (route) {	+
−	pushState(cleanPath(this$1.base + route.fullPath))	+
−	this$1.handleScroll(route, current, false)	+
−	})	+
−	};	+
−		+
−	HTML5History.prototype.replace = function replace (location) {	+
−	var this$1 = this;	+
−		+
−	var current = this.current	+
−	this.transitionTo(location, function (route) {	+
−	replaceState(cleanPath(this$1.base + route.fullPath))	+
−	this$1.handleScroll(route, current, false)	+
−	})	+
−	};	+
−		+
−	HTML5History.prototype.ensureURL = function ensureURL (push) {	+
−	if (getLocation(this.base) !== this.current.fullPath) {	+
−	var current = cleanPath(this.base + this.current.fullPath)	+
−	push ? pushState(current) : replaceState(current)	+
−	}	+
−	};	+
−		+
−	HTML5History.prototype.handleScroll = function handleScroll (to, from, isPop) {	+
−	var router = this.router	+
−	if (!router.app) {	+
−	return	+
−	}	+
−		+
−	var behavior = router.options.scrollBehavior	+
−	if (!behavior) {	+
−	return	+
−	}	+
−	if (process.env.NODE_ENV !== 'production') {	+
−	assert(typeof behavior === 'function', "scrollBehavior must be a function")	+
−	}	+
−		+
−	// wait until re-render finishes before scrolling	+
−	router.app.$nextTick(function () {	+
−	var position = getScrollPosition(_key)	+
−	var shouldScroll = behavior(to, from, isPop ? position : null)	+
−	if (!shouldScroll) {	+
−	return	+
−	}	+
−	var isObject = typeof shouldScroll === 'object'	+
−	if (isObject && typeof shouldScroll.selector === 'string') {	+
−	var el = document.querySelector(shouldScroll.selector)	+
−	if (el) {	+
−	position = getElementPosition(el)	+
−	} else if (isValidPosition(shouldScroll)) {	+
−	position = normalizePosition(shouldScroll)	+
−	}	+
−	} else if (isObject && isValidPosition(shouldScroll)) {	+
−	position = normalizePosition(shouldScroll)	+
−	}	+
−		+
−	if (position) {	+
−	window.scrollTo(position.x, position.y)	+
−	}	+
−	})	+
−	};	+
−		+
−	return HTML5History;	+
−	}(History));	+
−		+
−	function getLocation (base) {	+
−	var path = window.location.pathname	+
−	if (base && path.indexOf(base) === 0) {	+
−	path = path.slice(base.length)	+
−	}	+
−	return (path || '/') + window.location.search + window.location.hash	+
−	}	+
−		+
−	function pushState (url, replace) {	+
−	// try...catch the pushState call to get around Safari	+
−	// DOM Exception 18 where it limits to 100 pushState calls	+
−	var history = window.history	+
−	try {	+
−	if (replace) {	+
−	history.replaceState({ key: _key }, '', url)	+
−	} else {	+
−	_key = genKey()	+
−	history.pushState({ key: _key }, '', url)	+
−	}	+
−	saveScrollPosition(_key)	+
−	} catch (e) {	+
−	window.location[replace ? 'assign' : 'replace'](url)	+
−	}	+
−	}	+
−		+
−	function replaceState (url) {	+
−	pushState(url, true)	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var HashHistory = (function (History) {	+
−	function HashHistory (router, base, fallback) {	+
−	History.call(this, router, base)	+
−	// check history fallback deeplinking	+
−	if (fallback && this.checkFallback()) {	+
−	return	+
−	}	+
−	ensureSlash()	+
−	}	+
−		+
−	if ( History ) HashHistory.__proto__ = History;	+
−	HashHistory.prototype = Object.create( History && History.prototype );	+
−	HashHistory.prototype.constructor = HashHistory;	+
−		+
−	HashHistory.prototype.checkFallback = function checkFallback () {	+
−	var location = getLocation(this.base)	+
−	if (!/^\/#/.test(location)) {	+
−	window.location.replace(	+
−	cleanPath(this.base + '/#' + location)	+
−	)	+
−	return true	+
−	}	+
−	};	+
−		+
−	HashHistory.prototype.onHashChange = function onHashChange () {	+
−	if (!ensureSlash()) {	+
−	return	+
−	}	+
−	this.transitionTo(getHash(), function (route) {	+
−	replaceHash(route.fullPath)	+
−	})	+
−	};	+
−		+
−	HashHistory.prototype.push = function push (location) {	+
−	this.transitionTo(location, function (route) {	+
−	pushHash(route.fullPath)	+
−	})	+
−	};	+
−		+
−	HashHistory.prototype.replace = function replace (location) {	+
−	this.transitionTo(location, function (route) {	+
−	replaceHash(route.fullPath)	+
−	})	+
−	};	+
−		+
−	HashHistory.prototype.go = function go (n) {	+
−	window.history.go(n)	+
−	};	+
−		+
−	HashHistory.prototype.ensureURL = function ensureURL (push) {	+
−	var current = this.current.fullPath	+
−	if (getHash() !== current) {	+
−	push ? pushHash(current) : replaceHash(current)	+
−	}	+
−	};	+
−		+
−	return HashHistory;	+
−	}(History));	+
−		+
−	function ensureSlash () {	+
−	var path = getHash()	+
−	if (path.charAt(0) === '/') {	+
−	return true	+
−	}	+
−	replaceHash('/' + path)	+
−	return false	+
−	}	+
−		+
−	function getHash () {	+
−	// We can't use window.location.hash here because it's not	+
−	// consistent across browsers - Firefox will pre-decode it!	+
−	var href = window.location.href	+
−	var index = href.indexOf('#')	+
−	return index === -1 ? '' : href.slice(index + 1)	+
−	}	+
−		+
−	function pushHash (path) {	+
−	window.location.hash = path	+
−	}	+
−		+
−	function replaceHash (path) {	+
−	var i = window.location.href.indexOf('#')	+
−	window.location.replace(	+
−	window.location.href.slice(0, i >= 0 ? i : 0) + '#' + path	+
−	)	+
−	}	+
−		+
−	/*  */	+
−		+
−		+
−	var AbstractHistory = (function (History) {	+
−	function AbstractHistory (router) {	+
−	History.call(this, router)	+
−	this.stack = []	+
−	this.index = -1	+
−	}	+
−		+
−	if ( History ) AbstractHistory.__proto__ = History;	+
−	AbstractHistory.prototype = Object.create( History && History.prototype );	+
−	AbstractHistory.prototype.constructor = AbstractHistory;	+
−		+
−	AbstractHistory.prototype.push = function push (location) {	+
−	var this$1 = this;	+
−		+
−	this.transitionTo(location, function (route) {	+
−	this$1.stack = this$1.stack.slice(0, this$1.index + 1).concat(route)	+
−	this$1.index++	+
−	})	+
−	};	+
−		+
−	AbstractHistory.prototype.replace = function replace (location) {	+
−	var this$1 = this;	+
−		+
−	this.transitionTo(location, function (route) {	+
−	this$1.stack = this$1.stack.slice(0, this$1.index).concat(route)	+
−	})	+
−	};	+
−		+
−	AbstractHistory.prototype.go = function go (n) {	+
−	var this$1 = this;	+
−		+
−	var targetIndex = this.index + n	+
−	if (targetIndex < 0 || targetIndex >= this.stack.length) {	+
−	return	+
−	}	+
−	var route = this.stack[targetIndex]	+
−	this.confirmTransition(route, function () {	+
−	this$1.index = targetIndex	+
−	this$1.updateRoute(route)	+
−	})	+
−	};	+
−		+
−	AbstractHistory.prototype.ensureURL = function ensureURL () {	+
−	// noop	+
−	};	+
−		+
−	return AbstractHistory;	+
−	}(History));	+
−		+
−	/*  */	+
−		+
−	var VueRouter = function VueRouter (options) {	+
−	if ( options === void 0 ) options = {};	+
−		+
−	this.app = null	+
−	this.options = options	+
−	this.beforeHooks = []	+
−	this.afterHooks = []	+
−	this.match = createMatcher(options.routes || [])	+
−		+
−	var mode = options.mode || 'hash'	+
−	this.fallback = mode === 'history' && !supportsHistory	+
−	if (this.fallback) {	+
−	mode = 'hash'	+
−	}	+
−	if (!inBrowser) {	+
−	mode = 'abstract'	+
−	}	+
−	this.mode = mode	+
−		+
−	switch (mode) {	+
−	case 'history':	+
−	this.history = new HTML5History(this, options.base)	+
−	break	+
−	case 'hash':	+
−	this.history = new HashHistory(this, options.base, this.fallback)	+
−	break	+
−	case 'abstract':	+
−	this.history = new AbstractHistory(this)	+
−	break	+
−	default:	+
−	process.env.NODE_ENV !== 'production' && assert(false, ("invalid mode: " + mode))	+
−	}	+
−	};	+
−		+
−	var prototypeAccessors = { currentRoute: {} };	+
−		+
−	prototypeAccessors.currentRoute.get = function () {	+
−	return this.history && this.history.current	+
−	};	+
−		+
−	VueRouter.prototype.init = function init (app /* Vue component instance */) {	+
−	var this$1 = this;	+
−		+
−	process.env.NODE_ENV !== 'production' && assert(	+
−	install.installed,	+
−	"not installed. Make sure to call `Vue.use(VueRouter)` " +	+
−	"before creating root instance."	+
−	)	+
−		+
−	this.app = app	+
−		+
−	var history = this.history	+
−		+
−	if (history instanceof HTML5History) {	+
−	history.transitionTo(getLocation(history.base))	+
−	} else if (history instanceof HashHistory) {	+
−	var setupHashListener = function () {	+
−	window.addEventListener('hashchange', function () {	+
−	history.onHashChange()	+
−	})	+
−	}	+
−	history.transitionTo(getHash(), setupHashListener, setupHashListener)	+
−	}	+
−		+
−	history.listen(function (route) {	+
−	this$1.app._route = route	+
−	})	+
−	};	+
−		+
−	VueRouter.prototype.beforeEach = function beforeEach (fn) {	+
−	this.beforeHooks.push(fn)	+
−	};	+
−		+
−	VueRouter.prototype.afterEach = function afterEach (fn) {	+
−	this.afterHooks.push(fn)	+
−	};	+
−		+
−	VueRouter.prototype.push = function push (location) {	+
−	this.history.push(location)	+
−	};	+
−		+
−	VueRouter.prototype.replace = function replace (location) {	+
−	this.history.replace(location)	+
−	};	+
−		+
−	VueRouter.prototype.go = function go (n) {	+
−	this.history.go(n)	+
−	};	+
−		+
−	VueRouter.prototype.back = function back () {	+
−	this.go(-1)	+
−	};	+
−		+
−	VueRouter.prototype.forward = function forward () {	+
−	this.go(1)	+
−	};	+
−		+
−	VueRouter.prototype.getMatchedComponents = function getMatchedComponents (to) {	+
−	var route = to	+
−	? this.resolve(to).resolved	+
−	: this.currentRoute	+
−	if (!route) {	+
−	return []	+
−	}	+
−	return [].concat.apply([], route.matched.map(function (m) {	+
−	return Object.keys(m.components).map(function (key) {	+
−	return m.components[key]	+
−	})	+
−	}))	+
−	};	+
−		+
−	VueRouter.prototype.resolve = function resolve (	+
−	to,	+
−	current,	+
−	append	+
−	) {	+
−	var normalizedTo = normalizeLocation(to, current || this.history.current, append)	+
−	var resolved = this.match(normalizedTo, current)	+
−	var fullPath = resolved.redirectedFrom || resolved.fullPath	+
−	var base = this.history.base	+
−	var href = createHref(base, fullPath, this.mode)	+
−	return {	+
−	normalizedTo: normalizedTo,	+
−	resolved: resolved,	+
−	href: href	+
−	}	+
−	};	+
−		+
−	Object.defineProperties( VueRouter.prototype, prototypeAccessors );	+
−		+
−	function createHref (base, fullPath, mode) {	+
−	var path = mode === 'hash' ? '#' + fullPath : fullPath	+
−	return base ? cleanPath(base + '/' + path) : path	+
−	}	+
−		+
−	VueRouter.install = install	+
−		+
−	if (inBrowser && window.Vue) {	+
−	window.Vue.use(VueRouter)	+
−	}	+
−		+
−	module.exports = VueRouter;	+
−	/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(3)))	+
−		+
−	/***/ },	+
−		+
−	/***/ 698:	+
−	/***/ function(module, exports) {	+
−		+
−	'use strict';	+
−		+
−	var env = {	+
−	PORT: '3000',	+
−	NODE_ENV: 'test'	+
−	};	+
−		+
−	exports.config = env;	+
−		+
−	/***/ }	+
−		+
−	/******/ });	+

---

Latest revision as of 08:48, 25 October 2017

!function(t){function e(n){if(r[n])return r[n].exports;var o=r[n]={exports:{},id:n,loaded:!1};return t[n].call(o.exports,o,o.exports,e),o.loaded=!0,o.exports}var n=window.webpackJsonp;window.webpackJsonp=function(i,a){for(var s,u,c=0,l=[];c<i.length;c++)u=i[c],o[u]&&l.push.apply(l,o[u]),o[u]=0;for(s in a)t[s]=a[s];for(n&&n(i,a);l.length;)l.shift().call(null,e);if(a[0])return r[0]=0,e(0)};var r={},o={1:0};return e.e=function(t,n){if(0===o[t])return n.call(null,e);if(void 0!==o[t])o[t].push(n);else{o[t]=[n];var r=document.getElementsByTagName("head")[0],i=document.createElement("script");i.type="text/javascript",i.charset="utf-8",i.async=!0,i.src=e.p+""+t+".ca91e93d.js",r.appendChild(i)}},e.m=t,e.c=r,e.p="/dist/",e(0)}({0:function(t,e,n){n(2),n(4),t.exports=n(33)},2:function(t,e,n){(function(e,n){/*! * Vue.js v2.1.8 * (c) 2014-2016 Evan You * Released under the MIT License. */ "use strict";function r(t){return null==t?"":"object"==typeof t?JSON.stringify(t,null,2):String(t)}function o(t){var e=parseFloat(t,10);return e||0===e?e:t}function i(t,e){for(var n=Object.create(null),r=t.split(","),o=0;o<r.length;o++)n[r[o]]=!0;return e?function(t){return n[t.toLowerCase()]}:function(t){return n[t]}}function a(t,e){if(t.length){var n=t.indexOf(e);if(n>-1)return t.splice(n,1)}}function s(t,e){return kn.call(t,e)}function u(t){return"string"==typeof t||"number"==typeof t}function c(t){var e=Object.create(null);return function(n){var r=e[n];return r||(e[n]=t(n))}}function l(t,e){function n(n){var r=arguments.length;return r?r>1?t.apply(e,arguments):t.call(e,n):t.call(e)}return n._length=t.length,n}function p(t,e){e=e||0;for(var n=t.length-e,r=new Array(n);n--;)r[n]=t[n+e];return r}function f(t,e){for(var n in e)t[n]=e[n];return t}function d(t){return null!==t&&"object"==typeof t}function h(t){return Sn.call(t)===Tn}function v(t){for(var e={},n=0;n<t.length;n++)t[n]&&f(e,t[n]);return e}function m(){}function y(t){return t.reduce(function(t,e){return t.concat(e.staticKeys||[])},[]).join(",")}function g(t,e){var n=d(t),r=d(e);return n&&r?JSON.stringify(t)===JSON.stringify(e):!n&&!r&&String(t)===String(e)}function _(t,e){for(var n=0;n<t.length;n++)if(g(t[n],e))return n;return-1}function b(t){var e=(t+"").charCodeAt(0);return 36===e||95===e}function w(t,e,n,r){Object.defineProperty(t,e,{value:n,enumerable:!!r,writable:!0,configurable:!0})}function E(t){if(!Rn.test(t)){var e=t.split(".");return function(t){for(var n=0;n<e.length;n++){if(!t)return;t=t[e[n]]}return t}}}function O(t){return/native code/.test(t.toString())}function x(t){Qn.target&&tr.push(Qn.target),Qn.target=t}function k(){Qn.target=tr.pop()}function N(t,e){t.__proto__=e}function C(t,e,n){for(var r=0,o=n.length;r<o;r++){var i=n[r];w(t,i,e[i])}}function A(t,e){if(d(t)){var n;return s(t,"__ob__")&&t.__ob__ instanceof ir?n=t.__ob__:or.shouldConvert&&!zn()&&(Array.isArray(t)||h(t))&&Object.isExtensible(t)&&!t._isVue&&(n=new ir(t)),e&&n&&n.vmCount++,n}}function $(t,n,r,o){var i=new Qn,a=Object.getOwnPropertyDescriptor(t,n);if(!a||a.configurable!==!1){var s=a&&a.get,u=a&&a.set,c=A(r);Object.defineProperty(t,n,{enumerable:!0,configurable:!0,get:function(){var e=s?s.call(t):r;return Qn.target&&(i.depend(),c&&c.dep.depend(),Array.isArray(e)&&T(e)),e},set:function(n){var a=s?s.call(t):r;n===a||n!==n&&a!==a||("production"!==e.env.NODE_ENV&&o&&o(),u?u.call(t,n):r=n,c=A(n),i.notify())}})}}function D(t,n,r){if(Array.isArray(t))return t.length=Math.max(t.length,n),t.splice(n,1,r),r;if(s(t,n))return void(t[n]=r);var o=t.__ob__;return t._isVue||o&&o.vmCount?void("production"!==e.env.NODE_ENV&&Yn("Avoid adding reactive properties to a Vue instance or its root $data at runtime - declare it upfront in the data option.")):o?($(o.value,n,r),o.dep.notify(),r):void(t[n]=r)}function S(t,n){var r=t.__ob__;return t._isVue||r&&r.vmCount?void("production"!==e.env.NODE_ENV&&Yn("Avoid deleting properties on a Vue instance or its root $data - just set it to null.")):void(s(t,n)&&(delete t[n],r&&r.dep.notify()))}function T(t){for(var e=void 0,n=0,r=t.length;n<r;n++)e=t[n],e&&e.__ob__&&e.__ob__.dep.depend(),Array.isArray(e)&&T(e)}function j(t,e){if(!e)return t;for(var n,r,o,i=Object.keys(e),a=0;a<i.length;a++)n=i[a],r=t[n],o=e[n],s(t,n)?h(r)&&h(o)&&j(r,o):D(t,n,o);return t}function V(t,e){return e?t?t.concat(e):Array.isArray(e)?e:[e]:t}function P(t,e){var n=Object.create(t||null);return e?f(n,e):n}function R(t){for(var e in t.components){var n=e.toLowerCase();(xn(n)||Pn.isReservedTag(n))&&Yn("Do not use built-in or reserved HTML elements as component id: "+e)}}function L(t){var n=t.props;if(n){var r,o,i,a={};if(Array.isArray(n))for(r=n.length;r--;)o=n[r],"string"==typeof o?(i=Cn(o),a[i]={type:null}):"production"!==e.env.NODE_ENV&&Yn("props must be strings when using array syntax.");else if(h(n))for(var s in n)o=n[s],i=Cn(s),a[i]=h(o)?o:{type:o};t.props=a}}function M(t){var e=t.directives;if(e)for(var n in e){var r=e[n];"function"==typeof r&&(e[n]={bind:r,update:r})}}function I(t,n,r){function o(e){var o=ar[e]||ur;p[e]=o(t[e],n[e],r,e)}"production"!==e.env.NODE_ENV&&R(n),L(n),M(n);var i=n.extends;if(i&&(t="function"==typeof i?I(t,i.options,r):I(t,i,r)),n.mixins)for(var a=0,u=n.mixins.length;a<u;a++){var c=n.mixins[a];c.prototype instanceof Wt&&(c=c.options),t=I(t,c,r)}var l,p={};for(l in t)o(l);for(l in n)s(t,l)||o(l);return p}function U(t,n,r,o){if("string"==typeof r){var i=t[n];if(s(i,r))return i[r];var a=Cn(r);if(s(i,a))return i[a];var u=An(a);if(s(i,u))return i[u];var c=i[r]||i[a]||i[u];return"production"!==e.env.NODE_ENV&&o&&!c&&Yn("Failed to resolve "+n.slice(0,-1)+": "+r,t),c}}function q(t,n,r,o){var i=n[t],a=!s(r,t),u=r[t];if(J(Boolean,i.type)&&(a&&!s(i,"default")?u=!1:J(String,i.type)||""!==u&&u!==Dn(t)||(u=!0)),void 0===u){u=B(o,i,t);var c=or.shouldConvert;or.shouldConvert=!0,A(u),or.shouldConvert=c}return"production"!==e.env.NODE_ENV&&F(i,t,u,o,a),u}function B(t,n,r){if(s(n,"default")){var o=n.default;return d(o)&&"production"!==e.env.NODE_ENV&&Yn('Invalid default value for prop "'+r+'": Props with type Object/Array must use a factory function to return the default value.',t),t&&t.$options.propsData&&void 0===t.$options.propsData[r]&&void 0!==t[r]?t[r]:"function"==typeof o&&n.type!==Function?o.call(t):o}}function F(t,e,n,r,o){if(t.required&&o)return void Yn('Missing required prop: "'+e+'"',r);if(null!=n||t.required){var i=t.type,a=!i||i===!0,s=[];if(i){Array.isArray(i)||(i=[i]);for(var u=0;u<i.length&&!a;u++){var c=H(n,i[u]);s.push(c.expectedType||""),a=c.valid}}if(!a)return void Yn('Invalid prop: type check failed for prop "'+e+'". Expected '+s.map(An).join(", ")+", got "+Object.prototype.toString.call(n).slice(8,-1)+".",r);var l=t.validator;l&&(l(n)||Yn('Invalid prop: custom validator check failed for prop "'+e+'".',r))}}function H(t,e){var n,r=z(e);return n="String"===r?typeof t==(r="string"):"Number"===r?typeof t==(r="number"):"Boolean"===r?typeof t==(r="boolean"):"Function"===r?typeof t==(r="function"):"Object"===r?h(t):"Array"===r?Array.isArray(t):t instanceof e,{valid:n,expectedType:r}}function z(t){var e=t&&t.toString().match(/^\s*function (\w+)/);return e&&e[1]}function J(t,e){if(!Array.isArray(e))return z(e)===z(t);for(var n=0,r=e.length;n<r;n++)if(z(e[n])===z(t))return!0;return!1}function K(){mr.length=0,yr={},"production"!==e.env.NODE_ENV&&(gr={}),_r=br=!1}function W(){for(br=!0,mr.sort(function(t,e){return t.id-e.id}),wr=0;wr<mr.length;wr++){var t=mr[wr],n=t.id;if(yr[n]=null,t.run(),"production"!==e.env.NODE_ENV&&null!=yr[n]&&(gr[n]=(gr[n]||0)+1,gr[n]>Pn._maxUpdateCount)){Yn("You may have an infinite update loop "+(t.user?'in watcher with expression "'+t.expression+'"':"in a component render function."),t.vm);break}}Jn&&Pn.devtools&&Jn.emit("flush"),K()}function Y(t){var e=t.id;if(null==yr[e]){if(yr[e]=!0,br){for(var n=mr.length-1;n>=0&&mr[n].id>t.id;)n--;mr.splice(Math.max(n,wr)+1,0,t)}else mr.push(t);_r||(_r=!0,Kn(W))}}function Z(t){kr.clear(),G(t,kr)}function G(t,e){var n,r,o=Array.isArray(t);if((o||d(t))&&Object.isExtensible(t)){if(t.__ob__){var i=t.__ob__.dep.id;if(e.has(i))return;e.add(i)}if(o)for(n=t.length;n--;)G(t[n],e);else for(r=Object.keys(t),n=r.length;n--;)G(t[r[n]],e)}}function X(t){t._watchers=[];var e=t.$options;e.props&&Q(t,e.props),e.methods&&rt(t,e.methods),e.data?tt(t):A(t._data={},!0),e.computed&&et(t,e.computed),e.watch&&ot(t,e.watch)}function Q(t,n){var r=t.$options.propsData||{},o=t.$options._propKeys=Object.keys(n),i=!t.$parent;or.shouldConvert=i;for(var a=function(i){var a=o[i];"production"!==e.env.NODE_ENV?(Nr[a]&&Yn('"'+a+'" is a reserved attribute and cannot be used as component prop.',t),$(t,a,q(a,n,r,t),function(){t.$parent&&!or.isSettingProps&&Yn("Avoid mutating a prop directly since the value will be overwritten whenever the parent component re-renders. Instead, use a data or computed property based on the prop's value. Prop being mutated: \""+a+'"',t)})):$(t,a,q(a,n,r,t))},s=0;s<o.length;s++)a(s);or.shouldConvert=!0}function tt(t){var n=t.$options.data;n=t._data="function"==typeof n?n.call(t):n||{},h(n)||(n={},"production"!==e.env.NODE_ENV&&Yn("data functions should return an object:\nhttps://vuejs.org/v2/guide/components.html#data-Must-Be-a-Function",t));for(var r=Object.keys(n),o=t.$options.props,i=r.length;i--;)o&&s(o,r[i])?"production"!==e.env.NODE_ENV&&Yn('The data property "'+r[i]+'" is already declared as a prop. Use prop default value instead.',t):st(t,r[i]);A(n,!0)}function et(t,n){for(var r in n){"production"!==e.env.NODE_ENV&&r in t&&Yn('existing instance property "'+r+'" will be overwritten by a computed property with the same name.',t);var o=n[r];"function"==typeof o?(Cr.get=nt(o,t),Cr.set=m):(Cr.get=o.get?o.cache!==!1?nt(o.get,t):l(o.get,t):m,Cr.set=o.set?l(o.set,t):m),Object.defineProperty(t,r,Cr)}}function nt(t,e){var n=new Or(e,t,m,{lazy:!0});return function(){return n.dirty&&n.evaluate(),Qn.target&&n.depend(),n.value}}function rt(t,n){for(var r in n)t[r]=null==n[r]?m:l(n[r],t),"production"!==e.env.NODE_ENV&&null==n[r]&&Yn('method "'+r+'" has an undefined value in the component definition. Did you reference the function correctly?',t)}function ot(t,e){for(var n in e){var r=e[n];if(Array.isArray(r))for(var o=0;o<r.length;o++)it(t,n,r[o]);else it(t,n,r)}}function it(t,e,n){var r;h(n)&&(r=n,n=n.handler),"string"==typeof n&&(n=t[n]),t.$watch(e,n,r)}function at(t){var n={};n.get=function(){return this._data},"production"!==e.env.NODE_ENV&&(n.set=function(t){Yn("Avoid replacing instance root $data. Use nested data properties instead.",this)}),Object.defineProperty(t.prototype,"$data",n),t.prototype.$set=D,t.prototype.$delete=S,t.prototype.$watch=function(t,e,n){var r=this;n=n||{},n.user=!0;var o=new Or(r,t,e,n);return n.immediate&&e.call(r,o.value),function(){o.teardown()}}}function st(t,e){b(e)||Object.defineProperty(t,e,{configurable:!0,enumerable:!0,get:function(){return t._data[e]},set:function(n){t._data[e]=n}})}function ut(t){return new Ar(void 0,void 0,void 0,String(t))}function ct(t){var e=new Ar(t.tag,t.data,t.children,t.text,t.elm,t.context,t.componentOptions);return e.ns=t.ns,e.isStatic=t.isStatic,e.key=t.key,e.isCloned=!0,e}function lt(t){for(var e=new Array(t.length),n=0;n<t.length;n++)e[n]=ct(t[n]);return e}function pt(t,e,n,r){r+=e;var o=t.__injected||(t.__injected={});if(!o[r]){o[r]=!0;var i=t[e];i?t[e]=function(){i.apply(this,arguments),n.apply(this,arguments)}:t[e]=n}}function ft(t,n,r,o,i){var a,s,u,c,l,p,f;for(a in t)if(s=t[a],u=n[a],s)if(u){if(s!==u)if(Array.isArray(u)){u.length=s.length;for(var d=0;d<u.length;d++)u[d]=s[d];t[a]=u}else u.fn=s,t[a]=u}else f="~"===a.charAt(0),l=f?a.slice(1):a,p="!"===l.charAt(0),l=p?l.slice(1):l,Array.isArray(s)?r(l,s.invoker=dt(s),f,p):(s.invoker||(c=s,s=t[a]={},s.fn=c,s.invoker=ht(s)),r(l,s.invoker,f,p));else"production"!==e.env.NODE_ENV&&Yn('Invalid handler for event "'+a+'": got '+String(s),i);for(a in n)t[a]||(f="~"===a.charAt(0),l=f?a.slice(1):a,p="!"===l.charAt(0),l=p?l.slice(1):l,o(l,n[a].invoker,p))}function dt(t){return function(e){for(var n=arguments,r=1===arguments.length,o=0;o<t.length;o++)r?t[o](e):t[o].apply(null,n)}}function ht(t){return function(e){var n=1===arguments.length;n?t.fn(e):t.fn.apply(null,arguments)}}function vt(t){for(var e=0;e<t.length;e++)if(Array.isArray(t[e]))return Array.prototype.concat.apply([],t);return t}function mt(t){return u(t)?[ut(t)]:Array.isArray(t)?yt(t):void 0}function yt(t,e){var n,r,o,i=[];for(n=0;n<t.length;n++)r=t[n],null!=r&&"boolean"!=typeof r&&(o=i[i.length-1],Array.isArray(r)?i.push.apply(i,yt(r,(e||"")+"_"+n)):u(r)?o&&o.text?o.text+=String(r):""!==r&&i.push(ut(r)):r.text&&o&&o.text?i[i.length-1]=ut(o.text+r.text):(r.tag&&null==r.key&&null!=e&&(r.key="__vlist"+e+"_"+n+"__"),i.push(r)));return i}function gt(t){return t&&t.filter(function(t){return t&&t.componentOptions})[0]}function _t(t){t._events=Object.create(null),t._hasHookEvent=!1;var e=t.$options._parentListeners;e&&Et(t,e)}function bt(t,e,n){n?xr.$once(t,e):xr.$on(t,e)}function wt(t,e){xr.$off(t,e)}function Et(t,e,n){xr=t,ft(e,n||{},bt,wt,t)}function Ot(t){var e=/^hook:/;t.prototype.$on=function(t,n){var r=this;return(r._events[t]||(r._events[t]=[])).push(n),e.test(t)&&(r._hasHookEvent=!0),r},t.prototype.$once=function(t,e){function n(){r.$off(t,n),e.apply(r,arguments)}var r=this;return n.fn=e,r.$on(t,n),r},t.prototype.$off=function(t,e){var n=this;if(!arguments.length)return n._events=Object.create(null),n;var r=n._events[t];if(!r)return n;if(1===arguments.length)return n._events[t]=null,n;for(var o,i=r.length;i--;)if(o=r[i],o===e||o.fn===e){r.splice(i,1);break}return n},t.prototype.$emit=function(t){var e=this,n=e._events[t];if(n){n=n.length>1?p(n):n;for(var r=p(arguments,1),o=0,i=n.length;o<i;o++)n[o].apply(e,r)}return e}}function xt(t){var e=t.$options,n=e.parent;if(n&&!e.abstract){for(;n.$options.abstract&&n.$parent;)n=n.$parent;n.$children.push(t)}t.$parent=n,t.$root=n?n.$root:t,t.$children=[],t.$refs={},t._watcher=null,t._inactive=!1,t._isMounted=!1,t._isDestroyed=!1,t._isBeingDestroyed=!1}function kt(t){t.prototype._mount=function(t,n){var r=this;return r.$el=t,r.$options.render||(r.$options.render=$r,"production"!==e.env.NODE_ENV&&(r.$options.template&&"#"!==r.$options.template.charAt(0)?Yn("You are using the runtime-only build of Vue where the template option is not available. Either pre-compile the templates into render functions, or use the compiler-included build.",r):Yn("Failed to mount component: template or render function not defined.",r))),Nt(r,"beforeMount"),r._watcher=new Or(r,function(){r._update(r._render(),n)},m),n=!1,null==r.$vnode&&(r._isMounted=!0,Nt(r,"mounted")),r},t.prototype._update=function(t,e){var n=this;n._isMounted&&Nt(n,"beforeUpdate");var r=n.$el,o=n._vnode,i=Dr;Dr=n,n._vnode=t,o?n.$el=n.__patch__(o,t):n.$el=n.__patch__(n.$el,t,e,!1,n.$options._parentElm,n.$options._refElm),Dr=i,r&&(r.__vue__=null),n.$el&&(n.$el.__vue__=n),n.$vnode&&n.$parent&&n.$vnode===n.$parent._vnode&&(n.$parent.$el=n.$el),n._isMounted&&Nt(n,"updated")},t.prototype._updateFromParent=function(t,n,r,o){var i=this,a=!(!i.$options._renderChildren&&!o);if(i.$options._parentVnode=r,i.$vnode=r,i._vnode&&(i._vnode.parent=r),i.$options._renderChildren=o,t&&i.$options.props){or.shouldConvert=!1,"production"!==e.env.NODE_ENV&&(or.isSettingProps=!0);for(var s=i.$options._propKeys||[],u=0;u<s.length;u++){var c=s[u];i[c]=q(c,i.$options.props,t,i)}or.shouldConvert=!0,"production"!==e.env.NODE_ENV&&(or.isSettingProps=!1),i.$options.propsData=t}if(n){var l=i.$options._parentListeners;i.$options._parentListeners=n,Et(i,n,l)}a&&(i.$slots=Ht(o,r.context),i.$forceUpdate())},t.prototype.$forceUpdate=function(){var t=this;t._watcher&&t._watcher.update()},t.prototype.$destroy=function(){var t=this;if(!t._isBeingDestroyed){Nt(t,"beforeDestroy"),t._isBeingDestroyed=!0;var e=t.$parent;!e||e._isBeingDestroyed||t.$options.abstract||a(e.$children,t),t._watcher&&t._watcher.teardown();for(var n=t._watchers.length;n--;)t._watchers[n].teardown();t._data.__ob__&&t._data.__ob__.vmCount--,t._isDestroyed=!0,Nt(t,"destroyed"),t.$off(),t.$el&&(t.$el.__vue__=null),t.__patch__(t._vnode,null)}}}function Nt(t,e){var n=t.$options[e];if(n)for(var r=0,o=n.length;r<o;r++)n[r].call(t);t._hasHookEvent&&t.$emit("hook:"+e)}function Ct(t,n,r,o,i){if(t){var a=r.$options._base;if(d(t)&&(t=a.extend(t)),"function"!=typeof t)return void("production"!==e.env.NODE_ENV&&Yn("Invalid Component definition: "+String(t),r));if(!t.cid)if(t.resolved)t=t.resolved;else if(t=Vt(t,a,function(){r.$forceUpdate()}),!t)return;Kt(t),n=n||{};var s=Pt(n,t);if(t.options.functional)return At(t,s,n,r,o);var u=n.on;n.on=n.nativeOn,t.options.abstract&&(n={}),Lt(n);var c=t.options.name||i,l=new Ar("vue-component-"+t.cid+(c?"-"+c:""),n,void 0,void 0,void 0,r,{Ctor:t,propsData:s,listeners:u,tag:i,children:o});return l}}function At(t,e,n,r,o){var i={},a=t.options.props;if(a)for(var s in a)i[s]=q(s,a,e);var u=Object.create(r),c=function(t,e,n,r){return It(u,t,e,n,r,!0)},l=t.options.render.call(null,c,{props:i,data:n,parent:r,children:o,slots:function(){return Ht(o,r)}});return l instanceof Ar&&(l.functionalContext=r,n.slot&&((l.data||(l.data={})).slot=n.slot)),l}function $t(t,e,n,r){var o=t.componentOptions,i={_isComponent:!0,parent:e,propsData:o.propsData,_componentTag:o.tag,_parentVnode:t,_parentListeners:o.listeners,_renderChildren:o.children,_parentElm:n||null,_refElm:r||null},a=t.data.inlineTemplate;return a&&(i.render=a.render,i.staticRenderFns=a.staticRenderFns),new o.Ctor(i)}function Dt(t,e,n,r){if(!t.child||t.child._isDestroyed){var o=t.child=$t(t,Dr,n,r);o.$mount(e?t.elm:void 0,e)}else if(t.data.keepAlive){var i=t;St(i,i)}}function St(t,e){var n=e.componentOptions,r=e.child=t.child;r._updateFromParent(n.propsData,n.listeners,e,n.children)}function Tt(t){t.child._isMounted||(t.child._isMounted=!0,Nt(t.child,"mounted")),t.data.keepAlive&&(t.child._inactive=!1,Nt(t.child,"activated"))}function jt(t){t.child._isDestroyed||(t.data.keepAlive?(t.child._inactive=!0,Nt(t.child,"deactivated")):t.child.$destroy())}function Vt(t,n,r){if(!t.requested){t.requested=!0;var o=t.pendingCallbacks=[r],i=!0,a=function(e){if(d(e)&&(e=n.extend(e)),t.resolved=e,!i)for(var r=0,a=o.length;r<a;r++)o[r](e)},s=function(n){"production"!==e.env.NODE_ENV&&Yn("Failed to resolve async component: "+String(t)+(n?"\nReason: "+n:""))},u=t(a,s);return u&&"function"==typeof u.then&&!t.resolved&&u.then(a,s),i=!1,t.resolved}t.pendingCallbacks.push(r)}function Pt(t,e){var n=e.options.props;if(n){var r={},o=t.attrs,i=t.props,a=t.domProps;if(o||i||a)for(var s in n){var u=Dn(s);Rt(r,i,s,u,!0)||Rt(r,o,s,u)||Rt(r,a,s,u)}return r}}function Rt(t,e,n,r,o){if(e){if(s(e,n))return t[n]=e[n],o||delete e[n],!0;if(s(e,r))return t[n]=e[r],o||delete e[r],!0}return!1}function Lt(t){t.hook||(t.hook={});for(var e=0;e<Tr.length;e++){var n=Tr[e],r=t.hook[n],o=Sr[n];t.hook[n]=r?Mt(o,r):o}}function Mt(t,e){return function(n,r,o,i){t(n,r,o,i),e(n,r,o,i)}}function It(t,e,n,r,o,i){return(Array.isArray(n)||u(n))&&(o=r,r=n,n=void 0),i&&(o=Vr),Ut(t,e,n,r,o)}function Ut(t,n,r,o,i){if(r&&r.__ob__)return"production"!==e.env.NODE_ENV&&Yn("Avoid using observed data object as vnode data: "+JSON.stringify(r)+"\nAlways create fresh vnode data objects in each render!",t),$r();if(!n)return $r();Array.isArray(o)&&"function"==typeof o[0]&&(r=r||{},r.scopedSlots={default:o[0]},o.length=0),i===Vr?o=mt(o):i===jr&&(o=vt(o));var a,s;if("string"==typeof n){var u;s=Pn.getTagNamespace(n),a=Pn.isReservedTag(n)?new Ar(Pn.parsePlatformTagName(n),r,o,void 0,void 0,t):(u=U(t.$options,"components",n))?Ct(u,r,t,o,n):new Ar(n,r,o,void 0,void 0,t)}else a=Ct(n,r,t,o);return a?(s&&qt(a,s),a):$r()}function qt(t,e){if(t.ns=e,"foreignObject"!==t.tag&&t.children)for(var n=0,r=t.children.length;n<r;n++){var o=t.children[n];o.tag&&!o.ns&&qt(o,e)}}function Bt(t){t.$vnode=null,t._vnode=null,t._staticTrees=null;var e=t.$options._parentVnode,n=e&&e.context;t.$slots=Ht(t.$options._renderChildren,n),t.$scopedSlots={},t._c=function(e,n,r,o){return It(t,e,n,r,o,!1)},t.$createElement=function(e,n,r,o){return It(t,e,n,r,o,!0)},t.$options.el&&t.$mount(t.$options.el)}function Ft(t){function n(t,e,n){if(Array.isArray(t))for(var r=0;r<t.length;r++)t[r]&&"string"!=typeof t[r]&&i(t[r],e+"_"+r,n);else i(t,e,n)}function i(t,e,n){t.isStatic=!0,t.key=e,t.isOnce=n}t.prototype.$nextTick=function(t){return Kn(t,this)},t.prototype._render=function(){var t=this,n=t.$options,r=n.render,o=n.staticRenderFns,i=n._parentVnode;if(t._isMounted)for(var a in t.$slots)t.$slots[a]=lt(t.$slots[a]);i&&i.data.scopedSlots&&(t.$scopedSlots=i.data.scopedSlots),o&&!t._staticTrees&&(t._staticTrees=[]),t.$vnode=i;var s;try{s=r.call(t._renderProxy,t.$createElement)}catch(n){if(!Pn.errorHandler)throw"production"!==e.env.NODE_ENV&&Yn("Error when rendering "+Wn(t)+":"),n;Pn.errorHandler.call(null,n,t),s=t._vnode}return s instanceof Ar||("production"!==e.env.NODE_ENV&&Array.isArray(s)&&Yn("Multiple root nodes returned from render function. Render function should return a single root node.",t),s=$r()),s.parent=i,s},t.prototype._s=r,t.prototype._v=ut,t.prototype._n=o,t.prototype._e=$r,t.prototype._q=g,t.prototype._i=_,t.prototype._m=function(t,e){var r=this._staticTrees[t];return r&&!e?Array.isArray(r)?lt(r):ct(r):(r=this._staticTrees[t]=this.$options.staticRenderFns[t].call(this._renderProxy),n(r,"__static__"+t,!1),r)},t.prototype._o=function(t,e,r){return n(t,"__once__"+e+(r?"_"+r:""),!0),t},t.prototype._f=function(t){return U(this.$options,"filters",t,!0)||Vn},t.prototype._l=function(t,e){var n,r,o,i,a;if(Array.isArray(t)||"string"==typeof t)for(n=new Array(t.length),r=0,o=t.length;r<o;r++)n[r]=e(t[r],r);else if("number"==typeof t)for(n=new Array(t),r=0;r<t;r++)n[r]=e(r+1,r);else if(d(t))for(i=Object.keys(t),n=new Array(i.length),r=0,o=i.length;r<o;r++)a=i[r],n[r]=e(t[a],a,r);return n},t.prototype._t=function(t,n,r,o){var i=this.$scopedSlots[t];if(i)return r=r||{},o&&f(r,o),i(r)||n;var a=this.$slots[t];return a&&"production"!==e.env.NODE_ENV&&(a._rendered&&Yn('Duplicate presence of slot "'+t+'" found in the same render tree - this will likely cause render errors.',this),a._rendered=!0),a||n},t.prototype._b=function(t,n,r,o){if(r)if(d(r)){Array.isArray(r)&&(r=v(r));for(var i in r)if("class"===i||"style"===i)t[i]=r[i];else{var a=o||Pn.mustUseProp(n,i)?t.domProps||(t.domProps={}):t.attrs||(t.attrs={});a[i]=r[i]}}else"production"!==e.env.NODE_ENV&&Yn("v-bind without argument expects an Object or Array value",this);return t},t.prototype._k=function(t,e,n){var r=Pn.keyCodes[e]||n;return Array.isArray(r)?r.indexOf(t)===-1:r!==t}}function Ht(t,e){var n={};if(!t)return n;for(var r,o,i=[],a=0,s=t.length;a<s;a++)if(o=t[a],(o.context===e||o.functionalContext===e)&&o.data&&(r=o.data.slot)){var u=n[r]||(n[r]=[]);"template"===o.tag?u.push.apply(u,o.children):u.push(o)}else i.push(o);return i.length&&(1!==i.length||" "!==i[0].text&&!i[0].isComment)&&(n.default=i),n}function zt(t){t.prototype._init=function(t){var n=this;n._uid=Pr++,n._isVue=!0,t&&t._isComponent?Jt(n,t):n.$options=I(Kt(n.constructor),t||{},n),"production"!==e.env.NODE_ENV?sr(n):n._renderProxy=n,n._self=n,xt(n),_t(n),Nt(n,"beforeCreate"),X(n),Nt(n,"created"),Bt(n)}}function Jt(t,e){var n=t.$options=Object.create(t.constructor.options);n.parent=e.parent,n.propsData=e.propsData,n._parentVnode=e._parentVnode,n._parentListeners=e._parentListeners,n._renderChildren=e._renderChildren,n._componentTag=e._componentTag,n._parentElm=e._parentElm,n._refElm=e._refElm,e.render&&(n.render=e.render,n.staticRenderFns=e.staticRenderFns)}function Kt(t){var e=t.options;if(t.super){var n=t.super.options,r=t.superOptions,o=t.extendOptions;n!==r&&(t.superOptions=n,o.render=e.render,o.staticRenderFns=e.staticRenderFns,o._scopeId=e._scopeId,e=t.options=I(n,o),e.name&&(e.components[e.name]=t))}return e}function Wt(t){"production"===e.env.NODE_ENV||this instanceof Wt||Yn("Vue is a constructor and should be called with the `new` keyword"),this._init(t)}function Yt(t){t.use=function(t){if(!t.installed){var e=p(arguments,1);return e.unshift(this),"function"==typeof t.install?t.install.apply(t,e):t.apply(null,e),t.installed=!0,this}}}function Zt(t){t.mixin=function(t){this.options=I(this.options,t)}}function Gt(t){t.cid=0;var n=1;t.extend=function(t){t=t||{};var r=this,o=r.cid,i=t._Ctor||(t._Ctor={});if(i[o])return i[o];var a=t.name||r.options.name;"production"!==e.env.NODE_ENV&&(/^[a-zA-Z][\w-]*$/.test(a)||Yn('Invalid component name: "'+a+'". Component names can only contain alphanumeric characters and the hyphen, and must start with a letter.'));var s=function(t){this._init(t)};return s.prototype=Object.create(r.prototype),s.prototype.constructor=s,s.cid=n++,s.options=I(r.options,t),s.super=r,s.extend=r.extend,s.mixin=r.mixin,s.use=r.use,Pn._assetTypes.forEach(function(t){s[t]=r[t]}),a&&(s.options.components[a]=s),s.superOptions=r.options,s.extendOptions=t,i[o]=s,s}}function Xt(t){Pn._assetTypes.forEach(function(n){t[n]=function(t,r){return r?("production"!==e.env.NODE_ENV&&"component"===n&&Pn.isReservedTag(t)&&Yn("Do not use built-in or reserved HTML elements as component id: "+t),"component"===n&&h(r)&&(r.name=r.name||t,r=this.options._base.extend(r)),"directive"===n&&"function"==typeof r&&(r={bind:r,update:r}),this.options[n+"s"][t]=r,r):this.options[n+"s"][t]}})}function Qt(t,e){return"string"==typeof t?t.split(",").indexOf(e)>-1:t.test(e)}function te(t){var n={};n.get=function(){return Pn},"production"!==e.env.NODE_ENV&&(n.set=function(){Yn("Do not replace the Vue.config object, set individual fields instead.")}),Object.defineProperty(t,"config",n),t.util=cr,t.set=D,t.delete=S,t.nextTick=Kn,t.options=Object.create(null),Pn._assetTypes.forEach(function(e){t.options[e+"s"]=Object.create(null)}),t.options._base=t,f(t.options.components,Mr),Yt(t),Zt(t),Gt(t),Xt(t)}function ee(t){for(var e=t.data,n=t,r=t;r.child;)r=r.child._vnode,r.data&&(e=ne(r.data,e));for(;n=n.parent;)n.data&&(e=ne(e,n.data));return re(e)}function ne(t,e){return{staticClass:oe(t.staticClass,e.staticClass),class:t.class?[t.class,e.class]:e.class}}function re(t){var e=t.class,n=t.staticClass;return n||e?oe(n,ie(e)):""}function oe(t,e){return t?e?t+" "+e:t:e||""}function ie(t){var e="";if(!t)return e;if("string"==typeof t)return t;if(Array.isArray(t)){for(var n,r=0,o=t.length;r<o;r++)t[r]&&(n=ie(t[r]))&&(e+=n+" ");return e.slice(0,-1)}if(d(t)){for(var i in t)t[i]&&(e+=i+" ");return e.slice(0,-1)}return e}function ae(t){return Gr(t)?"svg":"math"===t?"math":void 0}function se(t){if(!Mn)return!0;if(Xr(t))return!1;if(t=t.toLowerCase(),null!=Qr[t])return Qr[t];var e=document.createElement(t);return t.indexOf("-")>-1?Qr[t]=e.constructor===window.HTMLUnknownElement||e.constructor===window.HTMLElement:Qr[t]=/HTMLUnknownElement/.test(e.toString())}function ue(t){if("string"==typeof t){var n=t;if(t=document.querySelector(t),!t)return"production"!==e.env.NODE_ENV&&Yn("Cannot find element: "+n),document.createElement("div")}return t}function ce(t,e){var n=document.createElement(t);return"select"!==t?n:(e.data&&e.data.attrs&&"multiple"in e.data.attrs&&n.setAttribute("multiple","multiple"),n)}function le(t,e){return document.createElementNS(Yr[t],e)}function pe(t){return document.createTextNode(t)}function fe(t){return document.createComment(t)}function de(t,e,n){t.insertBefore(e,n)}function he(t,e){t.removeChild(e)}function ve(t,e){t.appendChild(e)}function me(t){return t.parentNode}function ye(t){return t.nextSibling}function ge(t){return t.tagName}function _e(t,e){t.textContent=e}function be(t,e,n){t.setAttribute(e,n)}function we(t,e){var n=t.data.ref;if(n){var r=t.context,o=t.child||t.elm,i=r.$refs;e?Array.isArray(i[n])?a(i[n],o):i[n]===o&&(i[n]=void 0):t.data.refInFor?Array.isArray(i[n])&&i[n].indexOf(o)<0?i[n].push(o):i[n]=[o]:i[n]=o}}function Ee(t){return null==t}function Oe(t){return null!=t}function xe(t,e){return t.key===e.key&&t.tag===e.tag&&t.isComment===e.isComment&&!t.data==!e.data}function ke(t,e,n){var r,o,i={};for(r=e;r<=n;++r)o=t[r].key,Oe(o)&&(i[o]=r);return i}function Ne(t){function n(t){return new Ar($.tagName(t).toLowerCase(),{},[],void 0,t)}function r(t,e){function n(){0===--n.listeners&&o(t)}return n.listeners=e,n}function o(t){var e=$.parentNode(t);e&&$.removeChild(e,t)}function a(t,n,r,o,i){if(t.isRootInsert=!i,!s(t,n,r,o)){var a=t.data,u=t.children,c=t.tag;Oe(c)?("production"!==e.env.NODE_ENV&&(a&&a.pre&&D++,D||t.ns||Pn.ignoredElements.length&&Pn.ignoredElements.indexOf(c)>-1||!Pn.isUnknownElement(c)||Yn("Unknown custom element: <"+c+'> - did you register the component correctly? For recursive components, make sure to provide the "name" option.',t.context)),t.elm=t.ns?$.createElementNS(t.ns,c):$.createElement(c,t),v(t),p(t,u,n),Oe(a)&&d(t,n),l(r,t.elm,o),"production"!==e.env.NODE_ENV&&a&&a.pre&&D--):t.isComment?(t.elm=$.createComment(t.text),l(r,t.elm,o)):(t.elm=$.createTextNode(t.text),l(r,t.elm,o))}}function s(t,e,n,r){var o=t.data;if(Oe(o)){var i=Oe(t.child)&&o.keepAlive;if(Oe(o=o.hook)&&Oe(o=o.init)&&o(t,!1,n,r),Oe(t.child))return h(t,e),i&&c(t,e,n,r),!0}}function c(t,e,n,r){for(var o,i=t;i.child;)if(i=i.child._vnode,Oe(o=i.data)&&Oe(o=o.transition)){for(o=0;o<C.activate.length;++o)C.activate[o](no,i);e.push(i);break}l(n,t.elm,r)}function l(t,e,n){t&&(n?$.insertBefore(t,e,n):$.appendChild(t,e))}function p(t,e,n){if(Array.isArray(e))for(var r=0;r<e.length;++r)a(e[r],n,t.elm,null,!0);else u(t.text)&&$.appendChild(t.elm,$.createTextNode(t.text))}function f(t){for(;t.child;)t=t.child._vnode;return Oe(t.tag)}function d(t,e){for(var n=0;n<C.create.length;++n)C.create[n](no,t);k=t.data.hook,Oe(k)&&(k.create&&k.create(no,t),k.insert&&e.push(t))}function h(t,e){t.data.pendingInsert&&e.push.apply(e,t.data.pendingInsert),t.elm=t.child.$el,f(t)?(d(t,e),v(t)):(we(t),e.push(t))}function v(t){var e;Oe(e=t.context)&&Oe(e=e.$options._scopeId)&&$.setAttribute(t.elm,e,""),Oe(e=Dr)&&e!==t.context&&Oe(e=e.$options._scopeId)&&$.setAttribute(t.elm,e,"")}function m(t,e,n,r,o,i){for(;r<=o;++r)a(n[r],i,t,e)}function y(t){var e,n,r=t.data;if(Oe(r))for(Oe(e=r.hook)&&Oe(e=e.destroy)&&e(t),e=0;e<C.destroy.length;++e)C.destroy[e](t);if(Oe(e=t.children))for(n=0;n<t.children.length;++n)y(t.children[n])}function g(t,e,n,r){for(;n<=r;++n){var i=e[n];Oe(i)&&(Oe(i.tag)?(_(i),y(i)):o(i.elm))}}function _(t,e){if(e||Oe(t.data)){var n=C.remove.length+1;for(e?e.listeners+=n:e=r(t.elm,n),Oe(k=t.child)&&Oe(k=k._vnode)&&Oe(k.data)&&_(k,e),k=0;k<C.remove.length;++k)C.remove[k](t,e);Oe(k=t.data.hook)&&Oe(k=k.remove)?k(t,e):e()}else o(t.elm)}function b(t,n,r,o,i){for(var s,u,c,l,p=0,f=0,d=n.length-1,h=n[0],v=n[d],y=r.length-1,_=r[0],b=r[y],E=!i;p<=d&&f<=y;)Ee(h)?h=n[++p]:Ee(v)?v=n[--d]:xe(h,_)?(w(h,_,o),h=n[++p],_=r[++f]):xe(v,b)?(w(v,b,o),v=n[--d],b=r[--y]):xe(h,b)?(w(h,b,o),E&&$.insertBefore(t,h.elm,$.nextSibling(v.elm)),h=n[++p],b=r[--y]):xe(v,_)?(w(v,_,o),E&&$.insertBefore(t,v.elm,h.elm),v=n[--d],_=r[++f]):(Ee(s)&&(s=ke(n,p,d)),u=Oe(_.key)?s[_.key]:null,Ee(u)?(a(_,o,t,h.elm),_=r[++f]):(c=n[u],"production"===e.env.NODE_ENV||c||Yn("It seems there are duplicate keys that is causing an update error. Make sure each v-for item has a unique key."),xe(c,_)?(w(c,_,o),n[u]=void 0,E&&$.insertBefore(t,_.elm,h.elm),_=r[++f]):(a(_,o,t,h.elm),_=r[++f])));p>d?(l=Ee(r[y+1])?null:r[y+1].elm,m(t,l,r,f,y,o)):f>y&&g(t,n,p,d)}function w(t,e,n,r){if(t!==e){if(e.isStatic&&t.isStatic&&e.key===t.key&&(e.isCloned||e.isOnce))return e.elm=t.elm,void(e.child=t.child);var o,i=e.data,a=Oe(i);a&&Oe(o=i.hook)&&Oe(o=o.prepatch)&&o(t,e);var s=e.elm=t.elm,u=t.children,c=e.children;if(a&&f(e)){for(o=0;o<C.update.length;++o)C.update[o](t,e);Oe(o=i.hook)&&Oe(o=o.update)&&o(t,e)}Ee(e.text)?Oe(u)&&Oe(c)?u!==c&&b(s,u,c,n,r):Oe(c)?(Oe(t.text)&&$.setTextContent(s,""),m(s,null,c,0,c.length-1,n)):Oe(u)?g(s,u,0,u.length-1):Oe(t.text)&&$.setTextContent(s,""):t.text!==e.text&&$.setTextContent(s,e.text),a&&Oe(o=i.hook)&&Oe(o=o.postpatch)&&o(t,e)}}function E(t,e,n){if(n&&t.parent)t.parent.data.pendingInsert=e;else for(var r=0;r<e.length;++r)e[r].data.hook.insert(e[r])}function O(t,n,r){if("production"!==e.env.NODE_ENV&&!x(t,n))return!1;n.elm=t;var o=n.tag,i=n.data,a=n.children;if(Oe(i)&&(Oe(k=i.hook)&&Oe(k=k.init)&&k(n,!0),Oe(k=n.child)))return h(n,r),!0;if(Oe(o)){if(Oe(a))if(t.hasChildNodes()){for(var s=!0,u=t.firstChild,c=0;c<a.length;c++){if(!u||!O(u,a[c],r)){s=!1;break}u=u.nextSibling}if(!s||u)return"production"===e.env.NODE_ENV||"undefined"==typeof console||S||(S=!0,console.warn("Parent: ",t),console.warn("Mismatching childNodes vs. VNodes: ",t.childNodes,a)),!1}else p(n,a,r);if(Oe(i))for(var l in i)if(!T(l)){d(n,r);break}}else t.data!==n.text&&(t.data=n.text);return!0}function x(t,e){return e.tag?0===e.tag.indexOf("vue-component")||e.tag.toLowerCase()===(t.tagName&&t.tagName.toLowerCase()):t.nodeType===(e.isComment?8:3)}var k,N,C={},A=t.modules,$=t.nodeOps;for(k=0;k<ro.length;++k)for(C[ro[k]]=[],N=0;N<A.length;++N)void 0!==A[N][ro[k]]&&C[ro[k]].push(A[N][ro[k]]);

var D=0,S=!1,T=i("attrs,style,class,staticClass,staticStyle,key");return function(t,r,o,i,s,u){if(!r)return void(t&&y(t));var c,l,p=!1,d=[];if(t){var h=Oe(t.nodeType);if(!h&&xe(t,r))w(t,r,d,i);else{if(h){if(1===t.nodeType&&t.hasAttribute("server-rendered")&&(t.removeAttribute("server-rendered"),o=!0),o){if(O(t,r,d))return E(r,d,!0),t;"production"!==e.env.NODE_ENV&&Yn("The client-side rendered virtual DOM tree is not matching server-rendered content. This is likely caused by incorrect HTML markup, for example nesting block-level elements inside

, or missing <tbody>. Bailing hydration and performing full client-side render.")}t=n(t)}if(c=t.elm,l=$.parentNode(c),a(r,d,l,$.nextSibling(c)),r.parent){for(var v=r.parent;v;)v.elm=r.elm,v=v.parent;if(f(r))for(var m=0;m<C.create.length;++m)C.create[m](no,r.parent)}null!==l?g(l,[t],0,0):Oe(t.tag)&&y(t)}}else p=!0,a(r,d,s,u);return E(r,d,p),r.elm}}function Ce(t,e){(t.data.directives||e.data.directives)&&Ae(t,e)}function Ae(t,e){var n,r,o,i=t===no,a=e===no,s=$e(t.data.directives,t.context),u=$e(e.data.directives,e.context),c=[],l=[];for(n in u)r=s[n],o=u[n],r?(o.oldValue=r.value,Se(o,"update",e,t),o.def&&o.def.componentUpdated&&l.push(o)):(Se(o,"bind",e,t),o.def&&o.def.inserted&&c.push(o));if(c.length){var p=function(){for(var n=0;n<c.length;n++)Se(c[n],"inserted",e,t)};i?pt(e.data.hook||(e.data.hook={}),"insert",p,"dir-insert"):p()}if(l.length&&pt(e.data.hook||(e.data.hook={}),"postpatch",function(){for(var n=0;n<l.length;n++)Se(l[n],"componentUpdated",e,t)},"dir-postpatch"),!i)for(n in s)u[n]||Se(s[n],"unbind",t,t,a)}function $e(t,e){var n=Object.create(null);if(!t)return n;var r,o;for(r=0;r<t.length;r++)o=t[r],o.modifiers||(o.modifiers=io),n[De(o)]=o,o.def=U(e.$options,"directives",o.name,!0);return n}function De(t){return t.rawName||t.name+"."+Object.keys(t.modifiers||{}).join(".")}function Se(t,e,n,r,o){var i=t.def&&t.def[e];i&&i(n.elm,t,n,r,o)}function Te(t,e){if(t.data.attrs||e.data.attrs){var n,r,o,i=e.elm,a=t.data.attrs||{},s=e.data.attrs||{};s.__ob__&&(s=e.data.attrs=f({},s));for(n in s)r=s[n],o=a[n],o!==r&&je(i,n,r);qn&&s.value!==a.value&&je(i,"value",s.value);for(n in a)null==s[n]&&(Jr(n)?i.removeAttributeNS(zr,Kr(n)):Fr(n)||i.removeAttribute(n))}}function je(t,e,n){Hr(e)?Wr(n)?t.removeAttribute(e):t.setAttribute(e,e):Fr(e)?t.setAttribute(e,Wr(n)||"false"===n?"false":"true"):Jr(e)?Wr(n)?t.removeAttributeNS(zr,Kr(e)):t.setAttributeNS(zr,e,n):Wr(n)?t.removeAttribute(e):t.setAttribute(e,n)}function Ve(t,e){var n=e.elm,r=e.data,o=t.data;if(r.staticClass||r.class||o&&(o.staticClass||o.class)){var i=ee(e),a=n._transitionClasses;a&&(i=oe(i,ie(a))),i!==n._prevClass&&(n.setAttribute("class",i),n._prevClass=i)}}function Pe(t,e,n,r){if(n){var o=e;e=function(n){Re(t,e,r),1===arguments.length?o(n):o.apply(null,arguments)}}Ir.addEventListener(t,e,r)}function Re(t,e,n){Ir.removeEventListener(t,e,n)}function Le(t,e){if(t.data.on||e.data.on){var n=e.data.on||{},r=t.data.on||{};Ir=e.elm,ft(n,r,Pe,Re,e.context)}}function Me(t,e){if(t.data.domProps||e.data.domProps){var n,r,o=e.elm,i=t.data.domProps||{},a=e.data.domProps||{};a.__ob__&&(a=e.data.domProps=f({},a));for(n in i)null==a[n]&&(o[n]="");for(n in a)if(r=a[n],("textContent"!==n&&"innerHTML"!==n||(e.children&&(e.children.length=0),r!==i[n]))&&("checked"!==n||Ue(o,r)))if("value"===n){o._value=r;var s=null==r?"":String(r);Ie(o,e,s)&&(o.value=s)}else o[n]=r}}function Ie(t,e,n){return!(t.composing||"option"!==e.tag&&!Ue(t,n)&&!qe(e,n))}function Ue(t,e){return document.activeElement!==t&&t.value!==e}function qe(t,e){var n=t.elm.value,r=t.elm._vModifiers;return r&&r.number||"number"===t.elm.type?o(n)!==o(e):r&&r.trim?n.trim()!==e.trim():n!==e}function Be(t){var e=Fe(t.style);return t.staticStyle?f(t.staticStyle,e):e}function Fe(t){return Array.isArray(t)?v(t):"string"==typeof t?po(t):t}function He(t,e){var n,r={};if(e)for(var o=t;o.child;)o=o.child._vnode,o.data&&(n=Be(o.data))&&f(r,n);(n=Be(t.data))&&f(r,n);for(var i=t;i=i.parent;)i.data&&(n=Be(i.data))&&f(r,n);return r}function ze(t,e){var n=e.data,r=t.data;if(n.staticStyle||n.style||r.staticStyle||r.style){var o,i,a=e.elm,s=t.data.staticStyle,u=t.data.style||{},c=s||u,l=Fe(e.data.style)||{};e.data.style=l.__ob__?f({},l):l;var p=He(e,!0);for(i in c)null==p[i]&&vo(a,i,"");for(i in p)o=p[i],o!==c[i]&&vo(a,i,null==o?"":o)}}function Je(t,e){if(e&&e.trim())if(t.classList)e.indexOf(" ")>-1?e.split(/\s+/).forEach(function(e){return t.classList.add(e)}):t.classList.add(e);else{var n=" "+t.getAttribute("class")+" ";n.indexOf(" "+e+" ")<0&&t.setAttribute("class",(n+e).trim())}}function Ke(t,e){if(e&&e.trim())if(t.classList)e.indexOf(" ")>-1?e.split(/\s+/).forEach(function(e){return t.classList.remove(e)}):t.classList.remove(e);else{for(var n=" "+t.getAttribute("class")+" ",r=" "+e+" ";n.indexOf(r)>=0;)n=n.replace(r," ");t.setAttribute("class",n.trim())}}function We(t){No(function(){No(t)})}function Ye(t,e){(t._transitionClasses||(t._transitionClasses=[])).push(e),Je(t,e)}function Ze(t,e){t._transitionClasses&&a(t._transitionClasses,e),Ke(t,e)}function Ge(t,e,n){var r=Xe(t,e),o=r.type,i=r.timeout,a=r.propCount;if(!o)return n();var s=o===bo?Oo:ko,u=0,c=function(){t.removeEventListener(s,l),n()},l=function(e){e.target===t&&++u>=a&&c()};setTimeout(function(){u<a&&c()},i+1),t.addEventListener(s,l)}function Xe(t,e){var n,r=window.getComputedStyle(t),o=r[Eo+"Delay"].split(", "),i=r[Eo+"Duration"].split(", "),a=Qe(o,i),s=r[xo+"Delay"].split(", "),u=r[xo+"Duration"].split(", "),c=Qe(s,u),l=0,p=0;e===bo?a>0&&(n=bo,l=a,p=i.length):e===wo?c>0&&(n=wo,l=c,p=u.length):(l=Math.max(a,c),n=l>0?a>c?bo:wo:null,p=n?n===bo?i.length:u.length:0);var f=n===bo&&Co.test(r[Eo+"Property"]);return{type:n,timeout:l,propCount:p,hasTransform:f}}function Qe(t,e){for(;t.length<e.length;)t=t.concat(t);return Math.max.apply(null,e.map(function(e,n){return tn(e)+tn(t[n])}))}function tn(t){return 1e3*Number(t.slice(0,-1))}function en(t,e){var n=t.elm;n._leaveCb&&(n._leaveCb.cancelled=!0,n._leaveCb());var r=rn(t.data.transition);if(r&&!n._enterCb&&1===n.nodeType){for(var o=r.css,i=r.type,a=r.enterClass,s=r.enterToClass,u=r.enterActiveClass,c=r.appearClass,l=r.appearToClass,p=r.appearActiveClass,f=r.beforeEnter,d=r.enter,h=r.afterEnter,v=r.enterCancelled,m=r.beforeAppear,y=r.appear,g=r.afterAppear,_=r.appearCancelled,b=Dr,w=Dr.$vnode;w&&w.parent;)w=w.parent,b=w.context;var E=!b._isMounted||!t.isRootInsert;if(!E||y||""===y){var O=E?c:a,x=E?p:u,k=E?l:s,N=E?m||f:f,C=E&&"function"==typeof y?y:d,A=E?g||h:h,$=E?_||v:v,D=o!==!1&&!qn,S=C&&(C._length||C.length)>1,T=n._enterCb=on(function(){D&&(Ze(n,k),Ze(n,x)),T.cancelled?(D&&Ze(n,O),$&&$(n)):A&&A(n),n._enterCb=null});t.data.show||pt(t.data.hook||(t.data.hook={}),"insert",function(){var e=n.parentNode,r=e&&e._pending&&e._pending[t.key];r&&r.context===t.context&&r.tag===t.tag&&r.elm._leaveCb&&r.elm._leaveCb(),C&&C(n,T)},"transition-insert"),N&&N(n),D&&(Ye(n,O),Ye(n,x),We(function(){Ye(n,k),Ze(n,O),T.cancelled||S||Ge(n,i,T)})),t.data.show&&(e&&e(),C&&C(n,T)),D||S||T()}}}function nn(t,e){function n(){y.cancelled||(t.data.show||((r.parentNode._pending||(r.parentNode._pending={}))[t.key]=t),l&&l(r),v&&(Ye(r,s),Ye(r,c),We(function(){Ye(r,u),Ze(r,s),y.cancelled||m||Ge(r,a,y)})),p&&p(r,y),v||m||y())}var r=t.elm;r._enterCb&&(r._enterCb.cancelled=!0,r._enterCb());var o=rn(t.data.transition);if(!o)return e();if(!r._leaveCb&&1===r.nodeType){var i=o.css,a=o.type,s=o.leaveClass,u=o.leaveToClass,c=o.leaveActiveClass,l=o.beforeLeave,p=o.leave,f=o.afterLeave,d=o.leaveCancelled,h=o.delayLeave,v=i!==!1&&!qn,m=p&&(p._length||p.length)>1,y=r._leaveCb=on(function(){r.parentNode&&r.parentNode._pending&&(r.parentNode._pending[t.key]=null),v&&(Ze(r,u),Ze(r,c)),y.cancelled?(v&&Ze(r,s),d&&d(r)):(e(),f&&f(r)),r._leaveCb=null});h?h(n):n()}}function rn(t){if(t){if("object"==typeof t){var e={};return t.css!==!1&&f(e,Ao(t.name||"v")),f(e,t),e}return"string"==typeof t?Ao(t):void 0}}function on(t){var e=!1;return function(){e||(e=!0,t())}}function an(t,e){e.data.show||en(e)}function sn(t,n,r){var o=n.value,i=t.multiple;if(i&&!Array.isArray(o))return void("production"!==e.env.NODE_ENV&&Yn('<select multiple v-model="'+n.expression+'"> expects an Array value for its binding, but got '+Object.prototype.toString.call(o).slice(8,-1),r));for(var a,s,u=0,c=t.options.length;u<c;u++)if(s=t.options[u],i)a=_(o,cn(s))>-1,s.selected!==a&&(s.selected=a);else if(g(cn(s),o))return void(t.selectedIndex!==u&&(t.selectedIndex=u));i||(t.selectedIndex=-1)}function un(t,e){for(var n=0,r=e.length;n<r;n++)if(g(cn(e[n]),t))return!1;return!0}function cn(t){return"_value"in t?t._value:t.value}function ln(t){t.target.composing=!0}function pn(t){t.target.composing=!1,fn(t.target,"input")}function fn(t,e){var n=document.createEvent("HTMLEvents");n.initEvent(e,!0,!0),t.dispatchEvent(n)}function dn(t){return!t.child||t.data&&t.data.transition?t:dn(t.child._vnode)}function hn(t){var e=t&&t.componentOptions;return e&&e.Ctor.options.abstract?hn(gt(e.children)):t}function vn(t){var e={},n=t.$options;for(var r in n.propsData)e[r]=t[r];var o=n._parentListeners;for(var i in o)e[Cn(i)]=o[i].fn;return e}function mn(t,e){return/\d-keep-alive$/.test(e.tag)?t("keep-alive"):null}function yn(t){for(;t=t.parent;)if(t.data.transition)return!0}function gn(t,e){return e.key===t.key&&e.tag===t.tag}function _n(t){t.elm._moveCb&&t.elm._moveCb(),t.elm._enterCb&&t.elm._enterCb()}function bn(t){t.data.newPos=t.elm.getBoundingClientRect()}function wn(t){var e=t.data.pos,n=t.data.newPos,r=e.left-n.left,o=e.top-n.top;if(r||o){t.data.moved=!0;var i=t.elm.style;i.transform=i.WebkitTransform="translate("+r+"px,"+o+"px)",i.transitionDuration="0s"}}var En,On,xn=i("slot,component",!0),kn=Object.prototype.hasOwnProperty,Nn=/-(\w)/g,Cn=c(function(t){return t.replace(Nn,function(t,e){return e?e.toUpperCase():""})}),An=c(function(t){return t.charAt(0).toUpperCase()+t.slice(1)}),$n=/([^-])([A-Z])/g,Dn=c(function(t){return t.replace($n,"$1-$2").replace($n,"$1-$2").toLowerCase()}),Sn=Object.prototype.toString,Tn="[object Object]",jn=function(){return!1},Vn=function(t){return t},Pn={optionMergeStrategies:Object.create(null),silent:!1,devtools:"production"!==e.env.NODE_ENV,errorHandler:null,ignoredElements:[],keyCodes:Object.create(null),isReservedTag:jn,isUnknownElement:jn,getTagNamespace:m,parsePlatformTagName:Vn,mustUseProp:jn,_assetTypes:["component","directive","filter"],_lifecycleHooks:["beforeCreate","created","beforeMount","mounted","beforeUpdate","updated","beforeDestroy","destroyed","activated","deactivated"],_maxUpdateCount:100},Rn=/[^\w.$]/,Ln="__proto__"in{},Mn="undefined"!=typeof window,In=Mn&&window.navigator.userAgent.toLowerCase(),Un=In&&/msie|trident/.test(In),qn=In&&In.indexOf("msie 9.0")>0,Bn=In&&In.indexOf("edge/")>0,Fn=In&&In.indexOf("android")>0,Hn=In&&/iphone|ipad|ipod|ios/.test(In),zn=function(){return void 0===En&&(En=!Mn&&"undefined"!=typeof n&&"server"===n.process.env.VUE_ENV),En},Jn=Mn&&window.__VUE_DEVTOOLS_GLOBAL_HOOK__,Kn=function(){function t(){r=!1;var t=n.slice(0);n.length=0;for(var e=0;e<t.length;e++)t[e]()}var e,n=[],r=!1;if("undefined"!=typeof Promise&&O(Promise)){var o=Promise.resolve(),i=function(t){console.error(t)};e=function(){o.then(t).catch(i),Hn&&setTimeout(m)}}else if("undefined"==typeof MutationObserver||!O(MutationObserver)&&"[object MutationObserverConstructor]"!==MutationObserver.toString())e=function(){setTimeout(t,0)};else{var a=1,s=new MutationObserver(t),u=document.createTextNode(String(a));s.observe(u,{characterData:!0}),e=function(){a=(a+1)%2,u.data=String(a)}}return function(t,o){var i;if(n.push(function(){t&&t.call(o),i&&i(o)}),r||(r=!0,e()),!t&&"undefined"!=typeof Promise)return new Promise(function(t){i=t})}}();On="undefined"!=typeof Set&&O(Set)?Set:function(){function t(){this.set=Object.create(null)}return t.prototype.has=function(t){return this.set[t]===!0},t.prototype.add=function(t){this.set[t]=!0},t.prototype.clear=function(){this.set=Object.create(null)},t}();var Wn,Yn=m;if("production"!==e.env.NODE_ENV){var Zn="undefined"!=typeof console;Yn=function(t,e){Zn&&!Pn.silent&&console.error("[Vue warn]: "+t+" "+(e?Gn(Wn(e)):""))},Wn=function(t){if(t.$root===t)return"root instance";var e=t._isVue?t.$options.name||t.$options._componentTag:t.name;return(e?"component <"+e+">":"anonymous component")+(t._isVue&&t.$options.__file?" at "+t.$options.__file:"")};var Gn=function(t){return"anonymous component"===t&&(t+=' - use the "name" option for better debugging messages.'),"\n(found in "+t+")"}}var Xn=0,Qn=function(){this.id=Xn++,this.subs=[]};Qn.prototype.addSub=function(t){this.subs.push(t)},Qn.prototype.removeSub=function(t){a(this.subs,t)},Qn.prototype.depend=function(){Qn.target&&Qn.target.addDep(this)},Qn.prototype.notify=function(){for(var t=this.subs.slice(),e=0,n=t.length;e<n;e++)t[e].update()},Qn.target=null;var tr=[],er=Array.prototype,nr=Object.create(er);["push","pop","shift","unshift","splice","sort","reverse"].forEach(function(t){var e=er[t];w(nr,t,function(){for(var n=arguments,r=arguments.length,o=new Array(r);r--;)o[r]=n[r];var i,a=e.apply(this,o),s=this.__ob__;switch(t){case"push":i=o;break;case"unshift":i=o;break;case"splice":i=o.slice(2)}return i&&s.observeArray(i),s.dep.notify(),a})});var rr=Object.getOwnPropertyNames(nr),or={shouldConvert:!0,isSettingProps:!1},ir=function(t){if(this.value=t,this.dep=new Qn,this.vmCount=0,w(t,"__ob__",this),Array.isArray(t)){var e=Ln?N:C;e(t,nr,rr),this.observeArray(t)}else this.walk(t)};ir.prototype.walk=function(t){for(var e=Object.keys(t),n=0;n<e.length;n++)$(t,e[n],t[e[n]])},ir.prototype.observeArray=function(t){for(var e=0,n=t.length;e<n;e++)A(t[e])};var ar=Pn.optionMergeStrategies;"production"!==e.env.NODE_ENV&&(ar.el=ar.propsData=function(t,e,n,r){return n||Yn('option "'+r+'" can only be used during instance creation with the `new` keyword.'),ur(t,e)}),ar.data=function(t,n,r){return r?t||n?function(){var e="function"==typeof n?n.call(r):n,o="function"==typeof t?t.call(r):void 0;return e?j(e,o):o}:void 0:n?"function"!=typeof n?("production"!==e.env.NODE_ENV&&Yn('The "data" option should be a function that returns a per-instance value in component definitions.',r),t):t?function(){return j(n.call(this),t.call(this))}:n:t},Pn._lifecycleHooks.forEach(function(t){ar[t]=V}),Pn._assetTypes.forEach(function(t){ar[t+"s"]=P}),ar.watch=function(t,e){if(!e)return t;if(!t)return e;var n={};f(n,t);for(var r in e){var o=n[r],i=e[r];o&&!Array.isArray(o)&&(o=[o]),n[r]=o?o.concat(i):[i]}return n},ar.props=ar.methods=ar.computed=function(t,e){if(!e)return t;if(!t)return e;var n=Object.create(null);return f(n,t),f(n,e),n};var sr,ur=function(t,e){return void 0===e?t:e},cr=Object.freeze({defineReactive:$,_toString:r,toNumber:o,makeMap:i,isBuiltInTag:xn,remove:a,hasOwn:s,isPrimitive:u,cached:c,camelize:Cn,capitalize:An,hyphenate:Dn,bind:l,toArray:p,extend:f,isObject:d,isPlainObject:h,toObject:v,noop:m,no:jn,identity:Vn,genStaticKeys:y,looseEqual:g,looseIndexOf:_,isReserved:b,def:w,parsePath:E,hasProto:Ln,inBrowser:Mn,UA:In,isIE:Un,isIE9:qn,isEdge:Bn,isAndroid:Fn,isIOS:Hn,isServerRendering:zn,devtools:Jn,nextTick:Kn,get _Set(){return On},mergeOptions:I,resolveAsset:U,get warn(){return Yn},get formatComponentName(){return Wn},validateProp:q});if("production"!==e.env.NODE_ENV){var lr=i("Infinity,undefined,NaN,isFinite,isNaN,parseFloat,parseInt,decodeURI,decodeURIComponent,encodeURI,encodeURIComponent,Math,Number,Date,Array,Object,Boolean,String,RegExp,Map,Set,JSON,Intl,require"),pr=function(t,e){Yn('Property or method "'+e+'" is not defined on the instance but referenced during render. Make sure to declare reactive data properties in the data option.',t)},fr="undefined"!=typeof Proxy&&Proxy.toString().match(/native code/);if(fr){var dr=i("stop,prevent,self,ctrl,shift,alt,meta");Pn.keyCodes=new Proxy(Pn.keyCodes,{set:function(t,e,n){return dr(e)?(Yn("Avoid overwriting built-in modifier in config.keyCodes: ."+e),!1):(t[e]=n,!0)}})}var hr={has:function t(e,n){var t=n in e,r=lr(n)||"_"===n.charAt(0);return t||r||pr(e,n),t||!r}},vr={get:function(t,e){return"string"!=typeof e||e in t||pr(t,e),t[e]}};sr=function(t){if(fr){var e=t.$options,n=e.render&&e.render._withStripped?vr:hr;t._renderProxy=new Proxy(t,n)}else t._renderProxy=t}}var mr=[],yr={},gr={},_r=!1,br=!1,wr=0,Er=0,Or=function(t,n,r,o){this.vm=t,t._watchers.push(this),o?(this.deep=!!o.deep,this.user=!!o.user,this.lazy=!!o.lazy,this.sync=!!o.sync):this.deep=this.user=this.lazy=this.sync=!1,this.cb=r,this.id=++Er,this.active=!0,this.dirty=this.lazy,this.deps=[],this.newDeps=[],this.depIds=new On,this.newDepIds=new On,this.expression="production"!==e.env.NODE_ENV?n.toString():"","function"==typeof n?this.getter=n:(this.getter=E(n),this.getter||(this.getter=function(){},"production"!==e.env.NODE_ENV&&Yn('Failed watching path: "'+n+'" Watcher only accepts simple dot-delimited paths. For full control, use a function instead.',t))),this.value=this.lazy?void 0:this.get()};Or.prototype.get=function(){x(this);var t=this.getter.call(this.vm,this.vm);return this.deep&&Z(t),k(),this.cleanupDeps(),t},Or.prototype.addDep=function(t){var e=t.id;this.newDepIds.has(e)||(this.newDepIds.add(e),this.newDeps.push(t),this.depIds.has(e)||t.addSub(this))},Or.prototype.cleanupDeps=function(){for(var t=this,e=this.deps.length;e--;){var n=t.deps[e];t.newDepIds.has(n.id)||n.removeSub(t)}var r=this.depIds;this.depIds=this.newDepIds,this.newDepIds=r,this.newDepIds.clear(),r=this.deps,this.deps=this.newDeps,this.newDeps=r,this.newDeps.length=0},Or.prototype.update=function(){this.lazy?this.dirty=!0:this.sync?this.run():Y(this)},Or.prototype.run=function(){if(this.active){var t=this.get();if(t!==this.value||d(t)||this.deep){var n=this.value;if(this.value=t,this.user)try{this.cb.call(this.vm,t,n)}catch(t){if(!Pn.errorHandler)throw"production"!==e.env.NODE_ENV&&Yn('Error in watcher "'+this.expression+'"',this.vm),t;Pn.errorHandler.call(null,t,this.vm)}else this.cb.call(this.vm,t,n)}}},Or.prototype.evaluate=function(){this.value=this.get(),this.dirty=!1},Or.prototype.depend=function(){for(var t=this,e=this.deps.length;e--;)t.deps[e].depend()},Or.prototype.teardown=function(){var t=this;if(this.active){this.vm._isBeingDestroyed||a(this.vm._watchers,this);for(var e=this.deps.length;e--;)t.deps[e].removeSub(t);this.active=!1}};var xr,kr=new On,Nr={key:1,ref:1,slot:1},Cr={enumerable:!0,configurable:!0,get:m,set:m},Ar=function(t,e,n,r,o,i,a){this.tag=t,this.data=e,this.children=n,this.text=r,this.elm=o,this.ns=void 0,this.context=i,this.functionalContext=void 0,this.key=e&&e.key,this.componentOptions=a,this.child=void 0,this.parent=void 0,this.raw=!1,this.isStatic=!1,this.isRootInsert=!0,this.isComment=!1,this.isCloned=!1,this.isOnce=!1},$r=function(){var t=new Ar;return t.text="",t.isComment=!0,t},Dr=null,Sr={init:Dt,prepatch:St,insert:Tt,destroy:jt},Tr=Object.keys(Sr),jr=1,Vr=2,Pr=0;zt(Wt),at(Wt),Ot(Wt),kt(Wt),Ft(Wt);var Rr=[String,RegExp],Lr={name:"keep-alive",abstract:!0,props:{include:Rr,exclude:Rr},created:function(){this.cache=Object.create(null)},render:function(){var t=gt(this.$slots.default);if(t&&t.componentOptions){var e=t.componentOptions,n=e.Ctor.options.name||e.tag;if(n&&(this.include&&!Qt(this.include,n)||this.exclude&&Qt(this.exclude,n)))return t;var r=null==t.key?e.Ctor.cid+(e.tag?"::"+e.tag:""):t.key;this.cache[r]?t.child=this.cache[r].child:this.cache[r]=t,t.data.keepAlive=!0}return t},destroyed:function(){var t=this;for(var e in this.cache){var n=t.cache[e];Nt(n.child,"deactivated"),n.child.$destroy()}}},Mr={KeepAlive:Lr};te(Wt),Object.defineProperty(Wt.prototype,"$isServer",{get:zn}),Wt.version="2.1.8";var Ir,Ur,qr=i("input,textarea,option,select"),Br=function(t,e){return"value"===e&&qr(t)||"selected"===e&&"option"===t||"checked"===e&&"input"===t||"muted"===e&&"video"===t},Fr=i("contenteditable,draggable,spellcheck"),Hr=i("allowfullscreen,async,autofocus,autoplay,checked,compact,controls,declare,default,defaultchecked,defaultmuted,defaultselected,defer,disabled,enabled,formnovalidate,hidden,indeterminate,inert,ismap,itemscope,loop,multiple,muted,nohref,noresize,noshade,novalidate,nowrap,open,pauseonexit,readonly,required,reversed,scoped,seamless,selected,sortable,translate,truespeed,typemustmatch,visible"),zr="http://www.w3.org/1999/xlink",Jr=function(t){return":"===t.charAt(5)&&"xlink"===t.slice(0,5)},Kr=function(t){return Jr(t)?t.slice(6,t.length):""},Wr=function(t){return null==t||t===!1},Yr={svg:"http://www.w3.org/2000/svg",math:"http://www.w3.org/1998/Math/MathML"},Zr=i("html,body,base,head,link,meta,style,title,address,article,aside,footer,header,h1,h2,h3,h4,h5,h6,hgroup,nav,section,div,dd,dl,dt,figcaption,figure,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,rtc,ruby,s,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,output,progress,select,textarea,details,dialog,menu,menuitem,summary,content,element,shadow,template"),Gr=i("svg,animate,circle,clippath,cursor,defs,desc,ellipse,filter,font-face,g,glyph,image,line,marker,mask,missing-glyph,path,pattern,polygon,polyline,rect,switch,symbol,text,textpath,tspan,use,view",!0),Xr=function(t){return Zr(t)||Gr(t)},Qr=Object.create(null),to=Object.freeze({createElement:ce,createElementNS:le,createTextNode:pe,createComment:fe,insertBefore:de,removeChild:he,appendChild:ve,parentNode:me,nextSibling:ye,tagName:ge,setTextContent:_e,setAttribute:be}),eo={create:function(t,e){we(e)},update:function(t,e){t.data.ref!==e.data.ref&&(we(t,!0),we(e))},destroy:function(t){we(t,!0)}},no=new Ar("",{},[]),ro=["create","activate","update","remove","destroy"],oo={create:Ce,update:Ce,destroy:function(t){Ce(t,no)}},io=Object.create(null),ao=[eo,oo],so={create:Te,update:Te},uo={create:Ve,update:Ve},co={create:Le,update:Le},lo={create:Me,update:Me},po=c(function(t){var e={},n=/;(?![^(]*\))/g,r=/:(.+)/;return t.split(n).forEach(function(t){if(t){var n=t.split(r);n.length>1&&(e[n[0].trim()]=n[1].trim())}}),e}),fo=/^--/,ho=/\s*!important$/,vo=function(t,e,n){fo.test(e)?t.style.setProperty(e,n):ho.test(n)?t.style.setProperty(e,n.replace(ho,""),"important"):t.style[yo(e)]=n},mo=["Webkit","Moz","ms"],yo=c(function(t){if(Ur=Ur||document.createElement("div"),t=Cn(t),"filter"!==t&&t in Ur.style)return t;for(var e=t.charAt(0).toUpperCase()+t.slice(1),n=0;n<mo.length;n++){var r=mo[n]+e;if(r in Ur.style)return r}}),go={create:ze,update:ze},_o=Mn&&!qn,bo="transition",wo="animation",Eo="transition",Oo="transitionend",xo="animation",ko="animationend";_o&&(void 0===window.ontransitionend&&void 0!==window.onwebkittransitionend&&(Eo="WebkitTransition",Oo="webkitTransitionEnd"),void 0===window.onanimationend&&void 0!==window.onwebkitanimationend&&(xo="WebkitAnimation",ko="webkitAnimationEnd"));var No=Mn&&window.requestAnimationFrame||setTimeout,Co=/\b(transform|all)(,|$)/,Ao=c(function(t){return{enterClass:t+"-enter",leaveClass:t+"-leave",appearClass:t+"-enter",enterToClass:t+"-enter-to",leaveToClass:t+"-leave-to",appearToClass:t+"-enter-to",enterActiveClass:t+"-enter-active",leaveActiveClass:t+"-leave-active",appearActiveClass:t+"-enter-active"}}),$o=Mn?{create:an,activate:an,remove:function(t,e){t.data.show?e():nn(t,e)}}:{},Do=[so,uo,co,lo,go,$o],So=Do.concat(ao),To=Ne({nodeOps:to,modules:So}),jo=/^input|select|textarea|vue-component-[0-9]+(-[0-9a-zA-Z_-]*)?$/;qn&&document.addEventListener("selectionchange",function(){var t=document.activeElement;t&&t.vmodel&&fn(t,"input")});var Vo={inserted:function(t,n,r){if("production"!==e.env.NODE_ENV&&(jo.test(r.tag)||Yn("v-model is not supported on element type: <"+r.tag+">. If you are working with contenteditable, it's recommended to wrap a library dedicated for that purpose inside a custom component.",r.context)),"select"===r.tag){var o=function(){sn(t,n,r.context)};o(),(Un||Bn)&&setTimeout(o,0)}else"textarea"!==r.tag&&"text"!==t.type||(t._vModifiers=n.modifiers,n.modifiers.lazy||(Fn||(t.addEventListener("compositionstart",ln),t.addEventListener("compositionend",pn)),qn&&(t.vmodel=!0)))},componentUpdated:function(t,e,n){if("select"===n.tag){sn(t,e,n.context);var r=t.multiple?e.value.some(function(e){return un(e,t.options)}):e.value!==e.oldValue&&un(e.value,t.options);r&&fn(t,"change")}}},Po={bind:function(t,e,n){var r=e.value;n=dn(n);var o=n.data&&n.data.transition,i=t.__vOriginalDisplay="none"===t.style.display?"":t.style.display;r&&o&&!qn?(n.data.show=!0,en(n,function(){t.style.display=i})):t.style.display=r?i:"none"},update:function(t,e,n){var r=e.value,o=e.oldValue;if(r!==o){n=dn(n);var i=n.data&&n.data.transition;i&&!qn?(n.data.show=!0,r?en(n,function(){t.style.display=t.__vOriginalDisplay}):nn(n,function(){t.style.display="none"})):t.style.display=r?t.__vOriginalDisplay:"none"}},unbind:function(t,e,n,r,o){o||(t.style.display=t.__vOriginalDisplay)}},Ro={model:Vo,show:Po},Lo={name:String,appear:Boolean,css:Boolean,mode:String,type:String,enterClass:String,leaveClass:String,enterToClass:String,leaveToClass:String,enterActiveClass:String,leaveActiveClass:String,appearClass:String,appearActiveClass:String,appearToClass:String},Mo={name:"transition",props:Lo,abstract:!0,render:function(t){var n=this,r=this.$slots.default;if(r&&(r=r.filter(function(t){return t.tag}),r.length)){"production"!==e.env.NODE_ENV&&r.length>1&&Yn("<transition> can only be used on a single element. Use <transition-group> for lists.",this.$parent);var o=this.mode;"production"!==e.env.NODE_ENV&&o&&"in-out"!==o&&"out-in"!==o&&Yn("invalid <transition> mode: "+o,this.$parent);var i=r[0];if(yn(this.$vnode))return i;var a=hn(i);if(!a)return i;if(this._leaving)return mn(t,i);var s=a.key=null==a.key||a.isStatic?"__v"+(a.tag+this._uid)+"__":a.key,u=(a.data||(a.data={})).transition=vn(this),c=this._vnode,l=hn(c);if(a.data.directives&&a.data.directives.some(function(t){return"show"===t.name})&&(a.data.show=!0),l&&l.data&&!gn(a,l)){var p=l&&(l.data.transition=f({},u));if("out-in"===o)return this._leaving=!0,pt(p,"afterLeave",function(){n._leaving=!1,n.$forceUpdate()},s),mn(t,i);if("in-out"===o){var d,h=function(){d()};pt(u,"afterEnter",h,s),pt(u,"enterCancelled",h,s),pt(p,"delayLeave",function(t){d=t},s)}}return i}}},Io=f({tag:String,moveClass:String},Lo);delete Io.mode;var Uo={props:Io,render:function(t){for(var n=this.tag||this.$vnode.data.tag||"span",r=Object.create(null),o=this.prevChildren=this.children,i=this.$slots.default||[],a=this.children=[],s=vn(this),u=0;u<i.length;u++){var c=i[u];if(c.tag)if(null!=c.key&&0!==String(c.key).indexOf("__vlist"))a.push(c),r[c.key]=c,(c.data||(c.data={})).transition=s;else if("production"!==e.env.NODE_ENV){var l=c.componentOptions,p=l?l.Ctor.options.name||l.tag:c.tag;Yn("<transition-group> children must be keyed: <"+p+">")}}if(o){for(var f=[],d=[],h=0;h<o.length;h++){var v=o[h];v.data.transition=s,v.data.pos=v.elm.getBoundingClientRect(),r[v.key]?f.push(v):d.push(v)}this.kept=t(n,null,f),this.removed=d}return t(n,null,a)},beforeUpdate:function(){this.__patch__(this._vnode,this.kept,!1,!0),this._vnode=this.kept},updated:function(){var t=this.prevChildren,e=this.moveClass||(this.name||"v")+"-move";if(t.length&&this.hasMove(t[0].elm,e)){t.forEach(_n),t.forEach(bn),t.forEach(wn);document.body.offsetHeight;t.forEach(function(t){if(t.data.moved){var n=t.elm,r=n.style;Ye(n,e),r.transform=r.WebkitTransform=r.transitionDuration="",n.addEventListener(Oo,n._moveCb=function t(r){r&&!/transform$/.test(r.propertyName)||(n.removeEventListener(Oo,t),n._moveCb=null,Ze(n,e))})}})}},methods:{hasMove:function(t,e){if(!_o)return!1;if(null!=this._hasMove)return this._hasMove;Ye(t,e);var n=Xe(t);return Ze(t,e),this._hasMove=n.hasTransform}}},qo={Transition:Mo,TransitionGroup:Uo};Wt.config.isUnknownElement=se,Wt.config.isReservedTag=Xr,Wt.config.getTagNamespace=ae,Wt.config.mustUseProp=Br,f(Wt.options.directives,Ro),f(Wt.options.components,qo),Wt.prototype.__patch__=Mn?To:m,Wt.prototype.$mount=function(t,e){return t=t&&Mn?ue(t):void 0,this._mount(t,e)},"production"!==e.env.NODE_ENV&&Mn&&"undefined"!=typeof console&&console[console.info?"info":"log"]("You are running Vue in development mode.\nMake sure to turn on production mode when deploying for production.\nSee more tips at https://vuejs.org/guide/deployment.html"),setTimeout(function(){Pn.devtools&&(Jn?Jn.emit("init",Wt):"production"!==e.env.NODE_ENV&&Mn&&!Bn&&/Chrome\/\d+/.test(window.navigator.userAgent)&&console[console.info?"info":"log"]("Download the Vue Devtools extension for a better development experience:\nhttps://github.com/vuejs/vue-devtools"))},0),t.exports=Wt}).call(e,n(3),function(){return this}())},3:function(t,e){function n(){throw new Error("setTimeout has not been defined")}function r(){throw new Error("clearTimeout has not been defined")}function o(t){if(l===setTimeout)return setTimeout(t,0);if((l===n||!l)&&setTimeout)return l=setTimeout,setTimeout(t,0);try{return l(t,0)}catch(e){try{return l.call(null,t,0)}catch(e){return l.call(this,t,0)}}}function i(t){if(p===clearTimeout)return clearTimeout(t);if((p===r||!p)&&clearTimeout)return p=clearTimeout,clearTimeout(t);try{return p(t)}catch(e){try{return p.call(null,t)}catch(e){return p.call(this,t)}}}function a(){v&&d&&(v=!1,d.length?h=d.concat(h):m=-1,h.length&&s())}function s(){if(!v){var t=o(a);v=!0;for(var e=h.length;e;){for(d=h,h=[];++m<e;)d&&d[m].run();m=-1,e=h.length}d=null,v=!1,i(t)}}function u(t,e){this.fun=t,this.array=e}function c(){}var l,p,f=t.exports={};!function(){try{l="function"==typeof setTimeout?setTimeout:n}catch(t){l=n}try{p="function"==typeof clearTimeout?clearTimeout:r}catch(t){p=r}}();var d,h=[],v=!1,m=-1;f.nextTick=function(t){var e=new Array(arguments.length-1);if(arguments.length>1)for(var n=1;n<arguments.length;n++)e[n-1]=arguments[n];h.push(new u(t,e)),1!==h.length||v||o(s)},u.prototype.run=function(){this.fun.apply(null,this.array)},f.title="browser",f.browser=!0,f.env={},f.argv=[],f.version="",f.versions={},f.on=c,f.addListener=c,f.once=c,f.off=c,f.removeListener=c,f.removeAllListeners=c,f.emit=c,f.binding=function(t){throw new Error("process.binding is not supported")},f.cwd=function(){return"/"},f.chdir=function(t){throw new Error("process.chdir is not supported")},f.umask=function(){return 0}},4:function(t,e,n){(function(e){/** * vue-router v2.1.1 * (c) 2016 Evan You * @license MIT */ "use strict";function n(t,e){if(!t)throw new Error("[vue-router] "+e)}function r(t,e){t||"undefined"!=typeof console&&console.warn("[vue-router] "+e)}function o(t,n){if(void 0===n&&(n={}),t){var o;try{o=i(t)}catch(t){"production"!==e.env.NODE_ENV&&r(!1,t.message),o={}}for(var a in n)o[a]=n[a];return o}return n}function i(t){var e={};return(t=t.trim().replace(/^(\?|#|&)/,""))?(t.split("&").forEach(function(t){var n=t.replace(/\+/g," ").split("="),r=_t(n.shift()),o=n.length>0?_t(n.join("=")):null;void 0===e[r]?e[r]=o:Array.isArray(e[r])?e[r].push(o):e[r]=[e[r],o]}),e):e}function a(t){var e=t?Object.keys(t).map(function(e){var n=t[e];if(void 0===n)return"";if(null===n)return gt(e);if(Array.isArray(n)){var r=[];return n.slice().forEach(function(t){void 0!==t&&(null===t?r.push(gt(e)):r.push(gt(e)+"="+gt(t)))}),r.join("&")}return gt(e)+"="+gt(n)}).filter(function(t){return t.length>0}).join("&"):null;return e?"?"+e:""}function s(t,e,n){var r={name:e.name||t&&t.name,meta:t&&t.meta||{},path:e.path||"/",hash:e.hash||"",query:e.query||{},params:e.params||{},fullPath:c(e),matched:t?u(t):[]};return n&&(r.redirectedFrom=c(n)),Object.freeze(r)}function u(t){for(var e=[];t;)e.unshift(t),t=t.parent;return e}function c(t){var e=t.path,n=t.query;void 0===n&&(n={});var r=t.hash;return void 0===r&&(r=""),(e||"/")+a(n)+r}function l(t,e){return e===bt?t===e:!!e&&(t.path&&e.path?t.path.replace(wt,"")===e.path.replace(wt,"")&&t.hash===e.hash&&p(t.query,e.query):!(!t.name||!e.name)&&(t.name===e.name&&t.hash===e.hash&&p(t.query,e.query)&&p(t.params,e.params)))}function p(t,e){void 0===t&&(t={}),void 0===e&&(e={});var n=Object.keys(t),r=Object.keys(e);return n.length===r.length&&n.every(function(n){return String(t[n])===String(e[n])})}function f(t,e){return 0===t.path.indexOf(e.path.replace(/\/$/,""))&&(!e.hash||t.hash===e.hash)&&d(t.query,e.query)}function d(t,e){for(var n in e)if(!(n in t))return!1;return!0}function h(t){if(!(t.metaKey||t.ctrlKey||t.shiftKey||t.defaultPrevented||0!==t.button)){var e=t.target.getAttribute("target");if(!/\b_blank\b/i.test(e))return t.preventDefault(),!0}}function v(t){if(t)for(var e,n=0;n<t.length;n++){if(e=t[n],"a"===e.tag)return e;if(e.children&&(e=v(e.children)))return e}}function m(t){if(!m.installed){m.installed=!0,mt=t,Object.defineProperty(t.prototype,"$router",{get:function(){return this.$root._router}}),Object.defineProperty(t.prototype,"$route",{get:function(){return this.$root._route}}),t.mixin({beforeCreate:function(){this.$options.router&&(this._router=this.$options.router,this._router.init(this),t.util.defineReactive(this,"_route",this._router.history.current))}}),t.component("router-view",yt),t.component("router-link",Ot);var e=t.config.optionMergeStrategies;e.beforeRouteEnter=e.beforeRouteLeave=e.created}}function y(t,e,n){if("/"===t.charAt(0))return t;if("?"===t.charAt(0)||"#"===t.charAt(0))return e+t;var r=e.split("/");n&&r[r.length-1]||r.pop();for(var o=t.replace(/^\//,"").split("/"),i=0;i<o.length;i++){var a=o[i];"."!==a&&(".."===a?r.pop():r.push(a))}return""!==r[0]&&r.unshift(""),r.join("/")}function g(t){var e="",n="",r=t.indexOf("#");r>=0&&(e=t.slice(r),t=t.slice(0,r));var o=t.indexOf("?");return o>=0&&(n=t.slice(o+1),t=t.slice(0,o)),{path:t,query:n,hash:e}}function _(t){return t.replace(/\/\//g,"/")}function b(t){var e=Object.create(null),n=Object.create(null);return t.forEach(function(t){w(e,n,t)}),{pathMap:e,nameMap:n}}function w(t,o,i,a,s){var u=i.path,c=i.name;"production"!==e.env.NODE_ENV&&(n(null!=u,'"path" is required in a route configuration.'),n("string"!=typeof i.component,'route config "component" for path: '+String(u||c)+" cannot be a string id. Use an actual component instead."));var l={path:E(u,a),components:i.components||{default:i.component},instances:{},name:c,parent:a,matchAs:s,redirect:i.redirect,beforeEnter:i.beforeEnter,meta:i.meta||{}};i.children&&("production"!==e.env.NODE_ENV&&i.name&&i.children.some(function(t){return/^\/?$/.test(t.path)})&&r(!1,"Named Route '"+i.name+"' has a default child route.\n When navigating to this named route (:to=\"{name: '"+i.name+"'\"), the default child route will not be rendered.\n Remove the name from this route and use the name of the default child route for named links instead."),i.children.forEach(function(e){w(t,o,e,l)})),void 0!==i.alias&&(Array.isArray(i.alias)?i.alias.forEach(function(e){w(t,o,{path:e},a,l.path)}):w(t,o,{path:i.alias},a,l.path)),t[l.path]||(t[l.path]=l),c&&(o[c]?"production"!==e.env.NODE_ENV&&r(!1,'Duplicate named routes definition: { name: "'+c+'", path: "'+l.path+'" }'):o[c]=l)}function E(t,e){return t=t.replace(/\/$/,""),"/"===t[0]?t:null==e?t:_(e.path+"/"+t)}function O(t,e){for(var n,r=[],o=0,i=0,a="",s=e&&e.delimiter||"/";null!=(n=St.exec(t));){var u=n[0],c=n[1],l=n.index;if(a+=t.slice(i,l),i=l+u.length,c)a+=c[1];else{var p=t[i],f=n[2],d=n[3],h=n[4],v=n[5],m=n[6],y=n[7];a&&(r.push(a),a="");var g=null!=f&&null!=p&&p!==f,_="+"===m||"*"===m,b="?"===m||"*"===m,w=n[2]||s,E=h||v;r.push({name:d||o++,prefix:f||"",delimiter:w,optional:b,repeat:_,partial:g,asterisk:!!y,pattern:E?$(E):y?".*":"[^"+A(w)+"]+?"})}}return i<t.length&&(a+=t.substr(i)),a&&r.push(a),r}function x(t,e){return C(O(t,e))}function k(t){return encodeURI(t).replace(/[\/?#]/g,function(t){return"%"+t.charCodeAt(0).toString(16).toUpperCase()})}function N(t){return encodeURI(t).replace(/[?#]/g,function(t){return"%"+t.charCodeAt(0).toString(16).toUpperCase()})}function C(t){for(var e=new Array(t.length),n=0;n<t.length;n++)"object"==typeof t[n]&&(e[n]=new RegExp("^(?:"+t[n].pattern+")$"));return function(n,r){for(var o="",i=n||{},a=r||{},s=a.pretty?k:encodeURIComponent,u=0;u<t.length;u++){var c=t[u];if("string"!=typeof c){var l,p=i[c.name];if(null==p){if(c.optional){c.partial&&(o+=c.prefix);continue}throw new TypeError('Expected "'+c.name+'" to be defined')}if(kt(p)){if(!c.repeat)throw new TypeError('Expected "'+c.name+'" to not repeat, but received `'+JSON.stringify(p)+"`");if(0===p.length){if(c.optional)continue;throw new TypeError('Expected "'+c.name+'" to not be empty')}for(var f=0;f<p.length;f++){if(l=s(p[f]),!e[u].test(l))throw new TypeError('Expected all "'+c.name+'" to match "'+c.pattern+'", but received `'+JSON.stringify(l)+"`");o+=(0===f?c.prefix:c.delimiter)+l}}else{if(l=c.asterisk?N(p):s(p),!e[u].test(l))throw new TypeError('Expected "'+c.name+'" to match "'+c.pattern+'", but received "'+l+'"');o+=c.prefix+l}}else o+=c}return o}}function A(t){return t.replace(/([.+*?=^!:${}()[\]|\/\\])/g,"\\$1")}function $(t){return t.replace(/([=!:$\/()])/g,"\\$1")}function D(t,e){return t.keys=e,t}function S(t){return t.sensitive?"":"i"}function T(t,e){var n=t.source.match(/\((?!\?)/g);if(n)for(var r=0;r<n.length;r++)e.push({name:r,prefix:null,delimiter:null,optional:!1,repeat:!1,partial:!1,asterisk:!1,pattern:null});return D(t,e)}function j(t,e,n){for(var r=[],o=0;o<t.length;o++)r.push(R(t[o],e,n).source);var i=new RegExp("(?:"+r.join("|")+")",S(n));return D(i,e)}function V(t,e,n){return P(O(t,n),e,n)}function P(t,e,n){kt(e)||(n=e||n,e=[]),n=n||{};for(var r=n.strict,o=n.end!==!1,i="",a=0;a<t.length;a++){var s=t[a];if("string"==typeof s)i+=A(s);else{var u=A(s.prefix),c="(?:"+s.pattern+")";e.push(s),s.repeat&&(c+="(?:"+u+c+")*"),c=s.optional?s.partial?u+"("+c+")?":"(?:"+u+"("+c+"))?":u+"("+c+")",i+=c}}var l=A(n.delimiter||"/"),p=i.slice(-l.length)===l;return r||(i=(p?i.slice(0,-l.length):i)+"(?:"+l+"(?=$))?"),i+=o?"$":r&&p?"":"(?="+l+"|$)",D(new RegExp("^"+i,S(n)),e)}function R(t,e,n){return kt(e)||(n=e||n,e=[]),n=n||{},t instanceof RegExp?T(t,e):kt(t)?j(t,e,n):V(t,e,n)}function L(t){var e,n,r=Tt[t];return r?(e=r.keys,n=r.regexp):(e=[],n=Nt(t,e),Tt[t]={keys:e,regexp:n}),{keys:e,regexp:n}}function M(t,n,o){try{var i=jt[t]||(jt[t]=Nt.compile(t));return i(n||{},{pretty:!0})}catch(t){return"production"!==e.env.NODE_ENV&&r(!1,"missing param for "+o+": "+t.message),""}}function I(t,n,i){var a="string"==typeof t?{path:t}:t;if(a.name||a._normalized)return a;if(!a.path&&a.params&&n){a=U({},a),a._normalized=!0;var s=U(U({},n.params),a.params);if(n.name)a.name=n.name,a.params=s;else if(n.matched){var u=n.matched[n.matched.length-1].path;a.path=M(u,s,"path "+n.path)}else"production"!==e.env.NODE_ENV&&r(!1,"relative params navigation requires a current route.");return a}var c=g(a.path||""),l=n&&n.path||"/",p=c.path?y(c.path,l,i||a.append):n&&n.path||"/",f=o(c.query,a.query),d=a.hash||c.hash;return d&&"#"!==d.charAt(0)&&(d="#"+d),{_normalized:!0,path:p,query:f,hash:d}}function U(t,e){for(var n in e)t[n]=e[n];return t}function q(t){function o(t,e,n){var r=I(t,e),o=r.name;if(o){var i=p[o],a=L(i.path).keys.filter(function(t){return!t.optional}).map(function(t){return t.name});if("object"!=typeof r.params&&(r.params={}),e&&"object"==typeof e.params)for(var s in e.params)!(s in r.params)&&a.indexOf(s)>-1&&(r.params[s]=e.params[s]);if(i)return r.path=M(i.path,r.params,'named route "'+o+'"'),u(i,r,n)}else if(r.path){r.params={};for(var c in l)if(B(c,r.params,r.path))return u(l[c],r,n)}return u(null,r)}function i(t,i){var a=t.redirect,c="function"==typeof a?a(s(t,i)):a;if("string"==typeof c&&(c={path:c}),!c||"object"!=typeof c)return"production"!==e.env.NODE_ENV&&r(!1,"invalid redirect option: "+JSON.stringify(c)),u(null,i);var l=c,f=l.name,d=l.path,h=i.query,v=i.hash,m=i.params;if(h=l.hasOwnProperty("query")?l.query:h,v=l.hasOwnProperty("hash")?l.hash:v,m=l.hasOwnProperty("params")?l.params:m,f){var y=p[f];return"production"!==e.env.NODE_ENV&&n(y,'redirect failed: named route "'+f+'" not found.'),o({_normalized:!0,name:f,query:h,hash:v,params:m},void 0,i)}if(d){var g=F(d,t),_=M(g,m,'redirect route with path "'+g+'"');return o({_normalized:!0,path:_,query:h,hash:v},void 0,i)}return r(!1,"invalid redirect option: "+JSON.stringify(c)),u(null,i)}function a(t,e,n){var r=M(n,e.params,'aliased route with path "'+n+'"'),i=o({_normalized:!0,path:r});if(i){var a=i.matched,s=a[a.length-1];return e.params=i.params,u(s,e)}return u(null,e)}function u(t,e,n){return t&&t.redirect?i(t,n||e):t&&t.matchAs?a(t,e,t.matchAs):s(t,e,n)}var c=b(t),l=c.pathMap,p=c.nameMap;return o}function B(t,e,n){var r=L(t),o=r.regexp,i=r.keys,a=n.match(o);if(!a)return!1;if(!e)return!0;for(var s=1,u=a.length;s<u;++s){var c=i[s-1],l="string"==typeof a[s]?decodeURIComponent(a[s]):a[s];c&&(e[c.name]=l)}return!0}function F(t,e){return y(t,e.parent?e.parent.path:"/",!0)}function H(t,e,n){var r=function(o){o>=t.length?n():t[o]?e(t[o],function(){r(o+1)}):r(o+1)};r(0)}function z(t){if(!t)if(Vt){var e=document.querySelector("base");t=e?e.getAttribute("href"):"/"}else t="/";return"/"!==t.charAt(0)&&(t="/"+t),t.replace(/\/$/,"")}function J(t,e){var n,r=Math.max(t.length,e.length);for(n=0;n<r&&t[n]===e[n];n++);return{activated:e.slice(n),deactivated:t.slice(n)}}function K(t,e){return"function"!=typeof t&&(t=mt.extend(t)),t.options[e]}function W(t){return et(tt(t,function(t,e){var n=K(t,"beforeRouteLeave");if(n)return Array.isArray(n)?n.map(function(t){return Y(t,e)}):Y(n,e)}).reverse())}function Y(t,e){return function(){return t.apply(e,arguments)}}function Z(t,e,n){return et(tt(t,function(t,r,o,i){var a=K(t,"beforeRouteEnter");if(a)return Array.isArray(a)?a.map(function(t){return G(t,e,o,i,n)}):G(a,e,o,i,n)}))}function G(t,e,n,r,o){return function(i,a,s){return t(i,a,function(t){s(t),"function"==typeof t&&e.push(function(){X(t,n.instances,r,o)})})}}function X(t,e,n,r){e[n]?t(e[n]):r()&&setTimeout(function(){X(t,e,n,r)},16)}function Q(t){return tt(t,function(t,e,n,o){if("function"==typeof t&&!t.options)return function(e,i,a){var s=function(t){n.components[o]=t,a()},u=function(t){r(!1,"Failed to resolve async component "+o+": "+t),a(!1)},c=t(s,u);c&&"function"==typeof c.then&&c.then(s,u)}})}function tt(t,e){return et(t.map(function(t){return Object.keys(t.components).map(function(n){return e(t.components[n],t.instances[n],t,n)})}))}function et(t){return Array.prototype.concat.apply([],t)}function nt(t){t&&(Lt[t]={x:window.pageXOffset,y:window.pageYOffset})}function rt(t){if(t)return Lt[t]}function ot(t){var e=document.documentElement.getBoundingClientRect(),n=t.getBoundingClientRect();return{x:n.left-e.left,y:n.top-e.top}}function it(t){return st(t.x)||st(t.y)}function at(t){return{x:st(t.x)?t.x:window.pageXOffset,y:st(t.y)?t.y:window.pageYOffset}}function st(t){return"number"==typeof t}function ut(t){var e=window.location.pathname;return t&&0===e.indexOf(t)&&(e=e.slice(t.length)),(e||"/")+window.location.search+window.location.hash}function ct(t,e){var n=window.history;try{e?n.replaceState({key:It},"",t):(It=Mt(),n.pushState({key:It},"",t)),nt(It)}catch(n){window.location[e?"assign":"replace"](t)}}function lt(t){ct(t,!0)}function pt(){var t=ft();return"/"===t.charAt(0)||(ht("/"+t),!1)}function ft(){var t=window.location.href,e=t.indexOf("#");return e===-1?"":t.slice(e+1)}function dt(t){window.location.hash=t}function ht(t){var e=window.location.href.indexOf("#");window.location.replace(window.location.href.slice(0,e>=0?e:0)+"#"+t)}function vt(t,e,n){var r="hash"===n?"#"+e:e;return t?_(t+"/"+r):r}var mt,yt={name:"router-view",functional:!0,props:{name:{type:String,default:"default"}},render:function(t,e){var n=e.props,r=e.children,o=e.parent,i=e.data;i.routerView=!0;for(var a=o.$route,s=o._routerViewCache||(o._routerViewCache={}),u=0,c=!1;o;)o.$vnode&&o.$vnode.data.routerView&&u++,o._inactive&&(c=!0),o=o.$parent;i.routerViewDepth=u;var l=a.matched[u];if(!l)return t();var p=n.name,f=c?s[p]:s[p]=l.components[p];if(!c){var d=i.hook||(i.hook={});d.init=function(t){l.instances[p]=t.child},d.prepatch=function(t,e){l.instances[p]=e.child},d.destroy=function(t){l.instances[p]===t.child&&(l.instances[p]=void 0)}}return t(f,i,r)}},gt=encodeURIComponent,_t=decodeURIComponent,bt=s(null,{path:"/"}),wt=/\/$/,Et=[String,Object],Ot={name:"router-link",props:{to:{type:Et,required:!0},tag:{type:String,default:"a"},exact:Boolean,append:Boolean,replace:Boolean,activeClass:String,event:{type:[String,Array],default:"click"}},render:function(t){var e=this,n=this.$router,r=this.$route,o=n.resolve(this.to,r,this.append),i=o.normalizedTo,a=o.resolved,u=o.href,c={},p=this.activeClass||n.options.linkActiveClass||"router-link-active",d=i.path?s(null,i):a;c[p]=this.exact?l(r,d):f(r,d);var m=function(t){h(t)&&(e.replace?n.replace(i):n.push(i))},y={click:h};Array.isArray(this.event)?this.event.forEach(function(t){y[t]=m}):y[this.event]=m;var g={class:c};if("a"===this.tag)g.on=y,g.attrs={href:u};else{var _=v(this.$slots.default);if(_){_.isStatic=!1;var b=mt.util.extend,w=_.data=b({},_.data);w.on=y;var E=_.data.attrs=b({},_.data.attrs);E.href=u}else g.on=y}return t(this.tag,g,this.$slots.default)}},xt=Array.isArray||function(t){return"[object Array]"==Object.prototype.toString.call(t)},kt=xt,Nt=R,Ct=O,At=x,$t=C,Dt=P,St=new RegExp(["(\\\\.)","([\\/.])?(?:(?:\\:(\\w+)(?:\\(((?:\\\\.|[^\\\\()])+)\\))?|\\(((?:\\\\.|[^\\\\()])+)\\))([+*?])?|(\\*))"].join("|"),"g");Nt.parse=Ct,Nt.compile=At,Nt.tokensToFunction=$t,Nt.tokensToRegExp=Dt;var Tt=Object.create(null),jt=Object.create(null),Vt="undefined"!=typeof window,Pt=Vt&&function(){var t=window.navigator.userAgent;return(t.indexOf("Android 2.")===-1&&t.indexOf("Android 4.0")===-1||t.indexOf("Mobile Safari")===-1||t.indexOf("Chrome")!==-1||t.indexOf("Windows Phone")!==-1)&&(window.history&&"pushState"in window.history)}(),Rt=function(t,e){this.router=t,this.base=z(e),this.current=bt,this.pending=null};Rt.prototype.listen=function(t){this.cb=t},Rt.prototype.transitionTo=function(t,e,n){var r=this,o=this.router.match(t,this.current);this.confirmTransition(o,function(){r.updateRoute(o),e&&e(o),r.ensureURL()},n)},Rt.prototype.confirmTransition=function(t,e,n){var r=this,o=this.current,i=function(){n&&n()};if(l(t,o))return this.ensureURL(),i();var a=J(this.current.matched,t.matched),s=a.deactivated,u=a.activated,c=[].concat(W(s),this.router.beforeHooks,u.map(function(t){return t.beforeEnter}),Q(u));this.pending=t;var p=function(e,n){return r.pending!==t?i():void e(t,o,function(t){t===!1?(r.ensureURL(!0),i()):"string"==typeof t||"object"==typeof t?("object"==typeof t&&t.replace?r.replace(t):r.push(t),i()):n(t)})};H(c,p,function(){var n=[],o=Z(u,n,function(){return r.current===t});H(o,p,function(){return r.pending!==t?i():(r.pending=null,e(t),void(r.router.app&&r.router.app.$nextTick(function(){n.forEach(function(t){return t()})})))})})},Rt.prototype.updateRoute=function(t){var e=this.current;this.current=t,this.cb&&this.cb(t),this.router.afterHooks.forEach(function(n){n&&n(t,e)})};var Lt=Object.create(null),Mt=function(){return String(Date.now())},It=Mt(),Ut=function(t){function r(e,n){var r=this;t.call(this,e,n);var o=e.options.scrollBehavior;window.addEventListener("popstate",function(t){It=t.state&&t.state.key;var e=r.current;r.transitionTo(ut(r.base),function(t){o&&r.handleScroll(t,e,!0)})}),o&&window.addEventListener("scroll",function(){nt(It)})}return t&&(r.__proto__=t),r.prototype=Object.create(t&&t.prototype),r.prototype.constructor=r,r.prototype.go=function(t){window.history.go(t)},r.prototype.push=function(t){var e=this,n=this.current;this.transitionTo(t,function(t){ct(_(e.base+t.fullPath)),e.handleScroll(t,n,!1)})},r.prototype.replace=function(t){var e=this,n=this.current;this.transitionTo(t,function(t){lt(_(e.base+t.fullPath)),e.handleScroll(t,n,!1)})},r.prototype.ensureURL=function(t){if(ut(this.base)!==this.current.fullPath){var e=_(this.base+this.current.fullPath);t?ct(e):lt(e)}},r.prototype.handleScroll=function(t,r,o){var i=this.router;if(i.app){var a=i.options.scrollBehavior;a&&("production"!==e.env.NODE_ENV&&n("function"==typeof a,"scrollBehavior must be a function"),i.app.$nextTick(function(){var e=rt(It),n=a(t,r,o?e:null);if(n){var i="object"==typeof n;if(i&&"string"==typeof n.selector){var s=document.querySelector(n.selector);s?e=ot(s):it(n)&&(e=at(n))}else i&&it(n)&&(e=at(n));e&&window.scrollTo(e.x,e.y)}}))}},r}(Rt),qt=function(t){function e(e,n,r){t.call(this,e,n),r&&this.checkFallback()||pt()}return t&&(e.__proto__=t),e.prototype=Object.create(t&&t.prototype),e.prototype.constructor=e,e.prototype.checkFallback=function(){var t=ut(this.base);if(!/^\/#/.test(t))return window.location.replace(_(this.base+"/#"+t)),!0},e.prototype.onHashChange=function(){pt()&&this.transitionTo(ft(),function(t){ht(t.fullPath)})},e.prototype.push=function(t){this.transitionTo(t,function(t){dt(t.fullPath)})},e.prototype.replace=function(t){this.transitionTo(t,function(t){ht(t.fullPath)})},e.prototype.go=function(t){window.history.go(t)},e.prototype.ensureURL=function(t){var e=this.current.fullPath;ft()!==e&&(t?dt(e):ht(e))},e}(Rt),Bt=function(t){function e(e){t.call(this,e),this.stack=[],this.index=-1}return t&&(e.__proto__=t),e.prototype=Object.create(t&&t.prototype),e.prototype.constructor=e,e.prototype.push=function(t){var e=this;this.transitionTo(t,function(t){e.stack=e.stack.slice(0,e.index+1).concat(t),e.index++})},e.prototype.replace=function(t){var e=this;this.transitionTo(t,function(t){e.stack=e.stack.slice(0,e.index).concat(t)})},e.prototype.go=function(t){var e=this,n=this.index+t;if(!(n<0||n>=this.stack.length)){var r=this.stack[n];this.confirmTransition(r,function(){e.index=n,e.updateRoute(r)})}},e.prototype.ensureURL=function(){},e}(Rt),Ft=function(t){void 0===t&&(t={}),this.app=null,this.options=t,this.beforeHooks=[],this.afterHooks=[],this.match=q(t.routes||[]);var r=t.mode||"hash";switch(this.fallback="history"===r&&!Pt,this.fallback&&(r="hash"),Vt||(r="abstract"),this.mode=r,r){case"history":this.history=new Ut(this,t.base);break;case"hash":this.history=new qt(this,t.base,this.fallback);break;case"abstract":this.history=new Bt(this);break;default:"production"!==e.env.NODE_ENV&&n(!1,"invalid mode: "+r)}},Ht={currentRoute:{}};Ht.currentRoute.get=function(){return this.history&&this.history.current},Ft.prototype.init=function(t){var r=this;"production"!==e.env.NODE_ENV&&n(m.installed,"not installed. Make sure to call `Vue.use(VueRouter)` before creating root instance."),this.app=t;var o=this.history;if(o instanceof Ut)o.transitionTo(ut(o.base));else if(o instanceof qt){var i=function(){window.addEventListener("hashchange",function(){o.onHashChange()})};o.transitionTo(ft(),i,i)}o.listen(function(t){r.app._route=t})},Ft.prototype.beforeEach=function(t){this.beforeHooks.push(t)},Ft.prototype.afterEach=function(t){this.afterHooks.push(t)},Ft.prototype.push=function(t){this.history.push(t)},Ft.prototype.replace=function(t){this.history.replace(t)},Ft.prototype.go=function(t){this.history.go(t)},Ft.prototype.back=function(){this.go(-1)},Ft.prototype.forward=function(){this.go(1)},Ft.prototype.getMatchedComponents=function(t){var e=t?this.resolve(t).resolved:this.currentRoute;return e?[].concat.apply([],e.matched.map(function(t){return Object.keys(t.components).map(function(e){return t.components[e]})})):[]},Ft.prototype.resolve=function(t,e,n){var r=I(t,e||this.history.current,n),o=this.match(r,e),i=o.redirectedFrom||o.fullPath,a=this.history.base,s=vt(a,i,this.mode);return{normalizedTo:r,resolved:o,href:s}},Object.defineProperties(Ft.prototype,Ht),Ft.install=m,Vt&&window.Vue&&window.Vue.use(Ft),t.exports=Ft}).call(e,n(3))},33:function(t,e){"use strict";var n={PORT:"3000",NODE_ENV:"test"};e.config=n}});