Difference between revisions of "Team:Evry Paris-Saclay/Template:Javascript"

Revision as of 22:43, 29 June 2017 (view source) BColombo (Talk | contribs) (Blanked the page) ← Older edit		Revision as of 22:43, 29 June 2017 (view source) BColombo (Talk | contribs) Newer edit →
Line 1:		Line 1:
		+	/*!
		+	* Materialize v0.99.0 (http://materializecss.com)
		+	* Copyright 2014-2017 Materialize
		+	* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
		+	*/
		+	// Check for jQuery.
		+	if (typeof (jQuery) === 'undefined') {
		+	var jQuery;
		+	// Check if require is a defined function.
		+	if (typeof (require) === 'function') {
		+	jQuery = $ = require('jquery');
		+	// Else use the dollar sign alias.
		+	} else {
		+	jQuery = $;
		+	}
		+	};
		+	/*
		+	* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
		+	* Open source under the BSD License.
		+	* Copyright © 2008 George McGinley Smith
		+	* All rights reserved.
		+	* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
		+	*/
		+	(function (factory) {
		+	if (typeof define === "function" && define.amd) {
		+	define(['jquery'], function ($) {
		+	return factory($);
		+	});
		+	} else if (typeof module === "object" && typeof module.exports === "object") {
		+	exports = factory(require('jquery'));
		+	} else {
		+	factory(jQuery);
		+	}
		+	})(function ($) {
		+
		+	// Preserve the original jQuery "swing" easing as "jswing"
		+	$.easing['jswing'] = $.easing['swing'];
		+
		+	var pow = Math.pow,
		+	sqrt = Math.sqrt,
		+	sin = Math.sin,
		+	cos = Math.cos,
		+	PI = Math.PI,
		+	c1 = 1.70158,
		+	c2 = c1 * 1.525,
		+	c3 = c1 + 1,
		+	c4 = (2 * PI) / 3,
		+	c5 = (2 * PI) / 4.5;
		+
		+	// x is the fraction of animation progress, in the range 0..1
		+	function bounceOut(x) {
		+	var n1 = 7.5625,
		+	d1 = 2.75;
		+	if (x < 1 / d1) {
		+	return n1 * x * x;
		+	} else if (x < 2 / d1) {
		+	return n1 * (x -= (1.5 / d1)) * x + .75;
		+	} else if (x < 2.5 / d1) {
		+	return n1 * (x -= (2.25 / d1)) * x + .9375;
		+	} else {
		+	return n1 * (x -= (2.625 / d1)) * x + .984375;
		+	}
		+	}
		+
		+	$.extend($.easing, {
		+	def: 'easeOutQuad',
		+	swing: function (x) {
		+	return $.easing[$.easing.def](x);
		+	},
		+	easeInQuad: function (x) {
		+	return x * x;
		+	},
		+	easeOutQuad: function (x) {
		+	return 1 - (1 - x) * (1 - x);
		+	},
		+	easeInOutQuad: function (x) {
		+	return x < 0.5 ?
		+	2 * x * x :
		+	1 - pow(-2 * x + 2, 2) / 2;
		+	},
		+	easeInCubic: function (x) {
		+	return x * x * x;
		+	},
		+	easeOutCubic: function (x) {
		+	return 1 - pow(1 - x, 3);
		+	},
		+	easeInOutCubic: function (x) {
		+	return x < 0.5 ?
		+	4 * x * x * x :
		+	1 - pow(-2 * x + 2, 3) / 2;
		+	},
		+	easeInQuart: function (x) {
		+	return x * x * x * x;
		+	},
		+	easeOutQuart: function (x) {
		+	return 1 - pow(1 - x, 4);
		+	},
		+	easeInOutQuart: function (x) {
		+	return x < 0.5 ?
		+	8 * x * x * x * x :
		+	1 - pow(-2 * x + 2, 4) / 2;
		+	},
		+	easeInQuint: function (x) {
		+	return x * x * x * x * x;
		+	},
		+	easeOutQuint: function (x) {
		+	return 1 - pow(1 - x, 5);
		+	},
		+	easeInOutQuint: function (x) {
		+	return x < 0.5 ?
		+	16 * x * x * x * x * x :
		+	1 - pow(-2 * x + 2, 5) / 2;
		+	},
		+	easeInSine: function (x) {
		+	return 1 - cos(x * PI / 2);
		+	},
		+	easeOutSine: function (x) {
		+	return sin(x * PI / 2);
		+	},
		+	easeInOutSine: function (x) {
		+	return -(cos(PI * x) - 1) / 2;
		+	},
		+	easeInExpo: function (x) {
		+	return x === 0 ? 0 : pow(2, 10 * x - 10);
		+	},
		+	easeOutExpo: function (x) {
		+	return x === 1 ? 1 : 1 - pow(2, -10 * x);
		+	},
		+	easeInOutExpo: function (x) {
		+	return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
		+	pow(2, 20 * x - 10) / 2 :
		+	(2 - pow(2, -20 * x + 10)) / 2;
		+	},
		+	easeInCirc: function (x) {
		+	return 1 - sqrt(1 - pow(x, 2));
		+	},
		+	easeOutCirc: function (x) {
		+	return sqrt(1 - pow(x - 1, 2));
		+	},
		+	easeInOutCirc: function (x) {
		+	return x < 0.5 ?
		+	(1 - sqrt(1 - pow(2 * x, 2))) / 2 :
		+	(sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
		+	},
		+	easeInElastic: function (x) {
		+	return x === 0 ? 0 : x === 1 ? 1 :
		+	-pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
		+	},
		+	easeOutElastic: function (x) {
		+	return x === 0 ? 0 : x === 1 ? 1 :
		+	pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
		+	},
		+	easeInOutElastic: function (x) {
		+	return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
		+	-(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 :
		+	pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
		+	},
		+	easeInBack: function (x) {
		+	return c3 * x * x * x - c1 * x * x;
		+	},
		+	easeOutBack: function (x) {
		+	return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
		+	},
		+	easeInOutBack: function (x) {
		+	return x < 0.5 ?
		+	(pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 :
		+	(pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
		+	},
		+	easeInBounce: function (x) {
		+	return 1 - bounceOut(1 - x);
		+	},
		+	easeOutBounce: bounceOut,
		+	easeInOutBounce: function (x) {
		+	return x < 0.5 ?
		+	(1 - bounceOut(1 - 2 * x)) / 2 :
		+	(1 + bounceOut(2 * x - 1)) / 2;
		+	}
		+	});
		+
		+	});; // Custom Easing
		+	jQuery.extend(jQuery.easing, {
		+	easeInOutMaterial: function (x, t, b, c, d) {
		+	if ((t /= d / 2) < 1) return c / 2 * t * t + b;
		+	return c / 4 * ((t -= 2) * t * t + 2) + b;
		+	}
		+	});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
		+	/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
		+	/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
		+	jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (! function (e) {
		+	function t(e) {
		+	var t = e.length,
		+	a = r.type(e);
		+	return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e
		+	}
		+	if (!e.jQuery) {
		+	var r = function (e, t) {
		+	return new r.fn.init(e, t)
		+	};
		+	r.isWindow = function (e) {
		+	return null != e && e == e.window
		+	}, r.type = function (e) {
		+	return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e
		+	}, r.isArray = Array.isArray || function (e) {
		+	return "array" === r.type(e)
		+	}, r.isPlainObject = function (e) {
		+	var t;
		+	if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;
		+	try {
		+	if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1
		+	} catch (a) {
		+	return !1
		+	}
		+	for (t in e);
		+	return void 0 === t || o.call(e, t)
		+	}, r.each = function (e, r, a) {
		+	var n, o = 0,
		+	i = e.length,
		+	s = t(e);
		+	if (a) {
		+	if (s)
		+	for (; i > o && (n = r.apply(e[o], a), n !== !1); o++);
		+	else
		+	for (o in e)
		+	if (n = r.apply(e[o], a), n === !1) break
		+	} else if (s)
		+	for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++);
		+	else
		+	for (o in e)
		+	if (n = r.call(e[o], o, e[o]), n === !1) break; return e
		+	}, r.data = function (e, t, n) {
		+	if (void 0 === n) {
		+	var o = e[r.expando],
		+	i = o && a[o];
		+	if (void 0 === t) return i;
		+	if (i && t in i) return i[t]
		+	} else if (void 0 !== t) {
		+	var o = e[r.expando] || (e[r.expando] = ++r.uuid);
		+	return a[o] = a[o] || {}, a[o][t] = n, n
		+	}
		+	}, r.removeData = function (e, t) {
		+	var n = e[r.expando],
		+	o = n && a[n];
		+	o && r.each(t, function (e, t) {
		+	delete o[t]
		+	})
		+	}, r.extend = function () {
		+	var e, t, a, n, o, i, s = arguments[0] || {},
		+	l = 1,
		+	u = arguments.length,
		+	c = !1;
		+	for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++)
		+	if (null != (o = arguments[l]))
		+	for (n in o) e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
		+	return s
		+	}, r.queue = function (e, a, n) {
		+	function o(e, r) {
		+	var a = r || [];
		+	return null != e && (t(Object(e)) ? ! function (e, t) {
		+	for (var r = +t.length, a = 0, n = e.length; r > a;) e[n++] = t[a++];
		+	if (r !== r)
		+	for (; void 0 !== t[a];) e[n++] = t[a++];
		+	return e.length = n, e
		+	}(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a
		+	}
		+	if (e) {
		+	a = (a || "fx") + "queue";
		+	var i = r.data(e, a);
		+	return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []
		+	}
		+	}, r.dequeue = function (e, t) {
		+	r.each(e.nodeType ? [e] : e, function (e, a) {
		+	t = t || "fx";
		+	var n = r.queue(a, t),
		+	o = n.shift();
		+	"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
		+	r.dequeue(a, t)
		+	}))
		+	})
		+	}, r.fn = r.prototype = {
		+	init: function (e) {
		+	if (e.nodeType) return this[0] = e, this;
		+	throw new Error("Not a DOM node.")
		+	},
		+	offset: function () {
		+	var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : {
		+	top: 0,
		+	left: 0
		+	};
		+	return {
		+	top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0),
		+	left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0)
		+	}
		+	},
		+	position: function () {
		+	function e() {
		+	for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) e = e.offsetParent;
		+	return e || document
		+	}
		+	var t = this[0],
		+	e = e.apply(t),
		+	a = this.offset(),
		+	n = /^(?:body|html)$/i.test(e.nodeName) ? {
		+	top: 0,
		+	left: 0
		+	} : r(e).offset();
		+	return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), {
		+	top: a.top - n.top,
		+	left: a.left - n.left
		+	}
		+	}
		+	};
		+	var a = {};
		+	r.expando = "velocity" + (new Date).getTime(), r.uuid = 0;
		+	for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) n["[object " + s[l] + "]"] = s[l].toLowerCase();
		+	r.fn.init.prototype = r.fn, e.Velocity = {
		+	Utilities: r
		+	}
		+	}
		+	}(window), function (e) {
		+	"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e()
		+	}(function () {
		+	return function (e, t, r, a) {
		+	function n(e) {
		+	for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
		+	var n = e[t];
		+	n && a.push(n)
		+	}
		+	return a
		+	}
		+
		+	function o(e) {
		+	return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e
		+	}
		+
		+	function i(e) {
		+	var t = f.data(e, "velocity");
		+	return null === t ? a : t
		+	}
		+
		+	function s(e) {
		+	return function (t) {
		+	return Math.round(t * e) * (1 / e)
		+	}
		+	}
		+
		+	function l(e, r, a, n) {
		+	function o(e, t) {
		+	return 1 - 3 * t + 3 * e
		+	}
		+
		+	function i(e, t) {
		+	return 3 * t - 6 * e
		+	}
		+
		+	function s(e) {
		+	return 3 * e
		+	}
		+
		+	function l(e, t, r) {
		+	return ((o(t, r) * e + i(t, r)) * e + s(t)) * e
		+	}
		+
		+	function u(e, t, r) {
		+	return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t)
		+	}
		+
		+	function c(t, r) {
		+	for (var n = 0; m > n; ++n) {
		+	var o = u(r, e, a);
		+	if (0 === o) return r;
		+	var i = l(r, e, a) - t;
		+	r -= i / o
		+	}
		+	return r
		+	}
		+
		+	function p() {
		+	for (var t = 0; b > t; ++t) w[t] = l(t * x, e, a)
		+	}
		+
		+	function f(t, r, n) {
		+	var o, i, s = 0;
		+	do i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; while (Math.abs(o) > h && ++s < v);
		+	return i
		+	}
		+
		+	function d(t) {
		+	for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) r += x;
		+	--n;
		+	var i = (t - w[n]) / (w[n + 1] - w[n]),
		+	s = r + i * x,
		+	l = u(s, e, a);
		+	return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x)
		+	}
		+
		+	function g() {
		+	V = !0, (e != r || a != n) && p()
		+	}
		+	var m = 4,
		+	y = .001,
		+	h = 1e-7,
		+	v = 10,
		+	b = 11,
		+	x = 1 / (b - 1),
		+	S = "Float32Array" in t;
		+	if (4 !== arguments.length) return !1;
		+	for (var P = 0; 4 > P; ++P)
		+	if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
		+	e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);
		+	var w = S ? new Float32Array(b) : new Array(b),
		+	V = !1,
		+	C = function (t) {
		+	return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n)
		+	};
		+	C.getControlPoints = function () {
		+	return [{
		+	x: e,
		+	y: r
		+	}, {
		+	x: a,
		+	y: n
		+	}]
		+	};
		+	var T = "generateBezier(" + [e, r, a, n] + ")";
		+	return C.toString = function () {
		+	return T
		+	}, C
		+	}
		+
		+	function u(e, t) {
		+	var r = e;
		+	return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r
		+	}
		+
		+	function c(e) {
		+	if (e) {
		+	var t = (new Date).getTime(),
		+	r = b.State.calls.length;
		+	r > 1e4 && (b.State.calls = n(b.State.calls));
		+	for (var o = 0; r > o; o++)
		+	if (b.State.calls[o]) {
		+	var s = b.State.calls[o],
		+	l = s[0],
		+	u = s[2],
		+	d = s[3],
		+	g = !!d,
		+	y = null;
		+	d || (d = b.State.calls[o][3] = t - 16);
		+	for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
		+	var P = l[v],
		+	V = P.element;
		+	if (i(V)) {
		+	var C = !1;
		+	if (u.display !== a && null !== u.display && "none" !== u.display) {
		+	if ("flex" === u.display) {
		+	var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];
		+	f.each(T, function (e, t) {
		+	S.setPropertyValue(V, "display", t)
		+	})
		+	}
		+	S.setPropertyValue(V, "display", u.display)
		+	}
		+	u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);
		+	for (var k in P)
		+	if ("element" !== k) {
		+	var A, F = P[k],
		+	j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;
		+	if (1 === h) A = F.endValue;
		+	else {
		+	var E = F.endValue - F.startValue;
		+	if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue
		+	}
		+	if (F.currentValue = A, "tween" === k) y = A;
		+	else {
		+	if (S.Hooks.registered[k]) {
		+	var H = S.Hooks.getRoot(k),
		+	N = i(V).rootPropertyValueCache[H];
		+	N && (F.rootPropertyValue = N)
		+	}
		+	var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);
		+	S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0)
		+	}
		+	}
		+	u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V)
		+	}
		+	}
		+	u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o)
		+	}
		+	}
		+	b.State.isTicking && w(c)
		+	}
		+
		+	function p(e, t) {
		+	if (!b.State.calls[e]) return !1;
		+	for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
		+	var p = r[u].element;
		+	if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
		+	i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};
		+	var d = !1;
		+	f.each(S.Lists.transforms3D, function (e, t) {
		+	var r = /^scale/.test(t) ? 1 : 0,
		+	n = i(p).transformCache[t];
		+	i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t])
		+	}), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating")
		+	}
		+	if (!t && o.complete && !o.loop && u === c - 1) try {
		+	o.complete.call(n, n)
		+	} catch (g) {
		+	setTimeout(function () {
		+	throw g
		+	}, 1)
		+	}
		+	s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
		+	/^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100)
		+	}), b(p, "reverse", {
		+	loop: !0,
		+	delay: o.delay
		+	})), o.queue !== !1 && f.dequeue(p, o.queue)
		+	}
		+	b.State.calls[e] = !1;
		+	for (var m = 0, y = b.State.calls.length; y > m; m++)
		+	if (b.State.calls[m] !== !1) {
		+	l = !0;
		+	break
		+	}
		+	l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = [])
		+	}
		+	var f, d = function () {
		+	if (r.documentMode) return r.documentMode;
		+	for (var e = 7; e > 4; e--) {
		+	var t = r.createElement("div");
		+	if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e
		+	}
		+	return a
		+	}(),
		+	g = function () {
		+	var e = 0;
		+	return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
		+	var r, a = (new Date).getTime();
		+	return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
		+	t(a + r)
		+	}, r)
		+	}
		+	}(),
		+	m = {
		+	isString: function (e) {
		+	return "string" == typeof e
		+	},
		+	isArray: Array.isArray || function (e) {
		+	return "[object Array]" === Object.prototype.toString.call(e)
		+	},
		+	isFunction: function (e) {
		+	return "[object Function]" === Object.prototype.toString.call(e)
		+	},
		+	isNode: function (e) {
		+	return e && e.nodeType
		+	},
		+	isNodeList: function (e) {
		+	return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0)
		+	},
		+	isWrapped: function (e) {
		+	return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e))
		+	},
		+	isSVG: function (e) {
		+	return t.SVGElement && e instanceof t.SVGElement
		+	},
		+	isEmptyObject: function (e) {
		+	for (var t in e) return !1;
		+	return !0
		+	}
		+	},
		+	y = !1;
		+	if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");
		+	if (7 >= d) return void(jQuery.fn.velocity = jQuery.fn.animate);
		+	var h = 400,
		+	v = "swing",
		+	b = {
		+	State: {
		+	isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
		+	isAndroid: /Android/i.test(navigator.userAgent),
		+	isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent),
		+	isChrome: t.chrome,
		+	isFirefox: /Firefox/i.test(navigator.userAgent),
		+	prefixElement: r.createElement("div"),
		+	prefixMatches: {},
		+	scrollAnchor: null,
		+	scrollPropertyLeft: null,
		+	scrollPropertyTop: null,
		+	isTicking: !1,
		+	calls: []
		+	},
		+	CSS: {},
		+	Utilities: f,
		+	Redirects: {},
		+	Easings: {},
		+	Promise: t.Promise,
		+	defaults: {
		+	queue: "",
		+	duration: h,
		+	easing: v,
		+	begin: a,
		+	complete: a,
		+	progress: a,
		+	display: a,
		+	visibility: a,
		+	loop: !1,
		+	delay: !1,
		+	mobileHA: !0,
		+	_cacheValues: !0
		+	},
		+	init: function (e) {
		+	f.data(e, "velocity", {
		+	isSVG: m.isSVG(e),
		+	isAnimating: !1,
		+	computedStyle: null,
		+	tweensContainer: null,
		+	rootPropertyValueCache: {},
		+	transformCache: {}
		+	})
		+	},
		+	hook: null,
		+	mock: !1,
		+	version: {
		+	major: 1,
		+	minor: 2,
		+	patch: 2
		+	},
		+	debug: !1
		+	};
		+	t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");
		+	var x = function () {
		+	function e(e) {
		+	return -e.tension * e.x - e.friction * e.v
		+	}
		+
		+	function t(t, r, a) {
		+	var n = {
		+	x: t.x + a.dx * r,
		+	v: t.v + a.dv * r,
		+	tension: t.tension,
		+	friction: t.friction
		+	};
		+	return {
		+	dx: n.v,
		+	dv: e(n)
		+	}
		+	}
		+
		+	function r(r, a) {
		+	var n = {
		+	dx: r.v,
		+	dv: e(r)
		+	},
		+	o = t(r, .5 * a, n),
		+	i = t(r, .5 * a, o),
		+	s = t(r, a, i),
		+	l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
		+	u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);
		+	return r.x = r.x + l * a, r.v = r.v + u * a, r
		+	}
		+	return function a(e, t, n) {
		+	var o, i, s, l = {
		+	x: -1,
		+	v: 0,
		+	tension: null,
		+	friction: null
		+	},
		+	u = [0],
		+	c = 0,
		+	p = 1e-4,
		+	f = .016;
		+	for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;);
		+	return o ? function (e) {
		+	return u[e * (u.length - 1) | 0]
		+	} : c
		+	}
		+	}();
		+	b.Easings = {
		+	linear: function (e) {
		+	return e
		+	},
		+	swing: function (e) {
		+	return .5 - Math.cos(e * Math.PI) / 2
		+	},
		+	spring: function (e) {
		+	return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e)
		+	}
		+	}, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
		+	b.Easings[t[0]] = l.apply(null, t[1])
		+	});
		+	var S = b.CSS = {
		+	RegEx: {
		+	isHex: /^#([A-f\d]{3}){1,2}$/i,
		+	valueUnwrap: /^[A-z]+\((.*)\)$/i,
		+	wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,
		+	valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi
		+	},
		+	Lists: {
		+	colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"],
		+	transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"],
		+	transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"]
		+	},
		+	Hooks: {
		+	templates: {
		+	textShadow: ["Color X Y Blur", "black 0px 0px 0px"],
		+	boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"],
		+	clip: ["Top Right Bottom Left", "0px 0px 0px 0px"],
		+	backgroundPosition: ["X Y", "0% 0%"],
		+	transformOrigin: ["X Y Z", "50% 50% 0px"],
		+	perspectiveOrigin: ["X Y", "50% 50%"]
		+	},
		+	registered: {},
		+	register: function () {
		+	for (var e = 0; e < S.Lists.colors.length; e++) {
		+	var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";
		+	S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]
		+	}
		+	var r, a, n;
		+	if (d)
		+	for (r in S.Hooks.templates) {
		+	a = S.Hooks.templates[r], n = a[0].split(" ");
		+	var o = a[1].match(S.RegEx.valueSplit);
		+	"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")])
		+	}
		+	for (r in S.Hooks.templates) {
		+	a = S.Hooks.templates[r], n = a[0].split(" ");
		+	for (var e in n) {
		+	var i = r + n[e],
		+	s = e;
		+	S.Hooks.registered[i] = [r, s]
		+	}
		+	}
		+	},
		+	getRoot: function (e) {
		+	var t = S.Hooks.registered[e];
		+	return t ? t[0] : e
		+	},
		+	cleanRootPropertyValue: function (e, t) {
		+	return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t
		+	},
		+	extractValue: function (e, t) {
		+	var r = S.Hooks.registered[e];
		+	if (r) {
		+	var a = r[0],
		+	n = r[1];
		+	return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]
		+	}
		+	return t
		+	},
		+	injectValue: function (e, t, r) {
		+	var a = S.Hooks.registered[e];
		+	if (a) {
		+	var n, o, i = a[0],
		+	s = a[1];
		+	return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ")
		+	}
		+	return r
		+	}
		+	},
		+	Normalizations: {
		+	registered: {
		+	clip: function (e, t, r) {
		+	switch (e) {
		+	case "name":
		+	return "clip";
		+	case "extract":
		+	var a;
		+	return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;
		+	case "inject":
		+	return "rect(" + r + ")"
		+	}
		+	},
		+	blur: function (e, t, r) {
		+	switch (e) {
		+	case "name":
		+	return b.State.isFirefox ? "filter" : "-webkit-filter";
		+	case "extract":
		+	var a = parseFloat(r);
		+	if (!a && 0 !== a) {
		+	var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);
		+	a = n ? n[1] : 0
		+	}
		+	return a;
		+	case "inject":
		+	return parseFloat(r) ? "blur(" + r + ")" : "none"
		+	}
		+	},
		+	opacity: function (e, t, r) {
		+	if (8 >= d) switch (e) {
		+	case "name":
		+	return "filter";
		+	case "extract":
		+	var a = r.toString().match(/alpha\(opacity=(.*)\)/i);
		+	return r = a ? a[1] / 100 : 1;
		+	case "inject":
		+	return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")"
		+	} else switch (e) {
		+	case "name":
		+	return "opacity";
		+	case "extract":
		+	return r;
		+	case "inject":
		+	return r
		+	}
		+	}
		+	},
		+	register: function () {
		+	9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));
		+	for (var e = 0; e < S.Lists.transformsBase.length; e++) ! function () {
		+	var t = S.Lists.transformsBase[e];
		+	S.Normalizations.registered[t] = function (e, r, n) {
		+	switch (e) {
		+	case "name":
		+	return "transform";
		+	case "extract":
		+	return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");
		+	case "inject":
		+	var o = !1;
		+	switch (t.substr(0, t.length - 1)) {
		+	case "translate":
		+	o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);
		+	break;
		+	case "scal":
		+	case "scale":
		+	b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);
		+	break;
		+	case "skew":
		+	o = !/(deg|\d)$/i.test(n);
		+	break;
		+	case "rotate":
		+	o = !/(deg|\d)$/i.test(n)
		+	}
		+	return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t]
		+	}
		+	}
		+	}();
		+	for (var e = 0; e < S.Lists.colors.length; e++) ! function () {
		+	var t = S.Lists.colors[e];
		+	S.Normalizations.registered[t] = function (e, r, n) {
		+	switch (e) {
		+	case "name":
		+	return t;
		+	case "extract":
		+	var o;
		+	if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;
		+	else {
		+	var i, s = {
		+	black: "rgb(0, 0, 0)",
		+	blue: "rgb(0, 0, 255)",
		+	gray: "rgb(128, 128, 128)",
		+	green: "rgb(0, 128, 0)",
		+	red: "rgb(255, 0, 0)",
		+	white: "rgb(255, 255, 255)"
		+	};
		+	/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ")
		+	}
		+	return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;
		+	case "inject":
		+	return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")"
		+	}
		+	}
		+	}()
		+	}
		+	},
		+	Names: {
		+	camelCase: function (e) {
		+	return e.replace(/-(\w)/g, function (e, t) {
		+	return t.toUpperCase()
		+	})
		+	},
		+	SVGAttribute: function (e) {
		+	var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";
		+	return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e)
		+	},
		+	prefixCheck: function (e) {
		+	if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];
		+	for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
		+	var n;
		+	if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
		+	return e.toUpperCase()
		+	}), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]
		+	}
		+	return [e, !1]
		+	}
		+	},
		+	Values: {
		+	hexToRgb: function (e) {
		+	var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
		+	a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;
		+	return e = e.replace(r, function (e, t, r, a) {
		+	return t + t + r + r + a + a
		+	}), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]
		+	},
		+	isCSSNullValue: function (e) {
		+	return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)
		+	},
		+	getUnitType: function (e) {
		+	return /^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
		+	},
		+	getDisplayType: function (e) {
		+	var t = e && e.tagName.toString().toLowerCase();
		+	return /^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
		+	},
		+	addClass: function (e, t) {
		+	e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t
		+	},
		+	removeClass: function (e, t) {
		+	e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ")
		+	}
		+	},
		+	getPropertyValue: function (e, r, n, o) {
		+	function s(e, r) {
		+	function n() {
		+	u && S.setPropertyValue(e, "display", "none")
		+	}
		+	var l = 0;
		+	if (8 >= d) l = f.css(e, r);
		+	else {
		+	var u = !1;
		+	if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
		+	if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
		+	var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);
		+	return n(), c
		+	}
		+	if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
		+	var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);
		+	return n(), p
		+	}
		+	}
		+	var g;
		+	g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n()
		+	}
		+	if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
		+	var m = s(e, "position");
		+	("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px")
		+	}
		+	return l
		+	}
		+	var l;
		+	if (S.Hooks.registered[r]) {
		+	var u = r,
		+	c = S.Hooks.getRoot(u);
		+	n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n)
		+	} else if (S.Normalizations.registered[r]) {
		+	var p, g;
		+	p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g)
		+	}
		+	if (!/^[\d-]/.test(l))
		+	if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r))
		+	if (/^(height|width)$/i.test(r)) try {
		+	l = e.getBBox()[r]
		+	} catch (m) {
		+	l = 0
		+	} else l = e.getAttribute(r);
		+	else l = s(e, S.Names.prefixCheck(r)[0]);
		+	return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l
		+	},
		+	setPropertyValue: function (e, r, a, n, o) {
		+	var s = r;
		+	if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);
		+	else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];
		+	else {
		+	if (S.Hooks.registered[r]) {
		+	var l = r,
		+	u = S.Hooks.getRoot(r);
		+	n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u
		+	}
		+	if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
		+	e.style[s] = a
		+	} catch (c) {
		+	b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]")
		+	} else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;
		+	b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a)
		+	}
		+	return [s, a]
		+	},
		+	flushTransformCache: function (e) {
		+	function t(t) {
		+	return parseFloat(S.getPropertyValue(e, t))
		+	}
		+	var r = "";
		+	if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
		+	var a = {
		+	translate: [t("translateX"), t("translateY")],
		+	skewX: [t("skewX")],
		+	skewY: [t("skewY")],
		+	scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")],
		+	rotate: [t("rotateZ"), 0, 0]
		+	};
		+	f.each(i(e).transformCache, function (e) {
		+	/^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e])
		+	})
		+	} else {
		+	var n, o;
		+	f.each(i(e).transformCache, function (t) {
		+	return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void(r += t + n + " "))
		+	}), o && (r = "perspective" + o + " " + r)
		+	}
		+	S.setPropertyValue(e, "transform", r)
		+	}
		+	};
		+	S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
		+	var n = a;
		+	return e = o(e), f.each(e, function (e, o) {
		+	if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));
		+	else {
		+	var s = b.CSS.setPropertyValue(o, t, r);
		+	"transform" === s[0] && b.CSS.flushTransformCache(o), n = s
		+	}
		+	}), n
		+	};
		+	var P = function () {
		+	function e() {
		+	return s ? k.promise || null : l
		+	}
		+
		+	function n() {
		+	function e(e) {
		+	function p(e, t) {
		+	var r = a,
		+	n = a,
		+	i = a;
		+	return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]
		+	}
		+
		+	function d(e, t) {
		+	var r, a;
		+	return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
		+	return r = e, ""
		+	}), r || (r = S.Values.getUnitType(e)), [a, r]
		+	}
		+
		+	function h() {
		+	var e = {
		+	myParent: o.parentNode || r.body,
		+	position: S.getPropertyValue(o, "position"),
		+	fontSize: S.getPropertyValue(o, "fontSize")
		+	},
		+	a = e.position === L.lastPosition && e.myParent === L.lastParent,
		+	n = e.fontSize === L.lastFontSize;
		+	L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;
		+	var s = 100,
		+	l = {};
		+	if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;
		+	else {
		+	var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");
		+	b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
		+	b.CSS.setPropertyValue(u, t, "hidden")
		+	}), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
		+	b.CSS.setPropertyValue(u, t, s + "%")
		+	}), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u)
		+	}
		+	return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l
		+	}
		+	if (s.begin && 0 === V) try {
		+	s.begin.call(g, g)
		+	} catch (x) {
		+	setTimeout(function () {
		+	throw x
		+	}, 1)
		+	}
		+	if ("scroll" === A) {
		+	var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top",
		+	j = parseFloat(s.offset) || 0;
		+	s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = {
		+	scroll: {
		+	rootPropertyValue: !1,
		+	startValue: P,
		+	currentValue: P,
		+	endValue: T,
		+	unitType: "",
		+	easing: s.easing,
		+	scrollData: {
		+	container: s.container,
		+	direction: F,
		+	alternateValue: C
		+	}
		+	},
		+	element: o
		+	}, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o)
		+	} else if ("reverse" === A) {
		+	if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);
		+	"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);
		+	var E = f.extend(!0, {}, i(o).tweensContainer);
		+	for (var H in E)
		+	if ("element" !== H) {
		+	var N = E[H].startValue;
		+	E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o)
		+	}
		+	l = E
		+	} else if ("start" === A) {
		+	var E;
		+	i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
		+	if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
		+	var r = p(t, !0),
		+	n = r[0],
		+	o = r[1],
		+	i = r[2];
		+	if (S.RegEx.isHex.test(n)) {
		+	for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
		+	var f = [l[c]];
		+	o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f
		+	}
		+	delete y[e]
		+	}
		+	}
		+	});
		+	for (var z in y) {
		+	var O = p(y[z]),
		+	q = O[0],
		+	$ = O[1],
		+	M = O[2];
		+	z = S.Names.camelCase(z);
		+	var I = S.Hooks.getRoot(z),
		+	B = !1;
		+	if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
		+	(s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));
		+	var W, G, Y, D = !1;
		+	if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
		+	return D = t, ""
		+	}), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;
		+	else if (Y !== G && 0 !== M)
		+	if (0 === q) G = Y;
		+	else {
		+	n = n || h();
		+	var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";
		+	switch (Y) {
		+	case "%":
		+	M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;
		+	break;
		+	case "px":
		+	break;
		+	default:
		+	M *= n[Y + "ToPx"]
		+	}
		+	switch (G) {
		+	case "%":
		+	M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);
		+	break;
		+	case "px":
		+	break;
		+	default:
		+	M *= 1 / n[G + "ToPx"]
		+	}
		+	}
		+	switch (D) {
		+	case "+":
		+	q = M + q;
		+	break;
		+	case "-":
		+	q = M - q;
		+	break;
		+	case "*":
		+	q = M * q;
		+	break;
		+	case "/":
		+	q = M / q
		+	}
		+	l[z] = {
		+	rootPropertyValue: B,
		+	startValue: M,
		+	currentValue: M,
		+	endValue: q,
		+	unitType: G,
		+	easing: $
		+	}, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o)
		+	} else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.")
		+	}
		+	l.element = o
		+	}
		+	l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++)
		+	}
		+	var n, o = this,
		+	s = f.extend({}, b.defaults, v),
		+	l = {};
		+	switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
		+	b.velocityQueueEntryFlag = !0, i(o).delayTimer = {
		+	setTimeout: setTimeout(e, parseFloat(s.delay)),
		+	next: e
		+	}
		+	}), s.duration.toString().toLowerCase()) {
		+	case "fast":
		+	s.duration = 200;
		+	break;
		+	case "normal":
		+	s.duration = h;
		+	break;
		+	case "slow":
		+	s.duration = 600;
		+	break;
		+	default:
		+	s.duration = parseFloat(s.duration) || 1
		+	}
		+	b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
		+	return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t))
		+	}), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o)
		+	}
		+	var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));
		+	if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
		+	x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);
		+	var w = g.length,
		+	V = 0;
		+	if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
		+	var C = d + 1;
		+	v = {};
		+	for (var T = C; T < arguments.length; T++) m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]
		+	}
		+	var k = {
		+	promise: null,
		+	resolver: null,
		+	rejecter: null
		+	};
		+	s && b.Promise && (k.promise = new b.Promise(function (e, t) {
		+	k.resolver = e, k.rejecter = t
		+	}));
		+	var A;
		+	switch (y) {
		+	case "scroll":
		+	A = "scroll";
		+	break;
		+	case "reverse":
		+	A = "reverse";
		+	break;
		+	case "finish":
		+	case "stop":
		+	f.each(g, function (e, t) {
		+	i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer)
		+	});
		+	var F = [];
		+	return f.each(b.State.calls, function (e, t) {
		+	t && f.each(t[1], function (r, n) {
		+	var o = v === a ? "" : v;
		+	return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
		+	a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
		+	m.isFunction(t) && t(null, !0)
		+	}), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
		+	t.endValue = t.currentValue
		+	}), F.push(e)) : "finish" === y && (t[2].duration = 1))
		+	}) : !0
		+	})
		+	}), "stop" === y && (f.each(F, function (e, t) {
		+	p(t, !0)
		+	}), k.promise && k.resolver(g)), e();
		+	default:
		+	if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
		+	if (m.isString(y) && b.Redirects[y]) {
		+	var j = f.extend({}, v),
		+	E = j.duration,
		+	H = j.delay || 0;
		+	return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
		+	parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a)
		+	}), e()
		+	}
		+	var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";
		+	return k.promise ? k.rejecter(new Error(N)) : console.log(N), e()
		+	}
		+	A = "start"
		+	}
		+	var L = {
		+	lastParent: null,
		+	lastPosition: null,
		+	lastFontSize: null,
		+	lastPercentToPxWidth: null,
		+	lastPercentToPxHeight: null,
		+	lastEmToPx: null,
		+	remToPx: null,
		+	vwToPx: null,
		+	vhToPx: null
		+	},
		+	R = [];
		+	f.each(g, function (e, t) {
		+	m.isNode(t) && n.call(t)
		+	});
		+	var z, j = f.extend({}, b.defaults, v);
		+	if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop)
		+	for (var O = 0; z > O; O++) {
		+	var q = {
		+	delay: j.delay,
		+	progress: j.progress
		+	};
		+	O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q)
		+	}
		+	return e()
		+	}
		+	};
		+	b = f.extend(P, b), b.animate = P;
		+	var w = t.requestAnimationFrame || g;
		+	return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
		+	r.hidden ? (w = function (e) {
		+	return setTimeout(function () {
		+	e(!0)
		+	}, 16)
		+	}, c()) : w = t.requestAnimationFrame || g
		+	}), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
		+	b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
		+	var l = f.extend({}, r),
		+	u = l.begin,
		+	c = l.complete,
		+	p = {
		+	height: "",
		+	marginTop: "",
		+	marginBottom: "",
		+	paddingTop: "",
		+	paddingBottom: ""
		+	},
		+	d = {};
		+	l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
		+	u && u.call(i, i);
		+	for (var r in p) {
		+	d[r] = e.style[r];
		+	var a = b.CSS.getPropertyValue(e, r);
		+	p[r] = "Down" === t ? [a, 0] : [0, a]
		+	}
		+	d.overflow = e.style.overflow, e.style.overflow = "hidden"
		+	}, l.complete = function () {
		+	for (var t in d) e.style[t] = d[t];
		+	c && c.call(i, i), s && s.resolver(i)
		+	}, b(e, p, l)
		+	}
		+	}), f.each(["In", "Out"], function (e, t) {
		+	b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
		+	var l = f.extend({}, r),
		+	u = {
		+	opacity: "In" === t ? 1 : 0
		+	},
		+	c = l.complete;
		+	l.complete = n !== o - 1 ? l.begin = null : function () {
		+	c && c.call(i, i), s && s.resolver(i)
		+	}, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l)
		+	}
		+	}), b
		+	}(window.jQuery || window.Zepto || window, window, document)
		+	}));;
		+	! function (a, b, c, d) {
		+	"use strict";
		+
		+	function k(a, b, c) {
		+	return setTimeout(q(a, c), b)
		+	}
		+
		+	function l(a, b, c) {
		+	return Array.isArray(a) ? (m(a, c[b], c), !0) : !1
		+	}
		+
		+	function m(a, b, c) {
		+	var e;
		+	if (a)
		+	if (a.forEach) a.forEach(b, c);
		+	else if (a.length !== d)
		+	for (e = 0; e < a.length;) b.call(c, a[e], e, a), e++;
		+	else
		+	for (e in a) a.hasOwnProperty(e) && b.call(c, a[e], e, a)
		+	}
		+
		+	function n(a, b, c) {
		+	for (var e = Object.keys(b), f = 0; f < e.length;)(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
		+	return a
		+	}
		+
		+	function o(a, b) {
		+	return n(a, b, !0)
		+	}
		+
		+	function p(a, b, c) {
		+	var e, d = b.prototype;
		+	e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c)
		+	}
		+
		+	function q(a, b) {
		+	return function () {
		+	return a.apply(b, arguments)
		+	}
		+	}
		+
		+	function r(a, b) {
		+	return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a
		+	}
		+
		+	function s(a, b) {
		+	return a === d ? b : a
		+	}
		+
		+	function t(a, b, c) {
		+	m(x(b), function (b) {
		+	a.addEventListener(b, c, !1)
		+	})
		+	}
		+
		+	function u(a, b, c) {
		+	m(x(b), function (b) {
		+	a.removeEventListener(b, c, !1)
		+	})
		+	}
		+
		+	function v(a, b) {
		+	for (; a;) {
		+	if (a == b) return !0;
		+	a = a.parentNode
		+	}
		+	return !1
		+	}
		+
		+	function w(a, b) {
		+	return a.indexOf(b) > -1
		+	}
		+
		+	function x(a) {
		+	return a.trim().split(/\s+/g)
		+	}
		+
		+	function y(a, b, c) {
		+	if (a.indexOf && !c) return a.indexOf(b);
		+	for (var d = 0; d < a.length;) {
		+	if (c && a[d][c] == b || !c && a[d] === b) return d;
		+	d++
		+	}
		+	return -1
		+	}
		+
		+	function z(a) {
		+	return Array.prototype.slice.call(a, 0)
		+	}
		+
		+	function A(a, b, c) {
		+	for (var d = [], e = [], f = 0; f < a.length;) {
		+	var g = b ? a[f][b] : a[f];
		+	y(e, g) < 0 && d.push(a[f]), e[f] = g, f++
		+	}
		+	return c && (d = b ? d.sort(function (a, c) {
		+	return a[b] > c[b]
		+	}) : d.sort()), d
		+	}
		+
		+	function B(a, b) {
		+	for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
		+	if (c = e[h], f = c ? c + g : b, f in a) return f;
		+	h++
		+	}
		+	return d
		+	}
		+
		+	function D() {
		+	return C++
		+	}
		+
		+	function E(a) {
		+	var b = a.ownerDocument;
		+	return b.defaultView || b.parentWindow
		+	}
		+
		+	function ab(a, b) {
		+	var c = this;
		+	this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
		+	r(a.options.enable, [a]) && c.handler(b)
		+	}, this.init()
		+	}
		+
		+	function bb(a) {
		+	var b, c = a.options.inputClass;
		+	return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb)
		+	}
		+
		+	function cb(a, b, c) {
		+	var d = c.pointers.length,
		+	e = c.changedPointers.length,
		+	f = b & O && 0 === d - e,
		+	g = b & (Q | R) && 0 === d - e;
		+	c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c
		+	}
		+
		+	function db(a, b) {
		+	var c = a.session,
		+	d = b.pointers,
		+	e = d.length;
		+	c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);
		+	var f = c.firstInput,
		+	g = c.firstMultiple,
		+	h = g ? g.center : f.center,
		+	i = b.center = hb(d);
		+	b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);
		+	var k = a.element;
		+	v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k
		+	}
		+
		+	function eb(a, b) {
		+	var c = b.center,
		+	d = a.offsetDelta || {},
		+	e = a.prevDelta || {},
		+	f = a.prevInput || {};
		+	(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = {
		+	x: f.deltaX || 0,
		+	y: f.deltaY || 0
		+	}, d = a.offsetDelta = {
		+	x: c.x,
		+	y: c.y
		+	}), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y)
		+	}
		+
		+	function fb(a, b) {
		+	var f, g, h, j, c = a.lastInterval || b,
		+	e = b.timeStamp - c.timeStamp;
		+	if (b.eventType != R && (e > N || c.velocity === d)) {
		+	var k = c.deltaX - b.deltaX,
		+	l = c.deltaY - b.deltaY,
		+	m = ib(e, k, l);
		+	g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b
		+	} else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;
		+	b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j
		+	}
		+
		+	function gb(a) {
		+	for (var b = [], c = 0; c < a.pointers.length;) b[c] = {
		+	clientX: h(a.pointers[c].clientX),
		+	clientY: h(a.pointers[c].clientY)
		+	}, c++;
		+	return {
		+	timeStamp: j(),
		+	pointers: b,
		+	center: hb(b),
		+	deltaX: a.deltaX,
		+	deltaY: a.deltaY
		+	}
		+	}
		+
		+	function hb(a) {
		+	var b = a.length;
		+	if (1 === b) return {
		+	x: h(a[0].clientX),
		+	y: h(a[0].clientY)
		+	};
		+	for (var c = 0, d = 0, e = 0; b > e;) c += a[e].clientX, d += a[e].clientY, e++;
		+	return {
		+	x: h(c / b),
		+	y: h(d / b)
		+	}
		+	}
		+
		+	function ib(a, b, c) {
		+	return {
		+	x: b / a || 0,
		+	y: c / a || 0
		+	}
		+	}
		+
		+	function jb(a, b) {
		+	return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W
		+	}
		+
		+	function kb(a, b, c) {
		+	c || (c = $);
		+	var d = b[c[0]] - a[c[0]],
		+	e = b[c[1]] - a[c[1]];
		+	return Math.sqrt(d * d + e * e)
		+	}
		+
		+	function lb(a, b, c) {
		+	c || (c = $);
		+	var d = b[c[0]] - a[c[0]],
		+	e = b[c[1]] - a[c[1]];
		+	return 180 * Math.atan2(e, d) / Math.PI
		+	}
		+
		+	function mb(a, b) {
		+	return lb(b[1], b[0], _) - lb(a[1], a[0], _)
		+	}
		+
		+	function nb(a, b) {
		+	return kb(b[0], b[1], _) / kb(a[0], a[1], _)
		+	}
		+
		+	function rb() {
		+	this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments)
		+	}
		+
		+	function wb() {
		+	this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []
		+	}
		+
		+	function Ab() {
		+	this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments)
		+	}
		+
		+	function Bb(a, b) {
		+	var c = z(a.touches),
		+	d = z(a.changedTouches);
		+	return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]
		+	}
		+
		+	function Eb() {
		+	this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments)
		+	}
		+
		+	function Fb(a, b) {
		+	var c = z(a.touches),
		+	d = this.targetIds;
		+	if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];
		+	var e, f, g = z(a.changedTouches),
		+	h = [],
		+	i = this.target;
		+	if (f = c.filter(function (a) {
		+	return v(a.target, i)
		+	}), b === O)
		+	for (e = 0; e < f.length;) d[f[e].identifier] = !0, e++;
		+	for (e = 0; e < g.length;) d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
		+	return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0
		+	}
		+
		+	function Gb() {
		+	ab.apply(this, arguments);
		+	var a = q(this.handler, this);
		+	this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a)
		+	}
		+
		+	function Pb(a, b) {
		+	this.manager = a, this.set(b)
		+	}
		+
		+	function Qb(a) {
		+	if (w(a, Mb)) return Mb;
		+	var b = w(a, Nb),
		+	c = w(a, Ob);
		+	return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb
		+	}
		+
		+	function Yb(a) {
		+	this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []
		+	}
		+
		+	function Zb(a) {
		+	return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""
		+	}
		+
		+	function $b(a) {
		+	return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""
		+	}
		+
		+	function _b(a, b) {
		+	var c = b.manager;
		+	return c ? c.get(a) : a
		+	}
		+
		+	function ac() {
		+	Yb.apply(this, arguments)
		+	}
		+
		+	function bc() {
		+	ac.apply(this, arguments), this.pX = null, this.pY = null
		+	}
		+
		+	function cc() {
		+	ac.apply(this, arguments)
		+	}
		+
		+	function dc() {
		+	Yb.apply(this, arguments), this._timer = null, this._input = null
		+	}
		+
		+	function ec() {
		+	ac.apply(this, arguments)
		+	}
		+
		+	function fc() {
		+	ac.apply(this, arguments)
		+	}
		+
		+	function gc() {
		+	Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0
		+	}
		+
		+	function hc(a, b) {
		+	return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b)
		+	}
		+
		+	function kc(a, b) {
		+	b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
		+	var b = this.add(new a[0](a[1]));
		+	a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3])
		+	}, this)
		+	}
		+
		+	function lc(a, b) {
		+	var c = a.element;
		+	m(a.options.cssProps, function (a, d) {
		+	c.style[B(c.style, d)] = b ? a : ""
		+	})
		+	}
		+
		+	function mc(a, c) {
		+	var d = b.createEvent("Event");
		+	d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d)
		+	}
		+	var e = ["", "webkit", "moz", "MS", "ms", "o"],
		+	f = b.createElement("div"),
		+	g = "function",
		+	h = Math.round,
		+	i = Math.abs,
		+	j = Date.now,
		+	C = 1,
		+	F = /mobile|tablet|ip(ad|hone|od)|android/i,
		+	G = "ontouchstart" in a,
		+	H = B(a, "PointerEvent") !== d,
		+	I = G && F.test(navigator.userAgent),
		+	J = "touch",
		+	K = "pen",
		+	L = "mouse",
		+	M = "kinect",
		+	N = 25,
		+	O = 1,
		+	P = 2,
		+	Q = 4,
		+	R = 8,
		+	S = 1,
		+	T = 2,
		+	U = 4,
		+	V = 8,
		+	W = 16,
		+	X = T | U,
		+	Y = V | W,
		+	Z = X | Y,
		+	$ = ["x", "y"],
		+	_ = ["clientX", "clientY"];
		+	ab.prototype = {
		+	handler: function () {},
		+	init: function () {
		+	this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler)
		+	},
		+	destroy: function () {
		+	this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler)
		+	}
		+	};
		+	var ob = {
		+	mousedown: O,
		+	mousemove: P,
		+	mouseup: Q
		+	},
		+	pb = "mousedown",
		+	qb = "mousemove mouseup";
		+	p(rb, ab, {
		+	handler: function (a) {
		+	var b = ob[a.type];
		+	b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, {
		+	pointers: [a],
		+	changedPointers: [a],
		+	pointerType: L,
		+	srcEvent: a
		+	}))
		+	}
		+	});
		+	var sb = {
		+	pointerdown: O,
		+	pointermove: P,
		+	pointerup: Q,
		+	pointercancel: R,
		+	pointerout: R
		+	},
		+	tb = {
		+	2: J,
		+	3: K,
		+	4: L,
		+	5: M
		+	},
		+	ub = "pointerdown",
		+	vb = "pointermove pointerup pointercancel";
		+	a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, {
		+	handler: function (a) {
		+	var b = this.store,
		+	c = !1,
		+	d = a.type.toLowerCase().replace("ms", ""),
		+	e = sb[d],
		+	f = tb[a.pointerType] || a.pointerType,
		+	g = f == J,
		+	h = y(b, a.pointerId, "pointerId");
		+	e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, {
		+	pointers: b,
		+	changedPointers: [a],
		+	pointerType: f,
		+	srcEvent: a
		+	}), c && b.splice(h, 1))
		+	}
		+	});
		+	var xb = {
		+	touchstart: O,
		+	touchmove: P,
		+	touchend: Q,
		+	touchcancel: R
		+	},
		+	yb = "touchstart",
		+	zb = "touchstart touchmove touchend touchcancel";
		+	p(Ab, ab, {
		+	handler: function (a) {
		+	var b = xb[a.type];
		+	if (b === O && (this.started = !0), this.started) {
		+	var c = Bb.call(this, a, b);
		+	b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, {
		+	pointers: c[0],
		+	changedPointers: c[1],
		+	pointerType: J,
		+	srcEvent: a
		+	})
		+	}
		+	}
		+	});
		+	var Cb = {
		+	touchstart: O,
		+	touchmove: P,
		+	touchend: Q,
		+	touchcancel: R
		+	},
		+	Db = "touchstart touchmove touchend touchcancel";
		+	p(Eb, ab, {
		+	handler: function (a) {
		+	var b = Cb[a.type],
		+	c = Fb.call(this, a, b);
		+	c && this.callback(this.manager, b, {
		+	pointers: c[0],
		+	changedPointers: c[1],
		+	pointerType: J,
		+	srcEvent: a
		+	})
		+	}
		+	}), p(Gb, ab, {
		+	handler: function (a, b, c) {
		+	var d = c.pointerType == J,
		+	e = c.pointerType == L;
		+	if (d) this.mouse.allow = !1;
		+	else if (e && !this.mouse.allow) return;
		+	b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c)
		+	},
		+	destroy: function () {
		+	this.touch.destroy(), this.mouse.destroy()
		+	}
		+	});
		+	var Hb = B(f.style, "touchAction"),
		+	Ib = Hb !== d,
		+	Jb = "compute",
		+	Kb = "auto",
		+	Lb = "manipulation",
		+	Mb = "none",
		+	Nb = "pan-x",
		+	Ob = "pan-y";
		+	Pb.prototype = {
		+	set: function (a) {
		+	a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim()
		+	},
		+	update: function () {
		+	this.set(this.manager.options.touchAction)
		+	},
		+	compute: function () {
		+	var a = [];
		+	return m(this.manager.recognizers, function (b) {
		+	r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()))
		+	}), Qb(a.join(" "))
		+	},
		+	preventDefaults: function (a) {
		+	if (!Ib) {
		+	var b = a.srcEvent,
		+	c = a.offsetDirection;
		+	if (this.manager.session.prevented) return b.preventDefault(), void 0;
		+	var d = this.actions,
		+	e = w(d, Mb),
		+	f = w(d, Ob),
		+	g = w(d, Nb);
		+	return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0
		+	}
		+	},
		+	preventSrc: function (a) {
		+	this.manager.session.prevented = !0, a.preventDefault()
		+	}
		+	};
		+	var Rb = 1,
		+	Sb = 2,
		+	Tb = 4,
		+	Ub = 8,
		+	Vb = Ub,
		+	Wb = 16,
		+	Xb = 32;
		+	Yb.prototype = {
		+	defaults: {},
		+	set: function (a) {
		+	return n(this.options, a), this.manager && this.manager.touchAction.update(), this
		+	},
		+	recognizeWith: function (a) {
		+	if (l(a, "recognizeWith", this)) return this;
		+	var b = this.simultaneous;
		+	return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this
		+	},
		+	dropRecognizeWith: function (a) {
		+	return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this)
		+	},
		+	requireFailure: function (a) {
		+	if (l(a, "requireFailure", this)) return this;
		+	var b = this.requireFail;
		+	return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this
		+	},
		+	dropRequireFailure: function (a) {
		+	if (l(a, "dropRequireFailure", this)) return this;
		+	a = _b(a, this);
		+	var b = y(this.requireFail, a);
		+	return b > -1 && this.requireFail.splice(b, 1), this
		+	},
		+	hasRequireFailures: function () {
		+	return this.requireFail.length > 0
		+	},
		+	canRecognizeWith: function (a) {
		+	return !!this.simultaneous[a.id]
		+	},
		+	emit: function (a) {
		+	function d(d) {
		+	b.manager.emit(b.options.event + (d ? Zb(c) : ""), a)
		+	}
		+	var b = this,
		+	c = this.state;
		+	Ub > c && d(!0), d(), c >= Ub && d(!0)
		+	},
		+	tryEmit: function (a) {
		+	return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0)
		+	},
		+	canEmit: function () {
		+	for (var a = 0; a < this.requireFail.length;) {
		+	if (!(this.requireFail[a].state & (Xb | Rb))) return !1;
		+	a++
		+	}
		+	return !0
		+	},
		+	recognize: function (a) {
		+	var b = n({}, a);
		+	return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0)
		+	},
		+	process: function () {},
		+	getTouchAction: function () {},
		+	reset: function () {}
		+	}, p(ac, Yb, {
		+	defaults: {
		+	pointers: 1
		+	},
		+	attrTest: function (a) {
		+	var b = this.options.pointers;
		+	return 0 === b || a.pointers.length === b
		+	},
		+	process: function (a) {
		+	var b = this.state,
		+	c = a.eventType,
		+	d = b & (Sb | Tb),
		+	e = this.attrTest(a);
		+	return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb
		+	}
		+	}), p(bc, ac, {
		+	defaults: {
		+	event: "pan",
		+	threshold: 10,
		+	pointers: 1,
		+	direction: Z
		+	},
		+	getTouchAction: function () {
		+	var a = this.options.direction,
		+	b = [];
		+	return a & X && b.push(Ob), a & Y && b.push(Nb), b
		+	},
		+	directionTest: function (a) {
		+	var b = this.options,
		+	c = !0,
		+	d = a.distance,
		+	e = a.direction,
		+	f = a.deltaX,
		+	g = a.deltaY;
		+	return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction
		+	},
		+	attrTest: function (a) {
		+	return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a))
		+	},
		+	emit: function (a) {
		+	this.pX = a.deltaX, this.pY = a.deltaY;
		+	var b = $b(a.direction);
		+	b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a)
		+	}
		+	}), p(cc, ac, {
		+	defaults: {
		+	event: "pinch",
		+	threshold: 0,
		+	pointers: 2
		+	},
		+	getTouchAction: function () {
		+	return [Mb]
		+	},
		+	attrTest: function (a) {
		+	return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb)
		+	},
		+	emit: function (a) {
		+	if (this._super.emit.call(this, a), 1 !== a.scale) {
		+	var b = a.scale < 1 ? "in" : "out";
		+	this.manager.emit(this.options.event + b, a)
		+	}
		+	}
		+	}), p(dc, Yb, {
		+	defaults: {
		+	event: "press",
		+	pointers: 1,
		+	time: 500,
		+	threshold: 5
		+	},
		+	getTouchAction: function () {
		+	return [Kb]
		+	},
		+	process: function (a) {
		+	var b = this.options,
		+	c = a.pointers.length === b.pointers,
		+	d = a.distance < b.threshold,
		+	e = a.deltaTime > b.time;
		+	if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();
		+	else if (a.eventType & O) this.reset(), this._timer = k(function () {
		+	this.state = Vb, this.tryEmit()
		+	}, b.time, this);
		+	else if (a.eventType & Q) return Vb;
		+	return Xb
		+	},
		+	reset: function () {
		+	clearTimeout(this._timer)
		+	},
		+	emit: function (a) {
		+	this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)))
		+	}
		+	}), p(ec, ac, {
		+	defaults: {
		+	event: "rotate",
		+	threshold: 0,
		+	pointers: 2
		+	},
		+	getTouchAction: function () {
		+	return [Mb]
		+	},
		+	attrTest: function (a) {
		+	return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb)
		+	}
		+	}), p(fc, ac, {
		+	defaults: {
		+	event: "swipe",
		+	threshold: 10,
		+	velocity: .65,
		+	direction: X | Y,
		+	pointers: 1
		+	},
		+	getTouchAction: function () {
		+	return bc.prototype.getTouchAction.call(this)
		+	},
		+	attrTest: function (a) {
		+	var c, b = this.options.direction;
		+	return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q
		+	},
		+	emit: function (a) {
		+	var b = $b(a.direction);
		+	b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a)
		+	}
		+	}), p(gc, Yb, {
		+	defaults: {
		+	event: "tap",
		+	pointers: 1,
		+	taps: 1,
		+	interval: 300,
		+	time: 250,
		+	threshold: 2,
		+	posThreshold: 10
		+	},
		+	getTouchAction: function () {
		+	return [Lb]
		+	},
		+	process: function (a) {
		+	var b = this.options,
		+	c = a.pointers.length === b.pointers,
		+	d = a.distance < b.threshold,
		+	e = a.deltaTime < b.time;
		+	if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();
		+	if (d && e && c) {
		+	if (a.eventType != Q) return this.failTimeout();
		+	var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
		+	g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;
		+	this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;
		+	var h = this.count % b.taps;
		+	if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
		+	this.state = Vb, this.tryEmit()
		+	}, b.interval, this), Sb) : Vb
		+	}
		+	return Xb
		+	},
		+	failTimeout: function () {
		+	return this._timer = k(function () {
		+	this.state = Xb
		+	}, this.options.interval, this), Xb
		+	},
		+	reset: function () {
		+	clearTimeout(this._timer)
		+	},
		+	emit: function () {
		+	this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input))
		+	}
		+	}), hc.VERSION = "2.0.4", hc.defaults = {
		+	domEvents: !1,
		+	touchAction: Jb,
		+	enable: !0,
		+	inputTarget: null,
		+	inputClass: null,
		+	preset: [[ec, {
		+	enable: !1
		+	}], [cc, {
		+	enable: !1
		+	}, ["rotate"]], [fc, {
		+	direction: X
		+	}], [bc, {
		+	direction: X
		+	}, ["swipe"]], [gc], [gc, {
		+	event: "doubletap",
		+	taps: 2
		+	}, ["tap"]], [dc]],
		+	cssProps: {
		+	userSelect: "default",
		+	touchSelect: "none",
		+	touchCallout: "none",
		+	contentZooming: "none",
		+	userDrag: "none",
		+	tapHighlightColor: "rgba(0,0,0,0)"
		+	}
		+	};
		+	var ic = 1,
		+	jc = 2;
		+	kc.prototype = {
		+	set: function (a) {
		+	return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this
		+	},
		+	stop: function (a) {
		+	this.session.stopped = a ? jc : ic
		+	},
		+	recognize: function (a) {
		+	var b = this.session;
		+	if (!b.stopped) {
		+	this.touchAction.preventDefaults(a);
		+	var c, d = this.recognizers,
		+	e = b.curRecognizer;
		+	(!e || e && e.state & Vb) && (e = b.curRecognizer = null);
		+	for (var f = 0; f < d.length;) c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++
		+	}
		+	},
		+	get: function (a) {
		+	if (a instanceof Yb) return a;
		+	for (var b = this.recognizers, c = 0; c < b.length; c++)
		+	if (b[c].options.event == a) return b[c];
		+	return null
		+	},
		+	add: function (a) {
		+	if (l(a, "add", this)) return this;
		+	var b = this.get(a.options.event);
		+	return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a
		+	},
		+	remove: function (a) {
		+	if (l(a, "remove", this)) return this;
		+	var b = this.recognizers;
		+	return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this
		+	},
		+	on: function (a, b) {
		+	var c = this.handlers;
		+	return m(x(a), function (a) {
		+	c[a] = c[a] || [], c[a].push(b)
		+	}), this
		+	},
		+	off: function (a, b) {
		+	var c = this.handlers;
		+	return m(x(a), function (a) {
		+	b ? c[a].splice(y(c[a], b), 1) : delete c[a]
		+	}), this
		+	},
		+	emit: function (a, b) {
		+	this.options.domEvents && mc(a, b);
		+	var c = this.handlers[a] && this.handlers[a].slice();
		+	if (c && c.length) {
		+	b.type = a, b.preventDefault = function () {
		+	b.srcEvent.preventDefault()
		+	};
		+	for (var d = 0; d < c.length;) c[d](b), d++
		+	}
		+	},
		+	destroy: function () {
		+	this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null
		+	}
		+	}, n(hc, {
		+	INPUT_START: O,
		+	INPUT_MOVE: P,
		+	INPUT_END: Q,
		+	INPUT_CANCEL: R,
		+	STATE_POSSIBLE: Rb,
		+	STATE_BEGAN: Sb,
		+	STATE_CHANGED: Tb,
		+	STATE_ENDED: Ub,
		+	STATE_RECOGNIZED: Vb,
		+	STATE_CANCELLED: Wb,
		+	STATE_FAILED: Xb,
		+	DIRECTION_NONE: S,
		+	DIRECTION_LEFT: T,
		+	DIRECTION_RIGHT: U,
		+	DIRECTION_UP: V,
		+	DIRECTION_DOWN: W,
		+	DIRECTION_HORIZONTAL: X,
		+	DIRECTION_VERTICAL: Y,
		+	DIRECTION_ALL: Z,
		+	Manager: kc,
		+	Input: ab,
		+	TouchAction: Pb,
		+	TouchInput: Eb,
		+	MouseInput: rb,
		+	PointerEventInput: wb,
		+	TouchMouseInput: Gb,
		+	SingleTouchInput: Ab,
		+	Recognizer: Yb,
		+	AttrRecognizer: ac,
		+	Tap: gc,
		+	Pan: bc,
		+	Swipe: fc,
		+	Pinch: cc,
		+	Rotate: ec,
		+	Press: dc,
		+	on: t,
		+	off: u,
		+	each: m,
		+	merge: o,
		+	extend: n,
		+	inherit: p,
		+	bindFn: q,
		+	prefixed: B
		+	}), typeof define == g && define.amd ? define(function () {
		+	return hc
		+	}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc
		+	}(window, document, "Hammer");;
		+	(function (factory) {
		+	if (typeof define === 'function' && define.amd) {
		+	define(['jquery', 'hammerjs'], factory);
		+	} else if (typeof exports === 'object') {
		+	factory(require('jquery'), require('hammerjs'));
		+	} else {
		+	factory(jQuery, Hammer);
		+	}
		+	}(function ($, Hammer) {
		+	function hammerify(el, options) {
		+	var $el = $(el);
		+	if (!$el.data("hammer")) {
		+	$el.data("hammer", new Hammer($el[0], options));
		+	}
		+	}
		+
		+	$.fn.hammer = function (options) {
		+	return this.each(function () {
		+	hammerify(this, options);
		+	});
		+	};
		+
		+	// extend the emit method to also trigger jQuery events
		+	Hammer.Manager.prototype.emit = (function (originalEmit) {
		+	return function (type, data) {
		+	originalEmit.call(this, type, data);
		+	$(this.element).trigger({
		+	type: type,
		+	gesture: data
		+	});
		+	};
		+	})(Hammer.Manager.prototype.emit);
		+	}));; // Required for Meteor package, the use of window prevents export by Meteor
		+	(function (window) {
		+	if (window.Package) {
		+	Materialize = {};
		+	} else {
		+	window.Materialize = {};
		+	}
		+	})(window);
		+
		+
		+	/*
		+	* raf.js
		+	* https://github.com/ngryman/raf.js
		+	*
		+	* original requestAnimationFrame polyfill by Erik Möller
		+	* inspired from paul_irish gist and post
		+	*
		+	* Copyright (c) 2013 ngryman
		+	* Licensed under the MIT license.
		+	*/
		+	(function (window) {
		+	var lastTime = 0,
		+	vendors = ['webkit', 'moz'],
		+	requestAnimationFrame = window.requestAnimationFrame,
		+	cancelAnimationFrame = window.cancelAnimationFrame,
		+	i = vendors.length;
		+
		+	// try to un-prefix existing raf
		+	while (--i >= 0 && !requestAnimationFrame) {
		+	requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
		+	cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
		+	}
		+
		+	// polyfill with setTimeout fallback
		+	// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
		+	if (!requestAnimationFrame || !cancelAnimationFrame) {
		+	requestAnimationFrame = function (callback) {
		+	var now = +Date.now(),
		+	nextTime = Math.max(lastTime + 16, now);
		+	return setTimeout(function () {
		+	callback(lastTime = nextTime);
		+	}, nextTime - now);
		+	};
		+
		+	cancelAnimationFrame = clearTimeout;
		+	}
		+
		+	// export to window
		+	window.requestAnimationFrame = requestAnimationFrame;
		+	window.cancelAnimationFrame = cancelAnimationFrame;
		+	}(window));
		+
		+
		+	/**
		+	* Generate approximated selector string for a jQuery object
		+	* @param {jQuery} obj  jQuery object to be parsed
		+	* @returns {string}
		+	*/
		+	Materialize.objectSelectorString = function (obj) {
		+	var tagStr = obj.prop('tagName') || '';
		+	var idStr = obj.attr('id') || '';
		+	var classStr = obj.attr('class') || '';
		+	return (tagStr + idStr + classStr).replace(/\s/g, '');
		+	};
		+
		+
		+	// Unique Random ID
		+	Materialize.guid = (function () {
		+	function s4() {
		+	return Math.floor((1 + Math.random()) * 0x10000)
		+	.toString(16)
		+	.substring(1);
		+	}
		+	return function () {
		+	return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
		+	s4() + '-' + s4() + s4() + s4();
		+	};
		+	})();
		+
		+	/**
		+	* Escapes hash from special characters
		+	* @param {string} hash  String returned from this.hash
		+	* @returns {string}
		+	*/
		+	Materialize.escapeHash = function (hash) {
		+	return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
		+	};
		+
		+	Materialize.elementOrParentIsFixed = function (element) {
		+	var $element = $(element);
		+	var $checkElements = $element.add($element.parents());
		+	var isFixed = false;
		+	$checkElements.each(function () {
		+	if ($(this).css("position") === "fixed") {
		+	isFixed = true;
		+	return false;
		+	}
		+	});
		+	return isFixed;
		+	};
		+
		+
		+	/**
		+	* Get time in ms
		+	* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
		+	* @type {function}
		+	* @return {number}
		+	*/
		+	var getTime = (Date.now || function () {
		+	return new Date().getTime();
		+	});
		+
		+
		+	/**
		+	* Returns a function, that, when invoked, will only be triggered at most once
		+	* during a given window of time. Normally, the throttled function will run
		+	* as much as it can, without ever going more than once per `wait` duration;
		+	* but if you'd like to disable the execution on the leading edge, pass
		+	* `{leading: false}`. To disable execution on the trailing edge, ditto.
		+	* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
		+	* @param {function} func
		+	* @param {number} wait
		+	* @param {Object=} options
		+	* @returns {Function}
		+	*/
		+	Materialize.throttle = function (func, wait, options) {
		+	var context, args, result;
		+	var timeout = null;
		+	var previous = 0;
		+	options || (options = {});
		+	var later = function () {
		+	previous = options.leading === false ? 0 : getTime();
		+	timeout = null;
		+	result = func.apply(context, args);
		+	context = args = null;
		+	};
		+	return function () {
		+	var now = getTime();
		+	if (!previous && options.leading === false) previous = now;
		+	var remaining = wait - (now - previous);
		+	context = this;
		+	args = arguments;
		+	if (remaining <= 0) {
		+	clearTimeout(timeout);
		+	timeout = null;
		+	previous = now;
		+	result = func.apply(context, args);
		+	context = args = null;
		+	} else if (!timeout && options.trailing !== false) {
		+	timeout = setTimeout(later, remaining);
		+	}
		+	return result;
		+	};
		+	};
		+
		+
		+	// Velocity has conflicts when loaded with jQuery, this will check for it
		+	// First, check if in noConflict mode
		+	var Vel;
		+	if (jQuery) {
		+	Vel = jQuery.Velocity;
		+	} else if ($) {
		+	Vel = $.Velocity;
		+	} else {
		+	Vel = Velocity;
		+	};
		+	(function ($) {
		+	$.fn.collapsible = function (options, methodParam) {
		+	var defaults = {
		+	accordion: undefined,
		+	onOpen: undefined,
		+	onClose: undefined
		+	};
		+
		+	var methodName = options;
		+	options = $.extend(defaults, options);
		+
		+
		+	return this.each(function () {
		+
		+	var $this = $(this);
		+
		+	var $panel_headers = $(this).find('> li > .collapsible-header');
		+
		+	var collapsible_type = $this.data("collapsible");
		+
		+	/****************
		+	Helper Functions
		+	****************/
		+
		+	// Accordion Open
		+	function accordionOpen(object) {
		+	$panel_headers = $this.find('> li > .collapsible-header');
		+	if (object.hasClass('active')) {
		+	object.parent().addClass('active');
		+	} else {
		+	object.parent().removeClass('active');
		+	}
		+	if (object.parent().hasClass('active')) {
		+	object.siblings('.collapsible-body').stop(true, false).slideDown({
		+	duration: 350,
		+	easing: "easeOutQuart",
		+	queue: false,
		+	complete: function () {
		+	$(this).css('height', '');
		+	}
		+	});
		+	} else {
		+	object.siblings('.collapsible-body').stop(true, false).slideUp({
		+	duration: 350,
		+	easing: "easeOutQuart",
		+	queue: false,
		+	complete: function () {
		+	$(this).css('height', '');
		+	}
		+	});
		+	}
		+
		+	$panel_headers.not(object).removeClass('active').parent().removeClass('active');
		+
		+	// Close previously open accordion elements.
		+	$panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
		+	if ($(this).is(':visible')) {
		+	$(this).slideUp({
		+	duration: 350,
		+	easing: "easeOutQuart",
		+	queue: false,
		+	complete: function () {
		+	$(this).css('height', '');
		+	execCallbacks($(this).siblings('.collapsible-header'));
		+	}
		+	});
		+	}
		+	});
		+	}
		+
		+	// Expandable Open
		+	function expandableOpen(object) {
		+	if (object.hasClass('active')) {
		+	object.parent().addClass('active');
		+	} else {
		+	object.parent().removeClass('active');
		+	}
		+	if (object.parent().hasClass('active')) {
		+	object.siblings('.collapsible-body').stop(true, false).slideDown({
		+	duration: 350,
		+	easing: "easeOutQuart",
		+	queue: false,
		+	complete: function () {
		+	$(this).css('height', '');
		+	}
		+	});
		+	} else {
		+	object.siblings('.collapsible-body').stop(true, false).slideUp({
		+	duration: 350,
		+	easing: "easeOutQuart",
		+	queue: false,
		+	complete: function () {
		+	$(this).css('height', '');
		+	}
		+	});
		+	}
		+	}
		+
		+	// Open collapsible. object: .collapsible-header
		+	function collapsibleOpen(object, noToggle) {
		+	if (!noToggle) {
		+	object.toggleClass('active');
		+	}
		+
		+	if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
		+	accordionOpen(object);
		+	} else { // Handle Expandables
		+	expandableOpen(object);
		+	}
		+
		+	execCallbacks(object);
		+	}
		+
		+	// Handle callbacks
		+	function execCallbacks(object) {
		+	if (object.hasClass('active')) {
		+	if (typeof (options.onOpen) === "function") {
		+	options.onOpen.call(this, object.parent());
		+	}
		+	} else {
		+	if (typeof (options.onClose) === "function") {
		+	options.onClose.call(this, object.parent());
		+	}
		+	}
		+	}
		+
		+	/**
		+	* Check if object is children of panel header
		+	* @param  {Object}  object Jquery object
		+	* @return {Boolean} true if it is children
		+	*/
		+	function isChildrenOfPanelHeader(object) {
		+
		+	var panelHeader = getPanelHeader(object);
		+
		+	return panelHeader.length > 0;
		+	}
		+
		+	/**
		+	* Get panel header from a children element
		+	* @param  {Object} object Jquery object
		+	* @return {Object} panel header object
		+	*/
		+	function getPanelHeader(object) {
		+
		+	return object.closest('li > .collapsible-header');
		+	}
		+
		+
		+	// Turn off any existing event handlers
		+	function removeEventHandlers() {
		+	$this.off('click.collapse', '> li > .collapsible-header');
		+	}
		+
		+	/*****  End Helper Functions  *****/
		+
		+
		+	// Methods
		+	if (methodName === 'destroy') {
		+	removeEventHandlers();
		+	return;
		+	} else if (methodParam >= 0 &&
		+	methodParam < $panel_headers.length) {
		+	var $curr_header = $panel_headers.eq(methodParam);
		+	if ($curr_header.length &&
		+	(methodName === 'open' ||
		+	(methodName === 'close' &&
		+	$curr_header.hasClass('active')))) {
		+	collapsibleOpen($curr_header);
		+	}
		+	return;
		+	}
		+
		+
		+	removeEventHandlers();
		+
		+
		+	// Add click handler to only direct collapsible header children
		+	$this.on('click.collapse', '> li > .collapsible-header', function (e) {
		+	var element = $(e.target);
		+
		+	if (isChildrenOfPanelHeader(element)) {
		+	element = getPanelHeader(element);
		+	}
		+
		+	collapsibleOpen(element);
		+	});
		+
		+
		+	// Open first active
		+	if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
		+	collapsibleOpen($panel_headers.filter('.active').first(), true);
		+
		+	} else { // Handle Expandables
		+	$panel_headers.filter('.active').each(function () {
		+	collapsibleOpen($(this), true);
		+	});
		+	}
		+
		+	});
		+	};
		+
		+	$(document).ready(function () {
		+	$('.collapsible').collapsible();
		+	});
		+	}(jQuery));;
		+	(function ($) {
		+
		+	// Add posibility to scroll to selected option
		+	// usefull for select for example
		+	$.fn.scrollTo = function (elem) {
		+	$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
		+	return this;
		+	};
		+
		+	$.fn.dropdown = function (options) {
		+	var defaults = {
		+	inDuration: 300,
		+	outDuration: 225,
		+	constrainWidth: true, // Constrains width of dropdown to the activator
		+	hover: false,
		+	gutter: 0, // Spacing from edge
		+	belowOrigin: false,
		+	alignment: 'left',
		+	stopPropagation: false
		+	};
		+
		+	// Open dropdown.
		+	if (options === "open") {
		+	this.each(function () {
		+	$(this).trigger('open');
		+	});
		+	return false;
		+	}
		+
		+	// Close dropdown.
		+	if (options === "close") {
		+	this.each(function () {
		+	$(this).trigger('close');
		+	});
		+	return false;
		+	}
		+
		+	this.each(function () {
		+	var origin = $(this);
		+	var curr_options = $.extend({}, defaults, options);
		+	var isFocused = false;
		+
		+	// Dropdown menu
		+	var activates = $("#" + origin.attr('data-activates'));
		+
		+	function updateOptions() {
		+	if (origin.data('induration') !== undefined)
		+	curr_options.inDuration = origin.data('induration');
		+	if (origin.data('outduration') !== undefined)
		+	curr_options.outDuration = origin.data('outduration');
		+	if (origin.data('constrainwidth') !== undefined)
		+	curr_options.constrainWidth = origin.data('constrainwidth');
		+	if (origin.data('hover') !== undefined)
		+	curr_options.hover = origin.data('hover');
		+	if (origin.data('gutter') !== undefined)
		+	curr_options.gutter = origin.data('gutter');
		+	if (origin.data('beloworigin') !== undefined)
		+	curr_options.belowOrigin = origin.data('beloworigin');
		+	if (origin.data('alignment') !== undefined)
		+	curr_options.alignment = origin.data('alignment');
		+	if (origin.data('stoppropagation') !== undefined)
		+	curr_options.stopPropagation = origin.data('stoppropagation');
		+	}
		+
		+	updateOptions();
		+
		+	// Attach dropdown to its activator
		+	origin.after(activates);
		+
		+	/*
		+	Helper function to position and resize dropdown.
		+	Used in hover and click handler.
		+	*/
		+	function placeDropdown(eventType) {
		+	// Check for simultaneous focus and click events.
		+	if (eventType === 'focus') {
		+	isFocused = true;
		+	}
		+
		+	// Check html data attributes
		+	updateOptions();
		+
		+	// Set Dropdown state
		+	activates.addClass('active');
		+	origin.addClass('active');
		+
		+	// Constrain width
		+	if (curr_options.constrainWidth === true) {
		+	activates.css('width', origin.outerWidth());
		+
		+	} else {
		+	activates.css('white-space', 'nowrap');
		+	}
		+
		+	// Offscreen detection
		+	var windowHeight = window.innerHeight;
		+	var originHeight = origin.innerHeight();
		+	var offsetLeft = origin.offset().left;
		+	var offsetTop = origin.offset().top - $(window).scrollTop();
		+	var currAlignment = curr_options.alignment;
		+	var gutterSpacing = 0;
		+	var leftPosition = 0;
		+
		+	// Below Origin
		+	var verticalOffset = 0;
		+	if (curr_options.belowOrigin === true) {
		+	verticalOffset = originHeight;
		+	}
		+
		+	// Check for scrolling positioned container.
		+	var scrollYOffset = 0;
		+	var scrollXOffset = 0;
		+	var wrapper = origin.parent();
		+	if (!wrapper.is('body')) {
		+	if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
		+	scrollYOffset = wrapper[0].scrollTop;
		+	}
		+	if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
		+	scrollXOffset = wrapper[0].scrollLeft;
		+	}
		+	}
		+
		+
		+	if (offsetLeft + activates.innerWidth() > $(window).width()) {
		+	// Dropdown goes past screen on right, force right alignment
		+	currAlignment = 'right';
		+
		+	} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
		+	// Dropdown goes past screen on left, force left alignment
		+	currAlignment = 'left';
		+	}
		+	// Vertical bottom offscreen detection
		+	if (offsetTop + activates.innerHeight() > windowHeight) {
		+	// If going upwards still goes offscreen, just crop height of dropdown.
		+	if (offsetTop + originHeight - activates.innerHeight() < 0) {
		+	var adjustedHeight = windowHeight - offsetTop - verticalOffset;
		+	activates.css('max-height', adjustedHeight);
		+	} else {
		+	// Flow upwards.
		+	if (!verticalOffset) {
		+	verticalOffset += originHeight;
		+	}
		+	verticalOffset -= activates.innerHeight();
		+	}
		+	}
		+
		+	// Handle edge alignment
		+	if (currAlignment === 'left') {
		+	gutterSpacing = curr_options.gutter;
		+	leftPosition = origin.position().left + gutterSpacing;
		+	} else if (currAlignment === 'right') {
		+	// Material icons fix
		+	activates
		+	.stop(true, true)
		+	.css({
		+	opacity: 0,
		+	left: 0
		+	})
		+
		+	var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
		+	gutterSpacing = -curr_options.gutter;
		+	leftPosition = offsetRight + gutterSpacing;
		+	}
		+
		+	// Position dropdown
		+	activates.css({
		+	position: 'absolute',
		+	top: origin.position().top + verticalOffset + scrollYOffset,
		+	left: leftPosition + scrollXOffset
		+	});
		+
		+	// Show dropdown
		+	activates
		+	.slideDown({
		+	queue: false,
		+	duration: curr_options.inDuration,
		+	easing: 'easeOutCubic',
		+	complete: function () {
		+	$(this).css('height', '');
		+	}
		+	})
		+	.animate({
		+	opacity: 1
		+	}, {
		+	queue: false,
		+	duration: curr_options.inDuration,
		+	easing: 'easeOutSine'
		+	});
		+
		+	// Add click close handler to document
		+	setTimeout(function () {
		+	$(document).on('click.' + activates.attr('id'), function (e) {
		+	hideDropdown();
		+	$(document).off('click.' + activates.attr('id'));
		+	});
		+	}, 0);
		+	}
		+
		+	function hideDropdown() {
		+	// Check for simultaneous focus and click events.
		+	isFocused = false;
		+	activates.fadeOut(curr_options.outDuration);
		+	activates.removeClass('active');
		+	origin.removeClass('active');
		+	$(document).off('click.' + activates.attr('id'));
		+	setTimeout(function () {
		+	activates.css('max-height', '');
		+	}, curr_options.outDuration);
		+	}
		+
		+	// Hover
		+	if (curr_options.hover) {
		+	var open = false;
		+	origin.off('click.' + origin.attr('id'));
		+	// Hover handler to show dropdown
		+	origin.on('mouseenter', function (e) { // Mouse over
		+	if (open === false) {
		+	placeDropdown();
		+	open = true;
		+	}
		+	});
		+	origin.on('mouseleave', function (e) {
		+	// If hover on origin then to something other than dropdown content, then close
		+	var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
		+	if (!$(toEl).closest('.dropdown-content').is(activates)) {
		+	activates.stop(true, true);
		+	hideDropdown();
		+	open = false;
		+	}
		+	});
		+
		+	activates.on('mouseleave', function (e) { // Mouse out
		+	var toEl = e.toElement || e.relatedTarget;
		+	if (!$(toEl).closest('.dropdown-button').is(origin)) {
		+	activates.stop(true, true);
		+	hideDropdown();
		+	open = false;
		+	}
		+	});
		+
		+	// Click
		+	} else {
		+	// Click handler to show dropdown
		+	origin.off('click.' + origin.attr('id'));
		+	origin.on('click.' + origin.attr('id'), function (e) {
		+	if (!isFocused) {
		+	if (origin[0] == e.currentTarget &&
		+	!origin.hasClass('active') &&
		+	($(e.target).closest('.dropdown-content').length === 0)) {
		+	e.preventDefault(); // Prevents button click from moving window
		+	if (curr_options.stopPropagation) {
		+	e.stopPropagation();
		+	}
		+	placeDropdown('click');
		+	}
		+	// If origin is clicked and menu is open, close menu
		+	else if (origin.hasClass('active')) {
		+	hideDropdown();
		+	$(document).off('click.' + activates.attr('id'));
		+	}
		+	}
		+	});
		+
		+	} // End else
		+
		+	// Listen to open and close event - useful for select component
		+	origin.on('open', function (e, eventType) {
		+	placeDropdown(eventType);
		+	});
		+	origin.on('close', hideDropdown);
		+
		+
		+	});
		+	}; // End dropdown plugin
		+
		+	$(document).ready(function () {
		+	$('.dropdown-button').dropdown();
		+	});
		+	}(jQuery));;
		+	(function ($) {
		+	var _stack = 0,
		+	_lastID = 0,
		+	_generateID = function () {
		+	_lastID++;
		+	return 'materialize-modal-overlay-' + _lastID;
		+	};
		+
		+	var methods = {
		+	init: function (options) {
		+	var defaults = {
		+	opacity: 0.5,
		+	inDuration: 350,
		+	outDuration: 250,
		+	ready: undefined,
		+	complete: undefined,
		+	dismissible: true,
		+	startingTop: '4%',
		+	endingTop: '10%'
		+	};
		+
		+	// Override defaults
		+	options = $.extend(defaults, options);
		+
		+	return this.each(function () {
		+	var $modal = $(this);
		+	var modal_id = $(this).attr("id") || '#' + $(this).data('target');
		+
		+	var closeModal = function () {
		+	var overlayID = $modal.data('overlay-id');
		+	var $overlay = $('#' + overlayID);
		+	$modal.removeClass('open');
		+
		+	// Enable scrolling
		+	$('body').css({
		+	overflow: '',
		+	width: ''
		+	});
		+
		+	$modal.find('.modal-close').off('click.close');
		+	$(document).off('keyup.modal' + overlayID);
		+
		+	$overlay.velocity({
		+	opacity: 0
		+	}, {
		+	duration: options.outDuration,
		+	queue: false,
		+	ease: "easeOutQuart"
		+	});
		+
		+
		+	// Define Bottom Sheet animation
		+	var exitVelocityOptions = {
		+	duration: options.outDuration,
		+	queue: false,
		+	ease: "easeOutCubic",
		+	// Handle modal ready callback
		+	complete: function () {
		+	$(this).css({
		+	display: "none"
		+	});
		+
		+	// Call complete callback
		+	if (typeof (options.complete) === "function") {
		+	options.complete.call(this, $modal);
		+	}
		+	$overlay.remove();
		+	_stack--;
		+	}
		+	};
		+	if ($modal.hasClass('bottom-sheet')) {
		+	$modal.velocity({
		+	bottom: "-100%",
		+	opacity: 0
		+	}, exitVelocityOptions);
		+	} else {
		+	$modal.velocity({
		+	top: options.startingTop,
		+	opacity: 0,
		+	scaleX: 0.7
		+	},
		+	exitVelocityOptions
		+	);
		+	}
		+	};
		+
		+	var openModal = function ($trigger) {
		+	var $body = $('body');
		+	var oldWidth = $body.innerWidth();
		+	$body.css('overflow', 'hidden');
		+	$body.width(oldWidth);
		+
		+	if ($modal.hasClass('open')) {
		+	return;
		+	}
		+
		+	var overlayID = _generateID();
		+	var $overlay = $('<div class="modal-overlay"></div>');
		+	var lStack = (++_stack);
		+
		+	// Store a reference of the overlay
		+	$overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
		+	$modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
		+	$modal.addClass('open');
		+
		+	$("body").append($overlay);
		+
		+	if (options.dismissible) {
		+	$overlay.click(function () {
		+	closeModal();
		+	});
		+	// Return on ESC
		+	$(document).on('keyup.modal' + overlayID, function (e) {
		+	if (e.keyCode === 27) { // ESC key
		+	closeModal();
		+	}
		+	});
		+	}
		+
		+	$modal.find(".modal-close").on('click.close', function (e) {
		+	closeModal();
		+	});
		+
		+	$overlay.css({
		+	display: "block",
		+	opacity: 0
		+	});
		+
		+	$modal.css({
		+	display: "block",
		+	opacity: 0
		+	});
		+
		+	$overlay.velocity({
		+	opacity: options.opacity
		+	}, {
		+	duration: options.inDuration,
		+	queue: false,
		+	ease: "easeOutCubic"
		+	});
		+	$modal.data('associated-overlay', $overlay[0]);
		+
		+	// Define Bottom Sheet animation
		+	var enterVelocityOptions = {
		+	duration: options.inDuration,
		+	queue: false,
		+	ease: "easeOutCubic",
		+	// Handle modal ready callback
		+	complete: function () {
		+	if (typeof (options.ready) === "function") {
		+	options.ready.call(this, $modal, $trigger);
		+	}
		+	}
		+	};
		+	if ($modal.hasClass('bottom-sheet')) {
		+	$modal.velocity({
		+	bottom: "0",
		+	opacity: 1
		+	}, enterVelocityOptions);
		+	} else {
		+	$.Velocity.hook($modal, "scaleX", 0.7);
		+	$modal.css({
		+	top: options.startingTop
		+	});
		+	$modal.velocity({
		+	top: options.endingTop,
		+	opacity: 1,
		+	scaleX: '1'
		+	}, enterVelocityOptions);
		+	}
		+
		+	};
		+
		+	// Reset handlers
		+	$(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
		+	$(this).off('openModal');
		+	$(this).off('closeModal');
		+
		+	// Close Handlers
		+	$(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function (e) {
		+	options.startingTop = ($(this).offset().top - $(window).scrollTop()) / 1.15;
		+	openModal($(this));
		+	e.preventDefault();
		+	}); // done set on click
		+
		+	$(this).on('openModal', function () {
		+	var modal_id = $(this).attr("href") || '#' + $(this).data('target');
		+	openModal();
		+	});
		+
		+	$(this).on('closeModal', function () {
		+	closeModal();
		+	});
		+	}); // done return
		+	},
		+	open: function () {
		+	methods.init.apply(this, arguments);
		+	$(this).trigger('openModal');
		+	},
		+	close: function () {
		+	$(this).trigger('closeModal');
		+	}
		+	};
		+
		+	$.fn.modal = function (methodOrOptions) {
		+	if (methods[methodOrOptions]) {
		+	return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
		+	} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
		+	// Default to "init"
		+	return methods.init.apply(this, arguments);
		+	} else {
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
		+	}
		+	};
		+	})(jQuery);;
		+	(function ($) {
		+
		+	$.fn.materialbox = function () {
		+
		+	return this.each(function () {
		+
		+	if ($(this).hasClass('initialized')) {
		+	return;
		+	}
		+
		+	$(this).addClass('initialized');
		+
		+	var overlayActive = false;
		+	var doneAnimating = true;
		+	var inDuration = 275;
		+	var outDuration = 200;
		+	var origin = $(this);
		+	var placeholder = $('<div></div>').addClass('material-placeholder');
		+	var originalWidth = 0;
		+	var originalHeight = 0;
		+	var ancestorsChanged;
		+	var ancestor;
		+	var originInlineStyles = origin.attr('style');
		+	origin.wrap(placeholder);
		+
		+
		+	// Start click handler
		+	origin.on('click', function () {
		+	var placeholder = origin.parent('.material-placeholder');
		+	var windowWidth = window.innerWidth;
		+	var windowHeight = window.innerHeight;
		+	var originalWidth = origin.width();
		+	var originalHeight = origin.height();
		+
		+
		+	// If already modal, return to original
		+	if (doneAnimating === false) {
		+	returnToOriginal();
		+	return false;
		+	} else if (overlayActive && doneAnimating === true) {
		+	returnToOriginal();
		+	return false;
		+	}
		+
		+
		+	// Set states
		+	doneAnimating = false;
		+	origin.addClass('active');
		+	overlayActive = true;
		+
		+	// Set positioning for placeholder
		+	placeholder.css({
		+	width: placeholder[0].getBoundingClientRect().width,
		+	height: placeholder[0].getBoundingClientRect().height,
		+	position: 'relative',
		+	top: 0,
		+	left: 0
		+	});
		+
		+	// Find ancestor with overflow: hidden; and remove it
		+	ancestorsChanged = undefined;
		+	ancestor = placeholder[0].parentNode;
		+	var count = 0;
		+	while (ancestor !== null && !$(ancestor).is(document)) {
		+	var curr = $(ancestor);
		+	if (curr.css('overflow') !== 'visible') {
		+	curr.css('overflow', 'visible');
		+	if (ancestorsChanged === undefined) {
		+	ancestorsChanged = curr;
		+	} else {
		+	ancestorsChanged = ancestorsChanged.add(curr);
		+	}
		+	}
		+	ancestor = ancestor.parentNode;
		+	}
		+
		+	// Set css on origin
		+	origin.css({
		+	position: 'absolute',
		+	'z-index': 1000,
		+	'will-change': 'left, top, width, height'
		+	})
		+	.data('width', originalWidth)
		+	.data('height', originalHeight);
		+
		+	// Add overlay
		+	var overlay = $('<div id="materialbox-overlay"></div>')
		+	.css({
		+	opacity: 0
		+	})
		+	.click(function () {
		+	if (doneAnimating === true)
		+	returnToOriginal();
		+	});
		+
		+	// Put before in origin image to preserve z-index layering.
		+	origin.before(overlay);
		+
		+	// Set dimensions if needed
		+	var overlayOffset = overlay[0].getBoundingClientRect();
		+	overlay.css({
		+	width: windowWidth,
		+	height: windowHeight,
		+	left: -1 * overlayOffset.left,
		+	top: -1 * overlayOffset.top
		+	})
		+
		+	// Animate Overlay
		+	overlay.velocity({
		+	opacity: 1
		+	}, {
		+	duration: inDuration,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+
		+	// Add and animate caption if it exists
		+	if (origin.data('caption') !== "") {
		+	var $photo_caption = $('<div class="materialbox-caption"></div>');
		+	$photo_caption.text(origin.data('caption'));
		+	$('body').append($photo_caption);
		+	$photo_caption.css({
		+	"display": "inline"
		+	});
		+	$photo_caption.velocity({
		+	opacity: 1
		+	}, {
		+	duration: inDuration,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+	// Resize Image
		+	var ratio = 0;
		+	var widthPercent = originalWidth / windowWidth;
		+	var heightPercent = originalHeight / windowHeight;
		+	var newWidth = 0;
		+	var newHeight = 0;
		+
		+	if (widthPercent > heightPercent) {
		+	ratio = originalHeight / originalWidth;
		+	newWidth = windowWidth * 0.9;
		+	newHeight = windowWidth * 0.9 * ratio;
		+	} else {
		+	ratio = originalWidth / originalHeight;
		+	newWidth = (windowHeight * 0.9) * ratio;
		+	newHeight = windowHeight * 0.9;
		+	}
		+
		+	// Animate image + set z-index
		+	if (origin.hasClass('responsive-img')) {
		+	origin.velocity({
		+	'max-width': newWidth,
		+	'width': originalWidth
		+	}, {
		+	duration: 0,
		+	queue: false,
		+	complete: function () {
		+	origin.css({
		+	left: 0,
		+	top: 0
		+	})
		+	.velocity({
		+	height: newHeight,
		+	width: newWidth,
		+	left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
		+	top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
		+	}, {
		+	duration: inDuration,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	doneAnimating = true;
		+	}
		+	});
		+	} // End Complete
		+	}); // End Velocity
		+	} else {
		+	origin.css('left', 0)
		+	.css('top', 0)
		+	.velocity({
		+	height: newHeight,
		+	width: newWidth,
		+	left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
		+	top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
		+	}, {
		+	duration: inDuration,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	doneAnimating = true;
		+	}
		+	}); // End Velocity
		+	}
		+
		+	// Handle Exit triggers
		+	$(window).on('scroll.materialbox', function () {
		+	if (overlayActive) {
		+	returnToOriginal();
		+	}
		+	});
		+
		+	$(window).on('resize.materialbox', function () {
		+	if (overlayActive) {
		+	returnToOriginal();
		+	}
		+	});
		+
		+	$(document).on('keyup.materialbox', function (e) {
		+	// ESC key
		+	if (e.keyCode === 27 &&
		+	doneAnimating === true &&
		+	overlayActive) {
		+	returnToOriginal();
		+	}
		+	});
		+
		+	}); // End click handler
		+
		+
		+	// This function returns the modaled image to the original spot
		+	function returnToOriginal() {
		+
		+	doneAnimating = false;
		+
		+	var placeholder = origin.parent('.material-placeholder');
		+	var windowWidth = window.innerWidth;
		+	var windowHeight = window.innerHeight;
		+	var originalWidth = origin.data('width');
		+	var originalHeight = origin.data('height');
		+
		+	origin.velocity("stop", true);
		+	$('#materialbox-overlay').velocity("stop", true);
		+	$('.materialbox-caption').velocity("stop", true);
		+
		+	// disable exit handlers
		+	$(window).off('scroll.materialbox');
		+	$(document).off('keyup.materialbox');
		+	$(window).off('resize.materialbox');
		+
		+	$('#materialbox-overlay').velocity({
		+	opacity: 0
		+	}, {
		+	duration: outDuration, // Delay prevents animation overlapping
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	// Remove Overlay
		+	overlayActive = false;
		+	$(this).remove();
		+	}
		+	});
		+
		+	// Resize Image
		+	origin.velocity({
		+	width: originalWidth,
		+	height: originalHeight,
		+	left: 0,
		+	top: 0
		+	}, {
		+	duration: outDuration,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	placeholder.css({
		+	height: '',
		+	width: '',
		+	position: '',
		+	top: '',
		+	left: ''
		+	});
		+
		+	origin.removeAttr('style');
		+	origin.attr('style', originInlineStyles);
		+
		+	// Remove class
		+	origin.removeClass('active');
		+	doneAnimating = true;
		+
		+	// Remove overflow overrides on ancestors
		+	if (ancestorsChanged) {
		+	ancestorsChanged.css('overflow', '');
		+	}
		+	}
		+	});
		+
		+	// Remove Caption + reset css settings on image
		+	$('.materialbox-caption').velocity({
		+	opacity: 0
		+	}, {
		+	duration: outDuration, // Delay prevents animation overlapping
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$(this).remove();
		+	}
		+	});
		+
		+	}
		+	});
		+	};
		+
		+	$(document).ready(function () {
		+	$('.materialboxed').materialbox();
		+	});
		+
		+	}(jQuery));;
		+	(function ($) {
		+
		+	$.fn.parallax = function () {
		+	var window_width = $(window).width();
		+	// Parallax Scripts
		+	return this.each(function (i) {
		+	var $this = $(this);
		+	$this.addClass('parallax');
		+
		+	function updateParallax(initial) {
		+	var container_height;
		+	if (window_width < 601) {
		+	container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
		+	} else {
		+	container_height = ($this.height() > 0) ? $this.height() : 500;
		+	}
		+	var $img = $this.children("img").first();
		+	var img_height = $img.height();
		+	var parallax_dist = img_height - container_height;
		+	var bottom = $this.offset().top + container_height;
		+	var top = $this.offset().top;
		+	var scrollTop = $(window).scrollTop();
		+	var windowHeight = window.innerHeight;
		+	var windowBottom = scrollTop + windowHeight;
		+	var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
		+	var parallax = Math.round((parallax_dist * percentScrolled));
		+
		+	if (initial) {
		+	$img.css('display', 'block');
		+	}
		+	if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
		+	$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
		+	}
		+
		+	}
		+
		+	// Wait for image load
		+	$this.children("img").one("load", function () {
		+	updateParallax(true);
		+	}).each(function () {
		+	if (this.complete) $(this).trigger("load");
		+	});
		+
		+	$(window).scroll(function () {
		+	window_width = $(window).width();
		+	updateParallax(false);
		+	});
		+
		+	$(window).resize(function () {
		+	window_width = $(window).width();
		+	updateParallax(false);
		+	});
		+
		+	});
		+
		+	};
		+	}(jQuery));;
		+	(function ($) {
		+
		+	var methods = {
		+	init: function (options) {
		+	var defaults = {
		+	onShow: null,
		+	swipeable: false,
		+	responsiveThreshold: Infinity, // breakpoint for swipeable
		+	};
		+	options = $.extend(defaults, options);
		+	var namespace = Materialize.objectSelectorString($(this));
		+
		+	return this.each(function (i) {
		+
		+	var uniqueNamespace = namespace + i;
		+
		+	// For each set of tabs, we want to keep track of
		+	// which tab is active and its associated content
		+	var $this = $(this),
		+	window_width = $(window).width();
		+
		+	var $active, $content, $links = $this.find('li.tab a'),
		+	$tabs_width = $this.width(),
		+	$tabs_content = $(),
		+	$tabs_wrapper,
		+	$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
		+	$indicator,
		+	index = prev_index = 0,
		+	clicked = false,
		+	clickedTimeout,
		+	transition = 300;
		+
		+
		+	// Finds right attribute for indicator based on active tab.
		+	// el: jQuery Object
		+	var calcRightPos = function (el) {
		+	return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft());
		+	};
		+
		+	// Finds left attribute for indicator based on active tab.
		+	// el: jQuery Object
		+	var calcLeftPos = function (el) {
		+	return Math.floor(el.position().left + $this.scrollLeft());
		+	};
		+
		+	// Animates Indicator to active tab.
		+	// prev_index: Number
		+	var animateIndicator = function (prev_index) {
		+	if ((index - prev_index) >= 0) {
		+	$indicator.velocity({
		+	"right": calcRightPos($active)
		+	}, {
		+	duration: transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$indicator.velocity({
		+	"left": calcLeftPos($active)
		+	}, {
		+	duration: transition,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	delay: 90
		+	});
		+
		+	} else {
		+	$indicator.velocity({
		+	"left": calcLeftPos($active)
		+	}, {
		+	duration: transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$indicator.velocity({
		+	"right": calcRightPos($active)
		+	}, {
		+	duration: transition,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	delay: 90
		+	});
		+	}
		+	};
		+
		+	// Change swipeable according to responsive threshold
		+	if (options.swipeable) {
		+	if (window_width > options.responsiveThreshold) {
		+	options.swipeable = false;
		+	}
		+	}
		+
		+
		+	// If the location.hash matches one of the links, use that as the active tab.
		+	$active = $($links.filter('[href="' + location.hash + '"]'));
		+
		+	// If no match is found, use the first link or any with class 'active' as the initial active tab.
		+	if ($active.length === 0) {
		+	$active = $(this).find('li.tab a.active').first();
		+	}
		+	if ($active.length === 0) {
		+	$active = $(this).find('li.tab a').first();
		+	}
		+
		+	$active.addClass('active');
		+	index = $links.index($active);
		+	if (index < 0) {
		+	index = 0;
		+	}
		+
		+	if ($active[0] !== undefined) {
		+	$content = $($active[0].hash);
		+	$content.addClass('active');
		+	}
		+
		+	// append indicator then set indicator width to tab width
		+	if (!$this.find('.indicator').length) {
		+	$this.append('<li class="indicator"></li>');
		+	}
		+	$indicator = $this.find('.indicator');
		+
		+	// we make sure that the indicator is at the end of the tabs
		+	$this.append($indicator);
		+
		+	if ($this.is(":visible")) {
		+	// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
		+	// $indicator.css({"left": index * $tab_width});
		+	setTimeout(function () {
		+	$indicator.css({
		+	"right": calcRightPos($active)
		+	});
		+	$indicator.css({
		+	"left": calcLeftPos($active)
		+	});
		+	}, 0);
		+	}
		+	$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
		+	$tabs_width = $this.width();
		+	$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
		+	if (index < 0) {
		+	index = 0;
		+	}
		+	if ($tab_width !== 0 && $tabs_width !== 0) {
		+	$indicator.css({
		+	"right": calcRightPos($active)
		+	});
		+	$indicator.css({
		+	"left": calcLeftPos($active)
		+	});
		+	}
		+	});
		+
		+	// Initialize Tabs Content.
		+	if (options.swipeable) {
		+	// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
		+	$links.each(function () {
		+	var $curr_content = $(Materialize.escapeHash(this.hash));
		+	$curr_content.addClass('carousel-item');
		+	$tabs_content = $tabs_content.add($curr_content);
		+	});
		+	$tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
		+	$tabs_content.css('display', '');
		+	$('.tabs-content.carousel').carousel({
		+	fullWidth: true,
		+	noWrap: true,
		+	onCycleTo: function (item) {
		+	if (!clicked) {
		+	var prev_index = index;
		+	index = $tabs_wrapper.index(item);
		+	$active = $links.eq(index);
		+	animateIndicator(prev_index);
		+	if (typeof (options.onShow) === "function") {
		+	options.onShow.call($this[0], $content);
		+	}
		+	}
		+	},
		+	});
		+	} else {
		+	// Hide the remaining content
		+	$links.not($active).each(function () {
		+	$(Materialize.escapeHash(this.hash)).hide();
		+	});
		+	}
		+
		+
		+	// Bind the click event handler
		+	$this.off('click.tabs').on('click.tabs', 'a', function (e) {
		+	if ($(this).parent().hasClass('disabled')) {
		+	e.preventDefault();
		+	return;
		+	}
		+
		+	// Act as regular link if target attribute is specified.
		+	if (!!$(this).attr("target")) {
		+	return;
		+	}
		+
		+	clicked = true;
		+	$tabs_width = $this.width();
		+	$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
		+
		+	// Make the old tab inactive.
		+	$active.removeClass('active');
		+	var $oldContent = $content
		+
		+	// Update the variables with the new link and content
		+	$active = $(this);
		+	$content = $(Materialize.escapeHash(this.hash));
		+	$links = $this.find('li.tab a');
		+	var activeRect = $active.position();
		+
		+	// Make the tab active.
		+	$active.addClass('active');
		+	prev_index = index;
		+	index = $links.index($(this));
		+	if (index < 0) {
		+	index = 0;
		+	}
		+	// Change url to current tab
		+	// window.location.hash = $active.attr('href');
		+
		+	// Swap content
		+	if (options.swipeable) {
		+	if ($tabs_content.length) {
		+	$tabs_content.carousel('set', index, function () {
		+	if (typeof (options.onShow) === "function") {
		+	options.onShow.call($this[0], $content);
		+	}
		+	});
		+	}
		+	} else {
		+	if ($content !== undefined) {
		+	$content.show();
		+	$content.addClass('active');
		+	if (typeof (options.onShow) === "function") {
		+	options.onShow.call(this, $content);
		+	}
		+	}
		+
		+	if ($oldContent !== undefined &&
		+	!$oldContent.is($content)) {
		+	$oldContent.hide();
		+	$oldContent.removeClass('active');
		+	}
		+	}
		+
		+	// Reset clicked state
		+	clickedTimeout = setTimeout(function () {
		+	clicked = false;
		+	}, transition);
		+
		+	// Update indicator
		+	animateIndicator(prev_index);
		+
		+	// Prevent the anchor's default click action
		+	e.preventDefault();
		+	});
		+	});
		+
		+	},
		+	select_tab: function (id) {
		+	this.find('a[href="#' + id + '"]').trigger('click');
		+	}
		+	};
		+
		+	$.fn.tabs = function (methodOrOptions) {
		+	if (methods[methodOrOptions]) {
		+	return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
		+	} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
		+	// Default to "init"
		+	return methods.init.apply(this, arguments);
		+	} else {
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
		+	}
		+	};
		+
		+	$(document).ready(function () {
		+	$('ul.tabs').tabs();
		+	});
		+	}(jQuery));;
		+	(function ($) {
		+	$.fn.tooltip = function (options) {
		+	var timeout = null,
		+	margin = 5;
		+
		+	// Defaults
		+	var defaults = {
		+	delay: 350,
		+	tooltip: '',
		+	position: 'bottom',
		+	html: false
		+	};
		+
		+	// Remove tooltip from the activator
		+	if (options === "remove") {
		+	this.each(function () {
		+	$('#' + $(this).attr('data-tooltip-id')).remove();
		+	$(this).off('mouseenter.tooltip mouseleave.tooltip');
		+	});
		+	return false;
		+	}
		+
		+	options = $.extend(defaults, options);
		+
		+	return this.each(function () {
		+	var tooltipId = Materialize.guid();
		+	var origin = $(this);
		+
		+	// Destroy old tooltip
		+	if (origin.attr('data-tooltip-id')) {
		+	$('#' + origin.attr('data-tooltip-id')).remove();
		+	}
		+
		+	origin.attr('data-tooltip-id', tooltipId);
		+
		+	// Get attributes.
		+	var allowHtml,
		+	tooltipDelay,
		+	tooltipPosition,
		+	tooltipText,
		+	tooltipEl,
		+	backdrop;
		+	var setAttributes = function () {
		+	allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
		+	tooltipDelay = origin.attr('data-delay');
		+	tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
		+	options.delay : tooltipDelay;
		+	tooltipPosition = origin.attr('data-position');
		+	tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
		+	options.position : tooltipPosition;
		+	tooltipText = origin.attr('data-tooltip');
		+	tooltipText = (tooltipText === undefined || tooltipText === '') ?
		+	options.tooltip : tooltipText;
		+	};
		+	setAttributes();
		+
		+	var renderTooltipEl = function () {
		+	var tooltip = $('<div class="material-tooltip"></div>');
		+
		+	// Create Text span
		+	if (allowHtml) {
		+	tooltipText = $('<span></span>').html(tooltipText);
		+	} else {
		+	tooltipText = $('<span></span>').text(tooltipText);
		+	}
		+
		+	// Create tooltip
		+	tooltip.append(tooltipText)
		+	.appendTo($('body'))
		+	.attr('id', tooltipId);
		+
		+	// Create backdrop
		+	backdrop = $('<div class="backdrop"></div>');
		+	backdrop.appendTo(tooltip);
		+	return tooltip;
		+	};
		+	tooltipEl = renderTooltipEl();
		+
		+	// Destroy previously binded events
		+	origin.off('mouseenter.tooltip mouseleave.tooltip');
		+	// Mouse In
		+	var started = false,
		+	timeoutRef;
		+	origin.on({
		+	'mouseenter.tooltip': function (e) {
		+	var showTooltip = function () {
		+	setAttributes();
		+	started = true;
		+	tooltipEl.velocity('stop');
		+	backdrop.velocity('stop');
		+	tooltipEl.css({
		+	visibility: 'visible',
		+	left: '0px',
		+	top: '0px'
		+	});
		+
		+	// Tooltip positioning
		+	var originWidth = origin.outerWidth();
		+	var originHeight = origin.outerHeight();
		+	var tooltipHeight = tooltipEl.outerHeight();
		+	var tooltipWidth = tooltipEl.outerWidth();
		+	var tooltipVerticalMovement = '0px';
		+	var tooltipHorizontalMovement = '0px';
		+	var backdropOffsetWidth = backdrop[0].offsetWidth;
		+	var backdropOffsetHeight = backdrop[0].offsetHeight;
		+	var scaleXFactor = 8;
		+	var scaleYFactor = 8;
		+	var scaleFactor = 0;
		+	var targetTop, targetLeft, newCoordinates;
		+
		+	if (tooltipPosition === "top") {
		+	// Top Position
		+	targetTop = origin.offset().top - tooltipHeight - margin;
		+	targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
		+	newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
		+	tooltipVerticalMovement = '-10px';
		+	backdrop.css({
		+	bottom: 0,
		+	left: 0,
		+	borderRadius: '14px 14px 0 0',
		+	transformOrigin: '50% 100%',
		+	marginTop: tooltipHeight,
		+	marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
		+	});
		+	}
		+	// Left Position
		+	else if (tooltipPosition === "left") {
		+	targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
		+	targetLeft = origin.offset().left - tooltipWidth - margin;
		+	newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
		+
		+	tooltipHorizontalMovement = '-10px';
		+	backdrop.css({
		+	top: '-7px',
		+	right: 0,
		+	width: '14px',
		+	height: '14px',
		+	borderRadius: '14px 0 0 14px',
		+	transformOrigin: '95% 50%',
		+	marginTop: tooltipHeight / 2,
		+	marginLeft: tooltipWidth
		+	});
		+	}
		+	// Right Position
		+	else if (tooltipPosition === "right") {
		+	targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
		+	targetLeft = origin.offset().left + originWidth + margin;
		+	newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
		+
		+	tooltipHorizontalMovement = '+10px';
		+	backdrop.css({
		+	top: '-7px',
		+	left: 0,
		+	width: '14px',
		+	height: '14px',
		+	borderRadius: '0 14px 14px 0',
		+	transformOrigin: '5% 50%',
		+	marginTop: tooltipHeight / 2,
		+	marginLeft: '0px'
		+	});
		+	} else {
		+	// Bottom Position
		+	targetTop = origin.offset().top + origin.outerHeight() + margin;
		+	targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
		+	newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
		+	tooltipVerticalMovement = '+10px';
		+	backdrop.css({
		+	top: 0,
		+	left: 0,
		+	marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
		+	});
		+	}
		+
		+	// Set tooptip css placement
		+	tooltipEl.css({
		+	top: newCoordinates.y,
		+	left: newCoordinates.x
		+	});
		+
		+	// Calculate Scale to fill
		+	scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
		+	scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
		+	scaleFactor = Math.max(scaleXFactor, scaleYFactor);
		+
		+	tooltipEl.velocity({
		+	translateY: tooltipVerticalMovement,
		+	translateX: tooltipHorizontalMovement
		+	}, {
		+	duration: 350,
		+	queue: false
		+	})
		+	.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	delay: 50,
		+	queue: false
		+	});
		+	backdrop.css({
		+	visibility: 'visible'
		+	})
		+	.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 55,
		+	delay: 0,
		+	queue: false
		+	})
		+	.velocity({
		+	scaleX: scaleFactor,
		+	scaleY: scaleFactor
		+	}, {
		+	duration: 300,
		+	delay: 0,
		+	queue: false,
		+	easing: 'easeInOutQuad'
		+	});
		+	};
		+
		+	timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
		+
		+	// Mouse Out
		+	},
		+	'mouseleave.tooltip': function () {
		+	// Reset State
		+	started = false;
		+	clearTimeout(timeoutRef);
		+
		+	// Animate back
		+	setTimeout(function () {
		+	if (started !== true) {
		+	tooltipEl.velocity({
		+	opacity: 0,
		+	translateY: 0,
		+	translateX: 0
		+	}, {
		+	duration: 225,
		+	queue: false
		+	});
		+	backdrop.velocity({
		+	opacity: 0,
		+	scaleX: 1,
		+	scaleY: 1
		+	}, {
		+	duration: 225,
		+	queue: false,
		+	complete: function () {
		+	backdrop.css({
		+	visibility: 'hidden'
		+	});
		+	tooltipEl.css({
		+	visibility: 'hidden'
		+	});
		+	started = false;
		+	}
		+	});
		+	}
		+	}, 225);
		+	}
		+	});
		+	});
		+	};
		+
		+	var repositionWithinScreen = function (x, y, width, height) {
		+	var newX = x;
		+	var newY = y;
		+
		+	if (newX < 0) {
		+	newX = 4;
		+	} else if (newX + width > window.innerWidth) {
		+	newX -= newX + width - window.innerWidth;
		+	}
		+
		+	if (newY < 0) {
		+	newY = 4;
		+	} else if (newY + height > window.innerHeight + $(window).scrollTop) {
		+	newY -= newY + height - window.innerHeight;
		+	}
		+
		+	return {
		+	x: newX,
		+	y: newY
		+	};
		+	};
		+
		+	$(document).ready(function () {
		+	$('.tooltipped').tooltip();
		+	});
		+	}(jQuery));;
		+	/*!
		+	* Waves v0.6.4
		+	* http://fian.my.id/Waves
		+	*
		+	* Copyright 2014 Alfiana E. Sibuea and other contributors
		+	* Released under the MIT license
		+	* https://github.com/fians/Waves/blob/master/LICENSE
		+	*/
		+
		+	;
		+	(function (window) {
		+	'use strict';
		+
		+	var Waves = Waves || {};
		+	var $$ = document.querySelectorAll.bind(document);
		+
		+	// Find exact position of element
		+	function isWindow(obj) {
		+	return obj !== null && obj === obj.window;
		+	}
		+
		+	function getWindow(elem) {
		+	return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
		+	}
		+
		+	function offset(elem) {
		+	var docElem, win,
		+	box = {
		+	top: 0,
		+	left: 0
		+	},
		+	doc = elem && elem.ownerDocument;
		+
		+	docElem = doc.documentElement;
		+
		+	if (typeof elem.getBoundingClientRect !== typeof undefined) {
		+	box = elem.getBoundingClientRect();
		+	}
		+	win = getWindow(doc);
		+	return {
		+	top: box.top + win.pageYOffset - docElem.clientTop,
		+	left: box.left + win.pageXOffset - docElem.clientLeft
		+	};
		+	}
		+
		+	function convertStyle(obj) {
		+	var style = '';
		+
		+	for (var a in obj) {
		+	if (obj.hasOwnProperty(a)) {
		+	style += (a + ':' + obj[a] + ';');
		+	}
		+	}
		+
		+	return style;
		+	}
		+
		+	var Effect = {
		+
		+	// Effect delay
		+	duration: 750,
		+
		+	show: function (e, element) {
		+
		+	// Disable right click
		+	if (e.button === 2) {
		+	return false;
		+	}
		+
		+	var el = element || this;
		+
		+	// Create ripple
		+	var ripple = document.createElement('div');
		+	ripple.className = 'waves-ripple';
		+	el.appendChild(ripple);
		+
		+	// Get click coordinate and element witdh
		+	var pos = offset(el);
		+	var relativeY = (e.pageY - pos.top);
		+	var relativeX = (e.pageX - pos.left);
		+	var scale = 'scale(' + ((el.clientWidth / 100) * 10) + ')';
		+
		+	// Support for touch devices
		+	if ('touches' in e) {
		+	relativeY = (e.touches[0].pageY - pos.top);
		+	relativeX = (e.touches[0].pageX - pos.left);
		+	}
		+
		+	// Attach data to element
		+	ripple.setAttribute('data-hold', Date.now());
		+	ripple.setAttribute('data-scale', scale);
		+	ripple.setAttribute('data-x', relativeX);
		+	ripple.setAttribute('data-y', relativeY);
		+
		+	// Set ripple position
		+	var rippleStyle = {
		+	'top': relativeY + 'px',
		+	'left': relativeX + 'px'
		+	};
		+
		+	ripple.className = ripple.className + ' waves-notransition';
		+	ripple.setAttribute('style', convertStyle(rippleStyle));
		+	ripple.className = ripple.className.replace('waves-notransition', '');
		+
		+	// Scale the ripple
		+	rippleStyle['-webkit-transform'] = scale;
		+	rippleStyle['-moz-transform'] = scale;
		+	rippleStyle['-ms-transform'] = scale;
		+	rippleStyle['-o-transform'] = scale;
		+	rippleStyle.transform = scale;
		+	rippleStyle.opacity = '1';
		+
		+	rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
		+	rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
		+	rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
		+	rippleStyle['transition-duration'] = Effect.duration + 'ms';
		+
		+	rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
		+	rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
		+	rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
		+	rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
		+
		+	ripple.setAttribute('style', convertStyle(rippleStyle));
		+	},
		+
		+	hide: function (e) {
		+	TouchHandler.touchup(e);
		+
		+	var el = this;
		+	var width = el.clientWidth * 1.4;
		+
		+	// Get first ripple
		+	var ripple = null;
		+	var ripples = el.getElementsByClassName('waves-ripple');
		+	if (ripples.length > 0) {
		+	ripple = ripples[ripples.length - 1];
		+	} else {
		+	return false;
		+	}
		+
		+	var relativeX = ripple.getAttribute('data-x');
		+	var relativeY = ripple.getAttribute('data-y');
		+	var scale = ripple.getAttribute('data-scale');
		+
		+	// Get delay beetween mousedown and mouse leave
		+	var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
		+	var delay = 350 - diff;
		+
		+	if (delay < 0) {
		+	delay = 0;
		+	}
		+
		+	// Fade out ripple after delay
		+	setTimeout(function () {
		+	var style = {
		+	'top': relativeY + 'px',
		+	'left': relativeX + 'px',
		+	'opacity': '0',
		+
		+	// Duration
		+	'-webkit-transition-duration': Effect.duration + 'ms',
		+	'-moz-transition-duration': Effect.duration + 'ms',
		+	'-o-transition-duration': Effect.duration + 'ms',
		+	'transition-duration': Effect.duration + 'ms',
		+	'-webkit-transform': scale,
		+	'-moz-transform': scale,
		+	'-ms-transform': scale,
		+	'-o-transform': scale,
		+	'transform': scale,
		+	};
		+
		+	ripple.setAttribute('style', convertStyle(style));
		+
		+	setTimeout(function () {
		+	try {
		+	el.removeChild(ripple);
		+	} catch (e) {
		+	return false;
		+	}
		+	}, Effect.duration);
		+	}, delay);
		+	},
		+
		+	// Little hack to make <input> can perform waves effect
		+	wrapInput: function (elements) {
		+	for (var a = 0; a < elements.length; a++) {
		+	var el = elements[a];
		+
		+	if (el.tagName.toLowerCase() === 'input') {
		+	var parent = el.parentNode;
		+
		+	// If input already have parent just pass through
		+	if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
		+	continue;
		+	}
		+
		+	// Put element class and style to the specified parent
		+	var wrapper = document.createElement('i');
		+	wrapper.className = el.className + ' waves-input-wrapper';
		+
		+	var elementStyle = el.getAttribute('style');
		+
		+	if (!elementStyle) {
		+	elementStyle = '';
		+	}
		+
		+	wrapper.setAttribute('style', elementStyle);
		+
		+	el.className = 'waves-button-input';
		+	el.removeAttribute('style');
		+
		+	// Put element as child
		+	parent.replaceChild(wrapper, el);
		+	wrapper.appendChild(el);
		+	}
		+	}
		+	}
		+	};
		+
		+
		+	/**
		+	* Disable mousedown event for 500ms during and after touch
		+	*/
		+	var TouchHandler = {
		+	/* uses an integer rather than bool so there's no issues with
		+	* needing to clear timeouts if another touch event occurred
		+	* within the 500ms. Cannot mouseup between touchstart and
		+	* touchend, nor in the 500ms after touchend. */
		+	touches: 0,
		+	allowEvent: function (e) {
		+	var allow = true;
		+
		+	if (e.type === 'touchstart') {
		+	TouchHandler.touches += 1; //push
		+	} else if (e.type === 'touchend' || e.type === 'touchcancel') {
		+	setTimeout(function () {
		+	if (TouchHandler.touches > 0) {
		+	TouchHandler.touches -= 1; //pop after 500ms
		+	}
		+	}, 500);
		+	} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
		+	allow = false;
		+	}
		+
		+	return allow;
		+	},
		+	touchup: function (e) {
		+	TouchHandler.allowEvent(e);
		+	}
		+	};
		+
		+
		+	/**
		+	* Delegated click handler for .waves-effect element.
		+	* returns null when .waves-effect element not in "click tree"
		+	*/
		+	function getWavesEffectElement(e) {
		+	if (TouchHandler.allowEvent(e) === false) {
		+	return null;
		+	}
		+
		+	var element = null;
		+	var target = e.target || e.srcElement;
		+
		+	while (target.parentElement !== null) {
		+	if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
		+	element = target;
		+	break;
		+	} else if (target.className.indexOf('waves-effect') !== -1) {
		+	element = target;
		+	break;
		+	}
		+	target = target.parentElement;
		+	}
		+
		+	return element;
		+	}
		+
		+	/**
		+	* Bubble the click and show effect if .waves-effect elem was found
		+	*/
		+	function showEffect(e) {
		+	var element = getWavesEffectElement(e);
		+
		+	if (element !== null) {
		+	Effect.show(e, element);
		+
		+	if ('ontouchstart' in window) {
		+	element.addEventListener('touchend', Effect.hide, false);
		+	element.addEventListener('touchcancel', Effect.hide, false);
		+	}
		+
		+	element.addEventListener('mouseup', Effect.hide, false);
		+	element.addEventListener('mouseleave', Effect.hide, false);
		+	}
		+	}
		+
		+	Waves.displayEffect = function (options) {
		+	options = options || {};
		+
		+	if ('duration' in options) {
		+	Effect.duration = options.duration;
		+	}
		+
		+	//Wrap input inside <i> tag
		+	Effect.wrapInput($$('.waves-effect'));
		+
		+	if ('ontouchstart' in window) {
		+	document.body.addEventListener('touchstart', showEffect, false);
		+	}
		+
		+	document.body.addEventListener('mousedown', showEffect, false);
		+	};
		+
		+	/**
		+	* Attach Waves to an input element (or any element which doesn't
		+	* bubble mouseup/mousedown events).
		+	*  Intended to be used with dynamically loaded forms/inputs, or
		+	* where the user doesn't want a delegated click handler.
		+	*/
		+	Waves.attach = function (element) {
		+	//FUTURE: automatically add waves classes and allow users
		+	// to specify them with an options param? Eg. light/classic/button
		+	if (element.tagName.toLowerCase() === 'input') {
		+	Effect.wrapInput([element]);
		+	element = element.parentElement;
		+	}
		+
		+	if ('ontouchstart' in window) {
		+	element.addEventListener('touchstart', showEffect, false);
		+	}
		+
		+	element.addEventListener('mousedown', showEffect, false);
		+	};
		+
		+	window.Waves = Waves;
		+
		+	document.addEventListener('DOMContentLoaded', function () {
		+	Waves.displayEffect();
		+	}, false);
		+
		+	})(window);;
		+	Materialize.toast = function (message, displayLength, className, completeCallback) {
		+	className = className || "";
		+
		+	var container = document.getElementById('toast-container');
		+
		+	// Create toast container if it does not exist
		+	if (container === null) {
		+	// create notification container
		+	container = document.createElement('div');
		+	container.id = 'toast-container';
		+	document.body.appendChild(container);
		+	}
		+
		+	// Select and append toast
		+	var newToast = createToast(message);
		+
		+	// only append toast if message is not undefined
		+	if (message) {
		+	container.appendChild(newToast);
		+	}
		+
		+	newToast.style.opacity = 0;
		+
		+	// Animate toast in
		+	Vel(newToast, {
		+	translateY: '-35px',
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	easing: 'easeOutCubic',
		+	queue: false
		+	});
		+
		+	// Allows timer to be pause while being panned
		+	var timeLeft = displayLength;
		+	var counterInterval;
		+	if (timeLeft != null) {
		+	counterInterval = setInterval(function () {
		+	if (newToast.parentNode === null)
		+	window.clearInterval(counterInterval);
		+
		+	// If toast is not being dragged, decrease its time remaining
		+	if (!newToast.classList.contains('panning')) {
		+	timeLeft -= 20;
		+	}
		+
		+	if (timeLeft <= 0) {
		+	// Animate toast out
		+	Vel(newToast, {
		+	"opacity": 0,
		+	marginTop: '-40px'
		+	}, {
		+	duration: 375,
		+	easing: 'easeOutExpo',
		+	queue: false,
		+	complete: function () {
		+	// Call the optional callback
		+	if (typeof (completeCallback) === "function")
		+	completeCallback();
		+	// Remove toast after it times out
		+	this[0].parentNode.removeChild(this[0]);
		+	}
		+	});
		+	window.clearInterval(counterInterval);
		+	}
		+	}, 20);
		+	}
		+
		+
		+
		+	function createToast(html) {
		+
		+	// Create toast
		+	var toast = document.createElement('div');
		+	toast.classList.add('toast');
		+	if (className) {
		+	var classes = className.split(' ');
		+
		+	for (var i = 0, count = classes.length; i < count; i++) {
		+	toast.classList.add(classes[i]);
		+	}
		+	}
		+	// If type of parameter is HTML Element
		+	if (typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName === "string") {
		+	toast.appendChild(html);
		+	} else if (html instanceof jQuery) {
		+	// Check if it is jQuery object
		+	toast.appendChild(html[0]);
		+	} else {
		+	// Insert as text;
		+	toast.innerHTML = html;
		+	}
		+	// Bind hammer
		+	var hammerHandler = new Hammer(toast, {
		+	prevent_default: false
		+	});
		+	hammerHandler.on('pan', function (e) {
		+	var deltaX = e.deltaX;
		+	var activationDistance = 80;
		+
		+	// Change toast state
		+	if (!toast.classList.contains('panning')) {
		+	toast.classList.add('panning');
		+	}
		+
		+	var opacityPercent = 1 - Math.abs(deltaX / activationDistance);
		+	if (opacityPercent < 0)
		+	opacityPercent = 0;
		+
		+	Vel(toast, {
		+	left: deltaX,
		+	opacity: opacityPercent
		+	}, {
		+	duration: 50,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+
		+	});
		+
		+	hammerHandler.on('panend', function (e) {
		+	var deltaX = e.deltaX;
		+	var activationDistance = 80;
		+
		+	// If toast dragged past activation point
		+	if (Math.abs(deltaX) > activationDistance) {
		+	Vel(toast, {
		+	marginTop: '-40px'
		+	}, {
		+	duration: 375,
		+	easing: 'easeOutExpo',
		+	queue: false,
		+	complete: function () {
		+	if (typeof (completeCallback) === "function") {
		+	completeCallback();
		+	}
		+	toast.parentNode.removeChild(toast);
		+	}
		+	});
		+
		+	} else {
		+	toast.classList.remove('panning');
		+	// Put toast back into original position
		+	Vel(toast, {
		+	left: 0,
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	easing: 'easeOutExpo',
		+	queue: false
		+	});
		+
		+	}
		+	});
		+
		+	return toast;
		+	}
		+	};;
		+	(function ($) {
		+
		+	var methods = {
		+	init: function (options) {
		+	var defaults = {
		+	menuWidth: 300,
		+	edge: 'left',
		+	closeOnClick: false,
		+	draggable: true,
		+	onOpen: null,
		+	onClose: null
		+	};
		+	options = $.extend(defaults, options);
		+
		+	$(this).each(function () {
		+	var $this = $(this);
		+	var menuId = $this.attr('data-activates');
		+	var menu = $("#" + menuId);
		+
		+	// Set to width
		+	if (options.menuWidth != 300) {
		+	menu.css('width', options.menuWidth);
		+	}
		+
		+	// Add Touch Area
		+	var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
		+	if (options.draggable) {
		+	// Regenerate dragTarget
		+	if ($dragTarget.length) {
		+	$dragTarget.remove();
		+	}
		+
		+	$dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
		+	$('body').append($dragTarget);
		+	} else {
		+	$dragTarget = $();
		+	}
		+
		+	if (options.edge == 'left') {
		+	menu.css('transform', 'translateX(-100%)');
		+	$dragTarget.css({
		+	'left': 0
		+	}); // Add Touch Area
		+	} else {
		+	menu.addClass('right-aligned') // Change text-alignment to right
		+	.css('transform', 'translateX(100%)');
		+	$dragTarget.css({
		+	'right': 0
		+	}); // Add Touch Area
		+	}
		+
		+	// If fixed sidenav, bring menu out
		+	if (menu.hasClass('fixed')) {
		+	if (window.innerWidth > 992) {
		+	menu.css('transform', 'translateX(0)');
		+	}
		+	}
		+
		+	// Window resize to reset on large screens fixed
		+	if (menu.hasClass('fixed')) {
		+	$(window).resize(function () {
		+	if (window.innerWidth > 992) {
		+	// Close menu if window is resized bigger than 992 and user has fixed sidenav
		+	if ($('#sidenav-overlay').length !== 0 && menuOut) {
		+	removeMenu(true);
		+	} else {
		+	// menu.removeAttr('style');
		+	menu.css('transform', 'translateX(0%)');
		+	// menu.css('width', options.menuWidth);
		+	}
		+	} else if (menuOut === false) {
		+	if (options.edge === 'left') {
		+	menu.css('transform', 'translateX(-100%)');
		+	} else {
		+	menu.css('transform', 'translateX(100%)');
		+	}
		+
		+	}
		+
		+	});
		+	}
		+
		+	// if closeOnClick, then add close event for all a tags in side sideNav
		+	if (options.closeOnClick === true) {
		+	menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
		+	if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
		+	removeMenu();
		+	}
		+	});
		+	}
		+
		+	var removeMenu = function (restoreNav) {
		+	panning = false;
		+	menuOut = false;
		+	// Reenable scrolling
		+	$('body').css({
		+	overflow: '',
		+	width: ''
		+	});
		+
		+	$('#sidenav-overlay').velocity({
		+	opacity: 0
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$(this).remove();
		+	}
		+	});
		+	if (options.edge === 'left') {
		+	// Reset phantom div
		+	$dragTarget.css({
		+	width: '',
		+	right: '',
		+	left: '0'
		+	});
		+	menu.velocity({
		+	'translateX': '-100%'
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutCubic',
		+	complete: function () {
		+	if (restoreNav === true) {
		+	// Restore Fixed sidenav
		+	menu.removeAttr('style');
		+	menu.css('width', options.menuWidth);
		+	}
		+	}
		+
		+	});
		+	} else {
		+	// Reset phantom div
		+	$dragTarget.css({
		+	width: '',
		+	right: '0',
		+	left: ''
		+	});
		+	menu.velocity({
		+	'translateX': '100%'
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutCubic',
		+	complete: function () {
		+	if (restoreNav === true) {
		+	// Restore Fixed sidenav
		+	menu.removeAttr('style');
		+	menu.css('width', options.menuWidth);
		+	}
		+	}
		+	});
		+	}
		+
		+	// Callback
		+	if (typeof (options.onClose) === 'function') {
		+	options.onClose.call(this, menu);
		+	}
		+	}
		+
		+
		+
		+	// Touch Event
		+	var panning = false;
		+	var menuOut = false;
		+
		+	if (options.draggable) {
		+	$dragTarget.on('click', function () {
		+	if (menuOut) {
		+	removeMenu();
		+	}
		+	});
		+
		+	$dragTarget.hammer({
		+	prevent_default: false
		+	}).on('pan', function (e) {
		+
		+	if (e.gesture.pointerType == "touch") {
		+
		+	var direction = e.gesture.direction;
		+	var x = e.gesture.center.x;
		+	var y = e.gesture.center.y;
		+	var velocityX = e.gesture.velocityX;
		+
		+	// Vertical scroll bugfix
		+	if (x === 0 && y === 0) {
		+	return;
		+	}
		+
		+	// Disable Scrolling
		+	var $body = $('body');
		+	var $overlay = $('#sidenav-overlay');
		+	var oldWidth = $body.innerWidth();
		+	$body.css('overflow', 'hidden');
		+	$body.width(oldWidth);
		+
		+	// If overlay does not exist, create one and if it is clicked, close menu
		+	if ($overlay.length === 0) {
		+	$overlay = $('<div id="sidenav-overlay"></div>');
		+	$overlay.css('opacity', 0).click(function () {
		+	removeMenu();
		+	});
		+
		+	// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
		+	if (typeof (options.onOpen) === 'function') {
		+	options.onOpen.call(this, menu);
		+	}
		+
		+	$('body').append($overlay);
		+	}
		+
		+	// Keep within boundaries
		+	if (options.edge === 'left') {
		+	if (x > options.menuWidth) {
		+	x = options.menuWidth;
		+	} else if (x < 0) {
		+	x = 0;
		+	}
		+	}
		+
		+	if (options.edge === 'left') {
		+	// Left Direction
		+	if (x < (options.menuWidth / 2)) {
		+	menuOut = false;
		+	}
		+	// Right Direction
		+	else if (x >= (options.menuWidth / 2)) {
		+	menuOut = true;
		+	}
		+	menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
		+	} else {
		+	// Left Direction
		+	if (x < (window.innerWidth - options.menuWidth / 2)) {
		+	menuOut = true;
		+	}
		+	// Right Direction
		+	else if (x >= (window.innerWidth - options.menuWidth / 2)) {
		+	menuOut = false;
		+	}
		+	var rightPos = (x - options.menuWidth / 2);
		+	if (rightPos < 0) {
		+	rightPos = 0;
		+	}
		+
		+	menu.css('transform', 'translateX(' + rightPos + 'px)');
		+	}
		+
		+
		+	// Percentage overlay
		+	var overlayPerc;
		+	if (options.edge === 'left') {
		+	overlayPerc = x / options.menuWidth;
		+	$overlay.velocity({
		+	opacity: overlayPerc
		+	}, {
		+	duration: 10,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	} else {
		+	overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
		+	$overlay.velocity({
		+	opacity: overlayPerc
		+	}, {
		+	duration: 10,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+	}
		+
		+	}).on('panend', function (e) {
		+
		+	if (e.gesture.pointerType == "touch") {
		+	var $overlay = $('#sidenav-overlay');
		+	var velocityX = e.gesture.velocityX;
		+	var x = e.gesture.center.x;
		+	var leftPos = x - options.menuWidth;
		+	var rightPos = x - options.menuWidth / 2;
		+	if (leftPos > 0) {
		+	leftPos = 0;
		+	}
		+	if (rightPos < 0) {
		+	rightPos = 0;
		+	}
		+	panning = false;
		+
		+	if (options.edge === 'left') {
		+	// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
		+	if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
		+	// Return menu to open
		+	if (leftPos !== 0) {
		+	menu.velocity({
		+	'translateX': [0, leftPos]
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+	$overlay.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 50,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$dragTarget.css({
		+	width: '50%',
		+	right: 0,
		+	left: ''
		+	});
		+	menuOut = true;
		+	} else if (!menuOut || velocityX > 0.3) {
		+	// Enable Scrolling
		+	$('body').css({
		+	overflow: '',
		+	width: ''
		+	});
		+	// Slide menu closed
		+	menu.velocity({
		+	'translateX': [-1 * options.menuWidth - 10, leftPos]
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$overlay.velocity({
		+	opacity: 0
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	// Run 'onClose' when sidenav is closed via touch/swipe if applicable
		+	if (typeof (options.onClose) === 'function') {
		+	options.onClose.call(this, menu);
		+	}
		+
		+	$(this).remove();
		+	}
		+	});
		+	$dragTarget.css({
		+	width: '10px',
		+	right: '',
		+	left: 0
		+	});
		+	}
		+	} else {
		+	if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
		+	// Return menu to open
		+	if (rightPos !== 0) {
		+	menu.velocity({
		+	'translateX': [0, rightPos]
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+	$overlay.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 50,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$dragTarget.css({
		+	width: '50%',
		+	right: '',
		+	left: 0
		+	});
		+	menuOut = true;
		+	} else if (!menuOut || velocityX < -0.3) {
		+	// Enable Scrolling
		+	$('body').css({
		+	overflow: '',
		+	width: ''
		+	});
		+
		+	// Slide menu closed
		+	menu.velocity({
		+	'translateX': [options.menuWidth + 10, rightPos]
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$overlay.velocity({
		+	opacity: 0
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$(this).remove();
		+	}
		+	});
		+	$dragTarget.css({
		+	width: '10px',
		+	right: 0,
		+	left: ''
		+	});
		+	}
		+	}
		+
		+	}
		+	});
		+	}
		+
		+	$this.off('click.sidenav').on('click.sidenav', function () {
		+	if (menuOut === true) {
		+	menuOut = false;
		+	panning = false;
		+	removeMenu();
		+	} else {
		+
		+	// Disable Scrolling
		+	var $body = $('body');
		+	var $overlay = $('<div id="sidenav-overlay"></div>');
		+	var oldWidth = $body.innerWidth();
		+	$body.css('overflow', 'hidden');
		+	$body.width(oldWidth);
		+
		+	// Push current drag target on top of DOM tree
		+	$('body').append($dragTarget);
		+
		+	if (options.edge === 'left') {
		+	$dragTarget.css({
		+	width: '50%',
		+	right: 0,
		+	left: ''
		+	});
		+	menu.velocity({
		+	'translateX': [0, -1 * options.menuWidth]
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	} else {
		+	$dragTarget.css({
		+	width: '50%',
		+	right: '',
		+	left: 0
		+	});
		+	menu.velocity({
		+	'translateX': [0, options.menuWidth]
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+	$overlay.css('opacity', 0)
		+	.click(function () {
		+	menuOut = false;
		+	panning = false;
		+	removeMenu();
		+	$overlay.velocity({
		+	opacity: 0
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$(this).remove();
		+	}
		+	});
		+
		+	});
		+	$('body').append($overlay);
		+	$overlay.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	menuOut = true;
		+	panning = false;
		+	}
		+	});
		+
		+	// Callback
		+	if (typeof (options.onOpen) === 'function') {
		+	options.onOpen.call(this, menu);
		+	}
		+	}
		+
		+	return false;
		+	});
		+	});
		+
		+
		+	},
		+	destroy: function () {
		+	var $overlay = $('#sidenav-overlay');
		+	var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
		+	$overlay.trigger('click');
		+	$dragTarget.remove();
		+	$(this).off('click');
		+	$overlay.remove();
		+	},
		+	show: function () {
		+	this.trigger('click');
		+	},
		+	hide: function () {
		+	$('#sidenav-overlay').trigger('click');
		+	}
		+	};
		+
		+
		+	$.fn.sideNav = function (methodOrOptions) {
		+	if (methods[methodOrOptions]) {
		+	return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
		+	} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
		+	// Default to "init"
		+	return methods.init.apply(this, arguments);
		+	} else {
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
		+	}
		+	}; // Plugin end
		+	}(jQuery));;
		+	/**
		+	* Extend jquery with a scrollspy plugin.
		+	* This watches the window scroll and fires events when elements are scrolled into viewport.
		+	*
		+	* throttle() and getTime() taken from Underscore.js
		+	* https://github.com/jashkenas/underscore
		+	*
		+	* @author Copyright 2013 John Smart
		+	* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
		+	* @see https://github.com/thesmart
		+	* @version 0.1.2
		+	*/
		+	(function ($) {
		+
		+	var jWindow = $(window);
		+	var elements = [];
		+	var elementsInView = [];
		+	var isSpying = false;
		+	var ticks = 0;
		+	var unique_id = 1;
		+	var offset = {
		+	top: 0,
		+	right: 0,
		+	bottom: 0,
		+	left: 0,
		+	}
		+
		+	/**
		+	* Find elements that are within the boundary
		+	* @param {number} top
		+	* @param {number} right
		+	* @param {number} bottom
		+	* @param {number} left
		+	* @return {jQuery} A collection of elements
		+	*/
		+	function findElements(top, right, bottom, left) {
		+	var hits = $();
		+	$.each(elements, function (i, element) {
		+	if (element.height() > 0) {
		+	var elTop = element.offset().top,
		+	elLeft = element.offset().left,
		+	elRight = elLeft + element.width(),
		+	elBottom = elTop + element.height();
		+
		+	var isIntersect = !(elLeft > right ||
		+	elRight < left ||
		+	elTop > bottom ||
		+	elBottom < top);
		+
		+	if (isIntersect) {
		+	hits.push(element);
		+	}
		+	}
		+	});
		+
		+	return hits;
		+	}
		+
		+
		+	/**
		+	* Called when the user scrolls the window
		+	*/
		+	function onScroll(scrollOffset) {
		+	// unique tick id
		+	++ticks;
		+
		+	// viewport rectangle
		+	var top = jWindow.scrollTop(),
		+	left = jWindow.scrollLeft(),
		+	right = left + jWindow.width(),
		+	bottom = top + jWindow.height();
		+
		+	// determine which elements are in view
		+	var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
		+	$.each(intersections, function (i, element) {
		+
		+	var lastTick = element.data('scrollSpy:ticks');
		+	if (typeof lastTick != 'number') {
		+	// entered into view
		+	element.triggerHandler('scrollSpy:enter');
		+	}
		+
		+	// update tick id
		+	element.data('scrollSpy:ticks', ticks);
		+	});
		+
		+	// determine which elements are no longer in view
		+	$.each(elementsInView, function (i, element) {
		+	var lastTick = element.data('scrollSpy:ticks');
		+	if (typeof lastTick == 'number' && lastTick !== ticks) {
		+	// exited from view
		+	element.triggerHandler('scrollSpy:exit');
		+	element.data('scrollSpy:ticks', null);
		+	}
		+	});
		+
		+	// remember elements in view for next tick
		+	elementsInView = intersections;
		+	}
		+
		+	/**
		+	* Called when window is resized
		+	*/
		+	function onWinSize() {
		+	jWindow.trigger('scrollSpy:winSize');
		+	}
		+
		+
		+	/**
		+	* Enables ScrollSpy using a selector
		+	* @param {jQuery|string} selector  The elements collection, or a selector
		+	* @param {Object=} options Optional.
		+	throttle : number -> scrollspy throttling. Default: 100 ms
		+	offsetTop : number -> offset from top. Default: 0
		+	offsetRight : number -> offset from right. Default: 0
		+	offsetBottom : number -> offset from bottom. Default: 0
		+	offsetLeft : number -> offset from left. Default: 0
		+	activeClass : string -> Class name to be added to the active link. Default: active
		+	* @returns {jQuery}
		+	*/
		+	$.scrollSpy = function (selector, options) {
		+	var defaults = {
		+	throttle: 100,
		+	scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
		+	activeClass: 'active',
		+	getActiveElement: function (id) {
		+	return 'a[href="#' + id + '"]';
		+	}
		+	};
		+	options = $.extend(defaults, options);
		+
		+	var visible = [];
		+	selector = $(selector);
		+	selector.each(function (i, element) {
		+	elements.push($(element));
		+	$(element).data("scrollSpy:id", i);
		+	// Smooth scroll to section
		+	$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
		+	e.preventDefault();
		+	var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
		+	$('html, body').animate({
		+	scrollTop: offset - options.scrollOffset
		+	}, {
		+	duration: 400,
		+	queue: false,
		+	easing: 'easeOutCubic'
		+	});
		+	});
		+	});
		+
		+	offset.top = options.offsetTop || 0;
		+	offset.right = options.offsetRight || 0;
		+	offset.bottom = options.offsetBottom || 0;
		+	offset.left = options.offsetLeft || 0;
		+
		+	var throttledScroll = Materialize.throttle(function () {
		+	onScroll(options.scrollOffset);
		+	}, options.throttle || 100);
		+	var readyScroll = function () {
		+	$(document).ready(throttledScroll);
		+	};
		+
		+	if (!isSpying) {
		+	jWindow.on('scroll', readyScroll);
		+	jWindow.on('resize', readyScroll);
		+	isSpying = true;
		+	}
		+
		+	// perform a scan once, after current execution context, and after dom is ready
		+	setTimeout(readyScroll, 0);
		+
		+
		+	selector.on('scrollSpy:enter', function () {
		+	visible = $.grep(visible, function (value) {
		+	return value.height() != 0;
		+	});
		+
		+	var $this = $(this);
		+
		+	if (visible[0]) {
		+	$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
		+	if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
		+	visible.unshift($(this));
		+	} else {
		+	visible.push($(this));
		+	}
		+	} else {
		+	visible.push($(this));
		+	}
		+
		+
		+	$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
		+	});
		+	selector.on('scrollSpy:exit', function () {
		+	visible = $.grep(visible, function (value) {
		+	return value.height() != 0;
		+	});
		+
		+	if (visible[0]) {
		+	$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
		+	var $this = $(this);
		+	visible = $.grep(visible, function (value) {
		+	return value.attr('id') != $this.attr('id');
		+	});
		+	if (visible[0]) { // Check if empty
		+	$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
		+	}
		+	}
		+	});
		+
		+	return selector;
		+	};
		+
		+	/**
		+	* Listen for window resize events
		+	* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
		+	* @returns {jQuery} $(window)
		+	*/
		+	$.winSizeSpy = function (options) {
		+	$.winSizeSpy = function () {
		+	return jWindow;
		+	}; // lock from multiple calls
		+	options = options || {
		+	throttle: 100
		+	};
		+	return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
		+	};
		+
		+	/**
		+	* Enables ScrollSpy on a collection of elements
		+	* e.g. $('.scrollSpy').scrollSpy()
		+	* @param {Object=} options Optional.
		+	throttle : number -> scrollspy throttling. Default: 100 ms
		+	offsetTop : number -> offset from top. Default: 0
		+	offsetRight : number -> offset from right. Default: 0
		+	offsetBottom : number -> offset from bottom. Default: 0
		+	offsetLeft : number -> offset from left. Default: 0
		+	* @returns {jQuery}
		+	*/
		+	$.fn.scrollSpy = function (options) {
		+	return $.scrollSpy($(this), options);
		+	};
		+
		+	})(jQuery);;
		+	(function ($) {
		+	$(document).ready(function () {
		+
		+	// Function to update labels of text fields
		+	Materialize.updateTextFields = function () {
		+	var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
		+	$(input_selector).each(function (index, element) {
		+	var $this = $(this);
		+	if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
		+	$this.siblings('label').addClass('active');
		+	} else if ($(element)[0].validity) {
		+	$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
		+	} else {
		+	$this.siblings('label').removeClass('active');
		+	}
		+	});
		+	};
		+
		+	// Text based inputs
		+	var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
		+
		+	// Add active if form auto complete
		+	$(document).on('change', input_selector, function () {
		+	if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
		+	$(this).siblings('label').addClass('active');
		+	}
		+	validate_field($(this));
		+	});
		+
		+	// Add active if input element has been pre-populated on document ready
		+	$(document).ready(function () {
		+	Materialize.updateTextFields();
		+	});
		+
		+	// HTML DOM FORM RESET handling
		+	$(document).on('reset', function (e) {
		+	var formReset = $(e.target);
		+	if (formReset.is('form')) {
		+	formReset.find(input_selector).removeClass('valid').removeClass('invalid');
		+	formReset.find(input_selector).each(function () {
		+	if ($(this).attr('value') === '') {
		+	$(this).siblings('label').removeClass('active');
		+	}
		+	});
		+
		+	// Reset select
		+	formReset.find('select.initialized').each(function () {
		+	var reset_text = formReset.find('option[selected]').text();
		+	formReset.siblings('input.select-dropdown').val(reset_text);
		+	});
		+	}
		+	});
		+
		+	// Add active when element has focus
		+	$(document).on('focus', input_selector, function () {
		+	$(this).siblings('label, .prefix').addClass('active');
		+	});
		+
		+	$(document).on('blur', input_selector, function () {
		+	var $inputElement = $(this);
		+	var selector = ".prefix";
		+
		+	if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
		+	selector += ", label";
		+	}
		+
		+	$inputElement.siblings(selector).removeClass('active');
		+
		+	validate_field($inputElement);
		+	});
		+
		+	window.validate_field = function (object) {
		+	var hasLength = object.attr('data-length') !== undefined;
		+	var lenAttr = parseInt(object.attr('data-length'));
		+	var len = object.val().length;
		+
		+	if (object.val().length === 0 && object[0].validity.badInput === false) {
		+	if (object.hasClass('validate')) {
		+	object.removeClass('valid');
		+	object.removeClass('invalid');
		+	}
		+	} else {
		+	if (object.hasClass('validate')) {
		+	// Check for character counter attributes
		+	if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
		+	object.removeClass('invalid');
		+	object.addClass('valid');
		+	} else {
		+	object.removeClass('valid');
		+	object.addClass('invalid');
		+	}
		+	}
		+	}
		+	};
		+
		+	// Radio and Checkbox focus class
		+	var radio_checkbox = 'input[type=radio], input[type=checkbox]';
		+	$(document).on('keyup.radio', radio_checkbox, function (e) {
		+	// TAB, check if tabbing to radio or checkbox.
		+	if (e.which === 9) {
		+	$(this).addClass('tabbed');
		+	var $this = $(this);
		+	$this.one('blur', function (e) {
		+
		+	$(this).removeClass('tabbed');
		+	});
		+	return;
		+	}
		+	});
		+
		+	// Textarea Auto Resize
		+	var hiddenDiv = $('.hiddendiv').first();
		+	if (!hiddenDiv.length) {
		+	hiddenDiv = $('<div class="hiddendiv common"></div>');
		+	$('body').append(hiddenDiv);
		+	}
		+	var text_area_selector = '.materialize-textarea';
		+
		+	function textareaAutoResize($textarea) {
		+	// Set font properties of hiddenDiv
		+
		+	var fontFamily = $textarea.css('font-family');
		+	var fontSize = $textarea.css('font-size');
		+	var lineHeight = $textarea.css('line-height');
		+
		+	if (fontSize) {
		+	hiddenDiv.css('font-size', fontSize);
		+	}
		+	if (fontFamily) {
		+	hiddenDiv.css('font-family', fontFamily);
		+	}
		+	if (lineHeight) {
		+	hiddenDiv.css('line-height', lineHeight);
		+	}
		+
		+	// Set original-height, if none
		+	if (!$textarea.data('original-height')) {
		+	$textarea.data('original-height', $textarea.height());
		+	}
		+
		+	if ($textarea.attr('wrap') === 'off') {
		+	hiddenDiv.css('overflow-wrap', 'normal')
		+	.css('white-space', 'pre');
		+	}
		+
		+	hiddenDiv.text($textarea.val() + '\n');
		+	var content = hiddenDiv.html().replace(/\n/g, '<br>');
		+	hiddenDiv.html(content);
		+
		+
		+	// When textarea is hidden, width goes crazy.
		+	// Approximate with half of window size
		+
		+	if ($textarea.is(':visible')) {
		+	hiddenDiv.css('width', $textarea.width());
		+	} else {
		+	hiddenDiv.css('width', $(window).width() / 2);
		+	}
		+
		+
		+	/**
		+	* Resize if the new height is greater than the
		+	* original height of the textarea
		+	*/
		+	if ($textarea.data('original-height') <= hiddenDiv.height()) {
		+	$textarea.css('height', hiddenDiv.height());
		+	} else if ($textarea.val().length < $textarea.data('previous-length')) {
		+	/**
		+	* In case the new height is less than original height, it
		+	* means the textarea has less text than before
		+	* So we set the height to the original one
		+	*/
		+	$textarea.css('height', $textarea.data('original-height'));
		+	}
		+	$textarea.data('previous-length', $textarea.val().length);
		+	}
		+
		+	$(text_area_selector).each(function () {
		+	var $textarea = $(this);
		+	/**
		+	* Instead of resizing textarea on document load,
		+	* store the original height and the original length
		+	*/
		+	$textarea.data('original-height', $textarea.height());
		+	$textarea.data('previous-length', $textarea.val().length);
		+	});
		+
		+	$('body').on('keyup keydown autoresize', text_area_selector, function () {
		+	textareaAutoResize($(this));
		+	});
		+
		+	// File Input Path
		+	$(document).on('change', '.file-field input[type="file"]', function () {
		+	var file_field = $(this).closest('.file-field');
		+	var path_input = file_field.find('input.file-path');
		+	var files = $(this)[0].files;
		+	var file_names = [];
		+	for (var i = 0; i < files.length; i++) {
		+	file_names.push(files[i].name);
		+	}
		+	path_input.val(file_names.join(", "));
		+	path_input.trigger('change');
		+	});
		+
		+	/****************
		+	*  Range Input  *
		+	****************/
		+
		+	var range_type = 'input[type=range]';
		+	var range_mousedown = false;
		+	var left;
		+
		+	$(range_type).each(function () {
		+	var thumb = $('<span class="thumb"><span class="value"></span></span>');
		+	$(this).after(thumb);
		+	});
		+
		+	var showRangeBubble = function (thumb) {
		+	var paddingLeft = parseInt(thumb.parent().css('padding-left'));
		+	var marginLeft = (-7 + paddingLeft) + 'px';
		+	thumb.velocity({
		+	height: "30px",
		+	width: "30px",
		+	top: "-30px",
		+	marginLeft: marginLeft
		+	}, {
		+	duration: 300,
		+	easing: 'easeOutExpo'
		+	});
		+	};
		+
		+	var calcRangeOffset = function (range) {
		+	var width = range.width() - 15;
		+	var max = parseFloat(range.attr('max'));
		+	var min = parseFloat(range.attr('min'));
		+	var percent = (parseFloat(range.val()) - min) / (max - min);
		+	return percent * width;
		+	}
		+
		+	var range_wrapper = '.range-field';
		+	$(document).on('change', range_type, function (e) {
		+	var thumb = $(this).siblings('.thumb');
		+	thumb.find('.value').html($(this).val());
		+
		+	if (!thumb.hasClass('active')) {
		+	showRangeBubble(thumb);
		+	}
		+
		+	var offsetLeft = calcRangeOffset($(this));
		+	thumb.addClass('active').css('left', offsetLeft);
		+	});
		+
		+	$(document).on('mousedown touchstart', range_type, function (e) {
		+	var thumb = $(this).siblings('.thumb');
		+
		+	// If thumb indicator does not exist yet, create it
		+	if (thumb.length <= 0) {
		+	thumb = $('<span class="thumb"><span class="value"></span></span>');
		+	$(this).after(thumb);
		+	}
		+
		+	// Set indicator value
		+	thumb.find('.value').html($(this).val());
		+
		+	range_mousedown = true;
		+	$(this).addClass('active');
		+
		+	if (!thumb.hasClass('active')) {
		+	showRangeBubble(thumb);
		+	}
		+
		+	if (e.type !== 'input') {
		+	var offsetLeft = calcRangeOffset($(this));
		+	thumb.addClass('active').css('left', offsetLeft);
		+	}
		+	});
		+
		+	$(document).on('mouseup touchend', range_wrapper, function () {
		+	range_mousedown = false;
		+	$(this).removeClass('active');
		+	});
		+
		+	$(document).on('input mousemove touchmove', range_wrapper, function (e) {
		+	var thumb = $(this).children('.thumb');
		+	var left;
		+	var input = $(this).find(range_type);
		+
		+	if (range_mousedown) {
		+	if (!thumb.hasClass('active')) {
		+	showRangeBubble(thumb);
		+	}
		+
		+	var offsetLeft = calcRangeOffset(input);
		+	thumb.addClass('active').css('left', offsetLeft);
		+	thumb.find('.value').html(thumb.siblings(range_type).val());
		+	}
		+	});
		+
		+	$(document).on('mouseout touchleave', range_wrapper, function () {
		+	if (!range_mousedown) {
		+
		+	var thumb = $(this).children('.thumb');
		+	var paddingLeft = parseInt($(this).css('padding-left'));
		+	var marginLeft = (7 + paddingLeft) + 'px';
		+
		+	if (thumb.hasClass('active')) {
		+	thumb.velocity({
		+	height: '0',
		+	width: '0',
		+	top: '10px',
		+	marginLeft: marginLeft
		+	}, {
		+	duration: 100
		+	});
		+	}
		+	thumb.removeClass('active');
		+	}
		+	});
		+
		+	/**************************
		+	* Auto complete plugin  *
		+	*************************/
		+	$.fn.autocomplete = function (options) {
		+	// Defaults
		+	var defaults = {
		+	data: {},
		+	limit: Infinity,
		+	onAutocomplete: null,
		+	minLength: 1
		+	};
		+
		+	options = $.extend(defaults, options);
		+
		+	return this.each(function () {
		+	var $input = $(this);
		+	var data = options.data,
		+	count = 0,
		+	activeIndex = -1,
		+	oldVal,
		+	$inputDiv = $input.closest('.input-field'); // Div to append on
		+
		+	// Check if data isn't empty
		+	if (!$.isEmptyObject(data)) {
		+	var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
		+	var $oldAutocomplete;
		+
		+	// Append autocomplete element.
		+	// Prevent double structure init.
		+	if ($inputDiv.length) {
		+	$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
		+	if (!$oldAutocomplete.length) {
		+	$inputDiv.append($autocomplete); // Set ul in body
		+	}
		+	} else {
		+	$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
		+	if (!$oldAutocomplete.length) {
		+	$input.after($autocomplete);
		+	}
		+	}
		+	if ($oldAutocomplete.length) {
		+	$autocomplete = $oldAutocomplete;
		+	}
		+
		+	// Highlight partial match.
		+	var highlight = function (string, $el) {
		+	var img = $el.find('img');
		+	var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
		+	matchEnd = matchStart + string.length - 1,
		+	beforeMatch = $el.text().slice(0, matchStart),
		+	matchText = $el.text().slice(matchStart, matchEnd + 1),
		+	afterMatch = $el.text().slice(matchEnd + 1);
		+	$el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
		+	if (img.length) {
		+	$el.prepend(img);
		+	}
		+	};
		+
		+	// Reset current element position
		+	var resetCurrentElement = function () {
		+	activeIndex = -1;
		+	$autocomplete.find('.active').removeClass('active');
		+	}
		+
		+	// Remove autocomplete elements
		+	var removeAutocomplete = function () {
		+	$autocomplete.empty();
		+	resetCurrentElement();
		+	oldVal = undefined;
		+	};
		+
		+	$input.off('blur.autocomplete').on('blur.autocomplete', function () {
		+	removeAutocomplete();
		+	});
		+
		+	// Perform search
		+	$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
		+	// Reset count.
		+	count = 0;
		+	var val = $input.val().toLowerCase();
		+
		+	// Don't capture enter or arrow key usage.
		+	if (e.which === 13 ||
		+	e.which === 38 ||
		+	e.which === 40) {
		+	return;
		+	}
		+
		+
		+	// Check if the input isn't empty
		+	if (oldVal !== val) {
		+	removeAutocomplete();
		+
		+	if (val.length >= options.minLength) {
		+	for (var key in data) {
		+	if (data.hasOwnProperty(key) &&
		+	key.toLowerCase().indexOf(val) !== -1 &&
		+	key.toLowerCase() !== val) {
		+	// Break if past limit
		+	if (count >= options.limit) {
		+	break;
		+	}
		+
		+	var autocompleteOption = $('<li></li>');
		+	if (!!data[key]) {
		+	autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
		+	} else {
		+	autocompleteOption.append('<span>' + key + '</span>');
		+	}
		+
		+	$autocomplete.append(autocompleteOption);
		+	highlight(val, autocompleteOption);
		+	count++;
		+	}
		+	}
		+	}
		+	}
		+
		+	// Update oldVal
		+	oldVal = val;
		+	});
		+
		+	$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
		+	// Arrow keys and enter key usage
		+	var keyCode = e.which,
		+	liElement,
		+	numItems = $autocomplete.children('li').length,
		+	$active = $autocomplete.children('.active').first();
		+
		+	// select element on Enter
		+	if (keyCode === 13 && activeIndex >= 0) {
		+	liElement = $autocomplete.children('li').eq(activeIndex);
		+	if (liElement.length) {
		+	liElement.trigger('mousedown.autocomplete');
		+	e.preventDefault();
		+	}
		+	return;
		+	}
		+
		+	// Capture up and down key
		+	if (keyCode === 38 || keyCode === 40) {
		+	e.preventDefault();
		+
		+	if (keyCode === 38 &&
		+	activeIndex > 0) {
		+	activeIndex--;
		+	}
		+
		+	if (keyCode === 40 &&
		+	activeIndex < (numItems - 1)) {
		+	activeIndex++;
		+	}
		+
		+	$active.removeClass('active');
		+	if (activeIndex >= 0) {
		+	$autocomplete.children('li').eq(activeIndex).addClass('active');
		+	}
		+	}
		+	});
		+
		+	// Set input value
		+	$autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
		+	var text = $(this).text().trim();
		+	$input.val(text);
		+	$input.trigger('change');
		+	removeAutocomplete();
		+
		+	// Handle onAutocomplete callback.
		+	if (typeof (options.onAutocomplete) === "function") {
		+	options.onAutocomplete.call(this, text);
		+	}
		+	});
		+	}
		+	});
		+	};
		+
		+	}); // End of $(document).ready
		+
		+	/*******************
		+	*  Select Plugin  *
		+	******************/
		+	$.fn.material_select = function (callback) {
		+	$(this).each(function () {
		+	var $select = $(this);
		+
		+	if ($select.hasClass('browser-default')) {
		+	return; // Continue to next (return false breaks out of entire loop)
		+	}
		+
		+	var multiple = $select.attr('multiple') ? true : false,
		+	lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
		+
		+	if (lastID) {
		+	$select.parent().find('span.caret').remove();
		+	$select.parent().find('input').remove();
		+
		+	$select.unwrap();
		+	$('ul#select-options-' + lastID).remove();
		+	}
		+
		+	// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
		+	if (callback === 'destroy') {
		+	$select.data('select-id', null).removeClass('initialized');
		+	return;
		+	}
		+
		+	var uniqueID = Materialize.guid();
		+	$select.data('select-id', uniqueID);
		+	var wrapper = $('<div class="select-wrapper"></div>');
		+	wrapper.addClass($select.attr('class'));
		+	var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
		+	selectChildren = $select.children('option, optgroup'),
		+	valuesSelected = [],
		+	optionsHover = false;
		+
		+	var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
		+
		+	// Function that renders and appends the option taking into
		+	// account type and possible image icon.
		+	var appendOptionWithIcon = function (select, option, type) {
		+	// Add disabled attr if disabled
		+	var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
		+	var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
		+	var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
		+
		+	// add icons
		+	var icon_url = option.data('icon');
		+	var classes = option.attr('class');
		+	if (!!icon_url) {
		+	var classString = '';
		+	if (!!classes) classString = ' class="' + classes + '"';
		+
		+	// Check for multiple type.
		+	options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
		+	return true;
		+	}
		+
		+	// Check for multiple type.
		+	options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
		+	};
		+
		+	/* Create dropdown structure. */
		+	if (selectChildren.length) {
		+	selectChildren.each(function () {
		+	if ($(this).is('option')) {
		+	// Direct descendant option.
		+	if (multiple) {
		+	appendOptionWithIcon($select, $(this), 'multiple');
		+
		+	} else {
		+	appendOptionWithIcon($select, $(this));
		+	}
		+	} else if ($(this).is('optgroup')) {
		+	// Optgroup.
		+	var selectOptions = $(this).children('option');
		+	options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
		+
		+	selectOptions.each(function () {
		+	appendOptionWithIcon($select, $(this), 'optgroup-option');
		+	});
		+	}
		+	});
		+	}
		+
		+	options.find('li:not(.optgroup)').each(function (i) {
		+	$(this).click(function (e) {
		+	// Check if option element is disabled
		+	if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
		+	var selected = true;
		+
		+	if (multiple) {
		+	$('input[type="checkbox"]', this).prop('checked', function (i, v) {
		+	return !v;
		+	});
		+	selected = toggleEntryFromArray(valuesSelected, i, $select);
		+	$newSelect.trigger('focus');
		+	} else {
		+	options.find('li').removeClass('active');
		+	$(this).toggleClass('active');
		+	$newSelect.val($(this).text());
		+	}
		+
		+	activateOption(options, $(this));
		+	$select.find('option').eq(i).prop('selected', selected);
		+	// Trigger onchange() event
		+	$select.trigger('change');
		+	if (typeof callback !== 'undefined') callback();
		+	}
		+
		+	e.stopPropagation();
		+	});
		+	});
		+
		+	// Wrap Elements
		+	$select.wrap(wrapper);
		+	// Add Select Display Element
		+	var dropdownIcon = $('<span class="caret">&#9660;</span>');
		+	if ($select.is(':disabled'))
		+	dropdownIcon.addClass('disabled');
		+
		+	// escape double quotes
		+	var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
		+
		+	var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
		+	$select.before($newSelect);
		+	$newSelect.before(dropdownIcon);
		+
		+	$newSelect.after(options);
		+	// Check if section element is disabled
		+	if (!$select.is(':disabled')) {
		+	$newSelect.dropdown({
		+	'hover': false
		+	});
		+	}
		+
		+	// Copy tabindex
		+	if ($select.attr('tabindex')) {
		+	$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
		+	}
		+
		+	$select.addClass('initialized');
		+
		+	$newSelect.on({
		+	'focus': function () {
		+	if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
		+	$('input.select-dropdown').trigger('close');
		+	}
		+	if (!options.is(':visible')) {
		+	$(this).trigger('open', ['focus']);
		+	var label = $(this).val();
		+	if (multiple && label.indexOf(',') >= 0) {
		+	label = label.split(',')[0];
		+	}
		+
		+	var selectedOption = options.find('li').filter(function () {
		+	return $(this).text().toLowerCase() === label.toLowerCase();
		+	})[0];
		+	activateOption(options, selectedOption, true);
		+	}
		+	},
		+	'click': function (e) {
		+	e.stopPropagation();
		+	}
		+	});
		+
		+	$newSelect.on('blur', function () {
		+	if (!multiple) {
		+	$(this).trigger('close');
		+	}
		+	options.find('li.selected').removeClass('selected');
		+	});
		+
		+	options.hover(function () {
		+	optionsHover = true;
		+	}, function () {
		+	optionsHover = false;
		+	});
		+
		+	$(window).on({
		+	'click': function () {
		+	multiple && (optionsHover || $newSelect.trigger('close'));
		+	}
		+	});
		+
		+	// Add initial multiple selections.
		+	if (multiple) {
		+	$select.find("option:selected:not(:disabled)").each(function () {
		+	var index = $(this).index();
		+
		+	toggleEntryFromArray(valuesSelected, index, $select);
		+	options.find("li").eq(index).find(":checkbox").prop("checked", true);
		+	});
		+	}
		+
		+	/**
		+	* Make option as selected and scroll to selected position
		+	* @param {jQuery} collection  Select options jQuery element
		+	* @param {Element} newOption  element of the new option
		+	* @param {Boolean} firstActivation  If on first activation of select
		+	*/
		+	var activateOption = function (collection, newOption, firstActivation) {
		+	if (newOption) {
		+	collection.find('li.selected').removeClass('selected');
		+	var option = $(newOption);
		+	option.addClass('selected');
		+	if (!multiple || !!firstActivation) {
		+	options.scrollTo(option);
		+	}
		+	}
		+	};
		+
		+	// Allow user to search by typing
		+	// this array is cleared after 1 second
		+	var filterQuery = [],
		+	onKeyDown = function (e) {
		+	// TAB - switch to another input
		+	if (e.which == 9) {
		+	$newSelect.trigger('close');
		+	return;
		+	}
		+
		+	// ARROW DOWN WHEN SELECT IS CLOSED - open select options
		+	if (e.which == 40 && !options.is(':visible')) {
		+	$newSelect.trigger('open');
		+	return;
		+	}
		+
		+	// ENTER WHEN SELECT IS CLOSED - submit form
		+	if (e.which == 13 && !options.is(':visible')) {
		+	return;
		+	}
		+
		+	e.preventDefault();
		+
		+	// CASE WHEN USER TYPE LETTERS
		+	var letter = String.fromCharCode(e.which).toLowerCase(),
		+	nonLetters = [9, 13, 27, 38, 40];
		+	if (letter && (nonLetters.indexOf(e.which) === -1)) {
		+	filterQuery.push(letter);
		+
		+	var string = filterQuery.join(''),
		+	newOption = options.find('li').filter(function () {
		+	return $(this).text().toLowerCase().indexOf(string) === 0;
		+	})[0];
		+
		+	if (newOption) {
		+	activateOption(options, newOption);
		+	}
		+	}
		+
		+	// ENTER - select option and close when select options are opened
		+	if (e.which == 13) {
		+	var activeOption = options.find('li.selected:not(.disabled)')[0];
		+	if (activeOption) {
		+	$(activeOption).trigger('click');
		+	if (!multiple) {
		+	$newSelect.trigger('close');
		+	}
		+	}
		+	}
		+
		+	// ARROW DOWN - move to next not disabled option
		+	if (e.which == 40) {
		+	if (options.find('li.selected').length) {
		+	newOption = options.find('li.selected').next('li:not(.disabled)')[0];
		+	} else {
		+	newOption = options.find('li:not(.disabled)')[0];
		+	}
		+	activateOption(options, newOption);
		+	}
		+
		+	// ESC - close options
		+	if (e.which == 27) {
		+	$newSelect.trigger('close');
		+	}
		+
		+	// ARROW UP - move to previous not disabled option
		+	if (e.which == 38) {
		+	newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
		+	if (newOption)
		+	activateOption(options, newOption);
		+	}
		+
		+	// Automaticaly clean filter query so user can search again by starting letters
		+	setTimeout(function () {
		+	filterQuery = [];
		+	}, 1000);
		+	};
		+
		+	$newSelect.on('keydown', onKeyDown);
		+	});
		+
		+	function toggleEntryFromArray(entriesArray, entryIndex, select) {
		+	var index = entriesArray.indexOf(entryIndex),
		+	notAdded = index === -1;
		+
		+	if (notAdded) {
		+	entriesArray.push(entryIndex);
		+	} else {
		+	entriesArray.splice(index, 1);
		+	}
		+
		+	select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
		+
		+	// use notAdded instead of true (to detect if the option is selected or not)
		+	select.find('option').eq(entryIndex).prop('selected', notAdded);
		+	setValueToInput(entriesArray, select);
		+
		+	return notAdded;
		+	}
		+
		+	function setValueToInput(entriesArray, select) {
		+	var value = '';
		+
		+	for (var i = 0, count = entriesArray.length; i < count; i++) {
		+	var text = select.find('option').eq(entriesArray[i]).text();
		+
		+	i === 0 ? value += text : value += ', ' + text;
		+	}
		+
		+	if (value === '') {
		+	value = select.find('option:disabled').eq(0).text();
		+	}
		+
		+	select.siblings('input.select-dropdown').val(value);
		+	}
		+	};
		+
		+	}(jQuery));;
		+	(function ($) {
		+
		+	var methods = {
		+
		+	init: function (options) {
		+	var defaults = {
		+	indicators: true,
		+	height: 400,
		+	transition: 500,
		+	interval: 6000
		+	};
		+	options = $.extend(defaults, options);
		+
		+	return this.each(function () {
		+
		+	// For each slider, we want to keep track of
		+	// which slide is active and its associated content
		+	var $this = $(this);
		+	var $slider = $this.find('ul.slides').first();
		+	var $slides = $slider.find('> li');
		+	var $active_index = $slider.find('.active').index();
		+	var $active, $indicators, $interval;
		+	if ($active_index != -1) {
		+	$active = $slides.eq($active_index);
		+	}
		+
		+	// Transitions the caption depending on alignment
		+	function captionTransition(caption, duration) {
		+	if (caption.hasClass("center-align")) {
		+	caption.velocity({
		+	opacity: 0,
		+	translateY: -100
		+	}, {
		+	duration: duration,
		+	queue: false
		+	});
		+	} else if (caption.hasClass("right-align")) {
		+	caption.velocity({
		+	opacity: 0,
		+	translateX: 100
		+	}, {
		+	duration: duration,
		+	queue: false
		+	});
		+	} else if (caption.hasClass("left-align")) {
		+	caption.velocity({
		+	opacity: 0,
		+	translateX: -100
		+	}, {
		+	duration: duration,
		+	queue: false
		+	});
		+	}
		+	}
		+
		+	// This function will transition the slide to any index of the next slide
		+	function moveToSlide(index) {
		+	// Wrap around indices.
		+	if (index >= $slides.length) index = 0;
		+	else if (index < 0) index = $slides.length - 1;
		+
		+	$active_index = $slider.find('.active').index();
		+
		+	// Only do if index changes
		+	if ($active_index != index) {
		+	$active = $slides.eq($active_index);
		+	$caption = $active.find('.caption');
		+
		+	$active.removeClass('active');
		+	$active.velocity({
		+	opacity: 0
		+	}, {
		+	duration: options.transition,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$slides.not('.active').velocity({
		+	opacity: 0,
		+	translateX: 0,
		+	translateY: 0
		+	}, {
		+	duration: 0,
		+	queue: false
		+	});
		+	}
		+	});
		+	captionTransition($caption, options.transition);
		+
		+
		+	// Update indicators
		+	if (options.indicators) {
		+	$indicators.eq($active_index).removeClass('active');
		+	}
		+
		+	$slides.eq(index).velocity({
		+	opacity: 1
		+	}, {
		+	duration: options.transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$slides.eq(index).find('.caption').velocity({
		+	opacity: 1,
		+	translateX: 0,
		+	translateY: 0
		+	}, {
		+	duration: options.transition,
		+	delay: options.transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	$slides.eq(index).addClass('active');
		+
		+
		+	// Update indicators
		+	if (options.indicators) {
		+	$indicators.eq(index).addClass('active');
		+	}
		+	}
		+	}
		+
		+	// Set height of slider
		+	// If fullscreen, do nothing
		+	if (!$this.hasClass('fullscreen')) {
		+	if (options.indicators) {
		+	// Add height if indicators are present
		+	$this.height(options.height + 40);
		+	} else {
		+	$this.height(options.height);
		+	}
		+	$slider.height(options.height);
		+	}
		+
		+
		+	// Set initial positions of captions
		+	$slides.find('.caption').each(function () {
		+	captionTransition($(this), 0);
		+	});
		+
		+	// Move img src into background-image
		+	$slides.find('img').each(function () {
		+	var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
		+	if ($(this).attr('src') !== placeholderBase64) {
		+	$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
		+	$(this).attr('src', placeholderBase64);
		+	}
		+	});
		+
		+	// dynamically add indicators
		+	if (options.indicators) {
		+	$indicators = $('<ul class="indicators"></ul>');
		+	$slides.each(function (index) {
		+	var $indicator = $('<li class="indicator-item"></li>');
		+
		+	// Handle clicks on indicators
		+	$indicator.click(function () {
		+	var $parent = $slider.parent();
		+	var curr_index = $parent.find($(this)).index();
		+	moveToSlide(curr_index);
		+
		+	// reset interval
		+	clearInterval($interval);
		+	$interval = setInterval(
		+	function () {
		+	$active_index = $slider.find('.active').index();
		+	if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
		+	else $active_index += 1;
		+
		+	moveToSlide($active_index);
		+
		+	}, options.transition + options.interval
		+	);
		+	});
		+	$indicators.append($indicator);
		+	});
		+	$this.append($indicators);
		+	$indicators = $this.find('ul.indicators').find('li.indicator-item');
		+	}
		+
		+	if ($active) {
		+	$active.show();
		+	} else {
		+	$slides.first().addClass('active').velocity({
		+	opacity: 1
		+	}, {
		+	duration: options.transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+
		+	$active_index = 0;
		+	$active = $slides.eq($active_index);
		+
		+	// Update indicators
		+	if (options.indicators) {
		+	$indicators.eq($active_index).addClass('active');
		+	}
		+	}
		+
		+	// Adjust height to current slide
		+	$active.find('img').each(function () {
		+	$active.find('.caption').velocity({
		+	opacity: 1,
		+	translateX: 0,
		+	translateY: 0
		+	}, {
		+	duration: options.transition,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	});
		+
		+	// auto scroll
		+	$interval = setInterval(
		+	function () {
		+	$active_index = $slider.find('.active').index();
		+	moveToSlide($active_index + 1);
		+
		+	}, options.transition + options.interval
		+	);
		+
		+
		+	// HammerJS, Swipe navigation
		+
		+	// Touch Event
		+	var panning = false;
		+	var swipeLeft = false;
		+	var swipeRight = false;
		+
		+	$this.hammer({
		+	prevent_default: false
		+	}).on('pan', function (e) {
		+	if (e.gesture.pointerType === "touch") {
		+
		+	// reset interval
		+	clearInterval($interval);
		+
		+	var direction = e.gesture.direction;
		+	var x = e.gesture.deltaX;
		+	var velocityX = e.gesture.velocityX;
		+	var velocityY = e.gesture.velocityY;
		+
		+	$curr_slide = $slider.find('.active');
		+	if (Math.abs(velocityX) > Math.abs(velocityY)) {
		+	$curr_slide.velocity({
		+	translateX: x
		+	}, {
		+	duration: 50,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+	// Swipe Left
		+	if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
		+	swipeRight = true;
		+	}
		+	// Swipe Right
		+	else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
		+	swipeLeft = true;
		+	}
		+
		+	// Make Slide Behind active slide visible
		+	var next_slide;
		+	if (swipeLeft) {
		+	next_slide = $curr_slide.next();
		+	if (next_slide.length === 0) {
		+	next_slide = $slides.first();
		+	}
		+	next_slide.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+	if (swipeRight) {
		+	next_slide = $curr_slide.prev();
		+	if (next_slide.length === 0) {
		+	next_slide = $slides.last();
		+	}
		+	next_slide.velocity({
		+	opacity: 1
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+
		+
		+	}
		+
		+	}).on('panend', function (e) {
		+	if (e.gesture.pointerType === "touch") {
		+
		+	$curr_slide = $slider.find('.active');
		+	panning = false;
		+	curr_index = $slider.find('.active').index();
		+
		+	if (!swipeRight && !swipeLeft || $slides.length <= 1) {
		+	// Return to original spot
		+	$curr_slide.velocity({
		+	translateX: 0
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	} else if (swipeLeft) {
		+	moveToSlide(curr_index + 1);
		+	$curr_slide.velocity({
		+	translateX: -1 * $this.innerWidth()
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$curr_slide.velocity({
		+	opacity: 0,
		+	translateX: 0
		+	}, {
		+	duration: 0,
		+	queue: false
		+	});
		+	}
		+	});
		+	} else if (swipeRight) {
		+	moveToSlide(curr_index - 1);
		+	$curr_slide.velocity({
		+	translateX: $this.innerWidth()
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$curr_slide.velocity({
		+	opacity: 0,
		+	translateX: 0
		+	}, {
		+	duration: 0,
		+	queue: false
		+	});
		+	}
		+	});
		+	}
		+	swipeLeft = false;
		+	swipeRight = false;
		+
		+	// Restart interval
		+	clearInterval($interval);
		+	$interval = setInterval(
		+	function () {
		+	$active_index = $slider.find('.active').index();
		+	if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
		+	else $active_index += 1;
		+
		+	moveToSlide($active_index);
		+
		+	}, options.transition + options.interval
		+	);
		+	}
		+	});
		+
		+	$this.on('sliderPause', function () {
		+	clearInterval($interval);
		+	});
		+
		+	$this.on('sliderStart', function () {
		+	clearInterval($interval);
		+	$interval = setInterval(
		+	function () {
		+	$active_index = $slider.find('.active').index();
		+	if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
		+	else $active_index += 1;
		+
		+	moveToSlide($active_index);
		+
		+	}, options.transition + options.interval
		+	);
		+	});
		+
		+	$this.on('sliderNext', function () {
		+	$active_index = $slider.find('.active').index();
		+	moveToSlide($active_index + 1);
		+	});
		+
		+	$this.on('sliderPrev', function () {
		+	$active_index = $slider.find('.active').index();
		+	moveToSlide($active_index - 1);
		+	});
		+
		+	});
		+
		+
		+
		+	},
		+	pause: function () {
		+	$(this).trigger('sliderPause');
		+	},
		+	start: function () {
		+	$(this).trigger('sliderStart');
		+	},
		+	next: function () {
		+	$(this).trigger('sliderNext');
		+	},
		+	prev: function () {
		+	$(this).trigger('sliderPrev');
		+	}
		+	};
		+
		+
		+	$.fn.slider = function (methodOrOptions) {
		+	if (methods[methodOrOptions]) {
		+	return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
		+	} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
		+	// Default to "init"
		+	return methods.init.apply(this, arguments);
		+	} else {
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
		+	}
		+	}; // Plugin end
		+	}(jQuery));;
		+	(function ($) {
		+	$(document).ready(function () {
		+
		+	$(document).on('click.card', '.card', function (e) {
		+	if ($(this).find('> .card-reveal').length) {
		+	var $card = $(e.target).closest('.card');
		+	if ($card.data('initialOverflow') === undefined) {
		+	$card.data(
		+	'initialOverflow',
		+	$card.css('overflow') === undefined ? '' : $card.css('overflow')
		+	);
		+	}
		+	if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
		+	// Make Reveal animate down and display none
		+	$(this).find('.card-reveal').velocity({
		+	translateY: 0
		+	}, {
		+	duration: 225,
		+	queue: false,
		+	easing: 'easeInOutQuad',
		+	complete: function () {
		+	$(this).css({
		+	display: 'none'
		+	});
		+	$card.css('overflow', $card.data('initialOverflow'));
		+	}
		+	});
		+	} else if ($(e.target).is($('.card .activator')) ||
		+	$(e.target).is($('.card .activator i'))) {
		+	$card.css('overflow', 'hidden');
		+	$(this).find('.card-reveal').css({
		+	display: 'block'
		+	}).velocity("stop", false).velocity({
		+	translateY: '-100%'
		+	}, {
		+	duration: 300,
		+	queue: false,
		+	easing: 'easeInOutQuad'
		+	});
		+	}
		+	}
		+	});
		+
		+	});
		+	}(jQuery));;
		+	(function ($) {
		+	var materialChipsDefaults = {
		+	data: [],
		+	placeholder: '',
		+	secondaryPlaceholder: '',
		+	autocompleteOptions: {},
		+	};
		+
		+	$(document).ready(function () {
		+	// Handle removal of static chips.
		+	$(document).on('click', '.chip .close', function (e) {
		+	var $chips = $(this).closest('.chips');
		+	if ($chips.attr('data-initialized')) {
		+	return;
		+	}
		+	$(this).closest('.chip').remove();
		+	});
		+	});
		+
		+	$.fn.material_chip = function (options) {
		+	var self = this;
		+	this.$el = $(this);
		+	this.$document = $(document);
		+	this.SELS = {
		+	CHIPS: '.chips',
		+	CHIP: '.chip',
		+	INPUT: 'input',
		+	DELETE: '.material-icons',
		+	SELECTED_CHIP: '.selected',
		+	};
		+
		+	if ('data' === options) {
		+	return this.$el.data('chips');
		+	}
		+
		+	var curr_options = $.extend({}, materialChipsDefaults, options);
		+	self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
		+
		+	// Initialize
		+	this.init = function () {
		+	var i = 0;
		+	var chips;
		+	self.$el.each(function () {
		+	var $chips = $(this);
		+	var chipId = Materialize.guid();
		+	self.chipId = chipId;
		+
		+	if (!curr_options.data || !(curr_options.data instanceof Array)) {
		+	curr_options.data = [];
		+	}
		+	$chips.data('chips', curr_options.data);
		+	$chips.attr('data-index', i);
		+	$chips.attr('data-initialized', true);
		+
		+	if (!$chips.hasClass(self.SELS.CHIPS)) {
		+	$chips.addClass('chips');
		+	}
		+
		+	self.chips($chips, chipId);
		+	i++;
		+	});
		+	};
		+
		+	this.handleEvents = function () {
		+	var SELS = self.SELS;
		+
		+	self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
		+	$(e.target).find(SELS.INPUT).focus();
		+	});
		+
		+	self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
		+	var $chip = $(e.target);
		+	if ($chip.length) {
		+	var wasSelected = $chip.hasClass('selected');
		+	var $chips = $chip.closest(SELS.CHIPS);
		+	$(SELS.CHIP).removeClass('selected');
		+
		+	if (!wasSelected) {
		+	self.selectChip($chip.index(), $chips);
		+	}
		+	}
		+	});
		+
		+	self.$document.off('keydown.chips').on('keydown.chips', function (e) {
		+	if ($(e.target).is('input, textarea')) {
		+	return;
		+	}
		+
		+	// delete
		+	var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
		+	var $chips = $chip.closest(SELS.CHIPS);
		+	var length = $chip.siblings(SELS.CHIP).length;
		+	var index;
		+
		+	if (!$chip.length) {
		+	return;
		+	}
		+
		+	if (e.which === 8 || e.which === 46) {
		+	e.preventDefault();
		+
		+	index = $chip.index();
		+	self.deleteChip(index, $chips);
		+
		+	var selectIndex = null;
		+	if ((index + 1) < length) {
		+	selectIndex = index;
		+	} else if (index === length || (index + 1) === length) {
		+	selectIndex = length - 1;
		+	}
		+
		+	if (selectIndex < 0) selectIndex = null;
		+
		+	if (null !== selectIndex) {
		+	self.selectChip(selectIndex, $chips);
		+	}
		+	if (!length) $chips.find('input').focus();
		+
		+	// left
		+	} else if (e.which === 37) {
		+	index = $chip.index() - 1;
		+	if (index < 0) {
		+	return;
		+	}
		+	$(SELS.CHIP).removeClass('selected');
		+	self.selectChip(index, $chips);
		+
		+	// right
		+	} else if (e.which === 39) {
		+	index = $chip.index() + 1;
		+	$(SELS.CHIP).removeClass('selected');
		+	if (index > length) {
		+	$chips.find('input').focus();
		+	return;
		+	}
		+	self.selectChip(index, $chips);
		+	}
		+	});
		+
		+	self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
		+	var $currChips = $(e.target).closest(SELS.CHIPS);
		+	$currChips.addClass('focus');
		+	$currChips.siblings('label, .prefix').addClass('active');
		+	$(SELS.CHIP).removeClass('selected');
		+	});
		+
		+	self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
		+	var $currChips = $(e.target).closest(SELS.CHIPS);
		+	$currChips.removeClass('focus');
		+
		+	// Remove active if empty
		+	if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
		+	$currChips.siblings('label').removeClass('active');
		+	}
		+	$currChips.siblings('.prefix').removeClass('active');
		+	});
		+
		+	self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
		+	var $target = $(e.target);
		+	var $chips = $target.closest(SELS.CHIPS);
		+	var chipsLength = $chips.children(SELS.CHIP).length;
		+
		+	// enter
		+	if (13 === e.which) {
		+	// Override enter if autocompleting.
		+	if (self.hasAutocomplete &&
		+	$chips.find('.autocomplete-content.dropdown-content').length &&
		+	$chips.find('.autocomplete-content.dropdown-content').children().length) {
		+	return;
		+	}
		+
		+	e.preventDefault();
		+	self.addChip({
		+	tag: $target.val()
		+	}, $chips);
		+	$target.val('');
		+	return;
		+	}
		+
		+	// delete or left
		+	if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
		+	e.preventDefault();
		+	self.selectChip(chipsLength - 1, $chips);
		+	$target.blur();
		+	return;
		+	}
		+	});
		+
		+	// Click on delete icon in chip.
		+	self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
		+	var $target = $(e.target);
		+	var $chips = $target.closest(SELS.CHIPS);
		+	var $chip = $target.closest(SELS.CHIP);
		+	e.stopPropagation();
		+	self.deleteChip($chip.index(), $chips);
		+	$chips.find('input').focus();
		+	});
		+	};
		+
		+	this.chips = function ($chips, chipId) {
		+	$chips.empty();
		+	$chips.data('chips').forEach(function (elem) {
		+	$chips.append(self.renderChip(elem));
		+	});
		+	$chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
		+	self.setPlaceholder($chips);
		+
		+	// Set for attribute for label
		+	var label = $chips.next('label');
		+	if (label.length) {
		+	label.attr('for', chipId);
		+
		+	if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
		+	label.addClass('active');
		+	}
		+	}
		+
		+	// Setup autocomplete if needed.
		+	var input = $('#' + chipId);
		+	if (self.hasAutocomplete) {
		+	curr_options.autocompleteOptions.onAutocomplete = function (val) {
		+	self.addChip({
		+	tag: val
		+	}, $chips);
		+	input.val('');
		+	input.focus();
		+	}
		+	input.autocomplete(curr_options.autocompleteOptions);
		+	}
		+	};
		+
		+	/**
		+	* Render chip jQuery element.
		+	* @param {Object} elem
		+	* @return {jQuery}
		+	*/
		+	this.renderChip = function (elem) {
		+	if (!elem.tag) return;
		+
		+	var $renderedChip = $('<div class="chip"></div>');
		+	$renderedChip.text(elem.tag);
		+	if (elem.image) {
		+	$renderedChip.prepend($('<img />').attr('src', elem.image))
		+	}
		+	$renderedChip.append($('<i class="material-icons close">close</i>'));
		+	return $renderedChip;
		+	};
		+
		+	this.setPlaceholder = function ($chips) {
		+	if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) {
		+	$chips.find('input').prop('placeholder', curr_options.placeholder);
		+
		+	} else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
		+	$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
		+	}
		+	};
		+
		+	this.isValid = function ($chips, elem) {
		+	var chips = $chips.data('chips');
		+	var exists = false;
		+	for (var i = 0; i < chips.length; i++) {
		+	if (chips[i].tag === elem.tag) {
		+	exists = true;
		+	return;
		+	}
		+	}
		+	return '' !== elem.tag && !exists;
		+	};
		+
		+	this.addChip = function (elem, $chips) {
		+	if (!self.isValid($chips, elem)) {
		+	return;
		+	}
		+	var $renderedChip = self.renderChip(elem);
		+	var newData = [];
		+	var oldData = $chips.data('chips');
		+	for (var i = 0; i < oldData.length; i++) {
		+	newData.push(oldData[i]);
		+	}
		+	newData.push(elem);
		+
		+	$chips.data('chips', newData);
		+	$renderedChip.insertBefore($chips.find('input'));
		+	$chips.trigger('chip.add', elem);
		+	self.setPlaceholder($chips);
		+	};
		+
		+	this.deleteChip = function (chipIndex, $chips) {
		+	var chip = $chips.data('chips')[chipIndex];
		+	$chips.find('.chip').eq(chipIndex).remove();
		+
		+	var newData = [];
		+	var oldData = $chips.data('chips');
		+	for (var i = 0; i < oldData.length; i++) {
		+	if (i !== chipIndex) {
		+	newData.push(oldData[i]);
		+	}
		+	}
		+
		+	$chips.data('chips', newData);
		+	$chips.trigger('chip.delete', chip);
		+	self.setPlaceholder($chips);
		+	};
		+
		+	this.selectChip = function (chipIndex, $chips) {
		+	var $chip = $chips.find('.chip').eq(chipIndex);
		+	if ($chip && false === $chip.hasClass('selected')) {
		+	$chip.addClass('selected');
		+	$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
		+	}
		+	};
		+
		+	this.getChipsElement = function (index, $chips) {
		+	return $chips.eq(index);
		+	};
		+
		+	// init
		+	this.init();
		+
		+	this.handleEvents();
		+	};
		+	}(jQuery));;
		+	(function ($) {
		+	$.fn.pushpin = function (options) {
		+	// Defaults
		+	var defaults = {
		+	top: 0,
		+	bottom: Infinity,
		+	offset: 0
		+	};
		+
		+	// Remove pushpin event and classes
		+	if (options === "remove") {
		+	this.each(function () {
		+	if (id = $(this).data('pushpin-id')) {
		+	$(window).off('scroll.' + id);
		+	$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
		+	}
		+	});
		+	return false;
		+	}
		+
		+	options = $.extend(defaults, options);
		+
		+
		+	$index = 0;
		+	return this.each(function () {
		+	var $uniqueId = Materialize.guid(),
		+	$this = $(this),
		+	$original_offset = $(this).offset().top;
		+
		+	function removePinClasses(object) {
		+	object.removeClass('pin-top');
		+	object.removeClass('pinned');
		+	object.removeClass('pin-bottom');
		+	}
		+
		+	function updateElements(objects, scrolled) {
		+	objects.each(function () {
		+	// Add position fixed (because its between top and bottom)
		+	if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
		+	removePinClasses($(this));
		+	$(this).css('top', options.offset);
		+	$(this).addClass('pinned');
		+	}
		+
		+	// Add pin-top (when scrolled position is above top)
		+	if (scrolled < options.top && !$(this).hasClass('pin-top')) {
		+	removePinClasses($(this));
		+	$(this).css('top', 0);
		+	$(this).addClass('pin-top');
		+	}
		+
		+	// Add pin-bottom (when scrolled position is below bottom)
		+	if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
		+	removePinClasses($(this));
		+	$(this).addClass('pin-bottom');
		+	$(this).css('top', options.bottom - $original_offset);
		+	}
		+	});
		+	}
		+
		+	$(this).data('pushpin-id', $uniqueId);
		+	updateElements($this, $(window).scrollTop());
		+	$(window).on('scroll.' + $uniqueId, function () {
		+	var $scrolled = $(window).scrollTop() + options.offset;
		+	updateElements($this, $scrolled);
		+	});
		+
		+	});
		+
		+	};
		+	}(jQuery));;
		+	(function ($) {
		+	$(document).ready(function () {
		+
		+	// jQuery reverse
		+	$.fn.reverse = [].reverse;
		+
		+	// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
		+	$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
		+	var $this = $(this);
		+	openFABMenu($this);
		+	});
		+	$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
		+	var $this = $(this);
		+	closeFABMenu($this);
		+	});
		+
		+	// Toggle-on-click behaviour.
		+	$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
		+	var $this = $(this);
		+	var $menu = $this.parent();
		+	if ($menu.hasClass('active')) {
		+	closeFABMenu($menu);
		+	} else {
		+	openFABMenu($menu);
		+	}
		+	});
		+
		+	// Toolbar transition behaviour.
		+	$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
		+	var $this = $(this);
		+	var $menu = $this.parent();
		+	FABtoToolbar($menu);
		+	});
		+
		+	});
		+
		+	$.fn.extend({
		+	openFAB: function () {
		+	openFABMenu($(this));
		+	},
		+	closeFAB: function () {
		+	closeFABMenu($(this));
		+	},
		+	openToolbar: function () {
		+	FABtoToolbar($(this));
		+	},
		+	closeToolbar: function () {
		+	toolbarToFAB($(this));
		+	}
		+	});
		+
		+
		+	var openFABMenu = function (btn) {
		+	var $this = btn;
		+	if ($this.hasClass('active') === false) {
		+
		+	// Get direction option
		+	var horizontal = $this.hasClass('horizontal');
		+	var offsetY, offsetX;
		+
		+	if (horizontal === true) {
		+	offsetX = 40;
		+	} else {
		+	offsetY = 40;
		+	}
		+
		+	$this.addClass('active');
		+	$this.find('ul .btn-floating').velocity({
		+	scaleY: ".4",
		+	scaleX: ".4",
		+	translateY: offsetY + 'px',
		+	translateX: offsetX + 'px'
		+	}, {
		+	duration: 0
		+	});
		+
		+	var time = 0;
		+	$this.find('ul .btn-floating').reverse().each(function () {
		+	$(this).velocity({
		+	opacity: "1",
		+	scaleX: "1",
		+	scaleY: "1",
		+	translateY: "0",
		+	translateX: '0'
		+	}, {
		+	duration: 80,
		+	delay: time
		+	});
		+	time += 40;
		+	});
		+	}
		+	};
		+
		+	var closeFABMenu = function (btn) {
		+	var $this = btn;
		+	// Get direction option
		+	var horizontal = $this.hasClass('horizontal');
		+	var offsetY, offsetX;
		+
		+	if (horizontal === true) {
		+	offsetX = 40;
		+	} else {
		+	offsetY = 40;
		+	}
		+
		+	$this.removeClass('active');
		+	var time = 0;
		+	$this.find('ul .btn-floating').velocity("stop", true);
		+	$this.find('ul .btn-floating').velocity({
		+	opacity: "0",
		+	scaleX: ".4",
		+	scaleY: ".4",
		+	translateY: offsetY + 'px',
		+	translateX: offsetX + 'px'
		+	}, {
		+	duration: 80
		+	});
		+	};
		+
		+
		+	/**
		+	* Transform FAB into toolbar
		+	* @param  {Object}  object jQuery object
		+	*/
		+	var FABtoToolbar = function (btn) {
		+	if (btn.attr('data-open') === "true") {
		+	return;
		+	}
		+
		+	var offsetX, offsetY, scaleFactor;
		+	var windowWidth = window.innerWidth;
		+	var windowHeight = window.innerHeight;
		+	var btnRect = btn[0].getBoundingClientRect();
		+	var anchor = btn.find('> a').first();
		+	var menu = btn.find('> ul').first();
		+	var backdrop = $('<div class="fab-backdrop"></div>');
		+	var fabColor = anchor.css('background-color');
		+	anchor.append(backdrop);
		+
		+	offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
		+	offsetY = windowHeight - btnRect.bottom;
		+	scaleFactor = windowWidth / backdrop.width();
		+	btn.attr('data-origin-bottom', btnRect.bottom);
		+	btn.attr('data-origin-left', btnRect.left);
		+	btn.attr('data-origin-width', btnRect.width);
		+
		+	// Set initial state
		+	btn.addClass('active');
		+	btn.attr('data-open', true);
		+	btn.css({
		+	'text-align': 'center',
		+	width: '100%',
		+	bottom: 0,
		+	left: 0,
		+	transform: 'translateX(' + offsetX + 'px)',
		+	transition: 'none'
		+	});
		+	anchor.css({
		+	transform: 'translateY(' + -offsetY + 'px)',
		+	transition: 'none'
		+	});
		+	backdrop.css({
		+	'background-color': fabColor
		+	});
		+
		+
		+	setTimeout(function () {
		+	btn.css({
		+	transform: '',
		+	transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
		+	});
		+	anchor.css({
		+	overflow: 'visible',
		+	transform: '',
		+	transition: 'transform .2s'
		+	});
		+
		+	setTimeout(function () {
		+	btn.css({
		+	overflow: 'hidden',
		+	'background-color': fabColor
		+	});
		+	backdrop.css({
		+	transform: 'scale(' + scaleFactor + ')',
		+	transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
		+	});
		+	menu.find('> li > a').css({
		+	opacity: 1
		+	});
		+
		+	// Scroll to close.
		+	$(window).on('scroll.fabToolbarClose', function () {
		+	toolbarToFAB(btn);
		+	$(window).off('scroll.fabToolbarClose');
		+	$(document).off('click.fabToolbarClose');
		+	});
		+
		+	$(document).on('click.fabToolbarClose', function (e) {
		+	if (!$(e.target).closest(menu).length) {
		+	toolbarToFAB(btn);
		+	$(window).off('scroll.fabToolbarClose');
		+	$(document).off('click.fabToolbarClose');
		+	}
		+	});
		+	}, 100);
		+	}, 0);
		+	};
		+
		+	/**
		+	* Transform toolbar back into FAB
		+	* @param  {Object}  object jQuery object
		+	*/
		+	var toolbarToFAB = function (btn) {
		+	if (btn.attr('data-open') !== "true") {
		+	return;
		+	}
		+
		+	var offsetX, offsetY, scaleFactor;
		+	var windowWidth = window.innerWidth;
		+	var windowHeight = window.innerHeight;
		+	var btnWidth = btn.attr('data-origin-width');
		+	var btnBottom = btn.attr('data-origin-bottom');
		+	var btnLeft = btn.attr('data-origin-left');
		+	var anchor = btn.find('> .btn-floating').first();
		+	var menu = btn.find('> ul').first();
		+	var backdrop = btn.find('.fab-backdrop');
		+	var fabColor = anchor.css('background-color');
		+
		+	offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
		+	offsetY = windowHeight - btnBottom;
		+	scaleFactor = windowWidth / backdrop.width();
		+
		+
		+	// Hide backdrop
		+	btn.removeClass('active');
		+	btn.attr('data-open', false);
		+	btn.css({
		+	'background-color': 'transparent',
		+	transition: 'none'
		+	});
		+	anchor.css({
		+	transition: 'none'
		+	});
		+	backdrop.css({
		+	transform: 'scale(0)',
		+	'background-color': fabColor
		+	});
		+	menu.find('> li > a').css({
		+	opacity: ''
		+	});
		+
		+	setTimeout(function () {
		+	backdrop.remove();
		+
		+	// Set initial state.
		+	btn.css({
		+	'text-align': '',
		+	width: '',
		+	bottom: '',
		+	left: '',
		+	overflow: '',
		+	'background-color': '',
		+	transform: 'translate3d(' + -offsetX + 'px,0,0)'
		+	});
		+	anchor.css({
		+	overflow: '',
		+	transform: 'translate3d(0,' + offsetY + 'px,0)'
		+	});
		+
		+	setTimeout(function () {
		+	btn.css({
		+	transform: 'translate3d(0,0,0)',
		+	transition: 'transform .2s'
		+	});
		+	anchor.css({
		+	transform: 'translate3d(0,0,0)',
		+	transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
		+	});
		+	}, 20);
		+	}, 200);
		+	};
		+
		+
		+	}(jQuery));;
		+	(function ($) {
		+	// Image transition function
		+	Materialize.fadeInImage = function (selectorOrEl) {
		+	var element;
		+	if (typeof (selectorOrEl) === 'string') {
		+	element = $(selectorOrEl);
		+	} else if (typeof (selectorOrEl) === 'object') {
		+	element = selectorOrEl;
		+	} else {
		+	return;
		+	}
		+	element.css({
		+	opacity: 0
		+	});
		+	$(element).velocity({
		+	opacity: 1
		+	}, {
		+	duration: 650,
		+	queue: false,
		+	easing: 'easeOutSine'
		+	});
		+	$(element).velocity({
		+	opacity: 1
		+	}, {
		+	duration: 1300,
		+	queue: false,
		+	easing: 'swing',
		+	step: function (now, fx) {
		+	fx.start = 100;
		+	var grayscale_setting = now / 100;
		+	var brightness_setting = 150 - (100 - now) / 1.75;
		+
		+	if (brightness_setting < 100) {
		+	brightness_setting = 100;
		+	}
		+	if (now >= 0) {
		+	$(this).css({
		+	"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
		+	"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
		+	});
		+	}
		+	}
		+	});
		+	};
		+
		+	// Horizontal staggered list
		+	Materialize.showStaggeredList = function (selectorOrEl) {
		+	var element;
		+	if (typeof (selectorOrEl) === 'string') {
		+	element = $(selectorOrEl);
		+	} else if (typeof (selectorOrEl) === 'object') {
		+	element = selectorOrEl;
		+	} else {
		+	return;
		+	}
		+	var time = 0;
		+	element.find('li').velocity({
		+	translateX: "-100px"
		+	}, {
		+	duration: 0
		+	});
		+
		+	element.find('li').each(function () {
		+	$(this).velocity({
		+	opacity: "1",
		+	translateX: "0"
		+	}, {
		+	duration: 800,
		+	delay: time,
		+	easing: [60, 10]
		+	});
		+	time += 120;
		+	});
		+	};
		+
		+
		+	$(document).ready(function () {
		+	// Hardcoded .staggered-list scrollFire
		+	// var staggeredListOptions = [];
		+	// $('ul.staggered-list').each(function (i) {
		+
		+	//  var label = 'scrollFire-' + i;
		+	//  $(this).addClass(label);
		+	//  staggeredListOptions.push(
		+	//    {selector: 'ul.staggered-list.' + label,
		+	//      offset: 200,
		+	//      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
		+	// });
		+	// scrollFire(staggeredListOptions);
		+
		+	// HammerJS, Swipe navigation
		+
		+	// Touch Event
		+	var swipeLeft = false;
		+	var swipeRight = false;
		+
		+
		+	// Dismissible Collections
		+	$('.dismissable').each(function () {
		+	$(this).hammer({
		+	prevent_default: false
		+	}).on('pan', function (e) {
		+	if (e.gesture.pointerType === "touch") {
		+	var $this = $(this);
		+	var direction = e.gesture.direction;
		+	var x = e.gesture.deltaX;
		+	var velocityX = e.gesture.velocityX;
		+
		+	$this.velocity({
		+	translateX: x
		+	}, {
		+	duration: 50,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+
		+	// Swipe Left
		+	if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
		+	swipeLeft = true;
		+	}
		+
		+	// Swipe Right
		+	if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
		+	swipeRight = true;
		+	}
		+	}
		+	}).on('panend', function (e) {
		+	// Reset if collection is moved back into original position
		+	if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
		+	swipeRight = false;
		+	swipeLeft = false;
		+	}
		+
		+	if (e.gesture.pointerType === "touch") {
		+	var $this = $(this);
		+	if (swipeLeft || swipeRight) {
		+	var fullWidth;
		+	if (swipeLeft) {
		+	fullWidth = $this.innerWidth();
		+	} else {
		+	fullWidth = -1 * $this.innerWidth();
		+	}
		+
		+	$this.velocity({
		+	translateX: fullWidth,
		+	}, {
		+	duration: 100,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$this.css('border', 'none');
		+	$this.velocity({
		+	height: 0,
		+	padding: 0,
		+	}, {
		+	duration: 200,
		+	queue: false,
		+	easing: 'easeOutQuad',
		+	complete: function () {
		+	$this.remove();
		+	}
		+	});
		+	}
		+	});
		+	} else {
		+	$this.velocity({
		+	translateX: 0,
		+	}, {
		+	duration: 100,
		+	queue: false,
		+	easing: 'easeOutQuad'
		+	});
		+	}
		+	swipeLeft = false;
		+	swipeRight = false;
		+	}
		+	});
		+
		+	});
		+
		+
		+	// time = 0
		+	// // Vertical Staggered list
		+	// $('ul.staggered-list.vertical li').velocity(
		+	//    { translateY: "100px"},
		+	//    { duration: 0 });
		+
		+	// $('ul.staggered-list.vertical li').each(function() {
		+	//  $(this).velocity(
		+	//    { opacity: "1", translateY: "0"},
		+	//    { duration: 800, delay: time, easing: [60, 25] });
		+	//  time += 120;
		+	// });
		+
		+	// // Fade in and Scale
		+	// $('.fade-in.scale').velocity(
		+	//    { scaleX: .4, scaleY: .4, translateX: -600},
		+	//    { duration: 0});
		+	// $('.fade-in').each(function() {
		+	//  $(this).velocity(
		+	//    { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
		+	//    { duration: 800, easing: [60, 10] });
		+	// });
		+	});
		+	}(jQuery));;
		+	(function ($) {
		+
		+	var scrollFireEventsHandled = false;
		+
		+	// Input: Array of JSON objects {selector, offset, callback}
		+	Materialize.scrollFire = function (options) {
		+	var onScroll = function () {
		+	var windowScroll = window.pageYOffset + window.innerHeight;
		+
		+	for (var i = 0; i < options.length; i++) {
		+	// Get options from each line
		+	var value = options[i];
		+	var selector = value.selector,
		+	offset = value.offset,
		+	callback = value.callback;
		+
		+	var currentElement = document.querySelector(selector);
		+	if (currentElement !== null) {
		+	var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
		+
		+	if (windowScroll > (elementOffset + offset)) {
		+	if (value.done !== true) {
		+	if (typeof (callback) === 'function') {
		+	callback.call(this, currentElement);
		+	} else if (typeof (callback) === 'string') {
		+	var callbackFunc = new Function(callback);
		+	callbackFunc(currentElement);
		+	}
		+	value.done = true;
		+	}
		+	}
		+	}
		+	}
		+	};
		+
		+
		+	var throttledScroll = Materialize.throttle(function () {
		+	onScroll();
		+	}, options.throttle || 100);
		+
		+	if (!scrollFireEventsHandled) {
		+	window.addEventListener("scroll", throttledScroll);
		+	window.addEventListener("resize", throttledScroll);
		+	scrollFireEventsHandled = true;
		+	}
		+
		+	// perform a scan once, after current execution context, and after dom is ready
		+	setTimeout(throttledScroll, 0);
		+	};
		+
		+	})(jQuery);;
		+	/*!
		+	* pickadate.js v3.5.0, 2014/04/13
		+	* By Amsul, http://amsul.ca
		+	* Hosted on http://amsul.github.io/pickadate.js
		+	* Licensed under MIT
		+	*/
		+
		+	(function (factory) {
		+
		+	// AMD.
		+	if (typeof define == 'function' && define.amd)
		+	define('picker', ['jquery'], factory)
		+
		+	// Node.js/browserify.
		+	else if (typeof exports == 'object')
		+	module.exports = factory(require('jquery'))
		+
		+	// Browser globals.
		+	else this.Picker = factory(jQuery)
		+
		+	}(function ($) {
		+
		+	var $window = $(window)
		+	var $document = $(document)
		+	var $html = $(document.documentElement)
		+
		+
		+	/**
		+	* The picker constructor that creates a blank picker.
		+	*/
		+	function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
		+
		+	// If there’s no element, return the picker constructor.
		+	if (!ELEMENT) return PickerConstructor
		+
		+
		+	var
		+	IS_DEFAULT_THEME = false,
		+
		+
		+	// The state of the picker.
		+	STATE = {
		+	id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
		+	},
		+
		+
		+	// Merge the defaults and options passed.
		+	SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
		+
		+
		+	// Merge the default classes with the settings classes.
		+	CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
		+
		+
		+	// The element node wrapper into a jQuery object.
		+	$ELEMENT = $(ELEMENT),
		+
		+
		+	// Pseudo picker constructor.
		+	PickerInstance = function () {
		+	return this.start()
		+	},
		+
		+
		+	// The picker prototype.
		+	P = PickerInstance.prototype = {
		+
		+	constructor: PickerInstance,
		+
		+	$node: $ELEMENT,
		+
		+
		+	/**
		+	* Initialize everything
		+	*/
		+	start: function () {
		+
		+	// If it’s already started, do nothing.
		+	if (STATE && STATE.start) return P
		+
		+
		+	// Update the picker states.
		+	STATE.methods = {}
		+	STATE.start = true
		+	STATE.open = false
		+	STATE.type = ELEMENT.type
		+
		+
		+	// Confirm focus state, convert into text input to remove UA stylings,
		+	// and set as readonly to prevent keyboard popup.
		+	ELEMENT.autofocus = ELEMENT == getActiveElement()
		+	ELEMENT.readOnly = !SETTINGS.editable
		+	ELEMENT.id = ELEMENT.id || STATE.id
		+	if (ELEMENT.type != 'text') {
		+	ELEMENT.type = 'text'
		+	}
		+
		+
		+	// Create a new picker component with the settings.
		+	P.component = new COMPONENT(P, SETTINGS)
		+
		+
		+	// Create the picker root with a holder and then prepare it.
		+	P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'))
		+	prepareElementRoot()
		+
		+
		+	// If there’s a format for the hidden input element, create the element.
		+	if (SETTINGS.formatSubmit) {
		+	prepareElementHidden()
		+	}
		+
		+
		+	// Prepare the input element.
		+	prepareElement()
		+
		+
		+	// Insert the root as specified in the settings.
		+	if (SETTINGS.container) $(SETTINGS.container).append(P.$root)
		+	else $ELEMENT.after(P.$root)
		+
		+
		+	// Bind the default component and settings events.
		+	P.on({
		+	start: P.component.onStart,
		+	render: P.component.onRender,
		+	stop: P.component.onStop,
		+	open: P.component.onOpen,
		+	close: P.component.onClose,
		+	set: P.component.onSet
		+	}).on({
		+	start: SETTINGS.onStart,
		+	render: SETTINGS.onRender,
		+	stop: SETTINGS.onStop,
		+	open: SETTINGS.onOpen,
		+	close: SETTINGS.onClose,
		+	set: SETTINGS.onSet
		+	})
		+
		+
		+	// Once we’re all set, check the theme in use.
		+	IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0])
		+
		+
		+	// If the element has autofocus, open the picker.
		+	if (ELEMENT.autofocus) {
		+	P.open()
		+	}
		+
		+
		+	// Trigger queued the “start” and “render” events.
		+	return P.trigger('start').trigger('render')
		+	}, //start
		+
		+
		+	/**
		+	* Render a new picker
		+	*/
		+	render: function (entireComponent) {
		+
		+	// Insert a new component holder in the root or box.
		+	if (entireComponent) P.$root.html(createWrappedComponent())
		+	else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open))
		+
		+	// Trigger the queued “render” events.
		+	return P.trigger('render')
		+	}, //render
		+
		+
		+	/**
		+	* Destroy everything
		+	*/
		+	stop: function () {
		+
		+	// If it’s already stopped, do nothing.
		+	if (!STATE.start) return P
		+
		+	// Then close the picker.
		+	P.close()
		+
		+	// Remove the hidden field.
		+	if (P._hidden) {
		+	P._hidden.parentNode.removeChild(P._hidden)
		+	}
		+
		+	// Remove the root.
		+	P.$root.remove()
		+
		+	// Remove the input class, remove the stored data, and unbind
		+	// the events (after a tick for IE - see `P.close`).
		+	$ELEMENT.removeClass(CLASSES.input).removeData(NAME)
		+	setTimeout(function () {
		+	$ELEMENT.off('.' + STATE.id)
		+	}, 0)
		+
		+	// Restore the element state
		+	ELEMENT.type = STATE.type
		+	ELEMENT.readOnly = false
		+
		+	// Trigger the queued “stop” events.
		+	P.trigger('stop')
		+
		+	// Reset the picker states.
		+	STATE.methods = {}
		+	STATE.start = false
		+
		+	return P
		+	}, //stop
		+
		+
		+	/**
		+	* Open up the picker
		+	*/
		+	open: function (dontGiveFocus) {
		+
		+	// If it’s already open, do nothing.
		+	if (STATE.open) return P
		+
		+	// Add the “active” class.
		+	$ELEMENT.addClass(CLASSES.active)
		+	aria(ELEMENT, 'expanded', true)
		+
		+	// * A Firefox bug, when `html` has `overflow:hidden`, results in
		+	//  killing transitions :(. So add the “opened” state on the next tick.
		+	//  Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
		+	setTimeout(function () {
		+
		+	// Add the “opened” class to the picker root.
		+	P.$root.addClass(CLASSES.opened)
		+	aria(P.$root[0], 'hidden', false)
		+
		+	}, 0)
		+
		+	// If we have to give focus, bind the element and doc events.
		+	if (dontGiveFocus !== false) {
		+
		+	// Set it as open.
		+	STATE.open = true
		+
		+	// Prevent the page from scrolling.
		+	if (IS_DEFAULT_THEME) {
		+	$html.
		+	css('overflow', 'hidden').
		+	css('padding-right', '+=' + getScrollbarWidth())
		+	}
		+
		+	// Pass focus to the root element’s jQuery object.
		+	// * Workaround for iOS8 to bring the picker’s root into view.
		+	P.$root.eq(0).focus()
		+
		+	// Bind the document events.
		+	$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
		+
		+	var target = event.target
		+
		+	// If the target of the event is not the element, close the picker picker.
		+	// * Don’t worry about clicks or focusins on the root because those don’t bubble up.
		+	//  Also, for Firefox, a click on an `option` element bubbles up directly
		+	//  to the doc. So make sure the target wasn't the doc.
		+	// * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
		+	//  which causes the picker to unexpectedly close when right-clicking it. So make
		+	//  sure the event wasn’t a right-click.
		+	if (target != ELEMENT && target != document && event.which != 3) {
		+
		+	// If the target was the holder that covers the screen,
		+	// keep the element focused to maintain tabindex.
		+	P.close(target === P.$root.children()[0])
		+	}
		+
		+	}).on('keydown.' + STATE.id, function (event) {
		+
		+	var
		+	// Get the keycode.
		+	keycode = event.keyCode,
		+
		+	// Translate that to a selection change.
		+	keycodeToMove = P.component.key[keycode],
		+
		+	// Grab the target.
		+	target = event.target
		+
		+
		+	// On escape, close the picker and give focus.
		+	if (keycode == 27) {
		+	P.close(true)
		+	}
		+
		+
		+	// Check if there is a key movement or “enter” keypress on the element.
		+	else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
		+
		+	// Prevent the default action to stop page movement.
		+	event.preventDefault()
		+
		+	// Trigger the key movement action.
		+	if (keycodeToMove) {
		+	PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)])
		+	}
		+
		+	// On “enter”, if the highlighted item isn’t disabled, set the value and close.
		+	else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
		+	P.set('select', P.component.item.highlight).close()
		+	}
		+	}
		+
		+
		+	// If the target is within the root and “enter” is pressed,
		+	// prevent the default action and trigger a click on the target instead.
		+	else if ($.contains(P.$root[0], target) && keycode == 13) {
		+	event.preventDefault()
		+	target.click()
		+	}
		+	})
		+	}
		+
		+	// Trigger the queued “open” events.
		+	return P.trigger('open')
		+	}, //open
		+
		+
		+	/**
		+	* Close the picker
		+	*/
		+	close: function (giveFocus) {
		+
		+	// If we need to give focus, do it before changing states.
		+	if (giveFocus) {
		+	// ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
		+	// The focus is triggered *after* the close has completed - causing it
		+	// to open again. So unbind and rebind the event at the next tick.
		+	P.$root.off('focus.toOpen').eq(0).focus()
		+	setTimeout(function () {
		+	P.$root.on('focus.toOpen', handleFocusToOpenEvent)
		+	}, 0)
		+	}
		+
		+	// Remove the “active” class.
		+	$ELEMENT.removeClass(CLASSES.active)
		+	aria(ELEMENT, 'expanded', false)
		+
		+	// * A Firefox bug, when `html` has `overflow:hidden`, results in
		+	//  killing transitions :(. So remove the “opened” state on the next tick.
		+	//  Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
		+	setTimeout(function () {
		+
		+	// Remove the “opened” and “focused” class from the picker root.
		+	P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused)
		+	aria(P.$root[0], 'hidden', true)
		+
		+	}, 0)
		+
		+	// If it’s already closed, do nothing more.
		+	if (!STATE.open) return P
		+
		+	// Set it as closed.
		+	STATE.open = false
		+
		+	// Allow the page to scroll.
		+	if (IS_DEFAULT_THEME) {
		+	$html.
		+	css('overflow', '').
		+	css('padding-right', '-=' + getScrollbarWidth())
		+	}
		+
		+	// Unbind the document events.
		+	$document.off('.' + STATE.id)
		+
		+	// Trigger the queued “close” events.
		+	return P.trigger('close')
		+	}, //close
		+
		+
		+	/**
		+	* Clear the values
		+	*/
		+	clear: function (options) {
		+	return P.set('clear', null, options)
		+	}, //clear
		+
		+
		+	/**
		+	* Set something
		+	*/
		+	set: function (thing, value, options) {
		+
		+	var thingItem, thingValue,
		+	thingIsObject = $.isPlainObject(thing),
		+	thingObject = thingIsObject ? thing : {}
		+
		+	// Make sure we have usable options.
		+	options = thingIsObject && $.isPlainObject(value) ? value : options || {}
		+
		+	if (thing) {
		+
		+	// If the thing isn’t an object, make it one.
		+	if (!thingIsObject) {
		+	thingObject[thing] = value
		+	}
		+
		+	// Go through the things of items to set.
		+	for (thingItem in thingObject) {
		+
		+	// Grab the value of the thing.
		+	thingValue = thingObject[thingItem]
		+
		+	// First, if the item exists and there’s a value, set it.
		+	if (thingItem in P.component.item) {
		+	if (thingValue === undefined) thingValue = null
		+	P.component.set(thingItem, thingValue, options)
		+	}
		+
		+	// Then, check to update the element value and broadcast a change.
		+	if (thingItem == 'select' || thingItem == 'clear') {
		+	$ELEMENT.
		+	val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).
		+	trigger('change')
		+	}
		+	}
		+
		+	// Render a new picker.
		+	P.render()
		+	}
		+
		+	// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
		+	return options.muted ? P : P.trigger('set', thingObject)
		+	}, //set
		+
		+
		+	/**
		+	* Get something
		+	*/
		+	get: function (thing, format) {
		+
		+	// Make sure there’s something to get.
		+	thing = thing || 'value'
		+
		+	// If a picker state exists, return that.
		+	if (STATE[thing] != null) {
		+	return STATE[thing]
		+	}
		+
		+	// Return the submission value, if that.
		+	if (thing == 'valueSubmit') {
		+	if (P._hidden) {
		+	return P._hidden.value
		+	}
		+	thing = 'value'
		+	}
		+
		+	// Return the value, if that.
		+	if (thing == 'value') {
		+	return ELEMENT.value
		+	}
		+
		+	// Check if a component item exists, return that.
		+	if (thing in P.component.item) {
		+	if (typeof format == 'string') {
		+	var thingValue = P.component.get(thing)
		+	return thingValue ?
		+	PickerConstructor._.trigger(
		+	P.component.formats.toString,
		+	P.component, [format, thingValue]
		+	) : ''
		+	}
		+	return P.component.get(thing)
		+	}
		+	}, //get
		+
		+
		+
		+	/**
		+	* Bind events on the things.
		+	*/
		+	on: function (thing, method, internal) {
		+
		+	var thingName, thingMethod,
		+	thingIsObject = $.isPlainObject(thing),
		+	thingObject = thingIsObject ? thing : {}
		+
		+	if (thing) {
		+
		+	// If the thing isn’t an object, make it one.
		+	if (!thingIsObject) {
		+	thingObject[thing] = method
		+	}
		+
		+	// Go through the things to bind to.
		+	for (thingName in thingObject) {
		+
		+	// Grab the method of the thing.
		+	thingMethod = thingObject[thingName]
		+
		+	// If it was an internal binding, prefix it.
		+	if (internal) {
		+	thingName = '_' + thingName
		+	}
		+
		+	// Make sure the thing methods collection exists.
		+	STATE.methods[thingName] = STATE.methods[thingName] || []
		+
		+	// Add the method to the relative method collection.
		+	STATE.methods[thingName].push(thingMethod)
		+	}
		+	}
		+
		+	return P
		+	}, //on
		+
		+
		+
		+	/**
		+	* Unbind events on the things.
		+	*/
		+	off: function () {
		+	var i, thingName,
		+	names = arguments;
		+	for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
		+	thingName = names[i]
		+	if (thingName in STATE.methods) {
		+	delete STATE.methods[thingName]
		+	}
		+	}
		+	return P
		+	},
		+
		+
		+	/**
		+	* Fire off method events.
		+	*/
		+	trigger: function (name, data) {
		+	var _trigger = function (name) {
		+	var methodList = STATE.methods[name]
		+	if (methodList) {
		+	methodList.map(function (method) {
		+	PickerConstructor._.trigger(method, P, [data])
		+	})
		+	}
		+	}
		+	_trigger('_' + name)
		+	_trigger(name)
		+	return P
		+	} //trigger
		+	} //PickerInstance.prototype
		+
		+
		+	/**
		+	* Wrap the picker holder components together.
		+	*/
		+	function createWrappedComponent() {
		+
		+	// Create a picker wrapper holder
		+	return PickerConstructor._.node('div',
		+
		+	// Create a picker wrapper node
		+	PickerConstructor._.node('div',
		+
		+	// Create a picker frame
		+	PickerConstructor._.node('div',
		+
		+	// Create a picker box node
		+	PickerConstructor._.node('div',
		+
		+	// Create the components nodes.
		+	P.component.nodes(STATE.open),
		+
		+	// The picker box class
		+	CLASSES.box
		+	),
		+
		+	// Picker wrap class
		+	CLASSES.wrap
		+	),
		+
		+	// Picker frame class
		+	CLASSES.frame
		+	),
		+
		+	// Picker holder class
		+	CLASSES.holder
		+	) //endreturn
		+	} //createWrappedComponent
		+
		+
		+
		+	/**
		+	* Prepare the input element with all bindings.
		+	*/
		+	function prepareElement() {
		+
		+	$ELEMENT.
		+
		+	// Store the picker data by component name.
		+	data(NAME, P).
		+
		+	// Add the “input” class name.
		+	addClass(CLASSES.input).
		+
		+	// Remove the tabindex.
		+	attr('tabindex', -1).
		+
		+	// If there’s a `data-value`, update the value of the element.
		+	val($ELEMENT.data('value') ?
		+	P.get('select', SETTINGS.format) :
		+	ELEMENT.value
		+	)
		+
		+
		+	// Only bind keydown events if the element isn’t editable.
		+	if (!SETTINGS.editable) {
		+
		+	$ELEMENT.
		+
		+	// On focus/click, focus onto the root to open it up.
		+	on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
		+	event.preventDefault()
		+	P.$root.eq(0).focus()
		+	}).
		+
		+	// Handle keyboard event based on the picker being opened or not.
		+	on('keydown.' + STATE.id, handleKeydownEvent)
		+	}
		+
		+
		+	// Update the aria attributes.
		+	aria(ELEMENT, {
		+	haspopup: true,
		+	expanded: false,
		+	readonly: false,
		+	owns: ELEMENT.id + '_root'
		+	})
		+	}
		+
		+
		+	/**
		+	* Prepare the root picker element with all bindings.
		+	*/
		+	function prepareElementRoot() {
		+
		+	P.$root.
		+
		+	on({
		+
		+	// For iOS8.
		+	keydown: handleKeydownEvent,
		+
		+	// When something within the root is focused, stop from bubbling
		+	// to the doc and remove the “focused” state from the root.
		+	focusin: function (event) {
		+	P.$root.removeClass(CLASSES.focused)
		+	event.stopPropagation()
		+	},
		+
		+	// When something within the root holder is clicked, stop it
		+	// from bubbling to the doc.
		+	'mousedown click': function (event) {
		+
		+	var target = event.target
		+
		+	// Make sure the target isn’t the root holder so it can bubble up.
		+	if (target != P.$root.children()[0]) {
		+
		+	event.stopPropagation()
		+
		+	// * For mousedown events, cancel the default action in order to
		+	//  prevent cases where focus is shifted onto external elements
		+	//  when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
		+	//  Also, for Firefox, don’t prevent action on the `option` element.
		+	if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
		+
		+	event.preventDefault()
		+
		+	// Re-focus onto the root so that users can click away
		+	// from elements focused within the picker.
		+	P.$root.eq(0).focus()
		+	}
		+	}
		+	}
		+	}).
		+
		+	// Add/remove the “target” class on focus and blur.
		+	on({
		+	focus: function () {
		+	$ELEMENT.addClass(CLASSES.target)
		+	},
		+	blur: function () {
		+	$ELEMENT.removeClass(CLASSES.target)
		+	}
		+	}).
		+
		+	// Open the picker and adjust the root “focused” state
		+	on('focus.toOpen', handleFocusToOpenEvent).
		+
		+	// If there’s a click on an actionable element, carry out the actions.
		+	on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
		+
		+	var $target = $(this),
		+	targetData = $target.data(),
		+	targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
		+
		+	// * For IE, non-focusable elements can be active elements as well
		+	//  (http://stackoverflow.com/a/2684561).
		+	activeElement = getActiveElement()
		+	activeElement = activeElement && (activeElement.type || activeElement.href)
		+
		+	// If it’s disabled or nothing inside is actively focused, re-focus the element.
		+	if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
		+	P.$root.eq(0).focus()
		+	}
		+
		+	// If something is superficially changed, update the `highlight` based on the `nav`.
		+	if (!targetDisabled && targetData.nav) {
		+	P.set('highlight', P.component.item.highlight, {
		+	nav: targetData.nav
		+	})
		+	}
		+
		+	// If something is picked, set `select` then close with focus.
		+	else if (!targetDisabled && 'pick' in targetData) {
		+	P.set('select', targetData.pick)
		+	}
		+
		+	// If a “clear” button is pressed, empty the values and close with focus.
		+	else if (targetData.clear) {
		+	P.clear().close(true)
		+	} else if (targetData.close) {
		+	P.close(true)
		+	}
		+
		+	}) //P.$root
		+
		+	aria(P.$root[0], 'hidden', true)
		+	}
		+
		+
		+	/**
		+	* Prepare the hidden input element along with all bindings.
		+	*/
		+	function prepareElementHidden() {
		+
		+	var name
		+
		+	if (SETTINGS.hiddenName === true) {
		+	name = ELEMENT.name
		+	ELEMENT.name = ''
		+	} else {
		+	name = [
		+	typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
		+	typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
		+	]
		+	name = name[0] + ELEMENT.name + name[1]
		+	}
		+
		+	P._hidden = $(
		+	'<input ' +
		+	'type=hidden ' +
		+
		+	// Create the name using the original input’s with a prefix and suffix.
		+	'name="' + name + '"' +
		+
		+	// If the element has a value, set the hidden value as well.
		+	(
		+	$ELEMENT.data('value') || ELEMENT.value ?
		+	' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
		+	''
		+	) +
		+	'>'
		+	)[0]
		+
		+	$ELEMENT.
		+
		+	// If the value changes, update the hidden input with the correct format.
		+	on('change.' + STATE.id, function () {
		+	P._hidden.value = ELEMENT.value ?
		+	P.get('select', SETTINGS.formatSubmit) :
		+	''
		+	})
		+
		+
		+	// Insert the hidden input as specified in the settings.
		+	if (SETTINGS.container) $(SETTINGS.container).append(P._hidden)
		+	else $ELEMENT.after(P._hidden)
		+	}
		+
		+
		+	// For iOS8.
		+	function handleKeydownEvent(event) {
		+
		+	var keycode = event.keyCode,
		+
		+	// Check if one of the delete keys was pressed.
		+	isKeycodeDelete = /^(8|46)$/.test(keycode)
		+
		+	// For some reason IE clears the input value on “escape”.
		+	if (keycode == 27) {
		+	P.close()
		+	return false
		+	}
		+
		+	// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
		+	if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
		+
		+	// Prevent it from moving the page and bubbling to doc.
		+	event.preventDefault()
		+	event.stopPropagation()
		+
		+	// If `delete` was pressed, clear the values and close the picker.
		+	// Otherwise open the picker.
		+	if (isKeycodeDelete) {
		+	P.clear().close()
		+	} else {
		+	P.open()
		+	}
		+	}
		+	}
		+
		+
		+	// Separated for IE
		+	function handleFocusToOpenEvent(event) {
		+
		+	// Stop the event from propagating to the doc.
		+	event.stopPropagation()
		+
		+	// If it’s a focus event, add the “focused” class to the root.
		+	if (event.type == 'focus') {
		+	P.$root.addClass(CLASSES.focused)
		+	}
		+
		+	// And then finally open the picker.
		+	P.open()
		+	}
		+
		+
		+	// Return a new picker instance.
		+	return new PickerInstance()
		+	} //PickerConstructor
		+
		+
		+
		+	/**
		+	* The default classes and prefix to use for the HTML classes.
		+	*/
		+	PickerConstructor.klasses = function (prefix) {
		+	prefix = prefix || 'picker'
		+	return {
		+
		+	picker: prefix,
		+	opened: prefix + '--opened',
		+	focused: prefix + '--focused',
		+
		+	input: prefix + '__input',
		+	active: prefix + '__input--active',
		+	target: prefix + '__input--target',
		+
		+	holder: prefix + '__holder',
		+
		+	frame: prefix + '__frame',
		+	wrap: prefix + '__wrap',
		+
		+	box: prefix + '__box'
		+	}
		+	} //PickerConstructor.klasses
		+
		+
		+
		+	/**
		+	* Check if the default theme is being used.
		+	*/
		+	function isUsingDefaultTheme(element) {
		+
		+	var theme,
		+	prop = 'position'
		+
		+	// For IE.
		+	if (element.currentStyle) {
		+	theme = element.currentStyle[prop]
		+	}
		+
		+	// For normal browsers.
		+	else if (window.getComputedStyle) {
		+	theme = getComputedStyle(element)[prop]
		+	}
		+
		+	return theme == 'fixed'
		+	}
		+
		+
		+
		+	/**
		+	* Get the width of the browser’s scrollbar.
		+	* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
		+	*/
		+	function getScrollbarWidth() {
		+
		+	if ($html.height() <= $window.height()) {
		+	return 0
		+	}
		+
		+	var $outer = $('<div style="visibility:hidden;width:100px" />').
		+	appendTo('body')
		+
		+	// Get the width without scrollbars.
		+	var widthWithoutScroll = $outer[0].offsetWidth
		+
		+	// Force adding scrollbars.
		+	$outer.css('overflow', 'scroll')
		+
		+	// Add the inner div.
		+	var $inner = $('<div style="width:100%" />').appendTo($outer)
		+
		+	// Get the width with scrollbars.
		+	var widthWithScroll = $inner[0].offsetWidth
		+
		+	// Remove the divs.
		+	$outer.remove()
		+
		+	// Return the difference between the widths.
		+	return widthWithoutScroll - widthWithScroll
		+	}
		+
		+
		+
		+	/**
		+	* PickerConstructor helper methods.
		+	*/
		+	PickerConstructor._ = {
		+
		+	/**
		+	* Create a group of nodes. Expects:
		+	* `
		+	{
		+	min:    {Integer},
		+	max:    {Integer},
		+	i:      {Integer},
		+	node:  {String},
		+	item:  {Function}
		+	}
		+	* `
		+	*/
		+	group: function (groupObject) {
		+
		+	var
		+	// Scope for the looped object
		+	loopObjectScope,
		+
		+	// Create the nodes list
		+	nodesList = '',
		+
		+	// The counter starts from the `min`
		+	counter = PickerConstructor._.trigger(groupObject.min, groupObject)
		+
		+
		+	// Loop from the `min` to `max`, incrementing by `i`
		+	for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
		+
		+	// Trigger the `item` function within scope of the object
		+	loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter])
		+
		+	// Splice the subgroup and create nodes out of the sub nodes
		+	nodesList += PickerConstructor._.node(
		+	groupObject.node,
		+	loopObjectScope[0], // the node
		+	loopObjectScope[1], // the classes
		+	loopObjectScope[2] // the attributes
		+	)
		+	}
		+
		+	// Return the list of nodes
		+	return nodesList
		+	}, //group
		+
		+
		+	/**
		+	* Create a dom node string
		+	*/
		+	node: function (wrapper, item, klass, attribute) {
		+
		+	// If the item is false-y, just return an empty string
		+	if (!item) return ''
		+
		+	// If the item is an array, do a join
		+	item = $.isArray(item) ? item.join('') : item
		+
		+	// Check for the class
		+	klass = klass ? ' class="' + klass + '"' : ''
		+
		+	// Check for any attributes
		+	attribute = attribute ? ' ' + attribute : ''
		+
		+	// Return the wrapped item
		+	return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
		+	}, //node
		+
		+
		+	/**
		+	* Lead numbers below 10 with a zero.
		+	*/
		+	lead: function (number) {
		+	return (number < 10 ? '0' : '') + number
		+	},
		+
		+
		+	/**
		+	* Trigger a function otherwise return the value.
		+	*/
		+	trigger: function (callback, scope, args) {
		+	return typeof callback == 'function' ? callback.apply(scope, args || []) : callback
		+	},
		+
		+
		+	/**
		+	* If the second character is a digit, length is 2 otherwise 1.
		+	*/
		+	digits: function (string) {
		+	return (/\d/).test(string[1]) ? 2 : 1
		+	},
		+
		+
		+	/**
		+	* Tell if something is a date object.
		+	*/
		+	isDate: function (value) {
		+	return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate())
		+	},
		+
		+
		+	/**
		+	* Tell if something is an integer.
		+	*/
		+	isInteger: function (value) {
		+	return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0
		+	},
		+
		+
		+	/**
		+	* Create ARIA attribute strings.
		+	*/
		+	ariaAttr: ariaAttr
		+	} //PickerConstructor._
		+
		+
		+
		+	/**
		+	* Extend the picker with a component and defaults.
		+	*/
		+	PickerConstructor.extend = function (name, Component) {
		+
		+	// Extend jQuery.
		+	$.fn[name] = function (options, action) {
		+
		+	// Grab the component data.
		+	var componentData = this.data(name)
		+
		+	// If the picker is requested, return the data object.
		+	if (options == 'picker') {
		+	return componentData
		+	}
		+
		+	// If the component data exists and `options` is a string, carry out the action.
		+	if (componentData && typeof options == 'string') {
		+	return PickerConstructor._.trigger(componentData[options], componentData, [action])
		+	}
		+
		+	// Otherwise go through each matched element and if the component
		+	// doesn’t exist, create a new picker using `this` element
		+	// and merging the defaults and options with a deep copy.
		+	return this.each(function () {
		+	var $this = $(this)
		+	if (!$this.data(name)) {
		+	new PickerConstructor(this, name, Component, options)
		+	}
		+	})
		+	}
		+
		+	// Set the defaults.
		+	$.fn[name].defaults = Component.defaults
		+	} //PickerConstructor.extend
		+
		+
		+
		+	function aria(element, attribute, value) {
		+	if ($.isPlainObject(attribute)) {
		+	for (var key in attribute) {
		+	ariaSet(element, key, attribute[key])
		+	}
		+	} else {
		+	ariaSet(element, attribute, value)
		+	}
		+	}
		+
		+	function ariaSet(element, attribute, value) {
		+	element.setAttribute(
		+	(attribute == 'role' ? '' : 'aria-') + attribute,
		+	value
		+	)
		+	}
		+
		+	function ariaAttr(attribute, data) {
		+	if (!$.isPlainObject(attribute)) {
		+	attribute = {
		+	attribute: data
		+	}
		+	}
		+	data = ''
		+	for (var key in attribute) {
		+	var attr = (key == 'role' ? '' : 'aria-') + key,
		+	attrVal = attribute[key]
		+	data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
		+	}
		+	return data
		+	}
		+
		+	// IE8 bug throws an error for activeElements within iframes.
		+	function getActiveElement() {
		+	try {
		+	return document.activeElement
		+	} catch (err) {}
		+	}
		+
		+
		+
		+	// Expose the picker constructor.
		+	return PickerConstructor
		+
		+
		+	}));
		+
		+	;
		+	/*!
		+	* Date picker for pickadate.js v3.5.0
		+	* http://amsul.github.io/pickadate.js/date.htm
		+	*/
		+
		+	(function (factory) {
		+
		+	// AMD.
		+	if (typeof define == 'function' && define.amd)
		+	define(['picker', 'jquery'], factory)
		+
		+	// Node.js/browserify.
		+	else if (typeof exports == 'object')
		+	module.exports = factory(require('./picker.js'), require('jquery'))
		+
		+	// Browser globals.
		+	else factory(Picker, jQuery)
		+
		+	}(function (Picker, $) {
		+
		+
		+	/**
		+	* Globals and constants
		+	*/
		+	var DAYS_IN_WEEK = 7,
		+	WEEKS_IN_CALENDAR = 6,
		+	_ = Picker._;
		+
		+
		+
		+	/**
		+	* The date picker constructor
		+	*/
		+	function DatePicker(picker, settings) {
		+
		+	var calendar = this,
		+	element = picker.$node[0],
		+	elementValue = element.value,
		+	elementDataValue = picker.$node.data('value'),
		+	valueString = elementDataValue || elementValue,
		+	formatString = elementDataValue ? settings.formatSubmit : settings.format,
		+	isRTL = function () {
		+
		+	return element.currentStyle ?
		+
		+	// For IE.
		+	element.currentStyle.direction == 'rtl' :
		+
		+	// For normal browsers.
		+	getComputedStyle(picker.$root[0]).direction == 'rtl'
		+	}
		+
		+	calendar.settings = settings
		+	calendar.$node = picker.$node
		+
		+	// The queue of methods that will be used to build item objects.
		+	calendar.queue = {
		+	min: 'measure create',
		+	max: 'measure create',
		+	now: 'now create',
		+	select: 'parse create validate',
		+	highlight: 'parse navigate create validate',
		+	view: 'parse create validate viewset',
		+	disable: 'deactivate',
		+	enable: 'activate'
		+	}
		+
		+	// The component's item object.
		+	calendar.item = {}
		+
		+	calendar.item.clear = null
		+	calendar.item.disable = (settings.disable || []).slice(0)
		+	calendar.item.enable = -(function (collectionDisabled) {
		+	return collectionDisabled[0] === true ? collectionDisabled.shift() : -1
		+	})(calendar.item.disable)
		+
		+	calendar.
		+	set('min', settings.min).
		+	set('max', settings.max).
		+	set('now')
		+
		+	// When there’s a value, set the `select`, which in turn
		+	// also sets the `highlight` and `view`.
		+	if (valueString) {
		+	calendar.set('select', valueString, {
		+	format: formatString
		+	})
		+	}
		+
		+	// If there’s no value, default to highlighting “today”.
		+	else {
		+	calendar.
		+	set('select', null).
		+	set('highlight', calendar.item.now)
		+	}
		+
		+
		+	// The keycode to movement mapping.
		+	calendar.key = {
		+	40: 7, // Down
		+	38: -7, // Up
		+	39: function () {
		+	return isRTL() ? -1 : 1
		+	}, // Right
		+	37: function () {
		+	return isRTL() ? 1 : -1
		+	}, // Left
		+	go: function (timeChange) {
		+	var highlightedObject = calendar.item.highlight,
		+	targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange)
		+	calendar.set(
		+	'highlight',
		+	targetDate, {
		+	interval: timeChange
		+	}
		+	)
		+	this.render()
		+	}
		+	}
		+
		+
		+	// Bind some picker events.
		+	picker.
		+	on('render', function () {
		+	picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
		+	var value = this.value
		+	if (value) {
		+	picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date])
		+	picker.$root.find('.' + settings.klass.selectMonth).trigger('focus')
		+	}
		+	})
		+	picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
		+	var value = this.value
		+	if (value) {
		+	picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date])
		+	picker.$root.find('.' + settings.klass.selectYear).trigger('focus')
		+	}
		+	})
		+	}, 1).
		+	on('open', function () {
		+	var includeToday = ''
		+	if (calendar.disabled(calendar.get('now'))) {
		+	includeToday = ':not(.' + settings.klass.buttonToday + ')'
		+	}
		+	picker.$root.find('button' + includeToday + ', select').attr('disabled', false)
		+	}, 1).
		+	on('close', function () {
		+	picker.$root.find('button, select').attr('disabled', true)
		+	}, 1)
		+
		+	} //DatePicker
		+
		+
		+	/**
		+	* Set a datepicker item object.
		+	*/
		+	DatePicker.prototype.set = function (type, value, options) {
		+
		+	var calendar = this,
		+	calendarItem = calendar.item
		+
		+	// If the value is `null` just set it immediately.
		+	if (value === null) {
		+	if (type == 'clear') type = 'select'
		+	calendarItem[type] = value
		+	return calendar
		+	}
		+
		+	// Otherwise go through the queue of methods, and invoke the functions.
		+	// Update this as the time unit, and set the final value as this item.
		+	// * In the case of `enable`, keep the queue but set `disable` instead.
		+	//  And in the case of `flip`, keep the queue but set `enable` instead.
		+	calendarItem[(type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type)] = calendar.queue[type].split(' ').map(function (method) {
		+	value = calendar[method](type, value, options)
		+	return value
		+	}).pop()
		+
		+	// Check if we need to cascade through more updates.
		+	if (type == 'select') {
		+	calendar.set('highlight', calendarItem.select, options)
		+	} else if (type == 'highlight') {
		+	calendar.set('view', calendarItem.highlight, options)
		+	} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
		+	if (calendarItem.select && calendar.disabled(calendarItem.select)) {
		+	calendar.set('select', calendarItem.select, options)
		+	}
		+	if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
		+	calendar.set('highlight', calendarItem.highlight, options)
		+	}
		+	}
		+
		+	return calendar
		+	} //DatePicker.prototype.set
		+
		+
		+	/**
		+	* Get a datepicker item object.
		+	*/
		+	DatePicker.prototype.get = function (type) {
		+	return this.item[type]
		+	} //DatePicker.prototype.get
		+
		+
		+	/**
		+	* Create a picker date object.
		+	*/
		+	DatePicker.prototype.create = function (type, value, options) {
		+
		+	var isInfiniteValue,
		+	calendar = this
		+
		+	// If there’s no value, use the type as the value.
		+	value = value === undefined ? type : value
		+
		+
		+	// If it’s infinity, update the value.
		+	if (value == -Infinity || value == Infinity) {
		+	isInfiniteValue = value
		+	}
		+
		+	// If it’s an object, use the native date object.
		+	else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
		+	value = value.obj
		+	}
		+
		+	// If it’s an array, convert it into a date and make sure
		+	// that it’s a valid date – otherwise default to today.
		+	else if ($.isArray(value)) {
		+	value = new Date(value[0], value[1], value[2])
		+	value = _.isDate(value) ? value : calendar.create().obj
		+	}
		+
		+	// If it’s a number or date object, make a normalized date.
		+	else if (_.isInteger(value) || _.isDate(value)) {
		+	value = calendar.normalize(new Date(value), options)
		+	}
		+
		+	// If it’s a literal true or any other case, set it to now.
		+	else /*if ( value === true )*/ {
		+	value = calendar.now(type, value, options)
		+	}
		+
		+	// Return the compiled object.
		+	return {
		+	year: isInfiniteValue || value.getFullYear(),
		+	month: isInfiniteValue || value.getMonth(),
		+	date: isInfiniteValue || value.getDate(),
		+	day: isInfiniteValue || value.getDay(),
		+	obj: isInfiniteValue || value,
		+	pick: isInfiniteValue || value.getTime()
		+	}
		+	} //DatePicker.prototype.create
		+
		+
		+	/**
		+	* Create a range limit object using an array, date object,
		+	* literal “true”, or integer relative to another time.
		+	*/
		+	DatePicker.prototype.createRange = function (from, to) {
		+
		+	var calendar = this,
		+	createDate = function (date) {
		+	if (date === true || $.isArray(date) || _.isDate(date)) {
		+	return calendar.create(date)
		+	}
		+	return date
		+	}
		+
		+	// Create objects if possible.
		+	if (!_.isInteger(from)) {
		+	from = createDate(from)
		+	}
		+	if (!_.isInteger(to)) {
		+	to = createDate(to)
		+	}
		+
		+	// Create relative dates.
		+	if (_.isInteger(from) && $.isPlainObject(to)) {
		+	from = [to.year, to.month, to.date + from];
		+	} else if (_.isInteger(to) && $.isPlainObject(from)) {
		+	to = [from.year, from.month, from.date + to];
		+	}
		+
		+	return {
		+	from: createDate(from),
		+	to: createDate(to)
		+	}
		+	} //DatePicker.prototype.createRange
		+
		+
		+	/**
		+	* Check if a date unit falls within a date range object.
		+	*/
		+	DatePicker.prototype.withinRange = function (range, dateUnit) {
		+	range = this.createRange(range.from, range.to)
		+	return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
		+	}
		+
		+
		+	/**
		+	* Check if two date range objects overlap.
		+	*/
		+	DatePicker.prototype.overlapRanges = function (one, two) {
		+
		+	var calendar = this
		+
		+	// Convert the ranges into comparable dates.
		+	one = calendar.createRange(one.from, one.to)
		+	two = calendar.createRange(two.from, two.to)
		+
		+	return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) ||
		+	calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to)
		+	}
		+
		+
		+	/**
		+	* Get the date today.
		+	*/
		+	DatePicker.prototype.now = function (type, value, options) {
		+	value = new Date()
		+	if (options && options.rel) {
		+	value.setDate(value.getDate() + options.rel)
		+	}
		+	return this.normalize(value, options)
		+	}
		+
		+
		+	/**
		+	* Navigate to next/prev month.
		+	*/
		+	DatePicker.prototype.navigate = function (type, value, options) {
		+
		+	var targetDateObject,
		+	targetYear,
		+	targetMonth,
		+	targetDate,
		+	isTargetArray = $.isArray(value),
		+	isTargetObject = $.isPlainObject(value),
		+	viewsetObject = this.item.view
		+	/*,
		+	safety = 100*/
		+
		+
		+	if (isTargetArray || isTargetObject) {
		+
		+	if (isTargetObject) {
		+	targetYear = value.year
		+	targetMonth = value.month
		+	targetDate = value.date
		+	} else {
		+	targetYear = +value[0]
		+	targetMonth = +value[1]
		+	targetDate = +value[2]
		+	}
		+
		+	// If we’re navigating months but the view is in a different
		+	// month, navigate to the view’s year and month.
		+	if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
		+	targetYear = viewsetObject.year
		+	targetMonth = viewsetObject.month
		+	}
		+
		+	// Figure out the expected target year and month.
		+	targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1)
		+	targetYear = targetDateObject.getFullYear()
		+	targetMonth = targetDateObject.getMonth()
		+
		+	// If the month we’re going to doesn’t have enough days,
		+	// keep decreasing the date until we reach the month’s last date.
		+	while ( /*safety &&*/ new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
		+	targetDate -= 1
		+	/*safety -= 1
		+	if ( !safety ) {
		+	throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
		+	}*/
		+	}
		+
		+	value = [targetYear, targetMonth, targetDate]
		+	}
		+
		+	return value
		+	} //DatePicker.prototype.navigate
		+
		+
		+	/**
		+	* Normalize a date by setting the hours to midnight.
		+	*/
		+	DatePicker.prototype.normalize = function (value /*, options*/ ) {
		+	value.setHours(0, 0, 0, 0)
		+	return value
		+	}
		+
		+
		+	/**
		+	* Measure the range of dates.
		+	*/
		+	DatePicker.prototype.measure = function (type, value /*, options*/ ) {
		+
		+	var calendar = this
		+
		+	// If it’s anything false-y, remove the limits.
		+	if (!value) {
		+	value = type == 'min' ? -Infinity : Infinity
		+	}
		+
		+	// If it’s a string, parse it.
		+	else if (typeof value == 'string') {
		+	value = calendar.parse(type, value)
		+	}
		+
		+	// If it's an integer, get a date relative to today.
		+	else if (_.isInteger(value)) {
		+	value = calendar.now(type, value, {
		+	rel: value
		+	})
		+	}
		+
		+	return value
		+	} ///DatePicker.prototype.measure
		+
		+
		+	/**
		+	* Create a viewset object based on navigation.
		+	*/
		+	DatePicker.prototype.viewset = function (type, dateObject /*, options*/ ) {
		+	return this.create([dateObject.year, dateObject.month, 1])
		+	}
		+
		+
		+	/**
		+	* Validate a date as enabled and shift if needed.
		+	*/
		+	DatePicker.prototype.validate = function (type, dateObject, options) {
		+
		+	var calendar = this,
		+
		+	// Keep a reference to the original date.
		+	originalDateObject = dateObject,
		+
		+	// Make sure we have an interval.
		+	interval = options && options.interval ? options.interval : 1,
		+
		+	// Check if the calendar enabled dates are inverted.
		+	isFlippedBase = calendar.item.enable === -1,
		+
		+	// Check if we have any enabled dates after/before now.
		+	hasEnabledBeforeTarget, hasEnabledAfterTarget,
		+
		+	// The min & max limits.
		+	minLimitObject = calendar.item.min,
		+	maxLimitObject = calendar.item.max,
		+
		+	// Check if we’ve reached the limit during shifting.
		+	reachedMin, reachedMax,
		+
		+	// Check if the calendar is inverted and at least one weekday is enabled.
		+	hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
		+
		+	// If there’s a date, check where it is relative to the target.
		+	if ($.isArray(value)) {
		+	var dateTime = calendar.create(value).pick
		+	if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true
		+	else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true
		+	}
		+
		+	// Return only integers for enabled weekdays.
		+	return _.isInteger(value)
		+	}).length
		+	/*,
		+
		+	safety = 100*/
		+
		+
		+
		+	// Cases to validate for:
		+	// [1] Not inverted and date disabled.
		+	// [2] Inverted and some dates enabled.
		+	// [3] Not inverted and out of range.
		+	//
		+	// Cases to **not** validate for:
		+	// • Navigating months.
		+	// • Not inverted and date enabled.
		+	// • Inverted and all dates disabled.
		+	// • ..and anything else.
		+	if (!options || !options.nav)
		+	if (
		+	/* 1 */
		+	(!isFlippedBase && calendar.disabled(dateObject)) ||
		+	/* 2 */
		+	(isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget)) ||
		+	/* 3 */
		+	(!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick))
		+	) {
		+
		+
		+	// When inverted, flip the direction if there aren’t any enabled weekdays
		+	// and there are no enabled dates in the direction of the interval.
		+	if (isFlippedBase && !hasEnabledWeekdays && ((!hasEnabledAfterTarget && interval > 0) || (!hasEnabledBeforeTarget && interval < 0))) {
		+	interval *= -1
		+	}
		+
		+
		+	// Keep looping until we reach an enabled date.
		+	while ( /*safety &&*/ calendar.disabled(dateObject)) {
		+
		+	/*safety -= 1
		+	if ( !safety ) {
		+	throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
		+	}*/
		+
		+
		+	// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
		+	if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
		+	dateObject = originalDateObject
		+	interval = interval > 0 ? 1 : -1
		+	}
		+
		+
		+	// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
		+	if (dateObject.pick <= minLimitObject.pick) {
		+	reachedMin = true
		+	interval = 1
		+	dateObject = calendar.create([
		+	minLimitObject.year,
		+	minLimitObject.month,
		+	minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
		+	])
		+	} else if (dateObject.pick >= maxLimitObject.pick) {
		+	reachedMax = true
		+	interval = -1
		+	dateObject = calendar.create([
		+	maxLimitObject.year,
		+	maxLimitObject.month,
		+	maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
		+	])
		+	}
		+
		+
		+	// If we’ve reached both limits, just break out of the loop.
		+	if (reachedMin && reachedMax) {
		+	break
		+	}
		+
		+
		+	// Finally, create the shifted date using the interval and keep looping.
		+	dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval])
		+	}
		+
		+	} //endif
		+
		+
		+	// Return the date object settled on.
		+	return dateObject
		+	} //DatePicker.prototype.validate
		+
		+
		+	/**
		+	* Check if a date is disabled.
		+	*/
		+	DatePicker.prototype.disabled = function (dateToVerify) {
		+
		+	var
		+	calendar = this,
		+
		+	// Filter through the disabled dates to check if this is one.
		+	isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
		+
		+	// If the date is a number, match the weekday with 0index and `firstDay` check.
		+	if (_.isInteger(dateToDisable)) {
		+	return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7
		+	}
		+
		+	// If it’s an array or a native JS date, create and match the exact date.
		+	if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
		+	return dateToVerify.pick === calendar.create(dateToDisable).pick
		+	}
		+
		+	// If it’s an object, match a date within the “from” and “to” range.
		+	if ($.isPlainObject(dateToDisable)) {
		+	return calendar.withinRange(dateToDisable, dateToVerify)
		+	}
		+	})
		+
		+	// If this date matches a disabled date, confirm it’s not inverted.
		+	isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
		+	return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' ||
		+	$.isPlainObject(dateToDisable) && dateToDisable.inverted
		+	}).length
		+
		+	// Check the calendar “enabled” flag and respectively flip the
		+	// disabled state. Then also check if it’s beyond the min/max limits.
		+	return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
		+	dateToVerify.pick < calendar.item.min.pick ||
		+	dateToVerify.pick > calendar.item.max.pick
		+
		+	} //DatePicker.prototype.disabled
		+
		+
		+	/**
		+	* Parse a string into a usable type.
		+	*/
		+	DatePicker.prototype.parse = function (type, value, options) {
		+
		+	var calendar = this,
		+	parsingObject = {}
		+
		+	// If it’s already parsed, we’re good.
		+	if (!value || typeof value != 'string') {
		+	return value
		+	}
		+
		+	// We need a `.format` to parse the value with.
		+	if (!(options && options.format)) {
		+	options = options || {}
		+	options.format = calendar.settings.format
		+	}
		+
		+	// Convert the format into an array and then map through it.
		+	calendar.formats.toArray(options.format).map(function (label) {
		+
		+	var
		+	// Grab the formatting label.
		+	formattingLabel = calendar.formats[label],
		+
		+	// The format length is from the formatting label function or the
		+	// label length without the escaping exclamation (!) mark.
		+	formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length
		+
		+	// If there's a format label, split the value up to the format length.
		+	// Then add it to the parsing object with appropriate label.
		+	if (formattingLabel) {
		+	parsingObject[label] = value.substr(0, formatLength)
		+	}
		+
		+	// Update the value as the substring from format length to end.
		+	value = value.substr(formatLength)
		+	})
		+
		+	// Compensate for month 0index.
		+	return [
		+	parsingObject.yyyy || parsingObject.yy,
		+	+(parsingObject.mm || parsingObject.m) - 1,
		+	parsingObject.dd || parsingObject.d
		+	]
		+	} //DatePicker.prototype.parse
		+
		+
		+	/**
		+	* Various formats to display the object in.
		+	*/
		+	DatePicker.prototype.formats = (function () {
		+
		+	// Return the length of the first word in a collection.
		+	function getWordLengthFromCollection(string, collection, dateObject) {
		+
		+	// Grab the first word from the string.
		+	var word = string.match(/\w+/)[0]
		+
		+	// If there's no month index, add it to the date object
		+	if (!dateObject.mm && !dateObject.m) {
		+	dateObject.m = collection.indexOf(word) + 1
		+	}
		+
		+	// Return the length of the word.
		+	return word.length
		+	}
		+
		+	// Get the length of the first word in a string.
		+	function getFirstWordLength(string) {
		+	return string.match(/\w+/)[0].length
		+	}
		+
		+	return {
		+
		+	d: function (string, dateObject) {
		+
		+	// If there's string, then get the digits length.
		+	// Otherwise return the selected date.
		+	return string ? _.digits(string) : dateObject.date
		+	},
		+	dd: function (string, dateObject) {
		+
		+	// If there's a string, then the length is always 2.
		+	// Otherwise return the selected date with a leading zero.
		+	return string ? 2 : _.lead(dateObject.date)
		+	},
		+	ddd: function (string, dateObject) {
		+
		+	// If there's a string, then get the length of the first word.
		+	// Otherwise return the short selected weekday.
		+	return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]
		+	},
		+	dddd: function (string, dateObject) {
		+
		+	// If there's a string, then get the length of the first word.
		+	// Otherwise return the full selected weekday.
		+	return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]
		+	},
		+	m: function (string, dateObject) {
		+
		+	// If there's a string, then get the length of the digits
		+	// Otherwise return the selected month with 0index compensation.
		+	return string ? _.digits(string) : dateObject.month + 1
		+	},
		+	mm: function (string, dateObject) {
		+
		+	// If there's a string, then the length is always 2.
		+	// Otherwise return the selected month with 0index and leading zero.
		+	return string ? 2 : _.lead(dateObject.month + 1)
		+	},
		+	mmm: function (string, dateObject) {
		+
		+	var collection = this.settings.monthsShort
		+
		+	// If there's a string, get length of the relevant month from the short
		+	// months collection. Otherwise return the selected month from that collection.
		+	return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
		+	},
		+	mmmm: function (string, dateObject) {
		+
		+	var collection = this.settings.monthsFull
		+
		+	// If there's a string, get length of the relevant month from the full
		+	// months collection. Otherwise return the selected month from that collection.
		+	return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
		+	},
		+	yy: function (string, dateObject) {
		+
		+	// If there's a string, then the length is always 2.
		+	// Otherwise return the selected year by slicing out the first 2 digits.
		+	return string ? 2 : ('' + dateObject.year).slice(2)
		+	},
		+	yyyy: function (string, dateObject) {
		+
		+	// If there's a string, then the length is always 4.
		+	// Otherwise return the selected year.
		+	return string ? 4 : dateObject.year
		+	},
		+
		+	// Create an array by splitting the formatting string passed.
		+	toArray: function (formatString) {
		+	return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)
		+	},
		+
		+	// Format an object into a string using the formatting options.
		+	toString: function (formatString, itemObject) {
		+	var calendar = this
		+	return calendar.formats.toArray(formatString).map(function (label) {
		+	return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '')
		+	}).join('')
		+	}
		+	}
		+	})() //DatePicker.prototype.formats
		+
		+
		+
		+
		+	/**
		+	* Check if two date units are the exact.
		+	*/
		+	DatePicker.prototype.isDateExact = function (one, two) {
		+
		+	var calendar = this
		+
		+	// When we’re working with weekdays, do a direct comparison.
		+	if (
		+	(_.isInteger(one) && _.isInteger(two)) ||
		+	(typeof one == 'boolean' && typeof two == 'boolean')
		+	) {
		+	return one === two
		+	}
		+
		+	// When we’re working with date representations, compare the “pick” value.
		+	if (
		+	(_.isDate(one) || $.isArray(one)) &&
		+	(_.isDate(two) || $.isArray(two))
		+	) {
		+	return calendar.create(one).pick === calendar.create(two).pick
		+	}
		+
		+	// When we’re working with range objects, compare the “from” and “to”.
		+	if ($.isPlainObject(one) && $.isPlainObject(two)) {
		+	return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to)
		+	}
		+
		+	return false
		+	}
		+
		+
		+	/**
		+	* Check if two date units overlap.
		+	*/
		+	DatePicker.prototype.isDateOverlap = function (one, two) {
		+
		+	var calendar = this,
		+	firstDay = calendar.settings.firstDay ? 1 : 0
		+
		+	// When we’re working with a weekday index, compare the days.
		+	if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
		+	one = one % 7 + firstDay
		+	return one === calendar.create(two).day + 1
		+	}
		+	if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
		+	two = two % 7 + firstDay
		+	return two === calendar.create(one).day + 1
		+	}
		+
		+	// When we’re working with range objects, check if the ranges overlap.
		+	if ($.isPlainObject(one) && $.isPlainObject(two)) {
		+	return calendar.overlapRanges(one, two)
		+	}
		+
		+	return false
		+	}
		+
		+
		+	/**
		+	* Flip the “enabled” state.
		+	*/
		+	DatePicker.prototype.flipEnable = function (val) {
		+	var itemObject = this.item
		+	itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
		+	}
		+
		+
		+	/**
		+	* Mark a collection of dates as “disabled”.
		+	*/
		+	DatePicker.prototype.deactivate = function (type, datesToDisable) {
		+
		+	var calendar = this,
		+	disabledItems = calendar.item.disable.slice(0)
		+
		+
		+	// If we’re flipping, that’s all we need to do.
		+	if (datesToDisable == 'flip') {
		+	calendar.flipEnable()
		+	} else if (datesToDisable === false) {
		+	calendar.flipEnable(1)
		+	disabledItems = []
		+	} else if (datesToDisable === true) {
		+	calendar.flipEnable(-1)
		+	disabledItems = []
		+	}
		+
		+	// Otherwise go through the dates to disable.
		+	else {
		+
		+	datesToDisable.map(function (unitToDisable) {
		+
		+	var matchFound
		+
		+	// When we have disabled items, check for matches.
		+	// If something is matched, immediately break out.
		+	for (var index = 0; index < disabledItems.length; index += 1) {
		+	if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
		+	matchFound = true
		+	break
		+	}
		+	}
		+
		+	// If nothing was found, add the validated unit to the collection.
		+	if (!matchFound) {
		+	if (
		+	_.isInteger(unitToDisable) ||
		+	_.isDate(unitToDisable) ||
		+	$.isArray(unitToDisable) ||
		+	($.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to)
		+	) {
		+	disabledItems.push(unitToDisable)
		+	}
		+	}
		+	})
		+	}
		+
		+	// Return the updated collection.
		+	return disabledItems
		+	} //DatePicker.prototype.deactivate
		+
		+
		+	/**
		+	* Mark a collection of dates as “enabled”.
		+	*/
		+	DatePicker.prototype.activate = function (type, datesToEnable) {
		+
		+	var calendar = this,
		+	disabledItems = calendar.item.disable,
		+	disabledItemsCount = disabledItems.length
		+
		+	// If we’re flipping, that’s all we need to do.
		+	if (datesToEnable == 'flip') {
		+	calendar.flipEnable()
		+	} else if (datesToEnable === true) {
		+	calendar.flipEnable(1)
		+	disabledItems = []
		+	} else if (datesToEnable === false) {
		+	calendar.flipEnable(-1)
		+	disabledItems = []
		+	}
		+
		+	// Otherwise go through the disabled dates.
		+	else {
		+
		+	datesToEnable.map(function (unitToEnable) {
		+
		+	var matchFound,
		+	disabledUnit,
		+	index,
		+	isExactRange
		+
		+	// Go through the disabled items and try to find a match.
		+	for (index = 0; index < disabledItemsCount; index += 1) {
		+
		+	disabledUnit = disabledItems[index]
		+
		+	// When an exact match is found, remove it from the collection.
		+	if (calendar.isDateExact(disabledUnit, unitToEnable)) {
		+	matchFound = disabledItems[index] = null
		+	isExactRange = true
		+	break
		+	}
		+
		+	// When an overlapped match is found, add the “inverted” state to it.
		+	else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
		+	if ($.isPlainObject(unitToEnable)) {
		+	unitToEnable.inverted = true
		+	matchFound = unitToEnable
		+	} else if ($.isArray(unitToEnable)) {
		+	matchFound = unitToEnable
		+	if (!matchFound[3]) matchFound.push('inverted')
		+	} else if (_.isDate(unitToEnable)) {
		+	matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']
		+	}
		+	break
		+	}
		+	}
		+
		+	// If a match was found, remove a previous duplicate entry.
		+	if (matchFound)
		+	for (index = 0; index < disabledItemsCount; index += 1) {
		+	if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
		+	disabledItems[index] = null
		+	break
		+	}
		+	}
		+
		+	// In the event that we’re dealing with an exact range of dates,
		+	// make sure there are no “inverted” dates because of it.
		+	if (isExactRange)
		+	for (index = 0; index < disabledItemsCount; index += 1) {
		+	if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
		+	disabledItems[index] = null
		+	break
		+	}
		+	}
		+
		+	// If something is still matched, add it into the collection.
		+	if (matchFound) {
		+	disabledItems.push(matchFound)
		+	}
		+	})
		+	}
		+
		+	// Return the updated collection.
		+	return disabledItems.filter(function (val) {
		+	return val != null
		+	})
		+	} //DatePicker.prototype.activate
		+
		+
		+	/**
		+	* Create a string for the nodes in the picker.
		+	*/
		+	DatePicker.prototype.nodes = function (isOpen) {
		+
		+	var
		+	calendar = this,
		+	settings = calendar.settings,
		+	calendarItem = calendar.item,
		+	nowObject = calendarItem.now,
		+	selectedObject = calendarItem.select,
		+	highlightedObject = calendarItem.highlight,
		+	viewsetObject = calendarItem.view,
		+	disabledCollection = calendarItem.disable,
		+	minLimitObject = calendarItem.min,
		+	maxLimitObject = calendarItem.max,
		+
		+
		+	// Create the calendar table head using a copy of weekday labels collection.
		+	// * We do a copy so we don't mutate the original array.
		+	tableHead = (function (collection, fullCollection) {
		+
		+	// If the first day should be Monday, move Sunday to the end.
		+	if (settings.firstDay) {
		+	collection.push(collection.shift())
		+	fullCollection.push(fullCollection.shift())
		+	}
		+
		+	// Create and return the table head group.
		+	return _.node(
		+	'thead',
		+	_.node(
		+	'tr',
		+	_.group({
		+	min: 0,
		+	max: DAYS_IN_WEEK - 1,
		+	i: 1,
		+	node: 'th',
		+	item: function (counter) {
		+	return [
		+	collection[counter],
		+	settings.klass.weekdays,
		+	'scope=col title="' + fullCollection[counter] + '"'
		+	]
		+	}
		+	})
		+	)
		+	) //endreturn
		+
		+	// Materialize modified
		+	})((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead
		+
		+
		+	// Create the nav for next/prev month.
		+	createMonthNav = function (next) {
		+
		+	// Otherwise, return the created month tag.
		+	return _.node(
		+	'div',
		+	' ',
		+	settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
		+
		+	// If the focused month is outside the range, disabled the button.
		+	(next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month) ||
		+	(!next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month) ?
		+	' ' + settings.klass.navDisabled : ''
		+	),
		+	'data-nav=' + (next || -1) + ' ' +
		+	_.ariaAttr({
		+	role: 'button',
		+	controls: calendar.$node[0].id + '_table'
		+	}) + ' ' +
		+	'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'
		+	) //endreturn
		+	}, //createMonthNav
		+
		+
		+	// Create the month label.
		+	//Materialize modified
		+	createMonthLabel = function (override) {
		+
		+	var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
		+
		+	// Materialize modified
		+	if (override == "short_months") {
		+	monthsCollection = settings.monthsShort;
		+	}
		+
		+	// If there are months to select, add a dropdown menu.
		+	if (settings.selectMonths && override == undefined) {
		+
		+	return _.node('select',
		+	_.group({
		+	min: 0,
		+	max: 11,
		+	i: 1,
		+	node: 'option',
		+	item: function (loopedMonth) {
		+
		+	return [
		+
		+	// The looped month and no classes.
		+	monthsCollection[loopedMonth], 0,
		+
		+	// Set the value and selected index.
		+	'value=' + loopedMonth +
		+	(viewsetObject.month == loopedMonth ? ' selected' : '') +
		+	(
		+	(
		+	(viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month) ||
		+	(viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month)
		+	) ?
		+	' disabled' : ''
		+	)
		+	]
		+	}
		+	}),
		+	settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' +
		+	_.ariaAttr({
		+	controls: calendar.$node[0].id + '_table'
		+	}) + ' ' +
		+	'title="' + settings.labelMonthSelect + '"'
		+	)
		+	}
		+
		+	// Materialize modified
		+	if (override == "short_months")
		+	if (selectedObject != null)
		+	return monthsCollection[selectedObject.month];
		+	else return monthsCollection[viewsetObject.month];
		+
		+	// If there's a need for a month selector
		+	return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month)
		+	}, //createMonthLabel
		+
		+
		+	// Create the year label.
		+	// Materialize modified
		+	createYearLabel = function (override) {
		+
		+	var focusedYear = viewsetObject.year,
		+
		+	// If years selector is set to a literal "true", set it to 5. Otherwise
		+	// divide in half to get half before and half after focused year.
		+	numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2)
		+
		+	// If there are years to select, add a dropdown menu.
		+	if (numberYears) {
		+
		+	var
		+	minYear = minLimitObject.year,
		+	maxYear = maxLimitObject.year,
		+	lowestYear = focusedYear - numberYears,
		+	highestYear = focusedYear + numberYears
		+
		+	// If the min year is greater than the lowest year, increase the highest year
		+	// by the difference and set the lowest year to the min year.
		+	if (minYear > lowestYear) {
		+	highestYear += minYear - lowestYear
		+	lowestYear = minYear
		+	}
		+
		+	// If the max year is less than the highest year, decrease the lowest year
		+	// by the lower of the two: available and needed years. Then set the
		+	// highest year to the max year.
		+	if (maxYear < highestYear) {
		+
		+	var availableYears = lowestYear - minYear,
		+	neededYears = highestYear - maxYear
		+
		+	lowestYear -= availableYears > neededYears ? neededYears : availableYears
		+	highestYear = maxYear
		+	}
		+
		+	if (settings.selectYears && override == undefined) {
		+	return _.node('select',
		+	_.group({
		+	min: lowestYear,
		+	max: highestYear,
		+	i: 1,
		+	node: 'option',
		+	item: function (loopedYear) {
		+	return [
		+
		+	// The looped year and no classes.
		+	loopedYear, 0,
		+
		+	// Set the value and selected index.
		+	'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')
		+	]
		+	}
		+	}),
		+	settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({
		+	controls: calendar.$node[0].id + '_table'
		+	}) + ' ' +
		+	'title="' + settings.labelYearSelect + '"'
		+	)
		+	}
		+	}
		+
		+	// Materialize modified
		+	if (override == "raw")
		+	return _.node('div', focusedYear)
		+
		+	// Otherwise just return the year focused
		+	return _.node('div', focusedYear, settings.klass.year)
		+	} //createYearLabel
		+
		+
		+	// Materialize modified
		+	createDayLabel = function () {
		+	if (selectedObject != null)
		+	return selectedObject.date
		+	else return nowObject.date
		+	}
		+	createWeekdayLabel = function () {
		+	var display_day;
		+
		+	if (selectedObject != null)
		+	display_day = selectedObject.day;
		+	else
		+	display_day = nowObject.day;
		+	var weekday = settings.weekdaysShort[display_day];
		+	return weekday
		+	}
		+
		+
		+	// Create and return the entire calendar.
		+
		+	return _.node(
		+	// Date presentation View
		+	'div',
		+	_.node(
		+	// Div for Year
		+	'div',
		+	createYearLabel("raw"),
		+	settings.klass.year_display
		+	) +
		+	_.node(
		+	'span',
		+	createWeekdayLabel() + ', ',
		+	"picker__weekday-display"
		+	) +
		+	_.node(
		+	// Div for short Month
		+	'span',
		+	createMonthLabel("short_months") + ' ',
		+	settings.klass.month_display
		+	) +
		+	_.node(
		+	// Div for Day
		+	'span',
		+	createDayLabel(),
		+	settings.klass.day_display
		+	),
		+	settings.klass.date_display
		+	) +
		+	// Calendar container
		+	_.node('div',
		+	_.node('div',
		+	_.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) +
		+	createMonthNav() + createMonthNav(1),
		+	settings.klass.header
		+	) + _.node(
		+	'table',
		+	tableHead +
		+	_.node(
		+	'tbody',
		+	_.group({
		+	min: 0,
		+	max: WEEKS_IN_CALENDAR - 1,
		+	i: 1,
		+	node: 'tr',
		+	item: function (rowCounter) {
		+
		+	// If Monday is the first day and the month starts on Sunday, shift the date back a week.
		+	var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0
		+
		+	return [
		+	_.group({
		+	min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
		+	max: function () {
		+	return this.min + DAYS_IN_WEEK - 1
		+	},
		+	i: 1,
		+	node: 'td',
		+	item: function (targetDate) {
		+
		+	// Convert the time date from a relative date to a target date.
		+	targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)])
		+
		+	var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
		+	isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
		+	isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
		+	formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate])
		+
		+	return [
		+	_.node(
		+	'div',
		+	targetDate.date, (function (klasses) {
		+
		+	// Add the `infocus` or `outfocus` classes based on month in view.
		+	klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus)
		+
		+	// Add the `today` class if needed.
		+	if (nowObject.pick == targetDate.pick) {
		+	klasses.push(settings.klass.now)
		+	}
		+
		+	// Add the `selected` class if something's selected and the time matches.
		+	if (isSelected) {
		+	klasses.push(settings.klass.selected)
		+	}
		+
		+	// Add the `highlighted` class if something's highlighted and the time matches.
		+	if (isHighlighted) {
		+	klasses.push(settings.klass.highlighted)
		+	}
		+
		+	// Add the `disabled` class if something's disabled and the object matches.
		+	if (isDisabled) {
		+	klasses.push(settings.klass.disabled)
		+	}
		+
		+	return klasses.join(' ')
		+	})([settings.klass.day]),
		+	'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
		+	role: 'gridcell',
		+	label: formattedDate,
		+	selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
		+	activedescendant: isHighlighted ? true : null,
		+	disabled: isDisabled ? true : null
		+	})
		+	),
		+	'',
		+	_.ariaAttr({
		+	role: 'presentation'
		+	})
		+	] //endreturn
		+	}
		+	})
		+	] //endreturn
		+	}
		+	})
		+	),
		+	settings.klass.table,
		+	'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
		+	role: 'grid',
		+	controls: calendar.$node[0].id,
		+	readonly: true
		+	})
		+	), settings.klass.calendar_container) // end calendar
		+
		+	+
		+
		+	// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
		+	_.node(
		+	'div',
		+	_.node('button', settings.today, "btn-flat picker__today waves-effect",
		+	'type=button data-pick=' + nowObject.pick +
		+	(isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' +
		+	_.ariaAttr({
		+	controls: calendar.$node[0].id
		+	})) +
		+	_.node('button', settings.clear, "btn-flat picker__clear waves-effect",
		+	'type=button data-clear=1' +
		+	(isOpen ? '' : ' disabled') + ' ' +
		+	_.ariaAttr({
		+	controls: calendar.$node[0].id
		+	})) +
		+	_.node('button', settings.close, "btn-flat picker__close waves-effect",
		+	'type=button data-close=true ' +
		+	(isOpen ? '' : ' disabled') + ' ' +
		+	_.ariaAttr({
		+	controls: calendar.$node[0].id
		+	})),
		+	settings.klass.footer
		+	), 'picker__container__wrapper'
		+	) //endreturn
		+	} //DatePicker.prototype.nodes
		+
		+
		+
		+
		+	/**
		+	* The date picker defaults.
		+	*/
		+	DatePicker.defaults = (function (prefix) {
		+
		+	return {
		+
		+	// The title label to use for the month nav buttons
		+	labelMonthNext: 'Next month',
		+	labelMonthPrev: 'Previous month',
		+
		+	// The title label to use for the dropdown selectors
		+	labelMonthSelect: 'Select a month',
		+	labelYearSelect: 'Select a year',
		+
		+	// Months and weekdays
		+	monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
		+	monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
		+	weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
		+	weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
		+
		+	// Materialize modified
		+	weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
		+
		+	// Today and clear
		+	today: 'Today',
		+	clear: 'Clear',
		+	close: 'Ok',
		+
		+	// The format to show on the `input` element
		+	format: 'd mmmm, yyyy',
		+
		+	// Classes
		+	klass: {
		+
		+	table: prefix + 'table',
		+
		+	header: prefix + 'header',
		+
		+
		+	// Materialize Added klasses
		+	date_display: prefix + 'date-display',
		+	day_display: prefix + 'day-display',
		+	month_display: prefix + 'month-display',
		+	year_display: prefix + 'year-display',
		+	calendar_container: prefix + 'calendar-container',
		+	// end
		+
		+
		+
		+	navPrev: prefix + 'nav--prev',
		+	navNext: prefix + 'nav--next',
		+	navDisabled: prefix + 'nav--disabled',
		+
		+	month: prefix + 'month',
		+	year: prefix + 'year',
		+
		+	selectMonth: prefix + 'select--month',
		+	selectYear: prefix + 'select--year',
		+
		+	weekdays: prefix + 'weekday',
		+
		+	day: prefix + 'day',
		+	disabled: prefix + 'day--disabled',
		+	selected: prefix + 'day--selected',
		+	highlighted: prefix + 'day--highlighted',
		+	now: prefix + 'day--today',
		+	infocus: prefix + 'day--infocus',
		+	outfocus: prefix + 'day--outfocus',
		+
		+	footer: prefix + 'footer',
		+
		+	buttonClear: prefix + 'button--clear',
		+	buttonToday: prefix + 'button--today',
		+	buttonClose: prefix + 'button--close'
		+	}
		+	}
		+	})(Picker.klasses().picker + '__')
		+
		+
		+
		+
		+
		+	/**
		+	* Extend the picker to add the date picker.
		+	*/
		+	Picker.extend('pickadate', DatePicker)
		+
		+
		+	}));;
		+	/*!
		+	* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
		+	* Copyright 2014 Wang Shenwei.
		+	* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
		+	*
		+	* Further modified
		+	* Copyright 2015 Ching Yaw Hao.
		+	*/
		+
		+	;
		+	(function () {
		+	var $ = window.jQuery,
		+	$win = $(window),
		+	$doc = $(document);
		+
		+	// Can I use inline svg ?
		+	var svgNS = 'http://www.w3.org/2000/svg',
		+	svgSupported = 'SVGAngle' in window && (function () {
		+	var supported,
		+	el = document.createElement('div');
		+	el.innerHTML = '<svg/>';
		+	supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
		+	el.innerHTML = '';
		+	return supported;
		+	})();
		+
		+	// Can I use transition ?
		+	var transitionSupported = (function () {
		+	var style = document.createElement('div').style;
		+	return 'transition' in style ||
		+	'WebkitTransition' in style ||
		+	'MozTransition' in style ||
		+	'msTransition' in style ||
		+	'OTransition' in style;
		+	})();
		+
		+	// Listen touch events in touch screen device, instead of mouse events in desktop.
		+	var touchSupported = 'ontouchstart' in window,
		+	mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
		+	mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
		+	mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
		+
		+	// Vibrate the device if supported
		+	var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
		+
		+	function createSvgElement(name) {
		+	return document.createElementNS(svgNS, name);
		+	}
		+
		+	function leadingZero(num) {
		+	return (num < 10 ? '0' : '') + num;
		+	}
		+
		+	// Get a unique id
		+	var idCounter = 0;
		+
		+	function uniqueId(prefix) {
		+	var id = ++idCounter + '';
		+	return prefix ? prefix + id : id;
		+	}
		+
		+	// Clock size
		+	var dialRadius = 135,
		+	outerRadius = 105,
		+	// innerRadius = 80 on 12 hour clock
		+	innerRadius = 80,
		+	tickRadius = 20,
		+	diameter = dialRadius * 2,
		+	duration = transitionSupported ? 350 : 1;
		+
		+	// Popover template
		+	var tpl = [
		+	'<div class="clockpicker picker">',
		+	'<div class="picker__holder">',
		+	'<div class="picker__frame">',
		+	'<div class="picker__wrap">',
		+	'<div class="picker__box">',
		+	'<div class="picker__date-display">',
		+	'<div class="clockpicker-display">',
		+	'<div class="clockpicker-display-column">',
		+	'<span class="clockpicker-span-hours text-primary"></span>',
		+	':',
		+	'<span class="clockpicker-span-minutes"></span>',
		+	'</div>',
		+	'<div class="clockpicker-display-column clockpicker-display-am-pm">',
		+	'<div class="clockpicker-span-am-pm"></div>',
		+	'</div>',
		+	'</div>',
		+	'</div>',
		+	'<div class="picker__container__wrapper">',
		+	'<div class="picker__calendar-container">',
		+	'<div class="clockpicker-plate">',
		+	'<div class="clockpicker-canvas"></div>',
		+	'<div class="clockpicker-dial clockpicker-hours"></div>',
		+	'<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>',
		+	'</div>',
		+	'<div class="clockpicker-am-pm-block">',
		+	'</div>',
		+	'</div>',
		+	'<div class="picker__footer">',
		+	'</div>',
		+	'</div>',
		+	'</div>',
		+	'</div>',
		+	'</div>',
		+	'</div>',
		+	'</div>'
		+	].join('');
		+
		+	// ClockPicker
		+	function ClockPicker(element, options) {
		+	var popover = $(tpl),
		+	plate = popover.find('.clockpicker-plate'),
		+	holder = popover.find('.picker__holder'),
		+	hoursView = popover.find('.clockpicker-hours'),
		+	minutesView = popover.find('.clockpicker-minutes'),
		+	amPmBlock = popover.find('.clockpicker-am-pm-block'),
		+	isInput = element.prop('tagName') === 'INPUT',
		+	input = isInput ? element : element.find('input'),
		+	label = $("label[for=" + input.attr("id") + "]"),
		+	self = this;
		+
		+	this.id = uniqueId('cp');
		+	this.element = element;
		+	this.holder = holder;
		+	this.options = options;
		+	this.isAppended = false;
		+	this.isShown = false;
		+	this.currentView = 'hours';
		+	this.isInput = isInput;
		+	this.input = input;
		+	this.label = label;
		+	this.popover = popover;
		+	this.plate = plate;
		+	this.hoursView = hoursView;
		+	this.minutesView = minutesView;
		+	this.amPmBlock = amPmBlock;
		+	this.spanHours = popover.find('.clockpicker-span-hours');
		+	this.spanMinutes = popover.find('.clockpicker-span-minutes');
		+	this.spanAmPm = popover.find('.clockpicker-span-am-pm');
		+	this.footer = popover.find('.picker__footer');
		+	this.amOrPm = "PM";
		+
		+	// Setup for for 12 hour clock if option is selected
		+	if (options.twelvehour) {
		+	if (!options.ampmclickable) {
		+	this.spanAmPm.empty();
		+	$('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
		+	$('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
		+	} else {
		+	this.spanAmPm.empty();
		+	$('<div id="click-am">AM</div>').on("click", function () {
		+	self.spanAmPm.children('#click-am').addClass("text-primary");
		+	self.spanAmPm.children('#click-pm').removeClass("text-primary");
		+	self.amOrPm = "AM";
		+	}).appendTo(this.spanAmPm);
		+	$('<div id="click-pm">PM</div>').on("click", function () {
		+	self.spanAmPm.children('#click-pm').addClass("text-primary");
		+	self.spanAmPm.children('#click-am').removeClass("text-primary");
		+	self.amOrPm = 'PM';
		+	}).appendTo(this.spanAmPm);
		+	}
		+	}
		+
		+	// Add buttons to footer
		+	$('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
		+	$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
		+	$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
		+
		+	this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
		+	this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
		+
		+	// Show or toggle
		+	input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
		+
		+	// Build ticks
		+	var tickTpl = $('<div class="clockpicker-tick"></div>'),
		+	i, tick, radian, radius;
		+
		+	// Hours view
		+	if (options.twelvehour) {
		+	for (i = 1; i < 13; i += 1) {
		+	tick = tickTpl.clone();
		+	radian = i / 6 * Math.PI;
		+	radius = outerRadius;
		+	tick.css({
		+	left: dialRadius + Math.sin(radian) * radius - tickRadius,
		+	top: dialRadius - Math.cos(radian) * radius - tickRadius
		+	});
		+	tick.html(i === 0 ? '00' : i);
		+	hoursView.append(tick);
		+	tick.on(mousedownEvent, mousedown);
		+	}
		+	} else {
		+	for (i = 0; i < 24; i += 1) {
		+	tick = tickTpl.clone();
		+	radian = i / 6 * Math.PI;
		+	var inner = i > 0 && i < 13;
		+	radius = inner ? innerRadius : outerRadius;
		+	tick.css({
		+	left: dialRadius + Math.sin(radian) * radius - tickRadius,
		+	top: dialRadius - Math.cos(radian) * radius - tickRadius
		+	});
		+	tick.html(i === 0 ? '00' : i);
		+	hoursView.append(tick);
		+	tick.on(mousedownEvent, mousedown);
		+	}
		+	}
		+
		+	// Minutes view
		+	for (i = 0; i < 60; i += 5) {
		+	tick = tickTpl.clone();
		+	radian = i / 30 * Math.PI;
		+	tick.css({
		+	left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
		+	top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
		+	});
		+	tick.html(leadingZero(i));
		+	minutesView.append(tick);
		+	tick.on(mousedownEvent, mousedown);
		+	}
		+
		+	// Clicking on minutes view space
		+	plate.on(mousedownEvent, function (e) {
		+	if ($(e.target).closest('.clockpicker-tick').length === 0) {
		+	mousedown(e, true);
		+	}
		+	});
		+
		+	// Mousedown or touchstart
		+	function mousedown(e, space) {
		+	var offset = plate.offset(),
		+	isTouch = /^touch/.test(e.type),
		+	x0 = offset.left + dialRadius,
		+	y0 = offset.top + dialRadius,
		+	dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
		+	dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
		+	z = Math.sqrt(dx * dx + dy * dy),
		+	moved = false;
		+
		+	// When clicking on minutes view space, check the mouse position
		+	if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
		+	return;
		+	}
		+	e.preventDefault();
		+
		+	// Set cursor style of body after 200ms
		+	var movingTimer = setTimeout(function () {
		+	self.popover.addClass('clockpicker-moving');
		+	}, 200);
		+
		+	// Clock
		+	self.setHand(dx, dy, !space, true);
		+
		+	// Mousemove on document
		+	$doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
		+	e.preventDefault();
		+	var isTouch = /^touch/.test(e.type),
		+	x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
		+	y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
		+	if (!moved && x === dx && y === dy) {
		+	// Clicking in chrome on windows will trigger a mousemove event
		+	return;
		+	}
		+	moved = true;
		+	self.setHand(x, y, false, true);
		+	});
		+
		+	// Mouseup on document
		+	$doc.off(mouseupEvent).on(mouseupEvent, function (e) {
		+	$doc.off(mouseupEvent);
		+	e.preventDefault();
		+	var isTouch = /^touch/.test(e.type),
		+	x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
		+	y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
		+	if ((space || moved) && x === dx && y === dy) {
		+	self.setHand(x, y);
		+	}
		+
		+	if (self.currentView === 'hours') {
		+	self.toggleView('minutes', duration / 2);
		+	} else if (options.autoclose) {
		+	self.minutesView.addClass('clockpicker-dial-out');
		+	setTimeout(function () {
		+	self.done();
		+	}, duration / 2);
		+	}
		+	plate.prepend(canvas);
		+
		+	// Reset cursor style of body
		+	clearTimeout(movingTimer);
		+	self.popover.removeClass('clockpicker-moving');
		+
		+	// Unbind mousemove event
		+	$doc.off(mousemoveEvent);
		+	});
		+	}
		+
		+	if (svgSupported) {
		+	// Draw clock hands and others
		+	var canvas = popover.find('.clockpicker-canvas'),
		+	svg = createSvgElement('svg');
		+	svg.setAttribute('class', 'clockpicker-svg');
		+	svg.setAttribute('width', diameter);
		+	svg.setAttribute('height', diameter);
		+	var g = createSvgElement('g');
		+	g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
		+	var bearing = createSvgElement('circle');
		+	bearing.setAttribute('class', 'clockpicker-canvas-bearing');
		+	bearing.setAttribute('cx', 0);
		+	bearing.setAttribute('cy', 0);
		+	bearing.setAttribute('r', 4);
		+	var hand = createSvgElement('line');
		+	hand.setAttribute('x1', 0);
		+	hand.setAttribute('y1', 0);
		+	var bg = createSvgElement('circle');
		+	bg.setAttribute('class', 'clockpicker-canvas-bg');
		+	bg.setAttribute('r', tickRadius);
		+	g.appendChild(hand);
		+	g.appendChild(bg);
		+	g.appendChild(bearing);
		+	svg.appendChild(g);
		+	canvas.append(svg);
		+
		+	this.hand = hand;
		+	this.bg = bg;
		+	this.bearing = bearing;
		+	this.g = g;
		+	this.canvas = canvas;
		+	}
		+
		+	raiseCallback(this.options.init);
		+	}
		+
		+	function raiseCallback(callbackFunction) {
		+	if (callbackFunction && typeof callbackFunction === "function")
		+	callbackFunction();
		+	}
		+
		+	// Default options
		+	ClockPicker.DEFAULTS = {
		+	'default': '', // default time, 'now' or '13:14' e.g.
		+	fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
		+	donetext: 'Ok', // done button text
		+	cleartext: 'Clear',
		+	canceltext: 'Cancel',
		+	autoclose: false, // auto close when minute is selected
		+	ampmclickable: true, // set am/pm button on itself
		+	darktheme: false, // set to dark theme
		+	twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
		+	vibrate: true // vibrate the device when dragging clock hand
		+	};
		+
		+	// Show or hide popover
		+	ClockPicker.prototype.toggle = function () {
		+	this[this.isShown ? 'hide' : 'show']();
		+	};
		+
		+	// Set popover position
		+	ClockPicker.prototype.locate = function () {
		+	var element = this.element,
		+	popover = this.popover,
		+	offset = element.offset(),
		+	width = element.outerWidth(),
		+	height = element.outerHeight(),
		+	align = this.options.align,
		+	self = this;
		+
		+	popover.show();
		+	};
		+
		+	// Show popover
		+	ClockPicker.prototype.show = function (e) {
		+	// Not show again
		+	if (this.isShown) {
		+	return;
		+	}
		+	raiseCallback(this.options.beforeShow);
		+	$(':input').each(function () {
		+	$(this).attr('tabindex', -1);
		+	})
		+	var self = this;
		+	// Initialize
		+	this.input.blur();
		+	this.popover.addClass('picker--opened');
		+	this.input.addClass('picker__input picker__input--active');
		+	$(document.body).css('overflow', 'hidden');
		+	// Get the time
		+	var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
		+	if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
		+	if (value[1].indexOf("AM") > 0) {
		+	this.amOrPm = 'AM';
		+	} else {
		+	this.amOrPm = 'PM';
		+	}
		+	value[1] = value[1].replace("AM", "").replace("PM", "");
		+	}
		+	if (value[0] === 'now') {
		+	var now = new Date(+new Date() + this.options.fromnow);
		+	value = [
		+	now.getHours(),
		+	now.getMinutes()
		+	];
		+	}
		+	this.hours = +value[0] || 0;
		+	this.minutes = +value[1] || 0;
		+	this.spanHours.html(this.hours);
		+	this.spanMinutes.html(leadingZero(this.minutes));
		+	if (!this.isAppended) {
		+	// Append popover to body
		+	this.popover.insertAfter(this.input);
		+	if (this.options.twelvehour) {
		+	if (this.amOrPm === 'PM') {
		+	this.spanAmPm.children('#click-pm').addClass("text-primary");
		+	this.spanAmPm.children('#click-am').removeClass("text-primary");
		+	} else {
		+	this.spanAmPm.children('#click-am').addClass("text-primary");
		+	this.spanAmPm.children('#click-pm').removeClass("text-primary");
		+	}
		+	}
		+	// Reset position when resize
		+	$win.on('resize.clockpicker' + this.id, function () {
		+	if (self.isShown) {
		+	self.locate();
		+	}
		+	});
		+	this.isAppended = true;
		+	}
		+	// Toggle to hours view
		+	this.toggleView('hours');
		+	// Set position
		+	this.locate();
		+	this.isShown = true;
		+	// Hide when clicking or tabbing on any element except the clock and input
		+	$doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
		+	var target = $(e.target);
		+	if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
		+	self.hide();
		+	}
		+	});
		+	// Hide when ESC is pressed
		+	$doc.on('keyup.clockpicker.' + this.id, function (e) {
		+	if (e.keyCode === 27) {
		+	self.hide();
		+	}
		+	});
		+	raiseCallback(this.options.afterShow);
		+	};
		+	// Hide popover
		+	ClockPicker.prototype.hide = function () {
		+	raiseCallback(this.options.beforeHide);
		+	this.input.removeClass('picker__input picker__input--active');
		+	this.popover.removeClass('picker--opened');
		+	$(document.body).css('overflow', 'visible');
		+	this.isShown = false;
		+	$(':input').each(function (index) {
		+	$(this).attr('tabindex', index + 1);
		+	});
		+	// Unbinding events on document
		+	$doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
		+	$doc.off('keyup.clockpicker.' + this.id);
		+	this.popover.hide();
		+	raiseCallback(this.options.afterHide);
		+	};
		+	// Toggle to hours or minutes view
		+	ClockPicker.prototype.toggleView = function (view, delay) {
		+	var raiseAfterHourSelect = false;
		+	if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
		+	raiseCallback(this.options.beforeHourSelect);
		+	raiseAfterHourSelect = true;
		+	}
		+	var isHours = view === 'hours',
		+	nextView = isHours ? this.hoursView : this.minutesView,
		+	hideView = isHours ? this.minutesView : this.hoursView;
		+	this.currentView = view;
		+
		+	this.spanHours.toggleClass('text-primary', isHours);
		+	this.spanMinutes.toggleClass('text-primary', !isHours);
		+
		+	// Let's make transitions
		+	hideView.addClass('clockpicker-dial-out');
		+	nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
		+
		+	// Reset clock hand
		+	this.resetClock(delay);
		+
		+	// After transitions ended
		+	clearTimeout(this.toggleViewTimer);
		+	this.toggleViewTimer = setTimeout(function () {
		+	hideView.css('visibility', 'hidden');
		+	}, duration);
		+
		+	if (raiseAfterHourSelect) {
		+	raiseCallback(this.options.afterHourSelect);
		+	}
		+	};
		+
		+	// Reset clock hand
		+	ClockPicker.prototype.resetClock = function (delay) {
		+	var view = this.currentView,
		+	value = this[view],
		+	isHours = view === 'hours',
		+	unit = Math.PI / (isHours ? 6 : 30),
		+	radian = value * unit,
		+	radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
		+	x = Math.sin(radian) * radius,
		+	y = -Math.cos(radian) * radius,
		+	self = this;
		+
		+	if (svgSupported && delay) {
		+	self.canvas.addClass('clockpicker-canvas-out');
		+	setTimeout(function () {
		+	self.canvas.removeClass('clockpicker-canvas-out');
		+	self.setHand(x, y);
		+	}, delay);
		+	} else
		+	this.setHand(x, y);
		+	};
		+
		+	// Set clock hand to (x, y)
		+	ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
		+	var radian = Math.atan2(x, -y),
		+	isHours = this.currentView === 'hours',
		+	unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
		+	z = Math.sqrt(x * x + y * y),
		+	options = this.options,
		+	inner = isHours && z < (outerRadius + innerRadius) / 2,
		+	radius = inner ? innerRadius : outerRadius,
		+	value;
		+
		+	if (options.twelvehour) {
		+	radius = outerRadius;
		+	}
		+
		+	// Radian should in range [0, 2PI]
		+	if (radian < 0) {
		+	radian = Math.PI * 2 + radian;
		+	}
		+
		+	// Get the round value
		+	value = Math.round(radian / unit);
		+
		+	// Get the round radian
		+	radian = value * unit;
		+
		+	// Correct the hours or minutes
		+	if (options.twelvehour) {
		+	if (isHours) {
		+	if (value === 0)
		+	value = 12;
		+	} else {
		+	if (roundBy5)
		+	value *= 5;
		+	if (value === 60)
		+	value = 0;
		+	}
		+	} else {
		+	if (isHours) {
		+	if (value === 12)
		+	value = 0;
		+	value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
		+	} else {
		+	if (roundBy5)
		+	value *= 5;
		+	if (value === 60)
		+	value = 0;
		+	}
		+	}
		+
		+	// Once hours or minutes changed, vibrate the device
		+	if (this[this.currentView] !== value) {
		+	if (vibrate && this.options.vibrate) {
		+	// Do not vibrate too frequently
		+	if (!this.vibrateTimer) {
		+	navigator[vibrate](10);
		+	this.vibrateTimer = setTimeout($.proxy(function () {
		+	this.vibrateTimer = null;
		+	}, this), 100);
		+	}
		+	}
		+	}
		+
		+	this[this.currentView] = value;
		+	if (isHours) {
		+	this['spanHours'].html(value);
		+	} else {
		+	this['spanMinutes'].html(leadingZero(value));
		+	}
		+
		+	// If svg is not supported, just add an active class to the tick
		+	if (!svgSupported) {
		+	this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
		+	var tick = $(this);
		+	tick.toggleClass('active', value === +tick.html());
		+	});
		+	return;
		+	}
		+
		+	// Set clock hand and others' position
		+	var cx1 = Math.sin(radian) * (radius - tickRadius),
		+	cy1 = -Math.cos(radian) * (radius - tickRadius),
		+	cx2 = Math.sin(radian) * radius,
		+	cy2 = -Math.cos(radian) * radius;
		+	this.hand.setAttribute('x2', cx1);
		+	this.hand.setAttribute('y2', cy1);
		+	this.bg.setAttribute('cx', cx2);
		+	this.bg.setAttribute('cy', cy2);
		+	};
		+
		+	// Hours and minutes are selected
		+	ClockPicker.prototype.done = function () {
		+	raiseCallback(this.options.beforeDone);
		+	this.hide();
		+	this.label.addClass('active');
		+
		+	var last = this.input.prop('value'),
		+	value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
		+	if (this.options.twelvehour) {
		+	value = value + this.amOrPm;
		+	}
		+
		+	this.input.prop('value', value);
		+	if (value !== last) {
		+	this.input.triggerHandler('change');
		+	if (!this.isInput) {
		+	this.element.trigger('change');
		+	}
		+	}
		+
		+	if (this.options.autoclose)
		+	this.input.trigger('blur');
		+
		+	raiseCallback(this.options.afterDone);
		+	};
		+
		+	// Clear input field
		+	ClockPicker.prototype.clear = function () {
		+	this.hide();
		+	this.label.removeClass('active');
		+
		+	var last = this.input.prop('value'),
		+	value = '';
		+
		+	this.input.prop('value', value);
		+	if (value !== last) {
		+	this.input.triggerHandler('change');
		+	if (!this.isInput) {
		+	this.element.trigger('change');
		+	}
		+	}
		+
		+	if (this.options.autoclose) {
		+	this.input.trigger('blur');
		+	}
		+	};
		+
		+	// Remove clockpicker from input
		+	ClockPicker.prototype.remove = function () {
		+	this.element.removeData('clockpicker');
		+	this.input.off('focus.clockpicker click.clockpicker');
		+	if (this.isShown) {
		+	this.hide();
		+	}
		+	if (this.isAppended) {
		+	$win.off('resize.clockpicker' + this.id);
		+	this.popover.remove();
		+	}
		+	};
		+
		+	// Extends $.fn.clockpicker
		+	$.fn.pickatime = function (option) {
		+	var args = Array.prototype.slice.call(arguments, 1);
		+	return this.each(function () {
		+	var $this = $(this),
		+	data = $this.data('clockpicker');
		+	if (!data) {
		+	var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
		+	$this.data('clockpicker', new ClockPicker($this, options));
		+	} else {
		+	// Manual operatsions. show, hide, remove, e.g.
		+	if (typeof data[option] === 'function') {
		+	data[option].apply(data, args);
		+	}
		+	}
		+	});
		+	};
		+	}());;
		+	(function ($) {
		+
		+	$.fn.characterCounter = function () {
		+	return this.each(function () {
		+	var $input = $(this);
		+	var $counterElement = $input.parent().find('span[class="character-counter"]');
		+
		+	// character counter has already been added appended to the parent container
		+	if ($counterElement.length) {
		+	return;
		+	}
		+
		+	var itHasLengthAttribute = $input.attr('data-length') !== undefined;
		+
		+	if (itHasLengthAttribute) {
		+	$input.on('input', updateCounter);
		+	$input.on('focus', updateCounter);
		+	$input.on('blur', removeCounterElement);
		+
		+	addCounterElement($input);
		+	}
		+
		+	});
		+	};
		+
		+	function updateCounter() {
		+	var maxLength = +$(this).attr('data-length'),
		+	actualLength = +$(this).val().length,
		+	isValidLength = actualLength <= maxLength;
		+
		+	$(this).parent().find('span[class="character-counter"]')
		+	.html(actualLength + '/' + maxLength);
		+
		+	addInputStyle(isValidLength, $(this));
		+	}
		+
		+	function addCounterElement($input) {
		+	var $counterElement = $input.parent().find('span[class="character-counter"]');
		+
		+	if ($counterElement.length) {
		+	return;
		+	}
		+
		+	$counterElement = $('<span/>')
		+	.addClass('character-counter')
		+	.css('float', 'right')
		+	.css('font-size', '12px')
		+	.css('height', 1);
		+
		+	$input.parent().append($counterElement);
		+	}
		+
		+	function removeCounterElement() {
		+	$(this).parent().find('span[class="character-counter"]').html('');
		+	}
		+
		+	function addInputStyle(isValidLength, $input) {
		+	var inputHasInvalidClass = $input.hasClass('invalid');
		+	if (isValidLength && inputHasInvalidClass) {
		+	$input.removeClass('invalid');
		+	} else if (!isValidLength && !inputHasInvalidClass) {
		+	$input.removeClass('valid');
		+	$input.addClass('invalid');
		+	}
		+	}
		+
		+	$(document).ready(function () {
		+	$('input, textarea').characterCounter();
		+	});
		+
		+	}(jQuery));;
		+	(function ($) {
		+
		+	var methods = {
		+
		+	init: function (options) {
		+	var defaults = {
		+	duration: 200, // ms
		+	dist: -100, // zoom scale TODO: make this more intuitive as an option
		+	shift: 0, // spacing for center image
		+	padding: 0, // Padding between non center items
		+	fullWidth: false, // Change to full width styles
		+	indicators: false, // Toggle indicators
		+	noWrap: false, // Don't wrap around and cycle through items.
		+	onCycleTo: null // Callback for when a new slide is cycled to.
		+	};
		+	options = $.extend(defaults, options);
		+	var namespace = Materialize.objectSelectorString($(this));
		+
		+	return this.each(function (i) {
		+
		+	var uniqueNamespace = namespace + i;
		+	var images, item_width, item_height, offset, center, pressed, dim, count,
		+	reference, referenceY, amplitude, target, velocity, scrolling,
		+	xform, frame, timestamp, ticker, dragged, vertical_dragged;
		+	var $indicators = $('<ul class="indicators"></ul>');
		+	var scrollingTimeout = null;
		+	var oneTimeCallback = null;
		+
		+
		+	// Initialize
		+	var view = $(this);
		+	var showIndicators = view.attr('data-indicators') || options.indicators;
		+
		+
		+	// Options
		+	var setCarouselHeight = function () {
		+	var firstImage = view.find('.carousel-item img').first();
		+	if (firstImage.length) {
		+	if (firstImage.prop('complete')) {
		+	view.css('height', firstImage.height());
		+	} else {
		+	firstImage.on('load', function () {
		+	view.css('height', $(this).height());
		+	});
		+	}
		+	} else {
		+	var imageHeight = view.find('.carousel-item').first().height();
		+	view.css('height', imageHeight);
		+	}
		+	};
		+
		+	if (options.fullWidth) {
		+	options.dist = 0;
		+	setCarouselHeight();
		+
		+	// Offset fixed items when indicators.
		+	if (showIndicators) {
		+	view.find('.carousel-fixed-item').addClass('with-indicators');
		+	}
		+	}
		+
		+
		+	// Don't double initialize.
		+	if (view.hasClass('initialized')) {
		+	// Recalculate variables
		+	$(window).trigger('resize');
		+
		+	// Redraw carousel.
		+	$(this).trigger('carouselNext', [0.000001]);
		+	return true;
		+	}
		+
		+
		+	view.addClass('initialized');
		+	pressed = false;
		+	offset = target = 0;
		+	images = [];
		+	item_width = view.find('.carousel-item').first().innerWidth();
		+	item_height = view.find('.carousel-item').first().innerHeight();
		+	dim = item_width * 2 + options.padding;
		+
		+	view.find('.carousel-item').each(function (i) {
		+	images.push($(this)[0]);
		+	if (showIndicators) {
		+	var $indicator = $('<li class="indicator-item"></li>');
		+
		+	// Add active to first by default.
		+	if (i === 0) {
		+	$indicator.addClass('active');
		+	}
		+
		+	// Handle clicks on indicators.
		+	$indicator.click(function (e) {
		+	e.stopPropagation();
		+
		+	var index = $(this).index();
		+	cycleTo(index);
		+	});
		+	$indicators.append($indicator);
		+	}
		+	});
		+
		+	if (showIndicators) {
		+	view.append($indicators);
		+	}
		+	count = images.length;
		+
		+
		+	function setupEvents() {
		+	if (typeof window.ontouchstart !== 'undefined') {
		+	view[0].addEventListener('touchstart', tap);
		+	view[0].addEventListener('touchmove', drag);
		+	view[0].addEventListener('touchend', release);
		+	}
		+	view[0].addEventListener('mousedown', tap);
		+	view[0].addEventListener('mousemove', drag);
		+	view[0].addEventListener('mouseup', release);
		+	view[0].addEventListener('mouseleave', release);
		+	view[0].addEventListener('click', click);
		+	}
		+
		+	function xpos(e) {
		+	// touch event
		+	if (e.targetTouches && (e.targetTouches.length >= 1)) {
		+	return e.targetTouches[0].clientX;
		+	}
		+
		+	// mouse event
		+	return e.clientX;
		+	}
		+
		+	function ypos(e) {
		+	// touch event
		+	if (e.targetTouches && (e.targetTouches.length >= 1)) {
		+	return e.targetTouches[0].clientY;
		+	}
		+
		+	// mouse event
		+	return e.clientY;
		+	}
		+
		+	function wrap(x) {
		+	return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
		+	}
		+
		+	function scroll(x) {
		+	// Track scrolling state
		+	scrolling = true;
		+	if (!view.hasClass('scrolling')) {
		+	view.addClass('scrolling');
		+	}
		+	if (scrollingTimeout != null) {
		+	window.clearTimeout(scrollingTimeout);
		+	}
		+	scrollingTimeout = window.setTimeout(function () {
		+	scrolling = false;
		+	view.removeClass('scrolling');
		+	}, options.duration);
		+
		+	// Start actual scroll
		+	var i, half, delta, dir, tween, el, alignment, xTranslation;
		+	var lastCenter = center;
		+
		+	offset = (typeof x === 'number') ? x : offset;
		+	center = Math.floor((offset + dim / 2) / dim);
		+	delta = offset - center * dim;
		+	dir = (delta < 0) ? 1 : -1;
		+	tween = -dir * delta * 2 / dim;
		+	half = count >> 1;
		+
		+	if (!options.fullWidth) {
		+	alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
		+	alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
		+	} else {
		+	alignment = 'translateX(0)';
		+	}
		+
		+	// Set indicator active
		+	if (showIndicators) {
		+	var diff = (center % count);
		+	var activeIndicator = $indicators.find('.indicator-item.active');
		+	if (activeIndicator.index() !== diff) {
		+	activeIndicator.removeClass('active');
		+	$indicators.find('.indicator-item').eq(diff).addClass('active');
		+	}
		+	}
		+
		+	// center
		+	// Don't show wrapped items.
		+	if (!options.noWrap || (center >= 0 && center < count)) {
		+	el = images[wrap(center)];
		+
		+	// Add active class to center item.
		+	if (!$(el).hasClass('active')) {
		+	view.find('.carousel-item').removeClass('active');
		+	$(el).addClass('active');
		+	}
		+	el.style[xform] = alignment +
		+	' translateX(' + (-delta / 2) + 'px)' +
		+	' translateX(' + (dir * options.shift * tween * i) + 'px)' +
		+	' translateZ(' + (options.dist * tween) + 'px)';
		+	el.style.zIndex = 0;
		+	if (options.fullWidth) {
		+	tweenedOpacity = 1;
		+	} else {
		+	tweenedOpacity = 1 - 0.2 * tween;
		+	}
		+	el.style.opacity = tweenedOpacity;
		+	el.style.display = 'block';
		+	}
		+
		+	for (i = 1; i <= half; ++i) {
		+	// right side
		+	if (options.fullWidth) {
		+	zTranslation = options.dist;
		+	tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
		+	} else {
		+	zTranslation = options.dist * (i * 2 + tween * dir);
		+	tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
		+	}
		+	// Don't show wrapped items.
		+	if (!options.noWrap || center + i < count) {
		+	el = images[wrap(center + i)];
		+	el.style[xform] = alignment +
		+	' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
		+	' translateZ(' + zTranslation + 'px)';
		+	el.style.zIndex = -i;
		+	el.style.opacity = tweenedOpacity;
		+	el.style.display = 'block';
		+	}
		+
		+
		+	// left side
		+	if (options.fullWidth) {
		+	zTranslation = options.dist;
		+	tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
		+	} else {
		+	zTranslation = options.dist * (i * 2 - tween * dir);
		+	tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
		+	}
		+	// Don't show wrapped items.
		+	if (!options.noWrap || center - i >= 0) {
		+	el = images[wrap(center - i)];
		+	el.style[xform] = alignment +
		+	' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
		+	' translateZ(' + zTranslation + 'px)';
		+	el.style.zIndex = -i;
		+	el.style.opacity = tweenedOpacity;
		+	el.style.display = 'block';
		+	}
		+	}
		+
		+	// center
		+	// Don't show wrapped items.
		+	if (!options.noWrap || (center >= 0 && center < count)) {
		+	el = images[wrap(center)];
		+	el.style[xform] = alignment +
		+	' translateX(' + (-delta / 2) + 'px)' +
		+	' translateX(' + (dir * options.shift * tween) + 'px)' +
		+	' translateZ(' + (options.dist * tween) + 'px)';
		+	el.style.zIndex = 0;
		+	if (options.fullWidth) {
		+	tweenedOpacity = 1;
		+	} else {
		+	tweenedOpacity = 1 - 0.2 * tween;
		+	}
		+	el.style.opacity = tweenedOpacity;
		+	el.style.display = 'block';
		+	}
		+
		+	// onCycleTo callback
		+	if (lastCenter !== center &&
		+	typeof (options.onCycleTo) === "function") {
		+	var $curr_item = view.find('.carousel-item').eq(wrap(center));
		+	options.onCycleTo.call(this, $curr_item, dragged);
		+	}
		+
		+	// One time callback
		+	if (typeof (oneTimeCallback) === "function") {
		+	oneTimeCallback.call(this, $curr_item, dragged);
		+	oneTimeCallback = null;
		+	}
		+	}
		+
		+	function track() {
		+	var now, elapsed, delta, v;
		+
		+	now = Date.now();
		+	elapsed = now - timestamp;
		+	timestamp = now;
		+	delta = offset - frame;
		+	frame = offset;
		+
		+	v = 1000 * delta / (1 + elapsed);
		+	velocity = 0.8 * v + 0.2 * velocity;
		+	}
		+
		+	function autoScroll() {
		+	var elapsed, delta;
		+
		+	if (amplitude) {
		+	elapsed = Date.now() - timestamp;
		+	delta = amplitude * Math.exp(-elapsed / options.duration);
		+	if (delta > 2 || delta < -2) {
		+	scroll(target - delta);
		+	requestAnimationFrame(autoScroll);
		+	} else {
		+	scroll(target);
		+	}
		+	}
		+	}
		+
		+	function click(e) {
		+	// Disable clicks if carousel was dragged.
		+	if (dragged) {
		+	e.preventDefault();
		+	e.stopPropagation();
		+	return false;
		+
		+	} else if (!options.fullWidth) {
		+	var clickedIndex = $(e.target).closest('.carousel-item').index();
		+	var diff = wrap(center) - clickedIndex;
		+
		+	// Disable clicks if carousel was shifted by click
		+	if (diff !== 0) {
		+	e.preventDefault();
		+	e.stopPropagation();
		+	}
		+	cycleTo(clickedIndex);
		+	}
		+	}
		+
		+	function cycleTo(n) {
		+	var diff = (center % count) - n;
		+
		+	// Account for wraparound.
		+	if (!options.noWrap) {
		+	if (diff < 0) {
		+	if (Math.abs(diff + count) < Math.abs(diff)) {
		+	diff += count;
		+	}
		+
		+	} else if (diff > 0) {
		+	if (Math.abs(diff - count) < diff) {
		+	diff -= count;
		+	}
		+	}
		+	}
		+
		+	// Call prev or next accordingly.
		+	if (diff < 0) {
		+	view.trigger('carouselNext', [Math.abs(diff)]);
		+
		+	} else if (diff > 0) {
		+	view.trigger('carouselPrev', [diff]);
		+	}
		+	}
		+
		+	function tap(e) {
		+	if (e.type === 'mousedown') {
		+	e.preventDefault();
		+	}
		+	pressed = true;
		+	dragged = false;
		+	vertical_dragged = false;
		+	reference = xpos(e);
		+	referenceY = ypos(e);
		+
		+	velocity = amplitude = 0;
		+	frame = offset;
		+	timestamp = Date.now();
		+	clearInterval(ticker);
		+	ticker = setInterval(track, 100);
		+	}
		+
		+	function drag(e) {
		+	var x, delta, deltaY;
		+	if (pressed) {
		+	x = xpos(e);
		+	y = ypos(e);
		+	delta = reference - x;
		+	deltaY = Math.abs(referenceY - y);
		+	if (deltaY < 30 && !vertical_dragged) {
		+	// If vertical scrolling don't allow dragging.
		+	if (delta > 2 || delta < -2) {
		+	dragged = true;
		+	reference = x;
		+	scroll(offset + delta);
		+	}
		+
		+	} else if (dragged) {
		+	// If dragging don't allow vertical scroll.
		+	e.preventDefault();
		+	e.stopPropagation();
		+	return false;
		+
		+	} else {
		+	// Vertical scrolling.
		+	vertical_dragged = true;
		+	}
		+	}
		+
		+	if (dragged) {
		+	// If dragging don't allow vertical scroll.
		+	e.preventDefault();
		+	e.stopPropagation();
		+	return false;
		+	}
		+	}
		+
		+	function release(e) {
		+	if (pressed) {
		+	pressed = false;
		+	} else {
		+	return;
		+	}
		+
		+	clearInterval(ticker);
		+	target = offset;
		+	if (velocity > 10 || velocity < -10) {
		+	amplitude = 0.9 * velocity;
		+	target = offset + amplitude;
		+	}
		+	target = Math.round(target / dim) * dim;
		+
		+	// No wrap of items.
		+	if (options.noWrap) {
		+	if (target >= dim * (count - 1)) {
		+	target = dim * (count - 1);
		+	} else if (target < 0) {
		+	target = 0;
		+	}
		+	}
		+	amplitude = target - offset;
		+	timestamp = Date.now();
		+	requestAnimationFrame(autoScroll);
		+
		+	if (dragged) {
		+	e.preventDefault();
		+	e.stopPropagation();
		+	}
		+	return false;
		+	}
		+
		+	xform = 'transform';
		+	['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
		+	var e = prefix + 'Transform';
		+	if (typeof document.body.style[e] !== 'undefined') {
		+	xform = e;
		+	return false;
		+	}
		+	return true;
		+	});
		+
		+
		+	$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, function () {
		+	if (options.fullWidth) {
		+	item_width = view.find('.carousel-item').first().innerWidth();
		+	item_height = view.find('.carousel-item').first().innerHeight();
		+	dim = item_width * 2 + options.padding;
		+	offset = center * 2 * item_width;
		+	target = offset;
		+	} else {
		+	scroll();
		+	}
		+	});
		+
		+	setupEvents();
		+	scroll(offset);
		+
		+	$(this).on('carouselNext', function (e, n, callback) {
		+	if (n === undefined) {
		+	n = 1;
		+	}
		+	if (typeof (callback) === "function") {
		+	oneTimeCallback = callback;
		+	}
		+
		+	target = (dim * Math.round(offset / dim)) + (dim * n);
		+	if (offset !== target) {
		+	amplitude = target - offset;
		+	timestamp = Date.now();
		+	requestAnimationFrame(autoScroll);
		+	}
		+	});
		+
		+	$(this).on('carouselPrev', function (e, n, callback) {
		+	if (n === undefined) {
		+	n = 1;
		+	}
		+	if (typeof (callback) === "function") {
		+	oneTimeCallback = callback;
		+	}
		+
		+	target = (dim * Math.round(offset / dim)) - (dim * n);
		+	if (offset !== target) {
		+	amplitude = target - offset;
		+	timestamp = Date.now();
		+	requestAnimationFrame(autoScroll);
		+	}
		+	});
		+
		+	$(this).on('carouselSet', function (e, n, callback) {
		+	if (n === undefined) {
		+	n = 0;
		+	}
		+	if (typeof (callback) === "function") {
		+	oneTimeCallback = callback;
		+	}
		+
		+	cycleTo(n);
		+	});
		+
		+	});
		+
		+
		+
		+	},
		+	next: function (n, callback) {
		+	$(this).trigger('carouselNext', [n, callback]);
		+	},
		+	prev: function (n, callback) {
		+	$(this).trigger('carouselPrev', [n, callback]);
		+	},
		+	set: function (n, callback) {
		+	$(this).trigger('carouselSet', [n, callback]);
		+	}
		+	};
		+
		+
		+	$.fn.carousel = function (methodOrOptions) {
		+	if (methods[methodOrOptions]) {
		+	return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
		+	} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
		+	// Default to "init"
		+	return methods.init.apply(this, arguments);
		+	} else {
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
		+	}
		+	}; // Plugin end
		+	}(jQuery));;
		+	(function ($) {
		+
		+	var methods = {
		+	init: function (options) {
		+	return this.each(function () {
		+	var origin = $('#' + $(this).attr('data-activates'));
		+	var screen = $('body');
		+
		+	// Creating tap target
		+	var tapTargetEl = $(this);
		+	var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
		+	var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
		+	var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
		+	var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
		+
		+	// Creating wrapper
		+	if (!tapTargetWrapper.length) {
		+	tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
		+	}
		+
		+	// Creating content
		+	if (!tapTargetContentEl.length) {
		+	tapTargetContentEl = $('<div class="tap-target-content"></div>');
		+	tapTargetEl.append(tapTargetContentEl);
		+	}
		+
		+	// Creating foreground wave
		+	if (!tapTargetWave.length) {
		+	tapTargetWave = $('<div class="tap-target-wave"></div>');
		+
		+	// Creating origin
		+	if (!tapTargetOriginEl.length) {
		+	tapTargetOriginEl = origin.clone(true, true);
		+	tapTargetOriginEl.addClass('tap-target-origin');
		+	tapTargetOriginEl.removeAttr('id');
		+	tapTargetOriginEl.removeAttr('style');
		+	tapTargetWave.append(tapTargetOriginEl);
		+	}
		+
		+	tapTargetWrapper.append(tapTargetWave);
		+	}
		+
		+	// Open
		+	var openTapTarget = function () {
		+	if (tapTargetWrapper.is('.open')) {
		+	return;
		+	}
		+
		+	// Adding open class
		+	tapTargetWrapper.addClass('open');
		+
		+	setTimeout(function () {
		+	tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
		+	closeTapTarget();
		+	tapTargetOriginEl.off('click.tapTarget');
		+	});
		+
		+	$(document).off('click.tapTarget').on('click.tapTarget', function (e) {
		+	closeTapTarget();
		+	$(document).off('click.tapTarget');
		+	});
		+
		+	var throttledCalc = Materialize.throttle(function () {
		+	calculateTapTarget();
		+	}, 200);
		+	$(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
		+	}, 0);
		+	};
		+
		+	// Close
		+	var closeTapTarget = function () {
		+	if (!tapTargetWrapper.is('.open')) {
		+	return;
		+	}
		+
		+	tapTargetWrapper.removeClass('open');
		+	tapTargetOriginEl.off('click.tapTarget')
		+	$(document).off('click.tapTarget');
		+	$(window).off('resize.tapTarget');
		+	};
		+
		+	// Pre calculate
		+	var calculateTapTarget = function () {
		+	// Element or parent is fixed position?
		+	var isFixed = origin.css('position') === 'fixed';
		+	if (!isFixed) {
		+	var parents = origin.parents();
		+	for (var i = 0; i < parents.length; i++) {
		+	isFixed = $(parents[i]).css('position') == 'fixed';
		+	if (isFixed) {
		+	break;
		+	}
		+	}
		+	}
		+
		+	// Calculating origin
		+	var originWidth = origin.outerWidth();
		+	var originHeight = origin.outerHeight();
		+	var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
		+	var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
		+
		+	// Calculating screen
		+	var windowWidth = $(window).width();
		+	var windowHeight = $(window).height();
		+	var centerX = windowWidth / 2;
		+	var centerY = windowHeight / 2;
		+	var isLeft = originLeft <= centerX;
		+	var isRight = originLeft > centerX;
		+	var isTop = originTop <= centerY;
		+	var isBottom = originTop > centerY;
		+	var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
		+	var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
		+
		+	// Calculating tap target
		+	var tapTargetWidth = tapTargetEl.outerWidth();
		+	var tapTargetHeight = tapTargetEl.outerHeight();
		+	var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
		+	var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
		+	var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
		+
		+	// Calculating content
		+	var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
		+	var tapTargetTextHeight = tapTargetHeight / 2;
		+	var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
		+	var tapTargetTextBottom = 0;
		+	var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
		+	var tapTargetTextRight = 0;
		+	var tapTargetTextPadding = originWidth;
		+	var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
		+
		+	// Calculating wave
		+	var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
		+	var tapTargetWaveHeight = tapTargetWaveWidth;
		+	var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
		+	var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
		+
		+	// Setting tap target
		+	var tapTargetWrapperCssObj = {};
		+	tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
		+	tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
		+	tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
		+	tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
		+	tapTargetWrapperCssObj.position = tapTargetPosition;
		+	tapTargetWrapper.css(tapTargetWrapperCssObj);
		+
		+	// Setting content
		+	tapTargetContentEl.css({
		+	width: tapTargetTextWidth,
		+	height: tapTargetTextHeight,
		+	top: tapTargetTextTop,
		+	right: tapTargetTextRight,
		+	bottom: tapTargetTextBottom,
		+	left: tapTargetTextLeft,
		+	padding: tapTargetTextPadding,
		+	verticalAlign: tapTargetTextAlign
		+	});
		+
		+	// Setting wave
		+	tapTargetWave.css({
		+	top: tapTargetWaveTop,
		+	left: tapTargetWaveLeft,
		+	width: tapTargetWaveWidth,
		+	height: tapTargetWaveHeight
		+	});
		+	}
		+
		+	if (options == 'open') {
		+	calculateTapTarget();
		+	openTapTarget();
		+	}
		+
		+	if (options == 'close')
		+	closeTapTarget();
		+	});
		+	},
		+	open: function () {},
		+	close: function () {}
		+	};
		+
		+	$.fn.tapTarget = function (methodOrOptions) {
		+	if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
		+	return methods.init.apply(this, arguments);
		+
		+	$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
		+	};
		+
		+	}(jQuery));

---

Revision as of 22:43, 29 June 2017

/*!

* Materialize v0.99.0 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/

// Check for jQuery. if (typeof (jQuery) === 'undefined') {

   var jQuery;
   // Check if require is a defined function.
   if (typeof (require) === 'function') {
       jQuery = $ = require('jquery');
       // Else use the dollar sign alias.
   } else {
       jQuery = $;
   }

}; /*

* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
* Open source under the BSD License.
* Copyright © 2008 George McGinley Smith
* All rights reserved.
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
*/

(function (factory) {

   if (typeof define === "function" && define.amd) {
       define(['jquery'], function ($) {
           return factory($);
       });
   } else if (typeof module === "object" && typeof module.exports === "object") {
       exports = factory(require('jquery'));
   } else {
       factory(jQuery);
   }

})(function ($) {

   // Preserve the original jQuery "swing" easing as "jswing"
   $.easing['jswing'] = $.easing['swing'];

   var pow = Math.pow,
       sqrt = Math.sqrt,
       sin = Math.sin,
       cos = Math.cos,
       PI = Math.PI,
       c1 = 1.70158,
       c2 = c1 * 1.525,
       c3 = c1 + 1,
       c4 = (2 * PI) / 3,
       c5 = (2 * PI) / 4.5;

   // x is the fraction of animation progress, in the range 0..1
   function bounceOut(x) {
       var n1 = 7.5625,
           d1 = 2.75;
       if (x < 1 / d1) {
           return n1 * x * x;
       } else if (x < 2 / d1) {
           return n1 * (x -= (1.5 / d1)) * x + .75;
       } else if (x < 2.5 / d1) {
           return n1 * (x -= (2.25 / d1)) * x + .9375;
       } else {
           return n1 * (x -= (2.625 / d1)) * x + .984375;
       }
   }

   $.extend($.easing, {
       def: 'easeOutQuad',
       swing: function (x) {
           return $.easing[$.easing.def](x);
       },
       easeInQuad: function (x) {
           return x * x;
       },
       easeOutQuad: function (x) {
           return 1 - (1 - x) * (1 - x);
       },
       easeInOutQuad: function (x) {
           return x < 0.5 ?
               2 * x * x :
               1 - pow(-2 * x + 2, 2) / 2;
       },
       easeInCubic: function (x) {
           return x * x * x;
       },
       easeOutCubic: function (x) {
           return 1 - pow(1 - x, 3);
       },
       easeInOutCubic: function (x) {
           return x < 0.5 ?
               4 * x * x * x :
               1 - pow(-2 * x + 2, 3) / 2;
       },
       easeInQuart: function (x) {
           return x * x * x * x;
       },
       easeOutQuart: function (x) {
           return 1 - pow(1 - x, 4);
       },
       easeInOutQuart: function (x) {
           return x < 0.5 ?
               8 * x * x * x * x :
               1 - pow(-2 * x + 2, 4) / 2;
       },
       easeInQuint: function (x) {
           return x * x * x * x * x;
       },
       easeOutQuint: function (x) {
           return 1 - pow(1 - x, 5);
       },
       easeInOutQuint: function (x) {
           return x < 0.5 ?
               16 * x * x * x * x * x :
               1 - pow(-2 * x + 2, 5) / 2;
       },
       easeInSine: function (x) {
           return 1 - cos(x * PI / 2);
       },
       easeOutSine: function (x) {
           return sin(x * PI / 2);
       },
       easeInOutSine: function (x) {
           return -(cos(PI * x) - 1) / 2;
       },
       easeInExpo: function (x) {
           return x === 0 ? 0 : pow(2, 10 * x - 10);
       },
       easeOutExpo: function (x) {
           return x === 1 ? 1 : 1 - pow(2, -10 * x);
       },
       easeInOutExpo: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
               pow(2, 20 * x - 10) / 2 :
               (2 - pow(2, -20 * x + 10)) / 2;
       },
       easeInCirc: function (x) {
           return 1 - sqrt(1 - pow(x, 2));
       },
       easeOutCirc: function (x) {
           return sqrt(1 - pow(x - 1, 2));
       },
       easeInOutCirc: function (x) {
           return x < 0.5 ?
               (1 - sqrt(1 - pow(2 * x, 2))) / 2 :
               (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
       },
       easeInElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 :
               -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
       },
       easeOutElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 :
               pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
       },
       easeInOutElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
               -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 :
               pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
       },
       easeInBack: function (x) {
           return c3 * x * x * x - c1 * x * x;
       },
       easeOutBack: function (x) {
           return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
       },
       easeInOutBack: function (x) {
           return x < 0.5 ?
               (pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 :
               (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
       },
       easeInBounce: function (x) {
           return 1 - bounceOut(1 - x);
       },
       easeOutBounce: bounceOut,
       easeInOutBounce: function (x) {
           return x < 0.5 ?
               (1 - bounceOut(1 - 2 * x)) / 2 :
               (1 + bounceOut(2 * x - 1)) / 2;
       }
   });

});; // Custom Easing jQuery.extend(jQuery.easing, {

   easeInOutMaterial: function (x, t, b, c, d) {
       if ((t /= d / 2) < 1) return c / 2 * t * t + b;
       return c / 4 * ((t -= 2) * t * t + 2) + b;
   }

});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (! function (e) {

   function t(e) {
       var t = e.length,
           a = r.type(e);
       return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e
   }
   if (!e.jQuery) {
       var r = function (e, t) {
           return new r.fn.init(e, t)
       };
       r.isWindow = function (e) {
           return null != e && e == e.window
       }, r.type = function (e) {
           return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e
       }, r.isArray = Array.isArray || function (e) {
           return "array" === r.type(e)
       }, r.isPlainObject = function (e) {
           var t;
           if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;
           try {
               if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1
           } catch (a) {
               return !1
           }
           for (t in e);
           return void 0 === t || o.call(e, t)
       }, r.each = function (e, r, a) {
           var n, o = 0,
               i = e.length,
               s = t(e);
           if (a) {
               if (s)
                   for (; i > o && (n = r.apply(e[o], a), n !== !1); o++);
               else
                   for (o in e)
                       if (n = r.apply(e[o], a), n === !1) break
           } else if (s)
               for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++);
           else
               for (o in e)
                   if (n = r.call(e[o], o, e[o]), n === !1) break; return e
       }, r.data = function (e, t, n) {
           if (void 0 === n) {
               var o = e[r.expando],
                   i = o && a[o];
               if (void 0 === t) return i;
               if (i && t in i) return i[t]
           } else if (void 0 !== t) {
               var o = e[r.expando] || (e[r.expando] = ++r.uuid);
               return a[o] = a[o] || {}, a[o][t] = n, n
           }
       }, r.removeData = function (e, t) {
           var n = e[r.expando],
               o = n && a[n];
           o && r.each(t, function (e, t) {
               delete o[t]
           })
       }, r.extend = function () {
           var e, t, a, n, o, i, s = arguments[0] || {},
               l = 1,
               u = arguments.length,
               c = !1;
           for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++)
               if (null != (o = arguments[l]))
                   for (n in o) e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
           return s
       }, r.queue = function (e, a, n) {
           function o(e, r) {
               var a = r || [];
               return null != e && (t(Object(e)) ? ! function (e, t) {
                   for (var r = +t.length, a = 0, n = e.length; r > a;) e[n++] = t[a++];
                   if (r !== r)
                       for (; void 0 !== t[a];) e[n++] = t[a++];
                   return e.length = n, e
               }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a
           }
           if (e) {
               a = (a || "fx") + "queue";
               var i = r.data(e, a);
               return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []
           }
       }, r.dequeue = function (e, t) {
           r.each(e.nodeType ? [e] : e, function (e, a) {
               t = t || "fx";
               var n = r.queue(a, t),
                   o = n.shift();
               "inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
                   r.dequeue(a, t)
               }))
           })
       }, r.fn = r.prototype = {
           init: function (e) {
               if (e.nodeType) return this[0] = e, this;
               throw new Error("Not a DOM node.")
           },
           offset: function () {
               var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : {
                   top: 0,
                   left: 0
               };
               return {
                   top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0),
                   left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0)
               }
           },
           position: function () {
               function e() {
                   for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) e = e.offsetParent;
                   return e || document
               }
               var t = this[0],
                   e = e.apply(t),
                   a = this.offset(),
                   n = /^(?:body|html)$/i.test(e.nodeName) ? {
                       top: 0,
                       left: 0
                   } : r(e).offset();
               return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), {
                   top: a.top - n.top,
                   left: a.left - n.left
               }
           }
       };
       var a = {};
       r.expando = "velocity" + (new Date).getTime(), r.uuid = 0;
       for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) n["[object " + s[l] + "]"] = s[l].toLowerCase();
       r.fn.init.prototype = r.fn, e.Velocity = {
           Utilities: r
       }
   }

}(window), function (e) {

   "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e()

}(function () {

   return function (e, t, r, a) {
       function n(e) {
           for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
               var n = e[t];
               n && a.push(n)
           }
           return a
       }

       function o(e) {
           return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e
       }

       function i(e) {
           var t = f.data(e, "velocity");
           return null === t ? a : t
       }

       function s(e) {
           return function (t) {
               return Math.round(t * e) * (1 / e)
           }
       }

       function l(e, r, a, n) {
           function o(e, t) {
               return 1 - 3 * t + 3 * e
           }

           function i(e, t) {
               return 3 * t - 6 * e
           }

           function s(e) {
               return 3 * e
           }

           function l(e, t, r) {
               return ((o(t, r) * e + i(t, r)) * e + s(t)) * e
           }

           function u(e, t, r) {
               return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t)
           }

           function c(t, r) {
               for (var n = 0; m > n; ++n) {
                   var o = u(r, e, a);
                   if (0 === o) return r;
                   var i = l(r, e, a) - t;
                   r -= i / o
               }
               return r
           }

           function p() {
               for (var t = 0; b > t; ++t) w[t] = l(t * x, e, a)
           }

           function f(t, r, n) {
               var o, i, s = 0;
               do i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; while (Math.abs(o) > h && ++s < v);
               return i
           }

           function d(t) {
               for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) r += x;
               --n;
               var i = (t - w[n]) / (w[n + 1] - w[n]),
                   s = r + i * x,
                   l = u(s, e, a);
               return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x)
           }

           function g() {
               V = !0, (e != r || a != n) && p()
           }
           var m = 4,
               y = .001,
               h = 1e-7,
               v = 10,
               b = 11,
               x = 1 / (b - 1),
               S = "Float32Array" in t;
           if (4 !== arguments.length) return !1;
           for (var P = 0; 4 > P; ++P)
               if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
           e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);
           var w = S ? new Float32Array(b) : new Array(b),
               V = !1,
               C = function (t) {
                   return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n)
               };
           C.getControlPoints = function () {
               return [{
                   x: e,
                   y: r
               }, {
                   x: a,
                   y: n
               }]
           };
           var T = "generateBezier(" + [e, r, a, n] + ")";
           return C.toString = function () {
               return T
           }, C
       }

       function u(e, t) {
           var r = e;
           return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r
       }

       function c(e) {
           if (e) {
               var t = (new Date).getTime(),
                   r = b.State.calls.length;
               r > 1e4 && (b.State.calls = n(b.State.calls));
               for (var o = 0; r > o; o++)
                   if (b.State.calls[o]) {
                       var s = b.State.calls[o],
                           l = s[0],
                           u = s[2],
                           d = s[3],
                           g = !!d,
                           y = null;
                       d || (d = b.State.calls[o][3] = t - 16);
                       for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
                           var P = l[v],
                               V = P.element;
                           if (i(V)) {
                               var C = !1;
                               if (u.display !== a && null !== u.display && "none" !== u.display) {
                                   if ("flex" === u.display) {
                                       var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];
                                       f.each(T, function (e, t) {
                                           S.setPropertyValue(V, "display", t)
                                       })
                                   }
                                   S.setPropertyValue(V, "display", u.display)
                               }
                               u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);
                               for (var k in P)
                                   if ("element" !== k) {
                                       var A, F = P[k],
                                           j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;
                                       if (1 === h) A = F.endValue;
                                       else {
                                           var E = F.endValue - F.startValue;
                                           if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue
                                       }
                                       if (F.currentValue = A, "tween" === k) y = A;
                                       else {
                                           if (S.Hooks.registered[k]) {
                                               var H = S.Hooks.getRoot(k),
                                                   N = i(V).rootPropertyValueCache[H];
                                               N && (F.rootPropertyValue = N)
                                           }
                                           var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);
                                           S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0)
                                       }
                                   }
                               u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V)
                           }
                       }
                       u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o)
                   }
           }
           b.State.isTicking && w(c)
       }

       function p(e, t) {
           if (!b.State.calls[e]) return !1;
           for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
               var p = r[u].element;
               if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
                   i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};
                   var d = !1;
                   f.each(S.Lists.transforms3D, function (e, t) {
                       var r = /^scale/.test(t) ? 1 : 0,
                           n = i(p).transformCache[t];
                       i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t])
                   }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating")
               }
               if (!t && o.complete && !o.loop && u === c - 1) try {
                   o.complete.call(n, n)
               } catch (g) {
                   setTimeout(function () {
                       throw g
                   }, 1)
               }
               s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
                   /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100)
               }), b(p, "reverse", {
                   loop: !0,
                   delay: o.delay
               })), o.queue !== !1 && f.dequeue(p, o.queue)
           }
           b.State.calls[e] = !1;
           for (var m = 0, y = b.State.calls.length; y > m; m++)
               if (b.State.calls[m] !== !1) {
                   l = !0;
                   break
               }
           l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = [])
       }
       var f, d = function () {
               if (r.documentMode) return r.documentMode;
               for (var e = 7; e > 4; e--) {
                   var t = r.createElement("div");
                   if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e
               }
               return a
           }(),
           g = function () {
               var e = 0;
               return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
                   var r, a = (new Date).getTime();
                   return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
                       t(a + r)
                   }, r)
               }
           }(),
           m = {
               isString: function (e) {
                   return "string" == typeof e
               },
               isArray: Array.isArray || function (e) {
                   return "[object Array]" === Object.prototype.toString.call(e)
               },
               isFunction: function (e) {
                   return "[object Function]" === Object.prototype.toString.call(e)
               },
               isNode: function (e) {
                   return e && e.nodeType
               },
               isNodeList: function (e) {
                   return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0)
               },
               isWrapped: function (e) {
                   return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e))
               },
               isSVG: function (e) {
                   return t.SVGElement && e instanceof t.SVGElement
               },
               isEmptyObject: function (e) {
                   for (var t in e) return !1;
                   return !0
               }
           },
           y = !1;
       if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");
       if (7 >= d) return void(jQuery.fn.velocity = jQuery.fn.animate);
       var h = 400,
           v = "swing",
           b = {
               State: {
                   isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
                   isAndroid: /Android/i.test(navigator.userAgent),
                   isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent),
                   isChrome: t.chrome,
                   isFirefox: /Firefox/i.test(navigator.userAgent),
                   prefixElement: r.createElement("div"),
                   prefixMatches: {},
                   scrollAnchor: null,
                   scrollPropertyLeft: null,
                   scrollPropertyTop: null,
                   isTicking: !1,
                   calls: []
               },
               CSS: {},
               Utilities: f,
               Redirects: {},
               Easings: {},
               Promise: t.Promise,
               defaults: {
                   queue: "",
                   duration: h,
                   easing: v,
                   begin: a,
                   complete: a,
                   progress: a,
                   display: a,
                   visibility: a,
                   loop: !1,
                   delay: !1,
                   mobileHA: !0,
                   _cacheValues: !0
               },
               init: function (e) {
                   f.data(e, "velocity", {
                       isSVG: m.isSVG(e),
                       isAnimating: !1,
                       computedStyle: null,
                       tweensContainer: null,
                       rootPropertyValueCache: {},
                       transformCache: {}
                   })
               },
               hook: null,
               mock: !1,
               version: {
                   major: 1,
                   minor: 2,
                   patch: 2
               },
               debug: !1
           };
       t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");
       var x = function () {
           function e(e) {
               return -e.tension * e.x - e.friction * e.v
           }

           function t(t, r, a) {
               var n = {
                   x: t.x + a.dx * r,
                   v: t.v + a.dv * r,
                   tension: t.tension,
                   friction: t.friction
               };
               return {
                   dx: n.v,
                   dv: e(n)
               }
           }

           function r(r, a) {
               var n = {
                       dx: r.v,
                       dv: e(r)
                   },
                   o = t(r, .5 * a, n),
                   i = t(r, .5 * a, o),
                   s = t(r, a, i),
                   l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
                   u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);
               return r.x = r.x + l * a, r.v = r.v + u * a, r
           }
           return function a(e, t, n) {
               var o, i, s, l = {
                       x: -1,
                       v: 0,
                       tension: null,
                       friction: null
                   },
                   u = [0],
                   c = 0,
                   p = 1e-4,
                   f = .016;
               for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;);
               return o ? function (e) {
                   return u[e * (u.length - 1) | 0]
               } : c
           }
       }();
       b.Easings = {
           linear: function (e) {
               return e
           },
           swing: function (e) {
               return .5 - Math.cos(e * Math.PI) / 2
           },
           spring: function (e) {
               return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e)
           }
       }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
           b.Easings[t[0]] = l.apply(null, t[1])
       });
       var S = b.CSS = {
           RegEx: {
               isHex: /^#([A-f\d]{3}){1,2}$/i,
               valueUnwrap: /^[A-z]+\((.*)\)$/i,
               wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,
               valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi
           },
           Lists: {
               colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"],
               transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"],
               transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"]
           },
           Hooks: {
               templates: {
                   textShadow: ["Color X Y Blur", "black 0px 0px 0px"],
                   boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"],
                   clip: ["Top Right Bottom Left", "0px 0px 0px 0px"],
                   backgroundPosition: ["X Y", "0% 0%"],
                   transformOrigin: ["X Y Z", "50% 50% 0px"],
                   perspectiveOrigin: ["X Y", "50% 50%"]
               },
               registered: {},
               register: function () {
                   for (var e = 0; e < S.Lists.colors.length; e++) {
                       var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";
                       S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]
                   }
                   var r, a, n;
                   if (d)
                       for (r in S.Hooks.templates) {
                           a = S.Hooks.templates[r], n = a[0].split(" ");
                           var o = a[1].match(S.RegEx.valueSplit);
                           "Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")])
                       }
                   for (r in S.Hooks.templates) {
                       a = S.Hooks.templates[r], n = a[0].split(" ");
                       for (var e in n) {
                           var i = r + n[e],
                               s = e;
                           S.Hooks.registered[i] = [r, s]
                       }
                   }
               },
               getRoot: function (e) {
                   var t = S.Hooks.registered[e];
                   return t ? t[0] : e
               },
               cleanRootPropertyValue: function (e, t) {
                   return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t
               },
               extractValue: function (e, t) {
                   var r = S.Hooks.registered[e];
                   if (r) {
                       var a = r[0],
                           n = r[1];
                       return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]
                   }
                   return t
               },
               injectValue: function (e, t, r) {
                   var a = S.Hooks.registered[e];
                   if (a) {
                       var n, o, i = a[0],
                           s = a[1];
                       return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ")
                   }
                   return r
               }
           },
           Normalizations: {
               registered: {
                   clip: function (e, t, r) {
                       switch (e) {
                       case "name":
                           return "clip";
                       case "extract":
                           var a;
                           return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;
                       case "inject":
                           return "rect(" + r + ")"
                       }
                   },
                   blur: function (e, t, r) {
                       switch (e) {
                       case "name":
                           return b.State.isFirefox ? "filter" : "-webkit-filter";
                       case "extract":
                           var a = parseFloat(r);
                           if (!a && 0 !== a) {
                               var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);
                               a = n ? n[1] : 0
                           }
                           return a;
                       case "inject":
                           return parseFloat(r) ? "blur(" + r + ")" : "none"
                       }
                   },
                   opacity: function (e, t, r) {
                       if (8 >= d) switch (e) {
                       case "name":
                           return "filter";
                       case "extract":
                           var a = r.toString().match(/alpha\(opacity=(.*)\)/i);
                           return r = a ? a[1] / 100 : 1;
                       case "inject":
                           return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")"
                       } else switch (e) {
                       case "name":
                           return "opacity";
                       case "extract":
                           return r;
                       case "inject":
                           return r
                       }
                   }
               },
               register: function () {
                   9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));
                   for (var e = 0; e < S.Lists.transformsBase.length; e++) ! function () {
                       var t = S.Lists.transformsBase[e];
                       S.Normalizations.registered[t] = function (e, r, n) {
                           switch (e) {
                           case "name":
                               return "transform";
                           case "extract":
                               return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");
                           case "inject":
                               var o = !1;
                               switch (t.substr(0, t.length - 1)) {
                               case "translate":
                                   o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);
                                   break;
                               case "scal":
                               case "scale":
                                   b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);
                                   break;
                               case "skew":
                                   o = !/(deg|\d)$/i.test(n);
                                   break;
                               case "rotate":
                                   o = !/(deg|\d)$/i.test(n)
                               }
                               return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t]
                           }
                       }
                   }();
                   for (var e = 0; e < S.Lists.colors.length; e++) ! function () {
                       var t = S.Lists.colors[e];
                       S.Normalizations.registered[t] = function (e, r, n) {
                           switch (e) {
                           case "name":
                               return t;
                           case "extract":
                               var o;
                               if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;
                               else {
                                   var i, s = {
                                       black: "rgb(0, 0, 0)",
                                       blue: "rgb(0, 0, 255)",
                                       gray: "rgb(128, 128, 128)",
                                       green: "rgb(0, 128, 0)",
                                       red: "rgb(255, 0, 0)",
                                       white: "rgb(255, 255, 255)"
                                   };
                                   /^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ")
                               }
                               return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;
                           case "inject":
                               return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")"
                           }
                       }
                   }()
               }
           },
           Names: {
               camelCase: function (e) {
                   return e.replace(/-(\w)/g, function (e, t) {
                       return t.toUpperCase()
                   })
               },
               SVGAttribute: function (e) {
                   var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";
                   return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e)
               },
               prefixCheck: function (e) {
                   if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];
                   for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
                       var n;
                       if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
                               return e.toUpperCase()
                           }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]
                   }
                   return [e, !1]
               }
           },
           Values: {
               hexToRgb: function (e) {
                   var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
                       a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;
                   return e = e.replace(r, function (e, t, r, a) {
                       return t + t + r + r + a + a
                   }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]
               },
               isCSSNullValue: function (e) {
                   return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)
               },
               getUnitType: function (e) {
                   return /^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
               },
               getDisplayType: function (e) {
                   var t = e && e.tagName.toString().toLowerCase();
                   return /^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
               },
               addClass: function (e, t) {
                   e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t
               },
               removeClass: function (e, t) {
                   e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ")
               }
           },
           getPropertyValue: function (e, r, n, o) {
               function s(e, r) {
                   function n() {
                       u && S.setPropertyValue(e, "display", "none")
                   }
                   var l = 0;
                   if (8 >= d) l = f.css(e, r);
                   else {
                       var u = !1;
                       if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
                           if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
                               var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);
                               return n(), c
                           }
                           if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
                               var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);
                               return n(), p
                           }
                       }
                       var g;
                       g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n()
                   }
                   if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
                       var m = s(e, "position");
                       ("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px")
                   }
                   return l
               }
               var l;
               if (S.Hooks.registered[r]) {
                   var u = r,
                       c = S.Hooks.getRoot(u);
                   n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n)
               } else if (S.Normalizations.registered[r]) {
                   var p, g;
                   p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g)
               }
               if (!/^[\d-]/.test(l))
                   if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r))
                       if (/^(height|width)$/i.test(r)) try {
                           l = e.getBBox()[r]
                       } catch (m) {
                           l = 0
                       } else l = e.getAttribute(r);
                       else l = s(e, S.Names.prefixCheck(r)[0]);
               return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l
           },
           setPropertyValue: function (e, r, a, n, o) {
               var s = r;
               if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);
               else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];
               else {
                   if (S.Hooks.registered[r]) {
                       var l = r,
                           u = S.Hooks.getRoot(r);
                       n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u
                   }
                   if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
                       e.style[s] = a
                   } catch (c) {
                       b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]")
                   } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;
                   b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a)
               }
               return [s, a]
           },
           flushTransformCache: function (e) {
               function t(t) {
                   return parseFloat(S.getPropertyValue(e, t))
               }
               var r = "";
               if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
                   var a = {
                       translate: [t("translateX"), t("translateY")],
                       skewX: [t("skewX")],
                       skewY: [t("skewY")],
                       scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")],
                       rotate: [t("rotateZ"), 0, 0]
                   };
                   f.each(i(e).transformCache, function (e) {
                       /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e])
                   })
               } else {
                   var n, o;
                   f.each(i(e).transformCache, function (t) {
                       return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void(r += t + n + " "))
                   }), o && (r = "perspective" + o + " " + r)
               }
               S.setPropertyValue(e, "transform", r)
           }
       };
       S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
           var n = a;
           return e = o(e), f.each(e, function (e, o) {
               if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));
               else {
                   var s = b.CSS.setPropertyValue(o, t, r);
                   "transform" === s[0] && b.CSS.flushTransformCache(o), n = s
               }
           }), n
       };
       var P = function () {
           function e() {
               return s ? k.promise || null : l
           }

           function n() {
               function e(e) {
                   function p(e, t) {
                       var r = a,
                           n = a,
                           i = a;
                       return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]
                   }

                   function d(e, t) {
                       var r, a;
                       return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
                           return r = e, ""
                       }), r || (r = S.Values.getUnitType(e)), [a, r]
                   }

                   function h() {
                       var e = {
                               myParent: o.parentNode || r.body,
                               position: S.getPropertyValue(o, "position"),
                               fontSize: S.getPropertyValue(o, "fontSize")
                           },
                           a = e.position === L.lastPosition && e.myParent === L.lastParent,
                           n = e.fontSize === L.lastFontSize;
                       L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;
                       var s = 100,
                           l = {};
                       if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;
                       else {
                           var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");
                           b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
                               b.CSS.setPropertyValue(u, t, "hidden")
                           }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
                               b.CSS.setPropertyValue(u, t, s + "%")
                           }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u)
                       }
                       return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l
                   }
                   if (s.begin && 0 === V) try {
                       s.begin.call(g, g)
                   } catch (x) {
                       setTimeout(function () {
                           throw x
                       }, 1)
                   }
                   if ("scroll" === A) {
                       var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top",
                           j = parseFloat(s.offset) || 0;
                       s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = {
                           scroll: {
                               rootPropertyValue: !1,
                               startValue: P,
                               currentValue: P,
                               endValue: T,
                               unitType: "",
                               easing: s.easing,
                               scrollData: {
                                   container: s.container,
                                   direction: F,
                                   alternateValue: C
                               }
                           },
                           element: o
                       }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o)
                   } else if ("reverse" === A) {
                       if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);
                       "none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);
                       var E = f.extend(!0, {}, i(o).tweensContainer);
                       for (var H in E)
                           if ("element" !== H) {
                               var N = E[H].startValue;
                               E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o)
                           }
                       l = E
                   } else if ("start" === A) {
                       var E;
                       i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
                           if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
                               var r = p(t, !0),
                                   n = r[0],
                                   o = r[1],
                                   i = r[2];
                               if (S.RegEx.isHex.test(n)) {
                                   for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
                                       var f = [l[c]];
                                       o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f
                                   }
                                   delete y[e]
                               }
                           }
                       });
                       for (var z in y) {
                           var O = p(y[z]),
                               q = O[0],
                               $ = O[1],
                               M = O[2];
                           z = S.Names.camelCase(z);
                           var I = S.Hooks.getRoot(z),
                               B = !1;
                           if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
                               (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));
                               var W, G, Y, D = !1;
                               if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
                                       return D = t, ""
                                   }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;
                               else if (Y !== G && 0 !== M)
                                   if (0 === q) G = Y;
                                   else {
                                       n = n || h();
                                       var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";
                                       switch (Y) {
                                       case "%":
                                           M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;
                                           break;
                                       case "px":
                                           break;
                                       default:
                                           M *= n[Y + "ToPx"]
                                       }
                                       switch (G) {
                                       case "%":
                                           M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);
                                           break;
                                       case "px":
                                           break;
                                       default:
                                           M *= 1 / n[G + "ToPx"]
                                       }
                                   }
                               switch (D) {
                               case "+":
                                   q = M + q;
                                   break;
                               case "-":
                                   q = M - q;
                                   break;
                               case "*":
                                   q = M * q;
                                   break;
                               case "/":
                                   q = M / q
                               }
                               l[z] = {
                                   rootPropertyValue: B,
                                   startValue: M,
                                   currentValue: M,
                                   endValue: q,
                                   unitType: G,
                                   easing: $
                               }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o)
                           } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.")
                       }
                       l.element = o
                   }
                   l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++)
               }
               var n, o = this,
                   s = f.extend({}, b.defaults, v),
                   l = {};
               switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
                   b.velocityQueueEntryFlag = !0, i(o).delayTimer = {
                       setTimeout: setTimeout(e, parseFloat(s.delay)),
                       next: e
                   }
               }), s.duration.toString().toLowerCase()) {
               case "fast":
                   s.duration = 200;
                   break;
               case "normal":
                   s.duration = h;
                   break;
               case "slow":
                   s.duration = 600;
                   break;
               default:
                   s.duration = parseFloat(s.duration) || 1
               }
               b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
                   return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t))
               }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o)
           }
           var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));
           if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
               x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);
               var w = g.length,
                   V = 0;
               if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
                   var C = d + 1;
                   v = {};
                   for (var T = C; T < arguments.length; T++) m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]
               }
               var k = {
                   promise: null,
                   resolver: null,
                   rejecter: null
               };
               s && b.Promise && (k.promise = new b.Promise(function (e, t) {
                   k.resolver = e, k.rejecter = t
               }));
               var A;
               switch (y) {
               case "scroll":
                   A = "scroll";
                   break;
               case "reverse":
                   A = "reverse";
                   break;
               case "finish":
               case "stop":
                   f.each(g, function (e, t) {
                       i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer)
                   });
                   var F = [];
                   return f.each(b.State.calls, function (e, t) {
                       t && f.each(t[1], function (r, n) {
                           var o = v === a ? "" : v;
                           return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
                               a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
                                   m.isFunction(t) && t(null, !0)
                               }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
                                   t.endValue = t.currentValue
                               }), F.push(e)) : "finish" === y && (t[2].duration = 1))
                           }) : !0
                       })
                   }), "stop" === y && (f.each(F, function (e, t) {
                       p(t, !0)
                   }), k.promise && k.resolver(g)), e();
               default:
                   if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
                       if (m.isString(y) && b.Redirects[y]) {
                           var j = f.extend({}, v),
                               E = j.duration,
                               H = j.delay || 0;
                           return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
                               parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a)
                           }), e()
                       }
                       var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";
                       return k.promise ? k.rejecter(new Error(N)) : console.log(N), e()
                   }
                   A = "start"
               }
               var L = {
                       lastParent: null,
                       lastPosition: null,
                       lastFontSize: null,
                       lastPercentToPxWidth: null,
                       lastPercentToPxHeight: null,
                       lastEmToPx: null,
                       remToPx: null,
                       vwToPx: null,
                       vhToPx: null
                   },
                   R = [];
               f.each(g, function (e, t) {
                   m.isNode(t) && n.call(t)
               });
               var z, j = f.extend({}, b.defaults, v);
               if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop)
                   for (var O = 0; z > O; O++) {
                       var q = {
                           delay: j.delay,
                           progress: j.progress
                       };
                       O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q)
                   }
               return e()
           }
       };
       b = f.extend(P, b), b.animate = P;
       var w = t.requestAnimationFrame || g;
       return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
           r.hidden ? (w = function (e) {
               return setTimeout(function () {
                   e(!0)
               }, 16)
           }, c()) : w = t.requestAnimationFrame || g
       }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
           b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
               var l = f.extend({}, r),
                   u = l.begin,
                   c = l.complete,
                   p = {
                       height: "",
                       marginTop: "",
                       marginBottom: "",
                       paddingTop: "",
                       paddingBottom: ""
                   },
                   d = {};
               l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
                   u && u.call(i, i);
                   for (var r in p) {
                       d[r] = e.style[r];
                       var a = b.CSS.getPropertyValue(e, r);
                       p[r] = "Down" === t ? [a, 0] : [0, a]
                   }
                   d.overflow = e.style.overflow, e.style.overflow = "hidden"
               }, l.complete = function () {
                   for (var t in d) e.style[t] = d[t];
                   c && c.call(i, i), s && s.resolver(i)
               }, b(e, p, l)
           }
       }), f.each(["In", "Out"], function (e, t) {
           b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
               var l = f.extend({}, r),
                   u = {
                       opacity: "In" === t ? 1 : 0
                   },
                   c = l.complete;
               l.complete = n !== o - 1 ? l.begin = null : function () {
                   c && c.call(i, i), s && s.resolver(i)
               }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l)
           }
       }), b
   }(window.jQuery || window.Zepto || window, window, document)

}));; ! function (a, b, c, d) {

   "use strict";

   function k(a, b, c) {
       return setTimeout(q(a, c), b)
   }

   function l(a, b, c) {
       return Array.isArray(a) ? (m(a, c[b], c), !0) : !1
   }

   function m(a, b, c) {
       var e;
       if (a)
           if (a.forEach) a.forEach(b, c);
           else if (a.length !== d)
           for (e = 0; e < a.length;) b.call(c, a[e], e, a), e++;
       else
           for (e in a) a.hasOwnProperty(e) && b.call(c, a[e], e, a)
   }

   function n(a, b, c) {
       for (var e = Object.keys(b), f = 0; f < e.length;)(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
       return a
   }

   function o(a, b) {
       return n(a, b, !0)
   }

   function p(a, b, c) {
       var e, d = b.prototype;
       e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c)
   }

   function q(a, b) {
       return function () {
           return a.apply(b, arguments)
       }
   }

   function r(a, b) {
       return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a
   }

   function s(a, b) {
       return a === d ? b : a
   }

   function t(a, b, c) {
       m(x(b), function (b) {
           a.addEventListener(b, c, !1)
       })
   }

   function u(a, b, c) {
       m(x(b), function (b) {
           a.removeEventListener(b, c, !1)
       })
   }

   function v(a, b) {
       for (; a;) {
           if (a == b) return !0;
           a = a.parentNode
       }
       return !1
   }

   function w(a, b) {
       return a.indexOf(b) > -1
   }

   function x(a) {
       return a.trim().split(/\s+/g)
   }

   function y(a, b, c) {
       if (a.indexOf && !c) return a.indexOf(b);
       for (var d = 0; d < a.length;) {
           if (c && a[d][c] == b || !c && a[d] === b) return d;
           d++
       }
       return -1
   }

   function z(a) {
       return Array.prototype.slice.call(a, 0)
   }

   function A(a, b, c) {
       for (var d = [], e = [], f = 0; f < a.length;) {
           var g = b ? a[f][b] : a[f];
           y(e, g) < 0 && d.push(a[f]), e[f] = g, f++
       }
       return c && (d = b ? d.sort(function (a, c) {
           return a[b] > c[b]
       }) : d.sort()), d
   }

   function B(a, b) {
       for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
           if (c = e[h], f = c ? c + g : b, f in a) return f;
           h++
       }
       return d
   }

   function D() {
       return C++
   }

   function E(a) {
       var b = a.ownerDocument;
       return b.defaultView || b.parentWindow
   }

   function ab(a, b) {
       var c = this;
       this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
           r(a.options.enable, [a]) && c.handler(b)
       }, this.init()
   }

   function bb(a) {
       var b, c = a.options.inputClass;
       return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb)
   }

   function cb(a, b, c) {
       var d = c.pointers.length,
           e = c.changedPointers.length,
           f = b & O && 0 === d - e,
           g = b & (Q | R) && 0 === d - e;
       c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c
   }

   function db(a, b) {
       var c = a.session,
           d = b.pointers,
           e = d.length;
       c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);
       var f = c.firstInput,
           g = c.firstMultiple,
           h = g ? g.center : f.center,
           i = b.center = hb(d);
       b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);
       var k = a.element;
       v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k
   }

   function eb(a, b) {
       var c = b.center,
           d = a.offsetDelta || {},
           e = a.prevDelta || {},
           f = a.prevInput || {};
       (b.eventType === O || f.eventType === Q) && (e = a.prevDelta = {
           x: f.deltaX || 0,
           y: f.deltaY || 0
       }, d = a.offsetDelta = {
           x: c.x,
           y: c.y
       }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y)
   }

   function fb(a, b) {
       var f, g, h, j, c = a.lastInterval || b,
           e = b.timeStamp - c.timeStamp;
       if (b.eventType != R && (e > N || c.velocity === d)) {
           var k = c.deltaX - b.deltaX,
               l = c.deltaY - b.deltaY,
               m = ib(e, k, l);
           g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b
       } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;
       b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j
   }

   function gb(a) {
       for (var b = [], c = 0; c < a.pointers.length;) b[c] = {
           clientX: h(a.pointers[c].clientX),
           clientY: h(a.pointers[c].clientY)
       }, c++;
       return {
           timeStamp: j(),
           pointers: b,
           center: hb(b),
           deltaX: a.deltaX,
           deltaY: a.deltaY
       }
   }

   function hb(a) {
       var b = a.length;
       if (1 === b) return {
           x: h(a[0].clientX),
           y: h(a[0].clientY)
       };
       for (var c = 0, d = 0, e = 0; b > e;) c += a[e].clientX, d += a[e].clientY, e++;
       return {
           x: h(c / b),
           y: h(d / b)
       }
   }

   function ib(a, b, c) {
       return {
           x: b / a || 0,
           y: c / a || 0
       }
   }

   function jb(a, b) {
       return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W
   }

   function kb(a, b, c) {
       c || (c = $);
       var d = b[c[0]] - a[c[0]],
           e = b[c[1]] - a[c[1]];
       return Math.sqrt(d * d + e * e)
   }

   function lb(a, b, c) {
       c || (c = $);
       var d = b[c[0]] - a[c[0]],
           e = b[c[1]] - a[c[1]];
       return 180 * Math.atan2(e, d) / Math.PI
   }

   function mb(a, b) {
       return lb(b[1], b[0], _) - lb(a[1], a[0], _)
   }

   function nb(a, b) {
       return kb(b[0], b[1], _) / kb(a[0], a[1], _)
   }

   function rb() {
       this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments)
   }

   function wb() {
       this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []
   }

   function Ab() {
       this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments)
   }

   function Bb(a, b) {
       var c = z(a.touches),
           d = z(a.changedTouches);
       return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]
   }

   function Eb() {
       this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments)
   }

   function Fb(a, b) {
       var c = z(a.touches),
           d = this.targetIds;
       if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];
       var e, f, g = z(a.changedTouches),
           h = [],
           i = this.target;
       if (f = c.filter(function (a) {
               return v(a.target, i)
           }), b === O)
           for (e = 0; e < f.length;) d[f[e].identifier] = !0, e++;
       for (e = 0; e < g.length;) d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
       return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0
   }

   function Gb() {
       ab.apply(this, arguments);
       var a = q(this.handler, this);
       this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a)
   }

   function Pb(a, b) {
       this.manager = a, this.set(b)
   }

   function Qb(a) {
       if (w(a, Mb)) return Mb;
       var b = w(a, Nb),
           c = w(a, Ob);
       return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb
   }

   function Yb(a) {
       this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []
   }

   function Zb(a) {
       return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""
   }

   function $b(a) {
       return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""
   }

   function _b(a, b) {
       var c = b.manager;
       return c ? c.get(a) : a
   }

   function ac() {
       Yb.apply(this, arguments)
   }

   function bc() {
       ac.apply(this, arguments), this.pX = null, this.pY = null
   }

   function cc() {
       ac.apply(this, arguments)
   }

   function dc() {
       Yb.apply(this, arguments), this._timer = null, this._input = null
   }

   function ec() {
       ac.apply(this, arguments)
   }

   function fc() {
       ac.apply(this, arguments)
   }

   function gc() {
       Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0
   }

   function hc(a, b) {
       return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b)
   }

   function kc(a, b) {
       b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
           var b = this.add(new a[0](a[1]));
           a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3])
       }, this)
   }

   function lc(a, b) {
       var c = a.element;
       m(a.options.cssProps, function (a, d) {
           c.style[B(c.style, d)] = b ? a : ""
       })
   }

   function mc(a, c) {
       var d = b.createEvent("Event");
       d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d)
   }
   var e = ["", "webkit", "moz", "MS", "ms", "o"],
       f = b.createElement("div"),
       g = "function",
       h = Math.round,
       i = Math.abs,
       j = Date.now,
       C = 1,
       F = /mobile|tablet|ip(ad|hone|od)|android/i,
       G = "ontouchstart" in a,
       H = B(a, "PointerEvent") !== d,
       I = G && F.test(navigator.userAgent),
       J = "touch",
       K = "pen",
       L = "mouse",
       M = "kinect",
       N = 25,
       O = 1,
       P = 2,
       Q = 4,
       R = 8,
       S = 1,
       T = 2,
       U = 4,
       V = 8,
       W = 16,
       X = T | U,
       Y = V | W,
       Z = X | Y,
       $ = ["x", "y"],
       _ = ["clientX", "clientY"];
   ab.prototype = {
       handler: function () {},
       init: function () {
           this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler)
       },
       destroy: function () {
           this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler)
       }
   };
   var ob = {
           mousedown: O,
           mousemove: P,
           mouseup: Q
       },
       pb = "mousedown",
       qb = "mousemove mouseup";
   p(rb, ab, {
       handler: function (a) {
           var b = ob[a.type];
           b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, {
               pointers: [a],
               changedPointers: [a],
               pointerType: L,
               srcEvent: a
           }))
       }
   });
   var sb = {
           pointerdown: O,
           pointermove: P,
           pointerup: Q,
           pointercancel: R,
           pointerout: R
       },
       tb = {
           2: J,
           3: K,
           4: L,
           5: M
       },
       ub = "pointerdown",
       vb = "pointermove pointerup pointercancel";
   a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, {
       handler: function (a) {
           var b = this.store,
               c = !1,
               d = a.type.toLowerCase().replace("ms", ""),
               e = sb[d],
               f = tb[a.pointerType] || a.pointerType,
               g = f == J,
               h = y(b, a.pointerId, "pointerId");
           e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, {
               pointers: b,
               changedPointers: [a],
               pointerType: f,
               srcEvent: a
           }), c && b.splice(h, 1))
       }
   });
   var xb = {
           touchstart: O,
           touchmove: P,
           touchend: Q,
           touchcancel: R
       },
       yb = "touchstart",
       zb = "touchstart touchmove touchend touchcancel";
   p(Ab, ab, {
       handler: function (a) {
           var b = xb[a.type];
           if (b === O && (this.started = !0), this.started) {
               var c = Bb.call(this, a, b);
               b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, {
                   pointers: c[0],
                   changedPointers: c[1],
                   pointerType: J,
                   srcEvent: a
               })
           }
       }
   });
   var Cb = {
           touchstart: O,
           touchmove: P,
           touchend: Q,
           touchcancel: R
       },
       Db = "touchstart touchmove touchend touchcancel";
   p(Eb, ab, {
       handler: function (a) {
           var b = Cb[a.type],
               c = Fb.call(this, a, b);
           c && this.callback(this.manager, b, {
               pointers: c[0],
               changedPointers: c[1],
               pointerType: J,
               srcEvent: a
           })
       }
   }), p(Gb, ab, {
       handler: function (a, b, c) {
           var d = c.pointerType == J,
               e = c.pointerType == L;
           if (d) this.mouse.allow = !1;
           else if (e && !this.mouse.allow) return;
           b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c)
       },
       destroy: function () {
           this.touch.destroy(), this.mouse.destroy()
       }
   });
   var Hb = B(f.style, "touchAction"),
       Ib = Hb !== d,
       Jb = "compute",
       Kb = "auto",
       Lb = "manipulation",
       Mb = "none",
       Nb = "pan-x",
       Ob = "pan-y";
   Pb.prototype = {
       set: function (a) {
           a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim()
       },
       update: function () {
           this.set(this.manager.options.touchAction)
       },
       compute: function () {
           var a = [];
           return m(this.manager.recognizers, function (b) {
               r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()))
           }), Qb(a.join(" "))
       },
       preventDefaults: function (a) {
           if (!Ib) {
               var b = a.srcEvent,
                   c = a.offsetDirection;
               if (this.manager.session.prevented) return b.preventDefault(), void 0;
               var d = this.actions,
                   e = w(d, Mb),
                   f = w(d, Ob),
                   g = w(d, Nb);
               return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0
           }
       },
       preventSrc: function (a) {
           this.manager.session.prevented = !0, a.preventDefault()
       }
   };
   var Rb = 1,
       Sb = 2,
       Tb = 4,
       Ub = 8,
       Vb = Ub,
       Wb = 16,
       Xb = 32;
   Yb.prototype = {
       defaults: {},
       set: function (a) {
           return n(this.options, a), this.manager && this.manager.touchAction.update(), this
       },
       recognizeWith: function (a) {
           if (l(a, "recognizeWith", this)) return this;
           var b = this.simultaneous;
           return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this
       },
       dropRecognizeWith: function (a) {
           return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this)
       },
       requireFailure: function (a) {
           if (l(a, "requireFailure", this)) return this;
           var b = this.requireFail;
           return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this
       },
       dropRequireFailure: function (a) {
           if (l(a, "dropRequireFailure", this)) return this;
           a = _b(a, this);
           var b = y(this.requireFail, a);
           return b > -1 && this.requireFail.splice(b, 1), this
       },
       hasRequireFailures: function () {
           return this.requireFail.length > 0
       },
       canRecognizeWith: function (a) {
           return !!this.simultaneous[a.id]
       },
       emit: function (a) {
           function d(d) {
               b.manager.emit(b.options.event + (d ? Zb(c) : ""), a)
           }
           var b = this,
               c = this.state;
           Ub > c && d(!0), d(), c >= Ub && d(!0)
       },
       tryEmit: function (a) {
           return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0)
       },
       canEmit: function () {
           for (var a = 0; a < this.requireFail.length;) {
               if (!(this.requireFail[a].state & (Xb | Rb))) return !1;
               a++
           }
           return !0
       },
       recognize: function (a) {
           var b = n({}, a);
           return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0)
       },
       process: function () {},
       getTouchAction: function () {},
       reset: function () {}
   }, p(ac, Yb, {
       defaults: {
           pointers: 1
       },
       attrTest: function (a) {
           var b = this.options.pointers;
           return 0 === b || a.pointers.length === b
       },
       process: function (a) {
           var b = this.state,
               c = a.eventType,
               d = b & (Sb | Tb),
               e = this.attrTest(a);
           return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb
       }
   }), p(bc, ac, {
       defaults: {
           event: "pan",
           threshold: 10,
           pointers: 1,
           direction: Z
       },
       getTouchAction: function () {
           var a = this.options.direction,
               b = [];
           return a & X && b.push(Ob), a & Y && b.push(Nb), b
       },
       directionTest: function (a) {
           var b = this.options,
               c = !0,
               d = a.distance,
               e = a.direction,
               f = a.deltaX,
               g = a.deltaY;
           return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction
       },
       attrTest: function (a) {
           return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a))
       },
       emit: function (a) {
           this.pX = a.deltaX, this.pY = a.deltaY;
           var b = $b(a.direction);
           b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a)
       }
   }), p(cc, ac, {
       defaults: {
           event: "pinch",
           threshold: 0,
           pointers: 2
       },
       getTouchAction: function () {
           return [Mb]
       },
       attrTest: function (a) {
           return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb)
       },
       emit: function (a) {
           if (this._super.emit.call(this, a), 1 !== a.scale) {
               var b = a.scale < 1 ? "in" : "out";
               this.manager.emit(this.options.event + b, a)
           }
       }
   }), p(dc, Yb, {
       defaults: {
           event: "press",
           pointers: 1,
           time: 500,
           threshold: 5
       },
       getTouchAction: function () {
           return [Kb]
       },
       process: function (a) {
           var b = this.options,
               c = a.pointers.length === b.pointers,
               d = a.distance < b.threshold,
               e = a.deltaTime > b.time;
           if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();
           else if (a.eventType & O) this.reset(), this._timer = k(function () {
               this.state = Vb, this.tryEmit()
           }, b.time, this);
           else if (a.eventType & Q) return Vb;
           return Xb
       },
       reset: function () {
           clearTimeout(this._timer)
       },
       emit: function (a) {
           this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)))
       }
   }), p(ec, ac, {
       defaults: {
           event: "rotate",
           threshold: 0,
           pointers: 2
       },
       getTouchAction: function () {
           return [Mb]
       },
       attrTest: function (a) {
           return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb)
       }
   }), p(fc, ac, {
       defaults: {
           event: "swipe",
           threshold: 10,
           velocity: .65,
           direction: X | Y,
           pointers: 1
       },
       getTouchAction: function () {
           return bc.prototype.getTouchAction.call(this)
       },
       attrTest: function (a) {
           var c, b = this.options.direction;
           return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q
       },
       emit: function (a) {
           var b = $b(a.direction);
           b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a)
       }
   }), p(gc, Yb, {
       defaults: {
           event: "tap",
           pointers: 1,
           taps: 1,
           interval: 300,
           time: 250,
           threshold: 2,
           posThreshold: 10
       },
       getTouchAction: function () {
           return [Lb]
       },
       process: function (a) {
           var b = this.options,
               c = a.pointers.length === b.pointers,
               d = a.distance < b.threshold,
               e = a.deltaTime < b.time;
           if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();
           if (d && e && c) {
               if (a.eventType != Q) return this.failTimeout();
               var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
                   g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;
               this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;
               var h = this.count % b.taps;
               if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
                   this.state = Vb, this.tryEmit()
               }, b.interval, this), Sb) : Vb
           }
           return Xb
       },
       failTimeout: function () {
           return this._timer = k(function () {
               this.state = Xb
           }, this.options.interval, this), Xb
       },
       reset: function () {
           clearTimeout(this._timer)
       },
       emit: function () {
           this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input))
       }
   }), hc.VERSION = "2.0.4", hc.defaults = {
       domEvents: !1,
       touchAction: Jb,
       enable: !0,
       inputTarget: null,
       inputClass: null,
       preset: [[ec, {
           enable: !1
       }], [cc, {
           enable: !1
       }, ["rotate"]], [fc, {
           direction: X
       }], [bc, {
           direction: X
       }, ["swipe"]], [gc], [gc, {
           event: "doubletap",
           taps: 2
       }, ["tap"]], [dc]],
       cssProps: {
           userSelect: "default",
           touchSelect: "none",
           touchCallout: "none",
           contentZooming: "none",
           userDrag: "none",
           tapHighlightColor: "rgba(0,0,0,0)"
       }
   };
   var ic = 1,
       jc = 2;
   kc.prototype = {
       set: function (a) {
           return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this
       },
       stop: function (a) {
           this.session.stopped = a ? jc : ic
       },
       recognize: function (a) {
           var b = this.session;
           if (!b.stopped) {
               this.touchAction.preventDefaults(a);
               var c, d = this.recognizers,
                   e = b.curRecognizer;
               (!e || e && e.state & Vb) && (e = b.curRecognizer = null);
               for (var f = 0; f < d.length;) c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++
           }
       },
       get: function (a) {
           if (a instanceof Yb) return a;
           for (var b = this.recognizers, c = 0; c < b.length; c++)
               if (b[c].options.event == a) return b[c];
           return null
       },
       add: function (a) {
           if (l(a, "add", this)) return this;
           var b = this.get(a.options.event);
           return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a
       },
       remove: function (a) {
           if (l(a, "remove", this)) return this;
           var b = this.recognizers;
           return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this
       },
       on: function (a, b) {
           var c = this.handlers;
           return m(x(a), function (a) {
               c[a] = c[a] || [], c[a].push(b)
           }), this
       },
       off: function (a, b) {
           var c = this.handlers;
           return m(x(a), function (a) {
               b ? c[a].splice(y(c[a], b), 1) : delete c[a]
           }), this
       },
       emit: function (a, b) {
           this.options.domEvents && mc(a, b);
           var c = this.handlers[a] && this.handlers[a].slice();
           if (c && c.length) {
               b.type = a, b.preventDefault = function () {
                   b.srcEvent.preventDefault()
               };
               for (var d = 0; d < c.length;) c[d](b), d++
           }
       },
       destroy: function () {
           this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null
       }
   }, n(hc, {
       INPUT_START: O,
       INPUT_MOVE: P,
       INPUT_END: Q,
       INPUT_CANCEL: R,
       STATE_POSSIBLE: Rb,
       STATE_BEGAN: Sb,
       STATE_CHANGED: Tb,
       STATE_ENDED: Ub,
       STATE_RECOGNIZED: Vb,
       STATE_CANCELLED: Wb,
       STATE_FAILED: Xb,
       DIRECTION_NONE: S,
       DIRECTION_LEFT: T,
       DIRECTION_RIGHT: U,
       DIRECTION_UP: V,
       DIRECTION_DOWN: W,
       DIRECTION_HORIZONTAL: X,
       DIRECTION_VERTICAL: Y,
       DIRECTION_ALL: Z,
       Manager: kc,
       Input: ab,
       TouchAction: Pb,
       TouchInput: Eb,
       MouseInput: rb,
       PointerEventInput: wb,
       TouchMouseInput: Gb,
       SingleTouchInput: Ab,
       Recognizer: Yb,
       AttrRecognizer: ac,
       Tap: gc,
       Pan: bc,
       Swipe: fc,
       Pinch: cc,
       Rotate: ec,
       Press: dc,
       on: t,
       off: u,
       each: m,
       merge: o,
       extend: n,
       inherit: p,
       bindFn: q,
       prefixed: B
   }), typeof define == g && define.amd ? define(function () {
       return hc
   }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc

}(window, document, "Hammer");; (function (factory) {

   if (typeof define === 'function' && define.amd) {
       define(['jquery', 'hammerjs'], factory);
   } else if (typeof exports === 'object') {
       factory(require('jquery'), require('hammerjs'));
   } else {
       factory(jQuery, Hammer);
   }

}(function ($, Hammer) {

   function hammerify(el, options) {
       var $el = $(el);
       if (!$el.data("hammer")) {
           $el.data("hammer", new Hammer($el[0], options));
       }
   }

   $.fn.hammer = function (options) {
       return this.each(function () {
           hammerify(this, options);
       });
   };

   // extend the emit method to also trigger jQuery events
   Hammer.Manager.prototype.emit = (function (originalEmit) {
       return function (type, data) {
           originalEmit.call(this, type, data);
           $(this.element).trigger({
               type: type,
               gesture: data
           });
       };
   })(Hammer.Manager.prototype.emit);

}));; // Required for Meteor package, the use of window prevents export by Meteor (function (window) {

   if (window.Package) {
       Materialize = {};
   } else {
       window.Materialize = {};
   }

})(window);

/*

* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/

(function (window) {

   var lastTime = 0,
       vendors = ['webkit', 'moz'],
       requestAnimationFrame = window.requestAnimationFrame,
       cancelAnimationFrame = window.cancelAnimationFrame,
       i = vendors.length;

   // try to un-prefix existing raf
   while (--i >= 0 && !requestAnimationFrame) {
       requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
       cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
   }

   // polyfill with setTimeout fallback
   // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
   if (!requestAnimationFrame || !cancelAnimationFrame) {
       requestAnimationFrame = function (callback) {
           var now = +Date.now(),
               nextTime = Math.max(lastTime + 16, now);
           return setTimeout(function () {
               callback(lastTime = nextTime);
           }, nextTime - now);
       };

       cancelAnimationFrame = clearTimeout;
   }

   // export to window
   window.requestAnimationFrame = requestAnimationFrame;
   window.cancelAnimationFrame = cancelAnimationFrame;

}(window));

/**

* Generate approximated selector string for a jQuery object
* @param {jQuery} obj  jQuery object to be parsed
* @returns {string}
*/

Materialize.objectSelectorString = function (obj) {

   var tagStr = obj.prop('tagName') || ;
   var idStr = obj.attr('id') || ;
   var classStr = obj.attr('class') || ;
   return (tagStr + idStr + classStr).replace(/\s/g, );

};

// Unique Random ID Materialize.guid = (function () {

   function s4() {
       return Math.floor((1 + Math.random()) * 0x10000)
           .toString(16)
           .substring(1);
   }
   return function () {
       return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
           s4() + '-' + s4() + s4() + s4();
   };

})();

/**

* Escapes hash from special characters
* @param {string} hash  String returned from this.hash
* @returns {string}
*/

Materialize.escapeHash = function (hash) {

   return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");

};

Materialize.elementOrParentIsFixed = function (element) {

   var $element = $(element);
   var $checkElements = $element.add($element.parents());
   var isFixed = false;
   $checkElements.each(function () {
       if ($(this).css("position") === "fixed") {
           isFixed = true;
           return false;
       }
   });
   return isFixed;

};

/**

* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/

var getTime = (Date.now || function () {

   return new Date().getTime();

});

/**

* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/

Materialize.throttle = function (func, wait, options) {

   var context, args, result;
   var timeout = null;
   var previous = 0;
   options || (options = {});
   var later = function () {
       previous = options.leading === false ? 0 : getTime();
       timeout = null;
       result = func.apply(context, args);
       context = args = null;
   };
   return function () {
       var now = getTime();
       if (!previous && options.leading === false) previous = now;
       var remaining = wait - (now - previous);
       context = this;
       args = arguments;
       if (remaining <= 0) {
           clearTimeout(timeout);
           timeout = null;
           previous = now;
           result = func.apply(context, args);
           context = args = null;
       } else if (!timeout && options.trailing !== false) {
           timeout = setTimeout(later, remaining);
       }
       return result;
   };

};

// Velocity has conflicts when loaded with jQuery, this will check for it // First, check if in noConflict mode var Vel; if (jQuery) {

   Vel = jQuery.Velocity;

} else if ($) {

   Vel = $.Velocity;

} else {

   Vel = Velocity;

}; (function ($) {

   $.fn.collapsible = function (options, methodParam) {
       var defaults = {
           accordion: undefined,
           onOpen: undefined,
           onClose: undefined
       };

       var methodName = options;
       options = $.extend(defaults, options);

       return this.each(function () {

           var $this = $(this);

           var $panel_headers = $(this).find('> li > .collapsible-header');

           var collapsible_type = $this.data("collapsible");

           /****************
           Helper Functions
           ****************/

           // Accordion Open
           function accordionOpen(object) {
               $panel_headers = $this.find('> li > .collapsible-header');
               if (object.hasClass('active')) {
                   object.parent().addClass('active');
               } else {
                   object.parent().removeClass('active');
               }
               if (object.parent().hasClass('active')) {
                   object.siblings('.collapsible-body').stop(true, false).slideDown({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               } else {
                   object.siblings('.collapsible-body').stop(true, false).slideUp({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               }

               $panel_headers.not(object).removeClass('active').parent().removeClass('active');

               // Close previously open accordion elements.
               $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
                   if ($(this).is(':visible')) {
                       $(this).slideUp({
                           duration: 350,
                           easing: "easeOutQuart",
                           queue: false,
                           complete: function () {
                               $(this).css('height', );
                               execCallbacks($(this).siblings('.collapsible-header'));
                           }
                       });
                   }
               });
           }

           // Expandable Open
           function expandableOpen(object) {
               if (object.hasClass('active')) {
                   object.parent().addClass('active');
               } else {
                   object.parent().removeClass('active');
               }
               if (object.parent().hasClass('active')) {
                   object.siblings('.collapsible-body').stop(true, false).slideDown({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               } else {
                   object.siblings('.collapsible-body').stop(true, false).slideUp({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               }
           }

           // Open collapsible. object: .collapsible-header
           function collapsibleOpen(object, noToggle) {
               if (!noToggle) {
                   object.toggleClass('active');
               }

               if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
                   accordionOpen(object);
               } else { // Handle Expandables
                   expandableOpen(object);
               }

               execCallbacks(object);
           }

           // Handle callbacks
           function execCallbacks(object) {
               if (object.hasClass('active')) {
                   if (typeof (options.onOpen) === "function") {
                       options.onOpen.call(this, object.parent());
                   }
               } else {
                   if (typeof (options.onClose) === "function") {
                       options.onClose.call(this, object.parent());
                   }
               }
           }

           /**
            * Check if object is children of panel header
            * @param  {Object}  object Jquery object
            * @return {Boolean} true if it is children
            */
           function isChildrenOfPanelHeader(object) {

               var panelHeader = getPanelHeader(object);

               return panelHeader.length > 0;
           }

           /**
            * Get panel header from a children element
            * @param  {Object} object Jquery object
            * @return {Object} panel header object
            */
           function getPanelHeader(object) {

               return object.closest('li > .collapsible-header');
           }

           // Turn off any existing event handlers
           function removeEventHandlers() {
               $this.off('click.collapse', '> li > .collapsible-header');
           }

           /*****  End Helper Functions  *****/

           // Methods
           if (methodName === 'destroy') {
               removeEventHandlers();
               return;
           } else if (methodParam >= 0 &&
               methodParam < $panel_headers.length) {
               var $curr_header = $panel_headers.eq(methodParam);
               if ($curr_header.length &&
                   (methodName === 'open' ||
                       (methodName === 'close' &&
                           $curr_header.hasClass('active')))) {
                   collapsibleOpen($curr_header);
               }
               return;
           }

           removeEventHandlers();

           // Add click handler to only direct collapsible header children
           $this.on('click.collapse', '> li > .collapsible-header', function (e) {
               var element = $(e.target);

               if (isChildrenOfPanelHeader(element)) {
                   element = getPanelHeader(element);
               }

               collapsibleOpen(element);
           });

           // Open first active
           if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
               collapsibleOpen($panel_headers.filter('.active').first(), true);

           } else { // Handle Expandables
               $panel_headers.filter('.active').each(function () {
                   collapsibleOpen($(this), true);
               });
           }

       });
   };

   $(document).ready(function () {
       $('.collapsible').collapsible();
   });

}(jQuery));; (function ($) {

   // Add posibility to scroll to selected option
   // usefull for select for example
   $.fn.scrollTo = function (elem) {
       $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
       return this;
   };

   $.fn.dropdown = function (options) {
       var defaults = {
           inDuration: 300,
           outDuration: 225,
           constrainWidth: true, // Constrains width of dropdown to the activator
           hover: false,
           gutter: 0, // Spacing from edge
           belowOrigin: false,
           alignment: 'left',
           stopPropagation: false
       };

       // Open dropdown.
       if (options === "open") {
           this.each(function () {
               $(this).trigger('open');
           });
           return false;
       }

       // Close dropdown.
       if (options === "close") {
           this.each(function () {
               $(this).trigger('close');
           });
           return false;
       }

       this.each(function () {
           var origin = $(this);
           var curr_options = $.extend({}, defaults, options);
           var isFocused = false;

           // Dropdown menu
           var activates = $("#" + origin.attr('data-activates'));

           function updateOptions() {
               if (origin.data('induration') !== undefined)
                   curr_options.inDuration = origin.data('induration');
               if (origin.data('outduration') !== undefined)
                   curr_options.outDuration = origin.data('outduration');
               if (origin.data('constrainwidth') !== undefined)
                   curr_options.constrainWidth = origin.data('constrainwidth');
               if (origin.data('hover') !== undefined)
                   curr_options.hover = origin.data('hover');
               if (origin.data('gutter') !== undefined)
                   curr_options.gutter = origin.data('gutter');
               if (origin.data('beloworigin') !== undefined)
                   curr_options.belowOrigin = origin.data('beloworigin');
               if (origin.data('alignment') !== undefined)
                   curr_options.alignment = origin.data('alignment');
               if (origin.data('stoppropagation') !== undefined)
                   curr_options.stopPropagation = origin.data('stoppropagation');
           }

           updateOptions();

           // Attach dropdown to its activator
           origin.after(activates);

           /*
             Helper function to position and resize dropdown.
             Used in hover and click handler.
           */
           function placeDropdown(eventType) {
               // Check for simultaneous focus and click events.
               if (eventType === 'focus') {
                   isFocused = true;
               }

               // Check html data attributes
               updateOptions();

               // Set Dropdown state
               activates.addClass('active');
               origin.addClass('active');

               // Constrain width
               if (curr_options.constrainWidth === true) {
                   activates.css('width', origin.outerWidth());

               } else {
                   activates.css('white-space', 'nowrap');
               }

               // Offscreen detection
               var windowHeight = window.innerHeight;
               var originHeight = origin.innerHeight();
               var offsetLeft = origin.offset().left;
               var offsetTop = origin.offset().top - $(window).scrollTop();
               var currAlignment = curr_options.alignment;
               var gutterSpacing = 0;
               var leftPosition = 0;

               // Below Origin
               var verticalOffset = 0;
               if (curr_options.belowOrigin === true) {
                   verticalOffset = originHeight;
               }

               // Check for scrolling positioned container.
               var scrollYOffset = 0;
               var scrollXOffset = 0;
               var wrapper = origin.parent();
               if (!wrapper.is('body')) {
                   if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
                       scrollYOffset = wrapper[0].scrollTop;
                   }
                   if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
                       scrollXOffset = wrapper[0].scrollLeft;
                   }
               }

               if (offsetLeft + activates.innerWidth() > $(window).width()) {
                   // Dropdown goes past screen on right, force right alignment
                   currAlignment = 'right';

               } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
                   // Dropdown goes past screen on left, force left alignment
                   currAlignment = 'left';
               }
               // Vertical bottom offscreen detection
               if (offsetTop + activates.innerHeight() > windowHeight) {
                   // If going upwards still goes offscreen, just crop height of dropdown.
                   if (offsetTop + originHeight - activates.innerHeight() < 0) {
                       var adjustedHeight = windowHeight - offsetTop - verticalOffset;
                       activates.css('max-height', adjustedHeight);
                   } else {
                       // Flow upwards.
                       if (!verticalOffset) {
                           verticalOffset += originHeight;
                       }
                       verticalOffset -= activates.innerHeight();
                   }
               }

               // Handle edge alignment
               if (currAlignment === 'left') {
                   gutterSpacing = curr_options.gutter;
                   leftPosition = origin.position().left + gutterSpacing;
               } else if (currAlignment === 'right') {
                   // Material icons fix
                   activates
                       .stop(true, true)
                       .css({
                           opacity: 0,
                           left: 0
                       })

                   var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
                   gutterSpacing = -curr_options.gutter;
                   leftPosition = offsetRight + gutterSpacing;
               }

               // Position dropdown
               activates.css({
                   position: 'absolute',
                   top: origin.position().top + verticalOffset + scrollYOffset,
                   left: leftPosition + scrollXOffset
               });

               // Show dropdown
               activates
                   .slideDown({
                       queue: false,
                       duration: curr_options.inDuration,
                       easing: 'easeOutCubic',
                       complete: function () {
                           $(this).css('height', );
                       }
                   })
                   .animate({
                       opacity: 1
                   }, {
                       queue: false,
                       duration: curr_options.inDuration,
                       easing: 'easeOutSine'
                   });

               // Add click close handler to document
               setTimeout(function () {
                   $(document).on('click.' + activates.attr('id'), function (e) {
                       hideDropdown();
                       $(document).off('click.' + activates.attr('id'));
                   });
               }, 0);
           }

           function hideDropdown() {
               // Check for simultaneous focus and click events.
               isFocused = false;
               activates.fadeOut(curr_options.outDuration);
               activates.removeClass('active');
               origin.removeClass('active');
               $(document).off('click.' + activates.attr('id'));
               setTimeout(function () {
                   activates.css('max-height', );
               }, curr_options.outDuration);
           }

           // Hover
           if (curr_options.hover) {
               var open = false;
               origin.off('click.' + origin.attr('id'));
               // Hover handler to show dropdown
               origin.on('mouseenter', function (e) { // Mouse over
                   if (open === false) {
                       placeDropdown();
                       open = true;
                   }
               });
               origin.on('mouseleave', function (e) {
                   // If hover on origin then to something other than dropdown content, then close
                   var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
                   if (!$(toEl).closest('.dropdown-content').is(activates)) {
                       activates.stop(true, true);
                       hideDropdown();
                       open = false;
                   }
               });

               activates.on('mouseleave', function (e) { // Mouse out
                   var toEl = e.toElement || e.relatedTarget;
                   if (!$(toEl).closest('.dropdown-button').is(origin)) {
                       activates.stop(true, true);
                       hideDropdown();
                       open = false;
                   }
               });

               // Click
           } else {
               // Click handler to show dropdown
               origin.off('click.' + origin.attr('id'));
               origin.on('click.' + origin.attr('id'), function (e) {
                   if (!isFocused) {
                       if (origin[0] == e.currentTarget &&
                           !origin.hasClass('active') &&
                           ($(e.target).closest('.dropdown-content').length === 0)) {
                           e.preventDefault(); // Prevents button click from moving window
                           if (curr_options.stopPropagation) {
                               e.stopPropagation();
                           }
                           placeDropdown('click');
                       }
                       // If origin is clicked and menu is open, close menu
                       else if (origin.hasClass('active')) {
                           hideDropdown();
                           $(document).off('click.' + activates.attr('id'));
                       }
                   }
               });

           } // End else

           // Listen to open and close event - useful for select component
           origin.on('open', function (e, eventType) {
               placeDropdown(eventType);
           });
           origin.on('close', hideDropdown);

       });
   }; // End dropdown plugin

   $(document).ready(function () {
       $('.dropdown-button').dropdown();
   });

}(jQuery));; (function ($) {

   var _stack = 0,
       _lastID = 0,
       _generateID = function () {
           _lastID++;
           return 'materialize-modal-overlay-' + _lastID;
       };

   var methods = {
       init: function (options) {
           var defaults = {
               opacity: 0.5,
               inDuration: 350,
               outDuration: 250,
               ready: undefined,
               complete: undefined,
               dismissible: true,
               startingTop: '4%',
               endingTop: '10%'
           };

           // Override defaults
           options = $.extend(defaults, options);

           return this.each(function () {
               var $modal = $(this);
               var modal_id = $(this).attr("id") || '#' + $(this).data('target');

               var closeModal = function () {
                   var overlayID = $modal.data('overlay-id');
                   var $overlay = $('#' + overlayID);
                   $modal.removeClass('open');

                   // Enable scrolling
                   $('body').css({
                       overflow: ,
                       width: 
                   });

                   $modal.find('.modal-close').off('click.close');
                   $(document).off('keyup.modal' + overlayID);

                   $overlay.velocity({
                       opacity: 0
                   }, {
                       duration: options.outDuration,
                       queue: false,
                       ease: "easeOutQuart"
                   });

                   // Define Bottom Sheet animation
                   var exitVelocityOptions = {
                       duration: options.outDuration,
                       queue: false,
                       ease: "easeOutCubic",
                       // Handle modal ready callback
                       complete: function () {
                           $(this).css({
                               display: "none"
                           });

                           // Call complete callback
                           if (typeof (options.complete) === "function") {
                               options.complete.call(this, $modal);
                           }
                           $overlay.remove();
                           _stack--;
                       }
                   };
                   if ($modal.hasClass('bottom-sheet')) {
                       $modal.velocity({
                           bottom: "-100%",
                           opacity: 0
                       }, exitVelocityOptions);
                   } else {
                       $modal.velocity({
                               top: options.startingTop,
                               opacity: 0,
                               scaleX: 0.7
                           },
                           exitVelocityOptions
                       );
                   }
               };

               var openModal = function ($trigger) {
                   var $body = $('body');
                   var oldWidth = $body.innerWidth();
                   $body.css('overflow', 'hidden');
                   $body.width(oldWidth);

                   if ($modal.hasClass('open')) {
                       return;
                   }

                   var overlayID = _generateID();

var $overlay = $('');

                   var lStack = (++_stack);

                   // Store a reference of the overlay
                   $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
                   $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
                   $modal.addClass('open');

                   $("body").append($overlay);

                   if (options.dismissible) {
                       $overlay.click(function () {
                           closeModal();
                       });
                       // Return on ESC
                       $(document).on('keyup.modal' + overlayID, function (e) {
                           if (e.keyCode === 27) { // ESC key
                               closeModal();
                           }
                       });
                   }

                   $modal.find(".modal-close").on('click.close', function (e) {
                       closeModal();
                   });

                   $overlay.css({
                       display: "block",
                       opacity: 0
                   });

                   $modal.css({
                       display: "block",
                       opacity: 0
                   });

                   $overlay.velocity({
                       opacity: options.opacity
                   }, {
                       duration: options.inDuration,
                       queue: false,
                       ease: "easeOutCubic"
                   });
                   $modal.data('associated-overlay', $overlay[0]);

                   // Define Bottom Sheet animation
                   var enterVelocityOptions = {
                       duration: options.inDuration,
                       queue: false,
                       ease: "easeOutCubic",
                       // Handle modal ready callback
                       complete: function () {
                           if (typeof (options.ready) === "function") {
                               options.ready.call(this, $modal, $trigger);
                           }
                       }
                   };
                   if ($modal.hasClass('bottom-sheet')) {
                       $modal.velocity({
                           bottom: "0",
                           opacity: 1
                       }, enterVelocityOptions);
                   } else {
                       $.Velocity.hook($modal, "scaleX", 0.7);
                       $modal.css({
                           top: options.startingTop
                       });
                       $modal.velocity({
                           top: options.endingTop,
                           opacity: 1,
                           scaleX: '1'
                       }, enterVelocityOptions);
                   }

               };

               // Reset handlers
               $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
               $(this).off('openModal');
               $(this).off('closeModal');

               // Close Handlers
               $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function (e) {
                   options.startingTop = ($(this).offset().top - $(window).scrollTop()) / 1.15;
                   openModal($(this));
                   e.preventDefault();
               }); // done set on click

               $(this).on('openModal', function () {
                   var modal_id = $(this).attr("href") || '#' + $(this).data('target');
                   openModal();
               });

               $(this).on('closeModal', function () {
                   closeModal();
               });
           }); // done return
       },
       open: function () {
           methods.init.apply(this, arguments);
           $(this).trigger('openModal');
       },
       close: function () {
           $(this).trigger('closeModal');
       }
   };

   $.fn.modal = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
       }
   };

})(jQuery);; (function ($) {

   $.fn.materialbox = function () {

       return this.each(function () {

           if ($(this).hasClass('initialized')) {
               return;
           }

           $(this).addClass('initialized');

           var overlayActive = false;
           var doneAnimating = true;
           var inDuration = 275;
           var outDuration = 200;
           var origin = $(this);

var placeholder = $('').addClass('material-placeholder');

           var originalWidth = 0;
           var originalHeight = 0;
           var ancestorsChanged;
           var ancestor;
           var originInlineStyles = origin.attr('style');
           origin.wrap(placeholder);

           // Start click handler
           origin.on('click', function () {
               var placeholder = origin.parent('.material-placeholder');
               var windowWidth = window.innerWidth;
               var windowHeight = window.innerHeight;
               var originalWidth = origin.width();
               var originalHeight = origin.height();

               // If already modal, return to original
               if (doneAnimating === false) {
                   returnToOriginal();
                   return false;
               } else if (overlayActive && doneAnimating === true) {
                   returnToOriginal();
                   return false;
               }

               // Set states
               doneAnimating = false;
               origin.addClass('active');
               overlayActive = true;

               // Set positioning for placeholder
               placeholder.css({
                   width: placeholder[0].getBoundingClientRect().width,
                   height: placeholder[0].getBoundingClientRect().height,
                   position: 'relative',
                   top: 0,
                   left: 0
               });

               // Find ancestor with overflow: hidden; and remove it
               ancestorsChanged = undefined;
               ancestor = placeholder[0].parentNode;
               var count = 0;
               while (ancestor !== null && !$(ancestor).is(document)) {
                   var curr = $(ancestor);
                   if (curr.css('overflow') !== 'visible') {
                       curr.css('overflow', 'visible');
                       if (ancestorsChanged === undefined) {
                           ancestorsChanged = curr;
                       } else {
                           ancestorsChanged = ancestorsChanged.add(curr);
                       }
                   }
                   ancestor = ancestor.parentNode;
               }

               // Set css on origin
               origin.css({
                       position: 'absolute',
                       'z-index': 1000,
                       'will-change': 'left, top, width, height'
                   })
                   .data('width', originalWidth)
                   .data('height', originalHeight);

               // Add overlay

var overlay = $('')

                   .css({
                       opacity: 0
                   })
                   .click(function () {
                       if (doneAnimating === true)
                           returnToOriginal();
                   });

               // Put before in origin image to preserve z-index layering.
               origin.before(overlay);

               // Set dimensions if needed
               var overlayOffset = overlay[0].getBoundingClientRect();
               overlay.css({
                   width: windowWidth,
                   height: windowHeight,
                   left: -1 * overlayOffset.left,
                   top: -1 * overlayOffset.top
               })

               // Animate Overlay
               overlay.velocity({
                   opacity: 1
               }, {
                   duration: inDuration,
                   queue: false,
                   easing: 'easeOutQuad'
               });

               // Add and animate caption if it exists
               if (origin.data('caption') !== "") {

var $photo_caption = $('');

                   $photo_caption.text(origin.data('caption'));
                   $('body').append($photo_caption);
                   $photo_caption.css({
                       "display": "inline"
                   });
                   $photo_caption.velocity({
                       opacity: 1
                   }, {
                       duration: inDuration,
                       queue: false,
                       easing: 'easeOutQuad'
                   });
               }

               // Resize Image
               var ratio = 0;
               var widthPercent = originalWidth / windowWidth;
               var heightPercent = originalHeight / windowHeight;
               var newWidth = 0;
               var newHeight = 0;

               if (widthPercent > heightPercent) {
                   ratio = originalHeight / originalWidth;
                   newWidth = windowWidth * 0.9;
                   newHeight = windowWidth * 0.9 * ratio;
               } else {
                   ratio = originalWidth / originalHeight;
                   newWidth = (windowHeight * 0.9) * ratio;
                   newHeight = windowHeight * 0.9;
               }

               // Animate image + set z-index
               if (origin.hasClass('responsive-img')) {
                   origin.velocity({
                       'max-width': newWidth,
                       'width': originalWidth
                   }, {
                       duration: 0,
                       queue: false,
                       complete: function () {
                               origin.css({
                                       left: 0,
                                       top: 0
                                   })
                                   .velocity({
                                       height: newHeight,
                                       width: newWidth,
                                       left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
                                       top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
                                   }, {
                                       duration: inDuration,
                                       queue: false,
                                       easing: 'easeOutQuad',
                                       complete: function () {
                                           doneAnimating = true;
                                       }
                                   });
                           } // End Complete
                   }); // End Velocity
               } else {
                   origin.css('left', 0)
                       .css('top', 0)
                       .velocity({
                           height: newHeight,
                           width: newWidth,
                           left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
                           top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
                       }, {
                           duration: inDuration,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               doneAnimating = true;
                           }
                       }); // End Velocity
               }

               // Handle Exit triggers
               $(window).on('scroll.materialbox', function () {
                   if (overlayActive) {
                       returnToOriginal();
                   }
               });

               $(window).on('resize.materialbox', function () {
                   if (overlayActive) {
                       returnToOriginal();
                   }
               });

               $(document).on('keyup.materialbox', function (e) {
                   // ESC key
                   if (e.keyCode === 27 &&
                       doneAnimating === true &&
                       overlayActive) {
                       returnToOriginal();
                   }
               });

           }); // End click handler

           // This function returns the modaled image to the original spot
           function returnToOriginal() {

               doneAnimating = false;

               var placeholder = origin.parent('.material-placeholder');
               var windowWidth = window.innerWidth;
               var windowHeight = window.innerHeight;
               var originalWidth = origin.data('width');
               var originalHeight = origin.data('height');

               origin.velocity("stop", true);
               $('#materialbox-overlay').velocity("stop", true);
               $('.materialbox-caption').velocity("stop", true);

               // disable exit handlers
               $(window).off('scroll.materialbox');
               $(document).off('keyup.materialbox');
               $(window).off('resize.materialbox');

               $('#materialbox-overlay').velocity({
                   opacity: 0
               }, {
                   duration: outDuration, // Delay prevents animation overlapping
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       // Remove Overlay
                       overlayActive = false;
                       $(this).remove();
                   }
               });

               // Resize Image
               origin.velocity({
                   width: originalWidth,
                   height: originalHeight,
                   left: 0,
                   top: 0
               }, {
                   duration: outDuration,
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       placeholder.css({
                           height: ,
                           width: ,
                           position: ,
                           top: ,
                           left: 
                       });

                       origin.removeAttr('style');
                       origin.attr('style', originInlineStyles);

                       // Remove class
                       origin.removeClass('active');
                       doneAnimating = true;

                       // Remove overflow overrides on ancestors
                       if (ancestorsChanged) {
                           ancestorsChanged.css('overflow', );
                       }
                   }
               });

               // Remove Caption + reset css settings on image
               $('.materialbox-caption').velocity({
                   opacity: 0
               }, {
                   duration: outDuration, // Delay prevents animation overlapping
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       $(this).remove();
                   }
               });

           }
       });
   };

   $(document).ready(function () {
       $('.materialboxed').materialbox();
   });

}(jQuery));; (function ($) {

   $.fn.parallax = function () {
       var window_width = $(window).width();
       // Parallax Scripts
       return this.each(function (i) {
           var $this = $(this);
           $this.addClass('parallax');

           function updateParallax(initial) {
               var container_height;
               if (window_width < 601) {
                   container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
               } else {
                   container_height = ($this.height() > 0) ? $this.height() : 500;
               }
               var $img = $this.children("img").first();
               var img_height = $img.height();
               var parallax_dist = img_height - container_height;
               var bottom = $this.offset().top + container_height;
               var top = $this.offset().top;
               var scrollTop = $(window).scrollTop();
               var windowHeight = window.innerHeight;
               var windowBottom = scrollTop + windowHeight;
               var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
               var parallax = Math.round((parallax_dist * percentScrolled));

               if (initial) {
                   $img.css('display', 'block');
               }
               if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
                   $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
               }

           }

           // Wait for image load
           $this.children("img").one("load", function () {
               updateParallax(true);
           }).each(function () {
               if (this.complete) $(this).trigger("load");
           });

           $(window).scroll(function () {
               window_width = $(window).width();
               updateParallax(false);
           });

           $(window).resize(function () {
               window_width = $(window).width();
               updateParallax(false);
           });

       });

   };

}(jQuery));; (function ($) {

   var methods = {
       init: function (options) {
           var defaults = {
               onShow: null,
               swipeable: false,
               responsiveThreshold: Infinity, // breakpoint for swipeable
           };
           options = $.extend(defaults, options);
           var namespace = Materialize.objectSelectorString($(this));

           return this.each(function (i) {

               var uniqueNamespace = namespace + i;

               // For each set of tabs, we want to keep track of
               // which tab is active and its associated content
               var $this = $(this),
                   window_width = $(window).width();

               var $active, $content, $links = $this.find('li.tab a'),
                   $tabs_width = $this.width(),
                   $tabs_content = $(),
                   $tabs_wrapper,
                   $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
                   $indicator,
                   index = prev_index = 0,
                   clicked = false,
                   clickedTimeout,
                   transition = 300;

               // Finds right attribute for indicator based on active tab.
               // el: jQuery Object
               var calcRightPos = function (el) {
                   return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft());
               };

               // Finds left attribute for indicator based on active tab.
               // el: jQuery Object
               var calcLeftPos = function (el) {
                   return Math.floor(el.position().left + $this.scrollLeft());
               };

               // Animates Indicator to active tab.
               // prev_index: Number
               var animateIndicator = function (prev_index) {
                   if ((index - prev_index) >= 0) {
                       $indicator.velocity({
                           "right": calcRightPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $indicator.velocity({
                           "left": calcLeftPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad',
                           delay: 90
                       });

                   } else {
                       $indicator.velocity({
                           "left": calcLeftPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $indicator.velocity({
                           "right": calcRightPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad',
                           delay: 90
                       });
                   }
               };

               // Change swipeable according to responsive threshold
               if (options.swipeable) {
                   if (window_width > options.responsiveThreshold) {
                       options.swipeable = false;
                   }
               }

               // If the location.hash matches one of the links, use that as the active tab.
               $active = $($links.filter('[href="' + location.hash + '"]'));

               // If no match is found, use the first link or any with class 'active' as the initial active tab.
               if ($active.length === 0) {
                   $active = $(this).find('li.tab a.active').first();
               }
               if ($active.length === 0) {
                   $active = $(this).find('li.tab a').first();
               }

               $active.addClass('active');
               index = $links.index($active);
               if (index < 0) {
                   index = 0;
               }

               if ($active[0] !== undefined) {
                   $content = $($active[0].hash);
                   $content.addClass('active');
               }

               // append indicator then set indicator width to tab width
               if (!$this.find('.indicator').length) {

$this.append('

');

               }
               $indicator = $this.find('.indicator');

               // we make sure that the indicator is at the end of the tabs
               $this.append($indicator);

               if ($this.is(":visible")) {
                   // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
                   // $indicator.css({"left": index * $tab_width});
                   setTimeout(function () {
                       $indicator.css({
                           "right": calcRightPos($active)
                       });
                       $indicator.css({
                           "left": calcLeftPos($active)
                       });
                   }, 0);
               }
               $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
                   $tabs_width = $this.width();
                   $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
                   if (index < 0) {
                       index = 0;
                   }
                   if ($tab_width !== 0 && $tabs_width !== 0) {
                       $indicator.css({
                           "right": calcRightPos($active)
                       });
                       $indicator.css({
                           "left": calcLeftPos($active)
                       });
                   }
               });

               // Initialize Tabs Content.
               if (options.swipeable) {
                   // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
                   $links.each(function () {
                       var $curr_content = $(Materialize.escapeHash(this.hash));
                       $curr_content.addClass('carousel-item');
                       $tabs_content = $tabs_content.add($curr_content);
                   });

$tabs_wrapper = $tabs_content.wrapAll('');

                   $tabs_content.css('display', );
                   $('.tabs-content.carousel').carousel({
                       fullWidth: true,
                       noWrap: true,
                       onCycleTo: function (item) {
                           if (!clicked) {
                               var prev_index = index;
                               index = $tabs_wrapper.index(item);
                               $active = $links.eq(index);
                               animateIndicator(prev_index);
                               if (typeof (options.onShow) === "function") {
                                   options.onShow.call($this[0], $content);
                               }
                           }
                       },
                   });
               } else {
                   // Hide the remaining content
                   $links.not($active).each(function () {
                       $(Materialize.escapeHash(this.hash)).hide();
                   });
               }

               // Bind the click event handler
               $this.off('click.tabs').on('click.tabs', 'a', function (e) {
                   if ($(this).parent().hasClass('disabled')) {
                       e.preventDefault();
                       return;
                   }

                   // Act as regular link if target attribute is specified.
                   if (!!$(this).attr("target")) {
                       return;
                   }

                   clicked = true;
                   $tabs_width = $this.width();
                   $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;

                   // Make the old tab inactive.
                   $active.removeClass('active');
                   var $oldContent = $content

                   // Update the variables with the new link and content
                   $active = $(this);
                   $content = $(Materialize.escapeHash(this.hash));
                   $links = $this.find('li.tab a');
                   var activeRect = $active.position();

                   // Make the tab active.
                   $active.addClass('active');
                   prev_index = index;
                   index = $links.index($(this));
                   if (index < 0) {
                       index = 0;
                   }
                   // Change url to current tab
                   // window.location.hash = $active.attr('href');

                   // Swap content
                   if (options.swipeable) {
                       if ($tabs_content.length) {
                           $tabs_content.carousel('set', index, function () {
                               if (typeof (options.onShow) === "function") {
                                   options.onShow.call($this[0], $content);
                               }
                           });
                       }
                   } else {
                       if ($content !== undefined) {
                           $content.show();
                           $content.addClass('active');
                           if (typeof (options.onShow) === "function") {
                               options.onShow.call(this, $content);
                           }
                       }

                       if ($oldContent !== undefined &&
                           !$oldContent.is($content)) {
                           $oldContent.hide();
                           $oldContent.removeClass('active');
                       }
                   }

                   // Reset clicked state
                   clickedTimeout = setTimeout(function () {
                       clicked = false;
                   }, transition);

                   // Update indicator
                   animateIndicator(prev_index);

                   // Prevent the anchor's default click action
                   e.preventDefault();
               });
           });

       },
       select_tab: function (id) {
           this.find('a[href="#' + id + '"]').trigger('click');
       }
   };

   $.fn.tabs = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
       }
   };

   $(document).ready(function () {
       $('ul.tabs').tabs();
   });

}(jQuery));; (function ($) {

   $.fn.tooltip = function (options) {
       var timeout = null,
           margin = 5;

       // Defaults
       var defaults = {
           delay: 350,
           tooltip: ,
           position: 'bottom',
           html: false
       };

       // Remove tooltip from the activator
       if (options === "remove") {
           this.each(function () {
               $('#' + $(this).attr('data-tooltip-id')).remove();
               $(this).off('mouseenter.tooltip mouseleave.tooltip');
           });
           return false;
       }

       options = $.extend(defaults, options);

       return this.each(function () {
           var tooltipId = Materialize.guid();
           var origin = $(this);

           // Destroy old tooltip
           if (origin.attr('data-tooltip-id')) {
               $('#' + origin.attr('data-tooltip-id')).remove();
           }

           origin.attr('data-tooltip-id', tooltipId);

           // Get attributes.
           var allowHtml,
               tooltipDelay,
               tooltipPosition,
               tooltipText,
               tooltipEl,
               backdrop;
           var setAttributes = function () {
               allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
               tooltipDelay = origin.attr('data-delay');
               tooltipDelay = (tooltipDelay === undefined || tooltipDelay === ) ?
                   options.delay : tooltipDelay;
               tooltipPosition = origin.attr('data-position');
               tooltipPosition = (tooltipPosition === undefined || tooltipPosition === ) ?
                   options.position : tooltipPosition;
               tooltipText = origin.attr('data-tooltip');
               tooltipText = (tooltipText === undefined || tooltipText === ) ?
                   options.tooltip : tooltipText;
           };
           setAttributes();

           var renderTooltipEl = function () {

var tooltip = $('');

               // Create Text span
               if (allowHtml) {
                   tooltipText = $('').html(tooltipText);
               } else {
                   tooltipText = $('').text(tooltipText);
               }

               // Create tooltip
               tooltip.append(tooltipText)
                   .appendTo($('body'))
                   .attr('id', tooltipId);

               // Create backdrop

backdrop = $('');

               backdrop.appendTo(tooltip);
               return tooltip;
           };
           tooltipEl = renderTooltipEl();

           // Destroy previously binded events
           origin.off('mouseenter.tooltip mouseleave.tooltip');
           // Mouse In
           var started = false,
               timeoutRef;
           origin.on({
               'mouseenter.tooltip': function (e) {
                   var showTooltip = function () {
                       setAttributes();
                       started = true;
                       tooltipEl.velocity('stop');
                       backdrop.velocity('stop');
                       tooltipEl.css({
                           visibility: 'visible',
                           left: '0px',
                           top: '0px'
                       });

                       // Tooltip positioning
                       var originWidth = origin.outerWidth();
                       var originHeight = origin.outerHeight();
                       var tooltipHeight = tooltipEl.outerHeight();
                       var tooltipWidth = tooltipEl.outerWidth();
                       var tooltipVerticalMovement = '0px';
                       var tooltipHorizontalMovement = '0px';
                       var backdropOffsetWidth = backdrop[0].offsetWidth;
                       var backdropOffsetHeight = backdrop[0].offsetHeight;
                       var scaleXFactor = 8;
                       var scaleYFactor = 8;
                       var scaleFactor = 0;
                       var targetTop, targetLeft, newCoordinates;

                       if (tooltipPosition === "top") {
                           // Top Position
                           targetTop = origin.offset().top - tooltipHeight - margin;
                           targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                           newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                           tooltipVerticalMovement = '-10px';
                           backdrop.css({
                               bottom: 0,
                               left: 0,
                               borderRadius: '14px 14px 0 0',
                               transformOrigin: '50% 100%',
                               marginTop: tooltipHeight,
                               marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
                           });
                       }
                       // Left Position
                       else if (tooltipPosition === "left") {
                           targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                           targetLeft = origin.offset().left - tooltipWidth - margin;
                           newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);

                           tooltipHorizontalMovement = '-10px';
                           backdrop.css({
                               top: '-7px',
                               right: 0,
                               width: '14px',
                               height: '14px',
                               borderRadius: '14px 0 0 14px',
                               transformOrigin: '95% 50%',
                               marginTop: tooltipHeight / 2,
                               marginLeft: tooltipWidth
                           });
                       }
                       // Right Position
                       else if (tooltipPosition === "right") {
                           targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                           targetLeft = origin.offset().left + originWidth + margin;
                           newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);

                           tooltipHorizontalMovement = '+10px';
                           backdrop.css({
                               top: '-7px',
                               left: 0,
                               width: '14px',
                               height: '14px',
                               borderRadius: '0 14px 14px 0',
                               transformOrigin: '5% 50%',
                               marginTop: tooltipHeight / 2,
                               marginLeft: '0px'
                           });
                       } else {
                           // Bottom Position
                           targetTop = origin.offset().top + origin.outerHeight() + margin;
                           targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                           newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                           tooltipVerticalMovement = '+10px';
                           backdrop.css({
                               top: 0,
                               left: 0,
                               marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
                           });
                       }

                       // Set tooptip css placement
                       tooltipEl.css({
                           top: newCoordinates.y,
                           left: newCoordinates.x
                       });

                       // Calculate Scale to fill
                       scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
                       scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
                       scaleFactor = Math.max(scaleXFactor, scaleYFactor);

                       tooltipEl.velocity({
                               translateY: tooltipVerticalMovement,
                               translateX: tooltipHorizontalMovement
                           }, {
                               duration: 350,
                               queue: false
                           })
                           .velocity({
                               opacity: 1
                           }, {
                               duration: 300,
                               delay: 50,
                               queue: false
                           });
                       backdrop.css({
                               visibility: 'visible'
                           })
                           .velocity({
                               opacity: 1
                           }, {
                               duration: 55,
                               delay: 0,
                               queue: false
                           })
                           .velocity({
                               scaleX: scaleFactor,
                               scaleY: scaleFactor
                           }, {
                               duration: 300,
                               delay: 0,
                               queue: false,
                               easing: 'easeInOutQuad'
                           });
                   };

                   timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval

                   // Mouse Out
               },
               'mouseleave.tooltip': function () {
                   // Reset State
                   started = false;
                   clearTimeout(timeoutRef);

                   // Animate back
                   setTimeout(function () {
                       if (started !== true) {
                           tooltipEl.velocity({
                               opacity: 0,
                               translateY: 0,
                               translateX: 0
                           }, {
                               duration: 225,
                               queue: false
                           });
                           backdrop.velocity({
                               opacity: 0,
                               scaleX: 1,
                               scaleY: 1
                           }, {
                               duration: 225,
                               queue: false,
                               complete: function () {
                                   backdrop.css({
                                       visibility: 'hidden'
                                   });
                                   tooltipEl.css({
                                       visibility: 'hidden'
                                   });
                                   started = false;
                               }
                           });
                       }
                   }, 225);
               }
           });
       });
   };

   var repositionWithinScreen = function (x, y, width, height) {
       var newX = x;
       var newY = y;

       if (newX < 0) {
           newX = 4;
       } else if (newX + width > window.innerWidth) {
           newX -= newX + width - window.innerWidth;
       }

       if (newY < 0) {
           newY = 4;
       } else if (newY + height > window.innerHeight + $(window).scrollTop) {
           newY -= newY + height - window.innerHeight;
       }

       return {
           x: newX,
           y: newY
       };
   };

   $(document).ready(function () {
       $('.tooltipped').tooltip();
   });

}(jQuery));; /*!

* Waves v0.6.4
* http://fian.my.id/Waves
*
* Copyright 2014 Alfiana E. Sibuea and other contributors
* Released under the MIT license
* https://github.com/fians/Waves/blob/master/LICENSE
*/

(function (window) {

   'use strict';

   var Waves = Waves || {};
   var $$ = document.querySelectorAll.bind(document);

   // Find exact position of element
   function isWindow(obj) {
       return obj !== null && obj === obj.window;
   }

   function getWindow(elem) {
       return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
   }

   function offset(elem) {
       var docElem, win,
           box = {
               top: 0,
               left: 0
           },
           doc = elem && elem.ownerDocument;

       docElem = doc.documentElement;

       if (typeof elem.getBoundingClientRect !== typeof undefined) {
           box = elem.getBoundingClientRect();
       }
       win = getWindow(doc);
       return {
           top: box.top + win.pageYOffset - docElem.clientTop,
           left: box.left + win.pageXOffset - docElem.clientLeft
       };
   }

   function convertStyle(obj) {
       var style = ;

       for (var a in obj) {
           if (obj.hasOwnProperty(a)) {
               style += (a + ':' + obj[a] + ';');
           }
       }

       return style;
   }

   var Effect = {

       // Effect delay
       duration: 750,

       show: function (e, element) {

           // Disable right click
           if (e.button === 2) {
               return false;
           }

           var el = element || this;

           // Create ripple
           var ripple = document.createElement('div');
           ripple.className = 'waves-ripple';
           el.appendChild(ripple);

           // Get click coordinate and element witdh
           var pos = offset(el);
           var relativeY = (e.pageY - pos.top);
           var relativeX = (e.pageX - pos.left);
           var scale = 'scale(' + ((el.clientWidth / 100) * 10) + ')';

           // Support for touch devices
           if ('touches' in e) {
               relativeY = (e.touches[0].pageY - pos.top);
               relativeX = (e.touches[0].pageX - pos.left);
           }

           // Attach data to element
           ripple.setAttribute('data-hold', Date.now());
           ripple.setAttribute('data-scale', scale);
           ripple.setAttribute('data-x', relativeX);
           ripple.setAttribute('data-y', relativeY);

           // Set ripple position
           var rippleStyle = {
               'top': relativeY + 'px',
               'left': relativeX + 'px'
           };

           ripple.className = ripple.className + ' waves-notransition';
           ripple.setAttribute('style', convertStyle(rippleStyle));
           ripple.className = ripple.className.replace('waves-notransition', );

           // Scale the ripple
           rippleStyle['-webkit-transform'] = scale;
           rippleStyle['-moz-transform'] = scale;
           rippleStyle['-ms-transform'] = scale;
           rippleStyle['-o-transform'] = scale;
           rippleStyle.transform = scale;
           rippleStyle.opacity = '1';

           rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
           rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
           rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
           rippleStyle['transition-duration'] = Effect.duration + 'ms';

           rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
           rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
           rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
           rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';

           ripple.setAttribute('style', convertStyle(rippleStyle));
       },

       hide: function (e) {
           TouchHandler.touchup(e);

           var el = this;
           var width = el.clientWidth * 1.4;

           // Get first ripple
           var ripple = null;
           var ripples = el.getElementsByClassName('waves-ripple');
           if (ripples.length > 0) {
               ripple = ripples[ripples.length - 1];
           } else {
               return false;
           }

           var relativeX = ripple.getAttribute('data-x');
           var relativeY = ripple.getAttribute('data-y');
           var scale = ripple.getAttribute('data-scale');

           // Get delay beetween mousedown and mouse leave
           var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
           var delay = 350 - diff;

           if (delay < 0) {
               delay = 0;
           }

           // Fade out ripple after delay
           setTimeout(function () {
               var style = {
                   'top': relativeY + 'px',
                   'left': relativeX + 'px',
                   'opacity': '0',

                   // Duration
                   '-webkit-transition-duration': Effect.duration + 'ms',
                   '-moz-transition-duration': Effect.duration + 'ms',
                   '-o-transition-duration': Effect.duration + 'ms',
                   'transition-duration': Effect.duration + 'ms',
                   '-webkit-transform': scale,
                   '-moz-transform': scale,
                   '-ms-transform': scale,
                   '-o-transform': scale,
                   'transform': scale,
               };

               ripple.setAttribute('style', convertStyle(style));

               setTimeout(function () {
                   try {
                       el.removeChild(ripple);
                   } catch (e) {
                       return false;
                   }
               }, Effect.duration);
           }, delay);
       },

       // Little hack to make <input> can perform waves effect
       wrapInput: function (elements) {
           for (var a = 0; a < elements.length; a++) {
               var el = elements[a];

               if (el.tagName.toLowerCase() === 'input') {
                   var parent = el.parentNode;

                   // If input already have parent just pass through
                   if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
                       continue;
                   }

                   // Put element class and style to the specified parent
                   var wrapper = document.createElement('i');
                   wrapper.className = el.className + ' waves-input-wrapper';

                   var elementStyle = el.getAttribute('style');

                   if (!elementStyle) {
                       elementStyle = ;
                   }

                   wrapper.setAttribute('style', elementStyle);

                   el.className = 'waves-button-input';
                   el.removeAttribute('style');

                   // Put element as child
                   parent.replaceChild(wrapper, el);
                   wrapper.appendChild(el);
               }
           }
       }
   };

   /**
    * Disable mousedown event for 500ms during and after touch
    */
   var TouchHandler = {
       /* uses an integer rather than bool so there's no issues with
        * needing to clear timeouts if another touch event occurred
        * within the 500ms. Cannot mouseup between touchstart and
        * touchend, nor in the 500ms after touchend. */
       touches: 0,
       allowEvent: function (e) {
           var allow = true;

           if (e.type === 'touchstart') {
               TouchHandler.touches += 1; //push
           } else if (e.type === 'touchend' || e.type === 'touchcancel') {
               setTimeout(function () {
                   if (TouchHandler.touches > 0) {
                       TouchHandler.touches -= 1; //pop after 500ms
                   }
               }, 500);
           } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
               allow = false;
           }

           return allow;
       },
       touchup: function (e) {
           TouchHandler.allowEvent(e);
       }
   };

   /**
    * Delegated click handler for .waves-effect element.
    * returns null when .waves-effect element not in "click tree"
    */
   function getWavesEffectElement(e) {
       if (TouchHandler.allowEvent(e) === false) {
           return null;
       }

       var element = null;
       var target = e.target || e.srcElement;

       while (target.parentElement !== null) {
           if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
               element = target;
               break;
           } else if (target.className.indexOf('waves-effect') !== -1) {
               element = target;
               break;
           }
           target = target.parentElement;
       }

       return element;
   }

   /**
    * Bubble the click and show effect if .waves-effect elem was found
    */
   function showEffect(e) {
       var element = getWavesEffectElement(e);

       if (element !== null) {
           Effect.show(e, element);

           if ('ontouchstart' in window) {
               element.addEventListener('touchend', Effect.hide, false);
               element.addEventListener('touchcancel', Effect.hide, false);
           }

           element.addEventListener('mouseup', Effect.hide, false);
           element.addEventListener('mouseleave', Effect.hide, false);
       }
   }

   Waves.displayEffect = function (options) {
       options = options || {};

       if ('duration' in options) {
           Effect.duration = options.duration;
       }

       //Wrap input inside  tag
       Effect.wrapInput($$('.waves-effect'));

       if ('ontouchstart' in window) {
           document.body.addEventListener('touchstart', showEffect, false);
       }

       document.body.addEventListener('mousedown', showEffect, false);
   };

   /**
    * Attach Waves to an input element (or any element which doesn't
    * bubble mouseup/mousedown events).
    *   Intended to be used with dynamically loaded forms/inputs, or
    * where the user doesn't want a delegated click handler.
    */
   Waves.attach = function (element) {
       //FUTURE: automatically add waves classes and allow users
       // to specify them with an options param? Eg. light/classic/button
       if (element.tagName.toLowerCase() === 'input') {
           Effect.wrapInput([element]);
           element = element.parentElement;
       }

       if ('ontouchstart' in window) {
           element.addEventListener('touchstart', showEffect, false);
       }

       element.addEventListener('mousedown', showEffect, false);
   };

   window.Waves = Waves;

   document.addEventListener('DOMContentLoaded', function () {
       Waves.displayEffect();
   }, false);

})(window);; Materialize.toast = function (message, displayLength, className, completeCallback) {

   className = className || "";

   var container = document.getElementById('toast-container');

   // Create toast container if it does not exist
   if (container === null) {
       // create notification container
       container = document.createElement('div');
       container.id = 'toast-container';
       document.body.appendChild(container);
   }

   // Select and append toast
   var newToast = createToast(message);

   // only append toast if message is not undefined
   if (message) {
       container.appendChild(newToast);
   }

   newToast.style.opacity = 0;

   // Animate toast in
   Vel(newToast, {
       translateY: '-35px',
       opacity: 1
   }, {
       duration: 300,
       easing: 'easeOutCubic',
       queue: false
   });

   // Allows timer to be pause while being panned
   var timeLeft = displayLength;
   var counterInterval;
   if (timeLeft != null) {
       counterInterval = setInterval(function () {
           if (newToast.parentNode === null)
               window.clearInterval(counterInterval);

           // If toast is not being dragged, decrease its time remaining
           if (!newToast.classList.contains('panning')) {
               timeLeft -= 20;
           }

           if (timeLeft <= 0) {
               // Animate toast out
               Vel(newToast, {
                   "opacity": 0,
                   marginTop: '-40px'
               }, {
                   duration: 375,
                   easing: 'easeOutExpo',
                   queue: false,
                   complete: function () {
                       // Call the optional callback
                       if (typeof (completeCallback) === "function")
                           completeCallback();
                       // Remove toast after it times out
                       this[0].parentNode.removeChild(this[0]);
                   }
               });
               window.clearInterval(counterInterval);
           }
       }, 20);
   }

   function createToast(html) {

       // Create toast
       var toast = document.createElement('div');
       toast.classList.add('toast');
       if (className) {
           var classes = className.split(' ');

           for (var i = 0, count = classes.length; i < count; i++) {
               toast.classList.add(classes[i]);
           }
       }
       // If type of parameter is HTML Element
       if (typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName === "string") {
           toast.appendChild(html);
       } else if (html instanceof jQuery) {
           // Check if it is jQuery object
           toast.appendChild(html[0]);
       } else {
           // Insert as text;
           toast.innerHTML = html;
       }
       // Bind hammer
       var hammerHandler = new Hammer(toast, {
           prevent_default: false
       });
       hammerHandler.on('pan', function (e) {
           var deltaX = e.deltaX;
           var activationDistance = 80;

           // Change toast state
           if (!toast.classList.contains('panning')) {
               toast.classList.add('panning');
           }

           var opacityPercent = 1 - Math.abs(deltaX / activationDistance);
           if (opacityPercent < 0)
               opacityPercent = 0;

           Vel(toast, {
               left: deltaX,
               opacity: opacityPercent
           }, {
               duration: 50,
               queue: false,
               easing: 'easeOutQuad'
           });

       });

       hammerHandler.on('panend', function (e) {
           var deltaX = e.deltaX;
           var activationDistance = 80;

           // If toast dragged past activation point
           if (Math.abs(deltaX) > activationDistance) {
               Vel(toast, {
                   marginTop: '-40px'
               }, {
                   duration: 375,
                   easing: 'easeOutExpo',
                   queue: false,
                   complete: function () {
                       if (typeof (completeCallback) === "function") {
                           completeCallback();
                       }
                       toast.parentNode.removeChild(toast);
                   }
               });

           } else {
               toast.classList.remove('panning');
               // Put toast back into original position
               Vel(toast, {
                   left: 0,
                   opacity: 1
               }, {
                   duration: 300,
                   easing: 'easeOutExpo',
                   queue: false
               });

           }
       });

       return toast;
   }

};; (function ($) {

   var methods = {
       init: function (options) {
           var defaults = {
               menuWidth: 300,
               edge: 'left',
               closeOnClick: false,
               draggable: true,
               onOpen: null,
               onClose: null
           };
           options = $.extend(defaults, options);

           $(this).each(function () {
               var $this = $(this);
               var menuId = $this.attr('data-activates');
               var menu = $("#" + menuId);

               // Set to width
               if (options.menuWidth != 300) {
                   menu.css('width', options.menuWidth);
               }

               // Add Touch Area
               var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
               if (options.draggable) {
                   // Regenerate dragTarget
                   if ($dragTarget.length) {
                       $dragTarget.remove();
                   }

$dragTarget = $('

').attr('data-sidenav', menuId);

                   $('body').append($dragTarget);
               } else {
                   $dragTarget = $();
               }

               if (options.edge == 'left') {
                   menu.css('transform', 'translateX(-100%)');
                   $dragTarget.css({
                       'left': 0
                   }); // Add Touch Area
               } else {
                   menu.addClass('right-aligned') // Change text-alignment to right
                       .css('transform', 'translateX(100%)');
                   $dragTarget.css({
                       'right': 0
                   }); // Add Touch Area
               }

               // If fixed sidenav, bring menu out
               if (menu.hasClass('fixed')) {
                   if (window.innerWidth > 992) {
                       menu.css('transform', 'translateX(0)');
                   }
               }

               // Window resize to reset on large screens fixed
               if (menu.hasClass('fixed')) {
                   $(window).resize(function () {
                       if (window.innerWidth > 992) {
                           // Close menu if window is resized bigger than 992 and user has fixed sidenav
                           if ($('#sidenav-overlay').length !== 0 && menuOut) {
                               removeMenu(true);
                           } else {
                               // menu.removeAttr('style');
                               menu.css('transform', 'translateX(0%)');
                               // menu.css('width', options.menuWidth);
                           }
                       } else if (menuOut === false) {
                           if (options.edge === 'left') {
                               menu.css('transform', 'translateX(-100%)');
                           } else {
                               menu.css('transform', 'translateX(100%)');
                           }

                       }

                   });
               }

               // if closeOnClick, then add close event for all a tags in side sideNav
               if (options.closeOnClick === true) {
                   menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
                       if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
                           removeMenu();
                       }
                   });
               }

               var removeMenu = function (restoreNav) {
                   panning = false;
                   menuOut = false;
                   // Reenable scrolling
                   $('body').css({
                       overflow: ,
                       width: 
                   });

                   $('#sidenav-overlay').velocity({
                       opacity: 0
                   }, {
                       duration: 200,
                       queue: false,
                       easing: 'easeOutQuad',
                       complete: function () {
                           $(this).remove();
                       }
                   });
                   if (options.edge === 'left') {
                       // Reset phantom div
                       $dragTarget.css({
                           width: ,
                           right: ,
                           left: '0'
                       });
                       menu.velocity({
                           'translateX': '-100%'
                       }, {
                           duration: 200,
                           queue: false,
                           easing: 'easeOutCubic',
                           complete: function () {
                               if (restoreNav === true) {
                                   // Restore Fixed sidenav
                                   menu.removeAttr('style');
                                   menu.css('width', options.menuWidth);
                               }
                           }

                       });
                   } else {
                       // Reset phantom div
                       $dragTarget.css({
                           width: ,
                           right: '0',
                           left: 
                       });
                       menu.velocity({
                           'translateX': '100%'
                       }, {
                           duration: 200,
                           queue: false,
                           easing: 'easeOutCubic',
                           complete: function () {
                               if (restoreNav === true) {
                                   // Restore Fixed sidenav
                                   menu.removeAttr('style');
                                   menu.css('width', options.menuWidth);
                               }
                           }
                       });
                   }

                   // Callback
                   if (typeof (options.onClose) === 'function') {
                       options.onClose.call(this, menu);
                   }
               }

               // Touch Event
               var panning = false;
               var menuOut = false;

               if (options.draggable) {
                   $dragTarget.on('click', function () {
                       if (menuOut) {
                           removeMenu();
                       }
                   });

                   $dragTarget.hammer({
                       prevent_default: false
                   }).on('pan', function (e) {

                       if (e.gesture.pointerType == "touch") {

                           var direction = e.gesture.direction;
                           var x = e.gesture.center.x;
                           var y = e.gesture.center.y;
                           var velocityX = e.gesture.velocityX;

                           // Vertical scroll bugfix
                           if (x === 0 && y === 0) {
                               return;
                           }

                           // Disable Scrolling
                           var $body = $('body');
                           var $overlay = $('#sidenav-overlay');
                           var oldWidth = $body.innerWidth();
                           $body.css('overflow', 'hidden');
                           $body.width(oldWidth);

                           // If overlay does not exist, create one and if it is clicked, close menu
                           if ($overlay.length === 0) {

$overlay = $('

');

                               $overlay.css('opacity', 0).click(function () {
                                   removeMenu();
                               });

                               // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
                               if (typeof (options.onOpen) === 'function') {
                                   options.onOpen.call(this, menu);
                               }

                               $('body').append($overlay);
                           }

                           // Keep within boundaries
                           if (options.edge === 'left') {
                               if (x > options.menuWidth) {
                                   x = options.menuWidth;
                               } else if (x < 0) {
                                   x = 0;
                               }
                           }

                           if (options.edge === 'left') {
                               // Left Direction
                               if (x < (options.menuWidth / 2)) {
                                   menuOut = false;
                               }
                               // Right Direction
                               else if (x >= (options.menuWidth / 2)) {
                                   menuOut = true;
                               }
                               menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
                           } else {
                               // Left Direction
                               if (x < (window.innerWidth - options.menuWidth / 2)) {
                                   menuOut = true;
                               }
                               // Right Direction
                               else if (x >= (window.innerWidth - options.menuWidth / 2)) {
                                   menuOut = false;
                               }
                               var rightPos = (x - options.menuWidth / 2);
                               if (rightPos < 0) {
                                   rightPos = 0;
                               }

                               menu.css('transform', 'translateX(' + rightPos + 'px)');
                           }

                           // Percentage overlay
                           var overlayPerc;
                           if (options.edge === 'left') {
                               overlayPerc = x / options.menuWidth;
                               $overlay.velocity({
                                   opacity: overlayPerc
                               }, {
                                   duration: 10,
                                   queue: false,
                                   easing: 'easeOutQuad'
                               });
                           } else {
                               overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
                               $overlay.velocity({
                                   opacity: overlayPerc
                               }, {
                                   duration: 10,
                                   queue: false,
                                   easing: 'easeOutQuad'
                               });
                           }
                       }

                   }).on('panend', function (e) {

                       if (e.gesture.pointerType == "touch") {
                           var $overlay = $('#sidenav-overlay');
                           var velocityX = e.gesture.velocityX;
                           var x = e.gesture.center.x;
                           var leftPos = x - options.menuWidth;
                           var rightPos = x - options.menuWidth / 2;
                           if (leftPos > 0) {
                               leftPos = 0;
                           }
                           if (rightPos < 0) {
                               rightPos = 0;
                           }
                           panning = false;

                           if (options.edge === 'left') {
                               // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
                               if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
                                   // Return menu to open
                                   if (leftPos !== 0) {
                                       menu.velocity({
                                           'translateX': [0, leftPos]
                                       }, {
                                           duration: 300,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                   }

                                   $overlay.velocity({
                                       opacity: 1
                                   }, {
                                       duration: 50,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                                   $dragTarget.css({
                                       width: '50%',
                                       right: 0,
                                       left: 
                                   });
                                   menuOut = true;
                               } else if (!menuOut || velocityX > 0.3) {
                                   // Enable Scrolling
                                   $('body').css({
                                       overflow: ,
                                       width: 
                                   });
                                   // Slide menu closed
                                   menu.velocity({
                                       'translateX': [-1 * options.menuWidth - 10, leftPos]
                                   }, {
                                       duration: 200,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                                   $overlay.velocity({
                                       opacity: 0
                                   }, {
                                       duration: 200,
                                       queue: false,
                                       easing: 'easeOutQuad',
                                       complete: function () {
                                           // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                                           if (typeof (options.onClose) === 'function') {
                                               options.onClose.call(this, menu);
                                           }

                                           $(this).remove();
                                       }
                                   });
                                   $dragTarget.css({
                                       width: '10px',
                                       right: ,
                                       left: 0
                                   });
                               }
                           } else {
                               if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
                                   // Return menu to open
                                   if (rightPos !== 0) {
                                       menu.velocity({
                                           'translateX': [0, rightPos]
                                       }, {
                                           duration: 300,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                   }

                                   $overlay.velocity({
                                       opacity: 1
                                   }, {
                                       duration: 50,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                                   $dragTarget.css({
                                       width: '50%',
                                       right: ,
                                       left: 0
                                   });
                                   menuOut = true;
                               } else if (!menuOut || velocityX < -0.3) {
                                   // Enable Scrolling
                                   $('body').css({
                                       overflow: ,
                                       width: 
                                   });

                                   // Slide menu closed
                                   menu.velocity({
                                       'translateX': [options.menuWidth + 10, rightPos]
                                   }, {
                                       duration: 200,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                                   $overlay.velocity({
                                       opacity: 0
                                   }, {
                                       duration: 200,
                                       queue: false,
                                       easing: 'easeOutQuad',
                                       complete: function () {
                                           $(this).remove();
                                       }
                                   });
                                   $dragTarget.css({
                                       width: '10px',
                                       right: 0,
                                       left: 
                                   });
                               }
                           }

                       }
                   });
               }

               $this.off('click.sidenav').on('click.sidenav', function () {
                   if (menuOut === true) {
                       menuOut = false;
                       panning = false;
                       removeMenu();
                   } else {

                       // Disable Scrolling
                       var $body = $('body');

var $overlay = $('

');

                       var oldWidth = $body.innerWidth();
                       $body.css('overflow', 'hidden');
                       $body.width(oldWidth);

                       // Push current drag target on top of DOM tree
                       $('body').append($dragTarget);

                       if (options.edge === 'left') {
                           $dragTarget.css({
                               width: '50%',
                               right: 0,
                               left: 
                           });
                           menu.velocity({
                               'translateX': [0, -1 * options.menuWidth]
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       } else {
                           $dragTarget.css({
                               width: '50%',
                               right: ,
                               left: 0
                           });
                           menu.velocity({
                               'translateX': [0, options.menuWidth]
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       }

                       $overlay.css('opacity', 0)
                           .click(function () {
                               menuOut = false;
                               panning = false;
                               removeMenu();
                               $overlay.velocity({
                                   opacity: 0
                               }, {
                                   duration: 300,
                                   queue: false,
                                   easing: 'easeOutQuad',
                                   complete: function () {
                                       $(this).remove();
                                   }
                               });

                           });
                       $('body').append($overlay);
                       $overlay.velocity({
                           opacity: 1
                       }, {
                           duration: 300,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               menuOut = true;
                               panning = false;
                           }
                       });

                       // Callback
                       if (typeof (options.onOpen) === 'function') {
                           options.onOpen.call(this, menu);
                       }
                   }

                   return false;
               });
           });

       },
       destroy: function () {
           var $overlay = $('#sidenav-overlay');
           var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
           $overlay.trigger('click');
           $dragTarget.remove();
           $(this).off('click');
           $overlay.remove();
       },
       show: function () {
           this.trigger('click');
       },
       hide: function () {
           $('#sidenav-overlay').trigger('click');
       }
   };

   $.fn.sideNav = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
       }
   }; // Plugin end

}(jQuery));; /**

* Extend jquery with a scrollspy plugin.
* This watches the window scroll and fires events when elements are scrolled into viewport.
*
* throttle() and getTime() taken from Underscore.js
* https://github.com/jashkenas/underscore
*
* @author Copyright 2013 John Smart
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
* @see https://github.com/thesmart
* @version 0.1.2
*/

(function ($) {

   var jWindow = $(window);
   var elements = [];
   var elementsInView = [];
   var isSpying = false;
   var ticks = 0;
   var unique_id = 1;
   var offset = {
       top: 0,
       right: 0,
       bottom: 0,
       left: 0,
   }

   /**
    * Find elements that are within the boundary
    * @param {number} top
    * @param {number} right
    * @param {number} bottom
    * @param {number} left
    * @return {jQuery}		A collection of elements
    */
   function findElements(top, right, bottom, left) {
       var hits = $();
       $.each(elements, function (i, element) {
           if (element.height() > 0) {
               var elTop = element.offset().top,
                   elLeft = element.offset().left,
                   elRight = elLeft + element.width(),
                   elBottom = elTop + element.height();

               var isIntersect = !(elLeft > right ||
                   elRight < left ||
                   elTop > bottom ||
                   elBottom < top);

               if (isIntersect) {
                   hits.push(element);
               }
           }
       });

       return hits;
   }

   /**
    * Called when the user scrolls the window
    */
   function onScroll(scrollOffset) {
       // unique tick id
       ++ticks;

       // viewport rectangle
       var top = jWindow.scrollTop(),
           left = jWindow.scrollLeft(),
           right = left + jWindow.width(),
           bottom = top + jWindow.height();

       // determine which elements are in view
       var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
       $.each(intersections, function (i, element) {

           var lastTick = element.data('scrollSpy:ticks');
           if (typeof lastTick != 'number') {
               // entered into view
               element.triggerHandler('scrollSpy:enter');
           }

           // update tick id
           element.data('scrollSpy:ticks', ticks);
       });

       // determine which elements are no longer in view
       $.each(elementsInView, function (i, element) {
           var lastTick = element.data('scrollSpy:ticks');
           if (typeof lastTick == 'number' && lastTick !== ticks) {
               // exited from view
               element.triggerHandler('scrollSpy:exit');
               element.data('scrollSpy:ticks', null);
           }
       });

       // remember elements in view for next tick
       elementsInView = intersections;
   }

   /**
    * Called when window is resized
    */
   function onWinSize() {
       jWindow.trigger('scrollSpy:winSize');
   }

   /**

* Enables ScrollSpy using a selector * @param {jQuery|string} selector The elements collection, or a selector * @param {Object=} options Optional.

       throttle : number -> scrollspy throttling. Default: 100 ms
       offsetTop : number -> offset from top. Default: 0
       offsetRight : number -> offset from right. Default: 0
       offsetBottom : number -> offset from bottom. Default: 0
       offsetLeft : number -> offset from left. Default: 0

activeClass : string -> Class name to be added to the active link. Default: active * @returns {jQuery} */

   $.scrollSpy = function (selector, options) {
       var defaults = {
           throttle: 100,
           scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
           activeClass: 'active',
           getActiveElement: function (id) {
               return 'a[href="#' + id + '"]';
           }
       };
       options = $.extend(defaults, options);

       var visible = [];
       selector = $(selector);
       selector.each(function (i, element) {
           elements.push($(element));
           $(element).data("scrollSpy:id", i);
           // Smooth scroll to section
           $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
               e.preventDefault();
               var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
               $('html, body').animate({
                   scrollTop: offset - options.scrollOffset
               }, {
                   duration: 400,
                   queue: false,
                   easing: 'easeOutCubic'
               });
           });
       });

       offset.top = options.offsetTop || 0;
       offset.right = options.offsetRight || 0;
       offset.bottom = options.offsetBottom || 0;
       offset.left = options.offsetLeft || 0;

       var throttledScroll = Materialize.throttle(function () {
           onScroll(options.scrollOffset);
       }, options.throttle || 100);
       var readyScroll = function () {
           $(document).ready(throttledScroll);
       };

       if (!isSpying) {
           jWindow.on('scroll', readyScroll);
           jWindow.on('resize', readyScroll);
           isSpying = true;
       }

       // perform a scan once, after current execution context, and after dom is ready
       setTimeout(readyScroll, 0);

       selector.on('scrollSpy:enter', function () {
           visible = $.grep(visible, function (value) {
               return value.height() != 0;
           });

           var $this = $(this);

           if (visible[0]) {
               $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
               if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
                   visible.unshift($(this));
               } else {
                   visible.push($(this));
               }
           } else {
               visible.push($(this));
           }

           $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
       });
       selector.on('scrollSpy:exit', function () {
           visible = $.grep(visible, function (value) {
               return value.height() != 0;
           });

           if (visible[0]) {
               $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
               var $this = $(this);
               visible = $.grep(visible, function (value) {
                   return value.attr('id') != $this.attr('id');
               });
               if (visible[0]) { // Check if empty
                   $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
               }
           }
       });

       return selector;
   };

   /**
    * Listen for window resize events
    * @param {Object=} options						Optional. Set { throttle: number } to change throttling. Default: 100 ms
    * @returns {jQuery}		$(window)
    */
   $.winSizeSpy = function (options) {
       $.winSizeSpy = function () {
           return jWindow;
       }; // lock from multiple calls
       options = options || {
           throttle: 100
       };
       return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
   };

   /**
    * Enables ScrollSpy on a collection of elements
    * e.g. $('.scrollSpy').scrollSpy()
    * @param {Object=} options	Optional.
   										throttle : number -> scrollspy throttling. Default: 100 ms
   										offsetTop : number -> offset from top. Default: 0
   										offsetRight : number -> offset from right. Default: 0
   										offsetBottom : number -> offset from bottom. Default: 0
   										offsetLeft : number -> offset from left. Default: 0
    * @returns {jQuery}
    */
   $.fn.scrollSpy = function (options) {
       return $.scrollSpy($(this), options);
   };

})(jQuery);; (function ($) {

   $(document).ready(function () {

       // Function to update labels of text fields
       Materialize.updateTextFields = function () {
           var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
           $(input_selector).each(function (index, element) {
               var $this = $(this);
               if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
                   $this.siblings('label').addClass('active');
               } else if ($(element)[0].validity) {
                   $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
               } else {
                   $this.siblings('label').removeClass('active');
               }
           });
       };

       // Text based inputs
       var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';

       // Add active if form auto complete
       $(document).on('change', input_selector, function () {
           if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
               $(this).siblings('label').addClass('active');
           }
           validate_field($(this));
       });

       // Add active if input element has been pre-populated on document ready
       $(document).ready(function () {
           Materialize.updateTextFields();
       });

       // HTML DOM FORM RESET handling
       $(document).on('reset', function (e) {
           var formReset = $(e.target);
           if (formReset.is('form')) {
               formReset.find(input_selector).removeClass('valid').removeClass('invalid');
               formReset.find(input_selector).each(function () {
                   if ($(this).attr('value') === ) {
                       $(this).siblings('label').removeClass('active');
                   }
               });

               // Reset select
               formReset.find('select.initialized').each(function () {
                   var reset_text = formReset.find('option[selected]').text();
                   formReset.siblings('input.select-dropdown').val(reset_text);
               });
           }
       });

       // Add active when element has focus
       $(document).on('focus', input_selector, function () {
           $(this).siblings('label, .prefix').addClass('active');
       });

       $(document).on('blur', input_selector, function () {
           var $inputElement = $(this);
           var selector = ".prefix";

           if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
               selector += ", label";
           }

           $inputElement.siblings(selector).removeClass('active');

           validate_field($inputElement);
       });

       window.validate_field = function (object) {
           var hasLength = object.attr('data-length') !== undefined;
           var lenAttr = parseInt(object.attr('data-length'));
           var len = object.val().length;

           if (object.val().length === 0 && object[0].validity.badInput === false) {
               if (object.hasClass('validate')) {
                   object.removeClass('valid');
                   object.removeClass('invalid');
               }
           } else {
               if (object.hasClass('validate')) {
                   // Check for character counter attributes
                   if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
                       object.removeClass('invalid');
                       object.addClass('valid');
                   } else {
                       object.removeClass('valid');
                       object.addClass('invalid');
                   }
               }
           }
       };

       // Radio and Checkbox focus class
       var radio_checkbox = 'input[type=radio], input[type=checkbox]';
       $(document).on('keyup.radio', radio_checkbox, function (e) {
           // TAB, check if tabbing to radio or checkbox.
           if (e.which === 9) {
               $(this).addClass('tabbed');
               var $this = $(this);
               $this.one('blur', function (e) {

                   $(this).removeClass('tabbed');
               });
               return;
           }
       });

       // Textarea Auto Resize
       var hiddenDiv = $('.hiddendiv').first();
       if (!hiddenDiv.length) {

hiddenDiv = $('

');

           $('body').append(hiddenDiv);
       }
       var text_area_selector = '.materialize-textarea';

       function textareaAutoResize($textarea) {
           // Set font properties of hiddenDiv

           var fontFamily = $textarea.css('font-family');
           var fontSize = $textarea.css('font-size');
           var lineHeight = $textarea.css('line-height');

           if (fontSize) {
               hiddenDiv.css('font-size', fontSize);
           }
           if (fontFamily) {
               hiddenDiv.css('font-family', fontFamily);
           }
           if (lineHeight) {
               hiddenDiv.css('line-height', lineHeight);
           }

           // Set original-height, if none
           if (!$textarea.data('original-height')) {
               $textarea.data('original-height', $textarea.height());
           }

           if ($textarea.attr('wrap') === 'off') {
               hiddenDiv.css('overflow-wrap', 'normal')
                   .css('white-space', 'pre');
           }

           hiddenDiv.text($textarea.val() + '\n');
           var content = hiddenDiv.html().replace(/\n/g, '
');
           hiddenDiv.html(content);

           // When textarea is hidden, width goes crazy.
           // Approximate with half of window size

           if ($textarea.is(':visible')) {
               hiddenDiv.css('width', $textarea.width());
           } else {
               hiddenDiv.css('width', $(window).width() / 2);
           }

           /**
            * Resize if the new height is greater than the
            * original height of the textarea
            */
           if ($textarea.data('original-height') <= hiddenDiv.height()) {
               $textarea.css('height', hiddenDiv.height());
           } else if ($textarea.val().length < $textarea.data('previous-length')) {
               /**
                * In case the new height is less than original height, it
                * means the textarea has less text than before
                * So we set the height to the original one
                */
               $textarea.css('height', $textarea.data('original-height'));
           }
           $textarea.data('previous-length', $textarea.val().length);
       }

       $(text_area_selector).each(function () {
           var $textarea = $(this);
           /**
            * Instead of resizing textarea on document load,
            * store the original height and the original length
            */
           $textarea.data('original-height', $textarea.height());
           $textarea.data('previous-length', $textarea.val().length);
       });

       $('body').on('keyup keydown autoresize', text_area_selector, function () {
           textareaAutoResize($(this));
       });

       // File Input Path
       $(document).on('change', '.file-field input[type="file"]', function () {
           var file_field = $(this).closest('.file-field');
           var path_input = file_field.find('input.file-path');
           var files = $(this)[0].files;
           var file_names = [];
           for (var i = 0; i < files.length; i++) {
               file_names.push(files[i].name);
           }
           path_input.val(file_names.join(", "));
           path_input.trigger('change');
       });

       /****************
        *  Range Input  *
        ****************/

       var range_type = 'input[type=range]';
       var range_mousedown = false;
       var left;

       $(range_type).each(function () {
           var thumb = $('');
           $(this).after(thumb);
       });

       var showRangeBubble = function (thumb) {
           var paddingLeft = parseInt(thumb.parent().css('padding-left'));
           var marginLeft = (-7 + paddingLeft) + 'px';
           thumb.velocity({
               height: "30px",
               width: "30px",
               top: "-30px",
               marginLeft: marginLeft
           }, {
               duration: 300,
               easing: 'easeOutExpo'
           });
       };

       var calcRangeOffset = function (range) {
           var width = range.width() - 15;
           var max = parseFloat(range.attr('max'));
           var min = parseFloat(range.attr('min'));
           var percent = (parseFloat(range.val()) - min) / (max - min);
           return percent * width;
       }

       var range_wrapper = '.range-field';
       $(document).on('change', range_type, function (e) {
           var thumb = $(this).siblings('.thumb');
           thumb.find('.value').html($(this).val());

           if (!thumb.hasClass('active')) {
               showRangeBubble(thumb);
           }

           var offsetLeft = calcRangeOffset($(this));
           thumb.addClass('active').css('left', offsetLeft);
       });

       $(document).on('mousedown touchstart', range_type, function (e) {
           var thumb = $(this).siblings('.thumb');

           // If thumb indicator does not exist yet, create it
           if (thumb.length <= 0) {
               thumb = $('');
               $(this).after(thumb);
           }

           // Set indicator value
           thumb.find('.value').html($(this).val());

           range_mousedown = true;
           $(this).addClass('active');

           if (!thumb.hasClass('active')) {
               showRangeBubble(thumb);
           }

           if (e.type !== 'input') {
               var offsetLeft = calcRangeOffset($(this));
               thumb.addClass('active').css('left', offsetLeft);
           }
       });

       $(document).on('mouseup touchend', range_wrapper, function () {
           range_mousedown = false;
           $(this).removeClass('active');
       });

       $(document).on('input mousemove touchmove', range_wrapper, function (e) {
           var thumb = $(this).children('.thumb');
           var left;
           var input = $(this).find(range_type);

           if (range_mousedown) {
               if (!thumb.hasClass('active')) {
                   showRangeBubble(thumb);
               }

               var offsetLeft = calcRangeOffset(input);
               thumb.addClass('active').css('left', offsetLeft);
               thumb.find('.value').html(thumb.siblings(range_type).val());
           }
       });

       $(document).on('mouseout touchleave', range_wrapper, function () {
           if (!range_mousedown) {

               var thumb = $(this).children('.thumb');
               var paddingLeft = parseInt($(this).css('padding-left'));
               var marginLeft = (7 + paddingLeft) + 'px';

               if (thumb.hasClass('active')) {
                   thumb.velocity({
                       height: '0',
                       width: '0',
                       top: '10px',
                       marginLeft: marginLeft
                   }, {
                       duration: 100
                   });
               }
               thumb.removeClass('active');
           }
       });

       /**************************
        * Auto complete plugin  *
        *************************/
       $.fn.autocomplete = function (options) {
           // Defaults
           var defaults = {
               data: {},
               limit: Infinity,
               onAutocomplete: null,
               minLength: 1
           };

           options = $.extend(defaults, options);

           return this.each(function () {
               var $input = $(this);
               var data = options.data,
                   count = 0,
                   activeIndex = -1,
                   oldVal,
                   $inputDiv = $input.closest('.input-field'); // Div to append on

               // Check if data isn't empty
               if (!$.isEmptyObject(data)) {

var $autocomplete = $('

');

                   var $oldAutocomplete;

                   // Append autocomplete element.
                   // Prevent double structure init.
                   if ($inputDiv.length) {
                       $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
                       if (!$oldAutocomplete.length) {
                           $inputDiv.append($autocomplete); // Set ul in body
                       }
                   } else {
                       $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
                       if (!$oldAutocomplete.length) {
                           $input.after($autocomplete);
                       }
                   }
                   if ($oldAutocomplete.length) {
                       $autocomplete = $oldAutocomplete;
                   }

                   // Highlight partial match.
                   var highlight = function (string, $el) {
                       var img = $el.find('img');
                       var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
                           matchEnd = matchStart + string.length - 1,
                           beforeMatch = $el.text().slice(0, matchStart),
                           matchText = $el.text().slice(matchStart, matchEnd + 1),
                           afterMatch = $el.text().slice(matchEnd + 1);
                       $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
                       if (img.length) {
                           $el.prepend(img);
                       }
                   };

                   // Reset current element position
                   var resetCurrentElement = function () {
                       activeIndex = -1;
                       $autocomplete.find('.active').removeClass('active');
                   }

                   // Remove autocomplete elements
                   var removeAutocomplete = function () {
                       $autocomplete.empty();
                       resetCurrentElement();
                       oldVal = undefined;
                   };

                   $input.off('blur.autocomplete').on('blur.autocomplete', function () {
                       removeAutocomplete();
                   });

                   // Perform search
                   $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
                       // Reset count.
                       count = 0;
                       var val = $input.val().toLowerCase();

                       // Don't capture enter or arrow key usage.
                       if (e.which === 13 ||
                           e.which === 38 ||
                           e.which === 40) {
                           return;
                       }

                       // Check if the input isn't empty
                       if (oldVal !== val) {
                           removeAutocomplete();

                           if (val.length >= options.minLength) {
                               for (var key in data) {
                                   if (data.hasOwnProperty(key) &&
                                       key.toLowerCase().indexOf(val) !== -1 &&
                                       key.toLowerCase() !== val) {
                                       // Break if past limit
                                       if (count >= options.limit) {
                                           break;
                                       }

var autocompleteOption = $('

');

                                       if (!!data[key]) {
                                           autocompleteOption.append('<img src="' + data[key] + '" class="right circle">' + key + '');
                                       } else {
                                           autocompleteOption.append('' + key + '');
                                       }

                                       $autocomplete.append(autocompleteOption);
                                       highlight(val, autocompleteOption);
                                       count++;
                                   }
                               }
                           }
                       }

                       // Update oldVal
                       oldVal = val;
                   });

                   $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
                       // Arrow keys and enter key usage
                       var keyCode = e.which,
                           liElement,
                           numItems = $autocomplete.children('li').length,
                           $active = $autocomplete.children('.active').first();

                       // select element on Enter
                       if (keyCode === 13 && activeIndex >= 0) {
                           liElement = $autocomplete.children('li').eq(activeIndex);
                           if (liElement.length) {
                               liElement.trigger('mousedown.autocomplete');
                               e.preventDefault();
                           }
                           return;
                       }

                       // Capture up and down key
                       if (keyCode === 38 || keyCode === 40) {
                           e.preventDefault();

                           if (keyCode === 38 &&
                               activeIndex > 0) {
                               activeIndex--;
                           }

                           if (keyCode === 40 &&
                               activeIndex < (numItems - 1)) {
                               activeIndex++;
                           }

                           $active.removeClass('active');
                           if (activeIndex >= 0) {
                               $autocomplete.children('li').eq(activeIndex).addClass('active');
                           }
                       }
                   });

                   // Set input value
                   $autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
                       var text = $(this).text().trim();
                       $input.val(text);
                       $input.trigger('change');
                       removeAutocomplete();

                       // Handle onAutocomplete callback.
                       if (typeof (options.onAutocomplete) === "function") {
                           options.onAutocomplete.call(this, text);
                       }
                   });
               }
           });
       };

   }); // End of $(document).ready

   /*******************
    *  Select Plugin  *
    ******************/
   $.fn.material_select = function (callback) {
       $(this).each(function () {
           var $select = $(this);

           if ($select.hasClass('browser-default')) {
               return; // Continue to next (return false breaks out of entire loop)
           }

           var multiple = $select.attr('multiple') ? true : false,
               lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt

           if (lastID) {
               $select.parent().find('span.caret').remove();
               $select.parent().find('input').remove();

               $select.unwrap();
               $('ul#select-options-' + lastID).remove();
           }

           // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
           if (callback === 'destroy') {
               $select.data('select-id', null).removeClass('initialized');
               return;
           }

           var uniqueID = Materialize.guid();
           $select.data('select-id', uniqueID);

var wrapper = $('

');

           wrapper.addClass($select.attr('class'));

var options = $('

'),

               selectChildren = $select.children('option, optgroup'),
               valuesSelected = [],
               optionsHover = false;

           var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";

           // Function that renders and appends the option taking into
           // account type and possible image icon.
           var appendOptionWithIcon = function (select, option, type) {
               // Add disabled attr if disabled
               var disabledClass = (option.is(':disabled')) ? 'disabled ' : ;
               var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ;
               var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ;

               // add icons
               var icon_url = option.data('icon');
               var classes = option.attr('class');
               if (!!icon_url) {
                   var classString = ;
                   if (!!classes) classString = ' class="' + classes + '"';

                   // Check for multiple type.

options.append($('

<img alt="" src="' + icon_url + '"' + classString + '>' + multipleCheckbox + option.html() + '

'));

                   return true;
               }

               // Check for multiple type.

options.append($('

' + multipleCheckbox + option.html() + '

'));

           };

           /* Create dropdown structure. */
           if (selectChildren.length) {
               selectChildren.each(function () {
                   if ($(this).is('option')) {
                       // Direct descendant option.
                       if (multiple) {
                           appendOptionWithIcon($select, $(this), 'multiple');

                       } else {
                           appendOptionWithIcon($select, $(this));
                       }
                   } else if ($(this).is('optgroup')) {
                       // Optgroup.
                       var selectOptions = $(this).children('option');

options.append($('

' + $(this).attr('label') + '

'));

                       selectOptions.each(function () {
                           appendOptionWithIcon($select, $(this), 'optgroup-option');
                       });
                   }
               });
           }

           options.find('li:not(.optgroup)').each(function (i) {
               $(this).click(function (e) {
                   // Check if option element is disabled
                   if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
                       var selected = true;

                       if (multiple) {
                           $('input[type="checkbox"]', this).prop('checked', function (i, v) {
                               return !v;
                           });
                           selected = toggleEntryFromArray(valuesSelected, i, $select);
                           $newSelect.trigger('focus');
                       } else {
                           options.find('li').removeClass('active');
                           $(this).toggleClass('active');
                           $newSelect.val($(this).text());
                       }

                       activateOption(options, $(this));
                       $select.find('option').eq(i).prop('selected', selected);
                       // Trigger onchange() event
                       $select.trigger('change');
                       if (typeof callback !== 'undefined') callback();
                   }

                   e.stopPropagation();
               });
           });

           // Wrap Elements
           $select.wrap(wrapper);
           // Add Select Display Element
           var dropdownIcon = $('▼');
           if ($select.is(':disabled'))
               dropdownIcon.addClass('disabled');

           // escape double quotes
           var sanitizedLabelHtml = label.replace(/"/g, '"');

           var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : ) + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
           $select.before($newSelect);
           $newSelect.before(dropdownIcon);

           $newSelect.after(options);
           // Check if section element is disabled
           if (!$select.is(':disabled')) {
               $newSelect.dropdown({
                   'hover': false
               });
           }

           // Copy tabindex
           if ($select.attr('tabindex')) {
               $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
           }

           $select.addClass('initialized');

           $newSelect.on({
               'focus': function () {
                   if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
                       $('input.select-dropdown').trigger('close');
                   }
                   if (!options.is(':visible')) {
                       $(this).trigger('open', ['focus']);
                       var label = $(this).val();
                       if (multiple && label.indexOf(',') >= 0) {
                           label = label.split(',')[0];
                       }

                       var selectedOption = options.find('li').filter(function () {
                           return $(this).text().toLowerCase() === label.toLowerCase();
                       })[0];
                       activateOption(options, selectedOption, true);
                   }
               },
               'click': function (e) {
                   e.stopPropagation();
               }
           });

           $newSelect.on('blur', function () {
               if (!multiple) {
                   $(this).trigger('close');
               }
               options.find('li.selected').removeClass('selected');
           });

           options.hover(function () {
               optionsHover = true;
           }, function () {
               optionsHover = false;
           });

           $(window).on({
               'click': function () {
                   multiple && (optionsHover || $newSelect.trigger('close'));
               }
           });

           // Add initial multiple selections.
           if (multiple) {
               $select.find("option:selected:not(:disabled)").each(function () {
                   var index = $(this).index();

                   toggleEntryFromArray(valuesSelected, index, $select);
                   options.find("li").eq(index).find(":checkbox").prop("checked", true);
               });
           }

           /**
            * Make option as selected and scroll to selected position
            * @param {jQuery} collection  Select options jQuery element
            * @param {Element} newOption  element of the new option
            * @param {Boolean} firstActivation  If on first activation of select
            */
           var activateOption = function (collection, newOption, firstActivation) {
               if (newOption) {
                   collection.find('li.selected').removeClass('selected');
                   var option = $(newOption);
                   option.addClass('selected');
                   if (!multiple || !!firstActivation) {
                       options.scrollTo(option);
                   }
               }
           };

           // Allow user to search by typing
           // this array is cleared after 1 second
           var filterQuery = [],
               onKeyDown = function (e) {
                   // TAB - switch to another input
                   if (e.which == 9) {
                       $newSelect.trigger('close');
                       return;
                   }

                   // ARROW DOWN WHEN SELECT IS CLOSED - open select options
                   if (e.which == 40 && !options.is(':visible')) {
                       $newSelect.trigger('open');
                       return;
                   }

                   // ENTER WHEN SELECT IS CLOSED - submit form
                   if (e.which == 13 && !options.is(':visible')) {
                       return;
                   }

                   e.preventDefault();

                   // CASE WHEN USER TYPE LETTERS
                   var letter = String.fromCharCode(e.which).toLowerCase(),
                       nonLetters = [9, 13, 27, 38, 40];
                   if (letter && (nonLetters.indexOf(e.which) === -1)) {
                       filterQuery.push(letter);

                       var string = filterQuery.join(),
                           newOption = options.find('li').filter(function () {
                               return $(this).text().toLowerCase().indexOf(string) === 0;
                           })[0];

                       if (newOption) {
                           activateOption(options, newOption);
                       }
                   }

                   // ENTER - select option and close when select options are opened
                   if (e.which == 13) {
                       var activeOption = options.find('li.selected:not(.disabled)')[0];
                       if (activeOption) {
                           $(activeOption).trigger('click');
                           if (!multiple) {
                               $newSelect.trigger('close');
                           }
                       }
                   }

                   // ARROW DOWN - move to next not disabled option
                   if (e.which == 40) {
                       if (options.find('li.selected').length) {
                           newOption = options.find('li.selected').next('li:not(.disabled)')[0];
                       } else {
                           newOption = options.find('li:not(.disabled)')[0];
                       }
                       activateOption(options, newOption);
                   }

                   // ESC - close options
                   if (e.which == 27) {
                       $newSelect.trigger('close');
                   }

                   // ARROW UP - move to previous not disabled option
                   if (e.which == 38) {
                       newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
                       if (newOption)
                           activateOption(options, newOption);
                   }

                   // Automaticaly clean filter query so user can search again by starting letters
                   setTimeout(function () {
                       filterQuery = [];
                   }, 1000);
               };

           $newSelect.on('keydown', onKeyDown);
       });

       function toggleEntryFromArray(entriesArray, entryIndex, select) {
           var index = entriesArray.indexOf(entryIndex),
               notAdded = index === -1;

           if (notAdded) {
               entriesArray.push(entryIndex);
           } else {
               entriesArray.splice(index, 1);
           }

           select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');

           // use notAdded instead of true (to detect if the option is selected or not)
           select.find('option').eq(entryIndex).prop('selected', notAdded);
           setValueToInput(entriesArray, select);

           return notAdded;
       }

       function setValueToInput(entriesArray, select) {
           var value = ;

           for (var i = 0, count = entriesArray.length; i < count; i++) {
               var text = select.find('option').eq(entriesArray[i]).text();

               i === 0 ? value += text : value += ', ' + text;
           }

           if (value === ) {
               value = select.find('option:disabled').eq(0).text();
           }

           select.siblings('input.select-dropdown').val(value);
       }
   };

}(jQuery));; (function ($) {

   var methods = {

       init: function (options) {
           var defaults = {
               indicators: true,
               height: 400,
               transition: 500,
               interval: 6000
           };
           options = $.extend(defaults, options);

           return this.each(function () {

               // For each slider, we want to keep track of
               // which slide is active and its associated content
               var $this = $(this);
               var $slider = $this.find('ul.slides').first();
               var $slides = $slider.find('> li');
               var $active_index = $slider.find('.active').index();
               var $active, $indicators, $interval;
               if ($active_index != -1) {
                   $active = $slides.eq($active_index);
               }

               // Transitions the caption depending on alignment
               function captionTransition(caption, duration) {
                   if (caption.hasClass("center-align")) {
                       caption.velocity({
                           opacity: 0,
                           translateY: -100
                       }, {
                           duration: duration,
                           queue: false
                       });
                   } else if (caption.hasClass("right-align")) {
                       caption.velocity({
                           opacity: 0,
                           translateX: 100
                       }, {
                           duration: duration,
                           queue: false
                       });
                   } else if (caption.hasClass("left-align")) {
                       caption.velocity({
                           opacity: 0,
                           translateX: -100
                       }, {
                           duration: duration,
                           queue: false
                       });
                   }
               }

               // This function will transition the slide to any index of the next slide
               function moveToSlide(index) {
                   // Wrap around indices.
                   if (index >= $slides.length) index = 0;
                   else if (index < 0) index = $slides.length - 1;

                   $active_index = $slider.find('.active').index();

                   // Only do if index changes
                   if ($active_index != index) {
                       $active = $slides.eq($active_index);
                       $caption = $active.find('.caption');

                       $active.removeClass('active');
                       $active.velocity({
                           opacity: 0
                       }, {
                           duration: options.transition,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               $slides.not('.active').velocity({
                                   opacity: 0,
                                   translateX: 0,
                                   translateY: 0
                               }, {
                                   duration: 0,
                                   queue: false
                               });
                           }
                       });
                       captionTransition($caption, options.transition);

                       // Update indicators
                       if (options.indicators) {
                           $indicators.eq($active_index).removeClass('active');
                       }

                       $slides.eq(index).velocity({
                           opacity: 1
                       }, {
                           duration: options.transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $slides.eq(index).find('.caption').velocity({
                           opacity: 1,
                           translateX: 0,
                           translateY: 0
                       }, {
                           duration: options.transition,
                           delay: options.transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $slides.eq(index).addClass('active');

                       // Update indicators
                       if (options.indicators) {
                           $indicators.eq(index).addClass('active');
                       }
                   }
               }

               // Set height of slider
               // If fullscreen, do nothing
               if (!$this.hasClass('fullscreen')) {
                   if (options.indicators) {
                       // Add height if indicators are present
                       $this.height(options.height + 40);
                   } else {
                       $this.height(options.height);
                   }
                   $slider.height(options.height);
               }

               // Set initial positions of captions
               $slides.find('.caption').each(function () {
                   captionTransition($(this), 0);
               });

               // Move img src into background-image
               $slides.find('img').each(function () {
                   var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
                   if ($(this).attr('src') !== placeholderBase64) {
                       $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
                       $(this).attr('src', placeholderBase64);
                   }
               });

               // dynamically add indicators
               if (options.indicators) {

$indicators = $('

');

                   $slides.each(function (index) {

var $indicator = $('

');

                       // Handle clicks on indicators
                       $indicator.click(function () {
                           var $parent = $slider.parent();
                           var curr_index = $parent.find($(this)).index();
                           moveToSlide(curr_index);

                           // reset interval
                           clearInterval($interval);
                           $interval = setInterval(
                               function () {
                                   $active_index = $slider.find('.active').index();
                                   if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                                   else $active_index += 1;

                                   moveToSlide($active_index);

                               }, options.transition + options.interval
                           );
                       });
                       $indicators.append($indicator);
                   });
                   $this.append($indicators);
                   $indicators = $this.find('ul.indicators').find('li.indicator-item');
               }

               if ($active) {
                   $active.show();
               } else {
                   $slides.first().addClass('active').velocity({
                       opacity: 1
                   }, {
                       duration: options.transition,
                       queue: false,
                       easing: 'easeOutQuad'
                   });

                   $active_index = 0;
                   $active = $slides.eq($active_index);

                   // Update indicators
                   if (options.indicators) {
                       $indicators.eq($active_index).addClass('active');
                   }
               }

               // Adjust height to current slide
               $active.find('img').each(function () {
                   $active.find('.caption').velocity({
                       opacity: 1,
                       translateX: 0,
                       translateY: 0
                   }, {
                       duration: options.transition,
                       queue: false,
                       easing: 'easeOutQuad'
                   });
               });

               // auto scroll
               $interval = setInterval(
                   function () {
                       $active_index = $slider.find('.active').index();
                       moveToSlide($active_index + 1);

                   }, options.transition + options.interval
               );

               // HammerJS, Swipe navigation

               // Touch Event
               var panning = false;
               var swipeLeft = false;
               var swipeRight = false;

               $this.hammer({
                   prevent_default: false
               }).on('pan', function (e) {
                   if (e.gesture.pointerType === "touch") {

                       // reset interval
                       clearInterval($interval);

                       var direction = e.gesture.direction;
                       var x = e.gesture.deltaX;
                       var velocityX = e.gesture.velocityX;
                       var velocityY = e.gesture.velocityY;

                       $curr_slide = $slider.find('.active');
                       if (Math.abs(velocityX) > Math.abs(velocityY)) {
                           $curr_slide.velocity({
                               translateX: x
                           }, {
                               duration: 50,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       }

                       // Swipe Left
                       if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
                           swipeRight = true;
                       }
                       // Swipe Right
                       else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
                           swipeLeft = true;
                       }

                       // Make Slide Behind active slide visible
                       var next_slide;
                       if (swipeLeft) {
                           next_slide = $curr_slide.next();
                           if (next_slide.length === 0) {
                               next_slide = $slides.first();
                           }
                           next_slide.velocity({
                               opacity: 1
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       }
                       if (swipeRight) {
                           next_slide = $curr_slide.prev();
                           if (next_slide.length === 0) {
                               next_slide = $slides.last();
                           }
                           next_slide.velocity({
                               opacity: 1
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       }

                   }

               }).on('panend', function (e) {
                   if (e.gesture.pointerType === "touch") {

                       $curr_slide = $slider.find('.active');
                       panning = false;
                       curr_index = $slider.find('.active').index();

                       if (!swipeRight && !swipeLeft || $slides.length <= 1) {
                           // Return to original spot
                           $curr_slide.velocity({
                               translateX: 0
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                       } else if (swipeLeft) {
                           moveToSlide(curr_index + 1);
                           $curr_slide.velocity({
                               translateX: -1 * $this.innerWidth()
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad',
                               complete: function () {
                                   $curr_slide.velocity({
                                       opacity: 0,
                                       translateX: 0
                                   }, {
                                       duration: 0,
                                       queue: false
                                   });
                               }
                           });
                       } else if (swipeRight) {
                           moveToSlide(curr_index - 1);
                           $curr_slide.velocity({
                               translateX: $this.innerWidth()
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad',
                               complete: function () {
                                   $curr_slide.velocity({
                                       opacity: 0,
                                       translateX: 0
                                   }, {
                                       duration: 0,
                                       queue: false
                                   });
                               }
                           });
                       }
                       swipeLeft = false;
                       swipeRight = false;

                       // Restart interval
                       clearInterval($interval);
                       $interval = setInterval(
                           function () {
                               $active_index = $slider.find('.active').index();
                               if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                               else $active_index += 1;

                               moveToSlide($active_index);

                           }, options.transition + options.interval
                       );
                   }
               });

               $this.on('sliderPause', function () {
                   clearInterval($interval);
               });

               $this.on('sliderStart', function () {
                   clearInterval($interval);
                   $interval = setInterval(
                       function () {
                           $active_index = $slider.find('.active').index();
                           if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                           else $active_index += 1;

                           moveToSlide($active_index);

                       }, options.transition + options.interval
                   );
               });

               $this.on('sliderNext', function () {
                   $active_index = $slider.find('.active').index();
                   moveToSlide($active_index + 1);
               });

               $this.on('sliderPrev', function () {
                   $active_index = $slider.find('.active').index();
                   moveToSlide($active_index - 1);
               });

           });

       },
       pause: function () {
           $(this).trigger('sliderPause');
       },
       start: function () {
           $(this).trigger('sliderStart');
       },
       next: function () {
           $(this).trigger('sliderNext');
       },
       prev: function () {
           $(this).trigger('sliderPrev');
       }
   };

   $.fn.slider = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
       }
   }; // Plugin end

}(jQuery));; (function ($) {

   $(document).ready(function () {

       $(document).on('click.card', '.card', function (e) {
           if ($(this).find('> .card-reveal').length) {
               var $card = $(e.target).closest('.card');
               if ($card.data('initialOverflow') === undefined) {
                   $card.data(
                       'initialOverflow',
                       $card.css('overflow') === undefined ?  : $card.css('overflow')
                   );
               }
               if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
                   // Make Reveal animate down and display none
                   $(this).find('.card-reveal').velocity({
                       translateY: 0
                   }, {
                       duration: 225,
                       queue: false,
                       easing: 'easeInOutQuad',
                       complete: function () {
                           $(this).css({
                               display: 'none'
                           });
                           $card.css('overflow', $card.data('initialOverflow'));
                       }
                   });
               } else if ($(e.target).is($('.card .activator')) ||
                   $(e.target).is($('.card .activator i'))) {
                   $card.css('overflow', 'hidden');
                   $(this).find('.card-reveal').css({
                       display: 'block'
                   }).velocity("stop", false).velocity({
                       translateY: '-100%'
                   }, {
                       duration: 300,
                       queue: false,
                       easing: 'easeInOutQuad'
                   });
               }
           }
       });

   });

}(jQuery));; (function ($) {

   var materialChipsDefaults = {
       data: [],
       placeholder: ,
       secondaryPlaceholder: ,
       autocompleteOptions: {},
   };

   $(document).ready(function () {
       // Handle removal of static chips.
       $(document).on('click', '.chip .close', function (e) {
           var $chips = $(this).closest('.chips');
           if ($chips.attr('data-initialized')) {
               return;
           }
           $(this).closest('.chip').remove();
       });
   });

   $.fn.material_chip = function (options) {
       var self = this;
       this.$el = $(this);
       this.$document = $(document);
       this.SELS = {
           CHIPS: '.chips',
           CHIP: '.chip',
           INPUT: 'input',
           DELETE: '.material-icons',
           SELECTED_CHIP: '.selected',
       };

       if ('data' === options) {
           return this.$el.data('chips');
       }

       var curr_options = $.extend({}, materialChipsDefaults, options);
       self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);

       // Initialize
       this.init = function () {
           var i = 0;
           var chips;
           self.$el.each(function () {
               var $chips = $(this);
               var chipId = Materialize.guid();
               self.chipId = chipId;

               if (!curr_options.data || !(curr_options.data instanceof Array)) {
                   curr_options.data = [];
               }
               $chips.data('chips', curr_options.data);
               $chips.attr('data-index', i);
               $chips.attr('data-initialized', true);

               if (!$chips.hasClass(self.SELS.CHIPS)) {
                   $chips.addClass('chips');
               }

               self.chips($chips, chipId);
               i++;
           });
       };

       this.handleEvents = function () {
           var SELS = self.SELS;

           self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
               $(e.target).find(SELS.INPUT).focus();
           });

           self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
               var $chip = $(e.target);
               if ($chip.length) {
                   var wasSelected = $chip.hasClass('selected');
                   var $chips = $chip.closest(SELS.CHIPS);
                   $(SELS.CHIP).removeClass('selected');

                   if (!wasSelected) {
                       self.selectChip($chip.index(), $chips);
                   }
               }
           });

           self.$document.off('keydown.chips').on('keydown.chips', function (e) {
               if ($(e.target).is('input, textarea')) {
                   return;
               }

               // delete
               var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
               var $chips = $chip.closest(SELS.CHIPS);
               var length = $chip.siblings(SELS.CHIP).length;
               var index;

               if (!$chip.length) {
                   return;
               }

               if (e.which === 8 || e.which === 46) {
                   e.preventDefault();

                   index = $chip.index();
                   self.deleteChip(index, $chips);

                   var selectIndex = null;
                   if ((index + 1) < length) {
                       selectIndex = index;
                   } else if (index === length || (index + 1) === length) {
                       selectIndex = length - 1;
                   }

                   if (selectIndex < 0) selectIndex = null;

                   if (null !== selectIndex) {
                       self.selectChip(selectIndex, $chips);
                   }
                   if (!length) $chips.find('input').focus();

                   // left
               } else if (e.which === 37) {
                   index = $chip.index() - 1;
                   if (index < 0) {
                       return;
                   }
                   $(SELS.CHIP).removeClass('selected');
                   self.selectChip(index, $chips);

                   // right
               } else if (e.which === 39) {
                   index = $chip.index() + 1;
                   $(SELS.CHIP).removeClass('selected');
                   if (index > length) {
                       $chips.find('input').focus();
                       return;
                   }
                   self.selectChip(index, $chips);
               }
           });

           self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
               var $currChips = $(e.target).closest(SELS.CHIPS);
               $currChips.addClass('focus');
               $currChips.siblings('label, .prefix').addClass('active');
               $(SELS.CHIP).removeClass('selected');
           });

           self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
               var $currChips = $(e.target).closest(SELS.CHIPS);
               $currChips.removeClass('focus');

               // Remove active if empty
               if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
                   $currChips.siblings('label').removeClass('active');
               }
               $currChips.siblings('.prefix').removeClass('active');
           });

           self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
               var $target = $(e.target);
               var $chips = $target.closest(SELS.CHIPS);
               var chipsLength = $chips.children(SELS.CHIP).length;

               // enter
               if (13 === e.which) {
                   // Override enter if autocompleting.
                   if (self.hasAutocomplete &&
                       $chips.find('.autocomplete-content.dropdown-content').length &&
                       $chips.find('.autocomplete-content.dropdown-content').children().length) {
                       return;
                   }

                   e.preventDefault();
                   self.addChip({
                       tag: $target.val()
                   }, $chips);
                   $target.val();
                   return;
               }

               // delete or left
               if ((8 === e.keyCode || 37 === e.keyCode) &&  === $target.val() && chipsLength) {
                   e.preventDefault();
                   self.selectChip(chipsLength - 1, $chips);
                   $target.blur();
                   return;
               }
           });

           // Click on delete icon in chip.
           self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
               var $target = $(e.target);
               var $chips = $target.closest(SELS.CHIPS);
               var $chip = $target.closest(SELS.CHIP);
               e.stopPropagation();
               self.deleteChip($chip.index(), $chips);
               $chips.find('input').focus();
           });
       };

       this.chips = function ($chips, chipId) {
           $chips.empty();
           $chips.data('chips').forEach(function (elem) {
               $chips.append(self.renderChip(elem));
           });
           $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
           self.setPlaceholder($chips);

           // Set for attribute for label
           var label = $chips.next('label');
           if (label.length) {
               label.attr('for', chipId);

               if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
                   label.addClass('active');
               }
           }

           // Setup autocomplete if needed.
           var input = $('#' + chipId);
           if (self.hasAutocomplete) {
               curr_options.autocompleteOptions.onAutocomplete = function (val) {
                   self.addChip({
                       tag: val
                   }, $chips);
                   input.val();
                   input.focus();
               }
               input.autocomplete(curr_options.autocompleteOptions);
           }
       };

       /**
        * Render chip jQuery element.
        * @param {Object} elem
        * @return {jQuery}
        */
       this.renderChip = function (elem) {
           if (!elem.tag) return;

var $renderedChip = $('

');

           $renderedChip.text(elem.tag);
           if (elem.image) {
               $renderedChip.prepend($('<img />').attr('src', elem.image))
           }
           $renderedChip.append($('<i class="material-icons close">close'));
           return $renderedChip;
       };

       this.setPlaceholder = function ($chips) {
           if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) {
               $chips.find('input').prop('placeholder', curr_options.placeholder);

           } else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
               $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
           }
       };

       this.isValid = function ($chips, elem) {
           var chips = $chips.data('chips');
           var exists = false;
           for (var i = 0; i < chips.length; i++) {
               if (chips[i].tag === elem.tag) {
                   exists = true;
                   return;
               }
           }
           return  !== elem.tag && !exists;
       };

       this.addChip = function (elem, $chips) {
           if (!self.isValid($chips, elem)) {
               return;
           }
           var $renderedChip = self.renderChip(elem);
           var newData = [];
           var oldData = $chips.data('chips');
           for (var i = 0; i < oldData.length; i++) {
               newData.push(oldData[i]);
           }
           newData.push(elem);

           $chips.data('chips', newData);
           $renderedChip.insertBefore($chips.find('input'));
           $chips.trigger('chip.add', elem);
           self.setPlaceholder($chips);
       };

       this.deleteChip = function (chipIndex, $chips) {
           var chip = $chips.data('chips')[chipIndex];
           $chips.find('.chip').eq(chipIndex).remove();

           var newData = [];
           var oldData = $chips.data('chips');
           for (var i = 0; i < oldData.length; i++) {
               if (i !== chipIndex) {
                   newData.push(oldData[i]);
               }
           }

           $chips.data('chips', newData);
           $chips.trigger('chip.delete', chip);
           self.setPlaceholder($chips);
       };

       this.selectChip = function (chipIndex, $chips) {
           var $chip = $chips.find('.chip').eq(chipIndex);
           if ($chip && false === $chip.hasClass('selected')) {
               $chip.addClass('selected');
               $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
           }
       };

       this.getChipsElement = function (index, $chips) {
           return $chips.eq(index);
       };

       // init
       this.init();

       this.handleEvents();
   };

}(jQuery));; (function ($) {

   $.fn.pushpin = function (options) {
       // Defaults
       var defaults = {
           top: 0,
           bottom: Infinity,
           offset: 0
       };

       // Remove pushpin event and classes
       if (options === "remove") {
           this.each(function () {
               if (id = $(this).data('pushpin-id')) {
                   $(window).off('scroll.' + id);
                   $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
               }
           });
           return false;
       }

       options = $.extend(defaults, options);

       $index = 0;
       return this.each(function () {
           var $uniqueId = Materialize.guid(),
               $this = $(this),
               $original_offset = $(this).offset().top;

           function removePinClasses(object) {
               object.removeClass('pin-top');
               object.removeClass('pinned');
               object.removeClass('pin-bottom');
           }

           function updateElements(objects, scrolled) {
               objects.each(function () {
                   // Add position fixed (because its between top and bottom)
                   if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
                       removePinClasses($(this));
                       $(this).css('top', options.offset);
                       $(this).addClass('pinned');
                   }

                   // Add pin-top (when scrolled position is above top)
                   if (scrolled < options.top && !$(this).hasClass('pin-top')) {
                       removePinClasses($(this));
                       $(this).css('top', 0);
                       $(this).addClass('pin-top');
                   }

                   // Add pin-bottom (when scrolled position is below bottom)
                   if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
                       removePinClasses($(this));
                       $(this).addClass('pin-bottom');
                       $(this).css('top', options.bottom - $original_offset);
                   }
               });
           }

           $(this).data('pushpin-id', $uniqueId);
           updateElements($this, $(window).scrollTop());
           $(window).on('scroll.' + $uniqueId, function () {
               var $scrolled = $(window).scrollTop() + options.offset;
               updateElements($this, $scrolled);
           });

       });

   };

}(jQuery));; (function ($) {

   $(document).ready(function () {

       // jQuery reverse
       $.fn.reverse = [].reverse;

       // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
       $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
           var $this = $(this);
           openFABMenu($this);
       });
       $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
           var $this = $(this);
           closeFABMenu($this);
       });

       // Toggle-on-click behaviour.
       $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
           var $this = $(this);
           var $menu = $this.parent();
           if ($menu.hasClass('active')) {
               closeFABMenu($menu);
           } else {
               openFABMenu($menu);
           }
       });

       // Toolbar transition behaviour.
       $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
           var $this = $(this);
           var $menu = $this.parent();
           FABtoToolbar($menu);
       });

   });

   $.fn.extend({
       openFAB: function () {
           openFABMenu($(this));
       },
       closeFAB: function () {
           closeFABMenu($(this));
       },
       openToolbar: function () {
           FABtoToolbar($(this));
       },
       closeToolbar: function () {
           toolbarToFAB($(this));
       }
   });

   var openFABMenu = function (btn) {
       var $this = btn;
       if ($this.hasClass('active') === false) {

           // Get direction option
           var horizontal = $this.hasClass('horizontal');
           var offsetY, offsetX;

           if (horizontal === true) {
               offsetX = 40;
           } else {
               offsetY = 40;
           }

           $this.addClass('active');
           $this.find('ul .btn-floating').velocity({
               scaleY: ".4",
               scaleX: ".4",
               translateY: offsetY + 'px',
               translateX: offsetX + 'px'
           }, {
               duration: 0
           });

           var time = 0;
           $this.find('ul .btn-floating').reverse().each(function () {
               $(this).velocity({
                   opacity: "1",
                   scaleX: "1",
                   scaleY: "1",
                   translateY: "0",
                   translateX: '0'
               }, {
                   duration: 80,
                   delay: time
               });
               time += 40;
           });
       }
   };

   var closeFABMenu = function (btn) {
       var $this = btn;
       // Get direction option
       var horizontal = $this.hasClass('horizontal');
       var offsetY, offsetX;

       if (horizontal === true) {
           offsetX = 40;
       } else {
           offsetY = 40;
       }

       $this.removeClass('active');
       var time = 0;
       $this.find('ul .btn-floating').velocity("stop", true);
       $this.find('ul .btn-floating').velocity({
           opacity: "0",
           scaleX: ".4",
           scaleY: ".4",
           translateY: offsetY + 'px',
           translateX: offsetX + 'px'
       }, {
           duration: 80
       });
   };

   /**
    * Transform FAB into toolbar
    * @param  {Object}  object jQuery object
    */
   var FABtoToolbar = function (btn) {
       if (btn.attr('data-open') === "true") {
           return;
       }

       var offsetX, offsetY, scaleFactor;
       var windowWidth = window.innerWidth;
       var windowHeight = window.innerHeight;
       var btnRect = btn[0].getBoundingClientRect();
       var anchor = btn.find('> a').first();
       var menu = btn.find('> ul').first();

var backdrop = $('');

       var fabColor = anchor.css('background-color');
       anchor.append(backdrop);

       offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
       offsetY = windowHeight - btnRect.bottom;
       scaleFactor = windowWidth / backdrop.width();
       btn.attr('data-origin-bottom', btnRect.bottom);
       btn.attr('data-origin-left', btnRect.left);
       btn.attr('data-origin-width', btnRect.width);

       // Set initial state
       btn.addClass('active');
       btn.attr('data-open', true);
       btn.css({
           'text-align': 'center',
           width: '100%',
           bottom: 0,
           left: 0,
           transform: 'translateX(' + offsetX + 'px)',
           transition: 'none'
       });
       anchor.css({
           transform: 'translateY(' + -offsetY + 'px)',
           transition: 'none'
       });
       backdrop.css({
           'background-color': fabColor
       });

       setTimeout(function () {
           btn.css({
               transform: ,
               transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
           });
           anchor.css({
               overflow: 'visible',
               transform: ,
               transition: 'transform .2s'
           });

           setTimeout(function () {
               btn.css({
                   overflow: 'hidden',
                   'background-color': fabColor
               });
               backdrop.css({
                   transform: 'scale(' + scaleFactor + ')',
                   transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
               });
               menu.find('> li > a').css({
                   opacity: 1
               });

               // Scroll to close.
               $(window).on('scroll.fabToolbarClose', function () {
                   toolbarToFAB(btn);
                   $(window).off('scroll.fabToolbarClose');
                   $(document).off('click.fabToolbarClose');
               });

               $(document).on('click.fabToolbarClose', function (e) {
                   if (!$(e.target).closest(menu).length) {
                       toolbarToFAB(btn);
                       $(window).off('scroll.fabToolbarClose');
                       $(document).off('click.fabToolbarClose');
                   }
               });
           }, 100);
       }, 0);
   };

   /**
    * Transform toolbar back into FAB
    * @param  {Object}  object jQuery object
    */
   var toolbarToFAB = function (btn) {
       if (btn.attr('data-open') !== "true") {
           return;
       }

       var offsetX, offsetY, scaleFactor;
       var windowWidth = window.innerWidth;
       var windowHeight = window.innerHeight;
       var btnWidth = btn.attr('data-origin-width');
       var btnBottom = btn.attr('data-origin-bottom');
       var btnLeft = btn.attr('data-origin-left');
       var anchor = btn.find('> .btn-floating').first();
       var menu = btn.find('> ul').first();
       var backdrop = btn.find('.fab-backdrop');
       var fabColor = anchor.css('background-color');

       offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
       offsetY = windowHeight - btnBottom;
       scaleFactor = windowWidth / backdrop.width();

       // Hide backdrop
       btn.removeClass('active');
       btn.attr('data-open', false);
       btn.css({
           'background-color': 'transparent',
           transition: 'none'
       });
       anchor.css({
           transition: 'none'
       });
       backdrop.css({
           transform: 'scale(0)',
           'background-color': fabColor
       });
       menu.find('> li > a').css({
           opacity: 
       });

       setTimeout(function () {
           backdrop.remove();

           // Set initial state.
           btn.css({
               'text-align': ,
               width: ,
               bottom: ,
               left: ,
               overflow: ,
               'background-color': ,
               transform: 'translate3d(' + -offsetX + 'px,0,0)'
           });
           anchor.css({
               overflow: ,
               transform: 'translate3d(0,' + offsetY + 'px,0)'
           });

           setTimeout(function () {
               btn.css({
                   transform: 'translate3d(0,0,0)',
                   transition: 'transform .2s'
               });
               anchor.css({
                   transform: 'translate3d(0,0,0)',
                   transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
               });
           }, 20);
       }, 200);
   };

}(jQuery));; (function ($) {

   // Image transition function
   Materialize.fadeInImage = function (selectorOrEl) {
       var element;
       if (typeof (selectorOrEl) === 'string') {
           element = $(selectorOrEl);
       } else if (typeof (selectorOrEl) === 'object') {
           element = selectorOrEl;
       } else {
           return;
       }
       element.css({
           opacity: 0
       });
       $(element).velocity({
           opacity: 1
       }, {
           duration: 650,
           queue: false,
           easing: 'easeOutSine'
       });
       $(element).velocity({
           opacity: 1
       }, {
           duration: 1300,
           queue: false,
           easing: 'swing',
           step: function (now, fx) {
               fx.start = 100;
               var grayscale_setting = now / 100;
               var brightness_setting = 150 - (100 - now) / 1.75;

               if (brightness_setting < 100) {
                   brightness_setting = 100;
               }
               if (now >= 0) {
                   $(this).css({
                       "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
                       "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
                   });
               }
           }
       });
   };

   // Horizontal staggered list
   Materialize.showStaggeredList = function (selectorOrEl) {
       var element;
       if (typeof (selectorOrEl) === 'string') {
           element = $(selectorOrEl);
       } else if (typeof (selectorOrEl) === 'object') {
           element = selectorOrEl;
       } else {
           return;
       }
       var time = 0;
       element.find('li').velocity({
           translateX: "-100px"
       }, {
           duration: 0
       });

       element.find('li').each(function () {
           $(this).velocity({
               opacity: "1",
               translateX: "0"
           }, {
               duration: 800,
               delay: time,
               easing: [60, 10]
           });
           time += 120;
       });
   };

   $(document).ready(function () {
       // Hardcoded .staggered-list scrollFire
       // var staggeredListOptions = [];
       // $('ul.staggered-list').each(function (i) {

       //   var label = 'scrollFire-' + i;
       //   $(this).addClass(label);
       //   staggeredListOptions.push(
       //     {selector: 'ul.staggered-list.' + label,
       //      offset: 200,
       //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
       // });
       // scrollFire(staggeredListOptions);

       // HammerJS, Swipe navigation

       // Touch Event
       var swipeLeft = false;
       var swipeRight = false;

       // Dismissible Collections
       $('.dismissable').each(function () {
           $(this).hammer({
               prevent_default: false
           }).on('pan', function (e) {
               if (e.gesture.pointerType === "touch") {
                   var $this = $(this);
                   var direction = e.gesture.direction;
                   var x = e.gesture.deltaX;
                   var velocityX = e.gesture.velocityX;

                   $this.velocity({
                       translateX: x
                   }, {
                       duration: 50,
                       queue: false,
                       easing: 'easeOutQuad'
                   });

                   // Swipe Left
                   if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
                       swipeLeft = true;
                   }

                   // Swipe Right
                   if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
                       swipeRight = true;
                   }
               }
           }).on('panend', function (e) {
               // Reset if collection is moved back into original position
               if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
                   swipeRight = false;
                   swipeLeft = false;
               }

               if (e.gesture.pointerType === "touch") {
                   var $this = $(this);
                   if (swipeLeft || swipeRight) {
                       var fullWidth;
                       if (swipeLeft) {
                           fullWidth = $this.innerWidth();
                       } else {
                           fullWidth = -1 * $this.innerWidth();
                       }

                       $this.velocity({
                           translateX: fullWidth,
                       }, {
                           duration: 100,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               $this.css('border', 'none');
                               $this.velocity({
                                   height: 0,
                                   padding: 0,
                               }, {
                                   duration: 200,
                                   queue: false,
                                   easing: 'easeOutQuad',
                                   complete: function () {
                                       $this.remove();
                                   }
                               });
                           }
                       });
                   } else {
                       $this.velocity({
                           translateX: 0,
                       }, {
                           duration: 100,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                   }
                   swipeLeft = false;
                   swipeRight = false;
               }
           });

       });

       // time = 0
       // // Vertical Staggered list
       // $('ul.staggered-list.vertical li').velocity(
       //     { translateY: "100px"},
       //     { duration: 0 });

       // $('ul.staggered-list.vertical li').each(function() {
       //   $(this).velocity(
       //     { opacity: "1", translateY: "0"},
       //     { duration: 800, delay: time, easing: [60, 25] });
       //   time += 120;
       // });

       // // Fade in and Scale
       // $('.fade-in.scale').velocity(
       //     { scaleX: .4, scaleY: .4, translateX: -600},
       //     { duration: 0});
       // $('.fade-in').each(function() {
       //   $(this).velocity(
       //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
       //     { duration: 800, easing: [60, 10] });
       // });
   });

}(jQuery));; (function ($) {

   var scrollFireEventsHandled = false;

   // Input: Array of JSON objects {selector, offset, callback}
   Materialize.scrollFire = function (options) {
       var onScroll = function () {
           var windowScroll = window.pageYOffset + window.innerHeight;

           for (var i = 0; i < options.length; i++) {
               // Get options from each line
               var value = options[i];
               var selector = value.selector,
                   offset = value.offset,
                   callback = value.callback;

               var currentElement = document.querySelector(selector);
               if (currentElement !== null) {
                   var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;

                   if (windowScroll > (elementOffset + offset)) {
                       if (value.done !== true) {
                           if (typeof (callback) === 'function') {
                               callback.call(this, currentElement);
                           } else if (typeof (callback) === 'string') {
                               var callbackFunc = new Function(callback);
                               callbackFunc(currentElement);
                           }
                           value.done = true;
                       }
                   }
               }
           }
       };

       var throttledScroll = Materialize.throttle(function () {
           onScroll();
       }, options.throttle || 100);

       if (!scrollFireEventsHandled) {
           window.addEventListener("scroll", throttledScroll);
           window.addEventListener("resize", throttledScroll);
           scrollFireEventsHandled = true;
       }

       // perform a scan once, after current execution context, and after dom is ready
       setTimeout(throttledScroll, 0);
   };

})(jQuery);; /*!

* pickadate.js v3.5.0, 2014/04/13
* By Amsul, http://amsul.ca
* Hosted on http://amsul.github.io/pickadate.js
* Licensed under MIT
*/

(function (factory) {

   // AMD.
   if (typeof define == 'function' && define.amd)
       define('picker', ['jquery'], factory)

   // Node.js/browserify.
   else if (typeof exports == 'object')
       module.exports = factory(require('jquery'))

   // Browser globals.
   else this.Picker = factory(jQuery)

}(function ($) {

   var $window = $(window)
   var $document = $(document)
   var $html = $(document.documentElement)

   /**
    * The picker constructor that creates a blank picker.
    */
   function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {

       // If there’s no element, return the picker constructor.
       if (!ELEMENT) return PickerConstructor

       var
           IS_DEFAULT_THEME = false,

           // The state of the picker.
           STATE = {
               id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
           },

           // Merge the defaults and options passed.
           SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},

           // Merge the default classes with the settings classes.
           CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),

           // The element node wrapper into a jQuery object.
           $ELEMENT = $(ELEMENT),

           // Pseudo picker constructor.
           PickerInstance = function () {
               return this.start()
           },

           // The picker prototype.
           P = PickerInstance.prototype = {

               constructor: PickerInstance,

               $node: $ELEMENT,

               /**
                * Initialize everything
                */
               start: function () {

                   // If it’s already started, do nothing.
                   if (STATE && STATE.start) return P

                   // Update the picker states.
                   STATE.methods = {}
                   STATE.start = true
                   STATE.open = false
                   STATE.type = ELEMENT.type

                   // Confirm focus state, convert into text input to remove UA stylings,
                   // and set as readonly to prevent keyboard popup.
                   ELEMENT.autofocus = ELEMENT == getActiveElement()
                   ELEMENT.readOnly = !SETTINGS.editable
                   ELEMENT.id = ELEMENT.id || STATE.id
                   if (ELEMENT.type != 'text') {
                       ELEMENT.type = 'text'
                   }

                   // Create a new picker component with the settings.
                   P.component = new COMPONENT(P, SETTINGS)

                   // Create the picker root with a holder and then prepare it.
                   P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'))
                   prepareElementRoot()

                   // If there’s a format for the hidden input element, create the element.
                   if (SETTINGS.formatSubmit) {
                       prepareElementHidden()
                   }

                   // Prepare the input element.
                   prepareElement()

                   // Insert the root as specified in the settings.
                   if (SETTINGS.container) $(SETTINGS.container).append(P.$root)
                   else $ELEMENT.after(P.$root)

                   // Bind the default component and settings events.
                   P.on({
                       start: P.component.onStart,
                       render: P.component.onRender,
                       stop: P.component.onStop,
                       open: P.component.onOpen,
                       close: P.component.onClose,
                       set: P.component.onSet
                   }).on({
                       start: SETTINGS.onStart,
                       render: SETTINGS.onRender,
                       stop: SETTINGS.onStop,
                       open: SETTINGS.onOpen,
                       close: SETTINGS.onClose,
                       set: SETTINGS.onSet
                   })

                   // Once we’re all set, check the theme in use.
                   IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0])

                   // If the element has autofocus, open the picker.
                   if (ELEMENT.autofocus) {
                       P.open()
                   }

                   // Trigger queued the “start” and “render” events.
                   return P.trigger('start').trigger('render')
               }, //start

               /**
                * Render a new picker
                */
               render: function (entireComponent) {

                   // Insert a new component holder in the root or box.
                   if (entireComponent) P.$root.html(createWrappedComponent())
                   else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open))

                   // Trigger the queued “render” events.
                   return P.trigger('render')
               }, //render

               /**
                * Destroy everything
                */
               stop: function () {

                   // If it’s already stopped, do nothing.
                   if (!STATE.start) return P

                   // Then close the picker.
                   P.close()

                   // Remove the hidden field.
                   if (P._hidden) {
                       P._hidden.parentNode.removeChild(P._hidden)
                   }

                   // Remove the root.
                   P.$root.remove()

                   // Remove the input class, remove the stored data, and unbind
                   // the events (after a tick for IE - see `P.close`).
                   $ELEMENT.removeClass(CLASSES.input).removeData(NAME)
                   setTimeout(function () {
                       $ELEMENT.off('.' + STATE.id)
                   }, 0)

                   // Restore the element state
                   ELEMENT.type = STATE.type
                   ELEMENT.readOnly = false

                   // Trigger the queued “stop” events.
                   P.trigger('stop')

                   // Reset the picker states.
                   STATE.methods = {}
                   STATE.start = false

                   return P
               }, //stop

               /**
                * Open up the picker
                */
               open: function (dontGiveFocus) {

                   // If it’s already open, do nothing.
                   if (STATE.open) return P

                   // Add the “active” class.
                   $ELEMENT.addClass(CLASSES.active)
                   aria(ELEMENT, 'expanded', true)

                   // * A Firefox bug, when `html` has `overflow:hidden`, results in
                   //   killing transitions :(. So add the “opened” state on the next tick.
                   //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
                   setTimeout(function () {

                       // Add the “opened” class to the picker root.
                       P.$root.addClass(CLASSES.opened)
                       aria(P.$root[0], 'hidden', false)

                   }, 0)

                   // If we have to give focus, bind the element and doc events.
                   if (dontGiveFocus !== false) {

                       // Set it as open.
                       STATE.open = true

                       // Prevent the page from scrolling.
                       if (IS_DEFAULT_THEME) {
                           $html.
                           css('overflow', 'hidden').
                           css('padding-right', '+=' + getScrollbarWidth())
                       }

                       // Pass focus to the root element’s jQuery object.
                       // * Workaround for iOS8 to bring the picker’s root into view.
                       P.$root.eq(0).focus()

                       // Bind the document events.
                       $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {

                           var target = event.target

                           // If the target of the event is not the element, close the picker picker.
                           // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
                           //   Also, for Firefox, a click on an `option` element bubbles up directly
                           //   to the doc. So make sure the target wasn't the doc.
                           // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
                           //   which causes the picker to unexpectedly close when right-clicking it. So make
                           //   sure the event wasn’t a right-click.
                           if (target != ELEMENT && target != document && event.which != 3) {

                               // If the target was the holder that covers the screen,
                               // keep the element focused to maintain tabindex.
                               P.close(target === P.$root.children()[0])
                           }

                       }).on('keydown.' + STATE.id, function (event) {

                           var
                           // Get the keycode.
                               keycode = event.keyCode,

                               // Translate that to a selection change.
                               keycodeToMove = P.component.key[keycode],

                               // Grab the target.
                               target = event.target

                           // On escape, close the picker and give focus.
                           if (keycode == 27) {
                               P.close(true)
                           }

                           // Check if there is a key movement or “enter” keypress on the element.
                           else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {

                               // Prevent the default action to stop page movement.
                               event.preventDefault()

                               // Trigger the key movement action.
                               if (keycodeToMove) {
                                   PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)])
                               }

                               // On “enter”, if the highlighted item isn’t disabled, set the value and close.
                               else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
                                   P.set('select', P.component.item.highlight).close()
                               }
                           }

                           // If the target is within the root and “enter” is pressed,
                           // prevent the default action and trigger a click on the target instead.
                           else if ($.contains(P.$root[0], target) && keycode == 13) {
                               event.preventDefault()
                               target.click()
                           }
                       })
                   }

                   // Trigger the queued “open” events.
                   return P.trigger('open')
               }, //open

               /**
                * Close the picker
                */
               close: function (giveFocus) {

                   // If we need to give focus, do it before changing states.
                   if (giveFocus) {
                       // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
                       // The focus is triggered *after* the close has completed - causing it
                       // to open again. So unbind and rebind the event at the next tick.
                       P.$root.off('focus.toOpen').eq(0).focus()
                       setTimeout(function () {
                           P.$root.on('focus.toOpen', handleFocusToOpenEvent)
                       }, 0)
                   }

                   // Remove the “active” class.
                   $ELEMENT.removeClass(CLASSES.active)
                   aria(ELEMENT, 'expanded', false)

                   // * A Firefox bug, when `html` has `overflow:hidden`, results in
                   //   killing transitions :(. So remove the “opened” state on the next tick.
                   //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
                   setTimeout(function () {

                       // Remove the “opened” and “focused” class from the picker root.
                       P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused)
                       aria(P.$root[0], 'hidden', true)

                   }, 0)

                   // If it’s already closed, do nothing more.
                   if (!STATE.open) return P

                   // Set it as closed.
                   STATE.open = false

                   // Allow the page to scroll.
                   if (IS_DEFAULT_THEME) {
                       $html.
                       css('overflow', ).
                       css('padding-right', '-=' + getScrollbarWidth())
                   }

                   // Unbind the document events.
                   $document.off('.' + STATE.id)

                   // Trigger the queued “close” events.
                   return P.trigger('close')
               }, //close

               /**
                * Clear the values
                */
               clear: function (options) {
                   return P.set('clear', null, options)
               }, //clear

               /**
                * Set something
                */
               set: function (thing, value, options) {

                   var thingItem, thingValue,
                       thingIsObject = $.isPlainObject(thing),
                       thingObject = thingIsObject ? thing : {}

                   // Make sure we have usable options.
                   options = thingIsObject && $.isPlainObject(value) ? value : options || {}

                   if (thing) {

                       // If the thing isn’t an object, make it one.
                       if (!thingIsObject) {
                           thingObject[thing] = value
                       }

                       // Go through the things of items to set.
                       for (thingItem in thingObject) {

                           // Grab the value of the thing.
                           thingValue = thingObject[thingItem]

                           // First, if the item exists and there’s a value, set it.
                           if (thingItem in P.component.item) {
                               if (thingValue === undefined) thingValue = null
                               P.component.set(thingItem, thingValue, options)
                           }

                           // Then, check to update the element value and broadcast a change.
                           if (thingItem == 'select' || thingItem == 'clear') {
                               $ELEMENT.
                               val(thingItem == 'clear' ?  : P.get(thingItem, SETTINGS.format)).
                               trigger('change')
                           }
                       }

                       // Render a new picker.
                       P.render()
                   }

                   // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
                   return options.muted ? P : P.trigger('set', thingObject)
               }, //set

               /**
                * Get something
                */
               get: function (thing, format) {

                   // Make sure there’s something to get.
                   thing = thing || 'value'

                   // If a picker state exists, return that.
                   if (STATE[thing] != null) {
                       return STATE[thing]
                   }

                   // Return the submission value, if that.
                   if (thing == 'valueSubmit') {
                       if (P._hidden) {
                           return P._hidden.value
                       }
                       thing = 'value'
                   }

                   // Return the value, if that.
                   if (thing == 'value') {
                       return ELEMENT.value
                   }

                   // Check if a component item exists, return that.
                   if (thing in P.component.item) {
                       if (typeof format == 'string') {
                           var thingValue = P.component.get(thing)
                           return thingValue ?
                               PickerConstructor._.trigger(
                                   P.component.formats.toString,
                                   P.component, [format, thingValue]
                               ) : 
                       }
                       return P.component.get(thing)
                   }
               }, //get

               /**
                * Bind events on the things.
                */
               on: function (thing, method, internal) {

                   var thingName, thingMethod,
                       thingIsObject = $.isPlainObject(thing),
                       thingObject = thingIsObject ? thing : {}

                   if (thing) {

                       // If the thing isn’t an object, make it one.
                       if (!thingIsObject) {
                           thingObject[thing] = method
                       }

                       // Go through the things to bind to.
                       for (thingName in thingObject) {

                           // Grab the method of the thing.
                           thingMethod = thingObject[thingName]

                           // If it was an internal binding, prefix it.
                           if (internal) {
                               thingName = '_' + thingName
                           }

                           // Make sure the thing methods collection exists.
                           STATE.methods[thingName] = STATE.methods[thingName] || []

                           // Add the method to the relative method collection.
                           STATE.methods[thingName].push(thingMethod)
                       }
                   }

                   return P
               }, //on

               /**
                * Unbind events on the things.
                */
               off: function () {
                   var i, thingName,
                       names = arguments;
                   for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
                       thingName = names[i]
                       if (thingName in STATE.methods) {
                           delete STATE.methods[thingName]
                       }
                   }
                   return P
               },

               /**
                * Fire off method events.
                */
               trigger: function (name, data) {
                       var _trigger = function (name) {
                           var methodList = STATE.methods[name]
                           if (methodList) {
                               methodList.map(function (method) {
                                   PickerConstructor._.trigger(method, P, [data])
                               })
                           }
                       }
                       _trigger('_' + name)
                       _trigger(name)
                       return P
                   } //trigger
           } //PickerInstance.prototype

       /**
        * Wrap the picker holder components together.
        */
       function createWrappedComponent() {

           // Create a picker wrapper holder
           return PickerConstructor._.node('div',

                   // Create a picker wrapper node
                   PickerConstructor._.node('div',

                       // Create a picker frame
                       PickerConstructor._.node('div',

                           // Create a picker box node
                           PickerConstructor._.node('div',

                               // Create the components nodes.
                               P.component.nodes(STATE.open),

                               // The picker box class
                               CLASSES.box
                           ),

                           // Picker wrap class
                           CLASSES.wrap
                       ),

                       // Picker frame class
                       CLASSES.frame
                   ),

                   // Picker holder class
                   CLASSES.holder
               ) //endreturn
       } //createWrappedComponent

       /**
        * Prepare the input element with all bindings.
        */
       function prepareElement() {

           $ELEMENT.

           // Store the picker data by component name.
           data(NAME, P).

           // Add the “input” class name.
           addClass(CLASSES.input).

           // Remove the tabindex.
           attr('tabindex', -1).

           // If there’s a `data-value`, update the value of the element.
           val($ELEMENT.data('value') ?
               P.get('select', SETTINGS.format) :
               ELEMENT.value
           )

           // Only bind keydown events if the element isn’t editable.
           if (!SETTINGS.editable) {

               $ELEMENT.

               // On focus/click, focus onto the root to open it up.
               on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
                   event.preventDefault()
                   P.$root.eq(0).focus()
               }).

               // Handle keyboard event based on the picker being opened or not.
               on('keydown.' + STATE.id, handleKeydownEvent)
           }

           // Update the aria attributes.
           aria(ELEMENT, {
               haspopup: true,
               expanded: false,
               readonly: false,
               owns: ELEMENT.id + '_root'
           })
       }

       /**
        * Prepare the root picker element with all bindings.
        */
       function prepareElementRoot() {

           P.$root.

           on({

               // For iOS8.
               keydown: handleKeydownEvent,

               // When something within the root is focused, stop from bubbling
               // to the doc and remove the “focused” state from the root.
               focusin: function (event) {
                   P.$root.removeClass(CLASSES.focused)
                   event.stopPropagation()
               },

               // When something within the root holder is clicked, stop it
               // from bubbling to the doc.
               'mousedown click': function (event) {

                   var target = event.target

                   // Make sure the target isn’t the root holder so it can bubble up.
                   if (target != P.$root.children()[0]) {

                       event.stopPropagation()

                       // * For mousedown events, cancel the default action in order to
                       //   prevent cases where focus is shifted onto external elements
                       //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
                       //   Also, for Firefox, don’t prevent action on the `option` element.
                       if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {

                           event.preventDefault()

                           // Re-focus onto the root so that users can click away
                           // from elements focused within the picker.
                           P.$root.eq(0).focus()
                       }
                   }
               }
           }).

           // Add/remove the “target” class on focus and blur.
           on({
               focus: function () {
                   $ELEMENT.addClass(CLASSES.target)
               },
               blur: function () {
                   $ELEMENT.removeClass(CLASSES.target)
               }
           }).

           // Open the picker and adjust the root “focused” state
           on('focus.toOpen', handleFocusToOpenEvent).

           // If there’s a click on an actionable element, carry out the actions.
           on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {

                   var $target = $(this),
                       targetData = $target.data(),
                       targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),

                       // * For IE, non-focusable elements can be active elements as well
                       //   (http://stackoverflow.com/a/2684561).
                       activeElement = getActiveElement()
                   activeElement = activeElement && (activeElement.type || activeElement.href)

                   // If it’s disabled or nothing inside is actively focused, re-focus the element.
                   if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
                       P.$root.eq(0).focus()
                   }

                   // If something is superficially changed, update the `highlight` based on the `nav`.
                   if (!targetDisabled && targetData.nav) {
                       P.set('highlight', P.component.item.highlight, {
                           nav: targetData.nav
                       })
                   }

                   // If something is picked, set `select` then close with focus.
                   else if (!targetDisabled && 'pick' in targetData) {
                       P.set('select', targetData.pick)
                   }

                   // If a “clear” button is pressed, empty the values and close with focus.
                   else if (targetData.clear) {
                       P.clear().close(true)
                   } else if (targetData.close) {
                       P.close(true)
                   }

               }) //P.$root

           aria(P.$root[0], 'hidden', true)
       }

       /**
        * Prepare the hidden input element along with all bindings.
        */
       function prepareElementHidden() {

           var name

           if (SETTINGS.hiddenName === true) {
               name = ELEMENT.name
               ELEMENT.name = 
           } else {
               name = [
               typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : ,
               typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
           ]
               name = name[0] + ELEMENT.name + name[1]
           }

           P._hidden = $(
               '<input ' +
               'type=hidden ' +

               // Create the name using the original input’s with a prefix and suffix.
               'name="' + name + '"' +

               // If the element has a value, set the hidden value as well.
               (
                   $ELEMENT.data('value') || ELEMENT.value ?
                   ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
                   
               ) +
               '>'
           )[0]

           $ELEMENT.

           // If the value changes, update the hidden input with the correct format.
           on('change.' + STATE.id, function () {
               P._hidden.value = ELEMENT.value ?
                   P.get('select', SETTINGS.formatSubmit) :
                   
           })

           // Insert the hidden input as specified in the settings.
           if (SETTINGS.container) $(SETTINGS.container).append(P._hidden)
           else $ELEMENT.after(P._hidden)
       }

       // For iOS8.
       function handleKeydownEvent(event) {

           var keycode = event.keyCode,

               // Check if one of the delete keys was pressed.
               isKeycodeDelete = /^(8|46)$/.test(keycode)

           // For some reason IE clears the input value on “escape”.
           if (keycode == 27) {
               P.close()
               return false
           }

           // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
           if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {

               // Prevent it from moving the page and bubbling to doc.
               event.preventDefault()
               event.stopPropagation()

               // If `delete` was pressed, clear the values and close the picker.
               // Otherwise open the picker.
               if (isKeycodeDelete) {
                   P.clear().close()
               } else {
                   P.open()
               }
           }
       }

       // Separated for IE
       function handleFocusToOpenEvent(event) {

           // Stop the event from propagating to the doc.
           event.stopPropagation()

           // If it’s a focus event, add the “focused” class to the root.
           if (event.type == 'focus') {
               P.$root.addClass(CLASSES.focused)
           }

           // And then finally open the picker.
           P.open()
       }

       // Return a new picker instance.
       return new PickerInstance()
   } //PickerConstructor

   /**
    * The default classes and prefix to use for the HTML classes.
    */
   PickerConstructor.klasses = function (prefix) {
           prefix = prefix || 'picker'
           return {

               picker: prefix,
               opened: prefix + '--opened',
               focused: prefix + '--focused',

               input: prefix + '__input',
               active: prefix + '__input--active',
               target: prefix + '__input--target',

               holder: prefix + '__holder',

               frame: prefix + '__frame',
               wrap: prefix + '__wrap',

               box: prefix + '__box'
           }
       } //PickerConstructor.klasses

   /**
    * Check if the default theme is being used.
    */
   function isUsingDefaultTheme(element) {

       var theme,
           prop = 'position'

       // For IE.
       if (element.currentStyle) {
           theme = element.currentStyle[prop]
       }

       // For normal browsers.
       else if (window.getComputedStyle) {
           theme = getComputedStyle(element)[prop]
       }

       return theme == 'fixed'
   }

   /**
    * Get the width of the browser’s scrollbar.
    * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
    */
   function getScrollbarWidth() {

       if ($html.height() <= $window.height()) {
           return 0
       }

       var $outer = $('<div style="visibility:hidden;width:100px" />').
       appendTo('body')

       // Get the width without scrollbars.
       var widthWithoutScroll = $outer[0].offsetWidth

       // Force adding scrollbars.
       $outer.css('overflow', 'scroll')

       // Add the inner div.
       var $inner = $('<div style="width:100%" />').appendTo($outer)

       // Get the width with scrollbars.
       var widthWithScroll = $inner[0].offsetWidth

       // Remove the divs.
       $outer.remove()

       // Return the difference between the widths.
       return widthWithoutScroll - widthWithScroll
   }

   /**
    * PickerConstructor helper methods.
    */
   PickerConstructor._ = {

           /**
            * Create a group of nodes. Expects:
            * `
               {
                   min:    {Integer},
                   max:    {Integer},
                   i:      {Integer},
                   node:   {String},
                   item:   {Function}
               }
            * `
            */
           group: function (groupObject) {

               var
               // Scope for the looped object
                   loopObjectScope,

                   // Create the nodes list
                   nodesList = ,

                   // The counter starts from the `min`
                   counter = PickerConstructor._.trigger(groupObject.min, groupObject)

               // Loop from the `min` to `max`, incrementing by `i`
               for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {

                   // Trigger the `item` function within scope of the object
                   loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter])

                   // Splice the subgroup and create nodes out of the sub nodes
                   nodesList += PickerConstructor._.node(
                       groupObject.node,
                       loopObjectScope[0], // the node
                       loopObjectScope[1], // the classes
                       loopObjectScope[2] // the attributes
                   )
               }

               // Return the list of nodes
               return nodesList
           }, //group

           /**
            * Create a dom node string
            */
           node: function (wrapper, item, klass, attribute) {

               // If the item is false-y, just return an empty string
               if (!item) return 

               // If the item is an array, do a join
               item = $.isArray(item) ? item.join() : item

               // Check for the class
               klass = klass ? ' class="' + klass + '"' : 

               // Check for any attributes
               attribute = attribute ? ' ' + attribute : 

               // Return the wrapped item
               return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
           }, //node

           /**
            * Lead numbers below 10 with a zero.
            */
           lead: function (number) {
               return (number < 10 ? '0' : ) + number
           },

           /**
            * Trigger a function otherwise return the value.
            */
           trigger: function (callback, scope, args) {
               return typeof callback == 'function' ? callback.apply(scope, args || []) : callback
           },

           /**
            * If the second character is a digit, length is 2 otherwise 1.
            */
           digits: function (string) {
               return (/\d/).test(string[1]) ? 2 : 1
           },

           /**
            * Tell if something is a date object.
            */
           isDate: function (value) {
               return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate())
           },

           /**
            * Tell if something is an integer.
            */
           isInteger: function (value) {
               return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0
           },

           /**
            * Create ARIA attribute strings.
            */
           ariaAttr: ariaAttr
       } //PickerConstructor._

   /**
    * Extend the picker with a component and defaults.
    */
   PickerConstructor.extend = function (name, Component) {

           // Extend jQuery.
           $.fn[name] = function (options, action) {

               // Grab the component data.
               var componentData = this.data(name)

               // If the picker is requested, return the data object.
               if (options == 'picker') {
                   return componentData
               }

               // If the component data exists and `options` is a string, carry out the action.
               if (componentData && typeof options == 'string') {
                   return PickerConstructor._.trigger(componentData[options], componentData, [action])
               }

               // Otherwise go through each matched element and if the component
               // doesn’t exist, create a new picker using `this` element
               // and merging the defaults and options with a deep copy.
               return this.each(function () {
                   var $this = $(this)
                   if (!$this.data(name)) {
                       new PickerConstructor(this, name, Component, options)
                   }
               })
           }

           // Set the defaults.
           $.fn[name].defaults = Component.defaults
       } //PickerConstructor.extend

   function aria(element, attribute, value) {
       if ($.isPlainObject(attribute)) {
           for (var key in attribute) {
               ariaSet(element, key, attribute[key])
           }
       } else {
           ariaSet(element, attribute, value)
       }
   }

   function ariaSet(element, attribute, value) {
       element.setAttribute(
           (attribute == 'role' ?  : 'aria-') + attribute,
           value
       )
   }

   function ariaAttr(attribute, data) {
       if (!$.isPlainObject(attribute)) {
           attribute = {
               attribute: data
           }
       }
       data = 
       for (var key in attribute) {
           var attr = (key == 'role' ?  : 'aria-') + key,
               attrVal = attribute[key]
           data += attrVal == null ?  : attr + '="' + attribute[key] + '"'
       }
       return data
   }

   // IE8 bug throws an error for activeElements within iframes.
   function getActiveElement() {
       try {
           return document.activeElement
       } catch (err) {}
   }

   // Expose the picker constructor.
   return PickerConstructor

}));

/*!

* Date picker for pickadate.js v3.5.0
* http://amsul.github.io/pickadate.js/date.htm
*/

(function (factory) {

   // AMD.
   if (typeof define == 'function' && define.amd)
       define(['picker', 'jquery'], factory)

   // Node.js/browserify.
   else if (typeof exports == 'object')
       module.exports = factory(require('./picker.js'), require('jquery'))

   // Browser globals.
   else factory(Picker, jQuery)

}(function (Picker, $) {

   /**
    * Globals and constants
    */
   var DAYS_IN_WEEK = 7,
       WEEKS_IN_CALENDAR = 6,
       _ = Picker._;

   /**
    * The date picker constructor
    */
   function DatePicker(picker, settings) {

       var calendar = this,
           element = picker.$node[0],
           elementValue = element.value,
           elementDataValue = picker.$node.data('value'),
           valueString = elementDataValue || elementValue,
           formatString = elementDataValue ? settings.formatSubmit : settings.format,
           isRTL = function () {

               return element.currentStyle ?

                   // For IE.
                   element.currentStyle.direction == 'rtl' :

                   // For normal browsers.
                   getComputedStyle(picker.$root[0]).direction == 'rtl'
           }

       calendar.settings = settings
       calendar.$node = picker.$node

       // The queue of methods that will be used to build item objects.
       calendar.queue = {
           min: 'measure create',
           max: 'measure create',
           now: 'now create',
           select: 'parse create validate',
           highlight: 'parse navigate create validate',
           view: 'parse create validate viewset',
           disable: 'deactivate',
           enable: 'activate'
       }

       // The component's item object.
       calendar.item = {}

       calendar.item.clear = null
       calendar.item.disable = (settings.disable || []).slice(0)
       calendar.item.enable = -(function (collectionDisabled) {
           return collectionDisabled[0] === true ? collectionDisabled.shift() : -1
       })(calendar.item.disable)

       calendar.
       set('min', settings.min).
       set('max', settings.max).
       set('now')

       // When there’s a value, set the `select`, which in turn
       // also sets the `highlight` and `view`.
       if (valueString) {
           calendar.set('select', valueString, {
               format: formatString
           })
       }

       // If there’s no value, default to highlighting “today”.
       else {
           calendar.
           set('select', null).
           set('highlight', calendar.item.now)
       }

       // The keycode to movement mapping.
       calendar.key = {
           40: 7, // Down
           38: -7, // Up
           39: function () {
               return isRTL() ? -1 : 1
           }, // Right
           37: function () {
               return isRTL() ? 1 : -1
           }, // Left
           go: function (timeChange) {
               var highlightedObject = calendar.item.highlight,
                   targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange)
               calendar.set(
                   'highlight',
                   targetDate, {
                       interval: timeChange
                   }
               )
               this.render()
           }
       }

       // Bind some picker events.
       picker.
       on('render', function () {
           picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
               var value = this.value
               if (value) {
                   picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date])
                   picker.$root.find('.' + settings.klass.selectMonth).trigger('focus')
               }
           })
           picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
               var value = this.value
               if (value) {
                   picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date])
                   picker.$root.find('.' + settings.klass.selectYear).trigger('focus')
               }
           })
       }, 1).
       on('open', function () {
           var includeToday = 
           if (calendar.disabled(calendar.get('now'))) {
               includeToday = ':not(.' + settings.klass.buttonToday + ')'
           }
           picker.$root.find('button' + includeToday + ', select').attr('disabled', false)
       }, 1).
       on('close', function () {
           picker.$root.find('button, select').attr('disabled', true)
       }, 1)

   } //DatePicker

   /**
    * Set a datepicker item object.
    */
   DatePicker.prototype.set = function (type, value, options) {

           var calendar = this,
               calendarItem = calendar.item

           // If the value is `null` just set it immediately.
           if (value === null) {
               if (type == 'clear') type = 'select'
               calendarItem[type] = value
               return calendar
           }

           // Otherwise go through the queue of methods, and invoke the functions.
           // Update this as the time unit, and set the final value as this item.
           // * In the case of `enable`, keep the queue but set `disable` instead.
           //   And in the case of `flip`, keep the queue but set `enable` instead.
           calendarItem[(type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type)] = calendar.queue[type].split(' ').map(function (method) {
               value = calendar[method](type, value, options)
               return value
           }).pop()

           // Check if we need to cascade through more updates.
           if (type == 'select') {
               calendar.set('highlight', calendarItem.select, options)
           } else if (type == 'highlight') {
               calendar.set('view', calendarItem.highlight, options)
           } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
               if (calendarItem.select && calendar.disabled(calendarItem.select)) {
                   calendar.set('select', calendarItem.select, options)
               }
               if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
                   calendar.set('highlight', calendarItem.highlight, options)
               }
           }

           return calendar
       } //DatePicker.prototype.set

   /**
    * Get a datepicker item object.
    */
   DatePicker.prototype.get = function (type) {
           return this.item[type]
       } //DatePicker.prototype.get

   /**
    * Create a picker date object.
    */
   DatePicker.prototype.create = function (type, value, options) {

           var isInfiniteValue,
               calendar = this

           // If there’s no value, use the type as the value.
           value = value === undefined ? type : value

           // If it’s infinity, update the value.
           if (value == -Infinity || value == Infinity) {
               isInfiniteValue = value
           }

           // If it’s an object, use the native date object.
           else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
               value = value.obj
           }

           // If it’s an array, convert it into a date and make sure
           // that it’s a valid date – otherwise default to today.
           else if ($.isArray(value)) {
               value = new Date(value[0], value[1], value[2])
               value = _.isDate(value) ? value : calendar.create().obj
           }

           // If it’s a number or date object, make a normalized date.
           else if (_.isInteger(value) || _.isDate(value)) {
               value = calendar.normalize(new Date(value), options)
           }

           // If it’s a literal true or any other case, set it to now.
           else /*if ( value === true )*/ {
               value = calendar.now(type, value, options)
           }

           // Return the compiled object.
           return {
               year: isInfiniteValue || value.getFullYear(),
               month: isInfiniteValue || value.getMonth(),
               date: isInfiniteValue || value.getDate(),
               day: isInfiniteValue || value.getDay(),
               obj: isInfiniteValue || value,
               pick: isInfiniteValue || value.getTime()
           }
       } //DatePicker.prototype.create

   /**
    * Create a range limit object using an array, date object,
    * literal “true”, or integer relative to another time.
    */
   DatePicker.prototype.createRange = function (from, to) {

           var calendar = this,
               createDate = function (date) {
                   if (date === true || $.isArray(date) || _.isDate(date)) {
                       return calendar.create(date)
                   }
                   return date
               }

           // Create objects if possible.
           if (!_.isInteger(from)) {
               from = createDate(from)
           }
           if (!_.isInteger(to)) {
               to = createDate(to)
           }

           // Create relative dates.
           if (_.isInteger(from) && $.isPlainObject(to)) {
               from = [to.year, to.month, to.date + from];
           } else if (_.isInteger(to) && $.isPlainObject(from)) {
               to = [from.year, from.month, from.date + to];
           }

           return {
               from: createDate(from),
               to: createDate(to)
           }
       } //DatePicker.prototype.createRange

   /**
    * Check if a date unit falls within a date range object.
    */
   DatePicker.prototype.withinRange = function (range, dateUnit) {
       range = this.createRange(range.from, range.to)
       return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
   }

   /**
    * Check if two date range objects overlap.
    */
   DatePicker.prototype.overlapRanges = function (one, two) {

       var calendar = this

       // Convert the ranges into comparable dates.
       one = calendar.createRange(one.from, one.to)
       two = calendar.createRange(two.from, two.to)

       return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) ||
           calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to)
   }

   /**
    * Get the date today.
    */
   DatePicker.prototype.now = function (type, value, options) {
       value = new Date()
       if (options && options.rel) {
           value.setDate(value.getDate() + options.rel)
       }
       return this.normalize(value, options)
   }

   /**
    * Navigate to next/prev month.
    */
   DatePicker.prototype.navigate = function (type, value, options) {

           var targetDateObject,
               targetYear,
               targetMonth,
               targetDate,
               isTargetArray = $.isArray(value),
               isTargetObject = $.isPlainObject(value),
               viewsetObject = this.item.view
               /*,
                       safety = 100*/

           if (isTargetArray || isTargetObject) {

               if (isTargetObject) {
                   targetYear = value.year
                   targetMonth = value.month
                   targetDate = value.date
               } else {
                   targetYear = +value[0]
                   targetMonth = +value[1]
                   targetDate = +value[2]
               }

               // If we’re navigating months but the view is in a different
               // month, navigate to the view’s year and month.
               if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
                   targetYear = viewsetObject.year
                   targetMonth = viewsetObject.month
               }

               // Figure out the expected target year and month.
               targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1)
               targetYear = targetDateObject.getFullYear()
               targetMonth = targetDateObject.getMonth()

               // If the month we’re going to doesn’t have enough days,
               // keep decreasing the date until we reach the month’s last date.
               while ( /*safety &&*/ new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
                   targetDate -= 1
                       /*safety -= 1
                       if ( !safety ) {
                           throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
                       }*/
               }

               value = [targetYear, targetMonth, targetDate]
           }

           return value
       } //DatePicker.prototype.navigate

   /**
    * Normalize a date by setting the hours to midnight.
    */
   DatePicker.prototype.normalize = function (value /*, options*/ ) {
       value.setHours(0, 0, 0, 0)
       return value
   }

   /**
    * Measure the range of dates.
    */
   DatePicker.prototype.measure = function (type, value /*, options*/ ) {

           var calendar = this

           // If it’s anything false-y, remove the limits.
           if (!value) {
               value = type == 'min' ? -Infinity : Infinity
           }

           // If it’s a string, parse it.
           else if (typeof value == 'string') {
               value = calendar.parse(type, value)
           }

           // If it's an integer, get a date relative to today.
           else if (_.isInteger(value)) {
               value = calendar.now(type, value, {
                   rel: value
               })
           }

           return value
       } ///DatePicker.prototype.measure

   /**
    * Create a viewset object based on navigation.
    */
   DatePicker.prototype.viewset = function (type, dateObject /*, options*/ ) {
       return this.create([dateObject.year, dateObject.month, 1])
   }

   /**
    * Validate a date as enabled and shift if needed.
    */
   DatePicker.prototype.validate = function (type, dateObject, options) {

           var calendar = this,

               // Keep a reference to the original date.
               originalDateObject = dateObject,

               // Make sure we have an interval.
               interval = options && options.interval ? options.interval : 1,

               // Check if the calendar enabled dates are inverted.
               isFlippedBase = calendar.item.enable === -1,

               // Check if we have any enabled dates after/before now.
               hasEnabledBeforeTarget, hasEnabledAfterTarget,

               // The min & max limits.
               minLimitObject = calendar.item.min,
               maxLimitObject = calendar.item.max,

               // Check if we’ve reached the limit during shifting.
               reachedMin, reachedMax,

               // Check if the calendar is inverted and at least one weekday is enabled.
               hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {

                   // If there’s a date, check where it is relative to the target.
                   if ($.isArray(value)) {
                       var dateTime = calendar.create(value).pick
                       if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true
                       else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true
                   }

                   // Return only integers for enabled weekdays.
                   return _.isInteger(value)
               }).length
               /*,

                       safety = 100*/

           // Cases to validate for:
           // [1] Not inverted and date disabled.
           // [2] Inverted and some dates enabled.
           // [3] Not inverted and out of range.
           //
           // Cases to **not** validate for:
           // • Navigating months.
           // • Not inverted and date enabled.
           // • Inverted and all dates disabled.
           // • ..and anything else.
           if (!options || !options.nav)
               if (
                   /* 1 */
                   (!isFlippedBase && calendar.disabled(dateObject)) ||
                   /* 2 */
                   (isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget)) ||
                   /* 3 */
                   (!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick))
               ) {

                   // When inverted, flip the direction if there aren’t any enabled weekdays
                   // and there are no enabled dates in the direction of the interval.
                   if (isFlippedBase && !hasEnabledWeekdays && ((!hasEnabledAfterTarget && interval > 0) || (!hasEnabledBeforeTarget && interval < 0))) {
                       interval *= -1
                   }

                   // Keep looping until we reach an enabled date.
                   while ( /*safety &&*/ calendar.disabled(dateObject)) {

                       /*safety -= 1
                       if ( !safety ) {
                           throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
                       }*/

                       // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
                       if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
                           dateObject = originalDateObject
                           interval = interval > 0 ? 1 : -1
                       }

                       // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
                       if (dateObject.pick <= minLimitObject.pick) {
                           reachedMin = true
                           interval = 1
                           dateObject = calendar.create([
                   minLimitObject.year,
                   minLimitObject.month,
                   minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
               ])
                       } else if (dateObject.pick >= maxLimitObject.pick) {
                           reachedMax = true
                           interval = -1
                           dateObject = calendar.create([
                   maxLimitObject.year,
                   maxLimitObject.month,
                   maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
               ])
                       }

                       // If we’ve reached both limits, just break out of the loop.
                       if (reachedMin && reachedMax) {
                           break
                       }

                       // Finally, create the shifted date using the interval and keep looping.
                       dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval])
                   }

               } //endif

               // Return the date object settled on.
           return dateObject
       } //DatePicker.prototype.validate

   /**
    * Check if a date is disabled.
    */
   DatePicker.prototype.disabled = function (dateToVerify) {

           var
               calendar = this,

               // Filter through the disabled dates to check if this is one.
               isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {

                   // If the date is a number, match the weekday with 0index and `firstDay` check.
                   if (_.isInteger(dateToDisable)) {
                       return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7
                   }

                   // If it’s an array or a native JS date, create and match the exact date.
                   if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
                       return dateToVerify.pick === calendar.create(dateToDisable).pick
                   }

                   // If it’s an object, match a date within the “from” and “to” range.
                   if ($.isPlainObject(dateToDisable)) {
                       return calendar.withinRange(dateToDisable, dateToVerify)
                   }
               })

           // If this date matches a disabled date, confirm it’s not inverted.
           isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
               return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' ||
                   $.isPlainObject(dateToDisable) && dateToDisable.inverted
           }).length

           // Check the calendar “enabled” flag and respectively flip the
           // disabled state. Then also check if it’s beyond the min/max limits.
           return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
               dateToVerify.pick < calendar.item.min.pick ||
               dateToVerify.pick > calendar.item.max.pick

       } //DatePicker.prototype.disabled

   /**
    * Parse a string into a usable type.
    */
   DatePicker.prototype.parse = function (type, value, options) {

           var calendar = this,
               parsingObject = {}

           // If it’s already parsed, we’re good.
           if (!value || typeof value != 'string') {
               return value
           }

           // We need a `.format` to parse the value with.
           if (!(options && options.format)) {
               options = options || {}
               options.format = calendar.settings.format
           }

           // Convert the format into an array and then map through it.
           calendar.formats.toArray(options.format).map(function (label) {

               var
               // Grab the formatting label.
                   formattingLabel = calendar.formats[label],

                   // The format length is from the formatting label function or the
                   // label length without the escaping exclamation (!) mark.
                   formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, ).length

               // If there's a format label, split the value up to the format length.
               // Then add it to the parsing object with appropriate label.
               if (formattingLabel) {
                   parsingObject[label] = value.substr(0, formatLength)
               }

               // Update the value as the substring from format length to end.
               value = value.substr(formatLength)
           })

           // Compensate for month 0index.
           return [
       parsingObject.yyyy || parsingObject.yy,
       +(parsingObject.mm || parsingObject.m) - 1,
       parsingObject.dd || parsingObject.d
   ]
       } //DatePicker.prototype.parse

   /**
    * Various formats to display the object in.
    */
   DatePicker.prototype.formats = (function () {

           // Return the length of the first word in a collection.
           function getWordLengthFromCollection(string, collection, dateObject) {

               // Grab the first word from the string.
               var word = string.match(/\w+/)[0]

               // If there's no month index, add it to the date object
               if (!dateObject.mm && !dateObject.m) {
                   dateObject.m = collection.indexOf(word) + 1
               }

               // Return the length of the word.
               return word.length
           }

           // Get the length of the first word in a string.
           function getFirstWordLength(string) {
               return string.match(/\w+/)[0].length
           }

           return {

               d: function (string, dateObject) {

                   // If there's string, then get the digits length.
                   // Otherwise return the selected date.
                   return string ? _.digits(string) : dateObject.date
               },
               dd: function (string, dateObject) {

                   // If there's a string, then the length is always 2.
                   // Otherwise return the selected date with a leading zero.
                   return string ? 2 : _.lead(dateObject.date)
               },
               ddd: function (string, dateObject) {

                   // If there's a string, then get the length of the first word.
                   // Otherwise return the short selected weekday.
                   return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]
               },
               dddd: function (string, dateObject) {

                   // If there's a string, then get the length of the first word.
                   // Otherwise return the full selected weekday.
                   return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]
               },
               m: function (string, dateObject) {

                   // If there's a string, then get the length of the digits
                   // Otherwise return the selected month with 0index compensation.
                   return string ? _.digits(string) : dateObject.month + 1
               },
               mm: function (string, dateObject) {

                   // If there's a string, then the length is always 2.
                   // Otherwise return the selected month with 0index and leading zero.
                   return string ? 2 : _.lead(dateObject.month + 1)
               },
               mmm: function (string, dateObject) {

                   var collection = this.settings.monthsShort

                   // If there's a string, get length of the relevant month from the short
                   // months collection. Otherwise return the selected month from that collection.
                   return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
               },
               mmmm: function (string, dateObject) {

                   var collection = this.settings.monthsFull

                   // If there's a string, get length of the relevant month from the full
                   // months collection. Otherwise return the selected month from that collection.
                   return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
               },
               yy: function (string, dateObject) {

                   // If there's a string, then the length is always 2.
                   // Otherwise return the selected year by slicing out the first 2 digits.
                   return string ? 2 : ( + dateObject.year).slice(2)
               },
               yyyy: function (string, dateObject) {

                   // If there's a string, then the length is always 4.
                   // Otherwise return the selected year.
                   return string ? 4 : dateObject.year
               },

               // Create an array by splitting the formatting string passed.
               toArray: function (formatString) {
                   return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)
               },

               // Format an object into a string using the formatting options.
               toString: function (formatString, itemObject) {
                   var calendar = this
                   return calendar.formats.toArray(formatString).map(function (label) {
                       return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, )
                   }).join()
               }
           }
       })() //DatePicker.prototype.formats

   /**
    * Check if two date units are the exact.
    */
   DatePicker.prototype.isDateExact = function (one, two) {

       var calendar = this

       // When we’re working with weekdays, do a direct comparison.
       if (
           (_.isInteger(one) && _.isInteger(two)) ||
           (typeof one == 'boolean' && typeof two == 'boolean')
       ) {
           return one === two
       }

       // When we’re working with date representations, compare the “pick” value.
       if (
           (_.isDate(one) || $.isArray(one)) &&
           (_.isDate(two) || $.isArray(two))
       ) {
           return calendar.create(one).pick === calendar.create(two).pick
       }

       // When we’re working with range objects, compare the “from” and “to”.
       if ($.isPlainObject(one) && $.isPlainObject(two)) {
           return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to)
       }

       return false
   }

   /**
    * Check if two date units overlap.
    */
   DatePicker.prototype.isDateOverlap = function (one, two) {

       var calendar = this,
           firstDay = calendar.settings.firstDay ? 1 : 0

       // When we’re working with a weekday index, compare the days.
       if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
           one = one % 7 + firstDay
           return one === calendar.create(two).day + 1
       }
       if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
           two = two % 7 + firstDay
           return two === calendar.create(one).day + 1
       }

       // When we’re working with range objects, check if the ranges overlap.
       if ($.isPlainObject(one) && $.isPlainObject(two)) {
           return calendar.overlapRanges(one, two)
       }

       return false
   }

   /**
    * Flip the “enabled” state.
    */
   DatePicker.prototype.flipEnable = function (val) {
       var itemObject = this.item
       itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
   }

   /**
    * Mark a collection of dates as “disabled”.
    */
   DatePicker.prototype.deactivate = function (type, datesToDisable) {

           var calendar = this,
               disabledItems = calendar.item.disable.slice(0)

           // If we’re flipping, that’s all we need to do.
           if (datesToDisable == 'flip') {
               calendar.flipEnable()
           } else if (datesToDisable === false) {
               calendar.flipEnable(1)
               disabledItems = []
           } else if (datesToDisable === true) {
               calendar.flipEnable(-1)
               disabledItems = []
           }

           // Otherwise go through the dates to disable.
           else {

               datesToDisable.map(function (unitToDisable) {

                   var matchFound

                   // When we have disabled items, check for matches.
                   // If something is matched, immediately break out.
                   for (var index = 0; index < disabledItems.length; index += 1) {
                       if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
                           matchFound = true
                           break
                       }
                   }

                   // If nothing was found, add the validated unit to the collection.
                   if (!matchFound) {
                       if (
                           _.isInteger(unitToDisable) ||
                           _.isDate(unitToDisable) ||
                           $.isArray(unitToDisable) ||
                           ($.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to)
                       ) {
                           disabledItems.push(unitToDisable)
                       }
                   }
               })
           }

           // Return the updated collection.
           return disabledItems
       } //DatePicker.prototype.deactivate

   /**
    * Mark a collection of dates as “enabled”.
    */
   DatePicker.prototype.activate = function (type, datesToEnable) {

           var calendar = this,
               disabledItems = calendar.item.disable,
               disabledItemsCount = disabledItems.length

           // If we’re flipping, that’s all we need to do.
           if (datesToEnable == 'flip') {
               calendar.flipEnable()
           } else if (datesToEnable === true) {
               calendar.flipEnable(1)
               disabledItems = []
           } else if (datesToEnable === false) {
               calendar.flipEnable(-1)
               disabledItems = []
           }

           // Otherwise go through the disabled dates.
           else {

               datesToEnable.map(function (unitToEnable) {

                   var matchFound,
                       disabledUnit,
                       index,
                       isExactRange

                   // Go through the disabled items and try to find a match.
                   for (index = 0; index < disabledItemsCount; index += 1) {

                       disabledUnit = disabledItems[index]

                       // When an exact match is found, remove it from the collection.
                       if (calendar.isDateExact(disabledUnit, unitToEnable)) {
                           matchFound = disabledItems[index] = null
                           isExactRange = true
                           break
                       }

                       // When an overlapped match is found, add the “inverted” state to it.
                       else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
                           if ($.isPlainObject(unitToEnable)) {
                               unitToEnable.inverted = true
                               matchFound = unitToEnable
                           } else if ($.isArray(unitToEnable)) {
                               matchFound = unitToEnable
                               if (!matchFound[3]) matchFound.push('inverted')
                           } else if (_.isDate(unitToEnable)) {
                               matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']
                           }
                           break
                       }
                   }

                   // If a match was found, remove a previous duplicate entry.
                   if (matchFound)
                       for (index = 0; index < disabledItemsCount; index += 1) {
                           if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
                               disabledItems[index] = null
                               break
                           }
                       }

                   // In the event that we’re dealing with an exact range of dates,
                   // make sure there are no “inverted” dates because of it.
                   if (isExactRange)
                       for (index = 0; index < disabledItemsCount; index += 1) {
                           if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
                               disabledItems[index] = null
                               break
                           }
                       }

                   // If something is still matched, add it into the collection.
                   if (matchFound) {
                       disabledItems.push(matchFound)
                   }
               })
           }

           // Return the updated collection.
           return disabledItems.filter(function (val) {
               return val != null
           })
       } //DatePicker.prototype.activate

   /**
    * Create a string for the nodes in the picker.
    */
   DatePicker.prototype.nodes = function (isOpen) {

           var
               calendar = this,
               settings = calendar.settings,
               calendarItem = calendar.item,
               nowObject = calendarItem.now,
               selectedObject = calendarItem.select,
               highlightedObject = calendarItem.highlight,
               viewsetObject = calendarItem.view,
               disabledCollection = calendarItem.disable,
               minLimitObject = calendarItem.min,
               maxLimitObject = calendarItem.max,

               // Create the calendar table head using a copy of weekday labels collection.
               // * We do a copy so we don't mutate the original array.
               tableHead = (function (collection, fullCollection) {

                   // If the first day should be Monday, move Sunday to the end.
                   if (settings.firstDay) {
                       collection.push(collection.shift())
                       fullCollection.push(fullCollection.shift())
                   }

                   // Create and return the table head group.
                   return _.node(
                           'thead',
                           _.node(
                               'tr',
                               _.group({
                                   min: 0,
                                   max: DAYS_IN_WEEK - 1,
                                   i: 1,
                                   node: 'th',
                                   item: function (counter) {
                                       return [
                               collection[counter],
                               settings.klass.weekdays,
                               'scope=col title="' + fullCollection[counter] + '"'
                           ]
                                   }
                               })
                           )
                       ) //endreturn

                   // Materialize modified
               })((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead

               // Create the nav for next/prev month.
               createMonthNav = function (next) {

                   // Otherwise, return the created month tag.
                   return _.node(
                           'div',
                           ' ',
                           settings.klass['nav' + (next ? 'Next' : 'Prev')] + (

                               // If the focused month is outside the range, disabled the button.
                               (next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month) ||
                               (!next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month) ?
                               ' ' + settings.klass.navDisabled : 
                           ),
                           'data-nav=' + (next || -1) + ' ' +
                           _.ariaAttr({
                               role: 'button',
                               controls: calendar.$node[0].id + '_table'
                           }) + ' ' +
                           'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'
                       ) //endreturn
               }, //createMonthNav

               // Create the month label.
               //Materialize modified
               createMonthLabel = function (override) {

                   var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull

                   // Materialize modified
                   if (override == "short_months") {
                       monthsCollection = settings.monthsShort;
                   }

                   // If there are months to select, add a dropdown menu.
                   if (settings.selectMonths && override == undefined) {

                       return _.node('select',
                           _.group({
                               min: 0,
                               max: 11,
                               i: 1,
                               node: 'option',
                               item: function (loopedMonth) {

                                   return [

                               // The looped month and no classes.
                               monthsCollection[loopedMonth], 0,

                               // Set the value and selected index.
                               'value=' + loopedMonth +
                                       (viewsetObject.month == loopedMonth ? ' selected' : ) +
                                       (
                                           (
                                               (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month) ||
                                               (viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month)
                                           ) ?
                                           ' disabled' : 
                               )
                           ]
                               }
                           }),
                           settings.klass.selectMonth + ' browser-default', (isOpen ?  : 'disabled') + ' ' +
                           _.ariaAttr({
                               controls: calendar.$node[0].id + '_table'
                           }) + ' ' +
                           'title="' + settings.labelMonthSelect + '"'
                       )
                   }

                   // Materialize modified
                   if (override == "short_months")
                       if (selectedObject != null)
                           return monthsCollection[selectedObject.month];
                       else return monthsCollection[viewsetObject.month];

                       // If there's a need for a month selector
                   return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month)
               }, //createMonthLabel

               // Create the year label.
               // Materialize modified
               createYearLabel = function (override) {

                   var focusedYear = viewsetObject.year,

                       // If years selector is set to a literal "true", set it to 5. Otherwise
                       // divide in half to get half before and half after focused year.
                       numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2)

                   // If there are years to select, add a dropdown menu.
                   if (numberYears) {

                       var
                           minYear = minLimitObject.year,
                           maxYear = maxLimitObject.year,
                           lowestYear = focusedYear - numberYears,
                           highestYear = focusedYear + numberYears

                       // If the min year is greater than the lowest year, increase the highest year
                       // by the difference and set the lowest year to the min year.
                       if (minYear > lowestYear) {
                           highestYear += minYear - lowestYear
                           lowestYear = minYear
                       }

                       // If the max year is less than the highest year, decrease the lowest year
                       // by the lower of the two: available and needed years. Then set the
                       // highest year to the max year.
                       if (maxYear < highestYear) {

                           var availableYears = lowestYear - minYear,
                               neededYears = highestYear - maxYear

                           lowestYear -= availableYears > neededYears ? neededYears : availableYears
                           highestYear = maxYear
                       }

                       if (settings.selectYears && override == undefined) {
                           return _.node('select',
                               _.group({
                                   min: lowestYear,
                                   max: highestYear,
                                   i: 1,
                                   node: 'option',
                                   item: function (loopedYear) {
                                       return [

                                   // The looped year and no classes.
                                   loopedYear, 0,

                                   // Set the value and selected index.
                                   'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : )
                               ]
                                   }
                               }),
                               settings.klass.selectYear + ' browser-default', (isOpen ?  : 'disabled') + ' ' + _.ariaAttr({
                                   controls: calendar.$node[0].id + '_table'
                               }) + ' ' +
                               'title="' + settings.labelYearSelect + '"'
                           )
                       }
                   }

                   // Materialize modified
                   if (override == "raw")
                       return _.node('div', focusedYear)

                   // Otherwise just return the year focused
                   return _.node('div', focusedYear, settings.klass.year)
               } //createYearLabel

           // Materialize modified
           createDayLabel = function () {
               if (selectedObject != null)
                   return selectedObject.date
               else return nowObject.date
           }
           createWeekdayLabel = function () {
               var display_day;

               if (selectedObject != null)
                   display_day = selectedObject.day;
               else
                   display_day = nowObject.day;
               var weekday = settings.weekdaysShort[display_day];
               return weekday
           }

           // Create and return the entire calendar.

           return _.node(
                   // Date presentation View
                   'div',
                   _.node(
                       // Div for Year
                       'div',
                       createYearLabel("raw"),
                       settings.klass.year_display
                   ) +
                   _.node(
                       'span',
                       createWeekdayLabel() + ', ',
                       "picker__weekday-display"
                   ) +
                   _.node(
                       // Div for short Month
                       'span',
                       createMonthLabel("short_months") + ' ',
                       settings.klass.month_display
                   ) +
                   _.node(
                       // Div for Day
                       'span',
                       createDayLabel(),
                       settings.klass.day_display
                   ),
                   settings.klass.date_display
               ) +
               // Calendar container
               _.node('div',
                   _.node('div',
                       _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) +
                           createMonthNav() + createMonthNav(1),
                           settings.klass.header
                       ) + _.node(
                           'table',
                           tableHead +
                           _.node(
                               'tbody',
                               _.group({
                                   min: 0,
                                   max: WEEKS_IN_CALENDAR - 1,
                                   i: 1,
                                   node: 'tr',
                                   item: function (rowCounter) {

                                       // If Monday is the first day and the month starts on Sunday, shift the date back a week.
                                       var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0

                                       return [

_.group({

                                                   min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
                                                   max: function () {
                                                       return this.min + DAYS_IN_WEEK - 1
                                                   },
                                                   i: 1,
                                                   node: 'td',
                                                   item: function (targetDate) {

                                                       // Convert the time date from a relative date to a target date.
                                                       targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)])

                                                       var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
                                                           isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
                                                           isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
                                                           formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate])

                                                       return [

_.node(

                                                                   'div',
                                                                   targetDate.date, (function (klasses) {

                                                                       // Add the `infocus` or `outfocus` classes based on month in view.
                                                                       klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus)

                                                                       // Add the `today` class if needed.
                                                                       if (nowObject.pick == targetDate.pick) {
                                                                           klasses.push(settings.klass.now)
                                                                       }

                                                                       // Add the `selected` class if something's selected and the time matches.
                                                                       if (isSelected) {
                                                                           klasses.push(settings.klass.selected)
                                                                       }

                                                                       // Add the `highlighted` class if something's highlighted and the time matches.
                                                                       if (isHighlighted) {
                                                                           klasses.push(settings.klass.highlighted)
                                                                       }

                                                                       // Add the `disabled` class if something's disabled and the object matches.
                                                                       if (isDisabled) {
                                                                           klasses.push(settings.klass.disabled)
                                                                       }

                                                                       return klasses.join(' ')
                                                                   })([settings.klass.day]),
                                                                   'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
                                                                       role: 'gridcell',
                                                                       label: formattedDate,
                                                                       selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
                                                                       activedescendant: isHighlighted ? true : null,
                                                                       disabled: isDisabled ? true : null
                                                                   })

), , _.ariaAttr({

                                                                   role: 'presentation'
                                                               })

] //endreturn

                                                   }
                                               })

] //endreturn

                                   }
                               })
                           ),
                           settings.klass.table,
                           'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
                               role: 'grid',
                               controls: calendar.$node[0].id,
                               readonly: true
                           })
                       ), settings.klass.calendar_container) // end calendar

                   +

                   // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
                   _.node(
                       'div',
                       _.node('button', settings.today, "btn-flat picker__today waves-effect",
                           'type=button data-pick=' + nowObject.pick +
                           (isOpen && !calendar.disabled(nowObject) ?  : ' disabled') + ' ' +
                           _.ariaAttr({
                               controls: calendar.$node[0].id
                           })) +
                       _.node('button', settings.clear, "btn-flat picker__clear waves-effect",
                           'type=button data-clear=1' +
                           (isOpen ?  : ' disabled') + ' ' +
                           _.ariaAttr({
                               controls: calendar.$node[0].id
                           })) +
                       _.node('button', settings.close, "btn-flat picker__close waves-effect",
                           'type=button data-close=true ' +
                           (isOpen ?  : ' disabled') + ' ' +
                           _.ariaAttr({
                               controls: calendar.$node[0].id
                           })),
                       settings.klass.footer
                   ), 'picker__container__wrapper'
               ) //endreturn
       } //DatePicker.prototype.nodes

   /**
    * The date picker defaults.
    */
   DatePicker.defaults = (function (prefix) {

       return {

           // The title label to use for the month nav buttons
           labelMonthNext: 'Next month',
           labelMonthPrev: 'Previous month',

           // The title label to use for the dropdown selectors
           labelMonthSelect: 'Select a month',
           labelYearSelect: 'Select a year',

           // Months and weekdays
           monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
           monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
           weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
           weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],

           // Materialize modified
           weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],

           // Today and clear
           today: 'Today',
           clear: 'Clear',
           close: 'Ok',

           // The format to show on the `input` element
           format: 'd mmmm, yyyy',

           // Classes
           klass: {

               table: prefix + 'table',

               header: prefix + 'header',

               // Materialize Added klasses
               date_display: prefix + 'date-display',
               day_display: prefix + 'day-display',
               month_display: prefix + 'month-display',
               year_display: prefix + 'year-display',
               calendar_container: prefix + 'calendar-container',
               // end

               navPrev: prefix + 'nav--prev',
               navNext: prefix + 'nav--next',
               navDisabled: prefix + 'nav--disabled',

               month: prefix + 'month',
               year: prefix + 'year',

               selectMonth: prefix + 'select--month',
               selectYear: prefix + 'select--year',

               weekdays: prefix + 'weekday',

               day: prefix + 'day',
               disabled: prefix + 'day--disabled',
               selected: prefix + 'day--selected',
               highlighted: prefix + 'day--highlighted',
               now: prefix + 'day--today',
               infocus: prefix + 'day--infocus',
               outfocus: prefix + 'day--outfocus',

               footer: prefix + 'footer',

               buttonClear: prefix + 'button--clear',
               buttonToday: prefix + 'button--today',
               buttonClose: prefix + 'button--close'
           }
       }
   })(Picker.klasses().picker + '__')

   /**
    * Extend the picker to add the date picker.
    */
   Picker.extend('pickadate', DatePicker)

}));; /*!

* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
* Copyright 2014 Wang Shenwei.
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
*
* Further modified
* Copyright 2015 Ching Yaw Hao.
*/

(function () {

   var $ = window.jQuery,
       $win = $(window),
       $doc = $(document);

   // Can I use inline svg ?
   var svgNS = 'http://www.w3.org/2000/svg',
       svgSupported = 'SVGAngle' in window && (function () {
           var supported,
               el = document.createElement('div');
           el.innerHTML = '<svg/>';
           supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
           el.innerHTML = ;
           return supported;
       })();

   // Can I use transition ?
   var transitionSupported = (function () {
       var style = document.createElement('div').style;
       return 'transition' in style ||
           'WebkitTransition' in style ||
           'MozTransition' in style ||
           'msTransition' in style ||
           'OTransition' in style;
   })();

   // Listen touch events in touch screen device, instead of mouse events in desktop.
   var touchSupported = 'ontouchstart' in window,
       mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ),
       mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ),
       mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : );

   // Vibrate the device if supported
   var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;

   function createSvgElement(name) {
       return document.createElementNS(svgNS, name);
   }

   function leadingZero(num) {
       return (num < 10 ? '0' : ) + num;
   }

   // Get a unique id
   var idCounter = 0;

   function uniqueId(prefix) {
       var id = ++idCounter + ;
       return prefix ? prefix + id : id;
   }

   // Clock size
   var dialRadius = 135,
       outerRadius = 105,
       // innerRadius = 80 on 12 hour clock
       innerRadius = 80,
       tickRadius = 20,
       diameter = dialRadius * 2,
       duration = transitionSupported ? 350 : 1;

   // Popover template
   var tpl = [

''

].join();

   // ClockPicker
   function ClockPicker(element, options) {
       var popover = $(tpl),
           plate = popover.find('.clockpicker-plate'),
           holder = popover.find('.picker__holder'),
           hoursView = popover.find('.clockpicker-hours'),
           minutesView = popover.find('.clockpicker-minutes'),
           amPmBlock = popover.find('.clockpicker-am-pm-block'),
           isInput = element.prop('tagName') === 'INPUT',
           input = isInput ? element : element.find('input'),
           label = $("label[for=" + input.attr("id") + "]"),
           self = this;

       this.id = uniqueId('cp');
       this.element = element;
       this.holder = holder;
       this.options = options;
       this.isAppended = false;
       this.isShown = false;
       this.currentView = 'hours';
       this.isInput = isInput;
       this.input = input;
       this.label = label;
       this.popover = popover;
       this.plate = plate;
       this.hoursView = hoursView;
       this.minutesView = minutesView;
       this.amPmBlock = amPmBlock;
       this.spanHours = popover.find('.clockpicker-span-hours');
       this.spanMinutes = popover.find('.clockpicker-span-minutes');
       this.spanAmPm = popover.find('.clockpicker-span-am-pm');
       this.footer = popover.find('.picker__footer');
       this.amOrPm = "PM";

       // Setup for for 12 hour clock if option is selected
       if (options.twelvehour) {
           if (!options.ampmclickable) {
               this.spanAmPm.empty();

$('').appendTo(this.spanAmPm); $('').appendTo(this.spanAmPm);

           } else {
               this.spanAmPm.empty();

$('').on("click", function () {

                   self.spanAmPm.children('#click-am').addClass("text-primary");
                   self.spanAmPm.children('#click-pm').removeClass("text-primary");
                   self.amOrPm = "AM";
               }).appendTo(this.spanAmPm);

$('').on("click", function () {

                   self.spanAmPm.children('#click-pm').addClass("text-primary");
                   self.spanAmPm.children('#click-am').removeClass("text-primary");
                   self.amOrPm = 'PM';
               }).appendTo(this.spanAmPm);
           }
       }

       // Add buttons to footer
       $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
       $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
       $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);

       this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
       this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));

       // Show or toggle
       input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));

       // Build ticks

var tickTpl = $(''),

           i, tick, radian, radius;

       // Hours view
       if (options.twelvehour) {
           for (i = 1; i < 13; i += 1) {
               tick = tickTpl.clone();
               radian = i / 6 * Math.PI;
               radius = outerRadius;
               tick.css({
                   left: dialRadius + Math.sin(radian) * radius - tickRadius,
                   top: dialRadius - Math.cos(radian) * radius - tickRadius
               });
               tick.html(i === 0 ? '00' : i);
               hoursView.append(tick);
               tick.on(mousedownEvent, mousedown);
           }
       } else {
           for (i = 0; i < 24; i += 1) {
               tick = tickTpl.clone();
               radian = i / 6 * Math.PI;
               var inner = i > 0 && i < 13;
               radius = inner ? innerRadius : outerRadius;
               tick.css({
                   left: dialRadius + Math.sin(radian) * radius - tickRadius,
                   top: dialRadius - Math.cos(radian) * radius - tickRadius
               });
               tick.html(i === 0 ? '00' : i);
               hoursView.append(tick);
               tick.on(mousedownEvent, mousedown);
           }
       }

       // Minutes view
       for (i = 0; i < 60; i += 5) {
           tick = tickTpl.clone();
           radian = i / 30 * Math.PI;
           tick.css({
               left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
               top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
           });
           tick.html(leadingZero(i));
           minutesView.append(tick);
           tick.on(mousedownEvent, mousedown);
       }

       // Clicking on minutes view space
       plate.on(mousedownEvent, function (e) {
           if ($(e.target).closest('.clockpicker-tick').length === 0) {
               mousedown(e, true);
           }
       });

       // Mousedown or touchstart
       function mousedown(e, space) {
           var offset = plate.offset(),
               isTouch = /^touch/.test(e.type),
               x0 = offset.left + dialRadius,
               y0 = offset.top + dialRadius,
               dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
               dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
               z = Math.sqrt(dx * dx + dy * dy),
               moved = false;

           // When clicking on minutes view space, check the mouse position
           if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
               return;
           }
           e.preventDefault();

           // Set cursor style of body after 200ms
           var movingTimer = setTimeout(function () {
               self.popover.addClass('clockpicker-moving');
           }, 200);

           // Clock
           self.setHand(dx, dy, !space, true);

           // Mousemove on document
           $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
               e.preventDefault();
               var isTouch = /^touch/.test(e.type),
                   x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
                   y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
               if (!moved && x === dx && y === dy) {
                   // Clicking in chrome on windows will trigger a mousemove event
                   return;
               }
               moved = true;
               self.setHand(x, y, false, true);
           });

           // Mouseup on document
           $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
               $doc.off(mouseupEvent);
               e.preventDefault();
               var isTouch = /^touch/.test(e.type),
                   x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
                   y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
               if ((space || moved) && x === dx && y === dy) {
                   self.setHand(x, y);
               }

               if (self.currentView === 'hours') {
                   self.toggleView('minutes', duration / 2);
               } else if (options.autoclose) {
                   self.minutesView.addClass('clockpicker-dial-out');
                   setTimeout(function () {
                       self.done();
                   }, duration / 2);
               }
               plate.prepend(canvas);

               // Reset cursor style of body
               clearTimeout(movingTimer);
               self.popover.removeClass('clockpicker-moving');

               // Unbind mousemove event
               $doc.off(mousemoveEvent);
           });
       }

       if (svgSupported) {
           // Draw clock hands and others
           var canvas = popover.find('.clockpicker-canvas'),
               svg = createSvgElement('svg');
           svg.setAttribute('class', 'clockpicker-svg');
           svg.setAttribute('width', diameter);
           svg.setAttribute('height', diameter);
           var g = createSvgElement('g');
           g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
           var bearing = createSvgElement('circle');
           bearing.setAttribute('class', 'clockpicker-canvas-bearing');
           bearing.setAttribute('cx', 0);
           bearing.setAttribute('cy', 0);
           bearing.setAttribute('r', 4);
           var hand = createSvgElement('line');
           hand.setAttribute('x1', 0);
           hand.setAttribute('y1', 0);
           var bg = createSvgElement('circle');
           bg.setAttribute('class', 'clockpicker-canvas-bg');
           bg.setAttribute('r', tickRadius);
           g.appendChild(hand);
           g.appendChild(bg);
           g.appendChild(bearing);
           svg.appendChild(g);
           canvas.append(svg);

           this.hand = hand;
           this.bg = bg;
           this.bearing = bearing;
           this.g = g;
           this.canvas = canvas;
       }

       raiseCallback(this.options.init);
   }

   function raiseCallback(callbackFunction) {
       if (callbackFunction && typeof callbackFunction === "function")
           callbackFunction();
   }

   // Default options
   ClockPicker.DEFAULTS = {
       'default': , // default time, 'now' or '13:14' e.g.
       fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
       donetext: 'Ok', // done button text
       cleartext: 'Clear',
       canceltext: 'Cancel',
       autoclose: false, // auto close when minute is selected
       ampmclickable: true, // set am/pm button on itself
       darktheme: false, // set to dark theme
       twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
       vibrate: true // vibrate the device when dragging clock hand
   };

   // Show or hide popover
   ClockPicker.prototype.toggle = function () {
       this[this.isShown ? 'hide' : 'show']();
   };

   // Set popover position
   ClockPicker.prototype.locate = function () {
       var element = this.element,
           popover = this.popover,
           offset = element.offset(),
           width = element.outerWidth(),
           height = element.outerHeight(),
           align = this.options.align,
           self = this;

       popover.show();
   };

   // Show popover
   ClockPicker.prototype.show = function (e) {
       // Not show again
       if (this.isShown) {
           return;
       }
       raiseCallback(this.options.beforeShow);
       $(':input').each(function () {
           $(this).attr('tabindex', -1);
       })
       var self = this;
       // Initialize
       this.input.blur();
       this.popover.addClass('picker--opened');
       this.input.addClass('picker__input picker__input--active');
       $(document.body).css('overflow', 'hidden');
       // Get the time
       var value = ((this.input.prop('value') || this.options['default'] || ) + ).split(':');
       if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
           if (value[1].indexOf("AM") > 0) {
               this.amOrPm = 'AM';
           } else {
               this.amOrPm = 'PM';
           }
           value[1] = value[1].replace("AM", "").replace("PM", "");
       }
       if (value[0] === 'now') {
           var now = new Date(+new Date() + this.options.fromnow);
           value = [

now.getHours(), now.getMinutes() ];

       }
       this.hours = +value[0] || 0;
       this.minutes = +value[1] || 0;
       this.spanHours.html(this.hours);
       this.spanMinutes.html(leadingZero(this.minutes));
       if (!this.isAppended) {
           // Append popover to body
           this.popover.insertAfter(this.input);
           if (this.options.twelvehour) {
               if (this.amOrPm === 'PM') {
                   this.spanAmPm.children('#click-pm').addClass("text-primary");
                   this.spanAmPm.children('#click-am').removeClass("text-primary");
               } else {
                   this.spanAmPm.children('#click-am').addClass("text-primary");
                   this.spanAmPm.children('#click-pm').removeClass("text-primary");
               }
           }
           // Reset position when resize
           $win.on('resize.clockpicker' + this.id, function () {
               if (self.isShown) {
                   self.locate();
               }
           });
           this.isAppended = true;
       }
       // Toggle to hours view
       this.toggleView('hours');
       // Set position
       this.locate();
       this.isShown = true;
       // Hide when clicking or tabbing on any element except the clock and input
       $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
           var target = $(e.target);
           if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
               self.hide();
           }
       });
       // Hide when ESC is pressed
       $doc.on('keyup.clockpicker.' + this.id, function (e) {
           if (e.keyCode === 27) {
               self.hide();
           }
       });
       raiseCallback(this.options.afterShow);
   };
   // Hide popover
   ClockPicker.prototype.hide = function () {
       raiseCallback(this.options.beforeHide);
       this.input.removeClass('picker__input picker__input--active');
       this.popover.removeClass('picker--opened');
       $(document.body).css('overflow', 'visible');
       this.isShown = false;
       $(':input').each(function (index) {
           $(this).attr('tabindex', index + 1);
       });
       // Unbinding events on document
       $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
       $doc.off('keyup.clockpicker.' + this.id);
       this.popover.hide();
       raiseCallback(this.options.afterHide);
   };
   // Toggle to hours or minutes view
   ClockPicker.prototype.toggleView = function (view, delay) {
       var raiseAfterHourSelect = false;
       if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
           raiseCallback(this.options.beforeHourSelect);
           raiseAfterHourSelect = true;
       }
       var isHours = view === 'hours',
           nextView = isHours ? this.hoursView : this.minutesView,
           hideView = isHours ? this.minutesView : this.hoursView;
       this.currentView = view;

       this.spanHours.toggleClass('text-primary', isHours);
       this.spanMinutes.toggleClass('text-primary', !isHours);

       // Let's make transitions
       hideView.addClass('clockpicker-dial-out');
       nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');

       // Reset clock hand
       this.resetClock(delay);

       // After transitions ended
       clearTimeout(this.toggleViewTimer);
       this.toggleViewTimer = setTimeout(function () {
           hideView.css('visibility', 'hidden');
       }, duration);

       if (raiseAfterHourSelect) {
           raiseCallback(this.options.afterHourSelect);
       }
   };

   // Reset clock hand
   ClockPicker.prototype.resetClock = function (delay) {
       var view = this.currentView,
           value = this[view],
           isHours = view === 'hours',
           unit = Math.PI / (isHours ? 6 : 30),
           radian = value * unit,
           radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
           x = Math.sin(radian) * radius,
           y = -Math.cos(radian) * radius,
           self = this;

       if (svgSupported && delay) {
           self.canvas.addClass('clockpicker-canvas-out');
           setTimeout(function () {
               self.canvas.removeClass('clockpicker-canvas-out');
               self.setHand(x, y);
           }, delay);
       } else
           this.setHand(x, y);
   };

   // Set clock hand to (x, y)
   ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
       var radian = Math.atan2(x, -y),
           isHours = this.currentView === 'hours',
           unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
           z = Math.sqrt(x * x + y * y),
           options = this.options,
           inner = isHours && z < (outerRadius + innerRadius) / 2,
           radius = inner ? innerRadius : outerRadius,
           value;

       if (options.twelvehour) {
           radius = outerRadius;
       }

       // Radian should in range [0, 2PI]
       if (radian < 0) {
           radian = Math.PI * 2 + radian;
       }

       // Get the round value
       value = Math.round(radian / unit);

       // Get the round radian
       radian = value * unit;

       // Correct the hours or minutes
       if (options.twelvehour) {
           if (isHours) {
               if (value === 0)
                   value = 12;
           } else {
               if (roundBy5)
                   value *= 5;
               if (value === 60)
                   value = 0;
           }
       } else {
           if (isHours) {
               if (value === 12)
                   value = 0;
               value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
           } else {
               if (roundBy5)
                   value *= 5;
               if (value === 60)
                   value = 0;
           }
       }

       // Once hours or minutes changed, vibrate the device
       if (this[this.currentView] !== value) {
           if (vibrate && this.options.vibrate) {
               // Do not vibrate too frequently
               if (!this.vibrateTimer) {
                   navigator[vibrate](10);
                   this.vibrateTimer = setTimeout($.proxy(function () {
                       this.vibrateTimer = null;
                   }, this), 100);
               }
           }
       }

       this[this.currentView] = value;
       if (isHours) {
           this['spanHours'].html(value);
       } else {
           this['spanMinutes'].html(leadingZero(value));
       }

       // If svg is not supported, just add an active class to the tick
       if (!svgSupported) {
           this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
               var tick = $(this);
               tick.toggleClass('active', value === +tick.html());
           });
           return;
       }

       // Set clock hand and others' position
       var cx1 = Math.sin(radian) * (radius - tickRadius),
           cy1 = -Math.cos(radian) * (radius - tickRadius),
           cx2 = Math.sin(radian) * radius,
           cy2 = -Math.cos(radian) * radius;
       this.hand.setAttribute('x2', cx1);
       this.hand.setAttribute('y2', cy1);
       this.bg.setAttribute('cx', cx2);
       this.bg.setAttribute('cy', cy2);
   };

   // Hours and minutes are selected
   ClockPicker.prototype.done = function () {
       raiseCallback(this.options.beforeDone);
       this.hide();
       this.label.addClass('active');

       var last = this.input.prop('value'),
           value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
       if (this.options.twelvehour) {
           value = value + this.amOrPm;
       }

       this.input.prop('value', value);
       if (value !== last) {
           this.input.triggerHandler('change');
           if (!this.isInput) {
               this.element.trigger('change');
           }
       }

       if (this.options.autoclose)
           this.input.trigger('blur');

       raiseCallback(this.options.afterDone);
   };

   // Clear input field
   ClockPicker.prototype.clear = function () {
       this.hide();
       this.label.removeClass('active');

       var last = this.input.prop('value'),
           value = ;

       this.input.prop('value', value);
       if (value !== last) {
           this.input.triggerHandler('change');
           if (!this.isInput) {
               this.element.trigger('change');
           }
       }

       if (this.options.autoclose) {
           this.input.trigger('blur');
       }
   };

   // Remove clockpicker from input
   ClockPicker.prototype.remove = function () {
       this.element.removeData('clockpicker');
       this.input.off('focus.clockpicker click.clockpicker');
       if (this.isShown) {
           this.hide();
       }
       if (this.isAppended) {
           $win.off('resize.clockpicker' + this.id);
           this.popover.remove();
       }
   };

   // Extends $.fn.clockpicker
   $.fn.pickatime = function (option) {
       var args = Array.prototype.slice.call(arguments, 1);
       return this.each(function () {
           var $this = $(this),
               data = $this.data('clockpicker');
           if (!data) {
               var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
               $this.data('clockpicker', new ClockPicker($this, options));
           } else {
               // Manual operatsions. show, hide, remove, e.g.
               if (typeof data[option] === 'function') {
                   data[option].apply(data, args);
               }
           }
       });
   };

}());; (function ($) {

   $.fn.characterCounter = function () {
       return this.each(function () {
           var $input = $(this);
           var $counterElement = $input.parent().find('span[class="character-counter"]');

           // character counter has already been added appended to the parent container
           if ($counterElement.length) {
               return;
           }

           var itHasLengthAttribute = $input.attr('data-length') !== undefined;

           if (itHasLengthAttribute) {
               $input.on('input', updateCounter);
               $input.on('focus', updateCounter);
               $input.on('blur', removeCounterElement);

               addCounterElement($input);
           }

       });
   };

   function updateCounter() {
       var maxLength = +$(this).attr('data-length'),
           actualLength = +$(this).val().length,
           isValidLength = actualLength <= maxLength;

       $(this).parent().find('span[class="character-counter"]')
           .html(actualLength + '/' + maxLength);

       addInputStyle(isValidLength, $(this));
   }

   function addCounterElement($input) {
       var $counterElement = $input.parent().find('span[class="character-counter"]');

       if ($counterElement.length) {
           return;
       }

       $counterElement = $('<span/>')
           .addClass('character-counter')
           .css('float', 'right')
           .css('font-size', '12px')
           .css('height', 1);

       $input.parent().append($counterElement);
   }

   function removeCounterElement() {
       $(this).parent().find('span[class="character-counter"]').html();
   }

   function addInputStyle(isValidLength, $input) {
       var inputHasInvalidClass = $input.hasClass('invalid');
       if (isValidLength && inputHasInvalidClass) {
           $input.removeClass('invalid');
       } else if (!isValidLength && !inputHasInvalidClass) {
           $input.removeClass('valid');
           $input.addClass('invalid');
       }
   }

   $(document).ready(function () {
       $('input, textarea').characterCounter();
   });

}(jQuery));; (function ($) {

   var methods = {

       init: function (options) {
           var defaults = {
               duration: 200, // ms
               dist: -100, // zoom scale TODO: make this more intuitive as an option
               shift: 0, // spacing for center image
               padding: 0, // Padding between non center items
               fullWidth: false, // Change to full width styles
               indicators: false, // Toggle indicators
               noWrap: false, // Don't wrap around and cycle through items.
               onCycleTo: null // Callback for when a new slide is cycled to.
           };
           options = $.extend(defaults, options);
           var namespace = Materialize.objectSelectorString($(this));

           return this.each(function (i) {

               var uniqueNamespace = namespace + i;
               var images, item_width, item_height, offset, center, pressed, dim, count,
                   reference, referenceY, amplitude, target, velocity, scrolling,
                   xform, frame, timestamp, ticker, dragged, vertical_dragged;

var $indicators = $('

');

               var scrollingTimeout = null;
               var oneTimeCallback = null;

               // Initialize
               var view = $(this);
               var showIndicators = view.attr('data-indicators') || options.indicators;

               // Options
               var setCarouselHeight = function () {
                   var firstImage = view.find('.carousel-item img').first();
                   if (firstImage.length) {
                       if (firstImage.prop('complete')) {
                           view.css('height', firstImage.height());
                       } else {
                           firstImage.on('load', function () {
                               view.css('height', $(this).height());
                           });
                       }
                   } else {
                       var imageHeight = view.find('.carousel-item').first().height();
                       view.css('height', imageHeight);
                   }
               };

               if (options.fullWidth) {
                   options.dist = 0;
                   setCarouselHeight();

                   // Offset fixed items when indicators.
                   if (showIndicators) {
                       view.find('.carousel-fixed-item').addClass('with-indicators');
                   }
               }

               // Don't double initialize.
               if (view.hasClass('initialized')) {
                   // Recalculate variables
                   $(window).trigger('resize');

                   // Redraw carousel.
                   $(this).trigger('carouselNext', [0.000001]);
                   return true;
               }

               view.addClass('initialized');
               pressed = false;
               offset = target = 0;
               images = [];
               item_width = view.find('.carousel-item').first().innerWidth();
               item_height = view.find('.carousel-item').first().innerHeight();
               dim = item_width * 2 + options.padding;

               view.find('.carousel-item').each(function (i) {
                   images.push($(this)[0]);
                   if (showIndicators) {

var $indicator = $('

');

                       // Add active to first by default.
                       if (i === 0) {
                           $indicator.addClass('active');
                       }

                       // Handle clicks on indicators.
                       $indicator.click(function (e) {
                           e.stopPropagation();

                           var index = $(this).index();
                           cycleTo(index);
                       });
                       $indicators.append($indicator);
                   }
               });

               if (showIndicators) {
                   view.append($indicators);
               }
               count = images.length;

               function setupEvents() {
                   if (typeof window.ontouchstart !== 'undefined') {
                       view[0].addEventListener('touchstart', tap);
                       view[0].addEventListener('touchmove', drag);
                       view[0].addEventListener('touchend', release);
                   }
                   view[0].addEventListener('mousedown', tap);
                   view[0].addEventListener('mousemove', drag);
                   view[0].addEventListener('mouseup', release);
                   view[0].addEventListener('mouseleave', release);
                   view[0].addEventListener('click', click);
               }

               function xpos(e) {
                   // touch event
                   if (e.targetTouches && (e.targetTouches.length >= 1)) {
                       return e.targetTouches[0].clientX;
                   }

                   // mouse event
                   return e.clientX;
               }

               function ypos(e) {
                   // touch event
                   if (e.targetTouches && (e.targetTouches.length >= 1)) {
                       return e.targetTouches[0].clientY;
                   }

                   // mouse event
                   return e.clientY;
               }

               function wrap(x) {
                   return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
               }

               function scroll(x) {
                   // Track scrolling state
                   scrolling = true;
                   if (!view.hasClass('scrolling')) {
                       view.addClass('scrolling');
                   }
                   if (scrollingTimeout != null) {
                       window.clearTimeout(scrollingTimeout);
                   }
                   scrollingTimeout = window.setTimeout(function () {
                       scrolling = false;
                       view.removeClass('scrolling');
                   }, options.duration);

                   // Start actual scroll
                   var i, half, delta, dir, tween, el, alignment, xTranslation;
                   var lastCenter = center;

                   offset = (typeof x === 'number') ? x : offset;
                   center = Math.floor((offset + dim / 2) / dim);
                   delta = offset - center * dim;
                   dir = (delta < 0) ? 1 : -1;
                   tween = -dir * delta * 2 / dim;
                   half = count >> 1;

                   if (!options.fullWidth) {
                       alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
                       alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
                   } else {
                       alignment = 'translateX(0)';
                   }

                   // Set indicator active
                   if (showIndicators) {
                       var diff = (center % count);
                       var activeIndicator = $indicators.find('.indicator-item.active');
                       if (activeIndicator.index() !== diff) {
                           activeIndicator.removeClass('active');
                           $indicators.find('.indicator-item').eq(diff).addClass('active');
                       }
                   }

                   // center
                   // Don't show wrapped items.
                   if (!options.noWrap || (center >= 0 && center < count)) {
                       el = images[wrap(center)];

                       // Add active class to center item.
                       if (!$(el).hasClass('active')) {
                           view.find('.carousel-item').removeClass('active');
                           $(el).addClass('active');
                       }
                       el.style[xform] = alignment +
                           ' translateX(' + (-delta / 2) + 'px)' +
                           ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
                           ' translateZ(' + (options.dist * tween) + 'px)';
                       el.style.zIndex = 0;
                       if (options.fullWidth) {
                           tweenedOpacity = 1;
                       } else {
                           tweenedOpacity = 1 - 0.2 * tween;
                       }
                       el.style.opacity = tweenedOpacity;
                       el.style.display = 'block';
                   }

                   for (i = 1; i <= half; ++i) {
                       // right side
                       if (options.fullWidth) {
                           zTranslation = options.dist;
                           tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
                       } else {
                           zTranslation = options.dist * (i * 2 + tween * dir);
                           tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
                       }
                       // Don't show wrapped items.
                       if (!options.noWrap || center + i < count) {
                           el = images[wrap(center + i)];
                           el.style[xform] = alignment +
                               ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
                               ' translateZ(' + zTranslation + 'px)';
                           el.style.zIndex = -i;
                           el.style.opacity = tweenedOpacity;
                           el.style.display = 'block';
                       }

                       // left side
                       if (options.fullWidth) {
                           zTranslation = options.dist;
                           tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
                       } else {
                           zTranslation = options.dist * (i * 2 - tween * dir);
                           tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
                       }
                       // Don't show wrapped items.
                       if (!options.noWrap || center - i >= 0) {
                           el = images[wrap(center - i)];
                           el.style[xform] = alignment +
                               ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
                               ' translateZ(' + zTranslation + 'px)';
                           el.style.zIndex = -i;
                           el.style.opacity = tweenedOpacity;
                           el.style.display = 'block';
                       }
                   }

                   // center
                   // Don't show wrapped items.
                   if (!options.noWrap || (center >= 0 && center < count)) {
                       el = images[wrap(center)];
                       el.style[xform] = alignment +
                           ' translateX(' + (-delta / 2) + 'px)' +
                           ' translateX(' + (dir * options.shift * tween) + 'px)' +
                           ' translateZ(' + (options.dist * tween) + 'px)';
                       el.style.zIndex = 0;
                       if (options.fullWidth) {
                           tweenedOpacity = 1;
                       } else {
                           tweenedOpacity = 1 - 0.2 * tween;
                       }
                       el.style.opacity = tweenedOpacity;
                       el.style.display = 'block';
                   }

                   // onCycleTo callback
                   if (lastCenter !== center &&
                       typeof (options.onCycleTo) === "function") {
                       var $curr_item = view.find('.carousel-item').eq(wrap(center));
                       options.onCycleTo.call(this, $curr_item, dragged);
                   }

                   // One time callback
                   if (typeof (oneTimeCallback) === "function") {
                       oneTimeCallback.call(this, $curr_item, dragged);
                       oneTimeCallback = null;
                   }
               }

               function track() {
                   var now, elapsed, delta, v;

                   now = Date.now();
                   elapsed = now - timestamp;
                   timestamp = now;
                   delta = offset - frame;
                   frame = offset;

                   v = 1000 * delta / (1 + elapsed);
                   velocity = 0.8 * v + 0.2 * velocity;
               }

               function autoScroll() {
                   var elapsed, delta;

                   if (amplitude) {
                       elapsed = Date.now() - timestamp;
                       delta = amplitude * Math.exp(-elapsed / options.duration);
                       if (delta > 2 || delta < -2) {
                           scroll(target - delta);
                           requestAnimationFrame(autoScroll);
                       } else {
                           scroll(target);
                       }
                   }
               }

               function click(e) {
                   // Disable clicks if carousel was dragged.
                   if (dragged) {
                       e.preventDefault();
                       e.stopPropagation();
                       return false;

                   } else if (!options.fullWidth) {
                       var clickedIndex = $(e.target).closest('.carousel-item').index();
                       var diff = wrap(center) - clickedIndex;

                       // Disable clicks if carousel was shifted by click
                       if (diff !== 0) {
                           e.preventDefault();
                           e.stopPropagation();
                       }
                       cycleTo(clickedIndex);
                   }
               }

               function cycleTo(n) {
                   var diff = (center % count) - n;

                   // Account for wraparound.
                   if (!options.noWrap) {
                       if (diff < 0) {
                           if (Math.abs(diff + count) < Math.abs(diff)) {
                               diff += count;
                           }

                       } else if (diff > 0) {
                           if (Math.abs(diff - count) < diff) {
                               diff -= count;
                           }
                       }
                   }

                   // Call prev or next accordingly.
                   if (diff < 0) {
                       view.trigger('carouselNext', [Math.abs(diff)]);

                   } else if (diff > 0) {
                       view.trigger('carouselPrev', [diff]);
                   }
               }

               function tap(e) {
                   if (e.type === 'mousedown') {
                       e.preventDefault();
                   }
                   pressed = true;
                   dragged = false;
                   vertical_dragged = false;
                   reference = xpos(e);
                   referenceY = ypos(e);

                   velocity = amplitude = 0;
                   frame = offset;
                   timestamp = Date.now();
                   clearInterval(ticker);
                   ticker = setInterval(track, 100);
               }

               function drag(e) {
                   var x, delta, deltaY;
                   if (pressed) {
                       x = xpos(e);
                       y = ypos(e);
                       delta = reference - x;
                       deltaY = Math.abs(referenceY - y);
                       if (deltaY < 30 && !vertical_dragged) {
                           // If vertical scrolling don't allow dragging.
                           if (delta > 2 || delta < -2) {
                               dragged = true;
                               reference = x;
                               scroll(offset + delta);
                           }

                       } else if (dragged) {
                           // If dragging don't allow vertical scroll.
                           e.preventDefault();
                           e.stopPropagation();
                           return false;

                       } else {
                           // Vertical scrolling.
                           vertical_dragged = true;
                       }
                   }

                   if (dragged) {
                       // If dragging don't allow vertical scroll.
                       e.preventDefault();
                       e.stopPropagation();
                       return false;
                   }
               }

               function release(e) {
                   if (pressed) {
                       pressed = false;
                   } else {
                       return;
                   }

                   clearInterval(ticker);
                   target = offset;
                   if (velocity > 10 || velocity < -10) {
                       amplitude = 0.9 * velocity;
                       target = offset + amplitude;
                   }
                   target = Math.round(target / dim) * dim;

                   // No wrap of items.
                   if (options.noWrap) {
                       if (target >= dim * (count - 1)) {
                           target = dim * (count - 1);
                       } else if (target < 0) {
                           target = 0;
                       }
                   }
                   amplitude = target - offset;
                   timestamp = Date.now();
                   requestAnimationFrame(autoScroll);

                   if (dragged) {
                       e.preventDefault();
                       e.stopPropagation();
                   }
                   return false;
               }

               xform = 'transform';
       ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
                   var e = prefix + 'Transform';
                   if (typeof document.body.style[e] !== 'undefined') {
                       xform = e;
                       return false;
                   }
                   return true;
               });

               $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, function () {
                   if (options.fullWidth) {
                       item_width = view.find('.carousel-item').first().innerWidth();
                       item_height = view.find('.carousel-item').first().innerHeight();
                       dim = item_width * 2 + options.padding;
                       offset = center * 2 * item_width;
                       target = offset;
                   } else {
                       scroll();
                   }
               });

               setupEvents();
               scroll(offset);

               $(this).on('carouselNext', function (e, n, callback) {
                   if (n === undefined) {
                       n = 1;
                   }
                   if (typeof (callback) === "function") {
                       oneTimeCallback = callback;
                   }

                   target = (dim * Math.round(offset / dim)) + (dim * n);
                   if (offset !== target) {
                       amplitude = target - offset;
                       timestamp = Date.now();
                       requestAnimationFrame(autoScroll);
                   }
               });

               $(this).on('carouselPrev', function (e, n, callback) {
                   if (n === undefined) {
                       n = 1;
                   }
                   if (typeof (callback) === "function") {
                       oneTimeCallback = callback;
                   }

                   target = (dim * Math.round(offset / dim)) - (dim * n);
                   if (offset !== target) {
                       amplitude = target - offset;
                       timestamp = Date.now();
                       requestAnimationFrame(autoScroll);
                   }
               });

               $(this).on('carouselSet', function (e, n, callback) {
                   if (n === undefined) {
                       n = 0;
                   }
                   if (typeof (callback) === "function") {
                       oneTimeCallback = callback;
                   }

                   cycleTo(n);
               });

           });

       },
       next: function (n, callback) {
           $(this).trigger('carouselNext', [n, callback]);
       },
       prev: function (n, callback) {
           $(this).trigger('carouselPrev', [n, callback]);
       },
       set: function (n, callback) {
           $(this).trigger('carouselSet', [n, callback]);
       }
   };

   $.fn.carousel = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
       }
   }; // Plugin end

}(jQuery));; (function ($) {

   var methods = {
       init: function (options) {
           return this.each(function () {
               var origin = $('#' + $(this).attr('data-activates'));
               var screen = $('body');

               // Creating tap target
               var tapTargetEl = $(this);
               var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
               var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
               var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
               var tapTargetContentEl = tapTargetEl.find('.tap-target-content');

               // Creating wrapper
               if (!tapTargetWrapper.length) {

tapTargetWrapper = tapTargetEl.wrap($('')).parent();

               }

               // Creating content
               if (!tapTargetContentEl.length) {

tapTargetContentEl = $('');

                   tapTargetEl.append(tapTargetContentEl);
               }

               // Creating foreground wave
               if (!tapTargetWave.length) {

tapTargetWave = $('');

                   // Creating origin
                   if (!tapTargetOriginEl.length) {
                       tapTargetOriginEl = origin.clone(true, true);
                       tapTargetOriginEl.addClass('tap-target-origin');
                       tapTargetOriginEl.removeAttr('id');
                       tapTargetOriginEl.removeAttr('style');
                       tapTargetWave.append(tapTargetOriginEl);
                   }

                   tapTargetWrapper.append(tapTargetWave);
               }

               // Open
               var openTapTarget = function () {
                   if (tapTargetWrapper.is('.open')) {
                       return;
                   }

                   // Adding open class
                   tapTargetWrapper.addClass('open');

                   setTimeout(function () {
                       tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
                           closeTapTarget();
                           tapTargetOriginEl.off('click.tapTarget');
                       });

                       $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
                           closeTapTarget();
                           $(document).off('click.tapTarget');
                       });

                       var throttledCalc = Materialize.throttle(function () {
                           calculateTapTarget();
                       }, 200);
                       $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
                   }, 0);
               };

               // Close
               var closeTapTarget = function () {
                   if (!tapTargetWrapper.is('.open')) {
                       return;
                   }

                   tapTargetWrapper.removeClass('open');
                   tapTargetOriginEl.off('click.tapTarget')
                   $(document).off('click.tapTarget');
                   $(window).off('resize.tapTarget');
               };

               // Pre calculate
               var calculateTapTarget = function () {
                   // Element or parent is fixed position?
                   var isFixed = origin.css('position') === 'fixed';
                   if (!isFixed) {
                       var parents = origin.parents();
                       for (var i = 0; i < parents.length; i++) {
                           isFixed = $(parents[i]).css('position') == 'fixed';
                           if (isFixed) {
                               break;
                           }
                       }
                   }

                   // Calculating origin
                   var originWidth = origin.outerWidth();
                   var originHeight = origin.outerHeight();
                   var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
                   var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;

                   // Calculating screen
                   var windowWidth = $(window).width();
                   var windowHeight = $(window).height();
                   var centerX = windowWidth / 2;
                   var centerY = windowHeight / 2;
                   var isLeft = originLeft <= centerX;
                   var isRight = originLeft > centerX;
                   var isTop = originTop <= centerY;
                   var isBottom = originTop > centerY;
                   var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
                   var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;

                   // Calculating tap target
                   var tapTargetWidth = tapTargetEl.outerWidth();
                   var tapTargetHeight = tapTargetEl.outerHeight();
                   var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
                   var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
                   var tapTargetPosition = isFixed ? 'fixed' : 'absolute';

                   // Calculating content
                   var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
                   var tapTargetTextHeight = tapTargetHeight / 2;
                   var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
                   var tapTargetTextBottom = 0;
                   var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
                   var tapTargetTextRight = 0;
                   var tapTargetTextPadding = originWidth;
                   var tapTargetTextAlign = isBottom ? 'bottom' : 'top';

                   // Calculating wave
                   var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
                   var tapTargetWaveHeight = tapTargetWaveWidth;
                   var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
                   var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;

                   // Setting tap target
                   var tapTargetWrapperCssObj = {};
                   tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ;
                   tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ;
                   tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ;
                   tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ;
                   tapTargetWrapperCssObj.position = tapTargetPosition;
                   tapTargetWrapper.css(tapTargetWrapperCssObj);

                   // Setting content
                   tapTargetContentEl.css({
                       width: tapTargetTextWidth,
                       height: tapTargetTextHeight,
                       top: tapTargetTextTop,
                       right: tapTargetTextRight,
                       bottom: tapTargetTextBottom,
                       left: tapTargetTextLeft,
                       padding: tapTargetTextPadding,
                       verticalAlign: tapTargetTextAlign
                   });

                   // Setting wave
                   tapTargetWave.css({
                       top: tapTargetWaveTop,
                       left: tapTargetWaveLeft,
                       width: tapTargetWaveWidth,
                       height: tapTargetWaveHeight
                   });
               }

               if (options == 'open') {
                   calculateTapTarget();
                   openTapTarget();
               }

               if (options == 'close')
                   closeTapTarget();
           });
       },
       open: function () {},
       close: function () {}
   };

   $.fn.tapTarget = function (methodOrOptions) {
       if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
           return methods.init.apply(this, arguments);

       $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
   };

}(jQuery));