Team:TUDelft/js/materialize.js

/*!

* Materialize v0.100.1 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/

var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();

function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }

// Check for jQuery. if (typeof jQuery === 'undefined') {

 var jQuery;
 // Check if require is a defined function.
 if (typeof require === 'function') {
   jQuery = $ = require('jquery');
   // Else use the dollar sign alias.
 } else {
   jQuery = $;
 }

}

/*
 * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
 * Open source under the BSD License.
 * Copyright © 2008 George McGinley Smith
 * All rights reserved.
 * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
 */

(function (factory) {

 if (typeof define === "function" && define.amd) {
   define(['jquery'], function ($) {
     return factory($);
   });
 } else if (typeof module === "object" && typeof module.exports === "object") {
   exports = factory(require('jquery'));
 } else {
   factory(jQuery);
 }

})(function ($) {

 // Preserve the original jQuery "swing" easing as "jswing"
 $.easing['jswing'] = $.easing['swing'];
 var pow = Math.pow,
     sqrt = Math.sqrt,
     sin = Math.sin,
     cos = Math.cos,
     PI = Math.PI,
     c1 = 1.70158,
     c2 = c1 * 1.525,
     c3 = c1 + 1,
     c4 = 2 * PI / 3,
     c5 = 2 * PI / 4.5;
 // x is the fraction of animation progress, in the range 0..1
 function bounceOut(x) {
   var n1 = 7.5625,
       d1 = 2.75;
   if (x < 1 / d1) {
     return n1 * x * x;
   } else if (x < 2 / d1) {
     return n1 * (x -= 1.5 / d1) * x + .75;
   } else if (x < 2.5 / d1) {
     return n1 * (x -= 2.25 / d1) * x + .9375;
   } else {
     return n1 * (x -= 2.625 / d1) * x + .984375;
   }
 }
 $.extend($.easing, {
   def: 'easeOutQuad',
   swing: function (x) {
     return $.easing[$.easing.def](x);
   },
   easeInQuad: function (x) {
     return x * x;
   },
   easeOutQuad: function (x) {
     return 1 - (1 - x) * (1 - x);
   },
   easeInOutQuad: function (x) {
     return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
   },
   easeInCubic: function (x) {
     return x * x * x;
   },
   easeOutCubic: function (x) {
     return 1 - pow(1 - x, 3);
   },
   easeInOutCubic: function (x) {
     return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
   },
   easeInQuart: function (x) {
     return x * x * x * x;
   },
   easeOutQuart: function (x) {
     return 1 - pow(1 - x, 4);
   },
   easeInOutQuart: function (x) {
     return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
   },
   easeInQuint: function (x) {
     return x * x * x * x * x;
   },
   easeOutQuint: function (x) {
     return 1 - pow(1 - x, 5);
   },
   easeInOutQuint: function (x) {
     return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
   },
   easeInSine: function (x) {
     return 1 - cos(x * PI / 2);
   },
   easeOutSine: function (x) {
     return sin(x * PI / 2);
   },
   easeInOutSine: function (x) {
     return -(cos(PI * x) - 1) / 2;
   },
   easeInExpo: function (x) {
     return x === 0 ? 0 : pow(2, 10 * x - 10);
   },
   easeOutExpo: function (x) {
     return x === 1 ? 1 : 1 - pow(2, -10 * x);
   },
   easeInOutExpo: function (x) {
     return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
   },
   easeInCirc: function (x) {
     return 1 - sqrt(1 - pow(x, 2));
   },
   easeOutCirc: function (x) {
     return sqrt(1 - pow(x - 1, 2));
   },
   easeInOutCirc: function (x) {
     return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
   },
   easeInElastic: function (x) {
     return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
   },
   easeOutElastic: function (x) {
     return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
   },
   easeInOutElastic: function (x) {
     return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
   },
   easeInBack: function (x) {
     return c3 * x * x * x - c1 * x * x;
   },
   easeOutBack: function (x) {
     return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
   },
   easeInOutBack: function (x) {
     return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
   },
   easeInBounce: function (x) {
     return 1 - bounceOut(1 - x);
   },
   easeOutBounce: bounceOut,
   easeInOutBounce: function (x) {
     return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
   }
 });

});; // Custom Easing jQuery.extend(jQuery.easing, {

 easeInOutMaterial: function (x, t, b, c, d) {
   if ((t /= d / 2) < 1) return c / 2 * t * t + b;
   return c / 4 * ((t -= 2) * t * t + 2) + b;
 }

});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {

 function t(e) {
   var t = e.length,
       a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
 }if (!e.jQuery) {
   var r = function (e, t) {
     return new r.fn.init(e, t);
   };r.isWindow = function (e) {
     return null != e && e == e.window;
   }, r.type = function (e) {
     return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
   }, r.isArray = Array.isArray || function (e) {
     return "array" === r.type(e);
   }, r.isPlainObject = function (e) {
     var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
       if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
     } catch (a) {
       return !1;
     }for (t in e) {}return void 0 === t || o.call(e, t);
   }, r.each = function (e, r, a) {
     var n,
         o = 0,
         i = e.length,
         s = t(e);if (a) {
       if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
         if (n = r.apply(e[o], a), n === !1) break;
       }
     } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
       if (n = r.call(e[o], o, e[o]), n === !1) break;
     }return e;
   }, r.data = function (e, t, n) {
     if (void 0 === n) {
       var o = e[r.expando],
           i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
     } else if (void 0 !== t) {
       var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
     }
   }, r.removeData = function (e, t) {
     var n = e[r.expando],
         o = n && a[n];o && r.each(t, function (e, t) {
       delete o[t];
     });
   }, r.extend = function () {
     var e,
         t,
         a,
         n,
         o,
         i,
         s = arguments[0] || {},
         l = 1,
         u = arguments.length,
         c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
       if (null != (o = arguments[l])) for (n in o) {
         e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
       }
     }return s;
   }, r.queue = function (e, a, n) {
     function o(e, r) {
       var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
         for (var r = +t.length, a = 0, n = e.length; r > a;) {
           e[n++] = t[a++];
         }if (r !== r) for (; void 0 !== t[a];) {
           e[n++] = t[a++];
         }return e.length = n, e;
       }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
     }if (e) {
       a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
     }
   }, r.dequeue = function (e, t) {
     r.each(e.nodeType ? [e] : e, function (e, a) {
       t = t || "fx";var n = r.queue(a, t),
           o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
         r.dequeue(a, t);
       }));
     });
   }, r.fn = r.prototype = { init: function (e) {
       if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
     }, offset: function () {
       var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
     }, position: function () {
       function e() {
         for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
           e = e.offsetParent;
         }return e || document;
       }var t = this[0],
           e = e.apply(t),
           a = this.offset(),
           n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
     } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
     n["[object " + s[l] + "]"] = s[l].toLowerCase();
   }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
 }

}(window), function (e) {

 "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();

}(function () {

 return function (e, t, r, a) {
   function n(e) {
     for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
       var n = e[t];n && a.push(n);
     }return a;
   }function o(e) {
     return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
   }function i(e) {
     var t = f.data(e, "velocity");return null === t ? a : t;
   }function s(e) {
     return function (t) {
       return Math.round(t * e) * (1 / e);
     };
   }function l(e, r, a, n) {
     function o(e, t) {
       return 1 - 3 * t + 3 * e;
     }function i(e, t) {
       return 3 * t - 6 * e;
     }function s(e) {
       return 3 * e;
     }function l(e, t, r) {
       return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
     }function u(e, t, r) {
       return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
     }function c(t, r) {
       for (var n = 0; m > n; ++n) {
         var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
       }return r;
     }function p() {
       for (var t = 0; b > t; ++t) {
         w[t] = l(t * x, e, a);
       }
     }function f(t, r, n) {
       var o,
           i,
           s = 0;do {
         i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
       } while (Math.abs(o) > h && ++s < v);return i;
     }function d(t) {
       for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
         r += x;
       }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
           s = r + i * x,
           l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
     }function g() {
       V = !0, (e != r || a != n) && p();
     }var m = 4,
         y = .001,
         h = 1e-7,
         v = 10,
         b = 11,
         x = 1 / (b - 1),
         S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
       if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
     }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
         V = !1,
         C = function (t) {
       return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
     };C.getControlPoints = function () {
       return [{ x: e, y: r }, { x: a, y: n }];
     };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
       return T;
     }, C;
   }function u(e, t) {
     var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
   }function c(e) {
     if (e) {
       var t = new Date().getTime(),
           r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
         if (b.State.calls[o]) {
           var s = b.State.calls[o],
               l = s[0],
               u = s[2],
               d = s[3],
               g = !!d,
               y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
             var P = l[v],
                 V = P.element;if (i(V)) {
               var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
                 if ("flex" === u.display) {
                   var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
                     S.setPropertyValue(V, "display", t);
                   });
                 }S.setPropertyValue(V, "display", u.display);
               }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
                 if ("element" !== k) {
                   var A,
                       F = P[k],
                       j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
                     var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
                   }if (F.currentValue = A, "tween" === k) y = A;else {
                     if (S.Hooks.registered[k]) {
                       var H = S.Hooks.getRoot(k),
                           N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
                     }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
                   }
                 }
               }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
             }
           }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
         }
       }
     }b.State.isTicking && w(c);
   }function p(e, t) {
     if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
       var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
         i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
           var r = /^scale/.test(t) ? 1 : 0,
               n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
         }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
       }if (!t && o.complete && !o.loop && u === c - 1) try {
         o.complete.call(n, n);
       } catch (g) {
         setTimeout(function () {
           throw g;
         }, 1);
       }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
         /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
       }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
     }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
       if (b.State.calls[m] !== !1) {
         l = !0;break;
       }
     }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
   }var f,
       d = function () {
     if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
       var t = r.createElement("div");if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e;
     }return a;
   }(),
       g = function () {
     var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
       var r,
           a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
         t(a + r);
       }, r);
     };
   }(),
       m = { isString: function (e) {
       return "string" == typeof e;
     }, isArray: Array.isArray || function (e) {
       return "[object Array]" === Object.prototype.toString.call(e);
     }, isFunction: function (e) {
       return "[object Function]" === Object.prototype.toString.call(e);
     }, isNode: function (e) {
       return e && e.nodeType;
     }, isNodeList: function (e) {
       return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
     }, isWrapped: function (e) {
       return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
     }, isSVG: function (e) {
       return t.SVGElement && e instanceof t.SVGElement;
     }, isEmptyObject: function (e) {
       for (var t in e) {
         return !1;
       }return !0;
     } },
       y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
       v = "swing",
       b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
       f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
     }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
     function e(e) {
       return -e.tension * e.x - e.friction * e.v;
     }function t(t, r, a) {
       var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
     }function r(r, a) {
       var n = { dx: r.v, dv: e(r) },
           o = t(r, .5 * a, n),
           i = t(r, .5 * a, o),
           s = t(r, a, i),
           l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
           u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
     }return function a(e, t, n) {
       var o,
           i,
           s,
           l = { x: -1, v: 0, tension: null, friction: null },
           u = [0],
           c = 0,
           p = 1e-4,
           f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
         return u[e * (u.length - 1) | 0];
       } : c;
     };
   }();b.Easings = { linear: function (e) {
       return e;
     }, swing: function (e) {
       return .5 - Math.cos(e * Math.PI) / 2;
     }, spring: function (e) {
       return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
     } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
     b.Easings[t[0]] = l.apply(null, t[1]);
   });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
         for (var e = 0; e < S.Lists.colors.length; e++) {
           var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
         }var r, a, n;if (d) for (r in S.Hooks.templates) {
           a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
         }for (r in S.Hooks.templates) {
           a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
             var i = r + n[e],
                 s = e;S.Hooks.registered[i] = [r, s];
           }
         }
       }, getRoot: function (e) {
         var t = S.Hooks.registered[e];return t ? t[0] : e;
       }, cleanRootPropertyValue: function (e, t) {
         return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
       }, extractValue: function (e, t) {
         var r = S.Hooks.registered[e];if (r) {
           var a = r[0],
               n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
         }return t;
       }, injectValue: function (e, t, r) {
         var a = S.Hooks.registered[e];if (a) {
           var n,
               o,
               i = a[0],
               s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
         }return r;
       } }, Normalizations: { registered: { clip: function (e, t, r) {
           switch (e) {case "name":
               return "clip";case "extract":
               var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
               return "rect(" + r + ")";}
         }, blur: function (e, t, r) {
           switch (e) {case "name":
               return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
               var a = parseFloat(r);if (!a && 0 !== a) {
                 var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
               }return a;case "inject":
               return parseFloat(r) ? "blur(" + r + ")" : "none";}
         }, opacity: function (e, t, r) {
           if (8 >= d) switch (e) {case "name":
               return "filter";case "extract":
               var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
               return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
               return "opacity";case "extract":
               return r;case "inject":
               return r;}
         } }, register: function () {
         9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
           !function () {
             var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
               switch (e) {case "name":
                   return "transform";case "extract":
                   return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
                   var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
                       o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
                       b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
                       o = !/(deg|\d)$/i.test(n);break;case "rotate":
                       o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
             };
           }();
         }for (var e = 0; e < S.Lists.colors.length; e++) {
           !function () {
             var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
               switch (e) {case "name":
                   return t;case "extract":
                   var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
                     var i,
                         s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
                   }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
                   return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
             };
           }();
         }
       } }, Names: { camelCase: function (e) {
         return e.replace(/-(\w)/g, function (e, t) {
           return t.toUpperCase();
         });
       }, SVGAttribute: function (e) {
         var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
       }, prefixCheck: function (e) {
         if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
           var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
             return e.toUpperCase();
           }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
         }return [e, !1];
       } }, Values: { hexToRgb: function (e) {
         var t,
             r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
             a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
           return t + t + r + r + a + a;
         }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
       }, isCSSNullValue: function (e) {
         return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
       }, getUnitType: function (e) {
         return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
         );
       }, getDisplayType: function (e) {
         var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
         );
       }, addClass: function (e, t) {
         e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
       }, removeClass: function (e, t) {
         e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
       } }, getPropertyValue: function (e, r, n, o) {
       function s(e, r) {
         function n() {
           u && S.setPropertyValue(e, "display", "none");
         }var l = 0;if (8 >= d) l = f.css(e, r);else {
           var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
             if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
               var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
             }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
               var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
             }
           }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
         }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
           var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
         }return l;
       }var l;if (S.Hooks.registered[r]) {
         var u = r,
             c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
       } else if (S.Normalizations.registered[r]) {
         var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
       }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
         if (/^(height|width)$/i.test(r)) try {
           l = e.getBBox()[r];
         } catch (m) {
           l = 0;
         } else l = e.getAttribute(r);
       } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
     }, setPropertyValue: function (e, r, a, n, o) {
       var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
         if (S.Hooks.registered[r]) {
           var l = r,
               u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
         }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
           e.style[s] = a;
         } catch (c) {
           b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
         } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
       }return [s, a];
     }, flushTransformCache: function (e) {
       function t(t) {
         return parseFloat(S.getPropertyValue(e, t));
       }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
         var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
           /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
         });
       } else {
         var n, o;f.each(i(e).transformCache, function (t) {
           return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
         }), o && (r = "perspective" + o + " " + r);
       }S.setPropertyValue(e, "transform", r);
     } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
     var n = a;return e = o(e), f.each(e, function (e, o) {
       if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
         var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
       }
     }), n;
   };var P = function () {
     function e() {
       return s ? k.promise || null : l;
     }function n() {
       function e(e) {
         function p(e, t) {
           var r = a,
               n = a,
               i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
         }function d(e, t) {
           var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
             return r = e, "";
           }), r || (r = S.Values.getUnitType(e)), [a, r];
         }function h() {
           var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
               a = e.position === L.lastPosition && e.myParent === L.lastParent,
               n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
               l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
             var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
               b.CSS.setPropertyValue(u, t, "hidden");
             }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
               b.CSS.setPropertyValue(u, t, s + "%");
             }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
           }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
         }if (s.begin && 0 === V) try {
           s.begin.call(g, g);
         } catch (x) {
           setTimeout(function () {
             throw x;
           }, 1);
         }if ("scroll" === A) {
           var P,
               C,
               T,
               F = /^x$/i.test(s.axis) ? "Left" : "Top",
               j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
         } else if ("reverse" === A) {
           if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
             if ("element" !== H) {
               var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
             }
           }l = E;
         } else if ("start" === A) {
           var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
             if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
               var r = p(t, !0),
                   n = r[0],
                   o = r[1],
                   i = r[2];if (S.RegEx.isHex.test(n)) {
                 for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
                   var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
                 }delete y[e];
               }
             }
           });for (var z in y) {
             var O = p(y[z]),
                 q = O[0],
                 $ = O[1],
                 M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
                 B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
               (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
                   G,
                   Y,
                   D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
                 return D = t, "";
               }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
                 n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
                     M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
                     break;default:
                     M *= n[Y + "ToPx"];}switch (G) {case "%":
                     M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
                     break;default:
                     M *= 1 / n[G + "ToPx"];}
               }switch (D) {case "+":
                   q = M + q;break;case "-":
                   q = M - q;break;case "*":
                   q = M * q;break;case "/":
                   q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
             } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
           }l.element = o;
         }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
       }var n,
           o = this,
           s = f.extend({}, b.defaults, v),
           l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
         b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
       }), s.duration.toString().toLowerCase()) {case "fast":
           s.duration = 200;break;case "normal":
           s.duration = h;break;case "slow":
           s.duration = 600;break;default:
           s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
         return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
       }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
     }var s,
         l,
         d,
         g,
         y,
         v,
         x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
       x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
           V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
         var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
           m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
         }
       }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
         k.resolver = e, k.rejecter = t;
       }));var A;switch (y) {case "scroll":
           A = "scroll";break;case "reverse":
           A = "reverse";break;case "finish":case "stop":
           f.each(g, function (e, t) {
             i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
           });var F = [];return f.each(b.State.calls, function (e, t) {
             t && f.each(t[1], function (r, n) {
               var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
                 a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
                   m.isFunction(t) && t(null, !0);
                 }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
                   t.endValue = t.currentValue;
                 }), F.push(e)) : "finish" === y && (t[2].duration = 1));
               }) : !0;
             });
           }), "stop" === y && (f.each(F, function (e, t) {
             p(t, !0);
           }), k.promise && k.resolver(g)), e();default:
           if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
             if (m.isString(y) && b.Redirects[y]) {
               var j = f.extend({}, v),
                   E = j.duration,
                   H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
                 parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
               }), e();
             }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
           }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
           R = [];f.each(g, function (e, t) {
         m.isNode(t) && n.call(t);
       });var z,
           j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
         var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
       }return e();
     }
   };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
     r.hidden ? (w = function (e) {
       return setTimeout(function () {
         e(!0);
       }, 16);
     }, c()) : w = t.requestAnimationFrame || g;
   }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
     b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
       var l = f.extend({}, r),
           u = l.begin,
           c = l.complete,
           p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
           d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
         u && u.call(i, i);for (var r in p) {
           d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
         }d.overflow = e.style.overflow, e.style.overflow = "hidden";
       }, l.complete = function () {
         for (var t in d) {
           e.style[t] = d[t];
         }c && c.call(i, i), s && s.resolver(i);
       }, b(e, p, l);
     };
   }), f.each(["In", "Out"], function (e, t) {
     b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
       var l = f.extend({}, r),
           u = { opacity: "In" === t ? 1 : 0 },
           c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
         c && c.call(i, i), s && s.resolver(i);
       }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
     };
   }), b;
 }(window.jQuery || window.Zepto || window, window, document);

}));

!function (a, b, c, d) {
 "use strict";
 function k(a, b, c) {
   return setTimeout(q(a, c), b);
 }function l(a, b, c) {
   return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
 }function m(a, b, c) {
   var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
     b.call(c, a[e], e, a), e++;
   } else for (e in a) {
     a.hasOwnProperty(e) && b.call(c, a[e], e, a);
   }
 }function n(a, b, c) {
   for (var e = Object.keys(b), f = 0; f < e.length;) {
     (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
   }return a;
 }function o(a, b) {
   return n(a, b, !0);
 }function p(a, b, c) {
   var e,
       d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
 }function q(a, b) {
   return function () {
     return a.apply(b, arguments);
   };
 }function r(a, b) {
   return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
 }function s(a, b) {
   return a === d ? b : a;
 }function t(a, b, c) {
   m(x(b), function (b) {
     a.addEventListener(b, c, !1);
   });
 }function u(a, b, c) {
   m(x(b), function (b) {
     a.removeEventListener(b, c, !1);
   });
 }function v(a, b) {
   for (; a;) {
     if (a == b) return !0;a = a.parentNode;
   }return !1;
 }function w(a, b) {
   return a.indexOf(b) > -1;
 }function x(a) {
   return a.trim().split(/\s+/g);
 }function y(a, b, c) {
   if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
     if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
   }return -1;
 }function z(a) {
   return Array.prototype.slice.call(a, 0);
 }function A(a, b, c) {
   for (var d = [], e = [], f = 0; f < a.length;) {
     var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
   }return c && (d = b ? d.sort(function (a, c) {
     return a[b] > c[b];
   }) : d.sort()), d;
 }function B(a, b) {
   for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
     if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
   }return d;
 }function D() {
   return C++;
 }function E(a) {
   var b = a.ownerDocument;return b.defaultView || b.parentWindow;
 }function ab(a, b) {
   var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
     r(a.options.enable, [a]) && c.handler(b);
   }, this.init();
 }function bb(a) {
   var b,
       c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
 }function cb(a, b, c) {
   var d = c.pointers.length,
       e = c.changedPointers.length,
       f = b & O && 0 === d - e,
       g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
 }function db(a, b) {
   var c = a.session,
       d = b.pointers,
       e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
       g = c.firstMultiple,
       h = g ? g.center : f.center,
       i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
 }function eb(a, b) {
   var c = b.center,
       d = a.offsetDelta || {},
       e = a.prevDelta || {},
       f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
 }function fb(a, b) {
   var f,
       g,
       h,
       j,
       c = a.lastInterval || b,
       e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
     var k = c.deltaX - b.deltaX,
         l = c.deltaY - b.deltaY,
         m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
   } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
 }function gb(a) {
   for (var b = [], c = 0; c < a.pointers.length;) {
     b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
   }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
 }function hb(a) {
   var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
     c += a[e].clientX, d += a[e].clientY, e++;
   }return { x: h(c / b), y: h(d / b) };
 }function ib(a, b, c) {
   return { x: b / a || 0, y: c / a || 0 };
 }function jb(a, b) {
   return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
 }function kb(a, b, c) {
   c || (c = $);var d = b[c[0]] - a[c[0]],
       e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
 }function lb(a, b, c) {
   c || (c = $);var d = b[c[0]] - a[c[0]],
       e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
 }function mb(a, b) {
   return lb(b[1], b[0], _) - lb(a[1], a[0], _);
 }function nb(a, b) {
   return kb(b[0], b[1], _) / kb(a[0], a[1], _);
 }function rb() {
   this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
 }function wb() {
   this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
 }function Ab() {
   this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
 }function Bb(a, b) {
   var c = z(a.touches),
       d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
 }function Eb() {
   this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
 }function Fb(a, b) {
   var c = z(a.touches),
       d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
       f,
       g = z(a.changedTouches),
       h = [],
       i = this.target;if (f = c.filter(function (a) {
     return v(a.target, i);
   }), b === O) for (e = 0; e < f.length;) {
     d[f[e].identifier] = !0, e++;
   }for (e = 0; e < g.length;) {
     d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
   }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
 }function Gb() {
   ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
 }function Pb(a, b) {
   this.manager = a, this.set(b);
 }function Qb(a) {
   if (w(a, Mb)) return Mb;var b = w(a, Nb),
       c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
 }function Yb(a) {
   this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
 }function Zb(a) {
   return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
 }function $b(a) {
   return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
 }function _b(a, b) {
   var c = b.manager;return c ? c.get(a) : a;
 }function ac() {
   Yb.apply(this, arguments);
 }function bc() {
   ac.apply(this, arguments), this.pX = null, this.pY = null;
 }function cc() {
   ac.apply(this, arguments);
 }function dc() {
   Yb.apply(this, arguments), this._timer = null, this._input = null;
 }function ec() {
   ac.apply(this, arguments);
 }function fc() {
   ac.apply(this, arguments);
 }function gc() {
   Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
 }function hc(a, b) {
   return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
 }function kc(a, b) {
   b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
     var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
   }, this);
 }function lc(a, b) {
   var c = a.element;m(a.options.cssProps, function (a, d) {
     c.style[B(c.style, d)] = b ? a : "";
   });
 }function mc(a, c) {
   var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
 }var e = ["", "webkit", "moz", "MS", "ms", "o"],
     f = b.createElement("div"),
     g = "function",
     h = Math.round,
     i = Math.abs,
     j = Date.now,
     C = 1,
     F = /mobile|tablet|ip(ad|hone|od)|android/i,
     G = "ontouchstart" in a,
     H = B(a, "PointerEvent") !== d,
     I = G && F.test(navigator.userAgent),
     J = "touch",
     K = "pen",
     L = "mouse",
     M = "kinect",
     N = 25,
     O = 1,
     P = 2,
     Q = 4,
     R = 8,
     S = 1,
     T = 2,
     U = 4,
     V = 8,
     W = 16,
     X = T | U,
     Y = V | W,
     Z = X | Y,
     $ = ["x", "y"],
     _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
     this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
   }, destroy: function () {
     this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
   } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
     pb = "mousedown",
     qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
     var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
   } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
     tb = { 2: J, 3: K, 4: L, 5: M },
     ub = "pointerdown",
     vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
     var b = this.store,
         c = !1,
         d = a.type.toLowerCase().replace("ms", ""),
         e = sb[d],
         f = tb[a.pointerType] || a.pointerType,
         g = f == J,
         h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
   } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
     yb = "touchstart",
     zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
     var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
       var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
     }
   } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
     Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
     var b = Cb[a.type],
         c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
   } }), p(Gb, ab, { handler: function (a, b, c) {
     var d = c.pointerType == J,
         e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
   }, destroy: function () {
     this.touch.destroy(), this.mouse.destroy();
   } });var Hb = B(f.style, "touchAction"),
     Ib = Hb !== d,
     Jb = "compute",
     Kb = "auto",
     Lb = "manipulation",
     Mb = "none",
     Nb = "pan-x",
     Ob = "pan-y";Pb.prototype = { set: function (a) {
     a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
   }, update: function () {
     this.set(this.manager.options.touchAction);
   }, compute: function () {
     var a = [];return m(this.manager.recognizers, function (b) {
       r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
     }), Qb(a.join(" "));
   }, preventDefaults: function (a) {
     if (!Ib) {
       var b = a.srcEvent,
           c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
           e = w(d, Mb),
           f = w(d, Ob),
           g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
     }
   }, preventSrc: function (a) {
     this.manager.session.prevented = !0, a.preventDefault();
   } };var Rb = 1,
     Sb = 2,
     Tb = 4,
     Ub = 8,
     Vb = Ub,
     Wb = 16,
     Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
     return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
   }, recognizeWith: function (a) {
     if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
   }, dropRecognizeWith: function (a) {
     return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
   }, requireFailure: function (a) {
     if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
   }, dropRequireFailure: function (a) {
     if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
   }, hasRequireFailures: function () {
     return this.requireFail.length > 0;
   }, canRecognizeWith: function (a) {
     return !!this.simultaneous[a.id];
   }, emit: function (a) {
     function d(d) {
       b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
     }var b = this,
         c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
   }, tryEmit: function (a) {
     return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
   }, canEmit: function () {
     for (var a = 0; a < this.requireFail.length;) {
       if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
     }return !0;
   }, recognize: function (a) {
     var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
   }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
     var b = this.options.pointers;return 0 === b || a.pointers.length === b;
   }, process: function (a) {
     var b = this.state,
         c = a.eventType,
         d = b & (Sb | Tb),
         e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
   } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
     var a = this.options.direction,
         b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
   }, directionTest: function (a) {
     var b = this.options,
         c = !0,
         d = a.distance,
         e = a.direction,
         f = a.deltaX,
         g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
   }, attrTest: function (a) {
     return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
   }, emit: function (a) {
     this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
   } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
     return [Mb];
   }, attrTest: function (a) {
     return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
   }, emit: function (a) {
     if (this._super.emit.call(this, a), 1 !== a.scale) {
       var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
     }
   } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
     return [Kb];
   }, process: function (a) {
     var b = this.options,
         c = a.pointers.length === b.pointers,
         d = a.distance < b.threshold,
         e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
       this.state = Vb, this.tryEmit();
     }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
   }, reset: function () {
     clearTimeout(this._timer);
   }, emit: function (a) {
     this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
   } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
     return [Mb];
   }, attrTest: function (a) {
     return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
   } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
     return bc.prototype.getTouchAction.call(this);
   }, attrTest: function (a) {
     var c,
         b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
   }, emit: function (a) {
     var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
   } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
     return [Lb];
   }, process: function (a) {
     var b = this.options,
         c = a.pointers.length === b.pointers,
         d = a.distance < b.threshold,
         e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
       if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
           g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
         this.state = Vb, this.tryEmit();
       }, b.interval, this), Sb) : Vb;
     }return Xb;
   }, failTimeout: function () {
     return this._timer = k(function () {
       this.state = Xb;
     }, this.options.interval, this), Xb;
   }, reset: function () {
     clearTimeout(this._timer);
   }, emit: function () {
     this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
   } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
     jc = 2;kc.prototype = { set: function (a) {
     return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
   }, stop: function (a) {
     this.session.stopped = a ? jc : ic;
   }, recognize: function (a) {
     var b = this.session;if (!b.stopped) {
       this.touchAction.preventDefaults(a);var c,
           d = this.recognizers,
           e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
         c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
       }
     }
   }, get: function (a) {
     if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
       if (b[c].options.event == a) return b[c];
     }return null;
   }, add: function (a) {
     if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
   }, remove: function (a) {
     if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
   }, on: function (a, b) {
     var c = this.handlers;return m(x(a), function (a) {
       c[a] = c[a] || [], c[a].push(b);
     }), this;
   }, off: function (a, b) {
     var c = this.handlers;return m(x(a), function (a) {
       b ? c[a].splice(y(c[a], b), 1) : delete c[a];
     }), this;
   }, emit: function (a, b) {
     this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
       b.type = a, b.preventDefault = function () {
         b.srcEvent.preventDefault();
       };for (var d = 0; d < c.length;) {
         c[d](b), d++;
       }
     }
   }, destroy: function () {
     this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
   } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
   return hc;
 }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;

}(window, document, "Hammer");;(function (factory) {

 if (typeof define === 'function' && define.amd) {
   define(['jquery', 'hammerjs'], factory);
 } else if (typeof exports === 'object') {
   factory(require('jquery'), require('hammerjs'));
 } else {
   factory(jQuery, Hammer);
 }

})(function ($, Hammer) {

 function hammerify(el, options) {
   var $el = $(el);
   if (!$el.data("hammer")) {
     $el.data("hammer", new Hammer($el[0], options));
   }
 }
 $.fn.hammer = function (options) {
   return this.each(function () {
     hammerify(this, options);
   });
 };
 // extend the emit method to also trigger jQuery events
 Hammer.Manager.prototype.emit = function (originalEmit) {
   return function (type, data) {
     originalEmit.call(this, type, data);
     $(this.element).trigger({
       type: type,
       gesture: data
     });
   };
 }(Hammer.Manager.prototype.emit);

});

// Required for Meteor package, the use of window prevents export by Meteor

(function (window) {

 if (window.Package) {
   Materialize = {};
 } else {
   window.Materialize = {};
 }

})(window);

/*

* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/

(function (window) {

 var lastTime = 0,
     vendors = ['webkit', 'moz'],
     requestAnimationFrame = window.requestAnimationFrame,
     cancelAnimationFrame = window.cancelAnimationFrame,
     i = vendors.length;
 // try to un-prefix existing raf
 while (--i >= 0 && !requestAnimationFrame) {
   requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
   cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
 }
 // polyfill with setTimeout fallback
 // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
 if (!requestAnimationFrame || !cancelAnimationFrame) {
   requestAnimationFrame = function (callback) {
     var now = +Date.now(),
         nextTime = Math.max(lastTime + 16, now);
     return setTimeout(function () {
       callback(lastTime = nextTime);
     }, nextTime - now);
   };
   cancelAnimationFrame = clearTimeout;
 }
 // export to window
 window.requestAnimationFrame = requestAnimationFrame;
 window.cancelAnimationFrame = cancelAnimationFrame;

})(window);

/**

* Generate approximated selector string for a jQuery object
* @param {jQuery} obj  jQuery object to be parsed
* @returns {string}
*/

Materialize.objectSelectorString = function (obj) {

 var tagStr = obj.prop('tagName') || ;
 var idStr = obj.attr('id') || ;
 var classStr = obj.attr('class') || ;
 return (tagStr + idStr + classStr).replace(/\s/g, );

};

// Unique Random ID Materialize.guid = function () {

 function s4() {
   return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
 }
 return function () {
   return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
 };

}();

/**

* Escapes hash from special characters
* @param {string} hash  String returned from this.hash
* @returns {string}
*/

Materialize.escapeHash = function (hash) {

 return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");

};

Materialize.elementOrParentIsFixed = function (element) {

 var $element = $(element);
 var $checkElements = $element.add($element.parents());
 var isFixed = false;
 $checkElements.each(function () {
   if ($(this).css("position") === "fixed") {
     isFixed = true;
     return false;
   }
 });
 return isFixed;

};

/**

* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/

var getTime = Date.now || function () {

 return new Date().getTime();

};

/**

* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/

Materialize.throttle = function (func, wait, options) {

 var context, args, result;
 var timeout = null;
 var previous = 0;
 options || (options = {});
 var later = function () {
   previous = options.leading === false ? 0 : getTime();
   timeout = null;
   result = func.apply(context, args);
   context = args = null;
 };
 return function () {
   var now = getTime();
   if (!previous && options.leading === false) previous = now;
   var remaining = wait - (now - previous);
   context = this;
   args = arguments;
   if (remaining <= 0) {
     clearTimeout(timeout);
     timeout = null;
     previous = now;
     result = func.apply(context, args);
     context = args = null;
   } else if (!timeout && options.trailing !== false) {
     timeout = setTimeout(later, remaining);
   }
   return result;
 };

};

// Velocity has conflicts when loaded with jQuery, this will check for it // First, check if in noConflict mode var Vel; if (jQuery) {

 Vel = jQuery.Velocity;

} else if ($) {

 Vel = $.Velocity;

} else {

 Vel = Velocity;

}

(function ($) {
 $.fn.collapsible = function (options, methodParam) {
   var defaults = {
     accordion: undefined,
     onOpen: undefined,
     onClose: undefined
   };
   var methodName = options;
   options = $.extend(defaults, options);
   return this.each(function () {
     var $this = $(this);
     var $panel_headers = $(this).find('> li > .collapsible-header');
     var collapsible_type = $this.data("collapsible");
     /****************
     Helper Functions
     ****************/
     // Accordion Open
     function accordionOpen(object) {
       $panel_headers = $this.find('> li > .collapsible-header');
       if (object.hasClass('active')) {
         object.parent().addClass('active');
       } else {
         object.parent().removeClass('active');
       }
       if (object.parent().hasClass('active')) {
         object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
             $(this).css('height', );
           } });
       } else {
         object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
             $(this).css('height', );
           } });
       }
       $panel_headers.not(object).removeClass('active').parent().removeClass('active');
       // Close previously open accordion elements.
       $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
         if ($(this).is(':visible')) {
           $(this).slideUp({
             duration: 350,
             easing: "easeOutQuart",
             queue: false,
             complete: function () {
               $(this).css('height', );
               execCallbacks($(this).siblings('.collapsible-header'));
             }
           });
         }
       });
     }
     // Expandable Open
     function expandableOpen(object) {
       if (object.hasClass('active')) {
         object.parent().addClass('active');
       } else {
         object.parent().removeClass('active');
       }
       if (object.parent().hasClass('active')) {
         object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
             $(this).css('height', );
           } });
       } else {
         object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
             $(this).css('height', );
           } });
       }
     }
     // Open collapsible. object: .collapsible-header
     function collapsibleOpen(object, noToggle) {
       if (!noToggle) {
         object.toggleClass('active');
       }
       if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
         // Handle Accordion
         accordionOpen(object);
       } else {
         // Handle Expandables
         expandableOpen(object);
       }
       execCallbacks(object);
     }
     // Handle callbacks
     function execCallbacks(object) {
       if (object.hasClass('active')) {
         if (typeof options.onOpen === "function") {
           options.onOpen.call(this, object.parent());
         }
       } else {
         if (typeof options.onClose === "function") {
           options.onClose.call(this, object.parent());
         }
       }
     }
     /**
      * Check if object is children of panel header
      * @param  {Object}  object Jquery object
      * @return {Boolean} true if it is children
      */
     function isChildrenOfPanelHeader(object) {
       var panelHeader = getPanelHeader(object);
       return panelHeader.length > 0;
     }
     /**
      * Get panel header from a children element
      * @param  {Object} object Jquery object
      * @return {Object} panel header object
      */
     function getPanelHeader(object) {
       return object.closest('li > .collapsible-header');
     }
     // Turn off any existing event handlers
     function removeEventHandlers() {
       $this.off('click.collapse', '> li > .collapsible-header');
     }
     /*****  End Helper Functions  *****/
     // Methods
     if (methodName === 'destroy') {
       removeEventHandlers();
       return;
     } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
       var $curr_header = $panel_headers.eq(methodParam);
       if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
         collapsibleOpen($curr_header);
       }
       return;
     }
     removeEventHandlers();
     // Add click handler to only direct collapsible header children
     $this.on('click.collapse', '> li > .collapsible-header', function (e) {
       var element = $(e.target);
       if (isChildrenOfPanelHeader(element)) {
         element = getPanelHeader(element);
       }
       collapsibleOpen(element);
     });
     // Open first active
     if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
       // Handle Accordion
       collapsibleOpen($panel_headers.filter('.active').first(), true);
     } else {
       // Handle Expandables
       $panel_headers.filter('.active').each(function () {
         collapsibleOpen($(this), true);
       });
     }
   });
 };
 $(document).ready(function () {
   $('.collapsible').collapsible();
 });

})(jQuery);;(function ($) {

 // Add posibility to scroll to selected option
 // usefull for select for example
 $.fn.scrollTo = function (elem) {
   $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
   return this;
 };
 $.fn.dropdown = function (options) {
   var defaults = {
     inDuration: 300,
     outDuration: 225,
     constrainWidth: true, // Constrains width of dropdown to the activator
     hover: false,
     gutter: 0, // Spacing from edge
     belowOrigin: false,
     alignment: 'left',
     stopPropagation: false
   };
   // Open dropdown.
   if (options === "open") {
     this.each(function () {
       $(this).trigger('open');
     });
     return false;
   }
   // Close dropdown.
   if (options === "close") {
     this.each(function () {
       $(this).trigger('close');
     });
     return false;
   }
   this.each(function () {
     var origin = $(this);
     var curr_options = $.extend({}, defaults, options);
     var isFocused = false;
     // Dropdown menu
     var activates = $("#" + origin.attr('data-activates'));
     function updateOptions() {
       if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
       if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
       if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
       if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
       if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
       if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
       if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
       if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
     }
     updateOptions();
     // Attach dropdown to its activator
     origin.after(activates);
     /*
       Helper function to position and resize dropdown.
       Used in hover and click handler.
     */
     function placeDropdown(eventType) {
       // Check for simultaneous focus and click events.
       if (eventType === 'focus') {
         isFocused = true;
       }
       // Check html data attributes
       updateOptions();
       // Set Dropdown state
       activates.addClass('active');
       origin.addClass('active');
       var originWidth = origin[0].getBoundingClientRect().width;
       // Constrain width
       if (curr_options.constrainWidth === true) {
         activates.css('width', originWidth);
       } else {
         activates.css('white-space', 'nowrap');
       }
       // Offscreen detection
       var windowHeight = window.innerHeight;
       var originHeight = origin.innerHeight();
       var offsetLeft = origin.offset().left;
       var offsetTop = origin.offset().top - $(window).scrollTop();
       var currAlignment = curr_options.alignment;
       var gutterSpacing = 0;
       var leftPosition = 0;
       // Below Origin
       var verticalOffset = 0;
       if (curr_options.belowOrigin === true) {
         verticalOffset = originHeight;
       }
       // Check for scrolling positioned container.
       var scrollYOffset = 0;
       var scrollXOffset = 0;
       var wrapper = origin.parent();
       if (!wrapper.is('body')) {
         if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
           scrollYOffset = wrapper[0].scrollTop;
         }
         if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
           scrollXOffset = wrapper[0].scrollLeft;
         }
       }
       if (offsetLeft + activates.innerWidth() > $(window).width()) {
         // Dropdown goes past screen on right, force right alignment
         currAlignment = 'right';
       } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
         // Dropdown goes past screen on left, force left alignment
         currAlignment = 'left';
       }
       // Vertical bottom offscreen detection
       if (offsetTop + activates.innerHeight() > windowHeight) {
         // If going upwards still goes offscreen, just crop height of dropdown.
         if (offsetTop + originHeight - activates.innerHeight() < 0) {
           var adjustedHeight = windowHeight - offsetTop - verticalOffset;
           activates.css('max-height', adjustedHeight);
         } else {
           // Flow upwards.
           if (!verticalOffset) {
             verticalOffset += originHeight;
           }
           verticalOffset -= activates.innerHeight();
         }
       }
       // Handle edge alignment
       if (currAlignment === 'left') {
         gutterSpacing = curr_options.gutter;
         leftPosition = origin.position().left + gutterSpacing;
       } else if (currAlignment === 'right') {
         // Material icons fix
         activates.stop(true, true).css({
           opacity: 0,
           left: 0
         });
         var offsetRight = origin.position().left + originWidth - activates.width();
         gutterSpacing = -curr_options.gutter;
         leftPosition = offsetRight + gutterSpacing;
       }
       // Position dropdown
       activates.css({
         position: 'absolute',
         top: origin.position().top + verticalOffset + scrollYOffset,
         left: leftPosition + scrollXOffset
       });
       // Show dropdown
       activates.slideDown({
         queue: false,
         duration: curr_options.inDuration,
         easing: 'easeOutCubic',
         complete: function () {
           $(this).css('height', );
         }
       }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
       // Add click close handler to document
       setTimeout(function () {
         $(document).on('click.' + activates.attr('id'), function (e) {
           hideDropdown();
           $(document).off('click.' + activates.attr('id'));
         });
       }, 0);
     }
     function hideDropdown() {
       // Check for simultaneous focus and click events.
       isFocused = false;
       activates.fadeOut(curr_options.outDuration);
       activates.removeClass('active');
       origin.removeClass('active');
       $(document).off('click.' + activates.attr('id'));
       setTimeout(function () {
         activates.css('max-height', );
       }, curr_options.outDuration);
     }
     // Hover
     if (curr_options.hover) {
       var open = false;
       origin.off('click.' + origin.attr('id'));
       // Hover handler to show dropdown
       origin.on('mouseenter', function (e) {
         // Mouse over
         if (open === false) {
           placeDropdown();
           open = true;
         }
       });
       origin.on('mouseleave', function (e) {
         // If hover on origin then to something other than dropdown content, then close
         var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
         if (!$(toEl).closest('.dropdown-content').is(activates)) {
           activates.stop(true, true);
           hideDropdown();
           open = false;
         }
       });
       activates.on('mouseleave', function (e) {
         // Mouse out
         var toEl = e.toElement || e.relatedTarget;
         if (!$(toEl).closest('.dropdown-button').is(origin)) {
           activates.stop(true, true);
           hideDropdown();
           open = false;
         }
       });
       // Click
     } else {
       // Click handler to show dropdown
       origin.off('click.' + origin.attr('id'));
       origin.on('click.' + origin.attr('id'), function (e) {
         if (!isFocused) {
           if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
             e.preventDefault(); // Prevents button click from moving window
             if (curr_options.stopPropagation) {
               e.stopPropagation();
             }
             placeDropdown('click');
           }
           // If origin is clicked and menu is open, close menu
           else if (origin.hasClass('active')) {
               hideDropdown();
               $(document).off('click.' + activates.attr('id'));
             }
         }
       });
     } // End else
     // Listen to open and close event - useful for select component
     origin.on('open', function (e, eventType) {
       placeDropdown(eventType);
     });
     origin.on('close', hideDropdown);
   });
 }; // End dropdown plugin
 $(document).ready(function () {
   $('.dropdown-button').dropdown();
 });

})(jQuery);

(function ($) {
 'use strict';
 var _defaults = {
   opacity: 0.5,
   inDuration: 250,
   outDuration: 250,
   ready: undefined,
   complete: undefined,
   dismissible: true,
   startingTop: '4%',
   endingTop: '10%'
 };
 /**
  * @class
  *
  */
 var Modal = function () {
   /**
    * Construct Modal instance and set up overlay
    * @constructor
    * @param {jQuery} $el
    * @param {Object} options
    */
   function Modal($el, options) {
     _classCallCheck(this, Modal);
     // If exists, destroy and reinitialize
     if (!!$el[0].M_Modal) {
       $el[0].M_Modal.destroy();
     }
     /**
      * The jQuery element
      * @type {jQuery}
      */
     this.$el = $el;
     /**
      * Options for the modal
      * @member Modal#options
      * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
      * @prop {Number} [inDuration=250] - Length in ms of enter transition
      * @prop {Number} [outDuration=250] - Length in ms of exit transition
      * @prop {Function} ready - Callback function called when modal is finished entering
      * @prop {Function} complete - Callback function called when modal is finished exiting
      * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
      * @prop {String} [startingTop='4%'] - startingTop
      * @prop {String} [endingTop='10%'] - endingTop
      */
     this.options = $.extend({}, Modal.defaults, options);
     /**
      * Describes open/close state of modal
      * @type {Boolean}
      */
     this.isOpen = false;
     this.$el[0].M_Modal = this;
     this.id = $el.attr('id');
     this.openingTrigger = undefined;
this.$overlay = $('');
     Modal._increment++;
     Modal._count++;
     this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
     this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
     this.setupEventHandlers();
   }
   _createClass(Modal, [{
     key: 'getInstance',


     /**
      * Get Instance
      */
     value: function getInstance() {
       return this;
     }
     /**
      * Teardown component
      */
   }, {
     key: 'destroy',
     value: function destroy() {
       this.removeEventHandlers();
       this.$el[0].removeAttribute('style');
       if (!!this.$overlay[0].parentNode) {
         this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
       }
       this.$el[0].M_Modal = undefined;
       Modal._count--;
     }
     /**
      * Setup Event Handlers
      */
   }, {
     key: 'setupEventHandlers',
     value: function setupEventHandlers() {
       this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
       this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
       if (Modal._count === 1) {
         document.addEventListener('click', this.handleTriggerClick);
       }
       this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
       this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
     }
     /**
      * Remove Event Handlers
      */
   }, {
     key: 'removeEventHandlers',
     value: function removeEventHandlers() {
       if (Modal._count === 0) {
         document.removeEventListener('click', this.handleTriggerClick);
       }
       this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
       this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
     }
     /**
      * Handle Trigger Click
      * @param {Event} e
      */
   }, {
     key: 'handleTriggerClick',
     value: function handleTriggerClick(e) {
       var $trigger = $(e.target).closest('.modal-trigger');
       if (e.target && $trigger.length) {
         var modalId = $trigger[0].getAttribute('href');
         if (modalId) {
           modalId = modalId.slice(1);
         } else {
           modalId = $trigger[0].getAttribute('data-target');
         }
         var modalInstance = document.getElementById(modalId).M_Modal;
         if (modalInstance) {
           modalInstance.open($trigger);
         }
         e.preventDefault();
       }
     }
     /**
      * Handle Overlay Click
      */
   }, {
     key: 'handleOverlayClick',
     value: function handleOverlayClick() {
       if (this.options.dismissible) {
         this.close();
       }
     }
     /**
      * Handle Modal Close Click
      * @param {Event} e
      */
   }, {
     key: 'handleModalCloseClick',
     value: function handleModalCloseClick(e) {
       var $closeTrigger = $(e.target).closest('.modal-close');
       if (e.target && $closeTrigger.length) {
         this.close();
       }
     }
     /**
      * Handle Keydown
      * @param {Event} e
      */
   }, {
     key: 'handleKeydown',
     value: function handleKeydown(e) {
       // ESC key
       if (e.keyCode === 27 && this.options.dismissible) {
         this.close();
       }
     }
     /**
      * Animate in modal
      */
   }, {
     key: 'animateIn',
     value: function animateIn() {
       var _this = this;
       // Set initial styles
       $.extend(this.$el[0].style, {
         display: 'block',
         opacity: 0
       });
       $.extend(this.$overlay[0].style, {
         display: 'block',
         opacity: 0
       });
       // Animate overlay
       Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
       // Define modal animation options
       var enterVelocityOptions = {
         duration: this.options.inDuration,
         queue: false,
         ease: 'easeOutCubic',
         // Handle modal ready callback
         complete: function () {
           if (typeof _this.options.ready === 'function') {
             _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
           }
         }
       };
       // Bottom sheet animation
       if (this.$el[0].classList.contains('bottom-sheet')) {
         Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
         // Normal modal animation
       } else {
         Vel.hook(this.$el[0], 'scaleX', 0.7);
         this.$el[0].style.top = this.options.startingTop;
         Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
       }
     }
     /**
      * Animate out modal
      */
   }, {
     key: 'animateOut',
     value: function animateOut() {
       var _this2 = this;
       // Animate overlay
       Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
       // Define modal animation options
       var exitVelocityOptions = {
         duration: this.options.outDuration,
         queue: false,
         ease: 'easeOutCubic',
         // Handle modal ready callback
         complete: function () {
           _this2.$el[0].style.display = 'none';
           // Call complete callback
           if (typeof _this2.options.complete === 'function') {
             _this2.options.complete.call(_this2, _this2.$el);
           }
           _this2.$overlay[0].remove();
         }
       };
       // Bottom sheet animation
       if (this.$el[0].classList.contains('bottom-sheet')) {
         Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
         // Normal modal animation
       } else {
         Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
       }
     }
     /**
      * Open Modal
      * @param {jQuery} [$trigger]
      */
   }, {
     key: 'open',
     value: function open($trigger) {
       if (this.isOpen) {
         return;
       }
       this.isOpen = true;
       var body = document.body;
       body.style.overflow = 'hidden';
       this.$el[0].classList.add('open');
       body.appendChild(this.$overlay[0]);
       // Set opening trigger, undefined indicates modal was opened by javascript
       this.openingTrigger = !!$trigger ? $trigger : undefined;
       if (this.options.dismissible) {
         this.handleKeydownBound = this.handleKeydown.bind(this);
         document.addEventListener('keydown', this.handleKeydownBound);
       }
       this.animateIn();
       return this;
     }
     /**
      * Close Modal
      */
   }, {
     key: 'close',
     value: function close() {
       if (!this.isOpen) {
         return;
       }
       this.isOpen = false;
       this.$el[0].classList.remove('open');
       document.body.style.overflow = null;
       if (this.options.dismissible) {
         document.removeEventListener('keydown', this.handleKeydownBound);
       }
       this.animateOut();
       return this;
     }
   }], [{
     key: 'init',
     value: function init($els, options) {
       var arr = [];
       $els.each(function () {
         arr.push(new Modal($(this), options));
       });
       return arr;
     }
   }, {
     key: 'defaults',
     get: function () {
       return _defaults;
     }
   }]);
   return Modal;
 }();
 /**
  * @static
  * @memberof Modal
  */


 Modal._increment = 0;
 /**
  * @static
  * @memberof Modal
  */
 Modal._count = 0;
 window.Materialize.Modal = Modal;
 $.fn.modal = function (methodOrOptions) {
   // Call plugin method if valid method name is passed in
   if (Modal.prototype[methodOrOptions]) {
     // Getter methods
     if (methodOrOptions.slice(0, 3) === 'get') {
       return this.first()[0].M_Modal[methodOrOptions]();
       // Void methods
     } else {
       return this.each(function () {
         this.M_Modal[methodOrOptions]();
       });
     }
     // Initialize plugin if options or no argument is passed in
   } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
     Modal.init(this, arguments[0]);
     return this;
     // Return error if an unrecognized  method name is passed in
   } else {
     $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
   }
 };

})(jQuery);

(function ($) {
 $.fn.materialbox = function () {
   return this.each(function () {
     if ($(this).hasClass('initialized')) {
       return;
     }
     $(this).addClass('initialized');
     var overlayActive = false;
     var doneAnimating = true;
     var inDuration = 275;
     var outDuration = 200;
     var origin = $(this);
var placeholder = $('
').addClass('material-placeholder');
     var originalWidth = 0;
     var originalHeight = 0;
     var ancestorsChanged;
     var ancestor;
     var originInlineStyles = origin.attr('style');
     origin.wrap(placeholder);
     // Start click handler
     origin.on('click', function () {
       var placeholder = origin.parent('.material-placeholder');
       var windowWidth = window.innerWidth;
       var windowHeight = window.innerHeight;
       var originalWidth = origin.width();
       var originalHeight = origin.height();
       // If already modal, return to original
       if (doneAnimating === false) {
         returnToOriginal();
         return false;
       } else if (overlayActive && doneAnimating === true) {
         returnToOriginal();
         return false;
       }
       // Set states
       doneAnimating = false;
       origin.addClass('active');
       overlayActive = true;
       // Set positioning for placeholder
       placeholder.css({
         width: placeholder[0].getBoundingClientRect().width,
         height: placeholder[0].getBoundingClientRect().height,
         position: 'relative',
         top: 0,
         left: 0
       });
       // Find ancestor with overflow: hidden; and remove it
       ancestorsChanged = undefined;
       ancestor = placeholder[0].parentNode;
       var count = 0;
       while (ancestor !== null && !$(ancestor).is(document)) {
         var curr = $(ancestor);
         if (curr.css('overflow') !== 'visible') {
           curr.css('overflow', 'visible');
           if (ancestorsChanged === undefined) {
             ancestorsChanged = curr;
           } else {
             ancestorsChanged = ancestorsChanged.add(curr);
           }
         }
         ancestor = ancestor.parentNode;
       }
       // Set css on origin
       origin.css({
         position: 'absolute',
         'z-index': 1000,
         'will-change': 'left, top, width, height'
       }).data('width', originalWidth).data('height', originalHeight);
       // Add overlay
var overlay = $('
').css({
         opacity: 0
       }).click(function () {
         if (doneAnimating === true) returnToOriginal();
       });
       // Put before in origin image to preserve z-index layering.
       origin.before(overlay);
       // Set dimensions if needed
       var overlayOffset = overlay[0].getBoundingClientRect();
       overlay.css({
         width: windowWidth,
         height: windowHeight,
         left: -1 * overlayOffset.left,
         top: -1 * overlayOffset.top
       });
       // Animate Overlay
       overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
       // Add and animate caption if it exists
       if (origin.data('caption') !== "") {
var $photo_caption = $('
');
         $photo_caption.text(origin.data('caption'));
         $('body').append($photo_caption);
         $photo_caption.css({ "display": "inline" });
         $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
       }
       // Resize Image
       var ratio = 0;
       var widthPercent = originalWidth / windowWidth;
       var heightPercent = originalHeight / windowHeight;
       var newWidth = 0;
       var newHeight = 0;
       if (widthPercent > heightPercent) {
         ratio = originalHeight / originalWidth;
         newWidth = windowWidth * 0.9;
         newHeight = windowWidth * 0.9 * ratio;
       } else {
         ratio = originalWidth / originalHeight;
         newWidth = windowHeight * 0.9 * ratio;
         newHeight = windowHeight * 0.9;
       }
       // Animate image + set z-index
       if (origin.hasClass('responsive-img')) {
         origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
           complete: function () {
             origin.css({ left: 0, top: 0 }).velocity({
               height: newHeight,
               width: newWidth,
               left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
               top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
             }, {
               duration: inDuration,
               queue: false,
               easing: 'easeOutQuad',
               complete: function () {
                 doneAnimating = true;
               }
             });
           } // End Complete
         }); // End Velocity
       } else {
         origin.css('left', 0).css('top', 0).velocity({
           height: newHeight,
           width: newWidth,
           left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
           top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
         }, {
           duration: inDuration,
           queue: false,
           easing: 'easeOutQuad',
           complete: function () {
             doneAnimating = true;
           }
         }); // End Velocity
       }
       // Handle Exit triggers
       $(window).on('scroll.materialbox', function () {
         if (overlayActive) {
           returnToOriginal();
         }
       });
       $(window).on('resize.materialbox', function () {
         if (overlayActive) {
           returnToOriginal();
         }
       });
       $(document).on('keyup.materialbox', function (e) {
         // ESC key
         if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
           returnToOriginal();
         }
       });
     }); // End click handler


     // This function returns the modaled image to the original spot
     function returnToOriginal() {
       doneAnimating = false;
       var placeholder = origin.parent('.material-placeholder');
       var windowWidth = window.innerWidth;
       var windowHeight = window.innerHeight;
       var originalWidth = origin.data('width');
       var originalHeight = origin.data('height');
       origin.velocity("stop", true);
       $('#materialbox-overlay').velocity("stop", true);
       $('.materialbox-caption').velocity("stop", true);
       // disable exit handlers
       $(window).off('scroll.materialbox');
       $(document).off('keyup.materialbox');
       $(window).off('resize.materialbox');
       $('#materialbox-overlay').velocity({ opacity: 0 }, {
         duration: outDuration, // Delay prevents animation overlapping
         queue: false, easing: 'easeOutQuad',
         complete: function () {
           // Remove Overlay
           overlayActive = false;
           $(this).remove();
         }
       });
       // Resize Image
       origin.velocity({
         width: originalWidth,
         height: originalHeight,
         left: 0,
         top: 0
       }, {
         duration: outDuration,
         queue: false, easing: 'easeOutQuad',
         complete: function () {
           placeholder.css({
             height: ,
             width: ,
             position: ,
             top: ,
             left: 
           });
             console.log(originInlineStyles);
           origin.removeAttr('style');
           origin.attr('style', originInlineStyles);
           // Remove class
           origin.removeClass('active');
           doneAnimating = true;
           // Remove overflow overrides on ancestors
           if (ancestorsChanged) {
             ancestorsChanged.css('overflow', );
           }
         }
       });
       // Remove Caption + reset css settings on image
       $('.materialbox-caption').velocity({ opacity: 0 }, {
         duration: outDuration, // Delay prevents animation overlapping
         queue: false, easing: 'easeOutQuad',
         complete: function () {
           $(this).remove();
         }
       });
     }
   });
 };
 $(document).ready(function () {
   $('.materialboxed').materialbox();
 });

})(jQuery);

(function ($) {
 $.fn.parallax = function () {
   var window_width = $(window).width();
   // Parallax Scripts
   return this.each(function (i) {
     var $this = $(this);
     $this.addClass('parallax');
     function updateParallax(initial) {
       var container_height;
       if (window_width < 601) {
         container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
       } else {
         container_height = $this.height() > 0 ? $this.height() : 500;
       }
       var $img = $this.children("img").first();
       var img_height = $img.height();
       var parallax_dist = img_height - container_height;
       var bottom = $this.offset().top + container_height;
       var top = $this.offset().top;
       var scrollTop = $(window).scrollTop();
       var windowHeight = window.innerHeight;
       var windowBottom = scrollTop + windowHeight;
       var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
       var parallax = Math.round(parallax_dist * percentScrolled);
       if (initial) {
         $img.css('display', 'block');
       }
       if (bottom > scrollTop && top < scrollTop + windowHeight) {
         $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
       }
     }
     // Wait for image load
     $this.children("img").one("load", function () {
       updateParallax(true);
     }).each(function () {
       if (this.complete) $(this).trigger("load");
     });
     $(window).scroll(function () {
       window_width = $(window).width();
       updateParallax(false);
     });
     $(window).resize(function () {
       window_width = $(window).width();
       updateParallax(false);
     });
   });
 };

})(jQuery);

(function ($) {
 var methods = {
   init: function (options) {
     var defaults = {
       onShow: null,
       swipeable: false,
       responsiveThreshold: Infinity // breakpoint for swipeable
     };
     options = $.extend(defaults, options);
     var namespace = Materialize.objectSelectorString($(this));
     return this.each(function (i) {
       var uniqueNamespace = namespace + i;
       // For each set of tabs, we want to keep track of
       // which tab is active and its associated content
       var $this = $(this),
           window_width = $(window).width();
       var $active,
           $content,
           $links = $this.find('li.tab a'),
           $tabs_width = $this.width(),
           $tabs_content = $(),
           $tabs_wrapper,
           $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
           $indicator,
           index = prev_index = 0,
           clicked = false,
           clickedTimeout,
           transition = 300;
       // Finds right attribute for indicator based on active tab.
       // el: jQuery Object
       var calcRightPos = function (el) {
         return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
       };
       // Finds left attribute for indicator based on active tab.
       // el: jQuery Object
       var calcLeftPos = function (el) {
         return Math.floor(el.position().left + $this.scrollLeft());
       };
       // Animates Indicator to active tab.
       // prev_index: Number
       var animateIndicator = function (prev_index) {
         if (index - prev_index >= 0) {
           $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
           $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
         } else {
           $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
           $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
         }
       };
       // Change swipeable according to responsive threshold
       if (options.swipeable) {
         if (window_width > options.responsiveThreshold) {
           options.swipeable = false;
         }
       }
       // If the location.hash matches one of the links, use that as the active tab.
       $active = $($links.filter('[href="' + location.hash + '"]'));
       // If no match is found, use the first link or any with class 'active' as the initial active tab.
       if ($active.length === 0) {
         $active = $(this).find('li.tab a.active').first();
       }
       if ($active.length === 0) {
         $active = $(this).find('li.tab a').first();
       }
       $active.addClass('active');
       index = $links.index($active);
       if (index < 0) {
         index = 0;
       }
       if ($active[0] !== undefined) {
         $content = $($active[0].hash);
         $content.addClass('active');
       }
       // append indicator then set indicator width to tab width
       if (!$this.find('.indicator').length) {
$this.append('
  • ');
           }
           $indicator = $this.find('.indicator');
    
           // we make sure that the indicator is at the end of the tabs
           $this.append($indicator);
    
           if ($this.is(":visible")) {
             // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
             // $indicator.css({"left": index * $tab_width});
             setTimeout(function () {
               $indicator.css({ "right": calcRightPos($active) });
               $indicator.css({ "left": calcLeftPos($active) });
             }, 0);
           }
           $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
             $tabs_width = $this.width();
             $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
             if (index < 0) {
               index = 0;
             }
             if ($tab_width !== 0 && $tabs_width !== 0) {
               $indicator.css({ "right": calcRightPos($active) });
               $indicator.css({ "left": calcLeftPos($active) });
             }
           });
    
           // Initialize Tabs Content.
           if (options.swipeable) {
             // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
             $links.each(function () {
               var $curr_content = $(Materialize.escapeHash(this.hash));
               $curr_content.addClass('carousel-item');
               $tabs_content = $tabs_content.add($curr_content);
             });
    
    $tabs_wrapper = $tabs_content.wrapAll('');
             $tabs_content.css('display', );
             $('.tabs-content.carousel').carousel({
               fullWidth: true,
               noWrap: true,
               onCycleTo: function (item) {
                 if (!clicked) {
                   var prev_index = index;
                   index = $tabs_wrapper.index(item);
                   $active.removeClass('active');
                   $active = $links.eq(index);
                   $active.addClass('active');
                   animateIndicator(prev_index);
                   if (typeof options.onShow === "function") {
                     options.onShow.call($this[0], $content);
                   }
                 }
               }
             });
           } else {
             // Hide the remaining content
             $links.not($active).each(function () {
               $(Materialize.escapeHash(this.hash)).hide();
             });
           }
    
           // Bind the click event handler
           $this.off('click.tabs').on('click.tabs', 'a', function (e) {
             if ($(this).parent().hasClass('disabled')) {
               e.preventDefault();
               return;
             }
    
             // Act as regular link if target attribute is specified.
             if (!!$(this).attr("target")) {
               return;
             }
    
             clicked = true;
             $tabs_width = $this.width();
             $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
    
             // Make the old tab inactive.
             $active.removeClass('active');
             var $oldContent = $content;
    
             // Update the variables with the new link and content
             $active = $(this);
             $content = $(Materialize.escapeHash(this.hash));
             $links = $this.find('li.tab a');
             var activeRect = $active.position();
    
             // Make the tab active.
             $active.addClass('active');
             prev_index = index;
             index = $links.index($(this));
             if (index < 0) {
               index = 0;
             }
             // Change url to current tab
             // window.location.hash = $active.attr('href');
    
             // Swap content
             if (options.swipeable) {
               if ($tabs_content.length) {
                 $tabs_content.carousel('set', index, function () {
                   if (typeof options.onShow === "function") {
                     options.onShow.call($this[0], $content);
                   }
                 });
               }
             } else {
               if ($content !== undefined) {
                 $content.show();
                 $content.addClass('active');
                 if (typeof options.onShow === "function") {
                   options.onShow.call(this, $content);
                 }
               }
    
               if ($oldContent !== undefined && !$oldContent.is($content)) {
                 $oldContent.hide();
                 $oldContent.removeClass('active');
               }
             }
    
             // Reset clicked state
             clickedTimeout = setTimeout(function () {
               clicked = false;
             }, transition);
    
             // Update indicator
             animateIndicator(prev_index);
    
             // Prevent the anchor's default click action
             e.preventDefault();
           });
         });
       },
       select_tab: function (id) {
         this.find('a[href="#' + id + '"]').trigger('click');
       }
     };
    
     $.fn.tabs = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
         return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
         // Default to "init"
         return methods.init.apply(this, arguments);
       } else {
         $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
       }
     };
    
     $(document).ready(function () {
       $('ul.tabs').tabs();
     });
    

    })(jQuery);

    (function ($) {
     $.fn.tooltip = function (options) {
       var timeout = null,
           margin = 5;
    
       // Defaults
       var defaults = {
         delay: 350,
         tooltip: ,
         position: 'bottom',
         html: false
       };
    
       // Remove tooltip from the activator
       if (options === "remove") {
         this.each(function () {
           $('#' + $(this).attr('data-tooltip-id')).remove();
           $(this).removeAttr('data-tooltip-id');
           $(this).off('mouseenter.tooltip mouseleave.tooltip');
         });
         return false;
       }
    
       options = $.extend(defaults, options);
    
       return this.each(function () {
         var tooltipId = Materialize.guid();
         var origin = $(this);
    
         // Destroy old tooltip
         if (origin.attr('data-tooltip-id')) {
           $('#' + origin.attr('data-tooltip-id')).remove();
         }
    
         origin.attr('data-tooltip-id', tooltipId);
    
         // Get attributes.
         var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
         var setAttributes = function () {
           allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
           tooltipDelay = origin.attr('data-delay');
           tooltipDelay = tooltipDelay === undefined || tooltipDelay ===  ? options.delay : tooltipDelay;
           tooltipPosition = origin.attr('data-position');
           tooltipPosition = tooltipPosition === undefined || tooltipPosition ===  ? options.position : tooltipPosition;
           tooltipText = origin.attr('data-tooltip');
           tooltipText = tooltipText === undefined || tooltipText ===  ? options.tooltip : tooltipText;
         };
         setAttributes();
    
         var renderTooltipEl = function () {
    
    var tooltip = $('
    ');
           // Create Text span
           if (allowHtml) {
             tooltipText = $('').html(tooltipText);
           } else {
             tooltipText = $('').text(tooltipText);
           }
    
           // Create tooltip
           tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
    
           // Create backdrop
    
    backdrop = $('
    ');
           backdrop.appendTo(tooltip);
           return tooltip;
         };
         tooltipEl = renderTooltipEl();
    
         // Destroy previously binded events
         origin.off('mouseenter.tooltip mouseleave.tooltip');
         // Mouse In
         var started = false,
             timeoutRef;
         origin.on({ 'mouseenter.tooltip': function (e) {
             var showTooltip = function () {
               setAttributes();
               started = true;
               tooltipEl.velocity('stop');
               backdrop.velocity('stop');
               tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
    
               // Tooltip positioning
               var originWidth = origin.outerWidth();
               var originHeight = origin.outerHeight();
               var tooltipHeight = tooltipEl.outerHeight();
               var tooltipWidth = tooltipEl.outerWidth();
               var tooltipVerticalMovement = '0px';
               var tooltipHorizontalMovement = '0px';
               var backdropOffsetWidth = backdrop[0].offsetWidth;
               var backdropOffsetHeight = backdrop[0].offsetHeight;
               var scaleXFactor = 8;
               var scaleYFactor = 8;
               var scaleFactor = 0;
               var targetTop, targetLeft, newCoordinates;
    
               if (tooltipPosition === "top") {
                 // Top Position
                 targetTop = origin.offset().top - tooltipHeight - margin;
                 targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                 newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                 tooltipVerticalMovement = '-10px';
                 backdrop.css({
                   bottom: 0,
                   left: 0,
                   borderRadius: '14px 14px 0 0',
                   transformOrigin: '50% 100%',
                   marginTop: tooltipHeight,
                   marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
                 });
               }
               // Left Position
               else if (tooltipPosition === "left") {
                   targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                   targetLeft = origin.offset().left - tooltipWidth - margin;
                   newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
    
                   tooltipHorizontalMovement = '-10px';
                   backdrop.css({
                     top: '-7px',
                     right: 0,
                     width: '14px',
                     height: '14px',
                     borderRadius: '14px 0 0 14px',
                     transformOrigin: '95% 50%',
                     marginTop: tooltipHeight / 2,
                     marginLeft: tooltipWidth
                   });
                 }
                 // Right Position
                 else if (tooltipPosition === "right") {
                     targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                     targetLeft = origin.offset().left + originWidth + margin;
                     newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
    
                     tooltipHorizontalMovement = '+10px';
                     backdrop.css({
                       top: '-7px',
                       left: 0,
                       width: '14px',
                       height: '14px',
                       borderRadius: '0 14px 14px 0',
                       transformOrigin: '5% 50%',
                       marginTop: tooltipHeight / 2,
                       marginLeft: '0px'
                     });
                   } else {
                     // Bottom Position
                     targetTop = origin.offset().top + origin.outerHeight() + margin;
                     targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                     newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                     tooltipVerticalMovement = '+10px';
                     backdrop.css({
                       top: 0,
                       left: 0,
                       marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
                     });
                   }
    
               // Set tooptip css placement
               tooltipEl.css({
                 top: newCoordinates.y,
                 left: newCoordinates.x
               });
    
               // Calculate Scale to fill
               scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
               scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
               scaleFactor = Math.max(scaleXFactor, scaleYFactor);
    
               tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
               backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
             };
    
             timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
    
             // Mouse Out
           },
           'mouseleave.tooltip': function () {
             // Reset State
             started = false;
             clearTimeout(timeoutRef);
    
             // Animate back
             setTimeout(function () {
               if (started !== true) {
                 tooltipEl.velocity({
                   opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
                 backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
                   duration: 225,
                   queue: false,
                   complete: function () {
                     backdrop.css({ visibility: 'hidden' });
                     tooltipEl.css({ visibility: 'hidden' });
                     started = false;
                   }
                 });
               }
             }, 225);
           }
         });
       });
     };
    
     var repositionWithinScreen = function (x, y, width, height) {
       var newX = x;
       var newY = y;
    
       if (newX < 0) {
         newX = 4;
       } else if (newX + width > window.innerWidth) {
         newX -= newX + width - window.innerWidth;
       }
    
       if (newY < 0) {
         newY = 4;
       } else if (newY + height > window.innerHeight + $(window).scrollTop) {
         newY -= newY + height - window.innerHeight;
       }
    
       return { x: newX, y: newY };
     };
    
     $(document).ready(function () {
       $('.tooltipped').tooltip();
     });
    

    })(jQuery);

    /*!
     * Waves v0.6.4
     * http://fian.my.id/Waves
     *
     * Copyright 2014 Alfiana E. Sibuea and other contributors
     * Released under the MIT license
     * https://github.com/fians/Waves/blob/master/LICENSE
     */
    
    (function (window) {
     'use strict';
    
     var Waves = Waves || {};
     var $$ = document.querySelectorAll.bind(document);
    
     // Find exact position of element
     function isWindow(obj) {
       return obj !== null && obj === obj.window;
     }
    
     function getWindow(elem) {
       return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
     }
    
     function offset(elem) {
       var docElem,
           win,
           box = { top: 0, left: 0 },
           doc = elem && elem.ownerDocument;
    
       docElem = doc.documentElement;
    
       if (typeof elem.getBoundingClientRect !== typeof undefined) {
         box = elem.getBoundingClientRect();
       }
       win = getWindow(doc);
       return {
         top: box.top + win.pageYOffset - docElem.clientTop,
         left: box.left + win.pageXOffset - docElem.clientLeft
       };
     }
    
     function convertStyle(obj) {
       var style = ;
    
       for (var a in obj) {
         if (obj.hasOwnProperty(a)) {
           style += a + ':' + obj[a] + ';';
         }
       }
    
       return style;
     }
    
     var Effect = {
    
       // Effect delay
       duration: 750,
    
       show: function (e, element) {
    
         // Disable right click
         if (e.button === 2) {
           return false;
         }
    
         var el = element || this;
    
         // Create ripple
         var ripple = document.createElement('div');
         ripple.className = 'waves-ripple';
         el.appendChild(ripple);
    
         // Get click coordinate and element witdh
         var pos = offset(el);
         var relativeY = e.pageY - pos.top;
         var relativeX = e.pageX - pos.left;
         var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
    
         // Support for touch devices
         if ('touches' in e) {
           relativeY = e.touches[0].pageY - pos.top;
           relativeX = e.touches[0].pageX - pos.left;
         }
    
         // Attach data to element
         ripple.setAttribute('data-hold', Date.now());
         ripple.setAttribute('data-scale', scale);
         ripple.setAttribute('data-x', relativeX);
         ripple.setAttribute('data-y', relativeY);
    
         // Set ripple position
         var rippleStyle = {
           'top': relativeY + 'px',
           'left': relativeX + 'px'
         };
    
         ripple.className = ripple.className + ' waves-notransition';
         ripple.setAttribute('style', convertStyle(rippleStyle));
         ripple.className = ripple.className.replace('waves-notransition', );
    
         // Scale the ripple
         rippleStyle['-webkit-transform'] = scale;
         rippleStyle['-moz-transform'] = scale;
         rippleStyle['-ms-transform'] = scale;
         rippleStyle['-o-transform'] = scale;
         rippleStyle.transform = scale;
         rippleStyle.opacity = '1';
    
         rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
         rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
         rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
         rippleStyle['transition-duration'] = Effect.duration + 'ms';
    
         rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
         rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
         rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
         rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
    
         ripple.setAttribute('style', convertStyle(rippleStyle));
       },
    
       hide: function (e) {
         TouchHandler.touchup(e);
    
         var el = this;
         var width = el.clientWidth * 1.4;
    
         // Get first ripple
         var ripple = null;
         var ripples = el.getElementsByClassName('waves-ripple');
         if (ripples.length > 0) {
           ripple = ripples[ripples.length - 1];
         } else {
           return false;
         }
    
         var relativeX = ripple.getAttribute('data-x');
         var relativeY = ripple.getAttribute('data-y');
         var scale = ripple.getAttribute('data-scale');
    
         // Get delay beetween mousedown and mouse leave
         var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
         var delay = 350 - diff;
    
         if (delay < 0) {
           delay = 0;
         }
    
         // Fade out ripple after delay
         setTimeout(function () {
           var style = {
             'top': relativeY + 'px',
             'left': relativeX + 'px',
             'opacity': '0',
    
             // Duration
             '-webkit-transition-duration': Effect.duration + 'ms',
             '-moz-transition-duration': Effect.duration + 'ms',
             '-o-transition-duration': Effect.duration + 'ms',
             'transition-duration': Effect.duration + 'ms',
             '-webkit-transform': scale,
             '-moz-transform': scale,
             '-ms-transform': scale,
             '-o-transform': scale,
             'transform': scale
           };
    
           ripple.setAttribute('style', convertStyle(style));
    
           setTimeout(function () {
             try {
               el.removeChild(ripple);
             } catch (e) {
               return false;
             }
           }, Effect.duration);
         }, delay);
       },
    
       // Little hack to make <input> can perform waves effect
       wrapInput: function (elements) {
         for (var a = 0; a < elements.length; a++) {
           var el = elements[a];
    
           if (el.tagName.toLowerCase() === 'input') {
             var parent = el.parentNode;
    
             // If input already have parent just pass through
             if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
               continue;
             }
    
             // Put element class and style to the specified parent
             var wrapper = document.createElement('i');
             wrapper.className = el.className + ' waves-input-wrapper';
    
             var elementStyle = el.getAttribute('style');
    
             if (!elementStyle) {
               elementStyle = ;
             }
    
             wrapper.setAttribute('style', elementStyle);
    
             el.className = 'waves-button-input';
             el.removeAttribute('style');
    
             // Put element as child
             parent.replaceChild(wrapper, el);
             wrapper.appendChild(el);
           }
         }
       }
     };
    
     /**
      * Disable mousedown event for 500ms during and after touch
      */
     var TouchHandler = {
       /* uses an integer rather than bool so there's no issues with
        * needing to clear timeouts if another touch event occurred
        * within the 500ms. Cannot mouseup between touchstart and
        * touchend, nor in the 500ms after touchend. */
       touches: 0,
       allowEvent: function (e) {
         var allow = true;
    
         if (e.type === 'touchstart') {
           TouchHandler.touches += 1; //push
         } else if (e.type === 'touchend' || e.type === 'touchcancel') {
           setTimeout(function () {
             if (TouchHandler.touches > 0) {
               TouchHandler.touches -= 1; //pop after 500ms
             }
           }, 500);
         } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
           allow = false;
         }
    
         return allow;
       },
       touchup: function (e) {
         TouchHandler.allowEvent(e);
       }
     };
    
     /**
      * Delegated click handler for .waves-effect element.
      * returns null when .waves-effect element not in "click tree"
      */
     function getWavesEffectElement(e) {
       if (TouchHandler.allowEvent(e) === false) {
         return null;
       }
    
       var element = null;
       var target = e.target || e.srcElement;
    
       while (target.parentNode !== null) {
         if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
           element = target;
           break;
         }
         target = target.parentNode;
       }
       return element;
     }
    
     /**
      * Bubble the click and show effect if .waves-effect elem was found
      */
     function showEffect(e) {
       var element = getWavesEffectElement(e);
    
       if (element !== null) {
         Effect.show(e, element);
    
         if ('ontouchstart' in window) {
           element.addEventListener('touchend', Effect.hide, false);
           element.addEventListener('touchcancel', Effect.hide, false);
         }
    
         element.addEventListener('mouseup', Effect.hide, false);
         element.addEventListener('mouseleave', Effect.hide, false);
         element.addEventListener('dragend', Effect.hide, false);
       }
     }
    
     Waves.displayEffect = function (options) {
       options = options || {};
    
       if ('duration' in options) {
         Effect.duration = options.duration;
       }
    
       //Wrap input inside  tag
       Effect.wrapInput($$('.waves-effect'));
    
       if ('ontouchstart' in window) {
         document.body.addEventListener('touchstart', showEffect, false);
       }
    
       document.body.addEventListener('mousedown', showEffect, false);
     };
    
     /**
      * Attach Waves to an input element (or any element which doesn't
      * bubble mouseup/mousedown events).
      *   Intended to be used with dynamically loaded forms/inputs, or
      * where the user doesn't want a delegated click handler.
      */
     Waves.attach = function (element) {
       //FUTURE: automatically add waves classes and allow users
       // to specify them with an options param? Eg. light/classic/button
       if (element.tagName.toLowerCase() === 'input') {
         Effect.wrapInput([element]);
         element = element.parentNode;
       }
    
       if ('ontouchstart' in window) {
         element.addEventListener('touchstart', showEffect, false);
       }
    
       element.addEventListener('mousedown', showEffect, false);
     };
    
     window.Waves = Waves;
    
     document.addEventListener('DOMContentLoaded', function () {
       Waves.displayEffect();
     }, false);
    

    })(window);

    (function ($) {
     'use strict';
    
     var _defaults = {
       displayLength: Infinity,
       inDuration: 300,
       outDuration: 375,
       className: undefined,
       completeCallback: undefined,
       activationPercent: 0.8
     };
    
     var Toast = function () {
       function Toast(message, displayLength, className, completeCallback) {
         _classCallCheck(this, Toast);
    
         if (!message) {
           return;
         }
    
         /**
          * Options for the toast
          * @member Toast#options
          */
         this.options = {
           displayLength: displayLength,
           className: className,
           completeCallback: completeCallback
         };
    
         this.options = $.extend({}, Toast.defaults, this.options);
         this.message = message;
    
         /**
          * Describes current pan state toast
          * @type {Boolean}
          */
         this.panning = false;
    
         /**
          * Time remaining until toast is removed
          */
         this.timeRemaining = this.options.displayLength;
    
         if (Toast._toasts.length === 0) {
           Toast._createContainer();
         }
    
         // Create new toast
         Toast._toasts.push(this);
         var toastElement = this.createToast();
         toastElement.M_Toast = this;
         this.el = toastElement;
         this._animateIn();
         this.setTimer();
       }
    
       _createClass(Toast, [{
         key: 'createToast',
    


         /**
          * Create toast and append it to toast container
          */
         value: function createToast() {
           var toast = document.createElement('div');
           toast.classList.add('toast');
    
           // Add custom classes onto toast
           if (this.options.className) {
             var classes = this.options.className.split(' ');
             var i = void 0,
                 count = void 0;
             for (i = 0, count = classes.length; i < count; i++) {
               toast.classList.add(classes[i]);
             }
           }
    
           // Set content
           if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
             toast.appendChild(this.message);
    
             // Check if it is jQuery object
           } else if (this.message instanceof jQuery) {
             $(toast).append(this.message);
    
             // Insert as text;
           } else {
             toast.innerHTML = this.message;
           }
    
           // Append toasft
           Toast._container.appendChild(toast);
           return toast;
         }
    
         /**
          * Animate in toast
          */
    
       }, {
         key: '_animateIn',
         value: function _animateIn() {
           // Animate toast in
           Vel(this.el, { top: 0, opacity: 1 }, {
             duration: 300,
             easing: 'easeOutCubic',
             queue: false
           });
         }
    
         /**
          * Create setInterval which automatically removes toast when timeRemaining >= 0
          * has been reached
          */
    
       }, {
         key: 'setTimer',
         value: function setTimer() {
           var _this3 = this;
    
           if (this.timeRemaining !== Infinity) {
             this.counterInterval = setInterval(function () {
               // If toast is not being dragged, decrease its time remaining
               if (!_this3.panning) {
                 _this3.timeRemaining -= 20;
               }
    
               // Animate toast out
               if (_this3.timeRemaining <= 0) {
                 _this3.remove();
               }
             }, 20);
           }
         }
    
         /**
          * Dismiss toast with animation
          */
    
       }, {
         key: 'remove',
         value: function remove() {
           var _this4 = this;
    
           window.clearInterval(this.counterInterval);
           var activationDistance = this.el.offsetWidth * this.options.activationPercent;
    
           if (this.wasSwiped) {
             this.el.style.transition = 'transform .05s, opacity .05s';
             this.el.style.transform = 'translateX(' + activationDistance + 'px)';
             this.el.style.opacity = 0;
           }
    
           Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
             duration: this.options.outDuration,
             easing: 'easeOutExpo',
             queue: false,
             complete: function () {
               // Call the optional callback
               if (typeof _this4.options.completeCallback === 'function') {
                 _this4.options.completeCallback();
               }
               // Remove toast from DOM
               _this4.el.parentNode.removeChild(_this4.el);
               Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
               if (Toast._toasts.length === 0) {
                 Toast._removeContainer();
               }
             }
           });
         }
       }], [{
         key: '_createContainer',
    


         /**
          * Append toast container and add event handlers
          */
         value: function _createContainer() {
           var container = document.createElement('div');
           container.setAttribute('id', 'toast-container');
    
           // Add event handler
           container.addEventListener('touchstart', Toast._onDragStart);
           container.addEventListener('touchmove', Toast._onDragMove);
           container.addEventListener('touchend', Toast._onDragEnd);
    
           container.addEventListener('mousedown', Toast._onDragStart);
           document.addEventListener('mousemove', Toast._onDragMove);
           document.addEventListener('mouseup', Toast._onDragEnd);
    
           document.body.appendChild(container);
           Toast._container = container;
         }
    
         /**
          * Remove toast container and event handlers
          */
    
       }, {
         key: '_removeContainer',
         value: function _removeContainer() {
           // Add event handler
           document.removeEventListener('mousemove', Toast._onDragMove);
           document.removeEventListener('mouseup', Toast._onDragEnd);
    
           Toast._container.parentNode.removeChild(Toast._container);
           Toast._container = null;
         }
    
         /**
          * Begin drag handler
          * @param {Event} e
          */
    
       }, {
         key: '_onDragStart',
         value: function _onDragStart(e) {
           if (e.target && $(e.target).closest('.toast').length) {
             var $toast = $(e.target).closest('.toast');
             var toast = $toast[0].M_Toast;
             toast.panning = true;
             Toast._draggedToast = toast;
             toast.el.classList.add('panning');
             toast.el.style.transition = null;
             toast.startingXPos = Toast._xPos(e);
             toast.time = Date.now();
             toast.xPos = Toast._xPos(e);
           }
         }
    
         /**
          * Drag move handler
          * @param {Event} e
          */
    
       }, {
         key: '_onDragMove',
         value: function _onDragMove(e) {
           if (!!Toast._draggedToast) {
             e.preventDefault();
             var toast = Toast._draggedToast;
             toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
             toast.xPos = Toast._xPos(e);
             toast.velocityX = toast.deltaX / (Date.now() - toast.time);
             toast.time = Date.now();
    
             var totalDeltaX = toast.xPos - toast.startingXPos;
             var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
             toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
             toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
           }
         }
    
         /**
          * End drag handler
          * @param {Event} e
          */
    
       }, {
         key: '_onDragEnd',
         value: function _onDragEnd(e) {
           if (!!Toast._draggedToast) {
             var toast = Toast._draggedToast;
             toast.panning = false;
             toast.el.classList.remove('panning');
    
             var totalDeltaX = toast.xPos - toast.startingXPos;
             var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
             var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
    
             // Remove toast
             if (shouldBeDismissed) {
               toast.wasSwiped = true;
               toast.remove();
    
               // Animate toast back to original position
             } else {
               toast.el.style.transition = 'transform .2s, opacity .2s';
               toast.el.style.transform = null;
               toast.el.style.opacity = null;
             }
             Toast._draggedToast = null;
           }
         }
    
         /**
          * Get x position of mouse or touch event
          * @param {Event} e
          */
    
       }, {
         key: '_xPos',
         value: function _xPos(e) {
           if (e.targetTouches && e.targetTouches.length >= 1) {
             return e.targetTouches[0].clientX;
           }
           // mouse event
           return e.clientX;
         }
    
         /**
          * Remove all toasts
          */
    
       }, {
         key: 'removeAll',
         value: function removeAll() {
           for (var toastIndex in Toast._toasts) {
             Toast._toasts[toastIndex].remove();
           }
         }
       }, {
         key: 'defaults',
         get: function () {
           return _defaults;
         }
       }]);
    
       return Toast;
     }();
    
     /**
      * @static
      * @memberof Toast
      * @type {Array.<Toast>}
      */
    


     Toast._toasts = [];
    
     /**
      * @static
      * @memberof Toast
      */
     Toast._container = null;
    
     /**
      * @static
      * @memberof Toast
      * @type {Toast}
      */
     Toast._draggedToast = null;
    
     window.Materialize.Toast = Toast;
     window.Materialize.toast = function (message, displayLength, className, completeCallback) {
       return new Toast(message, displayLength, className, completeCallback);
     };
    

    })(jQuery);

    (function ($) {
     var methods = {
       init: function (options) {
         var defaults = {
           menuWidth: 300,
           edge: 'left',
           closeOnClick: false,
           draggable: true,
           onOpen: null,
           onClose: null
         };
         options = $.extend(defaults, options);
    
         $(this).each(function () {
           var $this = $(this);
           var menuId = $this.attr('data-activates');
           var menu = $("#" + menuId);
    
           // Set to width
           if (options.menuWidth != 300) {
             menu.css('width', options.menuWidth);
           }
    
           // Add Touch Area
           var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
           if (options.draggable) {
             // Regenerate dragTarget
             if ($dragTarget.length) {
               $dragTarget.remove();
             }
    
    $dragTarget = $('
    ').attr('data-sidenav', menuId);
             $('body').append($dragTarget);
           } else {
             $dragTarget = $();
           }
    
           if (options.edge == 'left') {
             menu.css('transform', 'translateX(-100%)');
             $dragTarget.css({ 'left': 0 }); // Add Touch Area
           } else {
             menu.addClass('right-aligned') // Change text-alignment to right
             .css('transform', 'translateX(100%)');
             $dragTarget.css({ 'right': 0 }); // Add Touch Area
           }
    
           // If fixed sidenav, bring menu out
           if (menu.hasClass('fixed')) {
             if (window.innerWidth > 992) {
               menu.css('transform', 'translateX(0)');
             }
           }
    
           // Window resize to reset on large screens fixed
           if (menu.hasClass('fixed')) {
             $(window).resize(function () {
               if (window.innerWidth > 992) {
                 // Close menu if window is resized bigger than 992 and user has fixed sidenav
                 if ($('#sidenav-overlay').length !== 0 && menuOut) {
                   removeMenu(true);
                 } else {
                   // menu.removeAttr('style');
                   menu.css('transform', 'translateX(0%)');
                   // menu.css('width', options.menuWidth);
                 }
               } else if (menuOut === false) {
                 if (options.edge === 'left') {
                   menu.css('transform', 'translateX(-100%)');
                 } else {
                   menu.css('transform', 'translateX(100%)');
                 }
               }
             });
           }
    
           // if closeOnClick, then add close event for all a tags in side sideNav
           if (options.closeOnClick === true) {
             menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
               if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
                 removeMenu();
               }
             });
           }
    
           var removeMenu = function (restoreNav) {
             panning = false;
             menuOut = false;
             // Reenable scrolling
             $('body').css({
               overflow: ,
               width: 
             });
    
             $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
               queue: false, easing: 'easeOutQuad',
               complete: function () {
                 $(this).remove();
               } });
             if (options.edge === 'left') {
               // Reset phantom div
               $dragTarget.css({ width: , right: , left: '0' });
               menu.velocity({ 'translateX': '-100%' }, { duration: 200,
                 queue: false,
                 easing: 'easeOutCubic',
                 complete: function () {
                   if (restoreNav === true) {
                     // Restore Fixed sidenav
                     menu.removeAttr('style');
                     menu.css('width', options.menuWidth);
                   }
                 }
    
               });
             } else {
               // Reset phantom div
               $dragTarget.css({ width: , right: '0', left:  });
               menu.velocity({ 'translateX': '100%' }, { duration: 200,
                 queue: false,
                 easing: 'easeOutCubic',
                 complete: function () {
                   if (restoreNav === true) {
                     // Restore Fixed sidenav
                     menu.removeAttr('style');
                     menu.css('width', options.menuWidth);
                   }
                 }
               });
             }
    
             // Callback
             if (typeof options.onClose === 'function') {
               options.onClose.call(this, menu);
             }
           };
    
           // Touch Event
           var panning = false;
           var menuOut = false;
    
           if (options.draggable) {
             $dragTarget.on('click', function () {
               if (menuOut) {
                 removeMenu();
               }
             });
    
             $dragTarget.hammer({
               prevent_default: false
             }).on('pan', function (e) {
    
               if (e.gesture.pointerType == "touch") {
    
                 var direction = e.gesture.direction;
                 var x = e.gesture.center.x;
                 var y = e.gesture.center.y;
                 var velocityX = e.gesture.velocityX;
    
                 // Vertical scroll bugfix
                 if (x === 0 && y === 0) {
                   return;
                 }
    
                 // Disable Scrolling
                 var $body = $('body');
                 var $overlay = $('#sidenav-overlay');
                 var oldWidth = $body.innerWidth();
                 $body.css('overflow', 'hidden');
                 $body.width(oldWidth);
    
                 // If overlay does not exist, create one and if it is clicked, close menu
                 if ($overlay.length === 0) {
    
    $overlay = $('
    ');
                   $overlay.css('opacity', 0).click(function () {
                     removeMenu();
                   });
    
                   // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
                   if (typeof options.onOpen === 'function') {
                     options.onOpen.call(this, menu);
                   }
    
                   $('body').append($overlay);
                 }
    
                 // Keep within boundaries
                 if (options.edge === 'left') {
                   if (x > options.menuWidth) {
                     x = options.menuWidth;
                   } else if (x < 0) {
                     x = 0;
                   }
                 }
    
                 if (options.edge === 'left') {
                   // Left Direction
                   if (x < options.menuWidth / 2) {
                     menuOut = false;
                   }
                   // Right Direction
                   else if (x >= options.menuWidth / 2) {
                       menuOut = true;
                     }
                   menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
                 } else {
                   // Left Direction
                   if (x < window.innerWidth - options.menuWidth / 2) {
                     menuOut = true;
                   }
                   // Right Direction
                   else if (x >= window.innerWidth - options.menuWidth / 2) {
                       menuOut = false;
                     }
                   var rightPos = x - options.menuWidth / 2;
                   if (rightPos < 0) {
                     rightPos = 0;
                   }
    
                   menu.css('transform', 'translateX(' + rightPos + 'px)');
                 }
    
                 // Percentage overlay
                 var overlayPerc;
                 if (options.edge === 'left') {
                   overlayPerc = x / options.menuWidth;
                   $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
                 } else {
                   overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
                   $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
                 }
               }
             }).on('panend', function (e) {
    
               if (e.gesture.pointerType == "touch") {
                 var $overlay = $('#sidenav-overlay');
                 var velocityX = e.gesture.velocityX;
                 var x = e.gesture.center.x;
                 var leftPos = x - options.menuWidth;
                 var rightPos = x - options.menuWidth / 2;
                 if (leftPos > 0) {
                   leftPos = 0;
                 }
                 if (rightPos < 0) {
                   rightPos = 0;
                 }
                 panning = false;
    
                 if (options.edge === 'left') {
                   // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
                   if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
                     // Return menu to open
                     if (leftPos !== 0) {
                       menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                     }
    
                     $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
                     $dragTarget.css({ width: '50%', right: 0, left:  });
                     menuOut = true;
                   } else if (!menuOut || velocityX > 0.3) {
                     // Enable Scrolling
                     $('body').css({
                       overflow: ,
                       width: 
                     });
                     // Slide menu closed
                     menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
                     $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
                       complete: function () {
                         // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                         if (typeof options.onClose === 'function') {
                           options.onClose.call(this, menu);
                         }
    
                         $(this).remove();
                       } });
                     $dragTarget.css({ width: '10px', right: , left: 0 });
                   }
                 } else {
                   if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
                     // Return menu to open
                     if (rightPos !== 0) {
                       menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                     }
    
                     $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
                     $dragTarget.css({ width: '50%', right: , left: 0 });
                     menuOut = true;
                   } else if (!menuOut || velocityX < -0.3) {
                     // Enable Scrolling
                     $('body').css({
                       overflow: ,
                       width: 
                     });
    
                     // Slide menu closed
                     menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
                     $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
                       complete: function () {
                         // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                         if (typeof options.onClose === 'function') {
                           options.onClose.call(this, menu);
                         }
    
                         $(this).remove();
                       } });
                     $dragTarget.css({ width: '10px', right: 0, left:  });
                   }
                 }
               }
             });
           }
    
           $this.off('click.sidenav').on('click.sidenav', function () {
             if (menuOut === true) {
               menuOut = false;
               panning = false;
               removeMenu();
             } else {
    
               // Disable Scrolling
               var $body = $('body');
    
    var $overlay = $('
    ');
               var oldWidth = $body.innerWidth();
               $body.css('overflow', 'hidden');
               $body.width(oldWidth);
    
               // Push current drag target on top of DOM tree
               $('body').append($dragTarget);
    
               if (options.edge === 'left') {
                 $dragTarget.css({ width: '50%', right: 0, left:  });
                 menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
               } else {
                 $dragTarget.css({ width: '50%', right: , left: 0 });
                 menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
               }
    
               // Overlay close on click
               $overlay.css('opacity', 0).click(function () {
                 menuOut = false;
                 panning = false;
                 removeMenu();
                 $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
                   complete: function () {
                     $(this).remove();
                   }
                 });
               });
    
               // Append body
               $('body').append($overlay);
               $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
                 complete: function () {
                   menuOut = true;
                   panning = false;
                 }
               });
    
               // Callback
               if (typeof options.onOpen === 'function') {
                 options.onOpen.call(this, menu);
               }
             }
    
             return false;
           });
         });
       },
       destroy: function () {
         var $overlay = $('#sidenav-overlay');
         var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
         $overlay.trigger('click');
         $dragTarget.remove();
         $(this).off('click');
         $overlay.remove();
       },
       show: function () {
         this.trigger('click');
       },
       hide: function () {
         $('#sidenav-overlay').trigger('click');
       }
     };
    
     $.fn.sideNav = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
         return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
         // Default to "init"
         return methods.init.apply(this, arguments);
       } else {
         $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
       }
     }; // Plugin end
    

    })(jQuery);

    /**
     * Extend jquery with a scrollspy plugin.
     * This watches the window scroll and fires events when elements are scrolled into viewport.
     *
     * throttle() and getTime() taken from Underscore.js
     * https://github.com/jashkenas/underscore
     *
     * @author Copyright 2013 John Smart
     * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
     * @see https://github.com/thesmart
     * @version 0.1.2
     */
    

    (function ($) {

     var jWindow = $(window);
     var elements = [];
     var elementsInView = [];
     var isSpying = false;
     var ticks = 0;
     var unique_id = 1;
     var offset = {
       top: 0,
       right: 0,
       bottom: 0,
       left: 0
    
       /**
        * Find elements that are within the boundary
        * @param {number} top
        * @param {number} right
        * @param {number} bottom
        * @param {number} left
        * @return {jQuery}		A collection of elements
        */
     };function findElements(top, right, bottom, left) {
       var hits = $();
       $.each(elements, function (i, element) {
         if (element.height() > 0) {
           var elTop = element.offset().top,
               elLeft = element.offset().left,
               elRight = elLeft + element.width(),
               elBottom = elTop + element.height();
    
           var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
    
           if (isIntersect) {
             hits.push(element);
           }
         }
       });
    
       return hits;
     }
    
     /**
      * Called when the user scrolls the window
      */
     function onScroll(scrollOffset) {
       // unique tick id
       ++ticks;
    
       // viewport rectangle
       var top = jWindow.scrollTop(),
           left = jWindow.scrollLeft(),
           right = left + jWindow.width(),
           bottom = top + jWindow.height();
    
       // determine which elements are in view
       var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
       $.each(intersections, function (i, element) {
    
         var lastTick = element.data('scrollSpy:ticks');
         if (typeof lastTick != 'number') {
           // entered into view
           element.triggerHandler('scrollSpy:enter');
         }
    
         // update tick id
         element.data('scrollSpy:ticks', ticks);
       });
    
       // determine which elements are no longer in view
       $.each(elementsInView, function (i, element) {
         var lastTick = element.data('scrollSpy:ticks');
         if (typeof lastTick == 'number' && lastTick !== ticks) {
           // exited from view
           element.triggerHandler('scrollSpy:exit');
           element.data('scrollSpy:ticks', null);
         }
       });
    
       // remember elements in view for next tick
       elementsInView = intersections;
     }
    
     /**
      * Called when window is resized
     */
     function onWinSize() {
       jWindow.trigger('scrollSpy:winSize');
     }
    
     /**
      * Enables ScrollSpy using a selector
      * @param {jQuery|string} selector  The elements collection, or a selector
      * @param {Object=} options	Optional.
            throttle : number -> scrollspy throttling. Default: 100 ms
            offsetTop : number -> offset from top. Default: 0
            offsetRight : number -> offset from right. Default: 0
            offsetBottom : number -> offset from bottom. Default: 0
            offsetLeft : number -> offset from left. Default: 0
     			activeClass : string -> Class name to be added to the active link. Default: active
      * @returns {jQuery}
      */
     $.scrollSpy = function (selector, options) {
       var defaults = {
         throttle: 100,
         scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
         activeClass: 'active',
         getActiveElement: function (id) {
           return 'a[href="#' + id + '"]';
         }
       };
       options = $.extend(defaults, options);
    
       var visible = [];
       selector = $(selector);
       selector.each(function (i, element) {
         elements.push($(element));
         $(element).data("scrollSpy:id", i);
         // Smooth scroll to section
         $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
           e.preventDefault();
           var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
           $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
         });
       });
    
       offset.top = options.offsetTop || 0;
       offset.right = options.offsetRight || 0;
       offset.bottom = options.offsetBottom || 0;
       offset.left = options.offsetLeft || 0;
    
       var throttledScroll = Materialize.throttle(function () {
         onScroll(options.scrollOffset);
       }, options.throttle || 100);
       var readyScroll = function () {
         $(document).ready(throttledScroll);
       };
    
       if (!isSpying) {
         jWindow.on('scroll', readyScroll);
         jWindow.on('resize', readyScroll);
         isSpying = true;
       }
    
       // perform a scan once, after current execution context, and after dom is ready
       setTimeout(readyScroll, 0);
    
       selector.on('scrollSpy:enter', function () {
         visible = $.grep(visible, function (value) {
           return value.height() != 0;
         });
    
         var $this = $(this);
    
         if (visible[0]) {
           $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
           if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
             visible.unshift($(this));
           } else {
             visible.push($(this));
           }
         } else {
           visible.push($(this));
         }
    
         $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
       });
       selector.on('scrollSpy:exit', function () {
         visible = $.grep(visible, function (value) {
           return value.height() != 0;
         });
    
         if (visible[0]) {
           $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
           var $this = $(this);
           visible = $.grep(visible, function (value) {
             return value.attr('id') != $this.attr('id');
           });
           if (visible[0]) {
             // Check if empty
             $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
           }
         }
       });
    
       return selector;
     };
    
     /**
      * Listen for window resize events
      * @param {Object=} options						Optional. Set { throttle: number } to change throttling. Default: 100 ms
      * @returns {jQuery}		$(window)
      */
     $.winSizeSpy = function (options) {
       $.winSizeSpy = function () {
         return jWindow;
       }; // lock from multiple calls
       options = options || {
         throttle: 100
       };
       return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
     };
    
     /**
      * Enables ScrollSpy on a collection of elements
      * e.g. $('.scrollSpy').scrollSpy()
      * @param {Object=} options	Optional.
     										throttle : number -> scrollspy throttling. Default: 100 ms
     										offsetTop : number -> offset from top. Default: 0
     										offsetRight : number -> offset from right. Default: 0
     										offsetBottom : number -> offset from bottom. Default: 0
     										offsetLeft : number -> offset from left. Default: 0
      * @returns {jQuery}
      */
     $.fn.scrollSpy = function (options) {
       return $.scrollSpy($(this), options);
     };
    

    })(jQuery);

    (function ($) {
     $(document).ready(function () {
    
       // Function to update labels of text fields
       Materialize.updateTextFields = function () {
         var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
         $(input_selector).each(function (index, element) {
           var $this = $(this);
           if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
             $this.siblings('label').addClass('active');
           } else if ($(element)[0].validity) {
             $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
           } else {
             $this.siblings('label').removeClass('active');
           }
         });
       };
    
       // Text based inputs
       var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
    
       // Add active if form auto complete
       $(document).on('change', input_selector, function () {
         if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
           $(this).siblings('label').addClass('active');
         }
         validate_field($(this));
       });
    
       // Add active if input element has been pre-populated on document ready
       $(document).ready(function () {
         Materialize.updateTextFields();
       });
    
       // HTML DOM FORM RESET handling
       $(document).on('reset', function (e) {
         var formReset = $(e.target);
         if (formReset.is('form')) {
           formReset.find(input_selector).removeClass('valid').removeClass('invalid');
           formReset.find(input_selector).each(function () {
             if ($(this).attr('value') === ) {
               $(this).siblings('label').removeClass('active');
             }
           });
    
           // Reset select
           formReset.find('select.initialized').each(function () {
             var reset_text = formReset.find('option[selected]').text();
             formReset.siblings('input.select-dropdown').val(reset_text);
           });
         }
       });
    
       // Add active when element has focus
       $(document).on('focus', input_selector, function () {
         $(this).siblings('label, .prefix').addClass('active');
       });
    
       $(document).on('blur', input_selector, function () {
         var $inputElement = $(this);
         var selector = ".prefix";
    
         if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
           selector += ", label";
         }
    
         $inputElement.siblings(selector).removeClass('active');
    
         validate_field($inputElement);
       });
    
       window.validate_field = function (object) {
         var hasLength = object.attr('data-length') !== undefined;
         var lenAttr = parseInt(object.attr('data-length'));
         var len = object.val().length;
    
         if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
           if (object.hasClass('validate')) {
             object.removeClass('valid');
             object.removeClass('invalid');
           }
         } else {
           if (object.hasClass('validate')) {
             // Check for character counter attributes
             if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
               object.removeClass('invalid');
               object.addClass('valid');
             } else {
               object.removeClass('valid');
               object.addClass('invalid');
             }
           }
         }
       };
    
       // Radio and Checkbox focus class
       var radio_checkbox = 'input[type=radio], input[type=checkbox]';
       $(document).on('keyup.radio', radio_checkbox, function (e) {
         // TAB, check if tabbing to radio or checkbox.
         if (e.which === 9) {
           $(this).addClass('tabbed');
           var $this = $(this);
           $this.one('blur', function (e) {
    
             $(this).removeClass('tabbed');
           });
           return;
         }
       });
    
       // Textarea Auto Resize
       var hiddenDiv = $('.hiddendiv').first();
       if (!hiddenDiv.length) {
    
    hiddenDiv = $('
    ');
         $('body').append(hiddenDiv);
       }
       var text_area_selector = '.materialize-textarea';
    
       function textareaAutoResize($textarea) {
         // Set font properties of hiddenDiv
    
         var fontFamily = $textarea.css('font-family');
         var fontSize = $textarea.css('font-size');
         var lineHeight = $textarea.css('line-height');
         var padding = $textarea.css('padding');
    
         if (fontSize) {
           hiddenDiv.css('font-size', fontSize);
         }
         if (fontFamily) {
           hiddenDiv.css('font-family', fontFamily);
         }
         if (lineHeight) {
           hiddenDiv.css('line-height', lineHeight);
         }
         if (padding) {
           hiddenDiv.css('padding', padding);
         }
    
         // Set original-height, if none
         if (!$textarea.data('original-height')) {
           $textarea.data('original-height', $textarea.height());
         }
    
         if ($textarea.attr('wrap') === 'off') {
           hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
         }
    
         hiddenDiv.text($textarea.val() + '\n');
         var content = hiddenDiv.html().replace(/\n/g, '
    '); hiddenDiv.html(content);
         // When textarea is hidden, width goes crazy.
         // Approximate with half of window size
    
         if ($textarea.is(':visible')) {
           hiddenDiv.css('width', $textarea.width());
         } else {
           hiddenDiv.css('width', $(window).width() / 2);
         }
    
         /**
          * Resize if the new height is greater than the
          * original height of the textarea
          */
         if ($textarea.data('original-height') <= hiddenDiv.height()) {
           $textarea.css('height', hiddenDiv.height());
         } else if ($textarea.val().length < $textarea.data('previous-length')) {
           /**
            * In case the new height is less than original height, it
            * means the textarea has less text than before
            * So we set the height to the original one
            */
           $textarea.css('height', $textarea.data('original-height'));
         }
         $textarea.data('previous-length', $textarea.val().length);
       }
    
       $(text_area_selector).each(function () {
         var $textarea = $(this);
         /**
          * Instead of resizing textarea on document load,
          * store the original height and the original length
          */
         $textarea.data('original-height', $textarea.height());
         $textarea.data('previous-length', $textarea.val().length);
       });
    
       $('body').on('keyup keydown autoresize', text_area_selector, function () {
         textareaAutoResize($(this));
       });
    
       // File Input Path
       $(document).on('change', '.file-field input[type="file"]', function () {
         var file_field = $(this).closest('.file-field');
         var path_input = file_field.find('input.file-path');
         var files = $(this)[0].files;
         var file_names = [];
         for (var i = 0; i < files.length; i++) {
           file_names.push(files[i].name);
         }
         path_input.val(file_names.join(", "));
         path_input.trigger('change');
       });
    
       /****************
       *  Range Input  *
       ****************/
    
       var range_type = 'input[type=range]';
       var range_mousedown = false;
       var left;
    
       $(range_type).each(function () {
         var thumb = $('');
         $(this).after(thumb);
       });
    
       var showRangeBubble = function (thumb) {
         var paddingLeft = parseInt(thumb.parent().css('padding-left'));
         var marginLeft = -7 + paddingLeft + 'px';
         thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
       };
    
       var calcRangeOffset = function (range) {
         var width = range.width() - 15;
         var max = parseFloat(range.attr('max'));
         var min = parseFloat(range.attr('min'));
         var percent = (parseFloat(range.val()) - min) / (max - min);
         return percent * width;
       };
    
       var range_wrapper = '.range-field';
       $(document).on('change', range_type, function (e) {
         var thumb = $(this).siblings('.thumb');
         thumb.find('.value').html($(this).val());
    
         if (!thumb.hasClass('active')) {
           showRangeBubble(thumb);
         }
    
         var offsetLeft = calcRangeOffset($(this));
         thumb.addClass('active').css('left', offsetLeft);
       });
    
       $(document).on('mousedown touchstart', range_type, function (e) {
         var thumb = $(this).siblings('.thumb');
    
         // If thumb indicator does not exist yet, create it
         if (thumb.length <= 0) {
           thumb = $('');
           $(this).after(thumb);
         }
    
         // Set indicator value
         thumb.find('.value').html($(this).val());
    
         range_mousedown = true;
         $(this).addClass('active');
    
         if (!thumb.hasClass('active')) {
           showRangeBubble(thumb);
         }
    
         if (e.type !== 'input') {
           var offsetLeft = calcRangeOffset($(this));
           thumb.addClass('active').css('left', offsetLeft);
         }
       });
    
       $(document).on('mouseup touchend', range_wrapper, function () {
         range_mousedown = false;
         $(this).removeClass('active');
       });
    
       $(document).on('input mousemove touchmove', range_wrapper, function (e) {
         var thumb = $(this).children('.thumb');
         var left;
         var input = $(this).find(range_type);
    
         if (range_mousedown) {
           if (!thumb.hasClass('active')) {
             showRangeBubble(thumb);
           }
    
           var offsetLeft = calcRangeOffset(input);
           thumb.addClass('active').css('left', offsetLeft);
           thumb.find('.value').html(thumb.siblings(range_type).val());
         }
       });
    
       $(document).on('mouseout touchleave', range_wrapper, function () {
         if (!range_mousedown) {
    
           var thumb = $(this).children('.thumb');
           var paddingLeft = parseInt($(this).css('padding-left'));
           var marginLeft = 7 + paddingLeft + 'px';
    
           if (thumb.hasClass('active')) {
             thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
           }
           thumb.removeClass('active');
         }
       });
    
       /**************************
        * Auto complete plugin  *
        *************************/
       $.fn.autocomplete = function (options) {
         // Defaults
         var defaults = {
           data: {},
           limit: Infinity,
           onAutocomplete: null,
           minLength: 1
         };
    
         options = $.extend(defaults, options);
    
         return this.each(function () {
           var $input = $(this);
           var data = options.data,
               count = 0,
               activeIndex = -1,
               oldVal,
               $inputDiv = $input.closest('.input-field'); // Div to append on
    
           // Check if data isn't empty
           if (!$.isEmptyObject(data)) {
    
    var $autocomplete = $('');
             var $oldAutocomplete;
    
             // Append autocomplete element.
             // Prevent double structure init.
             if ($inputDiv.length) {
               $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
               if (!$oldAutocomplete.length) {
                 $inputDiv.append($autocomplete); // Set ul in body
               }
             } else {
               $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
               if (!$oldAutocomplete.length) {
                 $input.after($autocomplete);
               }
             }
             if ($oldAutocomplete.length) {
               $autocomplete = $oldAutocomplete;
             }
    
             // Highlight partial match.
             var highlight = function (string, $el) {
               var img = $el.find('img');
               var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
                   matchEnd = matchStart + string.length - 1,
                   beforeMatch = $el.text().slice(0, matchStart),
                   matchText = $el.text().slice(matchStart, matchEnd + 1),
                   afterMatch = $el.text().slice(matchEnd + 1);
               $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
               if (img.length) {
                 $el.prepend(img);
               }
             };
    
             // Reset current element position
             var resetCurrentElement = function () {
               activeIndex = -1;
               $autocomplete.find('.active').removeClass('active');
             };
    
             // Remove autocomplete elements
             var removeAutocomplete = function () {
               $autocomplete.empty();
               resetCurrentElement();
               oldVal = undefined;
             };
    
             $input.off('blur.autocomplete').on('blur.autocomplete', function () {
               removeAutocomplete();
             });
    
             // Perform search
             $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
               // Reset count.
               count = 0;
               var val = $input.val().toLowerCase();
    
               // Don't capture enter or arrow key usage.
               if (e.which === 13 || e.which === 38 || e.which === 40) {
                 return;
               }
    
               // Check if the input isn't empty
               if (oldVal !== val) {
                 removeAutocomplete();
    
                 if (val.length >= options.minLength) {
                   for (var key in data) {
                     if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
                       // Break if past limit
                       if (count >= options.limit) {
                         break;
                       }
    
    var autocompleteOption = $('
  • ');
                       if (!!data[key]) {
                         autocompleteOption.append('<img src="' + data[key] + '" class="right circle">' + key + '');
                       } else {
                         autocompleteOption.append('' + key + '');
                       }
    
                       $autocomplete.append(autocompleteOption);
                       highlight(val, autocompleteOption);
                       count++;
                     }
                   }
                 }
               }
    
               // Update oldVal
               oldVal = val;
             });
    
             $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
               // Arrow keys and enter key usage
               var keyCode = e.which,
                   liElement,
                   numItems = $autocomplete.children('li').length,
                   $active = $autocomplete.children('.active').first();
    
               // select element on Enter
               if (keyCode === 13 && activeIndex >= 0) {
                 liElement = $autocomplete.children('li').eq(activeIndex);
                 if (liElement.length) {
                   liElement.trigger('mousedown.autocomplete');
                   e.preventDefault();
                 }
                 return;
               }
    
               // Capture up and down key
               if (keyCode === 38 || keyCode === 40) {
                 e.preventDefault();
    
                 if (keyCode === 38 && activeIndex > 0) {
                   activeIndex--;
                 }
    
                 if (keyCode === 40 && activeIndex < numItems - 1) {
                   activeIndex++;
                 }
    
                 $active.removeClass('active');
                 if (activeIndex >= 0) {
                   $autocomplete.children('li').eq(activeIndex).addClass('active');
                 }
               }
             });
    
             // Set input value
             $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
               var text = $(this).text().trim();
               $input.val(text);
               $input.trigger('change');
               removeAutocomplete();
    
               // Handle onAutocomplete callback.
               if (typeof options.onAutocomplete === "function") {
                 options.onAutocomplete.call(this, text);
               }
             });
    
             // Empty data
           } else {
             $input.off('keyup.autocomplete focus.autocomplete');
           }
         });
       };
     }); // End of $(document).ready
    
     /*******************
      *  Select Plugin  *
      ******************/
     $.fn.material_select = function (callback) {
       $(this).each(function () {
         var $select = $(this);
    
         if ($select.hasClass('browser-default')) {
           return; // Continue to next (return false breaks out of entire loop)
         }
    
         var multiple = $select.attr('multiple') ? true : false,
             lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
    
         if (lastID) {
           $select.parent().find('span.caret').remove();
           $select.parent().find('input').remove();
    
           $select.unwrap();
           $('ul#select-options-' + lastID).remove();
         }
    
         // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
         if (callback === 'destroy') {
           $select.removeAttr('data-select-id').removeClass('initialized');
           $(window).off('click.select');
           return;
         }
    
         var uniqueID = Materialize.guid();
         $select.attr('data-select-id', uniqueID);
    
    var wrapper = $('
    ');
         wrapper.addClass($select.attr('class'));
         if ($select.is(':disabled')) wrapper.addClass('disabled');
    
    var options = $(''),
             selectChildren = $select.children('option, optgroup'),
             valuesSelected = [],
             optionsHover = false;
    
         var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
    
         // Function that renders and appends the option taking into
         // account type and possible image icon.
         var appendOptionWithIcon = function (select, option, type) {
           // Add disabled attr if disabled
           var disabledClass = option.is(':disabled') ? 'disabled ' : ;
           var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : ;
           var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ;
    
           // add icons
           var icon_url = option.data('icon');
           var classes = option.attr('class');
           if (!!icon_url) {
             var classString = ;
             if (!!classes) classString = ' class="' + classes + '"';
    
             // Check for multiple type.
    
    options.append($('
  • <img alt="" src="' + icon_url + '"' + classString + '>' + multipleCheckbox + option.html() + '
  • '));
             return true;
           }
    
           // Check for multiple type.
    
    options.append($('
  • ' + multipleCheckbox + option.html() + '
  • '));
         };
    
         /* Create dropdown structure. */
         if (selectChildren.length) {
           selectChildren.each(function () {
             if ($(this).is('option')) {
               // Direct descendant option.
               if (multiple) {
                 appendOptionWithIcon($select, $(this), 'multiple');
               } else {
                 appendOptionWithIcon($select, $(this));
               }
             } else if ($(this).is('optgroup')) {
               // Optgroup.
               var selectOptions = $(this).children('option');
    
    options.append($('
  • ' + $(this).attr('label') + '
  • '));
               selectOptions.each(function () {
                 appendOptionWithIcon($select, $(this), 'optgroup-option');
               });
             }
           });
         }
    
         options.find('li:not(.optgroup)').each(function (i) {
           $(this).click(function (e) {
             // Check if option element is disabled
             if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
               var selected = true;
    
               if (multiple) {
                 $('input[type="checkbox"]', this).prop('checked', function (i, v) {
                   return !v;
                 });
                 selected = toggleEntryFromArray(valuesSelected, i, $select);
                 $newSelect.trigger('focus');
               } else {
                 options.find('li').removeClass('active');
                 $(this).toggleClass('active');
                 $newSelect.val($(this).text());
               }
    
               activateOption(options, $(this));
               $select.find('option').eq(i).prop('selected', selected);
               // Trigger onchange() event
               $select.trigger('change');
               if (typeof callback !== 'undefined') callback();
             }
    
             e.stopPropagation();
           });
         });
    
         // Wrap Elements
         $select.wrap(wrapper);
         // Add Select Display Element
         var dropdownIcon = $('');
    
         // escape double quotes
         var sanitizedLabelHtml = label.replace(/"/g, '"');
    
         var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : ) + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
         $select.before($newSelect);
         $newSelect.before(dropdownIcon);
    
         $newSelect.after(options);
         // Check if section element is disabled
         if (!$select.is(':disabled')) {
           $newSelect.dropdown({ 'hover': false });
         }
    
         // Copy tabindex
         if ($select.attr('tabindex')) {
           $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
         }
    
         $select.addClass('initialized');
    
         $newSelect.on({
           'focus': function () {
             if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
               $('input.select-dropdown').trigger('close');
               $(window).off('click.select');
             }
             if (!options.is(':visible')) {
               $(this).trigger('open', ['focus']);
               var label = $(this).val();
               if (multiple && label.indexOf(',') >= 0) {
                 label = label.split(',')[0];
               }
    
               var selectedOption = options.find('li').filter(function () {
                 return $(this).text().toLowerCase() === label.toLowerCase();
               })[0];
               activateOption(options, selectedOption, true);
    
               $(window).off('click.select').on('click.select', function () {
                 multiple && (optionsHover || $newSelect.trigger('close'));
                 $(window).off('click.select');
               });
             }
           },
           'click': function (e) {
             e.stopPropagation();
           }
         });
    
         $newSelect.on('blur', function () {
           if (!multiple) {
             $(this).trigger('close');
             $(window).off('click.select');
           }
           options.find('li.selected').removeClass('selected');
         });
    
         options.hover(function () {
           optionsHover = true;
         }, function () {
           optionsHover = false;
         });
    
         // Add initial multiple selections.
         if (multiple) {
           $select.find("option:selected:not(:disabled)").each(function () {
             var index = $(this).index();
    
             toggleEntryFromArray(valuesSelected, index, $select);
             options.find("li").eq(index).find(":checkbox").prop("checked", true);
           });
         }
    
         /**
          * Make option as selected and scroll to selected position
          * @param {jQuery} collection  Select options jQuery element
          * @param {Element} newOption  element of the new option
          * @param {Boolean} firstActivation  If on first activation of select
          */
         var activateOption = function (collection, newOption, firstActivation) {
           if (newOption) {
             collection.find('li.selected').removeClass('selected');
             var option = $(newOption);
             option.addClass('selected');
             if (!multiple || !!firstActivation) {
               options.scrollTo(option);
             }
           }
         };
    
         // Allow user to search by typing
         // this array is cleared after 1 second
         var filterQuery = [],
             onKeyDown = function (e) {
           // TAB - switch to another input
           if (e.which == 9) {
             $newSelect.trigger('close');
             return;
           }
    
           // ARROW DOWN WHEN SELECT IS CLOSED - open select options
           if (e.which == 40 && !options.is(':visible')) {
             $newSelect.trigger('open');
             return;
           }
    
           // ENTER WHEN SELECT IS CLOSED - submit form
           if (e.which == 13 && !options.is(':visible')) {
             return;
           }
    
           e.preventDefault();
    
           // CASE WHEN USER TYPE LETTERS
           var letter = String.fromCharCode(e.which).toLowerCase(),
               nonLetters = [9, 13, 27, 38, 40];
           if (letter && nonLetters.indexOf(e.which) === -1) {
             filterQuery.push(letter);
    
             var string = filterQuery.join(),
                 newOption = options.find('li').filter(function () {
               return $(this).text().toLowerCase().indexOf(string) === 0;
             })[0];
    
             if (newOption) {
               activateOption(options, newOption);
             }
           }
    
           // ENTER - select option and close when select options are opened
           if (e.which == 13) {
             var activeOption = options.find('li.selected:not(.disabled)')[0];
             if (activeOption) {
               $(activeOption).trigger('click');
               if (!multiple) {
                 $newSelect.trigger('close');
               }
             }
           }
    
           // ARROW DOWN - move to next not disabled option
           if (e.which == 40) {
             if (options.find('li.selected').length) {
               newOption = options.find('li.selected').next('li:not(.disabled)')[0];
             } else {
               newOption = options.find('li:not(.disabled)')[0];
             }
             activateOption(options, newOption);
           }
    
           // ESC - close options
           if (e.which == 27) {
             $newSelect.trigger('close');
           }
    
           // ARROW UP - move to previous not disabled option
           if (e.which == 38) {
             newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
             if (newOption) activateOption(options, newOption);
           }
    
           // Automaticaly clean filter query so user can search again by starting letters
           setTimeout(function () {
             filterQuery = [];
           }, 1000);
         };
    
         $newSelect.on('keydown', onKeyDown);
       });
    
       function toggleEntryFromArray(entriesArray, entryIndex, select) {
         var index = entriesArray.indexOf(entryIndex),
             notAdded = index === -1;
    
         if (notAdded) {
           entriesArray.push(entryIndex);
         } else {
           entriesArray.splice(index, 1);
         }
    
         select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
    
         // use notAdded instead of true (to detect if the option is selected or not)
         select.find('option').eq(entryIndex).prop('selected', notAdded);
         setValueToInput(entriesArray, select);
    
         return notAdded;
       }
    
       function setValueToInput(entriesArray, select) {
         var value = ;
    
         for (var i = 0, count = entriesArray.length; i < count; i++) {
           var text = select.find('option').eq(entriesArray[i]).text();
    
           i === 0 ? value += text : value += ', ' + text;
         }
    
         if (value === ) {
           value = select.find('option:disabled').eq(0).text();
         }
    
         select.siblings('input.select-dropdown').val(value);
       }
     };
    

    })(jQuery);

    (function ($) {
     var methods = {
    
       init: function (options) {
         var defaults = {
           indicators: true,
           height: 400,
           transition: 500,
           interval: 6000
         };
         options = $.extend(defaults, options);
    
         return this.each(function () {
    
           // For each slider, we want to keep track of
           // which slide is active and its associated content
           var $this = $(this);
           var $slider = $this.find('ul.slides').first();
           var $slides = $slider.find('> li');
           var $active_index = $slider.find('.active').index();
           var $active, $indicators, $interval;
           if ($active_index != -1) {
             $active = $slides.eq($active_index);
           }
    
           // Transitions the caption depending on alignment
           function captionTransition(caption, duration) {
             if (caption.hasClass("center-align")) {
               caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
             } else if (caption.hasClass("right-align")) {
               caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
             } else if (caption.hasClass("left-align")) {
               caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
             }
           }
    
           // This function will transition the slide to any index of the next slide
           function moveToSlide(index) {
             // Wrap around indices.
             if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
    
             $active_index = $slider.find('.active').index();
    
             // Only do if index changes
             if ($active_index != index) {
               $active = $slides.eq($active_index);
               $caption = $active.find('.caption');
    
               $active.removeClass('active');
               $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
                 complete: function () {
                   $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
                 } });
               captionTransition($caption, options.transition);
    
               // Update indicators
               if (options.indicators) {
                 $indicators.eq($active_index).removeClass('active');
               }
    
               $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
               $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
               $slides.eq(index).addClass('active');
    
               // Update indicators
               if (options.indicators) {
                 $indicators.eq(index).addClass('active');
               }
             }
           }
    
           // Set height of slider
           // If fullscreen, do nothing
           if (!$this.hasClass('fullscreen')) {
             if (options.indicators) {
               // Add height if indicators are present
               $this.height(options.height + 40);
             } else {
               $this.height(options.height);
             }
             $slider.height(options.height);
           }
    
           // Set initial positions of captions
           $slides.find('.caption').each(function () {
             captionTransition($(this), 0);
           });
    
           // Move img src into background-image
           $slides.find('img').each(function () {
             var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
             if ($(this).attr('src') !== placeholderBase64) {
               $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
               $(this).attr('src', placeholderBase64);
             }
           });
    
           // dynamically add indicators
           if (options.indicators) {
    
    $indicators = $('
      ');
               $slides.each(function (index) {
      
      var $indicator = $('
    • ');
                 // Handle clicks on indicators
                 $indicator.click(function () {
                   var $parent = $slider.parent();
                   var curr_index = $parent.find($(this)).index();
                   moveToSlide(curr_index);
      
                   // reset interval
                   clearInterval($interval);
                   $interval = setInterval(function () {
                     $active_index = $slider.find('.active').index();
                     if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                     else $active_index += 1;
      
                     moveToSlide($active_index);
                   }, options.transition + options.interval);
                 });
                 $indicators.append($indicator);
               });
               $this.append($indicators);
               $indicators = $this.find('ul.indicators').find('li.indicator-item');
             }
      
             if ($active) {
               $active.show();
             } else {
               $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
      
               $active_index = 0;
               $active = $slides.eq($active_index);
      
               // Update indicators
               if (options.indicators) {
                 $indicators.eq($active_index).addClass('active');
               }
             }
      
             // Adjust height to current slide
             $active.find('img').each(function () {
               $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
             });
      
             // auto scroll
             $interval = setInterval(function () {
               $active_index = $slider.find('.active').index();
               moveToSlide($active_index + 1);
             }, options.transition + options.interval);
      
             // HammerJS, Swipe navigation
      
             // Touch Event
             var panning = false;
             var swipeLeft = false;
             var swipeRight = false;
      
             $this.hammer({
               prevent_default: false
             }).on('pan', function (e) {
               if (e.gesture.pointerType === "touch") {
      
                 // reset interval
                 clearInterval($interval);
      
                 var direction = e.gesture.direction;
                 var x = e.gesture.deltaX;
                 var velocityX = e.gesture.velocityX;
                 var velocityY = e.gesture.velocityY;
      
                 $curr_slide = $slider.find('.active');
                 if (Math.abs(velocityX) > Math.abs(velocityY)) {
                   $curr_slide.velocity({ translateX: x
                   }, { duration: 50, queue: false, easing: 'easeOutQuad' });
                 }
      
                 // Swipe Left
                 if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
                   swipeRight = true;
                 }
                 // Swipe Right
                 else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
                     swipeLeft = true;
                   }
      
                 // Make Slide Behind active slide visible
                 var next_slide;
                 if (swipeLeft) {
                   next_slide = $curr_slide.next();
                   if (next_slide.length === 0) {
                     next_slide = $slides.first();
                   }
                   next_slide.velocity({ opacity: 1
                   }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                 }
                 if (swipeRight) {
                   next_slide = $curr_slide.prev();
                   if (next_slide.length === 0) {
                     next_slide = $slides.last();
                   }
                   next_slide.velocity({ opacity: 1
                   }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                 }
               }
             }).on('panend', function (e) {
               if (e.gesture.pointerType === "touch") {
      
                 $curr_slide = $slider.find('.active');
                 panning = false;
                 curr_index = $slider.find('.active').index();
      
                 if (!swipeRight && !swipeLeft || $slides.length <= 1) {
                   // Return to original spot
                   $curr_slide.velocity({ translateX: 0
                   }, { duration: 300, queue: false, easing: 'easeOutQuad' });
                 } else if (swipeLeft) {
                   moveToSlide(curr_index + 1);
                   $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
                     complete: function () {
                       $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
                     } });
                 } else if (swipeRight) {
                   moveToSlide(curr_index - 1);
                   $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
                     complete: function () {
                       $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
                     } });
                 }
                 swipeLeft = false;
                 swipeRight = false;
      
                 // Restart interval
                 clearInterval($interval);
                 $interval = setInterval(function () {
                   $active_index = $slider.find('.active').index();
                   if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                   else $active_index += 1;
      
                   moveToSlide($active_index);
                 }, options.transition + options.interval);
               }
             });
      
             $this.on('sliderPause', function () {
               clearInterval($interval);
             });
      
             $this.on('sliderStart', function () {
               clearInterval($interval);
               $interval = setInterval(function () {
                 $active_index = $slider.find('.active').index();
                 if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                 else $active_index += 1;
      
                 moveToSlide($active_index);
               }, options.transition + options.interval);
             });
      
             $this.on('sliderNext', function () {
               $active_index = $slider.find('.active').index();
               moveToSlide($active_index + 1);
             });
      
             $this.on('sliderPrev', function () {
               $active_index = $slider.find('.active').index();
               moveToSlide($active_index - 1);
             });
           });
         },
         pause: function () {
           $(this).trigger('sliderPause');
         },
         start: function () {
           $(this).trigger('sliderStart');
         },
         next: function () {
           $(this).trigger('sliderNext');
         },
         prev: function () {
           $(this).trigger('sliderPrev');
         }
       };
      
       $.fn.slider = function (methodOrOptions) {
         if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
         } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
         } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
         }
       }; // Plugin end
      

      })(jQuery);

      (function ($) {
       $(document).ready(function () {
      
         $(document).on('click.card', '.card', function (e) {
           if ($(this).find('> .card-reveal').length) {
             var $card = $(e.target).closest('.card');
             if ($card.data('initialOverflow') === undefined) {
               $card.data('initialOverflow', $card.css('overflow') === undefined ?  : $card.css('overflow'));
             }
             if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
               // Make Reveal animate down and display none
               $(this).find('.card-reveal').velocity({ translateY: 0 }, {
                 duration: 225,
                 queue: false,
                 easing: 'easeInOutQuad',
                 complete: function () {
                   $(this).css({ display: 'none' });
                   $card.css('overflow', $card.data('initialOverflow'));
                 }
               });
             } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
               $card.css('overflow', 'hidden');
               $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
             }
           }
         });
       });
      

      })(jQuery);

      (function ($) {
       var materialChipsDefaults = {
         data: [],
         placeholder: ,
         secondaryPlaceholder: ,
         autocompleteOptions: {}
       };
      
       $(document).ready(function () {
         // Handle removal of static chips.
         $(document).on('click', '.chip .close', function (e) {
           var $chips = $(this).closest('.chips');
           if ($chips.attr('data-initialized')) {
             return;
           }
           $(this).closest('.chip').remove();
         });
       });
      
       $.fn.material_chip = function (options) {
         var self = this;
         this.$el = $(this);
         this.$document = $(document);
         this.SELS = {
           CHIPS: '.chips',
           CHIP: '.chip',
           INPUT: 'input',
           DELETE: '.material-icons',
           SELECTED_CHIP: '.selected'
         };
      
         if ('data' === options) {
           return this.$el.data('chips');
         }
      
         var curr_options = $.extend({}, materialChipsDefaults, options);
         self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
      
         // Initialize
         this.init = function () {
           var i = 0;
           var chips;
           self.$el.each(function () {
             var $chips = $(this);
             var chipId = Materialize.guid();
             self.chipId = chipId;
      
             if (!curr_options.data || !(curr_options.data instanceof Array)) {
               curr_options.data = [];
             }
             $chips.data('chips', curr_options.data);
             $chips.attr('data-index', i);
             $chips.attr('data-initialized', true);
      
             if (!$chips.hasClass(self.SELS.CHIPS)) {
               $chips.addClass('chips');
             }
      
             self.chips($chips, chipId);
             i++;
           });
         };
      
         this.handleEvents = function () {
           var SELS = self.SELS;
      
           self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
             $(e.target).find(SELS.INPUT).focus();
           });
      
           self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
             var $chip = $(e.target);
             if ($chip.length) {
               var wasSelected = $chip.hasClass('selected');
               var $chips = $chip.closest(SELS.CHIPS);
               $(SELS.CHIP).removeClass('selected');
      
               if (!wasSelected) {
                 self.selectChip($chip.index(), $chips);
               }
             }
           });
      
           self.$document.off('keydown.chips').on('keydown.chips', function (e) {
             if ($(e.target).is('input, textarea')) {
               return;
             }
      
             // delete
             var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
             var $chips = $chip.closest(SELS.CHIPS);
             var length = $chip.siblings(SELS.CHIP).length;
             var index;
      
             if (!$chip.length) {
               return;
             }
      
             if (e.which === 8 || e.which === 46) {
               e.preventDefault();
      
               index = $chip.index();
               self.deleteChip(index, $chips);
      
               var selectIndex = null;
               if (index + 1 < length) {
                 selectIndex = index;
               } else if (index === length || index + 1 === length) {
                 selectIndex = length - 1;
               }
      
               if (selectIndex < 0) selectIndex = null;
      
               if (null !== selectIndex) {
                 self.selectChip(selectIndex, $chips);
               }
               if (!length) $chips.find('input').focus();
      
               // left
             } else if (e.which === 37) {
               index = $chip.index() - 1;
               if (index < 0) {
                 return;
               }
               $(SELS.CHIP).removeClass('selected');
               self.selectChip(index, $chips);
      
               // right
             } else if (e.which === 39) {
               index = $chip.index() + 1;
               $(SELS.CHIP).removeClass('selected');
               if (index > length) {
                 $chips.find('input').focus();
                 return;
               }
               self.selectChip(index, $chips);
             }
           });
      
           self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
             var $currChips = $(e.target).closest(SELS.CHIPS);
             $currChips.addClass('focus');
             $currChips.siblings('label, .prefix').addClass('active');
             $(SELS.CHIP).removeClass('selected');
           });
      
           self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
             var $currChips = $(e.target).closest(SELS.CHIPS);
             $currChips.removeClass('focus');
      
             // Remove active if empty
             if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
               $currChips.siblings('label').removeClass('active');
             }
             $currChips.siblings('.prefix').removeClass('active');
           });
      
           self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
             var $target = $(e.target);
             var $chips = $target.closest(SELS.CHIPS);
             var chipsLength = $chips.children(SELS.CHIP).length;
      
             // enter
             if (13 === e.which) {
               // Override enter if autocompleting.
               if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
                 return;
               }
      
               e.preventDefault();
               self.addChip({ tag: $target.val() }, $chips);
               $target.val();
               return;
             }
      
             // delete or left
             if ((8 === e.keyCode || 37 === e.keyCode) &&  === $target.val() && chipsLength) {
               e.preventDefault();
               self.selectChip(chipsLength - 1, $chips);
               $target.blur();
               return;
             }
           });
      
           // Click on delete icon in chip.
           self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
             var $target = $(e.target);
             var $chips = $target.closest(SELS.CHIPS);
             var $chip = $target.closest(SELS.CHIP);
             e.stopPropagation();
             self.deleteChip($chip.index(), $chips);
             $chips.find('input').focus();
           });
         };
      
         this.chips = function ($chips, chipId) {
           $chips.empty();
           $chips.data('chips').forEach(function (elem) {
             $chips.append(self.renderChip(elem));
           });
           $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
           self.setPlaceholder($chips);
      
           // Set for attribute for label
           var label = $chips.next('label');
           if (label.length) {
             label.attr('for', chipId);
      
             if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
               label.addClass('active');
             }
           }
      
           // Setup autocomplete if needed.
           var input = $('#' + chipId);
           if (self.hasAutocomplete) {
             curr_options.autocompleteOptions.onAutocomplete = function (val) {
               self.addChip({ tag: val }, $chips);
               input.val();
               input.focus();
             };
             input.autocomplete(curr_options.autocompleteOptions);
           }
         };
      
         /**
          * Render chip jQuery element.
          * @param {Object} elem
          * @return {jQuery}
          */
         this.renderChip = function (elem) {
           if (!elem.tag) return;
      
      var $renderedChip = $('
      ');
           $renderedChip.text(elem.tag);
           if (elem.image) {
             $renderedChip.prepend($('<img />').attr('src', elem.image));
           }
           $renderedChip.append($('<i class="material-icons close">close'));
           return $renderedChip;
         };
      
         this.setPlaceholder = function ($chips) {
           if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
             $chips.find('input').prop('placeholder', curr_options.placeholder);
           } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
             $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
           }
         };
      
         this.isValid = function ($chips, elem) {
           var chips = $chips.data('chips');
           var exists = false;
           for (var i = 0; i < chips.length; i++) {
             if (chips[i].tag === elem.tag) {
               exists = true;
               return;
             }
           }
           return  !== elem.tag && !exists;
         };
      
         this.addChip = function (elem, $chips) {
           if (!self.isValid($chips, elem)) {
             return;
           }
           var $renderedChip = self.renderChip(elem);
           var newData = [];
           var oldData = $chips.data('chips');
           for (var i = 0; i < oldData.length; i++) {
             newData.push(oldData[i]);
           }
           newData.push(elem);
      
           $chips.data('chips', newData);
           $renderedChip.insertBefore($chips.find('input'));
           $chips.trigger('chip.add', elem);
           self.setPlaceholder($chips);
         };
      
         this.deleteChip = function (chipIndex, $chips) {
           var chip = $chips.data('chips')[chipIndex];
           $chips.find('.chip').eq(chipIndex).remove();
      
           var newData = [];
           var oldData = $chips.data('chips');
           for (var i = 0; i < oldData.length; i++) {
             if (i !== chipIndex) {
               newData.push(oldData[i]);
             }
           }
      
           $chips.data('chips', newData);
           $chips.trigger('chip.delete', chip);
           self.setPlaceholder($chips);
         };
      
         this.selectChip = function (chipIndex, $chips) {
           var $chip = $chips.find('.chip').eq(chipIndex);
           if ($chip && false === $chip.hasClass('selected')) {
             $chip.addClass('selected');
             $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
           }
         };
      
         this.getChipsElement = function (index, $chips) {
           return $chips.eq(index);
         };
      
         // init
         this.init();
      
         this.handleEvents();
       };
      

      })(jQuery);

      (function ($) {
       $.fn.pushpin = function (options) {
           console.log(options.bottom);
         // Defaults
         var defaults = {
           top: 0,
           bottom: Infinity,
           offset: 0
         };
      
         // Remove pushpin event and classes
         if (options === "remove") {
           this.each(function () {
             if (id = $(this).data('pushpin-id')) {
               $(window).off('scroll.' + id);
               $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
             }
           });
           return false;
         }
      
         options = $.extend(defaults, options);
      
         $index = 0;
         return this.each(function () {
           var $uniqueId = Materialize.guid(),
               $this = $(this),
               $original_offset = $(this).offset().top;
      
           function removePinClasses(object) {
             object.removeClass('pin-top');
             object.removeClass('pinned');
             object.removeClass('pin-bottom');
           }
      
           function updateElements(objects, scrolled) {
             objects.each(function () {
               // Add position fixed (because its between top and bottom)
               if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
                 removePinClasses($(this));
                 $(this).css('top', options.offset);
                 $(this).addClass('pinned');
               }
      
               // Add pin-top (when scrolled position is above top)
               if (scrolled < options.top && !$(this).hasClass('pin-top')) {
                 removePinClasses($(this));
                   console.log(scrolled);
                   console.log(options.top);
                 $(this).css('top', 0);
                 $(this).addClass('pin-top');
               }
      
               // Add pin-bottom (when scrolled position is below bottom)
               if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
                   console.log(scrolled);
                   console.log(options.bottom);
                 removePinClasses($(this));
                 $(this).addClass('pin-bottom');
                 $(this).css('top', options.bottom - $original_offset);
               }
             });
           }
      
           $(this).data('pushpin-id', $uniqueId);
           updateElements($this, $(window).scrollTop());
           $(window).on('scroll.' + $uniqueId, function () {
             var $scrolled = $(window).scrollTop() + options.offset;
             updateElements($this, $scrolled);
           });
         });
       };
      

      })(jQuery);;(function ($) {

       $(document).ready(function () {
      
         // jQuery reverse
         $.fn.reverse = [].reverse;
      
         // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
         $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
           var $this = $(this);
           openFABMenu($this);
         });
         $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
           var $this = $(this);
           closeFABMenu($this);
         });
      
         // Toggle-on-click behaviour.
         $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
           var $this = $(this);
           var $menu = $this.parent();
           if ($menu.hasClass('active')) {
             closeFABMenu($menu);
           } else {
             openFABMenu($menu);
           }
         });
      
         // Toolbar transition behaviour.
         $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
           var $this = $(this);
           var $menu = $this.parent();
           FABtoToolbar($menu);
         });
       });
      
       $.fn.extend({
         openFAB: function () {
           openFABMenu($(this));
         },
         closeFAB: function () {
           closeFABMenu($(this));
         },
         openToolbar: function () {
           FABtoToolbar($(this));
         },
         closeToolbar: function () {
           toolbarToFAB($(this));
         }
       });
      
       var openFABMenu = function (btn) {
         var $this = btn;
         if ($this.hasClass('active') === false) {
      
           // Get direction option
           var horizontal = $this.hasClass('horizontal');
           var offsetY, offsetX;
      
           if (horizontal === true) {
             offsetX = 40;
           } else {
             offsetY = 40;
           }
      
           $this.addClass('active');
           $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
      
           var time = 0;
           $this.find('ul .btn-floating').reverse().each(function () {
             $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
             time += 40;
           });
         }
       };
      
       var closeFABMenu = function (btn) {
         var $this = btn;
         // Get direction option
         var horizontal = $this.hasClass('horizontal');
         var offsetY, offsetX;
      
         if (horizontal === true) {
           offsetX = 40;
         } else {
           offsetY = 40;
         }
      
         $this.removeClass('active');
         var time = 0;
         $this.find('ul .btn-floating').velocity("stop", true);
         $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
       };
      
       /**
        * Transform FAB into toolbar
        * @param  {Object}  object jQuery object
        */
       var FABtoToolbar = function (btn) {
         if (btn.attr('data-open') === "true") {
           return;
         }
      
         var offsetX, offsetY, scaleFactor;
         var windowWidth = window.innerWidth;
         var windowHeight = window.innerHeight;
         var btnRect = btn[0].getBoundingClientRect();
         var anchor = btn.find('> a').first();
         var menu = btn.find('> ul').first();
      
      var backdrop = $('
      ');
         var fabColor = anchor.css('background-color');
         anchor.append(backdrop);
      
         offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
         offsetY = windowHeight - btnRect.bottom;
         scaleFactor = windowWidth / backdrop.width();
         btn.attr('data-origin-bottom', btnRect.bottom);
         btn.attr('data-origin-left', btnRect.left);
         btn.attr('data-origin-width', btnRect.width);
      
         // Set initial state
         btn.addClass('active');
         btn.attr('data-open', true);
         btn.css({
           'text-align': 'center',
           width: '100%',
           bottom: 0,
           left: 0,
           transform: 'translateX(' + offsetX + 'px)',
           transition: 'none'
         });
         anchor.css({
           transform: 'translateY(' + -offsetY + 'px)',
           transition: 'none'
         });
         backdrop.css({
           'background-color': fabColor
         });
      
         setTimeout(function () {
           btn.css({
             transform: ,
             transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
           });
           anchor.css({
             overflow: 'visible',
             transform: ,
             transition: 'transform .2s'
           });
      
           setTimeout(function () {
             btn.css({
               overflow: 'hidden',
               'background-color': fabColor
             });
             backdrop.css({
               transform: 'scale(' + scaleFactor + ')',
               transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
             });
             menu.find('> li > a').css({
               opacity: 1
             });
      
             // Scroll to close.
             $(window).on('scroll.fabToolbarClose', function () {
               toolbarToFAB(btn);
               $(window).off('scroll.fabToolbarClose');
               $(document).off('click.fabToolbarClose');
             });
      
             $(document).on('click.fabToolbarClose', function (e) {
               if (!$(e.target).closest(menu).length) {
                 toolbarToFAB(btn);
                 $(window).off('scroll.fabToolbarClose');
                 $(document).off('click.fabToolbarClose');
               }
             });
           }, 100);
         }, 0);
       };
      
       /**
        * Transform toolbar back into FAB
        * @param  {Object}  object jQuery object
        */
       var toolbarToFAB = function (btn) {
         if (btn.attr('data-open') !== "true") {
           return;
         }
      
         var offsetX, offsetY, scaleFactor;
         var windowWidth = window.innerWidth;
         var windowHeight = window.innerHeight;
         var btnWidth = btn.attr('data-origin-width');
         var btnBottom = btn.attr('data-origin-bottom');
         var btnLeft = btn.attr('data-origin-left');
         var anchor = btn.find('> .btn-floating').first();
         var menu = btn.find('> ul').first();
         var backdrop = btn.find('.fab-backdrop');
         var fabColor = anchor.css('background-color');
      
         offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
         offsetY = windowHeight - btnBottom;
         scaleFactor = windowWidth / backdrop.width();
      
         // Hide backdrop
         btn.removeClass('active');
         btn.attr('data-open', false);
         btn.css({
           'background-color': 'transparent',
           transition: 'none'
         });
         anchor.css({
           transition: 'none'
         });
         backdrop.css({
           transform: 'scale(0)',
           'background-color': fabColor
         });
         menu.find('> li > a').css({
           opacity: 
         });
      
         setTimeout(function () {
           backdrop.remove();
      
           // Set initial state.
           btn.css({
             'text-align': ,
             width: ,
             bottom: ,
             left: ,
             overflow: ,
             'background-color': ,
             transform: 'translate3d(' + -offsetX + 'px,0,0)'
           });
           anchor.css({
             overflow: ,
             transform: 'translate3d(0,' + offsetY + 'px,0)'
           });
      
           setTimeout(function () {
             btn.css({
               transform: 'translate3d(0,0,0)',
               transition: 'transform .2s'
             });
             anchor.css({
               transform: 'translate3d(0,0,0)',
               transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
             });
           }, 20);
         }, 200);
       };
      

      })(jQuery);

      (function ($) {
       // Image transition function
       Materialize.fadeInImage = function (selectorOrEl) {
         var element;
         if (typeof selectorOrEl === 'string') {
           element = $(selectorOrEl);
         } else if (typeof selectorOrEl === 'object') {
           element = selectorOrEl;
         } else {
           return;
         }
         element.css({ opacity: 0 });
         $(element).velocity({ opacity: 1 }, {
           duration: 650,
           queue: false,
           easing: 'easeOutSine'
         });
         $(element).velocity({ opacity: 1 }, {
           duration: 1300,
           queue: false,
           easing: 'swing',
           step: function (now, fx) {
             fx.start = 100;
             var grayscale_setting = now / 100;
             var brightness_setting = 150 - (100 - now) / 1.75;
      
             if (brightness_setting < 100) {
               brightness_setting = 100;
             }
             if (now >= 0) {
               $(this).css({
                 "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
                 "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
               });
             }
           }
         });
       };
      
       // Horizontal staggered list
       Materialize.showStaggeredList = function (selectorOrEl) {
         var element;
         if (typeof selectorOrEl === 'string') {
           element = $(selectorOrEl);
         } else if (typeof selectorOrEl === 'object') {
           element = selectorOrEl;
         } else {
           return;
         }
         var time = 0;
         element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
      
         element.find('li').each(function () {
           $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
           time += 120;
         });
       };
      
       $(document).ready(function () {
         // Hardcoded .staggered-list scrollFire
         // var staggeredListOptions = [];
         // $('ul.staggered-list').each(function (i) {
      
         //   var label = 'scrollFire-' + i;
         //   $(this).addClass(label);
         //   staggeredListOptions.push(
         //     {selector: 'ul.staggered-list.' + label,
         //      offset: 200,
         //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
         // });
         // scrollFire(staggeredListOptions);
      
         // HammerJS, Swipe navigation
      
         // Touch Event
         var swipeLeft = false;
         var swipeRight = false;
      
         // Dismissible Collections
         $('.dismissable').each(function () {
           $(this).hammer({
             prevent_default: false
           }).on('pan', function (e) {
             if (e.gesture.pointerType === "touch") {
               var $this = $(this);
               var direction = e.gesture.direction;
               var x = e.gesture.deltaX;
               var velocityX = e.gesture.velocityX;
      
               $this.velocity({ translateX: x
               }, { duration: 50, queue: false, easing: 'easeOutQuad' });
      
               // Swipe Left
               if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
                 swipeLeft = true;
               }
      
               // Swipe Right
               if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
                 swipeRight = true;
               }
             }
           }).on('panend', function (e) {
             // Reset if collection is moved back into original position
             if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
               swipeRight = false;
               swipeLeft = false;
             }
      
             if (e.gesture.pointerType === "touch") {
               var $this = $(this);
               if (swipeLeft || swipeRight) {
                 var fullWidth;
                 if (swipeLeft) {
                   fullWidth = $this.innerWidth();
                 } else {
                   fullWidth = -1 * $this.innerWidth();
                 }
      
                 $this.velocity({ translateX: fullWidth
                 }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
                     $this.css('border', 'none');
                     $this.velocity({ height: 0, padding: 0
                     }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
                         $this.remove();
                       }
                     });
                   }
                 });
               } else {
                 $this.velocity({ translateX: 0
                 }, { duration: 100, queue: false, easing: 'easeOutQuad' });
               }
               swipeLeft = false;
               swipeRight = false;
             }
           });
         });
      
         // time = 0
         // // Vertical Staggered list
         // $('ul.staggered-list.vertical li').velocity(
         //     { translateY: "100px"},
         //     { duration: 0 });
      
         // $('ul.staggered-list.vertical li').each(function() {
         //   $(this).velocity(
         //     { opacity: "1", translateY: "0"},
         //     { duration: 800, delay: time, easing: [60, 25] });
         //   time += 120;
         // });
      
         // // Fade in and Scale
         // $('.fade-in.scale').velocity(
         //     { scaleX: .4, scaleY: .4, translateX: -600},
         //     { duration: 0});
         // $('.fade-in').each(function() {
         //   $(this).velocity(
         //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
         //     { duration: 800, easing: [60, 10] });
         // });
       });
      

      })(jQuery);

      (function ($) {
       var scrollFireEventsHandled = false;
      
       // Input: Array of JSON objects {selector, offset, callback}
       Materialize.scrollFire = function (options) {
         var onScroll = function () {
           var windowScroll = window.pageYOffset + window.innerHeight;
      
           for (var i = 0; i < options.length; i++) {
             // Get options from each line
             var value = options[i];
             var selector = value.selector,
                 offset = value.offset,
                 callback = value.callback;
      
             var currentElement = document.querySelector(selector);
             if (currentElement !== null) {
               var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
      
               if (windowScroll > elementOffset + offset) {
                 if (value.done !== true) {
                   if (typeof callback === 'function') {
                     callback.call(this, currentElement);
                   } else if (typeof callback === 'string') {
                     var callbackFunc = new Function(callback);
                     callbackFunc(currentElement);
                   }
                   value.done = true;
                 }
               }
             }
           }
         };
      
         var throttledScroll = Materialize.throttle(function () {
           onScroll();
         }, options.throttle || 100);
      
         if (!scrollFireEventsHandled) {
           window.addEventListener("scroll", throttledScroll);
           window.addEventListener("resize", throttledScroll);
           scrollFireEventsHandled = true;
         }
      
         // perform a scan once, after current execution context, and after dom is ready
         setTimeout(throttledScroll, 0);
       };
      

      })(jQuery);

      /*!
       * pickadate.js v3.5.0, 2014/04/13
       * By Amsul, http://amsul.ca
       * Hosted on http://amsul.github.io/pickadate.js
       * Licensed under MIT
       */
      

      (function (factory) {

       Materialize.Picker = factory(jQuery);
      

      })(function ($) {

       var $window = $(window);
       var $document = $(document);
       var $html = $(document.documentElement);
      
       /**
        * The picker constructor that creates a blank picker.
        */
       function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
      
         // If there’s no element, return the picker constructor.
         if (!ELEMENT) return PickerConstructor;
      
         var IS_DEFAULT_THEME = false,
      


         // The state of the picker.
         STATE = {
           id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
         },
      


         // Merge the defaults and options passed.
         SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
      


         // Merge the default classes with the settings classes.
         CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
      


         // The element node wrapper into a jQuery object.
         $ELEMENT = $(ELEMENT),
      


         // Pseudo picker constructor.
         PickerInstance = function () {
           return this.start();
         },
      


         // The picker prototype.
         P = PickerInstance.prototype = {
      
           constructor: PickerInstance,
      
           $node: $ELEMENT,
      
           /**
            * Initialize everything
            */
           start: function () {
      
             // If it’s already started, do nothing.
             if (STATE && STATE.start) return P;
      
             // Update the picker states.
             STATE.methods = {};
             STATE.start = true;
             STATE.open = false;
             STATE.type = ELEMENT.type;
      
             // Confirm focus state, convert into text input to remove UA stylings,
             // and set as readonly to prevent keyboard popup.
             ELEMENT.autofocus = ELEMENT == getActiveElement();
             ELEMENT.readOnly = !SETTINGS.editable;
             ELEMENT.id = ELEMENT.id || STATE.id;
             if (ELEMENT.type != 'text') {
               ELEMENT.type = 'text';
             }
      
             // Create a new picker component with the settings.
             P.component = new COMPONENT(P, SETTINGS);
      
             // Create the picker root with a holder and then prepare it.
             P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
             prepareElementRoot();
      
             // If there’s a format for the hidden input element, create the element.
             if (SETTINGS.formatSubmit) {
               prepareElementHidden();
             }
      
             // Prepare the input element.
             prepareElement();
      
             // Insert the root as specified in the settings.
             if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
      
             // Bind the default component and settings events.
             P.on({
               start: P.component.onStart,
               render: P.component.onRender,
               stop: P.component.onStop,
               open: P.component.onOpen,
               close: P.component.onClose,
               set: P.component.onSet
             }).on({
               start: SETTINGS.onStart,
               render: SETTINGS.onRender,
               stop: SETTINGS.onStop,
               open: SETTINGS.onOpen,
               close: SETTINGS.onClose,
               set: SETTINGS.onSet
             });
      
             // Once we’re all set, check the theme in use.
             IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
      
             // If the element has autofocus, open the picker.
             if (ELEMENT.autofocus) {
               P.open();
             }
      
             // Trigger queued the “start” and “render” events.
             return P.trigger('start').trigger('render');
           }, //start
      


           /**
            * Render a new picker
            */
           render: function (entireComponent) {
      
             // Insert a new component holder in the root or box.
             if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
      
             // Trigger the queued “render” events.
             return P.trigger('render');
           }, //render
      


           /**
            * Destroy everything
            */
           stop: function () {
      
             // If it’s already stopped, do nothing.
             if (!STATE.start) return P;
      
             // Then close the picker.
             P.close();
      
             // Remove the hidden field.
             if (P._hidden) {
               P._hidden.parentNode.removeChild(P._hidden);
             }
      
             // Remove the root.
             P.$root.remove();
      
             // Remove the input class, remove the stored data, and unbind
             // the events (after a tick for IE - see `P.close`).
             $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
             setTimeout(function () {
               $ELEMENT.off('.' + STATE.id);
             }, 0);
      
             // Restore the element state
             ELEMENT.type = STATE.type;
             ELEMENT.readOnly = false;
      
             // Trigger the queued “stop” events.
             P.trigger('stop');
      
             // Reset the picker states.
             STATE.methods = {};
             STATE.start = false;
      
             return P;
           }, //stop
      


           /**
            * Open up the picker
            */
           open: function (dontGiveFocus) {
      
             // If it’s already open, do nothing.
             if (STATE.open) return P;
      
             // Add the “active” class.
             $ELEMENT.addClass(CLASSES.active);
             aria(ELEMENT, 'expanded', true);
      
             // * A Firefox bug, when `html` has `overflow:hidden`, results in
             //   killing transitions :(. So add the “opened” state on the next tick.
             //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
             setTimeout(function () {
      
               // Add the “opened” class to the picker root.
               P.$root.addClass(CLASSES.opened);
               aria(P.$root[0], 'hidden', false);
             }, 0);
      
             // If we have to give focus, bind the element and doc events.
             if (dontGiveFocus !== false) {
      
               // Set it as open.
               STATE.open = true;
      
               // Prevent the page from scrolling.
               if (IS_DEFAULT_THEME) {
                 $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
               }
      
               // Pass focus to the root element’s jQuery object.
               // * Workaround for iOS8 to bring the picker’s root into view.
               P.$root.eq(0).focus();
      
               // Bind the document events.
               $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
      
                 var target = event.target;
      
                 // If the target of the event is not the element, close the picker picker.
                 // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
                 //   Also, for Firefox, a click on an `option` element bubbles up directly
                 //   to the doc. So make sure the target wasn't the doc.
                 // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
                 //   which causes the picker to unexpectedly close when right-clicking it. So make
                 //   sure the event wasn’t a right-click.
                 if (target != ELEMENT && target != document && event.which != 3) {
      
                   // If the target was the holder that covers the screen,
                   // keep the element focused to maintain tabindex.
                   P.close(target === P.$root.children()[0]);
                 }
               }).on('keydown.' + STATE.id, function (event) {
      
                 var
                 // Get the keycode.
                 keycode = event.keyCode,
      


                 // Translate that to a selection change.
                 keycodeToMove = P.component.key[keycode],
      


                 // Grab the target.
                 target = event.target;
      
                 // On escape, close the picker and give focus.
                 if (keycode == 27) {
                   P.close(true);
                 }
      
                 // Check if there is a key movement or “enter” keypress on the element.
                 else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
      
                     // Prevent the default action to stop page movement.
                     event.preventDefault();
      
                     // Trigger the key movement action.
                     if (keycodeToMove) {
                       PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
                     }
      
                     // On “enter”, if the highlighted item isn’t disabled, set the value and close.
                     else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
                         P.set('select', P.component.item.highlight);
                         if (SETTINGS.closeOnSelect) {
                           P.close(true);
                         }
                       }
                   }
      
                   // If the target is within the root and “enter” is pressed,
                   // prevent the default action and trigger a click on the target instead.
                   else if ($.contains(P.$root[0], target) && keycode == 13) {
                       event.preventDefault();
                       target.click();
                     }
               });
             }
      
             // Trigger the queued “open” events.
             return P.trigger('open');
           }, //open
      


           /**
            * Close the picker
            */
           close: function (giveFocus) {
      
             // If we need to give focus, do it before changing states.
             if (giveFocus) {
               // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
               // The focus is triggered *after* the close has completed - causing it
               // to open again. So unbind and rebind the event at the next tick.
               P.$root.off('focus.toOpen').eq(0).focus();
               setTimeout(function () {
                 P.$root.on('focus.toOpen', handleFocusToOpenEvent);
               }, 0);
             }
      
             // Remove the “active” class.
             $ELEMENT.removeClass(CLASSES.active);
             aria(ELEMENT, 'expanded', false);
      
             // * A Firefox bug, when `html` has `overflow:hidden`, results in
             //   killing transitions :(. So remove the “opened” state on the next tick.
             //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
             setTimeout(function () {
      
               // Remove the “opened” and “focused” class from the picker root.
               P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
               aria(P.$root[0], 'hidden', true);
             }, 0);
      
             // If it’s already closed, do nothing more.
             if (!STATE.open) return P;
      
             // Set it as closed.
             STATE.open = false;
      
             // Allow the page to scroll.
             if (IS_DEFAULT_THEME) {
               $html.css('overflow', ).css('padding-right', '-=' + getScrollbarWidth());
             }
      
             // Unbind the document events.
             $document.off('.' + STATE.id);
      
             // Trigger the queued “close” events.
             return P.trigger('close');
           }, //close
      


           /**
            * Clear the values
            */
           clear: function (options) {
             return P.set('clear', null, options);
           }, //clear
      


           /**
            * Set something
            */
           set: function (thing, value, options) {
      
             var thingItem,
                 thingValue,
                 thingIsObject = $.isPlainObject(thing),
                 thingObject = thingIsObject ? thing : {};
      
             // Make sure we have usable options.
             options = thingIsObject && $.isPlainObject(value) ? value : options || {};
      
             if (thing) {
      
               // If the thing isn’t an object, make it one.
               if (!thingIsObject) {
                 thingObject[thing] = value;
               }
      
               // Go through the things of items to set.
               for (thingItem in thingObject) {
      
                 // Grab the value of the thing.
                 thingValue = thingObject[thingItem];
      
                 // First, if the item exists and there’s a value, set it.
                 if (thingItem in P.component.item) {
                   if (thingValue === undefined) thingValue = null;
                   P.component.set(thingItem, thingValue, options);
                 }
      
                 // Then, check to update the element value and broadcast a change.
                 if (thingItem == 'select' || thingItem == 'clear') {
                   $ELEMENT.val(thingItem == 'clear' ?  : P.get(thingItem, SETTINGS.format)).trigger('change');
                 }
               }
      
               // Render a new picker.
               P.render();
             }
      
             // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
             return options.muted ? P : P.trigger('set', thingObject);
           }, //set
      


           /**
            * Get something
            */
           get: function (thing, format) {
      
             // Make sure there’s something to get.
             thing = thing || 'value';
      
             // If a picker state exists, return that.
             if (STATE[thing] != null) {
               return STATE[thing];
             }
      
             // Return the submission value, if that.
             if (thing == 'valueSubmit') {
               if (P._hidden) {
                 return P._hidden.value;
               }
               thing = 'value';
             }
      
             // Return the value, if that.
             if (thing == 'value') {
               return ELEMENT.value;
             }
      
             // Check if a component item exists, return that.
             if (thing in P.component.item) {
               if (typeof format == 'string') {
                 var thingValue = P.component.get(thing);
                 return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : ;
               }
               return P.component.get(thing);
             }
           }, //get
      


           /**
            * Bind events on the things.
            */
           on: function (thing, method, internal) {
      
             var thingName,
                 thingMethod,
                 thingIsObject = $.isPlainObject(thing),
                 thingObject = thingIsObject ? thing : {};
      
             if (thing) {
      
               // If the thing isn’t an object, make it one.
               if (!thingIsObject) {
                 thingObject[thing] = method;
               }
      
               // Go through the things to bind to.
               for (thingName in thingObject) {
      
                 // Grab the method of the thing.
                 thingMethod = thingObject[thingName];
      
                 // If it was an internal binding, prefix it.
                 if (internal) {
                   thingName = '_' + thingName;
                 }
      
                 // Make sure the thing methods collection exists.
                 STATE.methods[thingName] = STATE.methods[thingName] || [];
      
                 // Add the method to the relative method collection.
                 STATE.methods[thingName].push(thingMethod);
               }
             }
      
             return P;
           }, //on
      


           /**
            * Unbind events on the things.
            */
           off: function () {
             var i,
                 thingName,
                 names = arguments;
             for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
               thingName = names[i];
               if (thingName in STATE.methods) {
                 delete STATE.methods[thingName];
               }
             }
             return P;
           },
      
           /**
            * Fire off method events.
            */
           trigger: function (name, data) {
             var _trigger = function (name) {
               var methodList = STATE.methods[name];
               if (methodList) {
                 methodList.map(function (method) {
                   PickerConstructor._.trigger(method, P, [data]);
                 });
               }
             };
             _trigger('_' + name);
             _trigger(name);
             return P;
           } //trigger
           //PickerInstance.prototype
      


           /**
            * Wrap the picker holder components together.
            */
         };function createWrappedComponent() {
      
           // Create a picker wrapper holder
           return PickerConstructor._.node('div',
      
           // Create a picker wrapper node
           PickerConstructor._.node('div',
      
           // Create a picker frame
           PickerConstructor._.node('div',
      
           // Create a picker box node
           PickerConstructor._.node('div',
      
           // Create the components nodes.
           P.component.nodes(STATE.open),
      
           // The picker box class
           CLASSES.box),
      
           // Picker wrap class
           CLASSES.wrap),
      
           // Picker frame class
           CLASSES.frame),
      
           // Picker holder class
           CLASSES.holder); //endreturn
         } //createWrappedComponent
      


         /**
          * Prepare the input element with all bindings.
          */
         function prepareElement() {
      
           $ELEMENT.
      
           // Store the picker data by component name.
           data(NAME, P).
      
           // Add the “input” class name.
           addClass(CLASSES.input).
      
           // Remove the tabindex.
           attr('tabindex', -1).
      
           // If there’s a `data-value`, update the value of the element.
           val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
      
           // Only bind keydown events if the element isn’t editable.
           if (!SETTINGS.editable) {
      
             $ELEMENT.
      
             // On focus/click, focus onto the root to open it up.
             on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
               event.preventDefault();
               P.$root.eq(0).focus();
             }).
      
             // Handle keyboard event based on the picker being opened or not.
             on('keydown.' + STATE.id, handleKeydownEvent);
           }
      
           // Update the aria attributes.
           aria(ELEMENT, {
             haspopup: true,
             expanded: false,
             readonly: false,
             owns: ELEMENT.id + '_root'
           });
         }
      
         /**
          * Prepare the root picker element with all bindings.
          */
         function prepareElementRoot() {
      
           P.$root.on({
      
             // For iOS8.
             keydown: handleKeydownEvent,
      
             // When something within the root is focused, stop from bubbling
             // to the doc and remove the “focused” state from the root.
             focusin: function (event) {
               P.$root.removeClass(CLASSES.focused);
               event.stopPropagation();
             },
      
             // When something within the root holder is clicked, stop it
             // from bubbling to the doc.
             'mousedown click': function (event) {
      
               var target = event.target;
      
               // Make sure the target isn’t the root holder so it can bubble up.
               if (target != P.$root.children()[0]) {
      
                 event.stopPropagation();
      
                 // * For mousedown events, cancel the default action in order to
                 //   prevent cases where focus is shifted onto external elements
                 //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
                 //   Also, for Firefox, don’t prevent action on the `option` element.
                 if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
      
                   event.preventDefault();
      
                   // Re-focus onto the root so that users can click away
                   // from elements focused within the picker.
                   P.$root.eq(0).focus();
                 }
               }
             }
           }).
      
           // Add/remove the “target” class on focus and blur.
           on({
             focus: function () {
               $ELEMENT.addClass(CLASSES.target);
             },
             blur: function () {
               $ELEMENT.removeClass(CLASSES.target);
             }
           }).
      
           // Open the picker and adjust the root “focused” state
           on('focus.toOpen', handleFocusToOpenEvent).
      
           // If there’s a click on an actionable element, carry out the actions.
           on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
      
             var $target = $(this),
                 targetData = $target.data(),
                 targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
      


             // * For IE, non-focusable elements can be active elements as well
             //   (http://stackoverflow.com/a/2684561).
             activeElement = getActiveElement();
             activeElement = activeElement && (activeElement.type || activeElement.href);
      
             // If it’s disabled or nothing inside is actively focused, re-focus the element.
             if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
               P.$root.eq(0).focus();
             }
      
             // If something is superficially changed, update the `highlight` based on the `nav`.
             if (!targetDisabled && targetData.nav) {
               P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
             }
      
             // If something is picked, set `select` then close with focus.
             else if (!targetDisabled && 'pick' in targetData) {
                 P.set('select', targetData.pick);
                 if (SETTINGS.closeOnSelect) {
                   P.close(true);
                 }
               }
      
               // If a “clear” button is pressed, empty the values and close with focus.
               else if (targetData.clear) {
                   P.clear();
                   if (SETTINGS.closeOnSelect) {
                     P.close(true);
                   }
                 } else if (targetData.close) {
                   P.close(true);
                 }
           }); //P.$root
      
           aria(P.$root[0], 'hidden', true);
         }
      
         /**
          * Prepare the hidden input element along with all bindings.
          */
         function prepareElementHidden() {
      
           var name;
      
           if (SETTINGS.hiddenName === true) {
             name = ELEMENT.name;
             ELEMENT.name = ;
           } else {
             name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : , typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
             name = name[0] + ELEMENT.name + name[1];
           }
      
           P._hidden = $('<input ' + 'type=hidden ' +
      
           // Create the name using the original input’s with a prefix and suffix.
           'name="' + name + '"' + (
      
           // If the element has a value, set the hidden value as well.
           $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : ) + '>')[0];
      
           $ELEMENT.
      
           // If the value changes, update the hidden input with the correct format.
           on('change.' + STATE.id, function () {
             P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : ;
           });
      
           // Insert the hidden input as specified in the settings.
           if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
         }
      
         // For iOS8.
         function handleKeydownEvent(event) {
      
           var keycode = event.keyCode,
      


           // Check if one of the delete keys was pressed.
           isKeycodeDelete = /^(8|46)$/.test(keycode);
      
           // For some reason IE clears the input value on “escape”.
           if (keycode == 27) {
             P.close();
             return false;
           }
      
           // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
           if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
      
             // Prevent it from moving the page and bubbling to doc.
             event.preventDefault();
             event.stopPropagation();
      
             // If `delete` was pressed, clear the values and close the picker.
             // Otherwise open the picker.
             if (isKeycodeDelete) {
               P.clear().close();
             } else {
               P.open();
             }
           }
         }
      
         // Separated for IE
         function handleFocusToOpenEvent(event) {
      
           // Stop the event from propagating to the doc.
           event.stopPropagation();
      
           // If it’s a focus event, add the “focused” class to the root.
           if (event.type == 'focus') {
             P.$root.addClass(CLASSES.focused);
           }
      
           // And then finally open the picker.
           P.open();
         }
      
         // Return a new picker instance.
         return new PickerInstance();
       } //PickerConstructor
      


       /**
        * The default classes and prefix to use for the HTML classes.
        */
       PickerConstructor.klasses = function (prefix) {
         prefix = prefix || 'picker';
         return {
      
           picker: prefix,
           opened: prefix + '--opened',
           focused: prefix + '--focused',
      
           input: prefix + '__input',
           active: prefix + '__input--active',
           target: prefix + '__input--target',
      
           holder: prefix + '__holder',
      
           frame: prefix + '__frame',
           wrap: prefix + '__wrap',
      
           box: prefix + '__box'
         };
       }; //PickerConstructor.klasses
      


       /**
        * Check if the default theme is being used.
        */
       function isUsingDefaultTheme(element) {
      
         var theme,
             prop = 'position';
      
         // For IE.
         if (element.currentStyle) {
           theme = element.currentStyle[prop];
         }
      
         // For normal browsers.
         else if (window.getComputedStyle) {
             theme = getComputedStyle(element)[prop];
           }
      
         return theme == 'fixed';
       }
      
       /**
        * Get the width of the browser’s scrollbar.
        * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
        */
       function getScrollbarWidth() {
      
         if ($html.height() <= $window.height()) {
           return 0;
         }
      
         var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
      
         // Get the width without scrollbars.
         var widthWithoutScroll = $outer[0].offsetWidth;
      
         // Force adding scrollbars.
         $outer.css('overflow', 'scroll');
      
         // Add the inner div.
         var $inner = $('<div style="width:100%" />').appendTo($outer);
      
         // Get the width with scrollbars.
         var widthWithScroll = $inner[0].offsetWidth;
      
         // Remove the divs.
         $outer.remove();
      
         // Return the difference between the widths.
         return widthWithoutScroll - widthWithScroll;
       }
      
       /**
        * PickerConstructor helper methods.
        */
       PickerConstructor._ = {
      
         /**
          * Create a group of nodes. Expects:
          * `
             {
                 min:    {Integer},
                 max:    {Integer},
                 i:      {Integer},
                 node:   {String},
                 item:   {Function}
             }
          * `
          */
         group: function (groupObject) {
      
           var
           // Scope for the looped object
           loopObjectScope,
      


           // Create the nodes list
           nodesList = ,
      


           // The counter starts from the `min`
           counter = PickerConstructor._.trigger(groupObject.min, groupObject);
      
           // Loop from the `min` to `max`, incrementing by `i`
           for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
      
             // Trigger the `item` function within scope of the object
             loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
      
             // Splice the subgroup and create nodes out of the sub nodes
             nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
             loopObjectScope[1], // the classes
             loopObjectScope[2] // the attributes
             );
           }
      
           // Return the list of nodes
           return nodesList;
         }, //group
      


         /**
          * Create a dom node string
          */
         node: function (wrapper, item, klass, attribute) {
      
           // If the item is false-y, just return an empty string
           if (!item) return ;
      
           // If the item is an array, do a join
           item = $.isArray(item) ? item.join() : item;
      
           // Check for the class
           klass = klass ? ' class="' + klass + '"' : ;
      
           // Check for any attributes
           attribute = attribute ? ' ' + attribute : ;
      
           // Return the wrapped item
           return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
         }, //node
      


         /**
          * Lead numbers below 10 with a zero.
          */
         lead: function (number) {
           return (number < 10 ? '0' : ) + number;
         },
      
         /**
          * Trigger a function otherwise return the value.
          */
         trigger: function (callback, scope, args) {
           return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
         },
      
         /**
          * If the second character is a digit, length is 2 otherwise 1.
          */
         digits: function (string) {
           return (/\d/.test(string[1]) ? 2 : 1
           );
         },
      
         /**
          * Tell if something is a date object.
          */
         isDate: function (value) {
           return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
         },
      
         /**
          * Tell if something is an integer.
          */
         isInteger: function (value) {
           return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
         },
      
         /**
          * Create ARIA attribute strings.
          */
         ariaAttr: ariaAttr //PickerConstructor._
      


         /**
          * Extend the picker with a component and defaults.
          */
       };PickerConstructor.extend = function (name, Component) {
      
         // Extend jQuery.
         $.fn[name] = function (options, action) {
      
           // Grab the component data.
           var componentData = this.data(name);
      
           // If the picker is requested, return the data object.
           if (options == 'picker') {
             return componentData;
           }
      
           // If the component data exists and `options` is a string, carry out the action.
           if (componentData && typeof options == 'string') {
             return PickerConstructor._.trigger(componentData[options], componentData, [action]);
           }
      
           // Otherwise go through each matched element and if the component
           // doesn’t exist, create a new picker using `this` element
           // and merging the defaults and options with a deep copy.
           return this.each(function () {
             var $this = $(this);
             if (!$this.data(name)) {
               new PickerConstructor(this, name, Component, options);
             }
           });
         };
      
         // Set the defaults.
         $.fn[name].defaults = Component.defaults;
       }; //PickerConstructor.extend
      


       function aria(element, attribute, value) {
         if ($.isPlainObject(attribute)) {
           for (var key in attribute) {
             ariaSet(element, key, attribute[key]);
           }
         } else {
           ariaSet(element, attribute, value);
         }
       }
       function ariaSet(element, attribute, value) {
         element.setAttribute((attribute == 'role' ?  : 'aria-') + attribute, value);
       }
       function ariaAttr(attribute, data) {
         if (!$.isPlainObject(attribute)) {
           attribute = { attribute: data };
         }
         data = ;
         for (var key in attribute) {
           var attr = (key == 'role' ?  : 'aria-') + key,
               attrVal = attribute[key];
           data += attrVal == null ?  : attr + '="' + attribute[key] + '"';
         }
         return data;
       }
      
       // IE8 bug throws an error for activeElements within iframes.
       function getActiveElement() {
         try {
           return document.activeElement;
         } catch (err) {}
       }
      
       // Expose the picker constructor.
       return PickerConstructor;
      

      });

      /*!
       * Date picker for pickadate.js v3.5.0
       * http://amsul.github.io/pickadate.js/date.htm
       */
      

      (function (factory) {

       factory(Materialize.Picker, jQuery);
      

      })(function (Picker, $) {

       /**
        * Globals and constants
        */
       var DAYS_IN_WEEK = 7,
           WEEKS_IN_CALENDAR = 6,
           _ = Picker._;
      
       /**
        * The date picker constructor
        */
       function DatePicker(picker, settings) {
      
         var calendar = this,
             element = picker.$node[0],
             elementValue = element.value,
             elementDataValue = picker.$node.data('value'),
             valueString = elementDataValue || elementValue,
             formatString = elementDataValue ? settings.formatSubmit : settings.format,
             isRTL = function () {
      
           return element.currentStyle ?
      
           // For IE.
           element.currentStyle.direction == 'rtl' :
      
           // For normal browsers.
           getComputedStyle(picker.$root[0]).direction == 'rtl';
         };
      
         calendar.settings = settings;
         calendar.$node = picker.$node;
      
         // The queue of methods that will be used to build item objects.
         calendar.queue = {
           min: 'measure create',
           max: 'measure create',
           now: 'now create',
           select: 'parse create validate',
           highlight: 'parse navigate create validate',
           view: 'parse create validate viewset',
           disable: 'deactivate',
           enable: 'activate'
      
           // The component's item object.
         };calendar.item = {};
      
         calendar.item.clear = null;
         calendar.item.disable = (settings.disable || []).slice(0);
         calendar.item.enable = -function (collectionDisabled) {
           return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
         }(calendar.item.disable);
      
         calendar.set('min', settings.min).set('max', settings.max).set('now');
      
         // When there’s a value, set the `select`, which in turn
         // also sets the `highlight` and `view`.
         if (valueString) {
           calendar.set('select', valueString, { format: formatString });
         }
      
         // If there’s no value, default to highlighting “today”.
         else {
             calendar.set('select', null).set('highlight', calendar.item.now);
           }
      
         // The keycode to movement mapping.
         calendar.key = {
           40: 7, // Down
           38: -7, // Up
           39: function () {
             return isRTL() ? -1 : 1;
           }, // Right
           37: function () {
             return isRTL() ? 1 : -1;
           }, // Left
           go: function (timeChange) {
             var highlightedObject = calendar.item.highlight,
                 targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
             calendar.set('highlight', targetDate, { interval: timeChange });
             this.render();
           }
      
           // Bind some picker events.
         };picker.on('render', function () {
           picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
             var value = this.value;
             if (value) {
               picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
               picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
             }
           });
           picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
             var value = this.value;
             if (value) {
               picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
               picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
             }
           });
         }, 1).on('open', function () {
           var includeToday = ;
           if (calendar.disabled(calendar.get('now'))) {
             includeToday = ':not(.' + settings.klass.buttonToday + ')';
           }
           picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
         }, 1).on('close', function () {
           picker.$root.find('button, select').attr('disabled', true);
         }, 1);
       } //DatePicker
      


       /**
        * Set a datepicker item object.
        */
       DatePicker.prototype.set = function (type, value, options) {
      
         var calendar = this,
             calendarItem = calendar.item;
      
         // If the value is `null` just set it immediately.
         if (value === null) {
           if (type == 'clear') type = 'select';
           calendarItem[type] = value;
           return calendar;
         }
      
         // Otherwise go through the queue of methods, and invoke the functions.
         // Update this as the time unit, and set the final value as this item.
         // * In the case of `enable`, keep the queue but set `disable` instead.
         //   And in the case of `flip`, keep the queue but set `enable` instead.
         calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
           value = calendar[method](type, value, options);
           return value;
         }).pop();
      
         // Check if we need to cascade through more updates.
         if (type == 'select') {
           calendar.set('highlight', calendarItem.select, options);
         } else if (type == 'highlight') {
           calendar.set('view', calendarItem.highlight, options);
         } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
           if (calendarItem.select && calendar.disabled(calendarItem.select)) {
             calendar.set('select', calendarItem.select, options);
           }
           if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
             calendar.set('highlight', calendarItem.highlight, options);
           }
         }
      
         return calendar;
       }; //DatePicker.prototype.set
      


       /**
        * Get a datepicker item object.
        */
       DatePicker.prototype.get = function (type) {
         return this.item[type];
       }; //DatePicker.prototype.get
      


       /**
        * Create a picker date object.
        */
       DatePicker.prototype.create = function (type, value, options) {
      
         var isInfiniteValue,
             calendar = this;
      
         // If there’s no value, use the type as the value.
         value = value === undefined ? type : value;
      
         // If it’s infinity, update the value.
         if (value == -Infinity || value == Infinity) {
           isInfiniteValue = value;
         }
      
         // If it’s an object, use the native date object.
         else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
             value = value.obj;
           }
      
           // If it’s an array, convert it into a date and make sure
           // that it’s a valid date – otherwise default to today.
           else if ($.isArray(value)) {
               value = new Date(value[0], value[1], value[2]);
               value = _.isDate(value) ? value : calendar.create().obj;
             }
      
             // If it’s a number or date object, make a normalized date.
             else if (_.isInteger(value) || _.isDate(value)) {
                 value = calendar.normalize(new Date(value), options);
               }
      
               // If it’s a literal true or any other case, set it to now.
               else /*if ( value === true )*/{
                   value = calendar.now(type, value, options);
                 }
      
         // Return the compiled object.
         return {
           year: isInfiniteValue || value.getFullYear(),
           month: isInfiniteValue || value.getMonth(),
           date: isInfiniteValue || value.getDate(),
           day: isInfiniteValue || value.getDay(),
           obj: isInfiniteValue || value,
           pick: isInfiniteValue || value.getTime()
         };
       }; //DatePicker.prototype.create
      


       /**
        * Create a range limit object using an array, date object,
        * literal “true”, or integer relative to another time.
        */
       DatePicker.prototype.createRange = function (from, to) {
      
         var calendar = this,
             createDate = function (date) {
           if (date === true || $.isArray(date) || _.isDate(date)) {
             return calendar.create(date);
           }
           return date;
         };
      
         // Create objects if possible.
         if (!_.isInteger(from)) {
           from = createDate(from);
         }
         if (!_.isInteger(to)) {
           to = createDate(to);
         }
      
         // Create relative dates.
         if (_.isInteger(from) && $.isPlainObject(to)) {
           from = [to.year, to.month, to.date + from];
         } else if (_.isInteger(to) && $.isPlainObject(from)) {
           to = [from.year, from.month, from.date + to];
         }
      
         return {
           from: createDate(from),
           to: createDate(to)
         };
       }; //DatePicker.prototype.createRange
      


       /**
        * Check if a date unit falls within a date range object.
        */
       DatePicker.prototype.withinRange = function (range, dateUnit) {
         range = this.createRange(range.from, range.to);
         return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
       };
      
       /**
        * Check if two date range objects overlap.
        */
       DatePicker.prototype.overlapRanges = function (one, two) {
      
         var calendar = this;
      
         // Convert the ranges into comparable dates.
         one = calendar.createRange(one.from, one.to);
         two = calendar.createRange(two.from, two.to);
      
         return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
       };
      
       /**
        * Get the date today.
        */
       DatePicker.prototype.now = function (type, value, options) {
         value = new Date();
         if (options && options.rel) {
           value.setDate(value.getDate() + options.rel);
         }
         return this.normalize(value, options);
       };
      
       /**
        * Navigate to next/prev month.
        */
       DatePicker.prototype.navigate = function (type, value, options) {
      
         var targetDateObject,
             targetYear,
             targetMonth,
             targetDate,
             isTargetArray = $.isArray(value),
             isTargetObject = $.isPlainObject(value),
             viewsetObject = this.item.view; /*,
                                             safety = 100*/
      
         if (isTargetArray || isTargetObject) {
      
           if (isTargetObject) {
             targetYear = value.year;
             targetMonth = value.month;
             targetDate = value.date;
           } else {
             targetYear = +value[0];
             targetMonth = +value[1];
             targetDate = +value[2];
           }
      
           // If we’re navigating months but the view is in a different
           // month, navigate to the view’s year and month.
           if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
             targetYear = viewsetObject.year;
             targetMonth = viewsetObject.month;
           }
      
           // Figure out the expected target year and month.
           targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
           targetYear = targetDateObject.getFullYear();
           targetMonth = targetDateObject.getMonth();
      
           // If the month we’re going to doesn’t have enough days,
           // keep decreasing the date until we reach the month’s last date.
           while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
             targetDate -= 1;
             /*safety -= 1
             if ( !safety ) {
                 throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
             }*/
           }
      
           value = [targetYear, targetMonth, targetDate];
         }
      
         return value;
       }; //DatePicker.prototype.navigate
      


       /**
        * Normalize a date by setting the hours to midnight.
        */
       DatePicker.prototype.normalize = function (value /*, options*/) {
         value.setHours(0, 0, 0, 0);
         return value;
       };
      
       /**
        * Measure the range of dates.
        */
       DatePicker.prototype.measure = function (type, value /*, options*/) {
      
         var calendar = this;
      
         // If it’s anything false-y, remove the limits.
         if (!value) {
           value = type == 'min' ? -Infinity : Infinity;
         }
      
         // If it’s a string, parse it.
         else if (typeof value == 'string') {
             value = calendar.parse(type, value);
           }
      
           // If it's an integer, get a date relative to today.
           else if (_.isInteger(value)) {
               value = calendar.now(type, value, { rel: value });
             }
      
         return value;
       }; ///DatePicker.prototype.measure
      


       /**
        * Create a viewset object based on navigation.
        */
       DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
         return this.create([dateObject.year, dateObject.month, 1]);
       };
      
       /**
        * Validate a date as enabled and shift if needed.
        */
       DatePicker.prototype.validate = function (type, dateObject, options) {
      
         var calendar = this,
      


         // Keep a reference to the original date.
         originalDateObject = dateObject,
      


         // Make sure we have an interval.
         interval = options && options.interval ? options.interval : 1,
      


         // Check if the calendar enabled dates are inverted.
         isFlippedBase = calendar.item.enable === -1,
      


         // Check if we have any enabled dates after/before now.
         hasEnabledBeforeTarget,
             hasEnabledAfterTarget,
      


         // The min & max limits.
         minLimitObject = calendar.item.min,
             maxLimitObject = calendar.item.max,
      


         // Check if we’ve reached the limit during shifting.
         reachedMin,
             reachedMax,
      


         // Check if the calendar is inverted and at least one weekday is enabled.
         hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
      
           // If there’s a date, check where it is relative to the target.
           if ($.isArray(value)) {
             var dateTime = calendar.create(value).pick;
             if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
           }
      
           // Return only integers for enabled weekdays.
           return _.isInteger(value);
         }).length; /*,
                    safety = 100*/
      
         // Cases to validate for:
         // [1] Not inverted and date disabled.
         // [2] Inverted and some dates enabled.
         // [3] Not inverted and out of range.
         //
         // Cases to **not** validate for:
         // • Navigating months.
         // • Not inverted and date enabled.
         // • Inverted and all dates disabled.
         // • ..and anything else.
         if (!options || !options.nav) if (
         /* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
         /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
         /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
      
           // When inverted, flip the direction if there aren’t any enabled weekdays
           // and there are no enabled dates in the direction of the interval.
           if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
             interval *= -1;
           }
      
           // Keep looping until we reach an enabled date.
           while ( /*safety &&*/calendar.disabled(dateObject)) {
      
             /*safety -= 1
             if ( !safety ) {
                 throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
             }*/
      
             // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
             if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
               dateObject = originalDateObject;
               interval = interval > 0 ? 1 : -1;
             }
      
             // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
             if (dateObject.pick <= minLimitObject.pick) {
               reachedMin = true;
               interval = 1;
               dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
             } else if (dateObject.pick >= maxLimitObject.pick) {
               reachedMax = true;
               interval = -1;
               dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
             }
      
             // If we’ve reached both limits, just break out of the loop.
             if (reachedMin && reachedMax) {
               break;
             }
      
             // Finally, create the shifted date using the interval and keep looping.
             dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
           }
         } //endif
      


         // Return the date object settled on.
         return dateObject;
       }; //DatePicker.prototype.validate
      


       /**
        * Check if a date is disabled.
        */
       DatePicker.prototype.disabled = function (dateToVerify) {
      
         var calendar = this,
      


         // Filter through the disabled dates to check if this is one.
         isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
      
           // If the date is a number, match the weekday with 0index and `firstDay` check.
           if (_.isInteger(dateToDisable)) {
             return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
           }
      
           // If it’s an array or a native JS date, create and match the exact date.
           if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
             return dateToVerify.pick === calendar.create(dateToDisable).pick;
           }
      
           // If it’s an object, match a date within the “from” and “to” range.
           if ($.isPlainObject(dateToDisable)) {
             return calendar.withinRange(dateToDisable, dateToVerify);
           }
         });
      
         // If this date matches a disabled date, confirm it’s not inverted.
         isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
           return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
         }).length;
      
         // Check the calendar “enabled” flag and respectively flip the
         // disabled state. Then also check if it’s beyond the min/max limits.
         return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
       }; //DatePicker.prototype.disabled
      


       /**
        * Parse a string into a usable type.
        */
       DatePicker.prototype.parse = function (type, value, options) {
      
         var calendar = this,
             parsingObject = {};
      
         // If it’s already parsed, we’re good.
         if (!value || typeof value != 'string') {
           return value;
         }
      
         // We need a `.format` to parse the value with.
         if (!(options && options.format)) {
           options = options || {};
           options.format = calendar.settings.format;
         }
      
         // Convert the format into an array and then map through it.
         calendar.formats.toArray(options.format).map(function (label) {
      
           var
           // Grab the formatting label.
           formattingLabel = calendar.formats[label],
      


           // The format length is from the formatting label function or the
           // label length without the escaping exclamation (!) mark.
           formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, ).length;
      
           // If there's a format label, split the value up to the format length.
           // Then add it to the parsing object with appropriate label.
           if (formattingLabel) {
             parsingObject[label] = value.substr(0, formatLength);
           }
      
           // Update the value as the substring from format length to end.
           value = value.substr(formatLength);
         });
      
         // Compensate for month 0index.
         return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
       }; //DatePicker.prototype.parse
      


       /**
        * Various formats to display the object in.
        */
       DatePicker.prototype.formats = function () {
      
         // Return the length of the first word in a collection.
         function getWordLengthFromCollection(string, collection, dateObject) {
      
           // Grab the first word from the string.
           var word = string.match(/\w+/)[0];
      
           // If there's no month index, add it to the date object
           if (!dateObject.mm && !dateObject.m) {
             dateObject.m = collection.indexOf(word) + 1;
           }
      
           // Return the length of the word.
           return word.length;
         }
      
         // Get the length of the first word in a string.
         function getFirstWordLength(string) {
           return string.match(/\w+/)[0].length;
         }
      
         return {
      
           d: function (string, dateObject) {
      
             // If there's string, then get the digits length.
             // Otherwise return the selected date.
             return string ? _.digits(string) : dateObject.date;
           },
           dd: function (string, dateObject) {
      
             // If there's a string, then the length is always 2.
             // Otherwise return the selected date with a leading zero.
             return string ? 2 : _.lead(dateObject.date);
           },
           ddd: function (string, dateObject) {
      
             // If there's a string, then get the length of the first word.
             // Otherwise return the short selected weekday.
             return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
           },
           dddd: function (string, dateObject) {
      
             // If there's a string, then get the length of the first word.
             // Otherwise return the full selected weekday.
             return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
           },
           m: function (string, dateObject) {
      
             // If there's a string, then get the length of the digits
             // Otherwise return the selected month with 0index compensation.
             return string ? _.digits(string) : dateObject.month + 1;
           },
           mm: function (string, dateObject) {
      
             // If there's a string, then the length is always 2.
             // Otherwise return the selected month with 0index and leading zero.
             return string ? 2 : _.lead(dateObject.month + 1);
           },
           mmm: function (string, dateObject) {
      
             var collection = this.settings.monthsShort;
      
             // If there's a string, get length of the relevant month from the short
             // months collection. Otherwise return the selected month from that collection.
             return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
           },
           mmmm: function (string, dateObject) {
      
             var collection = this.settings.monthsFull;
      
             // If there's a string, get length of the relevant month from the full
             // months collection. Otherwise return the selected month from that collection.
             return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
           },
           yy: function (string, dateObject) {
      
             // If there's a string, then the length is always 2.
             // Otherwise return the selected year by slicing out the first 2 digits.
             return string ? 2 : ( + dateObject.year).slice(2);
           },
           yyyy: function (string, dateObject) {
      
             // If there's a string, then the length is always 4.
             // Otherwise return the selected year.
             return string ? 4 : dateObject.year;
           },
      
           // Create an array by splitting the formatting string passed.
           toArray: function (formatString) {
             return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
           },
      
           // Format an object into a string using the formatting options.
           toString: function (formatString, itemObject) {
             var calendar = this;
             return calendar.formats.toArray(formatString).map(function (label) {
               return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, );
             }).join();
           }
         };
       }(); //DatePicker.prototype.formats
      


       /**
        * Check if two date units are the exact.
        */
       DatePicker.prototype.isDateExact = function (one, two) {
      
         var calendar = this;
      
         // When we’re working with weekdays, do a direct comparison.
         if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
           return one === two;
         }
      
         // When we’re working with date representations, compare the “pick” value.
         if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
           return calendar.create(one).pick === calendar.create(two).pick;
         }
      
         // When we’re working with range objects, compare the “from” and “to”.
         if ($.isPlainObject(one) && $.isPlainObject(two)) {
           return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
         }
      
         return false;
       };
      
       /**
        * Check if two date units overlap.
        */
       DatePicker.prototype.isDateOverlap = function (one, two) {
      
         var calendar = this,
             firstDay = calendar.settings.firstDay ? 1 : 0;
      
         // When we’re working with a weekday index, compare the days.
         if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
           one = one % 7 + firstDay;
           return one === calendar.create(two).day + 1;
         }
         if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
           two = two % 7 + firstDay;
           return two === calendar.create(one).day + 1;
         }
      
         // When we’re working with range objects, check if the ranges overlap.
         if ($.isPlainObject(one) && $.isPlainObject(two)) {
           return calendar.overlapRanges(one, two);
         }
      
         return false;
       };
      
       /**
        * Flip the “enabled” state.
        */
       DatePicker.prototype.flipEnable = function (val) {
         var itemObject = this.item;
         itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
       };
      
       /**
        * Mark a collection of dates as “disabled”.
        */
       DatePicker.prototype.deactivate = function (type, datesToDisable) {
      
         var calendar = this,
             disabledItems = calendar.item.disable.slice(0);
      
         // If we’re flipping, that’s all we need to do.
         if (datesToDisable == 'flip') {
           calendar.flipEnable();
         } else if (datesToDisable === false) {
           calendar.flipEnable(1);
           disabledItems = [];
         } else if (datesToDisable === true) {
           calendar.flipEnable(-1);
           disabledItems = [];
         }
      
         // Otherwise go through the dates to disable.
         else {
      
             datesToDisable.map(function (unitToDisable) {
      
               var matchFound;
      
               // When we have disabled items, check for matches.
               // If something is matched, immediately break out.
               for (var index = 0; index < disabledItems.length; index += 1) {
                 if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
                   matchFound = true;
                   break;
                 }
               }
      
               // If nothing was found, add the validated unit to the collection.
               if (!matchFound) {
                 if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
                   disabledItems.push(unitToDisable);
                 }
               }
             });
           }
      
         // Return the updated collection.
         return disabledItems;
       }; //DatePicker.prototype.deactivate
      


       /**
        * Mark a collection of dates as “enabled”.
        */
       DatePicker.prototype.activate = function (type, datesToEnable) {
      
         var calendar = this,
             disabledItems = calendar.item.disable,
             disabledItemsCount = disabledItems.length;
      
         // If we’re flipping, that’s all we need to do.
         if (datesToEnable == 'flip') {
           calendar.flipEnable();
         } else if (datesToEnable === true) {
           calendar.flipEnable(1);
           disabledItems = [];
         } else if (datesToEnable === false) {
           calendar.flipEnable(-1);
           disabledItems = [];
         }
      
         // Otherwise go through the disabled dates.
         else {
      
             datesToEnable.map(function (unitToEnable) {
      
               var matchFound, disabledUnit, index, isExactRange;
      
               // Go through the disabled items and try to find a match.
               for (index = 0; index < disabledItemsCount; index += 1) {
      
                 disabledUnit = disabledItems[index];
      
                 // When an exact match is found, remove it from the collection.
                 if (calendar.isDateExact(disabledUnit, unitToEnable)) {
                   matchFound = disabledItems[index] = null;
                   isExactRange = true;
                   break;
                 }
      
                 // When an overlapped match is found, add the “inverted” state to it.
                 else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
                     if ($.isPlainObject(unitToEnable)) {
                       unitToEnable.inverted = true;
                       matchFound = unitToEnable;
                     } else if ($.isArray(unitToEnable)) {
                       matchFound = unitToEnable;
                       if (!matchFound[3]) matchFound.push('inverted');
                     } else if (_.isDate(unitToEnable)) {
                       matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
                     }
                     break;
                   }
               }
      
               // If a match was found, remove a previous duplicate entry.
               if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
                 if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
                   disabledItems[index] = null;
                   break;
                 }
               }
      
               // In the event that we’re dealing with an exact range of dates,
               // make sure there are no “inverted” dates because of it.
               if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
                 if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
                   disabledItems[index] = null;
                   break;
                 }
               }
      
               // If something is still matched, add it into the collection.
               if (matchFound) {
                 disabledItems.push(matchFound);
               }
             });
           }
      
         // Return the updated collection.
         return disabledItems.filter(function (val) {
           return val != null;
         });
       }; //DatePicker.prototype.activate
      


       /**
        * Create a string for the nodes in the picker.
        */
       DatePicker.prototype.nodes = function (isOpen) {
      
         var calendar = this,
             settings = calendar.settings,
             calendarItem = calendar.item,
             nowObject = calendarItem.now,
             selectedObject = calendarItem.select,
             highlightedObject = calendarItem.highlight,
             viewsetObject = calendarItem.view,
             disabledCollection = calendarItem.disable,
             minLimitObject = calendarItem.min,
             maxLimitObject = calendarItem.max,
      


         // Create the calendar table head using a copy of weekday labels collection.
         // * We do a copy so we don't mutate the original array.
         tableHead = function (collection, fullCollection) {
      
           // If the first day should be Monday, move Sunday to the end.
           if (settings.firstDay) {
             collection.push(collection.shift());
             fullCollection.push(fullCollection.shift());
           }
      
           // Create and return the table head group.
           return _.node('thead', _.node('tr', _.group({
             min: 0,
             max: DAYS_IN_WEEK - 1,
             i: 1,
             node: 'th',
             item: function (counter) {
               return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
             }
           }))); //endreturn
      
           // Materialize modified
         }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
             //tableHead
      


         // Create the nav for next/prev month.
         createMonthNav = function (next) {
      
           // Otherwise, return the created month tag.
           return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
      
           // If the focused month is outside the range, disabled the button.
           next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
             role: 'button',
             controls: calendar.$node[0].id + '_table'
           }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
         },
             //createMonthNav
      


         // Create the month label.
         //Materialize modified
         createMonthLabel = function (override) {
      
           var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
      
           // Materialize modified
           if (override == "short_months") {
             monthsCollection = settings.monthsShort;
           }
      
           // If there are months to select, add a dropdown menu.
           if (settings.selectMonths && override == undefined) {
      
             return _.node('select', _.group({
               min: 0,
               max: 11,
               i: 1,
               node: 'option',
               item: function (loopedMonth) {
      
                 return [
      
                 // The looped month and no classes.
                 monthsCollection[loopedMonth], 0,
      
                 // Set the value and selected index.
                 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : ) + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : )];
               }
             }), settings.klass.selectMonth + ' browser-default', (isOpen ?  : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
           }
      
           // Materialize modified
           if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
      
           // If there's a need for a month selector
           return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
         },
             //createMonthLabel
      


         // Create the year label.
         // Materialize modified
         createYearLabel = function (override) {
      
           var focusedYear = viewsetObject.year,
      


           // If years selector is set to a literal "true", set it to 5. Otherwise
           // divide in half to get half before and half after focused year.
           numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
      
           // If there are years to select, add a dropdown menu.
           if (numberYears) {
      
             var minYear = minLimitObject.year,
                 maxYear = maxLimitObject.year,
                 lowestYear = focusedYear - numberYears,
                 highestYear = focusedYear + numberYears;
      
             // If the min year is greater than the lowest year, increase the highest year
             // by the difference and set the lowest year to the min year.
             if (minYear > lowestYear) {
               highestYear += minYear - lowestYear;
               lowestYear = minYear;
             }
      
             // If the max year is less than the highest year, decrease the lowest year
             // by the lower of the two: available and needed years. Then set the
             // highest year to the max year.
             if (maxYear < highestYear) {
      
               var availableYears = lowestYear - minYear,
                   neededYears = highestYear - maxYear;
      
               lowestYear -= availableYears > neededYears ? neededYears : availableYears;
               highestYear = maxYear;
             }
      
             if (settings.selectYears && override == undefined) {
               return _.node('select', _.group({
                 min: lowestYear,
                 max: highestYear,
                 i: 1,
                 node: 'option',
                 item: function (loopedYear) {
                   return [
      
                   // The looped year and no classes.
                   loopedYear, 0,
      
                   // Set the value and selected index.
                   'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : )];
                 }
               }), settings.klass.selectYear + ' browser-default', (isOpen ?  : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
             }
           }
      
           // Materialize modified
           if (override == "raw") return _.node('div', focusedYear);
      
           // Otherwise just return the year focused
           return _.node('div', focusedYear, settings.klass.year);
         }; //createYearLabel
      


         // Materialize modified
         createDayLabel = function () {
           if (selectedObject != null) return selectedObject.date;else return nowObject.date;
         };
         createWeekdayLabel = function () {
           var display_day;
      
           if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
           var weekday = settings.weekdaysShort[display_day];
           return weekday;
         };
      
         // Create and return the entire calendar.
      
         return _.node(
         // Date presentation View
         'div', _.node(
         // Div for Year
         'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
         // Div for short Month
         'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
         // Div for Day
         'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
         // Calendar container
         _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
           min: 0,
           max: WEEKS_IN_CALENDAR - 1,
           i: 1,
           node: 'tr',
           item: function (rowCounter) {
      
             // If Monday is the first day and the month starts on Sunday, shift the date back a week.
             var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
      
             return [_.group({
               min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
               max: function () {
                 return this.min + DAYS_IN_WEEK - 1;
               },
               i: 1,
               node: 'td',
               item: function (targetDate) {
      
                 // Convert the time date from a relative date to a target date.
                 targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
      
                 var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
                     isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
                     isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
                     formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
      
                 return [_.node('div', targetDate.date, function (klasses) {
      
                   // Add the `infocus` or `outfocus` classes based on month in view.
                   klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
      
                   // Add the `today` class if needed.
                   if (nowObject.pick == targetDate.pick) {
                     klasses.push(settings.klass.now);
                   }
      
                   // Add the `selected` class if something's selected and the time matches.
                   if (isSelected) {
                     klasses.push(settings.klass.selected);
                   }
      
                   // Add the `highlighted` class if something's highlighted and the time matches.
                   if (isHighlighted) {
                     klasses.push(settings.klass.highlighted);
                   }
      
                   // Add the `disabled` class if something's disabled and the object matches.
                   if (isDisabled) {
                     klasses.push(settings.klass.disabled);
                   }
      
                   return klasses.join(' ');
                 }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
                   role: 'gridcell',
                   label: formattedDate,
                   selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
                   activedescendant: isHighlighted ? true : null,
                   disabled: isDisabled ? true : null
                 }) + ' ' + (isDisabled ?  : 'tabindex="0"')), , _.ariaAttr({ role: 'presentation' })]; //endreturn
               }
             })]; //endreturn
           }
         })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
           role: 'grid',
           controls: calendar.$node[0].id,
           readonly: true
         })), settings.klass.calendar_container) // end calendar
      
         +
      
         // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
         _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ?  : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ?  : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ?  : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
       }; //DatePicker.prototype.nodes
      


       /**
        * The date picker defaults.
        */
       DatePicker.defaults = function (prefix) {
      
         return {
      
           // The title label to use for the month nav buttons
           labelMonthNext: 'Next month',
           labelMonthPrev: 'Previous month',
      
           // The title label to use for the dropdown selectors
           labelMonthSelect: 'Select a month',
           labelYearSelect: 'Select a year',
      
           // Months and weekdays
           monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
           monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
           weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
           weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
      
           // Materialize modified
           weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
      
           // Today and clear
           today: 'Today',
           clear: 'Clear',
           close: 'Ok',
      
           // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
           closeOnSelect: false,
      
           // The format to show on the `input` element
           format: 'd mmmm, yyyy',
      
           // Classes
           klass: {
      
             table: prefix + 'table',
      
             header: prefix + 'header',
      
             // Materialize Added klasses
             date_display: prefix + 'date-display',
             day_display: prefix + 'day-display',
             month_display: prefix + 'month-display',
             year_display: prefix + 'year-display',
             calendar_container: prefix + 'calendar-container',
             // end
      


             navPrev: prefix + 'nav--prev',
             navNext: prefix + 'nav--next',
             navDisabled: prefix + 'nav--disabled',
      
             month: prefix + 'month',
             year: prefix + 'year',
      
             selectMonth: prefix + 'select--month',
             selectYear: prefix + 'select--year',
      
             weekdays: prefix + 'weekday',
      
             day: prefix + 'day',
             disabled: prefix + 'day--disabled',
             selected: prefix + 'day--selected',
             highlighted: prefix + 'day--highlighted',
             now: prefix + 'day--today',
             infocus: prefix + 'day--infocus',
             outfocus: prefix + 'day--outfocus',
      
             footer: prefix + 'footer',
      
             buttonClear: prefix + 'button--clear',
             buttonToday: prefix + 'button--today',
             buttonClose: prefix + 'button--close'
           }
         };
       }(Picker.klasses().picker + '__');
      
       /**
        * Extend the picker to add the date picker.
        */
       Picker.extend('pickadate', DatePicker);
      

      });

      /*!
       * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
       * Copyright 2014 Wang Shenwei.
       * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
       *
       * Further modified
       * Copyright 2015 Ching Yaw Hao.
       */
      

      (function () {

       var $ = window.jQuery,
           $win = $(window),
           $doc = $(document);
      
       // Can I use inline svg ?
       var svgNS = 'http://www.w3.org/2000/svg',
           svgSupported = 'SVGAngle' in window && function () {
         var supported,
             el = document.createElement('div');
         el.innerHTML = '<svg/>';
         supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
         el.innerHTML = ;
         return supported;
       }();
      
       // Can I use transition ?
       var transitionSupported = function () {
         var style = document.createElement('div').style;
         return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
       }();
      
       // Listen touch events in touch screen device, instead of mouse events in desktop.
       var touchSupported = 'ontouchstart' in window,
           mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ),
           mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ),
           mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : );
      
       // Vibrate the device if supported
       var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
      
       function createSvgElement(name) {
         return document.createElementNS(svgNS, name);
       }
      
       function leadingZero(num) {
         return (num < 10 ? '0' : ) + num;
       }
      
       // Get a unique id
       var idCounter = 0;
       function uniqueId(prefix) {
         var id = ++idCounter + ;
         return prefix ? prefix + id : id;
       }
      
       // Clock size
       var dialRadius = 135,
           outerRadius = 105,
      
       // innerRadius = 80 on 12 hour clock
       innerRadius = 80,
           tickRadius = 20,
           diameter = dialRadius * 2,
           duration = transitionSupported ? 350 : 1;
      
       // Popover template
      
      var tpl = ['
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', ':', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      '].join();
       // ClockPicker
       function ClockPicker(element, options) {
         var popover = $(tpl),
             plate = popover.find('.clockpicker-plate'),
             holder = popover.find('.picker__holder'),
             hoursView = popover.find('.clockpicker-hours'),
             minutesView = popover.find('.clockpicker-minutes'),
             amPmBlock = popover.find('.clockpicker-am-pm-block'),
             isInput = element.prop('tagName') === 'INPUT',
             input = isInput ? element : element.find('input'),
             label = $("label[for=" + input.attr("id") + "]"),
             self = this;
      
         this.id = uniqueId('cp');
         this.element = element;
         this.holder = holder;
         this.options = options;
         this.isAppended = false;
         this.isShown = false;
         this.currentView = 'hours';
         this.isInput = isInput;
         this.input = input;
         this.label = label;
         this.popover = popover;
         this.plate = plate;
         this.hoursView = hoursView;
         this.minutesView = minutesView;
         this.amPmBlock = amPmBlock;
         this.spanHours = popover.find('.clockpicker-span-hours');
         this.spanMinutes = popover.find('.clockpicker-span-minutes');
         this.spanAmPm = popover.find('.clockpicker-span-am-pm');
         this.footer = popover.find('.picker__footer');
         this.amOrPm = "PM";
      
         // Setup for for 12 hour clock if option is selected
         if (options.twelvehour) {
           if (!options.ampmclickable) {
             this.spanAmPm.empty();
      
      $('
      AM
      ').appendTo(this.spanAmPm); $('
      PM
      ').appendTo(this.spanAmPm);
           } else {
             this.spanAmPm.empty();
      
      $('
      AM
      ').on("click", function () {
               self.spanAmPm.children('#click-am').addClass("text-primary");
               self.spanAmPm.children('#click-pm').removeClass("text-primary");
               self.amOrPm = "AM";
             }).appendTo(this.spanAmPm);
      
      $('
      PM
      ').on("click", function () {
               self.spanAmPm.children('#click-pm').addClass("text-primary");
               self.spanAmPm.children('#click-am').removeClass("text-primary");
               self.amOrPm = 'PM';
             }).appendTo(this.spanAmPm);
           }
         }
      
         // Add buttons to footer
         $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
         $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
         $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
      
         this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
         this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
      
         // Show or toggle
         input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
      
         // Build ticks
      
      var tickTpl = $('
      '),
             i,
             tick,
             radian,
             radius;
      
         // Hours view
         if (options.twelvehour) {
           for (i = 1; i < 13; i += 1) {
             tick = tickTpl.clone();
             radian = i / 6 * Math.PI;
             radius = outerRadius;
             tick.css({
               left: dialRadius + Math.sin(radian) * radius - tickRadius,
               top: dialRadius - Math.cos(radian) * radius - tickRadius
             });
             tick.html(i === 0 ? '00' : i);
             hoursView.append(tick);
             tick.on(mousedownEvent, mousedown);
           }
         } else {
           for (i = 0; i < 24; i += 1) {
             tick = tickTpl.clone();
             radian = i / 6 * Math.PI;
             var inner = i > 0 && i < 13;
             radius = inner ? innerRadius : outerRadius;
             tick.css({
               left: dialRadius + Math.sin(radian) * radius - tickRadius,
               top: dialRadius - Math.cos(radian) * radius - tickRadius
             });
             tick.html(i === 0 ? '00' : i);
             hoursView.append(tick);
             tick.on(mousedownEvent, mousedown);
           }
         }
      
         // Minutes view
         for (i = 0; i < 60; i += 5) {
           tick = tickTpl.clone();
           radian = i / 30 * Math.PI;
           tick.css({
             left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
             top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
           });
           tick.html(leadingZero(i));
           minutesView.append(tick);
           tick.on(mousedownEvent, mousedown);
         }
      
         // Clicking on minutes view space
         plate.on(mousedownEvent, function (e) {
           if ($(e.target).closest('.clockpicker-tick').length === 0) {
             mousedown(e, true);
           }
         });
      
         // Mousedown or touchstart
         function mousedown(e, space) {
           var offset = plate.offset(),
               isTouch = /^touch/.test(e.type),
               x0 = offset.left + dialRadius,
               y0 = offset.top + dialRadius,
               dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
               dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
               z = Math.sqrt(dx * dx + dy * dy),
               moved = false;
      
           // When clicking on minutes view space, check the mouse position
           if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
             return;
           }
           e.preventDefault();
      
           // Set cursor style of body after 200ms
           var movingTimer = setTimeout(function () {
             self.popover.addClass('clockpicker-moving');
           }, 200);
      
           // Clock
           self.setHand(dx, dy, !space, true);
      
           // Mousemove on document
           $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
             e.preventDefault();
             var isTouch = /^touch/.test(e.type),
                 x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
                 y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
             if (!moved && x === dx && y === dy) {
               // Clicking in chrome on windows will trigger a mousemove event
               return;
             }
             moved = true;
             self.setHand(x, y, false, true);
           });
      
           // Mouseup on document
           $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
             $doc.off(mouseupEvent);
             e.preventDefault();
             var isTouch = /^touch/.test(e.type),
                 x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
                 y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
             if ((space || moved) && x === dx && y === dy) {
               self.setHand(x, y);
             }
      
             if (self.currentView === 'hours') {
               self.toggleView('minutes', duration / 2);
             } else if (options.autoclose) {
               self.minutesView.addClass('clockpicker-dial-out');
               setTimeout(function () {
                 self.done();
               }, duration / 2);
             }
             plate.prepend(canvas);
      
             // Reset cursor style of body
             clearTimeout(movingTimer);
             self.popover.removeClass('clockpicker-moving');
      
             // Unbind mousemove event
             $doc.off(mousemoveEvent);
           });
         }
      
         if (svgSupported) {
           // Draw clock hands and others
           var canvas = popover.find('.clockpicker-canvas'),
               svg = createSvgElement('svg');
           svg.setAttribute('class', 'clockpicker-svg');
           svg.setAttribute('width', diameter);
           svg.setAttribute('height', diameter);
           var g = createSvgElement('g');
           g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
           var bearing = createSvgElement('circle');
           bearing.setAttribute('class', 'clockpicker-canvas-bearing');
           bearing.setAttribute('cx', 0);
           bearing.setAttribute('cy', 0);
           bearing.setAttribute('r', 4);
           var hand = createSvgElement('line');
           hand.setAttribute('x1', 0);
           hand.setAttribute('y1', 0);
           var bg = createSvgElement('circle');
           bg.setAttribute('class', 'clockpicker-canvas-bg');
           bg.setAttribute('r', tickRadius);
           g.appendChild(hand);
           g.appendChild(bg);
           g.appendChild(bearing);
           svg.appendChild(g);
           canvas.append(svg);
      
           this.hand = hand;
           this.bg = bg;
           this.bearing = bearing;
           this.g = g;
           this.canvas = canvas;
         }
      
         raiseCallback(this.options.init);
       }
      
       function raiseCallback(callbackFunction) {
         if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
       }
      
       // Default options
       ClockPicker.DEFAULTS = {
         'default': , // default time, 'now' or '13:14' e.g.
         fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
         donetext: 'Ok', // done button text
         cleartext: 'Clear',
         canceltext: 'Cancel',
         autoclose: false, // auto close when minute is selected
         ampmclickable: true, // set am/pm button on itself
         darktheme: false, // set to dark theme
         twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
         vibrate: true // vibrate the device when dragging clock hand
       };
      
       // Show or hide popover
       ClockPicker.prototype.toggle = function () {
         this[this.isShown ? 'hide' : 'show']();
       };
      
       // Set popover position
       ClockPicker.prototype.locate = function () {
         var element = this.element,
             popover = this.popover,
             offset = element.offset(),
             width = element.outerWidth(),
             height = element.outerHeight(),
             align = this.options.align,
             self = this;
      
         popover.show();
       };
      
       // Show popover
       ClockPicker.prototype.show = function (e) {
         // Not show again
         if (this.isShown) {
           return;
         }
         raiseCallback(this.options.beforeShow);
         $(':input').each(function () {
           $(this).attr('tabindex', -1);
         });
         var self = this;
         // Initialize
         this.input.blur();
         this.popover.addClass('picker--opened');
         this.input.addClass('picker__input picker__input--active');
         $(document.body).css('overflow', 'hidden');
         // Get the time
         var value = ((this.input.prop('value') || this.options['default'] || ) + ).split(':');
         if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
           if (value[1].indexOf("AM") > 0) {
             this.amOrPm = 'AM';
           } else {
             this.amOrPm = 'PM';
           }
           value[1] = value[1].replace("AM", "").replace("PM", "");
         }
         if (value[0] === 'now') {
           var now = new Date(+new Date() + this.options.fromnow);
           value = [now.getHours(), now.getMinutes()];
           if (this.options.twelvehour) {
             this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
           }
         }
         this.hours = +value[0] || 0;
         this.minutes = +value[1] || 0;
         this.spanHours.html(this.hours);
         this.spanMinutes.html(leadingZero(this.minutes));
         if (!this.isAppended) {
           // Append popover to body
           this.popover.insertAfter(this.input);
           if (this.options.twelvehour) {
             if (this.amOrPm === 'PM') {
               this.spanAmPm.children('#click-pm').addClass("text-primary");
               this.spanAmPm.children('#click-am').removeClass("text-primary");
             } else {
               this.spanAmPm.children('#click-am').addClass("text-primary");
               this.spanAmPm.children('#click-pm').removeClass("text-primary");
             }
           }
           // Reset position when resize
           $win.on('resize.clockpicker' + this.id, function () {
             if (self.isShown) {
               self.locate();
             }
           });
           this.isAppended = true;
         }
         // Toggle to hours view
         this.toggleView('hours');
         // Set position
         this.locate();
         this.isShown = true;
         // Hide when clicking or tabbing on any element except the clock and input
         $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
           var target = $(e.target);
           if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
             self.hide();
           }
         });
         // Hide when ESC is pressed
         $doc.on('keyup.clockpicker.' + this.id, function (e) {
           if (e.keyCode === 27) {
             self.hide();
           }
         });
         raiseCallback(this.options.afterShow);
       };
       // Hide popover
       ClockPicker.prototype.hide = function () {
         raiseCallback(this.options.beforeHide);
         this.input.removeClass('picker__input picker__input--active');
         this.popover.removeClass('picker--opened');
         $(document.body).css('overflow', 'visible');
         this.isShown = false;
         $(':input').each(function (index) {
           $(this).attr('tabindex', index + 1);
         });
         // Unbinding events on document
         $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
         $doc.off('keyup.clockpicker.' + this.id);
         this.popover.hide();
         raiseCallback(this.options.afterHide);
       };
       // Toggle to hours or minutes view
       ClockPicker.prototype.toggleView = function (view, delay) {
         var raiseAfterHourSelect = false;
         if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
           raiseCallback(this.options.beforeHourSelect);
           raiseAfterHourSelect = true;
         }
         var isHours = view === 'hours',
             nextView = isHours ? this.hoursView : this.minutesView,
             hideView = isHours ? this.minutesView : this.hoursView;
         this.currentView = view;
      
         this.spanHours.toggleClass('text-primary', isHours);
         this.spanMinutes.toggleClass('text-primary', !isHours);
      
         // Let's make transitions
         hideView.addClass('clockpicker-dial-out');
         nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
      
         // Reset clock hand
         this.resetClock(delay);
      
         // After transitions ended
         clearTimeout(this.toggleViewTimer);
         this.toggleViewTimer = setTimeout(function () {
           hideView.css('visibility', 'hidden');
         }, duration);
      
         if (raiseAfterHourSelect) {
           raiseCallback(this.options.afterHourSelect);
         }
       };
      
       // Reset clock hand
       ClockPicker.prototype.resetClock = function (delay) {
         var view = this.currentView,
             value = this[view],
             isHours = view === 'hours',
             unit = Math.PI / (isHours ? 6 : 30),
             radian = value * unit,
             radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
             x = Math.sin(radian) * radius,
             y = -Math.cos(radian) * radius,
             self = this;
      
         if (svgSupported && delay) {
           self.canvas.addClass('clockpicker-canvas-out');
           setTimeout(function () {
             self.canvas.removeClass('clockpicker-canvas-out');
             self.setHand(x, y);
           }, delay);
         } else this.setHand(x, y);
       };
      
       // Set clock hand to (x, y)
       ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
         var radian = Math.atan2(x, -y),
             isHours = this.currentView === 'hours',
             unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
             z = Math.sqrt(x * x + y * y),
             options = this.options,
             inner = isHours && z < (outerRadius + innerRadius) / 2,
             radius = inner ? innerRadius : outerRadius,
             value;
      
         if (options.twelvehour) {
           radius = outerRadius;
         }
      
         // Radian should in range [0, 2PI]
         if (radian < 0) {
           radian = Math.PI * 2 + radian;
         }
      
         // Get the round value
         value = Math.round(radian / unit);
      
         // Get the round radian
         radian = value * unit;
      
         // Correct the hours or minutes
         if (options.twelvehour) {
           if (isHours) {
             if (value === 0) value = 12;
           } else {
             if (roundBy5) value *= 5;
             if (value === 60) value = 0;
           }
         } else {
           if (isHours) {
             if (value === 12) value = 0;
             value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
           } else {
             if (roundBy5) value *= 5;
             if (value === 60) value = 0;
           }
         }
      
         // Once hours or minutes changed, vibrate the device
         if (this[this.currentView] !== value) {
           if (vibrate && this.options.vibrate) {
             // Do not vibrate too frequently
             if (!this.vibrateTimer) {
               navigator[vibrate](10);
               this.vibrateTimer = setTimeout($.proxy(function () {
                 this.vibrateTimer = null;
               }, this), 100);
             }
           }
         }
      
         this[this.currentView] = value;
         if (isHours) {
           this['spanHours'].html(value);
         } else {
           this['spanMinutes'].html(leadingZero(value));
         }
      
         // If svg is not supported, just add an active class to the tick
         if (!svgSupported) {
           this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
             var tick = $(this);
             tick.toggleClass('active', value === +tick.html());
           });
           return;
         }
      
         // Set clock hand and others' position
         var cx1 = Math.sin(radian) * (radius - tickRadius),
             cy1 = -Math.cos(radian) * (radius - tickRadius),
             cx2 = Math.sin(radian) * radius,
             cy2 = -Math.cos(radian) * radius;
         this.hand.setAttribute('x2', cx1);
         this.hand.setAttribute('y2', cy1);
         this.bg.setAttribute('cx', cx2);
         this.bg.setAttribute('cy', cy2);
       };
      
       // Hours and minutes are selected
       ClockPicker.prototype.done = function () {
         raiseCallback(this.options.beforeDone);
         this.hide();
         this.label.addClass('active');
      
         var last = this.input.prop('value'),
             value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
         if (this.options.twelvehour) {
           value = value + this.amOrPm;
         }
      
         this.input.prop('value', value);
         if (value !== last) {
           this.input.triggerHandler('change');
           if (!this.isInput) {
             this.element.trigger('change');
           }
         }
      
         if (this.options.autoclose) this.input.trigger('blur');
      
         raiseCallback(this.options.afterDone);
       };
      
       // Clear input field
       ClockPicker.prototype.clear = function () {
         this.hide();
         this.label.removeClass('active');
      
         var last = this.input.prop('value'),
             value = ;
      
         this.input.prop('value', value);
         if (value !== last) {
           this.input.triggerHandler('change');
           if (!this.isInput) {
             this.element.trigger('change');
           }
         }
      
         if (this.options.autoclose) {
           this.input.trigger('blur');
         }
       };
      
       // Remove clockpicker from input
       ClockPicker.prototype.remove = function () {
         this.element.removeData('clockpicker');
         this.input.off('focus.clockpicker click.clockpicker');
         if (this.isShown) {
           this.hide();
         }
         if (this.isAppended) {
           $win.off('resize.clockpicker' + this.id);
           this.popover.remove();
         }
       };
      
       // Extends $.fn.clockpicker
       $.fn.pickatime = function (option) {
         var args = Array.prototype.slice.call(arguments, 1);
         return this.each(function () {
           var $this = $(this),
               data = $this.data('clockpicker');
           if (!data) {
             var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
             $this.data('clockpicker', new ClockPicker($this, options));
           } else {
             // Manual operatsions. show, hide, remove, e.g.
             if (typeof data[option] === 'function') {
               data[option].apply(data, args);
             }
           }
         });
       };
      

      })();

      (function ($) {
       $.fn.characterCounter = function () {
         return this.each(function () {
           var $input = $(this);
           var $counterElement = $input.parent().find('span[class="character-counter"]');
      
           // character counter has already been added appended to the parent container
           if ($counterElement.length) {
             return;
           }
      
           var itHasLengthAttribute = $input.attr('data-length') !== undefined;
      
           if (itHasLengthAttribute) {
             $input.on('input', updateCounter);
             $input.on('focus', updateCounter);
             $input.on('blur', removeCounterElement);
      
             addCounterElement($input);
           }
         });
       };
      
       function updateCounter() {
         var maxLength = +$(this).attr('data-length'),
             actualLength = +$(this).val().length,
             isValidLength = actualLength <= maxLength;
      
         $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
      
         addInputStyle(isValidLength, $(this));
       }
      
       function addCounterElement($input) {
         var $counterElement = $input.parent().find('span[class="character-counter"]');
      
         if ($counterElement.length) {
           return;
         }
      
         $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
      
         $input.parent().append($counterElement);
       }
      
       function removeCounterElement() {
         $(this).parent().find('span[class="character-counter"]').html();
       }
      
       function addInputStyle(isValidLength, $input) {
         var inputHasInvalidClass = $input.hasClass('invalid');
         if (isValidLength && inputHasInvalidClass) {
           $input.removeClass('invalid');
         } else if (!isValidLength && !inputHasInvalidClass) {
           $input.removeClass('valid');
           $input.addClass('invalid');
         }
       }
      
       $(document).ready(function () {
         $('input, textarea').characterCounter();
       });
      

      })(jQuery);

      (function ($) {
       var methods = {
      
         init: function (options) {
           var defaults = {
             duration: 200, // ms
             dist: -100, // zoom scale TODO: make this more intuitive as an option
             shift: 0, // spacing for center image
             padding: 0, // Padding between non center items
             fullWidth: false, // Change to full width styles
             indicators: false, // Toggle indicators
             noWrap: false, // Don't wrap around and cycle through items.
             onCycleTo: null // Callback for when a new slide is cycled to.
           };
           options = $.extend(defaults, options);
           var namespace = Materialize.objectSelectorString($(this));
      
           return this.each(function (i) {
      
             var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
      
      var $indicators = $('
        ');
               var scrollingTimeout = null;
               var oneTimeCallback = null;
        
               // Initialize
               var view = $(this);
               var hasMultipleSlides = view.find('.carousel-item').length > 1;
               var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
               var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
               var uniqueNamespace = view.attr('data-namespace') || namespace + i;
               view.attr('data-namespace', uniqueNamespace);
        
               // Options
               var setCarouselHeight = function (imageOnly) {
                 var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
                 var firstImage = firstSlide.find('img').first();
                 if (firstImage.length) {
                   if (firstImage[0].complete) {
                     // If image won't trigger the load event
                     var imageHeight = firstImage.height();
                     if (imageHeight > 0) {
                       view.css('height', firstImage.height());
                     } else {
                       // If image still has no height, use the natural dimensions to calculate
                       var naturalWidth = firstImage[0].naturalWidth;
                       var naturalHeight = firstImage[0].naturalHeight;
                       var adjustedHeight = view.width() / naturalWidth * naturalHeight;
                       view.css('height', adjustedHeight);
                     }
                   } else {
                     // Get height when image is loaded normally
                     firstImage.on('load', function () {
                       view.css('height', $(this).height());
                     });
                   }
                 } else if (!imageOnly) {
                   var slideHeight = firstSlide.height();
                   view.css('height', slideHeight);
                 }
               };
        
               if (options.fullWidth) {
                 options.dist = 0;
                 setCarouselHeight();
        
                 // Offset fixed items when indicators.
                 if (showIndicators) {
                   view.find('.carousel-fixed-item').addClass('with-indicators');
                 }
               }
        
               // Don't double initialize.
               if (view.hasClass('initialized')) {
                 // Recalculate variables
                 $(window).trigger('resize');
        
                 // Redraw carousel.
                 view.trigger('carouselNext', [0.000001]);
                 return true;
               }
        
               view.addClass('initialized');
               pressed = false;
               offset = target = 0;
               images = [];
               item_width = view.find('.carousel-item').first().innerWidth();
               item_height = view.find('.carousel-item').first().innerHeight();
               dim = item_width * 2 + options.padding;
        
               view.find('.carousel-item').each(function (i) {
                 images.push($(this)[0]);
                 if (showIndicators) {
        
        var $indicator = $('
      • ');
                   // Add active to first by default.
                   if (i === 0) {
                     $indicator.addClass('active');
                   }
        
                   // Handle clicks on indicators.
                   $indicator.click(function (e) {
                     e.stopPropagation();
        
                     var index = $(this).index();
                     cycleTo(index);
                   });
                   $indicators.append($indicator);
                 }
               });
        
               if (showIndicators) {
                 view.append($indicators);
               }
               count = images.length;
        
               function setupEvents() {
                 if (typeof window.ontouchstart !== 'undefined') {
                   view.on('touchstart.carousel', tap);
                   view.on('touchmove.carousel', drag);
                   view.on('touchend.carousel', release);
                 }
                 view.on('mousedown.carousel', tap);
                 view.on('mousemove.carousel', drag);
                 view.on('mouseup.carousel', release);
                 view.on('mouseleave.carousel', release);
                 view.on('click.carousel', click);
               }
        
               function xpos(e) {
                 // touch event
                 if (e.targetTouches && e.targetTouches.length >= 1) {
                   return e.targetTouches[0].clientX;
                 }
        
                 // mouse event
                 return e.clientX;
               }
        
               function ypos(e) {
                 // touch event
                 if (e.targetTouches && e.targetTouches.length >= 1) {
                   return e.targetTouches[0].clientY;
                 }
        
                 // mouse event
                 return e.clientY;
               }
        
               function wrap(x) {
                 return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
               }
        
               function scroll(x) {
                 // Track scrolling state
                 scrolling = true;
                 if (!view.hasClass('scrolling')) {
                   view.addClass('scrolling');
                 }
                 if (scrollingTimeout != null) {
                   window.clearTimeout(scrollingTimeout);
                 }
                 scrollingTimeout = window.setTimeout(function () {
                   scrolling = false;
                   view.removeClass('scrolling');
                 }, options.duration);
        
                 // Start actual scroll
                 var i, half, delta, dir, tween, el, alignment, xTranslation;
                 var lastCenter = center;
        
                 offset = typeof x === 'number' ? x : offset;
                 center = Math.floor((offset + dim / 2) / dim);
                 delta = offset - center * dim;
                 dir = delta < 0 ? 1 : -1;
                 tween = -dir * delta * 2 / dim;
                 half = count >> 1;
        
                 if (!options.fullWidth) {
                   alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
                   alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
                 } else {
                   alignment = 'translateX(0)';
                 }
        
                 // Set indicator active
                 if (showIndicators) {
                   var diff = center % count;
                   var activeIndicator = $indicators.find('.indicator-item.active');
                   if (activeIndicator.index() !== diff) {
                     activeIndicator.removeClass('active');
                     $indicators.find('.indicator-item').eq(diff).addClass('active');
                   }
                 }
        
                 // center
                 // Don't show wrapped items.
                 if (!noWrap || center >= 0 && center < count) {
                   el = images[wrap(center)];
        
                   // Add active class to center item.
                   if (!$(el).hasClass('active')) {
                     view.find('.carousel-item').removeClass('active');
                     $(el).addClass('active');
                   }
                   el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
                   el.style.zIndex = 0;
                   if (options.fullWidth) {
                     tweenedOpacity = 1;
                   } else {
                     tweenedOpacity = 1 - 0.2 * tween;
                   }
                   el.style.opacity = tweenedOpacity;
                   el.style.display = 'block';
                 }
        
                 for (i = 1; i <= half; ++i) {
                   // right side
                   if (options.fullWidth) {
                     zTranslation = options.dist;
                     tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
                   } else {
                     zTranslation = options.dist * (i * 2 + tween * dir);
                     tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
                   }
                   // Don't show wrapped items.
                   if (!noWrap || center + i < count) {
                     el = images[wrap(center + i)];
                     el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
                     el.style.zIndex = -i;
                     el.style.opacity = tweenedOpacity;
                     el.style.display = 'block';
                   }
        
                   // left side
                   if (options.fullWidth) {
                     zTranslation = options.dist;
                     tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
                   } else {
                     zTranslation = options.dist * (i * 2 - tween * dir);
                     tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
                   }
                   // Don't show wrapped items.
                   if (!noWrap || center - i >= 0) {
                     el = images[wrap(center - i)];
                     el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
                     el.style.zIndex = -i;
                     el.style.opacity = tweenedOpacity;
                     el.style.display = 'block';
                   }
                 }
        
                 // center
                 // Don't show wrapped items.
                 if (!noWrap || center >= 0 && center < count) {
                   el = images[wrap(center)];
                   el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
                   el.style.zIndex = 0;
                   if (options.fullWidth) {
                     tweenedOpacity = 1;
                   } else {
                     tweenedOpacity = 1 - 0.2 * tween;
                   }
                   el.style.opacity = tweenedOpacity;
                   el.style.display = 'block';
                 }
        
                 // onCycleTo callback
                 if (lastCenter !== center && typeof options.onCycleTo === "function") {
                   var $curr_item = view.find('.carousel-item').eq(wrap(center));
                   options.onCycleTo.call(this, $curr_item, dragged);
                 }
        
                 // One time callback
                 if (typeof oneTimeCallback === "function") {
                   oneTimeCallback.call(this, $curr_item, dragged);
                   oneTimeCallback = null;
                 }
               }
        
               function track() {
                 var now, elapsed, delta, v;
        
                 now = Date.now();
                 elapsed = now - timestamp;
                 timestamp = now;
                 delta = offset - frame;
                 frame = offset;
        
                 v = 1000 * delta / (1 + elapsed);
                 velocity = 0.8 * v + 0.2 * velocity;
               }
        
               function autoScroll() {
                 var elapsed, delta;
        
                 if (amplitude) {
                   elapsed = Date.now() - timestamp;
                   delta = amplitude * Math.exp(-elapsed / options.duration);
                   if (delta > 2 || delta < -2) {
                     scroll(target - delta);
                     requestAnimationFrame(autoScroll);
                   } else {
                     scroll(target);
                   }
                 }
               }
        
               function click(e) {
                 // Disable clicks if carousel was dragged.
                 if (dragged) {
                   e.preventDefault();
                   e.stopPropagation();
                   return false;
                 } else if (!options.fullWidth) {
                   var clickedIndex = $(e.target).closest('.carousel-item').index();
                   var diff = wrap(center) - clickedIndex;
        
                   // Disable clicks if carousel was shifted by click
                   if (diff !== 0) {
                     e.preventDefault();
                     e.stopPropagation();
                   }
                   cycleTo(clickedIndex);
                 }
               }
        
               function cycleTo(n) {
                 var diff = center % count - n;
        
                 // Account for wraparound.
                 if (!noWrap) {
                   if (diff < 0) {
                     if (Math.abs(diff + count) < Math.abs(diff)) {
                       diff += count;
                     }
                   } else if (diff > 0) {
                     if (Math.abs(diff - count) < diff) {
                       diff -= count;
                     }
                   }
                 }
        
                 // Call prev or next accordingly.
                 if (diff < 0) {
                   view.trigger('carouselNext', [Math.abs(diff)]);
                 } else if (diff > 0) {
                   view.trigger('carouselPrev', [diff]);
                 }
               }
        
               function tap(e) {
                 // Fixes firefox draggable image bug
                 if (e.type === 'mousedown' && $(e.target).is('img')) {
                   e.preventDefault();
                 }
                 pressed = true;
                 dragged = false;
                 vertical_dragged = false;
                 reference = xpos(e);
                 referenceY = ypos(e);
        
                 velocity = amplitude = 0;
                 frame = offset;
                 timestamp = Date.now();
                 clearInterval(ticker);
                 ticker = setInterval(track, 100);
               }
        
               function drag(e) {
                 var x, delta, deltaY;
                 if (pressed) {
                   x = xpos(e);
                   y = ypos(e);
                   delta = reference - x;
                   deltaY = Math.abs(referenceY - y);
                   if (deltaY < 30 && !vertical_dragged) {
                     // If vertical scrolling don't allow dragging.
                     if (delta > 2 || delta < -2) {
                       dragged = true;
                       reference = x;
                       scroll(offset + delta);
                     }
                   } else if (dragged) {
                     // If dragging don't allow vertical scroll.
                     e.preventDefault();
                     e.stopPropagation();
                     return false;
                   } else {
                     // Vertical scrolling.
                     vertical_dragged = true;
                   }
                 }
        
                 if (dragged) {
                   // If dragging don't allow vertical scroll.
                   e.preventDefault();
                   e.stopPropagation();
                   return false;
                 }
               }
        
               function release(e) {
                 if (pressed) {
                   pressed = false;
                 } else {
                   return;
                 }
        
                 clearInterval(ticker);
                 target = offset;
                 if (velocity > 10 || velocity < -10) {
                   amplitude = 0.9 * velocity;
                   target = offset + amplitude;
                 }
                 target = Math.round(target / dim) * dim;
        
                 // No wrap of items.
                 if (noWrap) {
                   if (target >= dim * (count - 1)) {
                     target = dim * (count - 1);
                   } else if (target < 0) {
                     target = 0;
                   }
                 }
                 amplitude = target - offset;
                 timestamp = Date.now();
                 requestAnimationFrame(autoScroll);
        
                 if (dragged) {
                   e.preventDefault();
                   e.stopPropagation();
                 }
                 return false;
               }
        
               xform = 'transform';
               ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
                 var e = prefix + 'Transform';
                 if (typeof document.body.style[e] !== 'undefined') {
                   xform = e;
                   return false;
                 }
                 return true;
               });
        
               var throttledResize = Materialize.throttle(function () {
                 if (options.fullWidth) {
                   item_width = view.find('.carousel-item').first().innerWidth();
                   var imageHeight = view.find('.carousel-item.active').height();
                   dim = item_width * 2 + options.padding;
                   offset = center * 2 * item_width;
                   target = offset;
                   setCarouselHeight(true);
                 } else {
                   scroll();
                 }
               }, 200);
               $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
        
               setupEvents();
               scroll(offset);
        
               $(this).on('carouselNext', function (e, n, callback) {
                 if (n === undefined) {
                   n = 1;
                 }
                 if (typeof callback === "function") {
                   oneTimeCallback = callback;
                 }
        
                 target = dim * Math.round(offset / dim) + dim * n;
                 if (offset !== target) {
                   amplitude = target - offset;
                   timestamp = Date.now();
                   requestAnimationFrame(autoScroll);
                 }
               });
        
               $(this).on('carouselPrev', function (e, n, callback) {
                 if (n === undefined) {
                   n = 1;
                 }
                 if (typeof callback === "function") {
                   oneTimeCallback = callback;
                 }
        
                 target = dim * Math.round(offset / dim) - dim * n;
                 if (offset !== target) {
                   amplitude = target - offset;
                   timestamp = Date.now();
                   requestAnimationFrame(autoScroll);
                 }
               });
        
               $(this).on('carouselSet', function (e, n, callback) {
                 if (n === undefined) {
                   n = 0;
                 }
                 if (typeof callback === "function") {
                   oneTimeCallback = callback;
                 }
        
                 cycleTo(n);
               });
             });
           },
           next: function (n, callback) {
             $(this).trigger('carouselNext', [n, callback]);
           },
           prev: function (n, callback) {
             $(this).trigger('carouselPrev', [n, callback]);
           },
           set: function (n, callback) {
             $(this).trigger('carouselSet', [n, callback]);
           },
           destroy: function () {
             var uniqueNamespace = $(this).attr('data-namespace');
             $(this).removeAttr('data-namespace');
             $(this).removeClass('initialized');
             $(this).find('.indicators').remove();
        
             // Remove event handlers
             $(this).off('carouselNext carouselPrev carouselSet');
             $(window).off('resize.carousel-' + uniqueNamespace);
             if (typeof window.ontouchstart !== 'undefined') {
               $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
             }
             $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
           }
         };
        
         $.fn.carousel = function (methodOrOptions) {
           if (methods[methodOrOptions]) {
             return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
           } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
             // Default to "init"
             return methods.init.apply(this, arguments);
           } else {
             $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
           }
         }; // Plugin end
        

        })(jQuery);

        (function ($) {
         var methods = {
           init: function (options) {
             return this.each(function () {
               var origin = $('#' + $(this).attr('data-activates'));
               var screen = $('body');
        
               // Creating tap target
               var tapTargetEl = $(this);
               var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
               var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
               var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
               var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
        
               // Creating wrapper
               if (!tapTargetWrapper.length) {
        
        tapTargetWrapper = tapTargetEl.wrap($('
        ')).parent();
               }
        
               // Creating content
               if (!tapTargetContentEl.length) {
        
        tapTargetContentEl = $('
        ');
                 tapTargetEl.append(tapTargetContentEl);
               }
        
               // Creating foreground wave
               if (!tapTargetWave.length) {
        
        tapTargetWave = $('
        ');
                 // Creating origin
                 if (!tapTargetOriginEl.length) {
                   tapTargetOriginEl = origin.clone(true, true);
                   tapTargetOriginEl.addClass('tap-target-origin');
                   tapTargetOriginEl.removeAttr('id');
                   tapTargetOriginEl.removeAttr('style');
                   tapTargetWave.append(tapTargetOriginEl);
                 }
        
                 tapTargetWrapper.append(tapTargetWave);
               }
        
               // Open
               var openTapTarget = function () {
                 if (tapTargetWrapper.is('.open')) {
                   return;
                 }
        
                 // Adding open class
                 tapTargetWrapper.addClass('open');
        
                 setTimeout(function () {
                   tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
                     closeTapTarget();
                     tapTargetOriginEl.off('click.tapTarget');
                   });
        
                   $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
                     closeTapTarget();
                     $(document).off('click.tapTarget');
                   });
        
                   var throttledCalc = Materialize.throttle(function () {
                     calculateTapTarget();
                   }, 200);
                   $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
                 }, 0);
               };
        
               // Close
               var closeTapTarget = function () {
                 if (!tapTargetWrapper.is('.open')) {
                   return;
                 }
        
                 tapTargetWrapper.removeClass('open');
                 tapTargetOriginEl.off('click.tapTarget');
                 $(document).off('click.tapTarget');
                 $(window).off('resize.tapTarget');
               };
        
               // Pre calculate
               var calculateTapTarget = function () {
                 // Element or parent is fixed position?
                 var isFixed = origin.css('position') === 'fixed';
                 if (!isFixed) {
                   var parents = origin.parents();
                   for (var i = 0; i < parents.length; i++) {
                     isFixed = $(parents[i]).css('position') == 'fixed';
                     if (isFixed) {
                       break;
                     }
                   }
                 }
        
                 // Calculating origin
                 var originWidth = origin.outerWidth();
                 var originHeight = origin.outerHeight();
                 var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
                 var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
        
                 // Calculating screen
                 var windowWidth = $(window).width();
                 var windowHeight = $(window).height();
                 var centerX = windowWidth / 2;
                 var centerY = windowHeight / 2;
                 var isLeft = originLeft <= centerX;
                 var isRight = originLeft > centerX;
                 var isTop = originTop <= centerY;
                 var isBottom = originTop > centerY;
                 var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
                 var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
        
                 // Calculating tap target
                 var tapTargetWidth = tapTargetEl.outerWidth();
                 var tapTargetHeight = tapTargetEl.outerHeight();
                 var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
                 var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
                 var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
        
                 // Calculating content
                 var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
                 var tapTargetTextHeight = tapTargetHeight / 2;
                 var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
                 var tapTargetTextBottom = 0;
                 var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
                 var tapTargetTextRight = 0;
                 var tapTargetTextPadding = originWidth;
                 var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
        
                 // Calculating wave
                 var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
                 var tapTargetWaveHeight = tapTargetWaveWidth;
                 var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
                 var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
        
                 // Setting tap target
                 var tapTargetWrapperCssObj = {};
                 tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ;
                 tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ;
                 tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ;
                 tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ;
                 tapTargetWrapperCssObj.position = tapTargetPosition;
                 tapTargetWrapper.css(tapTargetWrapperCssObj);
        
                 // Setting content
                 tapTargetContentEl.css({
                   width: tapTargetTextWidth,
                   height: tapTargetTextHeight,
                   top: tapTargetTextTop,
                   right: tapTargetTextRight,
                   bottom: tapTargetTextBottom,
                   left: tapTargetTextLeft,
                   padding: tapTargetTextPadding,
                   verticalAlign: tapTargetTextAlign
                 });
        
                 // Setting wave
                 tapTargetWave.css({
                   top: tapTargetWaveTop,
                   left: tapTargetWaveLeft,
                   width: tapTargetWaveWidth,
                   height: tapTargetWaveHeight
                 });
               };
        
               if (options == 'open') {
                 calculateTapTarget();
                 openTapTarget();
               }
        
               if (options == 'close') closeTapTarget();
             });
           },
           open: function () {},
           close: function () {}
         };
        
         $.fn.tapTarget = function (methodOrOptions) {
           if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
        
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
         };
        

        })(jQuery);