Team:Evry Paris-Saclay/Template:Javascript

/*!

* Materialize v0.99.0 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/

// Check for jQuery. if (typeof (jQuery) === 'undefined') {

   var jQuery;
   // Check if require is a defined function.
   if (typeof (require) === 'function') {
       jQuery = $ = require('jquery');
       // Else use the dollar sign alias.
   } else {
       jQuery = $;
   }

}; /*

* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
* Open source under the BSD License.
* Copyright © 2008 George McGinley Smith
* All rights reserved.
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
*/

(function (factory) {

   if (typeof define === "function" && define.amd) {
       define(['jquery'], function ($) {
           return factory($);
       });
   } else if (typeof module === "object" && typeof module.exports === "object") {
       exports = factory(require('jquery'));
   } else {
       factory(jQuery);
   }

})(function ($) {

   // Preserve the original jQuery "swing" easing as "jswing"
   $.easing['jswing'] = $.easing['swing'];
   var pow = Math.pow,
       sqrt = Math.sqrt,
       sin = Math.sin,
       cos = Math.cos,
       PI = Math.PI,
       c1 = 1.70158,
       c2 = c1 * 1.525,
       c3 = c1 + 1,
       c4 = (2 * PI) / 3,
       c5 = (2 * PI) / 4.5;
   // x is the fraction of animation progress, in the range 0..1
   function bounceOut(x) {
       var n1 = 7.5625,
           d1 = 2.75;
       if (x < 1 / d1) {
           return n1 * x * x;
       } else if (x < 2 / d1) {
           return n1 * (x -= (1.5 / d1)) * x + .75;
       } else if (x < 2.5 / d1) {
           return n1 * (x -= (2.25 / d1)) * x + .9375;
       } else {
           return n1 * (x -= (2.625 / d1)) * x + .984375;
       }
   }
   $.extend($.easing, {
       def: 'easeOutQuad',
       swing: function (x) {
           return $.easing[$.easing.def](x);
       },
       easeInQuad: function (x) {
           return x * x;
       },
       easeOutQuad: function (x) {
           return 1 - (1 - x) * (1 - x);
       },
       easeInOutQuad: function (x) {
           return x < 0.5 ?
               2 * x * x :
               1 - pow(-2 * x + 2, 2) / 2;
       },
       easeInCubic: function (x) {
           return x * x * x;
       },
       easeOutCubic: function (x) {
           return 1 - pow(1 - x, 3);
       },
       easeInOutCubic: function (x) {
           return x < 0.5 ?
               4 * x * x * x :
               1 - pow(-2 * x + 2, 3) / 2;
       },
       easeInQuart: function (x) {
           return x * x * x * x;
       },
       easeOutQuart: function (x) {
           return 1 - pow(1 - x, 4);
       },
       easeInOutQuart: function (x) {
           return x < 0.5 ?
               8 * x * x * x * x :
               1 - pow(-2 * x + 2, 4) / 2;
       },
       easeInQuint: function (x) {
           return x * x * x * x * x;
       },
       easeOutQuint: function (x) {
           return 1 - pow(1 - x, 5);
       },
       easeInOutQuint: function (x) {
           return x < 0.5 ?
               16 * x * x * x * x * x :
               1 - pow(-2 * x + 2, 5) / 2;
       },
       easeInSine: function (x) {
           return 1 - cos(x * PI / 2);
       },
       easeOutSine: function (x) {
           return sin(x * PI / 2);
       },
       easeInOutSine: function (x) {
           return -(cos(PI * x) - 1) / 2;
       },
       easeInExpo: function (x) {
           return x === 0 ? 0 : pow(2, 10 * x - 10);
       },
       easeOutExpo: function (x) {
           return x === 1 ? 1 : 1 - pow(2, -10 * x);
       },
       easeInOutExpo: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
               pow(2, 20 * x - 10) / 2 :
               (2 - pow(2, -20 * x + 10)) / 2;
       },
       easeInCirc: function (x) {
           return 1 - sqrt(1 - pow(x, 2));
       },
       easeOutCirc: function (x) {
           return sqrt(1 - pow(x - 1, 2));
       },
       easeInOutCirc: function (x) {
           return x < 0.5 ?
               (1 - sqrt(1 - pow(2 * x, 2))) / 2 :
               (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
       },
       easeInElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 :
               -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
       },
       easeOutElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 :
               pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
       },
       easeInOutElastic: function (x) {
           return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
               -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 :
               pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
       },
       easeInBack: function (x) {
           return c3 * x * x * x - c1 * x * x;
       },
       easeOutBack: function (x) {
           return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
       },
       easeInOutBack: function (x) {
           return x < 0.5 ?
               (pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 :
               (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
       },
       easeInBounce: function (x) {
           return 1 - bounceOut(1 - x);
       },
       easeOutBounce: bounceOut,
       easeInOutBounce: function (x) {
           return x < 0.5 ?
               (1 - bounceOut(1 - 2 * x)) / 2 :
               (1 + bounceOut(2 * x - 1)) / 2;
       }
   });

});; // Custom Easing jQuery.extend(jQuery.easing, {

   easeInOutMaterial: function (x, t, b, c, d) {
       if ((t /= d / 2) < 1) return c / 2 * t * t + b;
       return c / 4 * ((t -= 2) * t * t + 2) + b;
   }

});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (! function (e) {

   function t(e) {
       var t = e.length,
           a = r.type(e);
       return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e
   }
   if (!e.jQuery) {
       var r = function (e, t) {
           return new r.fn.init(e, t)
       };
       r.isWindow = function (e) {
           return null != e && e == e.window
       }, r.type = function (e) {
           return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e
       }, r.isArray = Array.isArray || function (e) {
           return "array" === r.type(e)
       }, r.isPlainObject = function (e) {
           var t;
           if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;
           try {
               if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1
           } catch (a) {
               return !1
           }
           for (t in e);
           return void 0 === t || o.call(e, t)
       }, r.each = function (e, r, a) {
           var n, o = 0,
               i = e.length,
               s = t(e);
           if (a) {
               if (s)
                   for (; i > o && (n = r.apply(e[o], a), n !== !1); o++);
               else
                   for (o in e)
                       if (n = r.apply(e[o], a), n === !1) break
           } else if (s)
               for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++);
           else
               for (o in e)
                   if (n = r.call(e[o], o, e[o]), n === !1) break; return e
       }, r.data = function (e, t, n) {
           if (void 0 === n) {
               var o = e[r.expando],
                   i = o && a[o];
               if (void 0 === t) return i;
               if (i && t in i) return i[t]
           } else if (void 0 !== t) {
               var o = e[r.expando] || (e[r.expando] = ++r.uuid);
               return a[o] = a[o] || {}, a[o][t] = n, n
           }
       }, r.removeData = function (e, t) {
           var n = e[r.expando],
               o = n && a[n];
           o && r.each(t, function (e, t) {
               delete o[t]
           })
       }, r.extend = function () {
           var e, t, a, n, o, i, s = arguments[0] || {},
               l = 1,
               u = arguments.length,
               c = !1;
           for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++)
               if (null != (o = arguments[l]))
                   for (n in o) e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
           return s
       }, r.queue = function (e, a, n) {
           function o(e, r) {
               var a = r || [];
               return null != e && (t(Object(e)) ? ! function (e, t) {
                   for (var r = +t.length, a = 0, n = e.length; r > a;) e[n++] = t[a++];
                   if (r !== r)
                       for (; void 0 !== t[a];) e[n++] = t[a++];
                   return e.length = n, e
               }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a
           }
           if (e) {
               a = (a || "fx") + "queue";
               var i = r.data(e, a);
               return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []
           }
       }, r.dequeue = function (e, t) {
           r.each(e.nodeType ? [e] : e, function (e, a) {
               t = t || "fx";
               var n = r.queue(a, t),
                   o = n.shift();
               "inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
                   r.dequeue(a, t)
               }))
           })
       }, r.fn = r.prototype = {
           init: function (e) {
               if (e.nodeType) return this[0] = e, this;
               throw new Error("Not a DOM node.")
           },
           offset: function () {
               var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : {
                   top: 0,
                   left: 0
               };
               return {
                   top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0),
                   left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0)
               }
           },
           position: function () {
               function e() {
                   for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) e = e.offsetParent;
                   return e || document
               }
               var t = this[0],
                   e = e.apply(t),
                   a = this.offset(),
                   n = /^(?:body|html)$/i.test(e.nodeName) ? {
                       top: 0,
                       left: 0
                   } : r(e).offset();
               return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), {
                   top: a.top - n.top,
                   left: a.left - n.left
               }
           }
       };
       var a = {};
       r.expando = "velocity" + (new Date).getTime(), r.uuid = 0;
       for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) n["[object " + s[l] + "]"] = s[l].toLowerCase();
       r.fn.init.prototype = r.fn, e.Velocity = {
           Utilities: r
       }
   }

}(window), function (e) {

   "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e()

}(function () {

   return function (e, t, r, a) {
       function n(e) {
           for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
               var n = e[t];
               n && a.push(n)
           }
           return a
       }
       function o(e) {
           return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e
       }
       function i(e) {
           var t = f.data(e, "velocity");
           return null === t ? a : t
       }
       function s(e) {
           return function (t) {
               return Math.round(t * e) * (1 / e)
           }
       }
       function l(e, r, a, n) {
           function o(e, t) {
               return 1 - 3 * t + 3 * e
           }
           function i(e, t) {
               return 3 * t - 6 * e
           }
           function s(e) {
               return 3 * e
           }
           function l(e, t, r) {
               return ((o(t, r) * e + i(t, r)) * e + s(t)) * e
           }
           function u(e, t, r) {
               return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t)
           }
           function c(t, r) {
               for (var n = 0; m > n; ++n) {
                   var o = u(r, e, a);
                   if (0 === o) return r;
                   var i = l(r, e, a) - t;
                   r -= i / o
               }
               return r
           }
           function p() {
               for (var t = 0; b > t; ++t) w[t] = l(t * x, e, a)
           }
           function f(t, r, n) {
               var o, i, s = 0;
               do i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; while (Math.abs(o) > h && ++s < v);
               return i
           }
           function d(t) {
               for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) r += x;
               --n;
               var i = (t - w[n]) / (w[n + 1] - w[n]),
                   s = r + i * x,
                   l = u(s, e, a);
               return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x)
           }
           function g() {
               V = !0, (e != r || a != n) && p()
           }
           var m = 4,
               y = .001,
               h = 1e-7,
               v = 10,
               b = 11,
               x = 1 / (b - 1),
               S = "Float32Array" in t;
           if (4 !== arguments.length) return !1;
           for (var P = 0; 4 > P; ++P)
               if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
           e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);
           var w = S ? new Float32Array(b) : new Array(b),
               V = !1,
               C = function (t) {
                   return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n)
               };
           C.getControlPoints = function () {
               return [{
                   x: e,
                   y: r
               }, {
                   x: a,
                   y: n
               }]
           };
           var T = "generateBezier(" + [e, r, a, n] + ")";
           return C.toString = function () {
               return T
           }, C
       }
       function u(e, t) {
           var r = e;
           return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r
       }
       function c(e) {
           if (e) {
               var t = (new Date).getTime(),
                   r = b.State.calls.length;
               r > 1e4 && (b.State.calls = n(b.State.calls));
               for (var o = 0; r > o; o++)
                   if (b.State.calls[o]) {
                       var s = b.State.calls[o],
                           l = s[0],
                           u = s[2],
                           d = s[3],
                           g = !!d,
                           y = null;
                       d || (d = b.State.calls[o][3] = t - 16);
                       for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
                           var P = l[v],
                               V = P.element;
                           if (i(V)) {
                               var C = !1;
                               if (u.display !== a && null !== u.display && "none" !== u.display) {
                                   if ("flex" === u.display) {
                                       var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];
                                       f.each(T, function (e, t) {
                                           S.setPropertyValue(V, "display", t)
                                       })
                                   }
                                   S.setPropertyValue(V, "display", u.display)
                               }
                               u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);
                               for (var k in P)
                                   if ("element" !== k) {
                                       var A, F = P[k],
                                           j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;
                                       if (1 === h) A = F.endValue;
                                       else {
                                           var E = F.endValue - F.startValue;
                                           if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue
                                       }
                                       if (F.currentValue = A, "tween" === k) y = A;
                                       else {
                                           if (S.Hooks.registered[k]) {
                                               var H = S.Hooks.getRoot(k),
                                                   N = i(V).rootPropertyValueCache[H];
                                               N && (F.rootPropertyValue = N)
                                           }
                                           var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);
                                           S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0)
                                       }
                                   }
                               u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V)
                           }
                       }
                       u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o)
                   }
           }
           b.State.isTicking && w(c)
       }
       function p(e, t) {
           if (!b.State.calls[e]) return !1;
           for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
               var p = r[u].element;
               if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
                   i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};
                   var d = !1;
                   f.each(S.Lists.transforms3D, function (e, t) {
                       var r = /^scale/.test(t) ? 1 : 0,
                           n = i(p).transformCache[t];
                       i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t])
                   }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating")
               }
               if (!t && o.complete && !o.loop && u === c - 1) try {
                   o.complete.call(n, n)
               } catch (g) {
                   setTimeout(function () {
                       throw g
                   }, 1)
               }
               s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
                   /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100)
               }), b(p, "reverse", {
                   loop: !0,
                   delay: o.delay
               })), o.queue !== !1 && f.dequeue(p, o.queue)
           }
           b.State.calls[e] = !1;
           for (var m = 0, y = b.State.calls.length; y > m; m++)
               if (b.State.calls[m] !== !1) {
                   l = !0;
                   break
               }
           l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = [])
       }
       var f, d = function () {
               if (r.documentMode) return r.documentMode;
               for (var e = 7; e > 4; e--) {
                   var t = r.createElement("div");
                   if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e
               }
               return a
           }(),
           g = function () {
               var e = 0;
               return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
                   var r, a = (new Date).getTime();
                   return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
                       t(a + r)
                   }, r)
               }
           }(),
           m = {
               isString: function (e) {
                   return "string" == typeof e
               },
               isArray: Array.isArray || function (e) {
                   return "[object Array]" === Object.prototype.toString.call(e)
               },
               isFunction: function (e) {
                   return "[object Function]" === Object.prototype.toString.call(e)
               },
               isNode: function (e) {
                   return e && e.nodeType
               },
               isNodeList: function (e) {
                   return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0)
               },
               isWrapped: function (e) {
                   return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e))
               },
               isSVG: function (e) {
                   return t.SVGElement && e instanceof t.SVGElement
               },
               isEmptyObject: function (e) {
                   for (var t in e) return !1;
                   return !0
               }
           },
           y = !1;
       if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");
       if (7 >= d) return void(jQuery.fn.velocity = jQuery.fn.animate);
       var h = 400,
           v = "swing",
           b = {
               State: {
                   isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
                   isAndroid: /Android/i.test(navigator.userAgent),
                   isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent),
                   isChrome: t.chrome,
                   isFirefox: /Firefox/i.test(navigator.userAgent),
                   prefixElement: r.createElement("div"),
                   prefixMatches: {},
                   scrollAnchor: null,
                   scrollPropertyLeft: null,
                   scrollPropertyTop: null,
                   isTicking: !1,
                   calls: []
               },
               CSS: {},
               Utilities: f,
               Redirects: {},
               Easings: {},
               Promise: t.Promise,
               defaults: {
                   queue: "",
                   duration: h,
                   easing: v,
                   begin: a,
                   complete: a,
                   progress: a,
                   display: a,
                   visibility: a,
                   loop: !1,
                   delay: !1,
                   mobileHA: !0,
                   _cacheValues: !0
               },
               init: function (e) {
                   f.data(e, "velocity", {
                       isSVG: m.isSVG(e),
                       isAnimating: !1,
                       computedStyle: null,
                       tweensContainer: null,
                       rootPropertyValueCache: {},
                       transformCache: {}
                   })
               },
               hook: null,
               mock: !1,
               version: {
                   major: 1,
                   minor: 2,
                   patch: 2
               },
               debug: !1
           };
       t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");
       var x = function () {
           function e(e) {
               return -e.tension * e.x - e.friction * e.v
           }
           function t(t, r, a) {
               var n = {
                   x: t.x + a.dx * r,
                   v: t.v + a.dv * r,
                   tension: t.tension,
                   friction: t.friction
               };
               return {
                   dx: n.v,
                   dv: e(n)
               }
           }
           function r(r, a) {
               var n = {
                       dx: r.v,
                       dv: e(r)
                   },
                   o = t(r, .5 * a, n),
                   i = t(r, .5 * a, o),
                   s = t(r, a, i),
                   l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
                   u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);
               return r.x = r.x + l * a, r.v = r.v + u * a, r
           }
           return function a(e, t, n) {
               var o, i, s, l = {
                       x: -1,
                       v: 0,
                       tension: null,
                       friction: null
                   },
                   u = [0],
                   c = 0,
                   p = 1e-4,
                   f = .016;
               for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;);
               return o ? function (e) {
                   return u[e * (u.length - 1) | 0]
               } : c
           }
       }();
       b.Easings = {
           linear: function (e) {
               return e
           },
           swing: function (e) {
               return .5 - Math.cos(e * Math.PI) / 2
           },
           spring: function (e) {
               return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e)
           }
       }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
           b.Easings[t[0]] = l.apply(null, t[1])
       });
       var S = b.CSS = {
           RegEx: {
               isHex: /^#([A-f\d]{3}){1,2}$/i,
               valueUnwrap: /^[A-z]+\((.*)\)$/i,
               wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,
               valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi
           },
           Lists: {
               colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"],
               transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"],
               transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"]
           },
           Hooks: {
               templates: {
                   textShadow: ["Color X Y Blur", "black 0px 0px 0px"],
                   boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"],
                   clip: ["Top Right Bottom Left", "0px 0px 0px 0px"],
                   backgroundPosition: ["X Y", "0% 0%"],
                   transformOrigin: ["X Y Z", "50% 50% 0px"],
                   perspectiveOrigin: ["X Y", "50% 50%"]
               },
               registered: {},
               register: function () {
                   for (var e = 0; e < S.Lists.colors.length; e++) {
                       var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";
                       S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]
                   }
                   var r, a, n;
                   if (d)
                       for (r in S.Hooks.templates) {
                           a = S.Hooks.templates[r], n = a[0].split(" ");
                           var o = a[1].match(S.RegEx.valueSplit);
                           "Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")])
                       }
                   for (r in S.Hooks.templates) {
                       a = S.Hooks.templates[r], n = a[0].split(" ");
                       for (var e in n) {
                           var i = r + n[e],
                               s = e;
                           S.Hooks.registered[i] = [r, s]
                       }
                   }
               },
               getRoot: function (e) {
                   var t = S.Hooks.registered[e];
                   return t ? t[0] : e
               },
               cleanRootPropertyValue: function (e, t) {
                   return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t
               },
               extractValue: function (e, t) {
                   var r = S.Hooks.registered[e];
                   if (r) {
                       var a = r[0],
                           n = r[1];
                       return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]
                   }
                   return t
               },
               injectValue: function (e, t, r) {
                   var a = S.Hooks.registered[e];
                   if (a) {
                       var n, o, i = a[0],
                           s = a[1];
                       return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ")
                   }
                   return r
               }
           },
           Normalizations: {
               registered: {
                   clip: function (e, t, r) {
                       switch (e) {
                       case "name":
                           return "clip";
                       case "extract":
                           var a;
                           return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;
                       case "inject":
                           return "rect(" + r + ")"
                       }
                   },
                   blur: function (e, t, r) {
                       switch (e) {
                       case "name":
                           return b.State.isFirefox ? "filter" : "-webkit-filter";
                       case "extract":
                           var a = parseFloat(r);
                           if (!a && 0 !== a) {
                               var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);
                               a = n ? n[1] : 0
                           }
                           return a;
                       case "inject":
                           return parseFloat(r) ? "blur(" + r + ")" : "none"
                       }
                   },
                   opacity: function (e, t, r) {
                       if (8 >= d) switch (e) {
                       case "name":
                           return "filter";
                       case "extract":
                           var a = r.toString().match(/alpha\(opacity=(.*)\)/i);
                           return r = a ? a[1] / 100 : 1;
                       case "inject":
                           return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")"
                       } else switch (e) {
                       case "name":
                           return "opacity";
                       case "extract":
                           return r;
                       case "inject":
                           return r
                       }
                   }
               },
               register: function () {
                   9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));
                   for (var e = 0; e < S.Lists.transformsBase.length; e++) ! function () {
                       var t = S.Lists.transformsBase[e];
                       S.Normalizations.registered[t] = function (e, r, n) {
                           switch (e) {
                           case "name":
                               return "transform";
                           case "extract":
                               return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");
                           case "inject":
                               var o = !1;
                               switch (t.substr(0, t.length - 1)) {
                               case "translate":
                                   o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);
                                   break;
                               case "scal":
                               case "scale":
                                   b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);
                                   break;
                               case "skew":
                                   o = !/(deg|\d)$/i.test(n);
                                   break;
                               case "rotate":
                                   o = !/(deg|\d)$/i.test(n)
                               }
                               return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t]
                           }
                       }
                   }();
                   for (var e = 0; e < S.Lists.colors.length; e++) ! function () {
                       var t = S.Lists.colors[e];
                       S.Normalizations.registered[t] = function (e, r, n) {
                           switch (e) {
                           case "name":
                               return t;
                           case "extract":
                               var o;
                               if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;
                               else {
                                   var i, s = {
                                       black: "rgb(0, 0, 0)",
                                       blue: "rgb(0, 0, 255)",
                                       gray: "rgb(128, 128, 128)",
                                       green: "rgb(0, 128, 0)",
                                       red: "rgb(255, 0, 0)",
                                       white: "rgb(255, 255, 255)"
                                   };
                                   /^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ")
                               }
                               return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;
                           case "inject":
                               return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")"
                           }
                       }
                   }()
               }
           },
           Names: {
               camelCase: function (e) {
                   return e.replace(/-(\w)/g, function (e, t) {
                       return t.toUpperCase()
                   })
               },
               SVGAttribute: function (e) {
                   var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";
                   return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e)
               },
               prefixCheck: function (e) {
                   if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];
                   for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
                       var n;
                       if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
                               return e.toUpperCase()
                           }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]
                   }
                   return [e, !1]
               }
           },
           Values: {
               hexToRgb: function (e) {
                   var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
                       a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;
                   return e = e.replace(r, function (e, t, r, a) {
                       return t + t + r + r + a + a
                   }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]
               },
               isCSSNullValue: function (e) {
                   return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)
               },
               getUnitType: function (e) {
                   return /^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
               },
               getDisplayType: function (e) {
                   var t = e && e.tagName.toString().toLowerCase();
                   return /^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
               },
               addClass: function (e, t) {
                   e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t
               },
               removeClass: function (e, t) {
                   e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ")
               }
           },
           getPropertyValue: function (e, r, n, o) {
               function s(e, r) {
                   function n() {
                       u && S.setPropertyValue(e, "display", "none")
                   }
                   var l = 0;
                   if (8 >= d) l = f.css(e, r);
                   else {
                       var u = !1;
                       if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
                           if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
                               var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);
                               return n(), c
                           }
                           if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
                               var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);
                               return n(), p
                           }
                       }
                       var g;
                       g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n()
                   }
                   if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
                       var m = s(e, "position");
                       ("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px")
                   }
                   return l
               }
               var l;
               if (S.Hooks.registered[r]) {
                   var u = r,
                       c = S.Hooks.getRoot(u);
                   n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n)
               } else if (S.Normalizations.registered[r]) {
                   var p, g;
                   p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g)
               }
               if (!/^[\d-]/.test(l))
                   if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r))
                       if (/^(height|width)$/i.test(r)) try {
                           l = e.getBBox()[r]
                       } catch (m) {
                           l = 0
                       } else l = e.getAttribute(r);
                       else l = s(e, S.Names.prefixCheck(r)[0]);
               return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l
           },
           setPropertyValue: function (e, r, a, n, o) {
               var s = r;
               if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);
               else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];
               else {
                   if (S.Hooks.registered[r]) {
                       var l = r,
                           u = S.Hooks.getRoot(r);
                       n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u
                   }
                   if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
                       e.style[s] = a
                   } catch (c) {
                       b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]")
                   } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;
                   b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a)
               }
               return [s, a]
           },
           flushTransformCache: function (e) {
               function t(t) {
                   return parseFloat(S.getPropertyValue(e, t))
               }
               var r = "";
               if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
                   var a = {
                       translate: [t("translateX"), t("translateY")],
                       skewX: [t("skewX")],
                       skewY: [t("skewY")],
                       scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")],
                       rotate: [t("rotateZ"), 0, 0]
                   };
                   f.each(i(e).transformCache, function (e) {
                       /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e])
                   })
               } else {
                   var n, o;
                   f.each(i(e).transformCache, function (t) {
                       return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void(r += t + n + " "))
                   }), o && (r = "perspective" + o + " " + r)
               }
               S.setPropertyValue(e, "transform", r)
           }
       };
       S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
           var n = a;
           return e = o(e), f.each(e, function (e, o) {
               if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));
               else {
                   var s = b.CSS.setPropertyValue(o, t, r);
                   "transform" === s[0] && b.CSS.flushTransformCache(o), n = s
               }
           }), n
       };
       var P = function () {
           function e() {
               return s ? k.promise || null : l
           }
           function n() {
               function e(e) {
                   function p(e, t) {
                       var r = a,
                           n = a,
                           i = a;
                       return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]
                   }
                   function d(e, t) {
                       var r, a;
                       return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
                           return r = e, ""
                       }), r || (r = S.Values.getUnitType(e)), [a, r]
                   }
                   function h() {
                       var e = {
                               myParent: o.parentNode || r.body,
                               position: S.getPropertyValue(o, "position"),
                               fontSize: S.getPropertyValue(o, "fontSize")
                           },
                           a = e.position === L.lastPosition && e.myParent === L.lastParent,
                           n = e.fontSize === L.lastFontSize;
                       L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;
                       var s = 100,
                           l = {};
                       if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;
                       else {
                           var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");
                           b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
                               b.CSS.setPropertyValue(u, t, "hidden")
                           }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
                               b.CSS.setPropertyValue(u, t, s + "%")
                           }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u)
                       }
                       return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l
                   }
                   if (s.begin && 0 === V) try {
                       s.begin.call(g, g)
                   } catch (x) {
                       setTimeout(function () {
                           throw x
                       }, 1)
                   }
                   if ("scroll" === A) {
                       var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top",
                           j = parseFloat(s.offset) || 0;
                       s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = {
                           scroll: {
                               rootPropertyValue: !1,
                               startValue: P,
                               currentValue: P,
                               endValue: T,
                               unitType: "",
                               easing: s.easing,
                               scrollData: {
                                   container: s.container,
                                   direction: F,
                                   alternateValue: C
                               }
                           },
                           element: o
                       }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o)
                   } else if ("reverse" === A) {
                       if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);
                       "none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);
                       var E = f.extend(!0, {}, i(o).tweensContainer);
                       for (var H in E)
                           if ("element" !== H) {
                               var N = E[H].startValue;
                               E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o)
                           }
                       l = E
                   } else if ("start" === A) {
                       var E;
                       i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
                           if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
                               var r = p(t, !0),
                                   n = r[0],
                                   o = r[1],
                                   i = r[2];
                               if (S.RegEx.isHex.test(n)) {
                                   for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
                                       var f = [l[c]];
                                       o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f
                                   }
                                   delete y[e]
                               }
                           }
                       });
                       for (var z in y) {
                           var O = p(y[z]),
                               q = O[0],
                               $ = O[1],
                               M = O[2];
                           z = S.Names.camelCase(z);
                           var I = S.Hooks.getRoot(z),
                               B = !1;
                           if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
                               (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));
                               var W, G, Y, D = !1;
                               if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
                                       return D = t, ""
                                   }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;
                               else if (Y !== G && 0 !== M)
                                   if (0 === q) G = Y;
                                   else {
                                       n = n || h();
                                       var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";
                                       switch (Y) {
                                       case "%":
                                           M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;
                                           break;
                                       case "px":
                                           break;
                                       default:
                                           M *= n[Y + "ToPx"]
                                       }
                                       switch (G) {
                                       case "%":
                                           M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);
                                           break;
                                       case "px":
                                           break;
                                       default:
                                           M *= 1 / n[G + "ToPx"]
                                       }
                                   }
                               switch (D) {
                               case "+":
                                   q = M + q;
                                   break;
                               case "-":
                                   q = M - q;
                                   break;
                               case "*":
                                   q = M * q;
                                   break;
                               case "/":
                                   q = M / q
                               }
                               l[z] = {
                                   rootPropertyValue: B,
                                   startValue: M,
                                   currentValue: M,
                                   endValue: q,
                                   unitType: G,
                                   easing: $
                               }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o)
                           } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.")
                       }
                       l.element = o
                   }
                   l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++)
               }
               var n, o = this,
                   s = f.extend({}, b.defaults, v),
                   l = {};
               switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
                   b.velocityQueueEntryFlag = !0, i(o).delayTimer = {
                       setTimeout: setTimeout(e, parseFloat(s.delay)),
                       next: e
                   }
               }), s.duration.toString().toLowerCase()) {
               case "fast":
                   s.duration = 200;
                   break;
               case "normal":
                   s.duration = h;
                   break;
               case "slow":
                   s.duration = 600;
                   break;
               default:
                   s.duration = parseFloat(s.duration) || 1
               }
               b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
                   return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t))
               }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o)
           }
           var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));
           if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
               x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);
               var w = g.length,
                   V = 0;
               if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
                   var C = d + 1;
                   v = {};
                   for (var T = C; T < arguments.length; T++) m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]
               }
               var k = {
                   promise: null,
                   resolver: null,
                   rejecter: null
               };
               s && b.Promise && (k.promise = new b.Promise(function (e, t) {
                   k.resolver = e, k.rejecter = t
               }));
               var A;
               switch (y) {
               case "scroll":
                   A = "scroll";
                   break;
               case "reverse":
                   A = "reverse";
                   break;
               case "finish":
               case "stop":
                   f.each(g, function (e, t) {
                       i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer)
                   });
                   var F = [];
                   return f.each(b.State.calls, function (e, t) {
                       t && f.each(t[1], function (r, n) {
                           var o = v === a ? "" : v;
                           return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
                               a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
                                   m.isFunction(t) && t(null, !0)
                               }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
                                   t.endValue = t.currentValue
                               }), F.push(e)) : "finish" === y && (t[2].duration = 1))
                           }) : !0
                       })
                   }), "stop" === y && (f.each(F, function (e, t) {
                       p(t, !0)
                   }), k.promise && k.resolver(g)), e();
               default:
                   if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
                       if (m.isString(y) && b.Redirects[y]) {
                           var j = f.extend({}, v),
                               E = j.duration,
                               H = j.delay || 0;
                           return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
                               parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a)
                           }), e()
                       }
                       var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";
                       return k.promise ? k.rejecter(new Error(N)) : console.log(N), e()
                   }
                   A = "start"
               }
               var L = {
                       lastParent: null,
                       lastPosition: null,
                       lastFontSize: null,
                       lastPercentToPxWidth: null,
                       lastPercentToPxHeight: null,
                       lastEmToPx: null,
                       remToPx: null,
                       vwToPx: null,
                       vhToPx: null
                   },
                   R = [];
               f.each(g, function (e, t) {
                   m.isNode(t) && n.call(t)
               });
               var z, j = f.extend({}, b.defaults, v);
               if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop)
                   for (var O = 0; z > O; O++) {
                       var q = {
                           delay: j.delay,
                           progress: j.progress
                       };
                       O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q)
                   }
               return e()
           }
       };
       b = f.extend(P, b), b.animate = P;
       var w = t.requestAnimationFrame || g;
       return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
           r.hidden ? (w = function (e) {
               return setTimeout(function () {
                   e(!0)
               }, 16)
           }, c()) : w = t.requestAnimationFrame || g
       }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
           b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
               var l = f.extend({}, r),
                   u = l.begin,
                   c = l.complete,
                   p = {
                       height: "",
                       marginTop: "",
                       marginBottom: "",
                       paddingTop: "",
                       paddingBottom: ""
                   },
                   d = {};
               l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
                   u && u.call(i, i);
                   for (var r in p) {
                       d[r] = e.style[r];
                       var a = b.CSS.getPropertyValue(e, r);
                       p[r] = "Down" === t ? [a, 0] : [0, a]
                   }
                   d.overflow = e.style.overflow, e.style.overflow = "hidden"
               }, l.complete = function () {
                   for (var t in d) e.style[t] = d[t];
                   c && c.call(i, i), s && s.resolver(i)
               }, b(e, p, l)
           }
       }), f.each(["In", "Out"], function (e, t) {
           b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
               var l = f.extend({}, r),
                   u = {
                       opacity: "In" === t ? 1 : 0
                   },
                   c = l.complete;
               l.complete = n !== o - 1 ? l.begin = null : function () {
                   c && c.call(i, i), s && s.resolver(i)
               }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l)
           }
       }), b
   }(window.jQuery || window.Zepto || window, window, document)

}));; ! function (a, b, c, d) {

   "use strict";
   function k(a, b, c) {
       return setTimeout(q(a, c), b)
   }
   function l(a, b, c) {
       return Array.isArray(a) ? (m(a, c[b], c), !0) : !1
   }
   function m(a, b, c) {
       var e;
       if (a)
           if (a.forEach) a.forEach(b, c);
           else if (a.length !== d)
           for (e = 0; e < a.length;) b.call(c, a[e], e, a), e++;
       else
           for (e in a) a.hasOwnProperty(e) && b.call(c, a[e], e, a)
   }
   function n(a, b, c) {
       for (var e = Object.keys(b), f = 0; f < e.length;)(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
       return a
   }
   function o(a, b) {
       return n(a, b, !0)
   }
   function p(a, b, c) {
       var e, d = b.prototype;
       e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c)
   }
   function q(a, b) {
       return function () {
           return a.apply(b, arguments)
       }
   }
   function r(a, b) {
       return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a
   }
   function s(a, b) {
       return a === d ? b : a
   }
   function t(a, b, c) {
       m(x(b), function (b) {
           a.addEventListener(b, c, !1)
       })
   }
   function u(a, b, c) {
       m(x(b), function (b) {
           a.removeEventListener(b, c, !1)
       })
   }
   function v(a, b) {
       for (; a;) {
           if (a == b) return !0;
           a = a.parentNode
       }
       return !1
   }
   function w(a, b) {
       return a.indexOf(b) > -1
   }
   function x(a) {
       return a.trim().split(/\s+/g)
   }
   function y(a, b, c) {
       if (a.indexOf && !c) return a.indexOf(b);
       for (var d = 0; d < a.length;) {
           if (c && a[d][c] == b || !c && a[d] === b) return d;
           d++
       }
       return -1
   }
   function z(a) {
       return Array.prototype.slice.call(a, 0)
   }
   function A(a, b, c) {
       for (var d = [], e = [], f = 0; f < a.length;) {
           var g = b ? a[f][b] : a[f];
           y(e, g) < 0 && d.push(a[f]), e[f] = g, f++
       }
       return c && (d = b ? d.sort(function (a, c) {
           return a[b] > c[b]
       }) : d.sort()), d
   }
   function B(a, b) {
       for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
           if (c = e[h], f = c ? c + g : b, f in a) return f;
           h++
       }
       return d
   }
   function D() {
       return C++
   }
   function E(a) {
       var b = a.ownerDocument;
       return b.defaultView || b.parentWindow
   }
   function ab(a, b) {
       var c = this;
       this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
           r(a.options.enable, [a]) && c.handler(b)
       }, this.init()
   }
   function bb(a) {
       var b, c = a.options.inputClass;
       return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb)
   }
   function cb(a, b, c) {
       var d = c.pointers.length,
           e = c.changedPointers.length,
           f = b & O && 0 === d - e,
           g = b & (Q | R) && 0 === d - e;
       c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c
   }
   function db(a, b) {
       var c = a.session,
           d = b.pointers,
           e = d.length;
       c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);
       var f = c.firstInput,
           g = c.firstMultiple,
           h = g ? g.center : f.center,
           i = b.center = hb(d);
       b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);
       var k = a.element;
       v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k
   }
   function eb(a, b) {
       var c = b.center,
           d = a.offsetDelta || {},
           e = a.prevDelta || {},
           f = a.prevInput || {};
       (b.eventType === O || f.eventType === Q) && (e = a.prevDelta = {
           x: f.deltaX || 0,
           y: f.deltaY || 0
       }, d = a.offsetDelta = {
           x: c.x,
           y: c.y
       }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y)
   }
   function fb(a, b) {
       var f, g, h, j, c = a.lastInterval || b,
           e = b.timeStamp - c.timeStamp;
       if (b.eventType != R && (e > N || c.velocity === d)) {
           var k = c.deltaX - b.deltaX,
               l = c.deltaY - b.deltaY,
               m = ib(e, k, l);
           g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b
       } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;
       b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j
   }
   function gb(a) {
       for (var b = [], c = 0; c < a.pointers.length;) b[c] = {
           clientX: h(a.pointers[c].clientX),
           clientY: h(a.pointers[c].clientY)
       }, c++;
       return {
           timeStamp: j(),
           pointers: b,
           center: hb(b),
           deltaX: a.deltaX,
           deltaY: a.deltaY
       }
   }
   function hb(a) {
       var b = a.length;
       if (1 === b) return {
           x: h(a[0].clientX),
           y: h(a[0].clientY)
       };
       for (var c = 0, d = 0, e = 0; b > e;) c += a[e].clientX, d += a[e].clientY, e++;
       return {
           x: h(c / b),
           y: h(d / b)
       }
   }
   function ib(a, b, c) {
       return {
           x: b / a || 0,
           y: c / a || 0
       }
   }
   function jb(a, b) {
       return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W
   }
   function kb(a, b, c) {
       c || (c = $);
       var d = b[c[0]] - a[c[0]],
           e = b[c[1]] - a[c[1]];
       return Math.sqrt(d * d + e * e)
   }
   function lb(a, b, c) {
       c || (c = $);
       var d = b[c[0]] - a[c[0]],
           e = b[c[1]] - a[c[1]];
       return 180 * Math.atan2(e, d) / Math.PI
   }
   function mb(a, b) {
       return lb(b[1], b[0], _) - lb(a[1], a[0], _)
   }
   function nb(a, b) {
       return kb(b[0], b[1], _) / kb(a[0], a[1], _)
   }
   function rb() {
       this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments)
   }
   function wb() {
       this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []
   }
   function Ab() {
       this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments)
   }
   function Bb(a, b) {
       var c = z(a.touches),
           d = z(a.changedTouches);
       return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]
   }
   function Eb() {
       this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments)
   }
   function Fb(a, b) {
       var c = z(a.touches),
           d = this.targetIds;
       if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];
       var e, f, g = z(a.changedTouches),
           h = [],
           i = this.target;
       if (f = c.filter(function (a) {
               return v(a.target, i)
           }), b === O)
           for (e = 0; e < f.length;) d[f[e].identifier] = !0, e++;
       for (e = 0; e < g.length;) d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
       return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0
   }
   function Gb() {
       ab.apply(this, arguments);
       var a = q(this.handler, this);
       this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a)
   }
   function Pb(a, b) {
       this.manager = a, this.set(b)
   }
   function Qb(a) {
       if (w(a, Mb)) return Mb;
       var b = w(a, Nb),
           c = w(a, Ob);
       return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb
   }
   function Yb(a) {
       this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []
   }
   function Zb(a) {
       return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""
   }
   function $b(a) {
       return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""
   }
   function _b(a, b) {
       var c = b.manager;
       return c ? c.get(a) : a
   }
   function ac() {
       Yb.apply(this, arguments)
   }
   function bc() {
       ac.apply(this, arguments), this.pX = null, this.pY = null
   }
   function cc() {
       ac.apply(this, arguments)
   }
   function dc() {
       Yb.apply(this, arguments), this._timer = null, this._input = null
   }
   function ec() {
       ac.apply(this, arguments)
   }
   function fc() {
       ac.apply(this, arguments)
   }
   function gc() {
       Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0
   }
   function hc(a, b) {
       return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b)
   }
   function kc(a, b) {
       b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
           var b = this.add(new a[0](a[1]));
           a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3])
       }, this)
   }
   function lc(a, b) {
       var c = a.element;
       m(a.options.cssProps, function (a, d) {
           c.style[B(c.style, d)] = b ? a : ""
       })
   }
   function mc(a, c) {
       var d = b.createEvent("Event");
       d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d)
   }
   var e = ["", "webkit", "moz", "MS", "ms", "o"],
       f = b.createElement("div"),
       g = "function",
       h = Math.round,
       i = Math.abs,
       j = Date.now,
       C = 1,
       F = /mobile|tablet|ip(ad|hone|od)|android/i,
       G = "ontouchstart" in a,
       H = B(a, "PointerEvent") !== d,
       I = G && F.test(navigator.userAgent),
       J = "touch",
       K = "pen",
       L = "mouse",
       M = "kinect",
       N = 25,
       O = 1,
       P = 2,
       Q = 4,
       R = 8,
       S = 1,
       T = 2,
       U = 4,
       V = 8,
       W = 16,
       X = T | U,
       Y = V | W,
       Z = X | Y,
       $ = ["x", "y"],
       _ = ["clientX", "clientY"];
   ab.prototype = {
       handler: function () {},
       init: function () {
           this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler)
       },
       destroy: function () {
           this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler)
       }
   };
   var ob = {
           mousedown: O,
           mousemove: P,
           mouseup: Q
       },
       pb = "mousedown",
       qb = "mousemove mouseup";
   p(rb, ab, {
       handler: function (a) {
           var b = ob[a.type];
           b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, {
               pointers: [a],
               changedPointers: [a],
               pointerType: L,
               srcEvent: a
           }))
       }
   });
   var sb = {
           pointerdown: O,
           pointermove: P,
           pointerup: Q,
           pointercancel: R,
           pointerout: R
       },
       tb = {
           2: J,
           3: K,
           4: L,
           5: M
       },
       ub = "pointerdown",
       vb = "pointermove pointerup pointercancel";
   a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, {
       handler: function (a) {
           var b = this.store,
               c = !1,
               d = a.type.toLowerCase().replace("ms", ""),
               e = sb[d],
               f = tb[a.pointerType] || a.pointerType,
               g = f == J,
               h = y(b, a.pointerId, "pointerId");
           e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, {
               pointers: b,
               changedPointers: [a],
               pointerType: f,
               srcEvent: a
           }), c && b.splice(h, 1))
       }
   });
   var xb = {
           touchstart: O,
           touchmove: P,
           touchend: Q,
           touchcancel: R
       },
       yb = "touchstart",
       zb = "touchstart touchmove touchend touchcancel";
   p(Ab, ab, {
       handler: function (a) {
           var b = xb[a.type];
           if (b === O && (this.started = !0), this.started) {
               var c = Bb.call(this, a, b);
               b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, {
                   pointers: c[0],
                   changedPointers: c[1],
                   pointerType: J,
                   srcEvent: a
               })
           }
       }
   });
   var Cb = {
           touchstart: O,
           touchmove: P,
           touchend: Q,
           touchcancel: R
       },
       Db = "touchstart touchmove touchend touchcancel";
   p(Eb, ab, {
       handler: function (a) {
           var b = Cb[a.type],
               c = Fb.call(this, a, b);
           c && this.callback(this.manager, b, {
               pointers: c[0],
               changedPointers: c[1],
               pointerType: J,
               srcEvent: a
           })
       }
   }), p(Gb, ab, {
       handler: function (a, b, c) {
           var d = c.pointerType == J,
               e = c.pointerType == L;
           if (d) this.mouse.allow = !1;
           else if (e && !this.mouse.allow) return;
           b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c)
       },
       destroy: function () {
           this.touch.destroy(), this.mouse.destroy()
       }
   });
   var Hb = B(f.style, "touchAction"),
       Ib = Hb !== d,
       Jb = "compute",
       Kb = "auto",
       Lb = "manipulation",
       Mb = "none",
       Nb = "pan-x",
       Ob = "pan-y";
   Pb.prototype = {
       set: function (a) {
           a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim()
       },
       update: function () {
           this.set(this.manager.options.touchAction)
       },
       compute: function () {
           var a = [];
           return m(this.manager.recognizers, function (b) {
               r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()))
           }), Qb(a.join(" "))
       },
       preventDefaults: function (a) {
           if (!Ib) {
               var b = a.srcEvent,
                   c = a.offsetDirection;
               if (this.manager.session.prevented) return b.preventDefault(), void 0;
               var d = this.actions,
                   e = w(d, Mb),
                   f = w(d, Ob),
                   g = w(d, Nb);
               return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0
           }
       },
       preventSrc: function (a) {
           this.manager.session.prevented = !0, a.preventDefault()
       }
   };
   var Rb = 1,
       Sb = 2,
       Tb = 4,
       Ub = 8,
       Vb = Ub,
       Wb = 16,
       Xb = 32;
   Yb.prototype = {
       defaults: {},
       set: function (a) {
           return n(this.options, a), this.manager && this.manager.touchAction.update(), this
       },
       recognizeWith: function (a) {
           if (l(a, "recognizeWith", this)) return this;
           var b = this.simultaneous;
           return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this
       },
       dropRecognizeWith: function (a) {
           return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this)
       },
       requireFailure: function (a) {
           if (l(a, "requireFailure", this)) return this;
           var b = this.requireFail;
           return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this
       },
       dropRequireFailure: function (a) {
           if (l(a, "dropRequireFailure", this)) return this;
           a = _b(a, this);
           var b = y(this.requireFail, a);
           return b > -1 && this.requireFail.splice(b, 1), this
       },
       hasRequireFailures: function () {
           return this.requireFail.length > 0
       },
       canRecognizeWith: function (a) {
           return !!this.simultaneous[a.id]
       },
       emit: function (a) {
           function d(d) {
               b.manager.emit(b.options.event + (d ? Zb(c) : ""), a)
           }
           var b = this,
               c = this.state;
           Ub > c && d(!0), d(), c >= Ub && d(!0)
       },
       tryEmit: function (a) {
           return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0)
       },
       canEmit: function () {
           for (var a = 0; a < this.requireFail.length;) {
               if (!(this.requireFail[a].state & (Xb | Rb))) return !1;
               a++
           }
           return !0
       },
       recognize: function (a) {
           var b = n({}, a);
           return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0)
       },
       process: function () {},
       getTouchAction: function () {},
       reset: function () {}
   }, p(ac, Yb, {
       defaults: {
           pointers: 1
       },
       attrTest: function (a) {
           var b = this.options.pointers;
           return 0 === b || a.pointers.length === b
       },
       process: function (a) {
           var b = this.state,
               c = a.eventType,
               d = b & (Sb | Tb),
               e = this.attrTest(a);
           return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb
       }
   }), p(bc, ac, {
       defaults: {
           event: "pan",
           threshold: 10,
           pointers: 1,
           direction: Z
       },
       getTouchAction: function () {
           var a = this.options.direction,
               b = [];
           return a & X && b.push(Ob), a & Y && b.push(Nb), b
       },
       directionTest: function (a) {
           var b = this.options,
               c = !0,
               d = a.distance,
               e = a.direction,
               f = a.deltaX,
               g = a.deltaY;
           return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction
       },
       attrTest: function (a) {
           return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a))
       },
       emit: function (a) {
           this.pX = a.deltaX, this.pY = a.deltaY;
           var b = $b(a.direction);
           b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a)
       }
   }), p(cc, ac, {
       defaults: {
           event: "pinch",
           threshold: 0,
           pointers: 2
       },
       getTouchAction: function () {
           return [Mb]
       },
       attrTest: function (a) {
           return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb)
       },
       emit: function (a) {
           if (this._super.emit.call(this, a), 1 !== a.scale) {
               var b = a.scale < 1 ? "in" : "out";
               this.manager.emit(this.options.event + b, a)
           }
       }
   }), p(dc, Yb, {
       defaults: {
           event: "press",
           pointers: 1,
           time: 500,
           threshold: 5
       },
       getTouchAction: function () {
           return [Kb]
       },
       process: function (a) {
           var b = this.options,
               c = a.pointers.length === b.pointers,
               d = a.distance < b.threshold,
               e = a.deltaTime > b.time;
           if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();
           else if (a.eventType & O) this.reset(), this._timer = k(function () {
               this.state = Vb, this.tryEmit()
           }, b.time, this);
           else if (a.eventType & Q) return Vb;
           return Xb
       },
       reset: function () {
           clearTimeout(this._timer)
       },
       emit: function (a) {
           this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)))
       }
   }), p(ec, ac, {
       defaults: {
           event: "rotate",
           threshold: 0,
           pointers: 2
       },
       getTouchAction: function () {
           return [Mb]
       },
       attrTest: function (a) {
           return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb)
       }
   }), p(fc, ac, {
       defaults: {
           event: "swipe",
           threshold: 10,
           velocity: .65,
           direction: X | Y,
           pointers: 1
       },
       getTouchAction: function () {
           return bc.prototype.getTouchAction.call(this)
       },
       attrTest: function (a) {
           var c, b = this.options.direction;
           return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q
       },
       emit: function (a) {
           var b = $b(a.direction);
           b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a)
       }
   }), p(gc, Yb, {
       defaults: {
           event: "tap",
           pointers: 1,
           taps: 1,
           interval: 300,
           time: 250,
           threshold: 2,
           posThreshold: 10
       },
       getTouchAction: function () {
           return [Lb]
       },
       process: function (a) {
           var b = this.options,
               c = a.pointers.length === b.pointers,
               d = a.distance < b.threshold,
               e = a.deltaTime < b.time;
           if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();
           if (d && e && c) {
               if (a.eventType != Q) return this.failTimeout();
               var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
                   g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;
               this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;
               var h = this.count % b.taps;
               if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
                   this.state = Vb, this.tryEmit()
               }, b.interval, this), Sb) : Vb
           }
           return Xb
       },
       failTimeout: function () {
           return this._timer = k(function () {
               this.state = Xb
           }, this.options.interval, this), Xb
       },
       reset: function () {
           clearTimeout(this._timer)
       },
       emit: function () {
           this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input))
       }
   }), hc.VERSION = "2.0.4", hc.defaults = {
       domEvents: !1,
       touchAction: Jb,
       enable: !0,
       inputTarget: null,
       inputClass: null,
       preset: [[ec, {
           enable: !1
       }], [cc, {
           enable: !1
       }, ["rotate"]], [fc, {
           direction: X
       }], [bc, {
           direction: X
       }, ["swipe"]], [gc], [gc, {
           event: "doubletap",
           taps: 2
       }, ["tap"]], [dc]],
       cssProps: {
           userSelect: "default",
           touchSelect: "none",
           touchCallout: "none",
           contentZooming: "none",
           userDrag: "none",
           tapHighlightColor: "rgba(0,0,0,0)"
       }
   };
   var ic = 1,
       jc = 2;
   kc.prototype = {
       set: function (a) {
           return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this
       },
       stop: function (a) {
           this.session.stopped = a ? jc : ic
       },
       recognize: function (a) {
           var b = this.session;
           if (!b.stopped) {
               this.touchAction.preventDefaults(a);
               var c, d = this.recognizers,
                   e = b.curRecognizer;
               (!e || e && e.state & Vb) && (e = b.curRecognizer = null);
               for (var f = 0; f < d.length;) c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++
           }
       },
       get: function (a) {
           if (a instanceof Yb) return a;
           for (var b = this.recognizers, c = 0; c < b.length; c++)
               if (b[c].options.event == a) return b[c];
           return null
       },
       add: function (a) {
           if (l(a, "add", this)) return this;
           var b = this.get(a.options.event);
           return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a
       },
       remove: function (a) {
           if (l(a, "remove", this)) return this;
           var b = this.recognizers;
           return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this
       },
       on: function (a, b) {
           var c = this.handlers;
           return m(x(a), function (a) {
               c[a] = c[a] || [], c[a].push(b)
           }), this
       },
       off: function (a, b) {
           var c = this.handlers;
           return m(x(a), function (a) {
               b ? c[a].splice(y(c[a], b), 1) : delete c[a]
           }), this
       },
       emit: function (a, b) {
           this.options.domEvents && mc(a, b);
           var c = this.handlers[a] && this.handlers[a].slice();
           if (c && c.length) {
               b.type = a, b.preventDefault = function () {
                   b.srcEvent.preventDefault()
               };
               for (var d = 0; d < c.length;) c[d](b), d++
           }
       },
       destroy: function () {
           this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null
       }
   }, n(hc, {
       INPUT_START: O,
       INPUT_MOVE: P,
       INPUT_END: Q,
       INPUT_CANCEL: R,
       STATE_POSSIBLE: Rb,
       STATE_BEGAN: Sb,
       STATE_CHANGED: Tb,
       STATE_ENDED: Ub,
       STATE_RECOGNIZED: Vb,
       STATE_CANCELLED: Wb,
       STATE_FAILED: Xb,
       DIRECTION_NONE: S,
       DIRECTION_LEFT: T,
       DIRECTION_RIGHT: U,
       DIRECTION_UP: V,
       DIRECTION_DOWN: W,
       DIRECTION_HORIZONTAL: X,
       DIRECTION_VERTICAL: Y,
       DIRECTION_ALL: Z,
       Manager: kc,
       Input: ab,
       TouchAction: Pb,
       TouchInput: Eb,
       MouseInput: rb,
       PointerEventInput: wb,
       TouchMouseInput: Gb,
       SingleTouchInput: Ab,
       Recognizer: Yb,
       AttrRecognizer: ac,
       Tap: gc,
       Pan: bc,
       Swipe: fc,
       Pinch: cc,
       Rotate: ec,
       Press: dc,
       on: t,
       off: u,
       each: m,
       merge: o,
       extend: n,
       inherit: p,
       bindFn: q,
       prefixed: B
   }), typeof define == g && define.amd ? define(function () {
       return hc
   }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc

}(window, document, "Hammer");; (function (factory) {

   if (typeof define === 'function' && define.amd) {
       define(['jquery', 'hammerjs'], factory);
   } else if (typeof exports === 'object') {
       factory(require('jquery'), require('hammerjs'));
   } else {
       factory(jQuery, Hammer);
   }

}(function ($, Hammer) {

   function hammerify(el, options) {
       var $el = $(el);
       if (!$el.data("hammer")) {
           $el.data("hammer", new Hammer($el[0], options));
       }
   }
   $.fn.hammer = function (options) {
       return this.each(function () {
           hammerify(this, options);
       });
   };
   // extend the emit method to also trigger jQuery events
   Hammer.Manager.prototype.emit = (function (originalEmit) {
       return function (type, data) {
           originalEmit.call(this, type, data);
           $(this.element).trigger({
               type: type,
               gesture: data
           });
       };
   })(Hammer.Manager.prototype.emit);

}));; // Required for Meteor package, the use of window prevents export by Meteor (function (window) {

   if (window.Package) {
       Materialize = {};
   } else {
       window.Materialize = {};
   }

})(window);


/*

* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/

(function (window) {

   var lastTime = 0,
       vendors = ['webkit', 'moz'],
       requestAnimationFrame = window.requestAnimationFrame,
       cancelAnimationFrame = window.cancelAnimationFrame,
       i = vendors.length;
   // try to un-prefix existing raf
   while (--i >= 0 && !requestAnimationFrame) {
       requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
       cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
   }
   // polyfill with setTimeout fallback
   // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
   if (!requestAnimationFrame || !cancelAnimationFrame) {
       requestAnimationFrame = function (callback) {
           var now = +Date.now(),
               nextTime = Math.max(lastTime + 16, now);
           return setTimeout(function () {
               callback(lastTime = nextTime);
           }, nextTime - now);
       };
       cancelAnimationFrame = clearTimeout;
   }
   // export to window
   window.requestAnimationFrame = requestAnimationFrame;
   window.cancelAnimationFrame = cancelAnimationFrame;

}(window));


/**

* Generate approximated selector string for a jQuery object
* @param {jQuery} obj  jQuery object to be parsed
* @returns {string}
*/

Materialize.objectSelectorString = function (obj) {

   var tagStr = obj.prop('tagName') || ;
   var idStr = obj.attr('id') || ;
   var classStr = obj.attr('class') || ;
   return (tagStr + idStr + classStr).replace(/\s/g, );

};


// Unique Random ID Materialize.guid = (function () {

   function s4() {
       return Math.floor((1 + Math.random()) * 0x10000)
           .toString(16)
           .substring(1);
   }
   return function () {
       return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
           s4() + '-' + s4() + s4() + s4();
   };

})();

/**

* Escapes hash from special characters
* @param {string} hash  String returned from this.hash
* @returns {string}
*/

Materialize.escapeHash = function (hash) {

   return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");

};

Materialize.elementOrParentIsFixed = function (element) {

   var $element = $(element);
   var $checkElements = $element.add($element.parents());
   var isFixed = false;
   $checkElements.each(function () {
       if ($(this).css("position") === "fixed") {
           isFixed = true;
           return false;
       }
   });
   return isFixed;

};


/**

* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/

var getTime = (Date.now || function () {

   return new Date().getTime();

});


/**

* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/

Materialize.throttle = function (func, wait, options) {

   var context, args, result;
   var timeout = null;
   var previous = 0;
   options || (options = {});
   var later = function () {
       previous = options.leading === false ? 0 : getTime();
       timeout = null;
       result = func.apply(context, args);
       context = args = null;
   };
   return function () {
       var now = getTime();
       if (!previous && options.leading === false) previous = now;
       var remaining = wait - (now - previous);
       context = this;
       args = arguments;
       if (remaining <= 0) {
           clearTimeout(timeout);
           timeout = null;
           previous = now;
           result = func.apply(context, args);
           context = args = null;
       } else if (!timeout && options.trailing !== false) {
           timeout = setTimeout(later, remaining);
       }
       return result;
   };

};


// Velocity has conflicts when loaded with jQuery, this will check for it // First, check if in noConflict mode var Vel; if (jQuery) {

   Vel = jQuery.Velocity;

} else if ($) {

   Vel = $.Velocity;

} else {

   Vel = Velocity;

}; (function ($) {

   $.fn.collapsible = function (options, methodParam) {
       var defaults = {
           accordion: undefined,
           onOpen: undefined,
           onClose: undefined
       };
       var methodName = options;
       options = $.extend(defaults, options);


       return this.each(function () {
           var $this = $(this);
           var $panel_headers = $(this).find('> li > .collapsible-header');
           var collapsible_type = $this.data("collapsible");
           /****************
           Helper Functions
           ****************/
           // Accordion Open
           function accordionOpen(object) {
               $panel_headers = $this.find('> li > .collapsible-header');
               if (object.hasClass('active')) {
                   object.parent().addClass('active');
               } else {
                   object.parent().removeClass('active');
               }
               if (object.parent().hasClass('active')) {
                   object.siblings('.collapsible-body').stop(true, false).slideDown({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               } else {
                   object.siblings('.collapsible-body').stop(true, false).slideUp({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               }
               $panel_headers.not(object).removeClass('active').parent().removeClass('active');
               // Close previously open accordion elements.
               $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
                   if ($(this).is(':visible')) {
                       $(this).slideUp({
                           duration: 350,
                           easing: "easeOutQuart",
                           queue: false,
                           complete: function () {
                               $(this).css('height', );
                               execCallbacks($(this).siblings('.collapsible-header'));
                           }
                       });
                   }
               });
           }
           // Expandable Open
           function expandableOpen(object) {
               if (object.hasClass('active')) {
                   object.parent().addClass('active');
               } else {
                   object.parent().removeClass('active');
               }
               if (object.parent().hasClass('active')) {
                   object.siblings('.collapsible-body').stop(true, false).slideDown({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               } else {
                   object.siblings('.collapsible-body').stop(true, false).slideUp({
                       duration: 350,
                       easing: "easeOutQuart",
                       queue: false,
                       complete: function () {
                           $(this).css('height', );
                       }
                   });
               }
           }
           // Open collapsible. object: .collapsible-header
           function collapsibleOpen(object, noToggle) {
               if (!noToggle) {
                   object.toggleClass('active');
               }
               if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
                   accordionOpen(object);
               } else { // Handle Expandables
                   expandableOpen(object);
               }
               execCallbacks(object);
           }
           // Handle callbacks
           function execCallbacks(object) {
               if (object.hasClass('active')) {
                   if (typeof (options.onOpen) === "function") {
                       options.onOpen.call(this, object.parent());
                   }
               } else {
                   if (typeof (options.onClose) === "function") {
                       options.onClose.call(this, object.parent());
                   }
               }
           }
           /**
            * Check if object is children of panel header
            * @param  {Object}  object Jquery object
            * @return {Boolean} true if it is children
            */
           function isChildrenOfPanelHeader(object) {
               var panelHeader = getPanelHeader(object);
               return panelHeader.length > 0;
           }
           /**
            * Get panel header from a children element
            * @param  {Object} object Jquery object
            * @return {Object} panel header object
            */
           function getPanelHeader(object) {
               return object.closest('li > .collapsible-header');
           }


           // Turn off any existing event handlers
           function removeEventHandlers() {
               $this.off('click.collapse', '> li > .collapsible-header');
           }
           /*****  End Helper Functions  *****/


           // Methods
           if (methodName === 'destroy') {
               removeEventHandlers();
               return;
           } else if (methodParam >= 0 &&
               methodParam < $panel_headers.length) {
               var $curr_header = $panel_headers.eq(methodParam);
               if ($curr_header.length &&
                   (methodName === 'open' ||
                       (methodName === 'close' &&
                           $curr_header.hasClass('active')))) {
                   collapsibleOpen($curr_header);
               }
               return;
           }


           removeEventHandlers();


           // Add click handler to only direct collapsible header children
           $this.on('click.collapse', '> li > .collapsible-header', function (e) {
               var element = $(e.target);
               if (isChildrenOfPanelHeader(element)) {
                   element = getPanelHeader(element);
               }
               collapsibleOpen(element);
           });


           // Open first active
           if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
               collapsibleOpen($panel_headers.filter('.active').first(), true);
           } else { // Handle Expandables
               $panel_headers.filter('.active').each(function () {
                   collapsibleOpen($(this), true);
               });
           }
       });
   };
   $(document).ready(function () {
       $('.collapsible').collapsible();
   });

}(jQuery));; (function ($) {

   // Add posibility to scroll to selected option
   // usefull for select for example
   $.fn.scrollTo = function (elem) {
       $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
       return this;
   };
   $.fn.dropdown = function (options) {
       var defaults = {
           inDuration: 300,
           outDuration: 225,
           constrainWidth: true, // Constrains width of dropdown to the activator
           hover: false,
           gutter: 0, // Spacing from edge
           belowOrigin: false,
           alignment: 'left',
           stopPropagation: false
       };
       // Open dropdown.
       if (options === "open") {
           this.each(function () {
               $(this).trigger('open');
           });
           return false;
       }
       // Close dropdown.
       if (options === "close") {
           this.each(function () {
               $(this).trigger('close');
           });
           return false;
       }
       this.each(function () {
           var origin = $(this);
           var curr_options = $.extend({}, defaults, options);
           var isFocused = false;
           // Dropdown menu
           var activates = $("#" + origin.attr('data-activates'));
           function updateOptions() {
               if (origin.data('induration') !== undefined)
                   curr_options.inDuration = origin.data('induration');
               if (origin.data('outduration') !== undefined)
                   curr_options.outDuration = origin.data('outduration');
               if (origin.data('constrainwidth') !== undefined)
                   curr_options.constrainWidth = origin.data('constrainwidth');
               if (origin.data('hover') !== undefined)
                   curr_options.hover = origin.data('hover');
               if (origin.data('gutter') !== undefined)
                   curr_options.gutter = origin.data('gutter');
               if (origin.data('beloworigin') !== undefined)
                   curr_options.belowOrigin = origin.data('beloworigin');
               if (origin.data('alignment') !== undefined)
                   curr_options.alignment = origin.data('alignment');
               if (origin.data('stoppropagation') !== undefined)
                   curr_options.stopPropagation = origin.data('stoppropagation');
           }
           updateOptions();
           // Attach dropdown to its activator
           origin.after(activates);
           /*
             Helper function to position and resize dropdown.
             Used in hover and click handler.
           */
           function placeDropdown(eventType) {
               // Check for simultaneous focus and click events.
               if (eventType === 'focus') {
                   isFocused = true;
               }
               // Check html data attributes
               updateOptions();
               // Set Dropdown state
               activates.addClass('active');
               origin.addClass('active');
               // Constrain width
               if (curr_options.constrainWidth === true) {
                   activates.css('width', origin.outerWidth());
               } else {
                   activates.css('white-space', 'nowrap');
               }
               // Offscreen detection
               var windowHeight = window.innerHeight;
               var originHeight = origin.innerHeight();
               var offsetLeft = origin.offset().left;
               var offsetTop = origin.offset().top - $(window).scrollTop();
               var currAlignment = curr_options.alignment;
               var gutterSpacing = 0;
               var leftPosition = 0;
               // Below Origin
               var verticalOffset = 0;
               if (curr_options.belowOrigin === true) {
                   verticalOffset = originHeight;
               }
               // Check for scrolling positioned container.
               var scrollYOffset = 0;
               var scrollXOffset = 0;
               var wrapper = origin.parent();
               if (!wrapper.is('body')) {
                   if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
                       scrollYOffset = wrapper[0].scrollTop;
                   }
                   if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
                       scrollXOffset = wrapper[0].scrollLeft;
                   }
               }


               if (offsetLeft + activates.innerWidth() > $(window).width()) {
                   // Dropdown goes past screen on right, force right alignment
                   currAlignment = 'right';
               } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
                   // Dropdown goes past screen on left, force left alignment
                   currAlignment = 'left';
               }
               // Vertical bottom offscreen detection
               if (offsetTop + activates.innerHeight() > windowHeight) {
                   // If going upwards still goes offscreen, just crop height of dropdown.
                   if (offsetTop + originHeight - activates.innerHeight() < 0) {
                       var adjustedHeight = windowHeight - offsetTop - verticalOffset;
                       activates.css('max-height', adjustedHeight);
                   } else {
                       // Flow upwards.
                       if (!verticalOffset) {
                           verticalOffset += originHeight;
                       }
                       verticalOffset -= activates.innerHeight();
                   }
               }
               // Handle edge alignment
               if (currAlignment === 'left') {
                   gutterSpacing = curr_options.gutter;
                   leftPosition = origin.position().left + gutterSpacing;
               } else if (currAlignment === 'right') {
                   // Material icons fix
                   activates
                       .stop(true, true)
                       .css({
                           opacity: 0,
                           left: 0
                       })
                   var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
                   gutterSpacing = -curr_options.gutter;
                   leftPosition = offsetRight + gutterSpacing;
               }
               // Position dropdown
               activates.css({
                   position: 'absolute',
                   top: origin.position().top + verticalOffset + scrollYOffset,
                   left: leftPosition + scrollXOffset
               });
               // Show dropdown
               activates
                   .slideDown({
                       queue: false,
                       duration: curr_options.inDuration,
                       easing: 'easeOutCubic',
                       complete: function () {
                           $(this).css('height', );
                       }
                   })
                   .animate({
                       opacity: 1
                   }, {
                       queue: false,
                       duration: curr_options.inDuration,
                       easing: 'easeOutSine'
                   });
               // Add click close handler to document
               setTimeout(function () {
                   $(document).on('click.' + activates.attr('id'), function (e) {
                       hideDropdown();
                       $(document).off('click.' + activates.attr('id'));
                   });
               }, 0);
           }
           function hideDropdown() {
               // Check for simultaneous focus and click events.
               isFocused = false;
               activates.fadeOut(curr_options.outDuration);
               activates.removeClass('active');
               origin.removeClass('active');
               $(document).off('click.' + activates.attr('id'));
               setTimeout(function () {
                   activates.css('max-height', );
               }, curr_options.outDuration);
           }
           // Hover
           if (curr_options.hover) {
               var open = false;
               origin.off('click.' + origin.attr('id'));
               // Hover handler to show dropdown
               origin.on('mouseenter', function (e) { // Mouse over
                   if (open === false) {
                       placeDropdown();
                       open = true;
                   }
               });
               origin.on('mouseleave', function (e) {
                   // If hover on origin then to something other than dropdown content, then close
                   var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
                   if (!$(toEl).closest('.dropdown-content').is(activates)) {
                       activates.stop(true, true);
                       hideDropdown();
                       open = false;
                   }
               });
               activates.on('mouseleave', function (e) { // Mouse out
                   var toEl = e.toElement || e.relatedTarget;
                   if (!$(toEl).closest('.dropdown-button').is(origin)) {
                       activates.stop(true, true);
                       hideDropdown();
                       open = false;
                   }
               });
               // Click
           } else {
               // Click handler to show dropdown
               origin.off('click.' + origin.attr('id'));
               origin.on('click.' + origin.attr('id'), function (e) {
                   if (!isFocused) {
                       if (origin[0] == e.currentTarget &&
                           !origin.hasClass('active') &&
                           ($(e.target).closest('.dropdown-content').length === 0)) {
                           e.preventDefault(); // Prevents button click from moving window
                           if (curr_options.stopPropagation) {
                               e.stopPropagation();
                           }
                           placeDropdown('click');
                       }
                       // If origin is clicked and menu is open, close menu
                       else if (origin.hasClass('active')) {
                           hideDropdown();
                           $(document).off('click.' + activates.attr('id'));
                       }
                   }
               });
           } // End else
           // Listen to open and close event - useful for select component
           origin.on('open', function (e, eventType) {
               placeDropdown(eventType);
           });
           origin.on('close', hideDropdown);


       });
   }; // End dropdown plugin
   $(document).ready(function () {
       $('.dropdown-button').dropdown();
   });

}(jQuery));; (function ($) {

   var _stack = 0,
       _lastID = 0,
       _generateID = function () {
           _lastID++;
           return 'materialize-modal-overlay-' + _lastID;
       };
   var methods = {
       init: function (options) {
           var defaults = {
               opacity: 0.5,
               inDuration: 350,
               outDuration: 250,
               ready: undefined,
               complete: undefined,
               dismissible: true,
               startingTop: '4%',
               endingTop: '10%'
           };
           // Override defaults
           options = $.extend(defaults, options);
           return this.each(function () {
               var $modal = $(this);
               var modal_id = $(this).attr("id") || '#' + $(this).data('target');
               var closeModal = function () {
                   var overlayID = $modal.data('overlay-id');
                   var $overlay = $('#' + overlayID);
                   $modal.removeClass('open');
                   // Enable scrolling
                   $('body').css({
                       overflow: ,
                       width: 
                   });
                   $modal.find('.modal-close').off('click.close');
                   $(document).off('keyup.modal' + overlayID);
                   $overlay.velocity({
                       opacity: 0
                   }, {
                       duration: options.outDuration,
                       queue: false,
                       ease: "easeOutQuart"
                   });


                   // Define Bottom Sheet animation
                   var exitVelocityOptions = {
                       duration: options.outDuration,
                       queue: false,
                       ease: "easeOutCubic",
                       // Handle modal ready callback
                       complete: function () {
                           $(this).css({
                               display: "none"
                           });
                           // Call complete callback
                           if (typeof (options.complete) === "function") {
                               options.complete.call(this, $modal);
                           }
                           $overlay.remove();
                           _stack--;
                       }
                   };
                   if ($modal.hasClass('bottom-sheet')) {
                       $modal.velocity({
                           bottom: "-100%",
                           opacity: 0
                       }, exitVelocityOptions);
                   } else {
                       $modal.velocity({
                               top: options.startingTop,
                               opacity: 0,
                               scaleX: 0.7
                           },
                           exitVelocityOptions
                       );
                   }
               };
               var openModal = function ($trigger) {
                   var $body = $('body');
                   var oldWidth = $body.innerWidth();
                   $body.css('overflow', 'hidden');
                   $body.width(oldWidth);
                   if ($modal.hasClass('open')) {
                       return;
                   }
                   var overlayID = _generateID();
var $overlay = $('');
                   var lStack = (++_stack);
                   // Store a reference of the overlay
                   $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
                   $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
                   $modal.addClass('open');
                   $("body").append($overlay);
                   if (options.dismissible) {
                       $overlay.click(function () {
                           closeModal();
                       });
                       // Return on ESC
                       $(document).on('keyup.modal' + overlayID, function (e) {
                           if (e.keyCode === 27) { // ESC key
                               closeModal();
                           }
                       });
                   }
                   $modal.find(".modal-close").on('click.close', function (e) {
                       closeModal();
                   });
                   $overlay.css({
                       display: "block",
                       opacity: 0
                   });
                   $modal.css({
                       display: "block",
                       opacity: 0
                   });
                   $overlay.velocity({
                       opacity: options.opacity
                   }, {
                       duration: options.inDuration,
                       queue: false,
                       ease: "easeOutCubic"
                   });
                   $modal.data('associated-overlay', $overlay[0]);
                   // Define Bottom Sheet animation
                   var enterVelocityOptions = {
                       duration: options.inDuration,
                       queue: false,
                       ease: "easeOutCubic",
                       // Handle modal ready callback
                       complete: function () {
                           if (typeof (options.ready) === "function") {
                               options.ready.call(this, $modal, $trigger);
                           }
                       }
                   };
                   if ($modal.hasClass('bottom-sheet')) {
                       $modal.velocity({
                           bottom: "0",
                           opacity: 1
                       }, enterVelocityOptions);
                   } else {
                       $.Velocity.hook($modal, "scaleX", 0.7);
                       $modal.css({
                           top: options.startingTop
                       });
                       $modal.velocity({
                           top: options.endingTop,
                           opacity: 1,
                           scaleX: '1'
                       }, enterVelocityOptions);
                   }
               };
               // Reset handlers
               $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
               $(this).off('openModal');
               $(this).off('closeModal');
               // Close Handlers
               $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function (e) {
                   options.startingTop = ($(this).offset().top - $(window).scrollTop()) / 1.15;
                   openModal($(this));
                   e.preventDefault();
               }); // done set on click
               $(this).on('openModal', function () {
                   var modal_id = $(this).attr("href") || '#' + $(this).data('target');
                   openModal();
               });
               $(this).on('closeModal', function () {
                   closeModal();
               });
           }); // done return
       },
       open: function () {
           methods.init.apply(this, arguments);
           $(this).trigger('openModal');
       },
       close: function () {
           $(this).trigger('closeModal');
       }
   };
   $.fn.modal = function (methodOrOptions) {
       if (methods[methodOrOptions]) {
           return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
       } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
           // Default to "init"
           return methods.init.apply(this, arguments);
       } else {
           $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
       }
   };

})(jQuery);; (function ($) {

   $.fn.materialbox = function () {
       return this.each(function () {
           if ($(this).hasClass('initialized')) {
               return;
           }
           $(this).addClass('initialized');
           var overlayActive = false;
           var doneAnimating = true;
           var inDuration = 275;
           var outDuration = 200;
           var origin = $(this);
var placeholder = $('
').addClass('material-placeholder');
           var originalWidth = 0;
           var originalHeight = 0;
           var ancestorsChanged;
           var ancestor;
           var originInlineStyles = origin.attr('style');
           origin.wrap(placeholder);


           // Start click handler
           origin.on('click', function () {
               var placeholder = origin.parent('.material-placeholder');
               var windowWidth = window.innerWidth;
               var windowHeight = window.innerHeight;
               var originalWidth = origin.width();
               var originalHeight = origin.height();


               // If already modal, return to original
               if (doneAnimating === false) {
                   returnToOriginal();
                   return false;
               } else if (overlayActive && doneAnimating === true) {
                   returnToOriginal();
                   return false;
               }


               // Set states
               doneAnimating = false;
               origin.addClass('active');
               overlayActive = true;
               // Set positioning for placeholder
               placeholder.css({
                   width: placeholder[0].getBoundingClientRect().width,
                   height: placeholder[0].getBoundingClientRect().height,
                   position: 'relative',
                   top: 0,
                   left: 0
               });
               // Find ancestor with overflow: hidden; and remove it
               ancestorsChanged = undefined;
               ancestor = placeholder[0].parentNode;
               var count = 0;
               while (ancestor !== null && !$(ancestor).is(document)) {
                   var curr = $(ancestor);
                   if (curr.css('overflow') !== 'visible') {
                       curr.css('overflow', 'visible');
                       if (ancestorsChanged === undefined) {
                           ancestorsChanged = curr;
                       } else {
                           ancestorsChanged = ancestorsChanged.add(curr);
                       }
                   }
                   ancestor = ancestor.parentNode;
               }
               // Set css on origin
               origin.css({
                       position: 'absolute',
                       'z-index': 1000,
                       'will-change': 'left, top, width, height'
                   })
                   .data('width', originalWidth)
                   .data('height', originalHeight);
               // Add overlay
var overlay = $('
')
                   .css({
                       opacity: 0
                   })
                   .click(function () {
                       if (doneAnimating === true)
                           returnToOriginal();
                   });
               // Put before in origin image to preserve z-index layering.
               origin.before(overlay);
               // Set dimensions if needed
               var overlayOffset = overlay[0].getBoundingClientRect();
               overlay.css({
                   width: windowWidth,
                   height: windowHeight,
                   left: -1 * overlayOffset.left,
                   top: -1 * overlayOffset.top
               })
               // Animate Overlay
               overlay.velocity({
                   opacity: 1
               }, {
                   duration: inDuration,
                   queue: false,
                   easing: 'easeOutQuad'
               });
               // Add and animate caption if it exists
               if (origin.data('caption') !== "") {
var $photo_caption = $('
');
                   $photo_caption.text(origin.data('caption'));
                   $('body').append($photo_caption);
                   $photo_caption.css({
                       "display": "inline"
                   });
                   $photo_caption.velocity({
                       opacity: 1
                   }, {
                       duration: inDuration,
                       queue: false,
                       easing: 'easeOutQuad'
                   });
               }
               // Resize Image
               var ratio = 0;
               var widthPercent = originalWidth / windowWidth;
               var heightPercent = originalHeight / windowHeight;
               var newWidth = 0;
               var newHeight = 0;
               if (widthPercent > heightPercent) {
                   ratio = originalHeight / originalWidth;
                   newWidth = windowWidth * 0.9;
                   newHeight = windowWidth * 0.9 * ratio;
               } else {
                   ratio = originalWidth / originalHeight;
                   newWidth = (windowHeight * 0.9) * ratio;
                   newHeight = windowHeight * 0.9;
               }
               // Animate image + set z-index
               if (origin.hasClass('responsive-img')) {
                   origin.velocity({
                       'max-width': newWidth,
                       'width': originalWidth
                   }, {
                       duration: 0,
                       queue: false,
                       complete: function () {
                               origin.css({
                                       left: 0,
                                       top: 0
                                   })
                                   .velocity({
                                       height: newHeight,
                                       width: newWidth,
                                       left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
                                       top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
                                   }, {
                                       duration: inDuration,
                                       queue: false,
                                       easing: 'easeOutQuad',
                                       complete: function () {
                                           doneAnimating = true;
                                       }
                                   });
                           } // End Complete
                   }); // End Velocity
               } else {
                   origin.css('left', 0)
                       .css('top', 0)
                       .velocity({
                           height: newHeight,
                           width: newWidth,
                           left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
                           top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
                       }, {
                           duration: inDuration,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               doneAnimating = true;
                           }
                       }); // End Velocity
               }
               // Handle Exit triggers
               $(window).on('scroll.materialbox', function () {
                   if (overlayActive) {
                       returnToOriginal();
                   }
               });
               $(window).on('resize.materialbox', function () {
                   if (overlayActive) {
                       returnToOriginal();
                   }
               });
               $(document).on('keyup.materialbox', function (e) {
                   // ESC key
                   if (e.keyCode === 27 &&
                       doneAnimating === true &&
                       overlayActive) {
                       returnToOriginal();
                   }
               });
           }); // End click handler


           // This function returns the modaled image to the original spot
           function returnToOriginal() {
               doneAnimating = false;
               var placeholder = origin.parent('.material-placeholder');
               var windowWidth = window.innerWidth;
               var windowHeight = window.innerHeight;
               var originalWidth = origin.data('width');
               var originalHeight = origin.data('height');
               origin.velocity("stop", true);
               $('#materialbox-overlay').velocity("stop", true);
               $('.materialbox-caption').velocity("stop", true);
               // disable exit handlers
               $(window).off('scroll.materialbox');
               $(document).off('keyup.materialbox');
               $(window).off('resize.materialbox');
               $('#materialbox-overlay').velocity({
                   opacity: 0
               }, {
                   duration: outDuration, // Delay prevents animation overlapping
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       // Remove Overlay
                       overlayActive = false;
                       $(this).remove();
                   }
               });
               // Resize Image
               origin.velocity({
                   width: originalWidth,
                   height: originalHeight,
                   left: 0,
                   top: 0
               }, {
                   duration: outDuration,
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       placeholder.css({
                           height: ,
                           width: ,
                           position: ,
                           top: ,
                           left: 
                       });
                       origin.removeAttr('style');
                       origin.attr('style', originInlineStyles);
                       // Remove class
                       origin.removeClass('active');
                       doneAnimating = true;
                       // Remove overflow overrides on ancestors
                       if (ancestorsChanged) {
                           ancestorsChanged.css('overflow', );
                       }
                   }
               });
               // Remove Caption + reset css settings on image
               $('.materialbox-caption').velocity({
                   opacity: 0
               }, {
                   duration: outDuration, // Delay prevents animation overlapping
                   queue: false,
                   easing: 'easeOutQuad',
                   complete: function () {
                       $(this).remove();
                   }
               });
           }
       });
   };
   $(document).ready(function () {
       $('.materialboxed').materialbox();
   });

}(jQuery));; (function ($) {

   $.fn.parallax = function () {
       var window_width = $(window).width();
       // Parallax Scripts
       return this.each(function (i) {
           var $this = $(this);
           $this.addClass('parallax');
           function updateParallax(initial) {
               var container_height;
               if (window_width < 601) {
                   container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
               } else {
                   container_height = ($this.height() > 0) ? $this.height() : 500;
               }
               var $img = $this.children("img").first();
               var img_height = $img.height();
               var parallax_dist = img_height - container_height;
               var bottom = $this.offset().top + container_height;
               var top = $this.offset().top;
               var scrollTop = $(window).scrollTop();
               var windowHeight = window.innerHeight;
               var windowBottom = scrollTop + windowHeight;
               var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
               var parallax = Math.round((parallax_dist * percentScrolled));
               if (initial) {
                   $img.css('display', 'block');
               }
               if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
                   $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
               }
           }
           // Wait for image load
           $this.children("img").one("load", function () {
               updateParallax(true);
           }).each(function () {
               if (this.complete) $(this).trigger("load");
           });
           $(window).scroll(function () {
               window_width = $(window).width();
               updateParallax(false);
           });
           $(window).resize(function () {
               window_width = $(window).width();
               updateParallax(false);
           });
       });
   };

}(jQuery));; (function ($) {

   var methods = {
       init: function (options) {
           var defaults = {
               onShow: null,
               swipeable: false,
               responsiveThreshold: Infinity, // breakpoint for swipeable
           };
           options = $.extend(defaults, options);
           var namespace = Materialize.objectSelectorString($(this));
           return this.each(function (i) {
               var uniqueNamespace = namespace + i;
               // For each set of tabs, we want to keep track of
               // which tab is active and its associated content
               var $this = $(this),
                   window_width = $(window).width();
               var $active, $content, $links = $this.find('li.tab a'),
                   $tabs_width = $this.width(),
                   $tabs_content = $(),
                   $tabs_wrapper,
                   $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
                   $indicator,
                   index = prev_index = 0,
                   clicked = false,
                   clickedTimeout,
                   transition = 300;


               // Finds right attribute for indicator based on active tab.
               // el: jQuery Object
               var calcRightPos = function (el) {
                   return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft());
               };
               // Finds left attribute for indicator based on active tab.
               // el: jQuery Object
               var calcLeftPos = function (el) {
                   return Math.floor(el.position().left + $this.scrollLeft());
               };
               // Animates Indicator to active tab.
               // prev_index: Number
               var animateIndicator = function (prev_index) {
                   if ((index - prev_index) >= 0) {
                       $indicator.velocity({
                           "right": calcRightPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $indicator.velocity({
                           "left": calcLeftPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad',
                           delay: 90
                       });
                   } else {
                       $indicator.velocity({
                           "left": calcLeftPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad'
                       });
                       $indicator.velocity({
                           "right": calcRightPos($active)
                       }, {
                           duration: transition,
                           queue: false,
                           easing: 'easeOutQuad',
                           delay: 90
                       });
                   }
               };
               // Change swipeable according to responsive threshold
               if (options.swipeable) {
                   if (window_width > options.responsiveThreshold) {
                       options.swipeable = false;
                   }
               }


               // If the location.hash matches one of the links, use that as the active tab.
               $active = $($links.filter('[href="' + location.hash + '"]'));
               // If no match is found, use the first link or any with class 'active' as the initial active tab.
               if ($active.length === 0) {
                   $active = $(this).find('li.tab a.active').first();
               }
               if ($active.length === 0) {
                   $active = $(this).find('li.tab a').first();
               }
               $active.addClass('active');
               index = $links.index($active);
               if (index < 0) {
                   index = 0;
               }
               if ($active[0] !== undefined) {
                   $content = $($active[0].hash);
                   $content.addClass('active');
               }
               // append indicator then set indicator width to tab width
               if (!$this.find('.indicator').length) {
$this.append('
  • ');
                   }
                   $indicator = $this.find('.indicator');
    
                   // we make sure that the indicator is at the end of the tabs
                   $this.append($indicator);
    
                   if ($this.is(":visible")) {
                       // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
                       // $indicator.css({"left": index * $tab_width});
                       setTimeout(function () {
                           $indicator.css({
                               "right": calcRightPos($active)
                           });
                           $indicator.css({
                               "left": calcLeftPos($active)
                           });
                       }, 0);
                   }
                   $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
                       $tabs_width = $this.width();
                       $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
                       if (index < 0) {
                           index = 0;
                       }
                       if ($tab_width !== 0 && $tabs_width !== 0) {
                           $indicator.css({
                               "right": calcRightPos($active)
                           });
                           $indicator.css({
                               "left": calcLeftPos($active)
                           });
                       }
                   });
    
                   // Initialize Tabs Content.
                   if (options.swipeable) {
                       // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
                       $links.each(function () {
                           var $curr_content = $(Materialize.escapeHash(this.hash));
                           $curr_content.addClass('carousel-item');
                           $tabs_content = $tabs_content.add($curr_content);
                       });
    
    $tabs_wrapper = $tabs_content.wrapAll('');
                       $tabs_content.css('display', );
                       $('.tabs-content.carousel').carousel({
                           fullWidth: true,
                           noWrap: true,
                           onCycleTo: function (item) {
                               if (!clicked) {
                                   var prev_index = index;
                                   index = $tabs_wrapper.index(item);
                                   $active = $links.eq(index);
                                   animateIndicator(prev_index);
                                   if (typeof (options.onShow) === "function") {
                                       options.onShow.call($this[0], $content);
                                   }
                               }
                           },
                       });
                   } else {
                       // Hide the remaining content
                       $links.not($active).each(function () {
                           $(Materialize.escapeHash(this.hash)).hide();
                       });
                   }
    


                   // Bind the click event handler
                   $this.off('click.tabs').on('click.tabs', 'a', function (e) {
                       if ($(this).parent().hasClass('disabled')) {
                           e.preventDefault();
                           return;
                       }
    
                       // Act as regular link if target attribute is specified.
                       if (!!$(this).attr("target")) {
                           return;
                       }
    
                       clicked = true;
                       $tabs_width = $this.width();
                       $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
    
                       // Make the old tab inactive.
                       $active.removeClass('active');
                       var $oldContent = $content
    
                       // Update the variables with the new link and content
                       $active = $(this);
                       $content = $(Materialize.escapeHash(this.hash));
                       $links = $this.find('li.tab a');
                       var activeRect = $active.position();
    
                       // Make the tab active.
                       $active.addClass('active');
                       prev_index = index;
                       index = $links.index($(this));
                       if (index < 0) {
                           index = 0;
                       }
                       // Change url to current tab
                       // window.location.hash = $active.attr('href');
    
                       // Swap content
                       if (options.swipeable) {
                           if ($tabs_content.length) {
                               $tabs_content.carousel('set', index, function () {
                                   if (typeof (options.onShow) === "function") {
                                       options.onShow.call($this[0], $content);
                                   }
                               });
                           }
                       } else {
                           if ($content !== undefined) {
                               $content.show();
                               $content.addClass('active');
                               if (typeof (options.onShow) === "function") {
                                   options.onShow.call(this, $content);
                               }
                           }
    
                           if ($oldContent !== undefined &&
                               !$oldContent.is($content)) {
                               $oldContent.hide();
                               $oldContent.removeClass('active');
                           }
                       }
    
                       // Reset clicked state
                       clickedTimeout = setTimeout(function () {
                           clicked = false;
                       }, transition);
    
                       // Update indicator
                       animateIndicator(prev_index);
    
                       // Prevent the anchor's default click action
                       e.preventDefault();
                   });
               });
    
           },
           select_tab: function (id) {
               this.find('a[href="#' + id + '"]').trigger('click');
           }
       };
    
       $.fn.tabs = function (methodOrOptions) {
           if (methods[methodOrOptions]) {
               return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
           } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
               // Default to "init"
               return methods.init.apply(this, arguments);
           } else {
               $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
           }
       };
    
       $(document).ready(function () {
           $('ul.tabs').tabs();
       });
    

    }(jQuery));; (function ($) {

       $.fn.tooltip = function (options) {
           var timeout = null,
               margin = 5;
    
           // Defaults
           var defaults = {
               delay: 350,
               tooltip: ,
               position: 'bottom',
               html: false
           };
    
           // Remove tooltip from the activator
           if (options === "remove") {
               this.each(function () {
                   $('#' + $(this).attr('data-tooltip-id')).remove();
                   $(this).off('mouseenter.tooltip mouseleave.tooltip');
               });
               return false;
           }
    
           options = $.extend(defaults, options);
    
           return this.each(function () {
               var tooltipId = Materialize.guid();
               var origin = $(this);
    
               // Destroy old tooltip
               if (origin.attr('data-tooltip-id')) {
                   $('#' + origin.attr('data-tooltip-id')).remove();
               }
    
               origin.attr('data-tooltip-id', tooltipId);
    
               // Get attributes.
               var allowHtml,
                   tooltipDelay,
                   tooltipPosition,
                   tooltipText,
                   tooltipEl,
                   backdrop;
               var setAttributes = function () {
                   allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
                   tooltipDelay = origin.attr('data-delay');
                   tooltipDelay = (tooltipDelay === undefined || tooltipDelay === ) ?
                       options.delay : tooltipDelay;
                   tooltipPosition = origin.attr('data-position');
                   tooltipPosition = (tooltipPosition === undefined || tooltipPosition === ) ?
                       options.position : tooltipPosition;
                   tooltipText = origin.attr('data-tooltip');
                   tooltipText = (tooltipText === undefined || tooltipText === ) ?
                       options.tooltip : tooltipText;
               };
               setAttributes();
    
               var renderTooltipEl = function () {
    
    var tooltip = $('
    ');
                   // Create Text span
                   if (allowHtml) {
                       tooltipText = $('').html(tooltipText);
                   } else {
                       tooltipText = $('').text(tooltipText);
                   }
    
                   // Create tooltip
                   tooltip.append(tooltipText)
                       .appendTo($('body'))
                       .attr('id', tooltipId);
    
                   // Create backdrop
    
    backdrop = $('
    ');
                   backdrop.appendTo(tooltip);
                   return tooltip;
               };
               tooltipEl = renderTooltipEl();
    
               // Destroy previously binded events
               origin.off('mouseenter.tooltip mouseleave.tooltip');
               // Mouse In
               var started = false,
                   timeoutRef;
               origin.on({
                   'mouseenter.tooltip': function (e) {
                       var showTooltip = function () {
                           setAttributes();
                           started = true;
                           tooltipEl.velocity('stop');
                           backdrop.velocity('stop');
                           tooltipEl.css({
                               visibility: 'visible',
                               left: '0px',
                               top: '0px'
                           });
    
                           // Tooltip positioning
                           var originWidth = origin.outerWidth();
                           var originHeight = origin.outerHeight();
                           var tooltipHeight = tooltipEl.outerHeight();
                           var tooltipWidth = tooltipEl.outerWidth();
                           var tooltipVerticalMovement = '0px';
                           var tooltipHorizontalMovement = '0px';
                           var backdropOffsetWidth = backdrop[0].offsetWidth;
                           var backdropOffsetHeight = backdrop[0].offsetHeight;
                           var scaleXFactor = 8;
                           var scaleYFactor = 8;
                           var scaleFactor = 0;
                           var targetTop, targetLeft, newCoordinates;
    
                           if (tooltipPosition === "top") {
                               // Top Position
                               targetTop = origin.offset().top - tooltipHeight - margin;
                               targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                               newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                               tooltipVerticalMovement = '-10px';
                               backdrop.css({
                                   bottom: 0,
                                   left: 0,
                                   borderRadius: '14px 14px 0 0',
                                   transformOrigin: '50% 100%',
                                   marginTop: tooltipHeight,
                                   marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
                               });
                           }
                           // Left Position
                           else if (tooltipPosition === "left") {
                               targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                               targetLeft = origin.offset().left - tooltipWidth - margin;
                               newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
    
                               tooltipHorizontalMovement = '-10px';
                               backdrop.css({
                                   top: '-7px',
                                   right: 0,
                                   width: '14px',
                                   height: '14px',
                                   borderRadius: '14px 0 0 14px',
                                   transformOrigin: '95% 50%',
                                   marginTop: tooltipHeight / 2,
                                   marginLeft: tooltipWidth
                               });
                           }
                           // Right Position
                           else if (tooltipPosition === "right") {
                               targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
                               targetLeft = origin.offset().left + originWidth + margin;
                               newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
    
                               tooltipHorizontalMovement = '+10px';
                               backdrop.css({
                                   top: '-7px',
                                   left: 0,
                                   width: '14px',
                                   height: '14px',
                                   borderRadius: '0 14px 14px 0',
                                   transformOrigin: '5% 50%',
                                   marginTop: tooltipHeight / 2,
                                   marginLeft: '0px'
                               });
                           } else {
                               // Bottom Position
                               targetTop = origin.offset().top + origin.outerHeight() + margin;
                               targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
                               newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
                               tooltipVerticalMovement = '+10px';
                               backdrop.css({
                                   top: 0,
                                   left: 0,
                                   marginLeft: (tooltipWidth / 2) - (backdropOffsetWidth / 2)
                               });
                           }
    
                           // Set tooptip css placement
                           tooltipEl.css({
                               top: newCoordinates.y,
                               left: newCoordinates.x
                           });
    
                           // Calculate Scale to fill
                           scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
                           scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
                           scaleFactor = Math.max(scaleXFactor, scaleYFactor);
    
                           tooltipEl.velocity({
                                   translateY: tooltipVerticalMovement,
                                   translateX: tooltipHorizontalMovement
                               }, {
                                   duration: 350,
                                   queue: false
                               })
                               .velocity({
                                   opacity: 1
                               }, {
                                   duration: 300,
                                   delay: 50,
                                   queue: false
                               });
                           backdrop.css({
                                   visibility: 'visible'
                               })
                               .velocity({
                                   opacity: 1
                               }, {
                                   duration: 55,
                                   delay: 0,
                                   queue: false
                               })
                               .velocity({
                                   scaleX: scaleFactor,
                                   scaleY: scaleFactor
                               }, {
                                   duration: 300,
                                   delay: 0,
                                   queue: false,
                                   easing: 'easeInOutQuad'
                               });
                       };
    
                       timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
    
                       // Mouse Out
                   },
                   'mouseleave.tooltip': function () {
                       // Reset State
                       started = false;
                       clearTimeout(timeoutRef);
    
                       // Animate back
                       setTimeout(function () {
                           if (started !== true) {
                               tooltipEl.velocity({
                                   opacity: 0,
                                   translateY: 0,
                                   translateX: 0
                               }, {
                                   duration: 225,
                                   queue: false
                               });
                               backdrop.velocity({
                                   opacity: 0,
                                   scaleX: 1,
                                   scaleY: 1
                               }, {
                                   duration: 225,
                                   queue: false,
                                   complete: function () {
                                       backdrop.css({
                                           visibility: 'hidden'
                                       });
                                       tooltipEl.css({
                                           visibility: 'hidden'
                                       });
                                       started = false;
                                   }
                               });
                           }
                       }, 225);
                   }
               });
           });
       };
    
       var repositionWithinScreen = function (x, y, width, height) {
           var newX = x;
           var newY = y;
    
           if (newX < 0) {
               newX = 4;
           } else if (newX + width > window.innerWidth) {
               newX -= newX + width - window.innerWidth;
           }
    
           if (newY < 0) {
               newY = 4;
           } else if (newY + height > window.innerHeight + $(window).scrollTop) {
               newY -= newY + height - window.innerHeight;
           }
    
           return {
               x: newX,
               y: newY
           };
       };
    
       $(document).ready(function () {
           $('.tooltipped').tooltip();
       });
    

    }(jQuery));; /*!

    * Waves v0.6.4
    * http://fian.my.id/Waves
    *
    * Copyright 2014 Alfiana E. Sibuea and other contributors
    * Released under the MIT license
    * https://github.com/fians/Waves/blob/master/LICENSE
    */
    

    (function (window) {

       'use strict';
    
       var Waves = Waves || {};
       var $$ = document.querySelectorAll.bind(document);
    
       // Find exact position of element
       function isWindow(obj) {
           return obj !== null && obj === obj.window;
       }
    
       function getWindow(elem) {
           return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
       }
    
       function offset(elem) {
           var docElem, win,
               box = {
                   top: 0,
                   left: 0
               },
               doc = elem && elem.ownerDocument;
    
           docElem = doc.documentElement;
    
           if (typeof elem.getBoundingClientRect !== typeof undefined) {
               box = elem.getBoundingClientRect();
           }
           win = getWindow(doc);
           return {
               top: box.top + win.pageYOffset - docElem.clientTop,
               left: box.left + win.pageXOffset - docElem.clientLeft
           };
       }
    
       function convertStyle(obj) {
           var style = ;
    
           for (var a in obj) {
               if (obj.hasOwnProperty(a)) {
                   style += (a + ':' + obj[a] + ';');
               }
           }
    
           return style;
       }
    
       var Effect = {
    
           // Effect delay
           duration: 750,
    
           show: function (e, element) {
    
               // Disable right click
               if (e.button === 2) {
                   return false;
               }
    
               var el = element || this;
    
               // Create ripple
               var ripple = document.createElement('div');
               ripple.className = 'waves-ripple';
               el.appendChild(ripple);
    
               // Get click coordinate and element witdh
               var pos = offset(el);
               var relativeY = (e.pageY - pos.top);
               var relativeX = (e.pageX - pos.left);
               var scale = 'scale(' + ((el.clientWidth / 100) * 10) + ')';
    
               // Support for touch devices
               if ('touches' in e) {
                   relativeY = (e.touches[0].pageY - pos.top);
                   relativeX = (e.touches[0].pageX - pos.left);
               }
    
               // Attach data to element
               ripple.setAttribute('data-hold', Date.now());
               ripple.setAttribute('data-scale', scale);
               ripple.setAttribute('data-x', relativeX);
               ripple.setAttribute('data-y', relativeY);
    
               // Set ripple position
               var rippleStyle = {
                   'top': relativeY + 'px',
                   'left': relativeX + 'px'
               };
    
               ripple.className = ripple.className + ' waves-notransition';
               ripple.setAttribute('style', convertStyle(rippleStyle));
               ripple.className = ripple.className.replace('waves-notransition', );
    
               // Scale the ripple
               rippleStyle['-webkit-transform'] = scale;
               rippleStyle['-moz-transform'] = scale;
               rippleStyle['-ms-transform'] = scale;
               rippleStyle['-o-transform'] = scale;
               rippleStyle.transform = scale;
               rippleStyle.opacity = '1';
    
               rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
               rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
               rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
               rippleStyle['transition-duration'] = Effect.duration + 'ms';
    
               rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
               rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
               rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
               rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
    
               ripple.setAttribute('style', convertStyle(rippleStyle));
           },
    
           hide: function (e) {
               TouchHandler.touchup(e);
    
               var el = this;
               var width = el.clientWidth * 1.4;
    
               // Get first ripple
               var ripple = null;
               var ripples = el.getElementsByClassName('waves-ripple');
               if (ripples.length > 0) {
                   ripple = ripples[ripples.length - 1];
               } else {
                   return false;
               }
    
               var relativeX = ripple.getAttribute('data-x');
               var relativeY = ripple.getAttribute('data-y');
               var scale = ripple.getAttribute('data-scale');
    
               // Get delay beetween mousedown and mouse leave
               var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
               var delay = 350 - diff;
    
               if (delay < 0) {
                   delay = 0;
               }
    
               // Fade out ripple after delay
               setTimeout(function () {
                   var style = {
                       'top': relativeY + 'px',
                       'left': relativeX + 'px',
                       'opacity': '0',
    
                       // Duration
                       '-webkit-transition-duration': Effect.duration + 'ms',
                       '-moz-transition-duration': Effect.duration + 'ms',
                       '-o-transition-duration': Effect.duration + 'ms',
                       'transition-duration': Effect.duration + 'ms',
                       '-webkit-transform': scale,
                       '-moz-transform': scale,
                       '-ms-transform': scale,
                       '-o-transform': scale,
                       'transform': scale,
                   };
    
                   ripple.setAttribute('style', convertStyle(style));
    
                   setTimeout(function () {
                       try {
                           el.removeChild(ripple);
                       } catch (e) {
                           return false;
                       }
                   }, Effect.duration);
               }, delay);
           },
    
           // Little hack to make <input> can perform waves effect
           wrapInput: function (elements) {
               for (var a = 0; a < elements.length; a++) {
                   var el = elements[a];
    
                   if (el.tagName.toLowerCase() === 'input') {
                       var parent = el.parentNode;
    
                       // If input already have parent just pass through
                       if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
                           continue;
                       }
    
                       // Put element class and style to the specified parent
                       var wrapper = document.createElement('i');
                       wrapper.className = el.className + ' waves-input-wrapper';
    
                       var elementStyle = el.getAttribute('style');
    
                       if (!elementStyle) {
                           elementStyle = ;
                       }
    
                       wrapper.setAttribute('style', elementStyle);
    
                       el.className = 'waves-button-input';
                       el.removeAttribute('style');
    
                       // Put element as child
                       parent.replaceChild(wrapper, el);
                       wrapper.appendChild(el);
                   }
               }
           }
       };
    


       /**
        * Disable mousedown event for 500ms during and after touch
        */
       var TouchHandler = {
           /* uses an integer rather than bool so there's no issues with
            * needing to clear timeouts if another touch event occurred
            * within the 500ms. Cannot mouseup between touchstart and
            * touchend, nor in the 500ms after touchend. */
           touches: 0,
           allowEvent: function (e) {
               var allow = true;
    
               if (e.type === 'touchstart') {
                   TouchHandler.touches += 1; //push
               } else if (e.type === 'touchend' || e.type === 'touchcancel') {
                   setTimeout(function () {
                       if (TouchHandler.touches > 0) {
                           TouchHandler.touches -= 1; //pop after 500ms
                       }
                   }, 500);
               } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
                   allow = false;
               }
    
               return allow;
           },
           touchup: function (e) {
               TouchHandler.allowEvent(e);
           }
       };
    


       /**
        * Delegated click handler for .waves-effect element.
        * returns null when .waves-effect element not in "click tree"
        */
       function getWavesEffectElement(e) {
           if (TouchHandler.allowEvent(e) === false) {
               return null;
           }
    
           var element = null;
           var target = e.target || e.srcElement;
    
           while (target.parentElement !== null) {
               if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
                   element = target;
                   break;
               } else if (target.className.indexOf('waves-effect') !== -1) {
                   element = target;
                   break;
               }
               target = target.parentElement;
           }
    
           return element;
       }
    
       /**
        * Bubble the click and show effect if .waves-effect elem was found
        */
       function showEffect(e) {
           var element = getWavesEffectElement(e);
    
           if (element !== null) {
               Effect.show(e, element);
    
               if ('ontouchstart' in window) {
                   element.addEventListener('touchend', Effect.hide, false);
                   element.addEventListener('touchcancel', Effect.hide, false);
               }
    
               element.addEventListener('mouseup', Effect.hide, false);
               element.addEventListener('mouseleave', Effect.hide, false);
           }
       }
    
       Waves.displayEffect = function (options) {
           options = options || {};
    
           if ('duration' in options) {
               Effect.duration = options.duration;
           }
    
           //Wrap input inside  tag
           Effect.wrapInput($$('.waves-effect'));
    
           if ('ontouchstart' in window) {
               document.body.addEventListener('touchstart', showEffect, false);
           }
    
           document.body.addEventListener('mousedown', showEffect, false);
       };
    
       /**
        * Attach Waves to an input element (or any element which doesn't
        * bubble mouseup/mousedown events).
        *   Intended to be used with dynamically loaded forms/inputs, or
        * where the user doesn't want a delegated click handler.
        */
       Waves.attach = function (element) {
           //FUTURE: automatically add waves classes and allow users
           // to specify them with an options param? Eg. light/classic/button
           if (element.tagName.toLowerCase() === 'input') {
               Effect.wrapInput([element]);
               element = element.parentElement;
           }
    
           if ('ontouchstart' in window) {
               element.addEventListener('touchstart', showEffect, false);
           }
    
           element.addEventListener('mousedown', showEffect, false);
       };
    
       window.Waves = Waves;
    
       document.addEventListener('DOMContentLoaded', function () {
           Waves.displayEffect();
       }, false);
    

    })(window);; Materialize.toast = function (message, displayLength, className, completeCallback) {

       className = className || "";
    
       var container = document.getElementById('toast-container');
    
       // Create toast container if it does not exist
       if (container === null) {
           // create notification container
           container = document.createElement('div');
           container.id = 'toast-container';
           document.body.appendChild(container);
       }
    
       // Select and append toast
       var newToast = createToast(message);
    
       // only append toast if message is not undefined
       if (message) {
           container.appendChild(newToast);
       }
    
       newToast.style.opacity = 0;
    
       // Animate toast in
       Vel(newToast, {
           translateY: '-35px',
           opacity: 1
       }, {
           duration: 300,
           easing: 'easeOutCubic',
           queue: false
       });
    
       // Allows timer to be pause while being panned
       var timeLeft = displayLength;
       var counterInterval;
       if (timeLeft != null) {
           counterInterval = setInterval(function () {
               if (newToast.parentNode === null)
                   window.clearInterval(counterInterval);
    
               // If toast is not being dragged, decrease its time remaining
               if (!newToast.classList.contains('panning')) {
                   timeLeft -= 20;
               }
    
               if (timeLeft <= 0) {
                   // Animate toast out
                   Vel(newToast, {
                       "opacity": 0,
                       marginTop: '-40px'
                   }, {
                       duration: 375,
                       easing: 'easeOutExpo',
                       queue: false,
                       complete: function () {
                           // Call the optional callback
                           if (typeof (completeCallback) === "function")
                               completeCallback();
                           // Remove toast after it times out
                           this[0].parentNode.removeChild(this[0]);
                       }
                   });
                   window.clearInterval(counterInterval);
               }
           }, 20);
       }
    


       function createToast(html) {
    
           // Create toast
           var toast = document.createElement('div');
           toast.classList.add('toast');
           if (className) {
               var classes = className.split(' ');
    
               for (var i = 0, count = classes.length; i < count; i++) {
                   toast.classList.add(classes[i]);
               }
           }
           // If type of parameter is HTML Element
           if (typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName === "string") {
               toast.appendChild(html);
           } else if (html instanceof jQuery) {
               // Check if it is jQuery object
               toast.appendChild(html[0]);
           } else {
               // Insert as text;
               toast.innerHTML = html;
           }
           // Bind hammer
           var hammerHandler = new Hammer(toast, {
               prevent_default: false
           });
           hammerHandler.on('pan', function (e) {
               var deltaX = e.deltaX;
               var activationDistance = 80;
    
               // Change toast state
               if (!toast.classList.contains('panning')) {
                   toast.classList.add('panning');
               }
    
               var opacityPercent = 1 - Math.abs(deltaX / activationDistance);
               if (opacityPercent < 0)
                   opacityPercent = 0;
    
               Vel(toast, {
                   left: deltaX,
                   opacity: opacityPercent
               }, {
                   duration: 50,
                   queue: false,
                   easing: 'easeOutQuad'
               });
    
           });
    
           hammerHandler.on('panend', function (e) {
               var deltaX = e.deltaX;
               var activationDistance = 80;
    
               // If toast dragged past activation point
               if (Math.abs(deltaX) > activationDistance) {
                   Vel(toast, {
                       marginTop: '-40px'
                   }, {
                       duration: 375,
                       easing: 'easeOutExpo',
                       queue: false,
                       complete: function () {
                           if (typeof (completeCallback) === "function") {
                               completeCallback();
                           }
                           toast.parentNode.removeChild(toast);
                       }
                   });
    
               } else {
                   toast.classList.remove('panning');
                   // Put toast back into original position
                   Vel(toast, {
                       left: 0,
                       opacity: 1
                   }, {
                       duration: 300,
                       easing: 'easeOutExpo',
                       queue: false
                   });
    
               }
           });
    
           return toast;
       }
    

    };; (function ($) {

       var methods = {
           init: function (options) {
               var defaults = {
                   menuWidth: 300,
                   edge: 'left',
                   closeOnClick: false,
                   draggable: true,
                   onOpen: null,
                   onClose: null
               };
               options = $.extend(defaults, options);
    
               $(this).each(function () {
                   var $this = $(this);
                   var menuId = $this.attr('data-activates');
                   var menu = $("#" + menuId);
    
                   // Set to width
                   if (options.menuWidth != 300) {
                       menu.css('width', options.menuWidth);
                   }
    
                   // Add Touch Area
                   var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
                   if (options.draggable) {
                       // Regenerate dragTarget
                       if ($dragTarget.length) {
                           $dragTarget.remove();
                       }
    
    $dragTarget = $('
    ').attr('data-sidenav', menuId);
                       $('body').append($dragTarget);
                   } else {
                       $dragTarget = $();
                   }
    
                   if (options.edge == 'left') {
                       menu.css('transform', 'translateX(-100%)');
                       $dragTarget.css({
                           'left': 0
                       }); // Add Touch Area
                   } else {
                       menu.addClass('right-aligned') // Change text-alignment to right
                           .css('transform', 'translateX(100%)');
                       $dragTarget.css({
                           'right': 0
                       }); // Add Touch Area
                   }
    
                   // If fixed sidenav, bring menu out
                   if (menu.hasClass('fixed')) {
                       if (window.innerWidth > 992) {
                           menu.css('transform', 'translateX(0)');
                       }
                   }
    
                   // Window resize to reset on large screens fixed
                   if (menu.hasClass('fixed')) {
                       $(window).resize(function () {
                           if (window.innerWidth > 992) {
                               // Close menu if window is resized bigger than 992 and user has fixed sidenav
                               if ($('#sidenav-overlay').length !== 0 && menuOut) {
                                   removeMenu(true);
                               } else {
                                   // menu.removeAttr('style');
                                   menu.css('transform', 'translateX(0%)');
                                   // menu.css('width', options.menuWidth);
                               }
                           } else if (menuOut === false) {
                               if (options.edge === 'left') {
                                   menu.css('transform', 'translateX(-100%)');
                               } else {
                                   menu.css('transform', 'translateX(100%)');
                               }
    
                           }
    
                       });
                   }
    
                   // if closeOnClick, then add close event for all a tags in side sideNav
                   if (options.closeOnClick === true) {
                       menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
                           if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
                               removeMenu();
                           }
                       });
                   }
    
                   var removeMenu = function (restoreNav) {
                       panning = false;
                       menuOut = false;
                       // Reenable scrolling
                       $('body').css({
                           overflow: ,
                           width: 
                       });
    
                       $('#sidenav-overlay').velocity({
                           opacity: 0
                       }, {
                           duration: 200,
                           queue: false,
                           easing: 'easeOutQuad',
                           complete: function () {
                               $(this).remove();
                           }
                       });
                       if (options.edge === 'left') {
                           // Reset phantom div
                           $dragTarget.css({
                               width: ,
                               right: ,
                               left: '0'
                           });
                           menu.velocity({
                               'translateX': '-100%'
                           }, {
                               duration: 200,
                               queue: false,
                               easing: 'easeOutCubic',
                               complete: function () {
                                   if (restoreNav === true) {
                                       // Restore Fixed sidenav
                                       menu.removeAttr('style');
                                       menu.css('width', options.menuWidth);
                                   }
                               }
    
                           });
                       } else {
                           // Reset phantom div
                           $dragTarget.css({
                               width: ,
                               right: '0',
                               left: 
                           });
                           menu.velocity({
                               'translateX': '100%'
                           }, {
                               duration: 200,
                               queue: false,
                               easing: 'easeOutCubic',
                               complete: function () {
                                   if (restoreNav === true) {
                                       // Restore Fixed sidenav
                                       menu.removeAttr('style');
                                       menu.css('width', options.menuWidth);
                                   }
                               }
                           });
                       }
    
                       // Callback
                       if (typeof (options.onClose) === 'function') {
                           options.onClose.call(this, menu);
                       }
                   }
    


                   // Touch Event
                   var panning = false;
                   var menuOut = false;
    
                   if (options.draggable) {
                       $dragTarget.on('click', function () {
                           if (menuOut) {
                               removeMenu();
                           }
                       });
    
                       $dragTarget.hammer({
                           prevent_default: false
                       }).on('pan', function (e) {
    
                           if (e.gesture.pointerType == "touch") {
    
                               var direction = e.gesture.direction;
                               var x = e.gesture.center.x;
                               var y = e.gesture.center.y;
                               var velocityX = e.gesture.velocityX;
    
                               // Vertical scroll bugfix
                               if (x === 0 && y === 0) {
                                   return;
                               }
    
                               // Disable Scrolling
                               var $body = $('body');
                               var $overlay = $('#sidenav-overlay');
                               var oldWidth = $body.innerWidth();
                               $body.css('overflow', 'hidden');
                               $body.width(oldWidth);
    
                               // If overlay does not exist, create one and if it is clicked, close menu
                               if ($overlay.length === 0) {
    
    $overlay = $('
    ');
                                   $overlay.css('opacity', 0).click(function () {
                                       removeMenu();
                                   });
    
                                   // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
                                   if (typeof (options.onOpen) === 'function') {
                                       options.onOpen.call(this, menu);
                                   }
    
                                   $('body').append($overlay);
                               }
    
                               // Keep within boundaries
                               if (options.edge === 'left') {
                                   if (x > options.menuWidth) {
                                       x = options.menuWidth;
                                   } else if (x < 0) {
                                       x = 0;
                                   }
                               }
    
                               if (options.edge === 'left') {
                                   // Left Direction
                                   if (x < (options.menuWidth / 2)) {
                                       menuOut = false;
                                   }
                                   // Right Direction
                                   else if (x >= (options.menuWidth / 2)) {
                                       menuOut = true;
                                   }
                                   menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
                               } else {
                                   // Left Direction
                                   if (x < (window.innerWidth - options.menuWidth / 2)) {
                                       menuOut = true;
                                   }
                                   // Right Direction
                                   else if (x >= (window.innerWidth - options.menuWidth / 2)) {
                                       menuOut = false;
                                   }
                                   var rightPos = (x - options.menuWidth / 2);
                                   if (rightPos < 0) {
                                       rightPos = 0;
                                   }
    
                                   menu.css('transform', 'translateX(' + rightPos + 'px)');
                               }
    


                               // Percentage overlay
                               var overlayPerc;
                               if (options.edge === 'left') {
                                   overlayPerc = x / options.menuWidth;
                                   $overlay.velocity({
                                       opacity: overlayPerc
                                   }, {
                                       duration: 10,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                               } else {
                                   overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
                                   $overlay.velocity({
                                       opacity: overlayPerc
                                   }, {
                                       duration: 10,
                                       queue: false,
                                       easing: 'easeOutQuad'
                                   });
                               }
                           }
    
                       }).on('panend', function (e) {
    
                           if (e.gesture.pointerType == "touch") {
                               var $overlay = $('#sidenav-overlay');
                               var velocityX = e.gesture.velocityX;
                               var x = e.gesture.center.x;
                               var leftPos = x - options.menuWidth;
                               var rightPos = x - options.menuWidth / 2;
                               if (leftPos > 0) {
                                   leftPos = 0;
                               }
                               if (rightPos < 0) {
                                   rightPos = 0;
                               }
                               panning = false;
    
                               if (options.edge === 'left') {
                                   // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
                                   if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
                                       // Return menu to open
                                       if (leftPos !== 0) {
                                           menu.velocity({
                                               'translateX': [0, leftPos]
                                           }, {
                                               duration: 300,
                                               queue: false,
                                               easing: 'easeOutQuad'
                                           });
                                       }
    
                                       $overlay.velocity({
                                           opacity: 1
                                       }, {
                                           duration: 50,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                       $dragTarget.css({
                                           width: '50%',
                                           right: 0,
                                           left: 
                                       });
                                       menuOut = true;
                                   } else if (!menuOut || velocityX > 0.3) {
                                       // Enable Scrolling
                                       $('body').css({
                                           overflow: ,
                                           width: 
                                       });
                                       // Slide menu closed
                                       menu.velocity({
                                           'translateX': [-1 * options.menuWidth - 10, leftPos]
                                       }, {
                                           duration: 200,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                       $overlay.velocity({
                                           opacity: 0
                                       }, {
                                           duration: 200,
                                           queue: false,
                                           easing: 'easeOutQuad',
                                           complete: function () {
                                               // Run 'onClose' when sidenav is closed via touch/swipe if applicable
                                               if (typeof (options.onClose) === 'function') {
                                                   options.onClose.call(this, menu);
                                               }
    
                                               $(this).remove();
                                           }
                                       });
                                       $dragTarget.css({
                                           width: '10px',
                                           right: ,
                                           left: 0
                                       });
                                   }
                               } else {
                                   if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
                                       // Return menu to open
                                       if (rightPos !== 0) {
                                           menu.velocity({
                                               'translateX': [0, rightPos]
                                           }, {
                                               duration: 300,
                                               queue: false,
                                               easing: 'easeOutQuad'
                                           });
                                       }
    
                                       $overlay.velocity({
                                           opacity: 1
                                       }, {
                                           duration: 50,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                       $dragTarget.css({
                                           width: '50%',
                                           right: ,
                                           left: 0
                                       });
                                       menuOut = true;
                                   } else if (!menuOut || velocityX < -0.3) {
                                       // Enable Scrolling
                                       $('body').css({
                                           overflow: ,
                                           width: 
                                       });
    
                                       // Slide menu closed
                                       menu.velocity({
                                           'translateX': [options.menuWidth + 10, rightPos]
                                       }, {
                                           duration: 200,
                                           queue: false,
                                           easing: 'easeOutQuad'
                                       });
                                       $overlay.velocity({
                                           opacity: 0
                                       }, {
                                           duration: 200,
                                           queue: false,
                                           easing: 'easeOutQuad',
                                           complete: function () {
                                               $(this).remove();
                                           }
                                       });
                                       $dragTarget.css({
                                           width: '10px',
                                           right: 0,
                                           left: 
                                       });
                                   }
                               }
    
                           }
                       });
                   }
    
                   $this.off('click.sidenav').on('click.sidenav', function () {
                       if (menuOut === true) {
                           menuOut = false;
                           panning = false;
                           removeMenu();
                       } else {
    
                           // Disable Scrolling
                           var $body = $('body');
    
    var $overlay = $('
    ');
                           var oldWidth = $body.innerWidth();
                           $body.css('overflow', 'hidden');
                           $body.width(oldWidth);
    
                           // Push current drag target on top of DOM tree
                           $('body').append($dragTarget);
    
                           if (options.edge === 'left') {
                               $dragTarget.css({
                                   width: '50%',
                                   right: 0,
                                   left: 
                               });
                               menu.velocity({
                                   'translateX': [0, -1 * options.menuWidth]
                               }, {
                                   duration: 300,
                                   queue: false,
                                   easing: 'easeOutQuad'
                               });
                           } else {
                               $dragTarget.css({
                                   width: '50%',
                                   right: ,
                                   left: 0
                               });
                               menu.velocity({
                                   'translateX': [0, options.menuWidth]
                               }, {
                                   duration: 300,
                                   queue: false,
                                   easing: 'easeOutQuad'
                               });
                           }
    
                           $overlay.css('opacity', 0)
                               .click(function () {
                                   menuOut = false;
                                   panning = false;
                                   removeMenu();
                                   $overlay.velocity({
                                       opacity: 0
                                   }, {
                                       duration: 300,
                                       queue: false,
                                       easing: 'easeOutQuad',
                                       complete: function () {
                                           $(this).remove();
                                       }
                                   });
    
                               });
                           $('body').append($overlay);
                           $overlay.velocity({
                               opacity: 1
                           }, {
                               duration: 300,
                               queue: false,
                               easing: 'easeOutQuad',
                               complete: function () {
                                   menuOut = true;
                                   panning = false;
                               }
                           });
    
                           // Callback
                           if (typeof (options.onOpen) === 'function') {
                               options.onOpen.call(this, menu);
                           }
                       }
    
                       return false;
                   });
               });
    


           },
           destroy: function () {
               var $overlay = $('#sidenav-overlay');
               var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
               $overlay.trigger('click');
               $dragTarget.remove();
               $(this).off('click');
               $overlay.remove();
           },
           show: function () {
               this.trigger('click');
           },
           hide: function () {
               $('#sidenav-overlay').trigger('click');
           }
       };
    


       $.fn.sideNav = function (methodOrOptions) {
           if (methods[methodOrOptions]) {
               return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
           } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
               // Default to "init"
               return methods.init.apply(this, arguments);
           } else {
               $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
           }
       }; // Plugin end
    

    }(jQuery));; /**

    * Extend jquery with a scrollspy plugin.
    * This watches the window scroll and fires events when elements are scrolled into viewport.
    *
    * throttle() and getTime() taken from Underscore.js
    * https://github.com/jashkenas/underscore
    *
    * @author Copyright 2013 John Smart
    * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
    * @see https://github.com/thesmart
    * @version 0.1.2
    */
    

    (function ($) {

       var jWindow = $(window);
       var elements = [];
       var elementsInView = [];
       var isSpying = false;
       var ticks = 0;
       var unique_id = 1;
       var offset = {
           top: 0,
           right: 0,
           bottom: 0,
           left: 0,
       }
    
       /**
        * Find elements that are within the boundary
        * @param {number} top
        * @param {number} right
        * @param {number} bottom
        * @param {number} left
        * @return {jQuery}		A collection of elements
        */
       function findElements(top, right, bottom, left) {
           var hits = $();
           $.each(elements, function (i, element) {
               if (element.height() > 0) {
                   var elTop = element.offset().top,
                       elLeft = element.offset().left,
                       elRight = elLeft + element.width(),
                       elBottom = elTop + element.height();
    
                   var isIntersect = !(elLeft > right ||
                       elRight < left ||
                       elTop > bottom ||
                       elBottom < top);
    
                   if (isIntersect) {
                       hits.push(element);
                   }
               }
           });
    
           return hits;
       }
    


       /**
        * Called when the user scrolls the window
        */
       function onScroll(scrollOffset) {
           // unique tick id
           ++ticks;
    
           // viewport rectangle
           var top = jWindow.scrollTop(),
               left = jWindow.scrollLeft(),
               right = left + jWindow.width(),
               bottom = top + jWindow.height();
    
           // determine which elements are in view
           var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
           $.each(intersections, function (i, element) {
    
               var lastTick = element.data('scrollSpy:ticks');
               if (typeof lastTick != 'number') {
                   // entered into view
                   element.triggerHandler('scrollSpy:enter');
               }
    
               // update tick id
               element.data('scrollSpy:ticks', ticks);
           });
    
           // determine which elements are no longer in view
           $.each(elementsInView, function (i, element) {
               var lastTick = element.data('scrollSpy:ticks');
               if (typeof lastTick == 'number' && lastTick !== ticks) {
                   // exited from view
                   element.triggerHandler('scrollSpy:exit');
                   element.data('scrollSpy:ticks', null);
               }
           });
    
           // remember elements in view for next tick
           elementsInView = intersections;
       }
    
       /**
        * Called when window is resized
        */
       function onWinSize() {
           jWindow.trigger('scrollSpy:winSize');
       }
    


       /**
    

    * Enables ScrollSpy using a selector * @param {jQuery|string} selector The elements collection, or a selector * @param {Object=} options Optional.

           throttle : number -> scrollspy throttling. Default: 100 ms
           offsetTop : number -> offset from top. Default: 0
           offsetRight : number -> offset from right. Default: 0
           offsetBottom : number -> offset from bottom. Default: 0
           offsetLeft : number -> offset from left. Default: 0
    

    activeClass : string -> Class name to be added to the active link. Default: active * @returns {jQuery} */

       $.scrollSpy = function (selector, options) {
           var defaults = {
               throttle: 100,
               scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
               activeClass: 'active',
               getActiveElement: function (id) {
                   return 'a[href="#' + id + '"]';
               }
           };
           options = $.extend(defaults, options);
    
           var visible = [];
           selector = $(selector);
           selector.each(function (i, element) {
               elements.push($(element));
               $(element).data("scrollSpy:id", i);
               // Smooth scroll to section
               $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
                   e.preventDefault();
                   var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
                   $('html, body').animate({
                       scrollTop: offset - options.scrollOffset
                   }, {
                       duration: 400,
                       queue: false,
                       easing: 'easeOutCubic'
                   });
               });
           });
    
           offset.top = options.offsetTop || 0;
           offset.right = options.offsetRight || 0;
           offset.bottom = options.offsetBottom || 0;
           offset.left = options.offsetLeft || 0;
    
           var throttledScroll = Materialize.throttle(function () {
               onScroll(options.scrollOffset);
           }, options.throttle || 100);
           var readyScroll = function () {
               $(document).ready(throttledScroll);
           };
    
           if (!isSpying) {
               jWindow.on('scroll', readyScroll);
               jWindow.on('resize', readyScroll);
               isSpying = true;
           }
    
           // perform a scan once, after current execution context, and after dom is ready
           setTimeout(readyScroll, 0);
    


           selector.on('scrollSpy:enter', function () {
               visible = $.grep(visible, function (value) {
                   return value.height() != 0;
               });
    
               var $this = $(this);
    
               if (visible[0]) {
                   $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
                   if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
                       visible.unshift($(this));
                   } else {
                       visible.push($(this));
                   }
               } else {
                   visible.push($(this));
               }
    


               $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
           });
           selector.on('scrollSpy:exit', function () {
               visible = $.grep(visible, function (value) {
                   return value.height() != 0;
               });
    
               if (visible[0]) {
                   $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
                   var $this = $(this);
                   visible = $.grep(visible, function (value) {
                       return value.attr('id') != $this.attr('id');
                   });
                   if (visible[0]) { // Check if empty
                       $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
                   }
               }
           });
    
           return selector;
       };
    
       /**
        * Listen for window resize events
        * @param {Object=} options						Optional. Set { throttle: number } to change throttling. Default: 100 ms
        * @returns {jQuery}		$(window)
        */
       $.winSizeSpy = function (options) {
           $.winSizeSpy = function () {
               return jWindow;
           }; // lock from multiple calls
           options = options || {
               throttle: 100
           };
           return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
       };
    
       /**
        * Enables ScrollSpy on a collection of elements
        * e.g. $('.scrollSpy').scrollSpy()
        * @param {Object=} options	Optional.
       										throttle : number -> scrollspy throttling. Default: 100 ms
       										offsetTop : number -> offset from top. Default: 0
       										offsetRight : number -> offset from right. Default: 0
       										offsetBottom : number -> offset from bottom. Default: 0
       										offsetLeft : number -> offset from left. Default: 0
        * @returns {jQuery}
        */
       $.fn.scrollSpy = function (options) {
           return $.scrollSpy($(this), options);
       };
    

    })(jQuery);; (function ($) {

       $(document).ready(function () {
    
           // Function to update labels of text fields
           Materialize.updateTextFields = function () {
               var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
               $(input_selector).each(function (index, element) {
                   var $this = $(this);
                   if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
                       $this.siblings('label').addClass('active');
                   } else if ($(element)[0].validity) {
                       $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
                   } else {
                       $this.siblings('label').removeClass('active');
                   }
               });
           };
    
           // Text based inputs
           var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
    
           // Add active if form auto complete
           $(document).on('change', input_selector, function () {
               if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
                   $(this).siblings('label').addClass('active');
               }
               validate_field($(this));
           });
    
           // Add active if input element has been pre-populated on document ready
           $(document).ready(function () {
               Materialize.updateTextFields();
           });
    
           // HTML DOM FORM RESET handling
           $(document).on('reset', function (e) {
               var formReset = $(e.target);
               if (formReset.is('form')) {
                   formReset.find(input_selector).removeClass('valid').removeClass('invalid');
                   formReset.find(input_selector).each(function () {
                       if ($(this).attr('value') === ) {
                           $(this).siblings('label').removeClass('active');
                       }
                   });
    
                   // Reset select
                   formReset.find('select.initialized').each(function () {
                       var reset_text = formReset.find('option[selected]').text();
                       formReset.siblings('input.select-dropdown').val(reset_text);
                   });
               }
           });
    
           // Add active when element has focus
           $(document).on('focus', input_selector, function () {
               $(this).siblings('label, .prefix').addClass('active');
           });
    
           $(document).on('blur', input_selector, function () {
               var $inputElement = $(this);
               var selector = ".prefix";
    
               if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
                   selector += ", label";
               }
    
               $inputElement.siblings(selector).removeClass('active');
    
               validate_field($inputElement);
           });
    
           window.validate_field = function (object) {
               var hasLength = object.attr('data-length') !== undefined;
               var lenAttr = parseInt(object.attr('data-length'));
               var len = object.val().length;
    
               if (object.val().length === 0 && object[0].validity.badInput === false) {
                   if (object.hasClass('validate')) {
                       object.removeClass('valid');
                       object.removeClass('invalid');
                   }
               } else {
                   if (object.hasClass('validate')) {
                       // Check for character counter attributes
                       if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
                           object.removeClass('invalid');
                           object.addClass('valid');
                       } else {
                           object.removeClass('valid');
                           object.addClass('invalid');
                       }
                   }
               }
           };
    
           // Radio and Checkbox focus class
           var radio_checkbox = 'input[type=radio], input[type=checkbox]';
           $(document).on('keyup.radio', radio_checkbox, function (e) {
               // TAB, check if tabbing to radio or checkbox.
               if (e.which === 9) {
                   $(this).addClass('tabbed');
                   var $this = $(this);
                   $this.one('blur', function (e) {
    
                       $(this).removeClass('tabbed');
                   });
                   return;
               }
           });
    
           // Textarea Auto Resize
           var hiddenDiv = $('.hiddendiv').first();
           if (!hiddenDiv.length) {
    
    hiddenDiv = $('
    ');
               $('body').append(hiddenDiv);
           }
           var text_area_selector = '.materialize-textarea';
    
           function textareaAutoResize($textarea) {
               // Set font properties of hiddenDiv
    
               var fontFamily = $textarea.css('font-family');
               var fontSize = $textarea.css('font-size');
               var lineHeight = $textarea.css('line-height');
    
               if (fontSize) {
                   hiddenDiv.css('font-size', fontSize);
               }
               if (fontFamily) {
                   hiddenDiv.css('font-family', fontFamily);
               }
               if (lineHeight) {
                   hiddenDiv.css('line-height', lineHeight);
               }
    
               // Set original-height, if none
               if (!$textarea.data('original-height')) {
                   $textarea.data('original-height', $textarea.height());
               }
    
               if ($textarea.attr('wrap') === 'off') {
                   hiddenDiv.css('overflow-wrap', 'normal')
                       .css('white-space', 'pre');
               }
    
               hiddenDiv.text($textarea.val() + '\n');
               var content = hiddenDiv.html().replace(/\n/g, '
    '); hiddenDiv.html(content);


               // When textarea is hidden, width goes crazy.
               // Approximate with half of window size
    
               if ($textarea.is(':visible')) {
                   hiddenDiv.css('width', $textarea.width());
               } else {
                   hiddenDiv.css('width', $(window).width() / 2);
               }
    


               /**
                * Resize if the new height is greater than the
                * original height of the textarea
                */
               if ($textarea.data('original-height') <= hiddenDiv.height()) {
                   $textarea.css('height', hiddenDiv.height());
               } else if ($textarea.val().length < $textarea.data('previous-length')) {
                   /**
                    * In case the new height is less than original height, it
                    * means the textarea has less text than before
                    * So we set the height to the original one
                    */
                   $textarea.css('height', $textarea.data('original-height'));
               }
               $textarea.data('previous-length', $textarea.val().length);
           }
    
           $(text_area_selector).each(function () {
               var $textarea = $(this);
               /**
                * Instead of resizing textarea on document load,
                * store the original height and the original length
                */
               $textarea.data('original-height', $textarea.height());
               $textarea.data('previous-length', $textarea.val().length);
           });
    
           $('body').on('keyup keydown autoresize', text_area_selector, function () {
               textareaAutoResize($(this));
           });
    
           // File Input Path
           $(document).on('change', '.file-field input[type="file"]', function () {
               var file_field = $(this).closest('.file-field');
               var path_input = file_field.find('input.file-path');
               var files = $(this)[0].files;
               var file_names = [];
               for (var i = 0; i < files.length; i++) {
                   file_names.push(files[i].name);
               }
               path_input.val(file_names.join(", "));
               path_input.trigger('change');
           });
    
           /****************
            *  Range Input  *
            ****************/
    
           var range_type = 'input[type=range]';
           var range_mousedown = false;
           var left;
    
           $(range_type).each(function () {
               var thumb = $('');
               $(this).after(thumb);
           });
    
           var showRangeBubble = function (thumb) {
               var paddingLeft = parseInt(thumb.parent().css('padding-left'));
               var marginLeft = (-7 + paddingLeft) + 'px';
               thumb.velocity({
                   height: "30px",
                   width: "30px",
                   top: "-30px",
                   marginLeft: marginLeft
               }, {
                   duration: 300,
                   easing: 'easeOutExpo'
               });
           };
    
           var calcRangeOffset = function (range) {
               var width = range.width() - 15;
               var max = parseFloat(range.attr('max'));
               var min = parseFloat(range.attr('min'));
               var percent = (parseFloat(range.val()) - min) / (max - min);
               return percent * width;
           }
    
           var range_wrapper = '.range-field';
           $(document).on('change', range_type, function (e) {
               var thumb = $(this).siblings('.thumb');
               thumb.find('.value').html($(this).val());
    
               if (!thumb.hasClass('active')) {
                   showRangeBubble(thumb);
               }
    
               var offsetLeft = calcRangeOffset($(this));
               thumb.addClass('active').css('left', offsetLeft);
           });
    
           $(document).on('mousedown touchstart', range_type, function (e) {
               var thumb = $(this).siblings('.thumb');
    
               // If thumb indicator does not exist yet, create it
               if (thumb.length <= 0) {
                   thumb = $('');
                   $(this).after(thumb);
               }
    
               // Set indicator value
               thumb.find('.value').html($(this).val());
    
               range_mousedown = true;
               $(this).addClass('active');
    
               if (!thumb.hasClass('active')) {
                   showRangeBubble(thumb);
               }
    
               if (e.type !== 'input') {
                   var offsetLeft = calcRangeOffset($(this));
                   thumb.addClass('active').css('left', offsetLeft);
               }
           });
    
           $(document).on('mouseup touchend', range_wrapper, function () {
               range_mousedown = false;
               $(this).removeClass('active');
           });
    
           $(document).on('input mousemove touchmove', range_wrapper, function (e) {
               var thumb = $(this).children('.thumb');
               var left;
               var input = $(this).find(range_type);
    
               if (range_mousedown) {
                   if (!thumb.hasClass('active')) {
                       showRangeBubble(thumb);
                   }
    
                   var offsetLeft = calcRangeOffset(input);
                   thumb.addClass('active').css('left', offsetLeft);
                   thumb.find('.value').html(thumb.siblings(range_type).val());
               }
           });
    
           $(document).on('mouseout touchleave', range_wrapper, function () {
               if (!range_mousedown) {
    
                   var thumb = $(this).children('.thumb');
                   var paddingLeft = parseInt($(this).css('padding-left'));
                   var marginLeft = (7 + paddingLeft) + 'px';
    
                   if (thumb.hasClass('active')) {
                       thumb.velocity({
                           height: '0',
                           width: '0',
                           top: '10px',
                           marginLeft: marginLeft
                       }, {
                           duration: 100
                       });
                   }
                   thumb.removeClass('active');
               }
           });
    
           /**************************
            * Auto complete plugin  *
            *************************/
           $.fn.autocomplete = function (options) {
               // Defaults
               var defaults = {
                   data: {},
                   limit: Infinity,
                   onAutocomplete: null,
                   minLength: 1
               };
    
               options = $.extend(defaults, options);
    
               return this.each(function () {
                   var $input = $(this);
                   var data = options.data,
                       count = 0,
                       activeIndex = -1,
                       oldVal,
                       $inputDiv = $input.closest('.input-field'); // Div to append on
    
                   // Check if data isn't empty
                   if (!$.isEmptyObject(data)) {
    
    var $autocomplete = $('');
                       var $oldAutocomplete;
    
                       // Append autocomplete element.
                       // Prevent double structure init.
                       if ($inputDiv.length) {
                           $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
                           if (!$oldAutocomplete.length) {
                               $inputDiv.append($autocomplete); // Set ul in body
                           }
                       } else {
                           $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
                           if (!$oldAutocomplete.length) {
                               $input.after($autocomplete);
                           }
                       }
                       if ($oldAutocomplete.length) {
                           $autocomplete = $oldAutocomplete;
                       }
    
                       // Highlight partial match.
                       var highlight = function (string, $el) {
                           var img = $el.find('img');
                           var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
                               matchEnd = matchStart + string.length - 1,
                               beforeMatch = $el.text().slice(0, matchStart),
                               matchText = $el.text().slice(matchStart, matchEnd + 1),
                               afterMatch = $el.text().slice(matchEnd + 1);
                           $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
                           if (img.length) {
                               $el.prepend(img);
                           }
                       };
    
                       // Reset current element position
                       var resetCurrentElement = function () {
                           activeIndex = -1;
                           $autocomplete.find('.active').removeClass('active');
                       }
    
                       // Remove autocomplete elements
                       var removeAutocomplete = function () {
                           $autocomplete.empty();
                           resetCurrentElement();
                           oldVal = undefined;
                       };
    
                       $input.off('blur.autocomplete').on('blur.autocomplete', function () {
                           removeAutocomplete();
                       });
    
                       // Perform search
                       $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
                           // Reset count.
                           count = 0;
                           var val = $input.val().toLowerCase();
    
                           // Don't capture enter or arrow key usage.
                           if (e.which === 13 ||
                               e.which === 38 ||
                               e.which === 40) {
                               return;
                           }
    


                           // Check if the input isn't empty
                           if (oldVal !== val) {
                               removeAutocomplete();
    
                               if (val.length >= options.minLength) {
                                   for (var key in data) {
                                       if (data.hasOwnProperty(key) &&
                                           key.toLowerCase().indexOf(val) !== -1 &&
                                           key.toLowerCase() !== val) {
                                           // Break if past limit
                                           if (count >= options.limit) {
                                               break;
                                           }
    
    var autocompleteOption = $('
  • ');
                                           if (!!data[key]) {
                                               autocompleteOption.append('<img src="' + data[key] + '" class="right circle">' + key + '');
                                           } else {
                                               autocompleteOption.append('' + key + '');
                                           }
    
                                           $autocomplete.append(autocompleteOption);
                                           highlight(val, autocompleteOption);
                                           count++;
                                       }
                                   }
                               }
                           }
    
                           // Update oldVal
                           oldVal = val;
                       });
    
                       $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
                           // Arrow keys and enter key usage
                           var keyCode = e.which,
                               liElement,
                               numItems = $autocomplete.children('li').length,
                               $active = $autocomplete.children('.active').first();
    
                           // select element on Enter
                           if (keyCode === 13 && activeIndex >= 0) {
                               liElement = $autocomplete.children('li').eq(activeIndex);
                               if (liElement.length) {
                                   liElement.trigger('mousedown.autocomplete');
                                   e.preventDefault();
                               }
                               return;
                           }
    
                           // Capture up and down key
                           if (keyCode === 38 || keyCode === 40) {
                               e.preventDefault();
    
                               if (keyCode === 38 &&
                                   activeIndex > 0) {
                                   activeIndex--;
                               }
    
                               if (keyCode === 40 &&
                                   activeIndex < (numItems - 1)) {
                                   activeIndex++;
                               }
    
                               $active.removeClass('active');
                               if (activeIndex >= 0) {
                                   $autocomplete.children('li').eq(activeIndex).addClass('active');
                               }
                           }
                       });
    
                       // Set input value
                       $autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
                           var text = $(this).text().trim();
                           $input.val(text);
                           $input.trigger('change');
                           removeAutocomplete();
    
                           // Handle onAutocomplete callback.
                           if (typeof (options.onAutocomplete) === "function") {
                               options.onAutocomplete.call(this, text);
                           }
                       });
                   }
               });
           };
    
       }); // End of $(document).ready
    
       /*******************
        *  Select Plugin  *
        ******************/
       $.fn.material_select = function (callback) {
           $(this).each(function () {
               var $select = $(this);
    
               if ($select.hasClass('browser-default')) {
                   return; // Continue to next (return false breaks out of entire loop)
               }
    
               var multiple = $select.attr('multiple') ? true : false,
                   lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
    
               if (lastID) {
                   $select.parent().find('span.caret').remove();
                   $select.parent().find('input').remove();
    
                   $select.unwrap();
                   $('ul#select-options-' + lastID).remove();
               }
    
               // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
               if (callback === 'destroy') {
                   $select.data('select-id', null).removeClass('initialized');
                   return;
               }
    
               var uniqueID = Materialize.guid();
               $select.data('select-id', uniqueID);
    
    var wrapper = $('
    ');
               wrapper.addClass($select.attr('class'));
    
    var options = $(''),
                   selectChildren = $select.children('option, optgroup'),
                   valuesSelected = [],
                   optionsHover = false;
    
               var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
    
               // Function that renders and appends the option taking into
               // account type and possible image icon.
               var appendOptionWithIcon = function (select, option, type) {
                   // Add disabled attr if disabled
                   var disabledClass = (option.is(':disabled')) ? 'disabled ' : ;
                   var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ;
                   var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ;
    
                   // add icons
                   var icon_url = option.data('icon');
                   var classes = option.attr('class');
                   if (!!icon_url) {
                       var classString = ;
                       if (!!classes) classString = ' class="' + classes + '"';
    
                       // Check for multiple type.
    
    options.append($('
  • <img alt="" src="' + icon_url + '"' + classString + '>' + multipleCheckbox + option.html() + '
  • '));
                       return true;
                   }
    
                   // Check for multiple type.
    
    options.append($('
  • ' + multipleCheckbox + option.html() + '
  • '));
               };
    
               /* Create dropdown structure. */
               if (selectChildren.length) {
                   selectChildren.each(function () {
                       if ($(this).is('option')) {
                           // Direct descendant option.
                           if (multiple) {
                               appendOptionWithIcon($select, $(this), 'multiple');
    
                           } else {
                               appendOptionWithIcon($select, $(this));
                           }
                       } else if ($(this).is('optgroup')) {
                           // Optgroup.
                           var selectOptions = $(this).children('option');
    
    options.append($('
  • ' + $(this).attr('label') + '
  • '));
                           selectOptions.each(function () {
                               appendOptionWithIcon($select, $(this), 'optgroup-option');
                           });
                       }
                   });
               }
    
               options.find('li:not(.optgroup)').each(function (i) {
                   $(this).click(function (e) {
                       // Check if option element is disabled
                       if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
                           var selected = true;
    
                           if (multiple) {
                               $('input[type="checkbox"]', this).prop('checked', function (i, v) {
                                   return !v;
                               });
                               selected = toggleEntryFromArray(valuesSelected, i, $select);
                               $newSelect.trigger('focus');
                           } else {
                               options.find('li').removeClass('active');
                               $(this).toggleClass('active');
                               $newSelect.val($(this).text());
                           }
    
                           activateOption(options, $(this));
                           $select.find('option').eq(i).prop('selected', selected);
                           // Trigger onchange() event
                           $select.trigger('change');
                           if (typeof callback !== 'undefined') callback();
                       }
    
                       e.stopPropagation();
                   });
               });
    
               // Wrap Elements
               $select.wrap(wrapper);
               // Add Select Display Element
               var dropdownIcon = $('');
               if ($select.is(':disabled'))
                   dropdownIcon.addClass('disabled');
    
               // escape double quotes
               var sanitizedLabelHtml = label.replace(/"/g, '"');
    
               var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : ) + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
               $select.before($newSelect);
               $newSelect.before(dropdownIcon);
    
               $newSelect.after(options);
               // Check if section element is disabled
               if (!$select.is(':disabled')) {
                   $newSelect.dropdown({
                       'hover': false
                   });
               }
    
               // Copy tabindex
               if ($select.attr('tabindex')) {
                   $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
               }
    
               $select.addClass('initialized');
    
               $newSelect.on({
                   'focus': function () {
                       if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
                           $('input.select-dropdown').trigger('close');
                       }
                       if (!options.is(':visible')) {
                           $(this).trigger('open', ['focus']);
                           var label = $(this).val();
                           if (multiple && label.indexOf(',') >= 0) {
                               label = label.split(',')[0];
                           }
    
                           var selectedOption = options.find('li').filter(function () {
                               return $(this).text().toLowerCase() === label.toLowerCase();
                           })[0];
                           activateOption(options, selectedOption, true);
                       }
                   },
                   'click': function (e) {
                       e.stopPropagation();
                   }
               });
    
               $newSelect.on('blur', function () {
                   if (!multiple) {
                       $(this).trigger('close');
                   }
                   options.find('li.selected').removeClass('selected');
               });
    
               options.hover(function () {
                   optionsHover = true;
               }, function () {
                   optionsHover = false;
               });
    
               $(window).on({
                   'click': function () {
                       multiple && (optionsHover || $newSelect.trigger('close'));
                   }
               });
    
               // Add initial multiple selections.
               if (multiple) {
                   $select.find("option:selected:not(:disabled)").each(function () {
                       var index = $(this).index();
    
                       toggleEntryFromArray(valuesSelected, index, $select);
                       options.find("li").eq(index).find(":checkbox").prop("checked", true);
                   });
               }
    
               /**
                * Make option as selected and scroll to selected position
                * @param {jQuery} collection  Select options jQuery element
                * @param {Element} newOption  element of the new option
                * @param {Boolean} firstActivation  If on first activation of select
                */
               var activateOption = function (collection, newOption, firstActivation) {
                   if (newOption) {
                       collection.find('li.selected').removeClass('selected');
                       var option = $(newOption);
                       option.addClass('selected');
                       if (!multiple || !!firstActivation) {
                           options.scrollTo(option);
                       }
                   }
               };
    
               // Allow user to search by typing
               // this array is cleared after 1 second
               var filterQuery = [],
                   onKeyDown = function (e) {
                       // TAB - switch to another input
                       if (e.which == 9) {
                           $newSelect.trigger('close');
                           return;
                       }
    
                       // ARROW DOWN WHEN SELECT IS CLOSED - open select options
                       if (e.which == 40 && !options.is(':visible')) {
                           $newSelect.trigger('open');
                           return;
                       }
    
                       // ENTER WHEN SELECT IS CLOSED - submit form
                       if (e.which == 13 && !options.is(':visible')) {
                           return;
                       }
    
                       e.preventDefault();
    
                       // CASE WHEN USER TYPE LETTERS
                       var letter = String.fromCharCode(e.which).toLowerCase(),
                           nonLetters = [9, 13, 27, 38, 40];
                       if (letter && (nonLetters.indexOf(e.which) === -1)) {
                           filterQuery.push(letter);
    
                           var string = filterQuery.join(),
                               newOption = options.find('li').filter(function () {
                                   return $(this).text().toLowerCase().indexOf(string) === 0;
                               })[0];
    
                           if (newOption) {
                               activateOption(options, newOption);
                           }
                       }
    
                       // ENTER - select option and close when select options are opened
                       if (e.which == 13) {
                           var activeOption = options.find('li.selected:not(.disabled)')[0];
                           if (activeOption) {
                               $(activeOption).trigger('click');
                               if (!multiple) {
                                   $newSelect.trigger('close');
                               }
                           }
                       }
    
                       // ARROW DOWN - move to next not disabled option
                       if (e.which == 40) {
                           if (options.find('li.selected').length) {
                               newOption = options.find('li.selected').next('li:not(.disabled)')[0];
                           } else {
                               newOption = options.find('li:not(.disabled)')[0];
                           }
                           activateOption(options, newOption);
                       }
    
                       // ESC - close options
                       if (e.which == 27) {
                           $newSelect.trigger('close');
                       }
    
                       // ARROW UP - move to previous not disabled option
                       if (e.which == 38) {
                           newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
                           if (newOption)
                               activateOption(options, newOption);
                       }
    
                       // Automaticaly clean filter query so user can search again by starting letters
                       setTimeout(function () {
                           filterQuery = [];
                       }, 1000);
                   };
    
               $newSelect.on('keydown', onKeyDown);
           });
    
           function toggleEntryFromArray(entriesArray, entryIndex, select) {
               var index = entriesArray.indexOf(entryIndex),
                   notAdded = index === -1;
    
               if (notAdded) {
                   entriesArray.push(entryIndex);
               } else {
                   entriesArray.splice(index, 1);
               }
    
               select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
    
               // use notAdded instead of true (to detect if the option is selected or not)
               select.find('option').eq(entryIndex).prop('selected', notAdded);
               setValueToInput(entriesArray, select);
    
               return notAdded;
           }
    
           function setValueToInput(entriesArray, select) {
               var value = ;
    
               for (var i = 0, count = entriesArray.length; i < count; i++) {
                   var text = select.find('option').eq(entriesArray[i]).text();
    
                   i === 0 ? value += text : value += ', ' + text;
               }
    
               if (value === ) {
                   value = select.find('option:disabled').eq(0).text();
               }
    
               select.siblings('input.select-dropdown').val(value);
           }
       };
    

    }(jQuery));; (function ($) {

       var methods = {
    
           init: function (options) {
               var defaults = {
                   indicators: true,
                   height: 400,
                   transition: 500,
                   interval: 6000
               };
               options = $.extend(defaults, options);
    
               return this.each(function () {
    
                   // For each slider, we want to keep track of
                   // which slide is active and its associated content
                   var $this = $(this);
                   var $slider = $this.find('ul.slides').first();
                   var $slides = $slider.find('> li');
                   var $active_index = $slider.find('.active').index();
                   var $active, $indicators, $interval;
                   if ($active_index != -1) {
                       $active = $slides.eq($active_index);
                   }
    
                   // Transitions the caption depending on alignment
                   function captionTransition(caption, duration) {
                       if (caption.hasClass("center-align")) {
                           caption.velocity({
                               opacity: 0,
                               translateY: -100
                           }, {
                               duration: duration,
                               queue: false
                           });
                       } else if (caption.hasClass("right-align")) {
                           caption.velocity({
                               opacity: 0,
                               translateX: 100
                           }, {
                               duration: duration,
                               queue: false
                           });
                       } else if (caption.hasClass("left-align")) {
                           caption.velocity({
                               opacity: 0,
                               translateX: -100
                           }, {
                               duration: duration,
                               queue: false
                           });
                       }
                   }
    
                   // This function will transition the slide to any index of the next slide
                   function moveToSlide(index) {
                       // Wrap around indices.
                       if (index >= $slides.length) index = 0;
                       else if (index < 0) index = $slides.length - 1;
    
                       $active_index = $slider.find('.active').index();
    
                       // Only do if index changes
                       if ($active_index != index) {
                           $active = $slides.eq($active_index);
                           $caption = $active.find('.caption');
    
                           $active.removeClass('active');
                           $active.velocity({
                               opacity: 0
                           }, {
                               duration: options.transition,
                               queue: false,
                               easing: 'easeOutQuad',
                               complete: function () {
                                   $slides.not('.active').velocity({
                                       opacity: 0,
                                       translateX: 0,
                                       translateY: 0
                                   }, {
                                       duration: 0,
                                       queue: false
                                   });
                               }
                           });
                           captionTransition($caption, options.transition);
    


                           // Update indicators
                           if (options.indicators) {
                               $indicators.eq($active_index).removeClass('active');
                           }
    
                           $slides.eq(index).velocity({
                               opacity: 1
                           }, {
                               duration: options.transition,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                           $slides.eq(index).find('.caption').velocity({
                               opacity: 1,
                               translateX: 0,
                               translateY: 0
                           }, {
                               duration: options.transition,
                               delay: options.transition,
                               queue: false,
                               easing: 'easeOutQuad'
                           });
                           $slides.eq(index).addClass('active');
    


                           // Update indicators
                           if (options.indicators) {
                               $indicators.eq(index).addClass('active');
                           }
                       }
                   }
    
                   // Set height of slider
                   // If fullscreen, do nothing
                   if (!$this.hasClass('fullscreen')) {
                       if (options.indicators) {
                           // Add height if indicators are present
                           $this.height(options.height + 40);
                       } else {
                           $this.height(options.height);
                       }
                       $slider.height(options.height);
                   }
    


                   // Set initial positions of captions
                   $slides.find('.caption').each(function () {
                       captionTransition($(this), 0);
                   });
    
                   // Move img src into background-image
                   $slides.find('img').each(function () {
                       var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
                       if ($(this).attr('src') !== placeholderBase64) {
                           $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
                           $(this).attr('src', placeholderBase64);
                       }
                   });
    
                   // dynamically add indicators
                   if (options.indicators) {
    
    $indicators = $('
      ');
                         $slides.each(function (index) {
      
      var $indicator = $('
    • ');
                             // Handle clicks on indicators
                             $indicator.click(function () {
                                 var $parent = $slider.parent();
                                 var curr_index = $parent.find($(this)).index();
                                 moveToSlide(curr_index);
      
                                 // reset interval
                                 clearInterval($interval);
                                 $interval = setInterval(
                                     function () {
                                         $active_index = $slider.find('.active').index();
                                         if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                                         else $active_index += 1;
      
                                         moveToSlide($active_index);
      
                                     }, options.transition + options.interval
                                 );
                             });
                             $indicators.append($indicator);
                         });
                         $this.append($indicators);
                         $indicators = $this.find('ul.indicators').find('li.indicator-item');
                     }
      
                     if ($active) {
                         $active.show();
                     } else {
                         $slides.first().addClass('active').velocity({
                             opacity: 1
                         }, {
                             duration: options.transition,
                             queue: false,
                             easing: 'easeOutQuad'
                         });
      
                         $active_index = 0;
                         $active = $slides.eq($active_index);
      
                         // Update indicators
                         if (options.indicators) {
                             $indicators.eq($active_index).addClass('active');
                         }
                     }
      
                     // Adjust height to current slide
                     $active.find('img').each(function () {
                         $active.find('.caption').velocity({
                             opacity: 1,
                             translateX: 0,
                             translateY: 0
                         }, {
                             duration: options.transition,
                             queue: false,
                             easing: 'easeOutQuad'
                         });
                     });
      
                     // auto scroll
                     $interval = setInterval(
                         function () {
                             $active_index = $slider.find('.active').index();
                             moveToSlide($active_index + 1);
      
                         }, options.transition + options.interval
                     );
      


                     // HammerJS, Swipe navigation
      
                     // Touch Event
                     var panning = false;
                     var swipeLeft = false;
                     var swipeRight = false;
      
                     $this.hammer({
                         prevent_default: false
                     }).on('pan', function (e) {
                         if (e.gesture.pointerType === "touch") {
      
                             // reset interval
                             clearInterval($interval);
      
                             var direction = e.gesture.direction;
                             var x = e.gesture.deltaX;
                             var velocityX = e.gesture.velocityX;
                             var velocityY = e.gesture.velocityY;
      
                             $curr_slide = $slider.find('.active');
                             if (Math.abs(velocityX) > Math.abs(velocityY)) {
                                 $curr_slide.velocity({
                                     translateX: x
                                 }, {
                                     duration: 50,
                                     queue: false,
                                     easing: 'easeOutQuad'
                                 });
                             }
      
                             // Swipe Left
                             if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
                                 swipeRight = true;
                             }
                             // Swipe Right
                             else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
                                 swipeLeft = true;
                             }
      
                             // Make Slide Behind active slide visible
                             var next_slide;
                             if (swipeLeft) {
                                 next_slide = $curr_slide.next();
                                 if (next_slide.length === 0) {
                                     next_slide = $slides.first();
                                 }
                                 next_slide.velocity({
                                     opacity: 1
                                 }, {
                                     duration: 300,
                                     queue: false,
                                     easing: 'easeOutQuad'
                                 });
                             }
                             if (swipeRight) {
                                 next_slide = $curr_slide.prev();
                                 if (next_slide.length === 0) {
                                     next_slide = $slides.last();
                                 }
                                 next_slide.velocity({
                                     opacity: 1
                                 }, {
                                     duration: 300,
                                     queue: false,
                                     easing: 'easeOutQuad'
                                 });
                             }
      


                         }
      
                     }).on('panend', function (e) {
                         if (e.gesture.pointerType === "touch") {
      
                             $curr_slide = $slider.find('.active');
                             panning = false;
                             curr_index = $slider.find('.active').index();
      
                             if (!swipeRight && !swipeLeft || $slides.length <= 1) {
                                 // Return to original spot
                                 $curr_slide.velocity({
                                     translateX: 0
                                 }, {
                                     duration: 300,
                                     queue: false,
                                     easing: 'easeOutQuad'
                                 });
                             } else if (swipeLeft) {
                                 moveToSlide(curr_index + 1);
                                 $curr_slide.velocity({
                                     translateX: -1 * $this.innerWidth()
                                 }, {
                                     duration: 300,
                                     queue: false,
                                     easing: 'easeOutQuad',
                                     complete: function () {
                                         $curr_slide.velocity({
                                             opacity: 0,
                                             translateX: 0
                                         }, {
                                             duration: 0,
                                             queue: false
                                         });
                                     }
                                 });
                             } else if (swipeRight) {
                                 moveToSlide(curr_index - 1);
                                 $curr_slide.velocity({
                                     translateX: $this.innerWidth()
                                 }, {
                                     duration: 300,
                                     queue: false,
                                     easing: 'easeOutQuad',
                                     complete: function () {
                                         $curr_slide.velocity({
                                             opacity: 0,
                                             translateX: 0
                                         }, {
                                             duration: 0,
                                             queue: false
                                         });
                                     }
                                 });
                             }
                             swipeLeft = false;
                             swipeRight = false;
      
                             // Restart interval
                             clearInterval($interval);
                             $interval = setInterval(
                                 function () {
                                     $active_index = $slider.find('.active').index();
                                     if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                                     else $active_index += 1;
      
                                     moveToSlide($active_index);
      
                                 }, options.transition + options.interval
                             );
                         }
                     });
      
                     $this.on('sliderPause', function () {
                         clearInterval($interval);
                     });
      
                     $this.on('sliderStart', function () {
                         clearInterval($interval);
                         $interval = setInterval(
                             function () {
                                 $active_index = $slider.find('.active').index();
                                 if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
                                 else $active_index += 1;
      
                                 moveToSlide($active_index);
      
                             }, options.transition + options.interval
                         );
                     });
      
                     $this.on('sliderNext', function () {
                         $active_index = $slider.find('.active').index();
                         moveToSlide($active_index + 1);
                     });
      
                     $this.on('sliderPrev', function () {
                         $active_index = $slider.find('.active').index();
                         moveToSlide($active_index - 1);
                     });
      
                 });
      


             },
             pause: function () {
                 $(this).trigger('sliderPause');
             },
             start: function () {
                 $(this).trigger('sliderStart');
             },
             next: function () {
                 $(this).trigger('sliderNext');
             },
             prev: function () {
                 $(this).trigger('sliderPrev');
             }
         };
      


         $.fn.slider = function (methodOrOptions) {
             if (methods[methodOrOptions]) {
                 return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
             } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
                 // Default to "init"
                 return methods.init.apply(this, arguments);
             } else {
                 $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
             }
         }; // Plugin end
      

      }(jQuery));; (function ($) {

         $(document).ready(function () {
      
             $(document).on('click.card', '.card', function (e) {
                 if ($(this).find('> .card-reveal').length) {
                     var $card = $(e.target).closest('.card');
                     if ($card.data('initialOverflow') === undefined) {
                         $card.data(
                             'initialOverflow',
                             $card.css('overflow') === undefined ?  : $card.css('overflow')
                         );
                     }
                     if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
                         // Make Reveal animate down and display none
                         $(this).find('.card-reveal').velocity({
                             translateY: 0
                         }, {
                             duration: 225,
                             queue: false,
                             easing: 'easeInOutQuad',
                             complete: function () {
                                 $(this).css({
                                     display: 'none'
                                 });
                                 $card.css('overflow', $card.data('initialOverflow'));
                             }
                         });
                     } else if ($(e.target).is($('.card .activator')) ||
                         $(e.target).is($('.card .activator i'))) {
                         $card.css('overflow', 'hidden');
                         $(this).find('.card-reveal').css({
                             display: 'block'
                         }).velocity("stop", false).velocity({
                             translateY: '-100%'
                         }, {
                             duration: 300,
                             queue: false,
                             easing: 'easeInOutQuad'
                         });
                     }
                 }
             });
      
         });
      

      }(jQuery));; (function ($) {

         var materialChipsDefaults = {
             data: [],
             placeholder: ,
             secondaryPlaceholder: ,
             autocompleteOptions: {},
         };
      
         $(document).ready(function () {
             // Handle removal of static chips.
             $(document).on('click', '.chip .close', function (e) {
                 var $chips = $(this).closest('.chips');
                 if ($chips.attr('data-initialized')) {
                     return;
                 }
                 $(this).closest('.chip').remove();
             });
         });
      
         $.fn.material_chip = function (options) {
             var self = this;
             this.$el = $(this);
             this.$document = $(document);
             this.SELS = {
                 CHIPS: '.chips',
                 CHIP: '.chip',
                 INPUT: 'input',
                 DELETE: '.material-icons',
                 SELECTED_CHIP: '.selected',
             };
      
             if ('data' === options) {
                 return this.$el.data('chips');
             }
      
             var curr_options = $.extend({}, materialChipsDefaults, options);
             self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
      
             // Initialize
             this.init = function () {
                 var i = 0;
                 var chips;
                 self.$el.each(function () {
                     var $chips = $(this);
                     var chipId = Materialize.guid();
                     self.chipId = chipId;
      
                     if (!curr_options.data || !(curr_options.data instanceof Array)) {
                         curr_options.data = [];
                     }
                     $chips.data('chips', curr_options.data);
                     $chips.attr('data-index', i);
                     $chips.attr('data-initialized', true);
      
                     if (!$chips.hasClass(self.SELS.CHIPS)) {
                         $chips.addClass('chips');
                     }
      
                     self.chips($chips, chipId);
                     i++;
                 });
             };
      
             this.handleEvents = function () {
                 var SELS = self.SELS;
      
                 self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
                     $(e.target).find(SELS.INPUT).focus();
                 });
      
                 self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
                     var $chip = $(e.target);
                     if ($chip.length) {
                         var wasSelected = $chip.hasClass('selected');
                         var $chips = $chip.closest(SELS.CHIPS);
                         $(SELS.CHIP).removeClass('selected');
      
                         if (!wasSelected) {
                             self.selectChip($chip.index(), $chips);
                         }
                     }
                 });
      
                 self.$document.off('keydown.chips').on('keydown.chips', function (e) {
                     if ($(e.target).is('input, textarea')) {
                         return;
                     }
      
                     // delete
                     var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
                     var $chips = $chip.closest(SELS.CHIPS);
                     var length = $chip.siblings(SELS.CHIP).length;
                     var index;
      
                     if (!$chip.length) {
                         return;
                     }
      
                     if (e.which === 8 || e.which === 46) {
                         e.preventDefault();
      
                         index = $chip.index();
                         self.deleteChip(index, $chips);
      
                         var selectIndex = null;
                         if ((index + 1) < length) {
                             selectIndex = index;
                         } else if (index === length || (index + 1) === length) {
                             selectIndex = length - 1;
                         }
      
                         if (selectIndex < 0) selectIndex = null;
      
                         if (null !== selectIndex) {
                             self.selectChip(selectIndex, $chips);
                         }
                         if (!length) $chips.find('input').focus();
      
                         // left
                     } else if (e.which === 37) {
                         index = $chip.index() - 1;
                         if (index < 0) {
                             return;
                         }
                         $(SELS.CHIP).removeClass('selected');
                         self.selectChip(index, $chips);
      
                         // right
                     } else if (e.which === 39) {
                         index = $chip.index() + 1;
                         $(SELS.CHIP).removeClass('selected');
                         if (index > length) {
                             $chips.find('input').focus();
                             return;
                         }
                         self.selectChip(index, $chips);
                     }
                 });
      
                 self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
                     var $currChips = $(e.target).closest(SELS.CHIPS);
                     $currChips.addClass('focus');
                     $currChips.siblings('label, .prefix').addClass('active');
                     $(SELS.CHIP).removeClass('selected');
                 });
      
                 self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
                     var $currChips = $(e.target).closest(SELS.CHIPS);
                     $currChips.removeClass('focus');
      
                     // Remove active if empty
                     if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
                         $currChips.siblings('label').removeClass('active');
                     }
                     $currChips.siblings('.prefix').removeClass('active');
                 });
      
                 self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
                     var $target = $(e.target);
                     var $chips = $target.closest(SELS.CHIPS);
                     var chipsLength = $chips.children(SELS.CHIP).length;
      
                     // enter
                     if (13 === e.which) {
                         // Override enter if autocompleting.
                         if (self.hasAutocomplete &&
                             $chips.find('.autocomplete-content.dropdown-content').length &&
                             $chips.find('.autocomplete-content.dropdown-content').children().length) {
                             return;
                         }
      
                         e.preventDefault();
                         self.addChip({
                             tag: $target.val()
                         }, $chips);
                         $target.val();
                         return;
                     }
      
                     // delete or left
                     if ((8 === e.keyCode || 37 === e.keyCode) &&  === $target.val() && chipsLength) {
                         e.preventDefault();
                         self.selectChip(chipsLength - 1, $chips);
                         $target.blur();
                         return;
                     }
                 });
      
                 // Click on delete icon in chip.
                 self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
                     var $target = $(e.target);
                     var $chips = $target.closest(SELS.CHIPS);
                     var $chip = $target.closest(SELS.CHIP);
                     e.stopPropagation();
                     self.deleteChip($chip.index(), $chips);
                     $chips.find('input').focus();
                 });
             };
      
             this.chips = function ($chips, chipId) {
                 $chips.empty();
                 $chips.data('chips').forEach(function (elem) {
                     $chips.append(self.renderChip(elem));
                 });
                 $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
                 self.setPlaceholder($chips);
      
                 // Set for attribute for label
                 var label = $chips.next('label');
                 if (label.length) {
                     label.attr('for', chipId);
      
                     if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
                         label.addClass('active');
                     }
                 }
      
                 // Setup autocomplete if needed.
                 var input = $('#' + chipId);
                 if (self.hasAutocomplete) {
                     curr_options.autocompleteOptions.onAutocomplete = function (val) {
                         self.addChip({
                             tag: val
                         }, $chips);
                         input.val();
                         input.focus();
                     }
                     input.autocomplete(curr_options.autocompleteOptions);
                 }
             };
      
             /**
              * Render chip jQuery element.
              * @param {Object} elem
              * @return {jQuery}
              */
             this.renderChip = function (elem) {
                 if (!elem.tag) return;
      
      var $renderedChip = $('
      ');
                 $renderedChip.text(elem.tag);
                 if (elem.image) {
                     $renderedChip.prepend($('<img />').attr('src', elem.image))
                 }
                 $renderedChip.append($('<i class="material-icons close">close'));
                 return $renderedChip;
             };
      
             this.setPlaceholder = function ($chips) {
                 if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) {
                     $chips.find('input').prop('placeholder', curr_options.placeholder);
      
                 } else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
                     $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
                 }
             };
      
             this.isValid = function ($chips, elem) {
                 var chips = $chips.data('chips');
                 var exists = false;
                 for (var i = 0; i < chips.length; i++) {
                     if (chips[i].tag === elem.tag) {
                         exists = true;
                         return;
                     }
                 }
                 return  !== elem.tag && !exists;
             };
      
             this.addChip = function (elem, $chips) {
                 if (!self.isValid($chips, elem)) {
                     return;
                 }
                 var $renderedChip = self.renderChip(elem);
                 var newData = [];
                 var oldData = $chips.data('chips');
                 for (var i = 0; i < oldData.length; i++) {
                     newData.push(oldData[i]);
                 }
                 newData.push(elem);
      
                 $chips.data('chips', newData);
                 $renderedChip.insertBefore($chips.find('input'));
                 $chips.trigger('chip.add', elem);
                 self.setPlaceholder($chips);
             };
      
             this.deleteChip = function (chipIndex, $chips) {
                 var chip = $chips.data('chips')[chipIndex];
                 $chips.find('.chip').eq(chipIndex).remove();
      
                 var newData = [];
                 var oldData = $chips.data('chips');
                 for (var i = 0; i < oldData.length; i++) {
                     if (i !== chipIndex) {
                         newData.push(oldData[i]);
                     }
                 }
      
                 $chips.data('chips', newData);
                 $chips.trigger('chip.delete', chip);
                 self.setPlaceholder($chips);
             };
      
             this.selectChip = function (chipIndex, $chips) {
                 var $chip = $chips.find('.chip').eq(chipIndex);
                 if ($chip && false === $chip.hasClass('selected')) {
                     $chip.addClass('selected');
                     $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
                 }
             };
      
             this.getChipsElement = function (index, $chips) {
                 return $chips.eq(index);
             };
      
             // init
             this.init();
      
             this.handleEvents();
         };
      

      }(jQuery));; (function ($) {

         $.fn.pushpin = function (options) {
             // Defaults
             var defaults = {
                 top: 0,
                 bottom: Infinity,
                 offset: 0
             };
      
             // Remove pushpin event and classes
             if (options === "remove") {
                 this.each(function () {
                     if (id = $(this).data('pushpin-id')) {
                         $(window).off('scroll.' + id);
                         $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
                     }
                 });
                 return false;
             }
      
             options = $.extend(defaults, options);
      


             $index = 0;
             return this.each(function () {
                 var $uniqueId = Materialize.guid(),
                     $this = $(this),
                     $original_offset = $(this).offset().top;
      
                 function removePinClasses(object) {
                     object.removeClass('pin-top');
                     object.removeClass('pinned');
                     object.removeClass('pin-bottom');
                 }
      
                 function updateElements(objects, scrolled) {
                     objects.each(function () {
                         // Add position fixed (because its between top and bottom)
                         if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
                             removePinClasses($(this));
                             $(this).css('top', options.offset);
                             $(this).addClass('pinned');
                         }
      
                         // Add pin-top (when scrolled position is above top)
                         if (scrolled < options.top && !$(this).hasClass('pin-top')) {
                             removePinClasses($(this));
                             $(this).css('top', 0);
                             $(this).addClass('pin-top');
                         }
      
                         // Add pin-bottom (when scrolled position is below bottom)
                         if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
                             removePinClasses($(this));
                             $(this).addClass('pin-bottom');
                             $(this).css('top', options.bottom - $original_offset);
                         }
                     });
                 }
      
                 $(this).data('pushpin-id', $uniqueId);
                 updateElements($this, $(window).scrollTop());
                 $(window).on('scroll.' + $uniqueId, function () {
                     var $scrolled = $(window).scrollTop() + options.offset;
                     updateElements($this, $scrolled);
                 });
      
             });
      
         };
      

      }(jQuery));; (function ($) {

         $(document).ready(function () {
      
             // jQuery reverse
             $.fn.reverse = [].reverse;
      
             // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
             $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
                 var $this = $(this);
                 openFABMenu($this);
             });
             $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
                 var $this = $(this);
                 closeFABMenu($this);
             });
      
             // Toggle-on-click behaviour.
             $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
                 var $this = $(this);
                 var $menu = $this.parent();
                 if ($menu.hasClass('active')) {
                     closeFABMenu($menu);
                 } else {
                     openFABMenu($menu);
                 }
             });
      
             // Toolbar transition behaviour.
             $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
                 var $this = $(this);
                 var $menu = $this.parent();
                 FABtoToolbar($menu);
             });
      
         });
      
         $.fn.extend({
             openFAB: function () {
                 openFABMenu($(this));
             },
             closeFAB: function () {
                 closeFABMenu($(this));
             },
             openToolbar: function () {
                 FABtoToolbar($(this));
             },
             closeToolbar: function () {
                 toolbarToFAB($(this));
             }
         });
      


         var openFABMenu = function (btn) {
             var $this = btn;
             if ($this.hasClass('active') === false) {
      
                 // Get direction option
                 var horizontal = $this.hasClass('horizontal');
                 var offsetY, offsetX;
      
                 if (horizontal === true) {
                     offsetX = 40;
                 } else {
                     offsetY = 40;
                 }
      
                 $this.addClass('active');
                 $this.find('ul .btn-floating').velocity({
                     scaleY: ".4",
                     scaleX: ".4",
                     translateY: offsetY + 'px',
                     translateX: offsetX + 'px'
                 }, {
                     duration: 0
                 });
      
                 var time = 0;
                 $this.find('ul .btn-floating').reverse().each(function () {
                     $(this).velocity({
                         opacity: "1",
                         scaleX: "1",
                         scaleY: "1",
                         translateY: "0",
                         translateX: '0'
                     }, {
                         duration: 80,
                         delay: time
                     });
                     time += 40;
                 });
             }
         };
      
         var closeFABMenu = function (btn) {
             var $this = btn;
             // Get direction option
             var horizontal = $this.hasClass('horizontal');
             var offsetY, offsetX;
      
             if (horizontal === true) {
                 offsetX = 40;
             } else {
                 offsetY = 40;
             }
      
             $this.removeClass('active');
             var time = 0;
             $this.find('ul .btn-floating').velocity("stop", true);
             $this.find('ul .btn-floating').velocity({
                 opacity: "0",
                 scaleX: ".4",
                 scaleY: ".4",
                 translateY: offsetY + 'px',
                 translateX: offsetX + 'px'
             }, {
                 duration: 80
             });
         };
      


         /**
          * Transform FAB into toolbar
          * @param  {Object}  object jQuery object
          */
         var FABtoToolbar = function (btn) {
             if (btn.attr('data-open') === "true") {
                 return;
             }
      
             var offsetX, offsetY, scaleFactor;
             var windowWidth = window.innerWidth;
             var windowHeight = window.innerHeight;
             var btnRect = btn[0].getBoundingClientRect();
             var anchor = btn.find('> a').first();
             var menu = btn.find('> ul').first();
      
      var backdrop = $('
      ');
             var fabColor = anchor.css('background-color');
             anchor.append(backdrop);
      
             offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
             offsetY = windowHeight - btnRect.bottom;
             scaleFactor = windowWidth / backdrop.width();
             btn.attr('data-origin-bottom', btnRect.bottom);
             btn.attr('data-origin-left', btnRect.left);
             btn.attr('data-origin-width', btnRect.width);
      
             // Set initial state
             btn.addClass('active');
             btn.attr('data-open', true);
             btn.css({
                 'text-align': 'center',
                 width: '100%',
                 bottom: 0,
                 left: 0,
                 transform: 'translateX(' + offsetX + 'px)',
                 transition: 'none'
             });
             anchor.css({
                 transform: 'translateY(' + -offsetY + 'px)',
                 transition: 'none'
             });
             backdrop.css({
                 'background-color': fabColor
             });
      


             setTimeout(function () {
                 btn.css({
                     transform: ,
                     transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
                 });
                 anchor.css({
                     overflow: 'visible',
                     transform: ,
                     transition: 'transform .2s'
                 });
      
                 setTimeout(function () {
                     btn.css({
                         overflow: 'hidden',
                         'background-color': fabColor
                     });
                     backdrop.css({
                         transform: 'scale(' + scaleFactor + ')',
                         transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
                     });
                     menu.find('> li > a').css({
                         opacity: 1
                     });
      
                     // Scroll to close.
                     $(window).on('scroll.fabToolbarClose', function () {
                         toolbarToFAB(btn);
                         $(window).off('scroll.fabToolbarClose');
                         $(document).off('click.fabToolbarClose');
                     });
      
                     $(document).on('click.fabToolbarClose', function (e) {
                         if (!$(e.target).closest(menu).length) {
                             toolbarToFAB(btn);
                             $(window).off('scroll.fabToolbarClose');
                             $(document).off('click.fabToolbarClose');
                         }
                     });
                 }, 100);
             }, 0);
         };
      
         /**
          * Transform toolbar back into FAB
          * @param  {Object}  object jQuery object
          */
         var toolbarToFAB = function (btn) {
             if (btn.attr('data-open') !== "true") {
                 return;
             }
      
             var offsetX, offsetY, scaleFactor;
             var windowWidth = window.innerWidth;
             var windowHeight = window.innerHeight;
             var btnWidth = btn.attr('data-origin-width');
             var btnBottom = btn.attr('data-origin-bottom');
             var btnLeft = btn.attr('data-origin-left');
             var anchor = btn.find('> .btn-floating').first();
             var menu = btn.find('> ul').first();
             var backdrop = btn.find('.fab-backdrop');
             var fabColor = anchor.css('background-color');
      
             offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
             offsetY = windowHeight - btnBottom;
             scaleFactor = windowWidth / backdrop.width();
      


             // Hide backdrop
             btn.removeClass('active');
             btn.attr('data-open', false);
             btn.css({
                 'background-color': 'transparent',
                 transition: 'none'
             });
             anchor.css({
                 transition: 'none'
             });
             backdrop.css({
                 transform: 'scale(0)',
                 'background-color': fabColor
             });
             menu.find('> li > a').css({
                 opacity: 
             });
      
             setTimeout(function () {
                 backdrop.remove();
      
                 // Set initial state.
                 btn.css({
                     'text-align': ,
                     width: ,
                     bottom: ,
                     left: ,
                     overflow: ,
                     'background-color': ,
                     transform: 'translate3d(' + -offsetX + 'px,0,0)'
                 });
                 anchor.css({
                     overflow: ,
                     transform: 'translate3d(0,' + offsetY + 'px,0)'
                 });
      
                 setTimeout(function () {
                     btn.css({
                         transform: 'translate3d(0,0,0)',
                         transition: 'transform .2s'
                     });
                     anchor.css({
                         transform: 'translate3d(0,0,0)',
                         transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
                     });
                 }, 20);
             }, 200);
         };
      


      }(jQuery));; (function ($) {

         // Image transition function
         Materialize.fadeInImage = function (selectorOrEl) {
             var element;
             if (typeof (selectorOrEl) === 'string') {
                 element = $(selectorOrEl);
             } else if (typeof (selectorOrEl) === 'object') {
                 element = selectorOrEl;
             } else {
                 return;
             }
             element.css({
                 opacity: 0
             });
             $(element).velocity({
                 opacity: 1
             }, {
                 duration: 650,
                 queue: false,
                 easing: 'easeOutSine'
             });
             $(element).velocity({
                 opacity: 1
             }, {
                 duration: 1300,
                 queue: false,
                 easing: 'swing',
                 step: function (now, fx) {
                     fx.start = 100;
                     var grayscale_setting = now / 100;
                     var brightness_setting = 150 - (100 - now) / 1.75;
      
                     if (brightness_setting < 100) {
                         brightness_setting = 100;
                     }
                     if (now >= 0) {
                         $(this).css({
                             "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
                             "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
                         });
                     }
                 }
             });
         };
      
         // Horizontal staggered list
         Materialize.showStaggeredList = function (selectorOrEl) {
             var element;
             if (typeof (selectorOrEl) === 'string') {
                 element = $(selectorOrEl);
             } else if (typeof (selectorOrEl) === 'object') {
                 element = selectorOrEl;
             } else {
                 return;
             }
             var time = 0;
             element.find('li').velocity({
                 translateX: "-100px"
             }, {
                 duration: 0
             });
      
             element.find('li').each(function () {
                 $(this).velocity({
                     opacity: "1",
                     translateX: "0"
                 }, {
                     duration: 800,
                     delay: time,
                     easing: [60, 10]
                 });
                 time += 120;
             });
         };
      


         $(document).ready(function () {
             // Hardcoded .staggered-list scrollFire
             // var staggeredListOptions = [];
             // $('ul.staggered-list').each(function (i) {
      
             //   var label = 'scrollFire-' + i;
             //   $(this).addClass(label);
             //   staggeredListOptions.push(
             //     {selector: 'ul.staggered-list.' + label,
             //      offset: 200,
             //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
             // });
             // scrollFire(staggeredListOptions);
      
             // HammerJS, Swipe navigation
      
             // Touch Event
             var swipeLeft = false;
             var swipeRight = false;
      


             // Dismissible Collections
             $('.dismissable').each(function () {
                 $(this).hammer({
                     prevent_default: false
                 }).on('pan', function (e) {
                     if (e.gesture.pointerType === "touch") {
                         var $this = $(this);
                         var direction = e.gesture.direction;
                         var x = e.gesture.deltaX;
                         var velocityX = e.gesture.velocityX;
      
                         $this.velocity({
                             translateX: x
                         }, {
                             duration: 50,
                             queue: false,
                             easing: 'easeOutQuad'
                         });
      
                         // Swipe Left
                         if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
                             swipeLeft = true;
                         }
      
                         // Swipe Right
                         if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
                             swipeRight = true;
                         }
                     }
                 }).on('panend', function (e) {
                     // Reset if collection is moved back into original position
                     if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
                         swipeRight = false;
                         swipeLeft = false;
                     }
      
                     if (e.gesture.pointerType === "touch") {
                         var $this = $(this);
                         if (swipeLeft || swipeRight) {
                             var fullWidth;
                             if (swipeLeft) {
                                 fullWidth = $this.innerWidth();
                             } else {
                                 fullWidth = -1 * $this.innerWidth();
                             }
      
                             $this.velocity({
                                 translateX: fullWidth,
                             }, {
                                 duration: 100,
                                 queue: false,
                                 easing: 'easeOutQuad',
                                 complete: function () {
                                     $this.css('border', 'none');
                                     $this.velocity({
                                         height: 0,
                                         padding: 0,
                                     }, {
                                         duration: 200,
                                         queue: false,
                                         easing: 'easeOutQuad',
                                         complete: function () {
                                             $this.remove();
                                         }
                                     });
                                 }
                             });
                         } else {
                             $this.velocity({
                                 translateX: 0,
                             }, {
                                 duration: 100,
                                 queue: false,
                                 easing: 'easeOutQuad'
                             });
                         }
                         swipeLeft = false;
                         swipeRight = false;
                     }
                 });
      
             });
      


             // time = 0
             // // Vertical Staggered list
             // $('ul.staggered-list.vertical li').velocity(
             //     { translateY: "100px"},
             //     { duration: 0 });
      
             // $('ul.staggered-list.vertical li').each(function() {
             //   $(this).velocity(
             //     { opacity: "1", translateY: "0"},
             //     { duration: 800, delay: time, easing: [60, 25] });
             //   time += 120;
             // });
      
             // // Fade in and Scale
             // $('.fade-in.scale').velocity(
             //     { scaleX: .4, scaleY: .4, translateX: -600},
             //     { duration: 0});
             // $('.fade-in').each(function() {
             //   $(this).velocity(
             //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
             //     { duration: 800, easing: [60, 10] });
             // });
         });
      

      }(jQuery));; (function ($) {

         var scrollFireEventsHandled = false;
      
         // Input: Array of JSON objects {selector, offset, callback}
         Materialize.scrollFire = function (options) {
             var onScroll = function () {
                 var windowScroll = window.pageYOffset + window.innerHeight;
      
                 for (var i = 0; i < options.length; i++) {
                     // Get options from each line
                     var value = options[i];
                     var selector = value.selector,
                         offset = value.offset,
                         callback = value.callback;
      
                     var currentElement = document.querySelector(selector);
                     if (currentElement !== null) {
                         var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
      
                         if (windowScroll > (elementOffset + offset)) {
                             if (value.done !== true) {
                                 if (typeof (callback) === 'function') {
                                     callback.call(this, currentElement);
                                 } else if (typeof (callback) === 'string') {
                                     var callbackFunc = new Function(callback);
                                     callbackFunc(currentElement);
                                 }
                                 value.done = true;
                             }
                         }
                     }
                 }
             };
      


             var throttledScroll = Materialize.throttle(function () {
                 onScroll();
             }, options.throttle || 100);
      
             if (!scrollFireEventsHandled) {
                 window.addEventListener("scroll", throttledScroll);
                 window.addEventListener("resize", throttledScroll);
                 scrollFireEventsHandled = true;
             }
      
             // perform a scan once, after current execution context, and after dom is ready
             setTimeout(throttledScroll, 0);
         };
      

      })(jQuery);; /*!

      * pickadate.js v3.5.0, 2014/04/13
      * By Amsul, http://amsul.ca
      * Hosted on http://amsul.github.io/pickadate.js
      * Licensed under MIT
      */
      

      (function (factory) {

         // AMD.
         if (typeof define == 'function' && define.amd)
             define('picker', ['jquery'], factory)
      
         // Node.js/browserify.
         else if (typeof exports == 'object')
             module.exports = factory(require('jquery'))
      
         // Browser globals.
         else this.Picker = factory(jQuery)
      

      }(function ($) {

         var $window = $(window)
         var $document = $(document)
         var $html = $(document.documentElement)
      


         /**
          * The picker constructor that creates a blank picker.
          */
         function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
      
             // If there’s no element, return the picker constructor.
             if (!ELEMENT) return PickerConstructor
      


             var
                 IS_DEFAULT_THEME = false,
      


                 // The state of the picker.
                 STATE = {
                     id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
                 },
      


                 // Merge the defaults and options passed.
                 SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
      


                 // Merge the default classes with the settings classes.
                 CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
      


                 // The element node wrapper into a jQuery object.
                 $ELEMENT = $(ELEMENT),
      


                 // Pseudo picker constructor.
                 PickerInstance = function () {
                     return this.start()
                 },
      


                 // The picker prototype.
                 P = PickerInstance.prototype = {
      
                     constructor: PickerInstance,
      
                     $node: $ELEMENT,
      


                     /**
                      * Initialize everything
                      */
                     start: function () {
      
                         // If it’s already started, do nothing.
                         if (STATE && STATE.start) return P
      


                         // Update the picker states.
                         STATE.methods = {}
                         STATE.start = true
                         STATE.open = false
                         STATE.type = ELEMENT.type
      


                         // Confirm focus state, convert into text input to remove UA stylings,
                         // and set as readonly to prevent keyboard popup.
                         ELEMENT.autofocus = ELEMENT == getActiveElement()
                         ELEMENT.readOnly = !SETTINGS.editable
                         ELEMENT.id = ELEMENT.id || STATE.id
                         if (ELEMENT.type != 'text') {
                             ELEMENT.type = 'text'
                         }
      


                         // Create a new picker component with the settings.
                         P.component = new COMPONENT(P, SETTINGS)
      


                         // Create the picker root with a holder and then prepare it.
                         P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'))
                         prepareElementRoot()
      


                         // If there’s a format for the hidden input element, create the element.
                         if (SETTINGS.formatSubmit) {
                             prepareElementHidden()
                         }
      


                         // Prepare the input element.
                         prepareElement()
      


                         // Insert the root as specified in the settings.
                         if (SETTINGS.container) $(SETTINGS.container).append(P.$root)
                         else $ELEMENT.after(P.$root)
      


                         // Bind the default component and settings events.
                         P.on({
                             start: P.component.onStart,
                             render: P.component.onRender,
                             stop: P.component.onStop,
                             open: P.component.onOpen,
                             close: P.component.onClose,
                             set: P.component.onSet
                         }).on({
                             start: SETTINGS.onStart,
                             render: SETTINGS.onRender,
                             stop: SETTINGS.onStop,
                             open: SETTINGS.onOpen,
                             close: SETTINGS.onClose,
                             set: SETTINGS.onSet
                         })
      


                         // Once we’re all set, check the theme in use.
                         IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0])
      


                         // If the element has autofocus, open the picker.
                         if (ELEMENT.autofocus) {
                             P.open()
                         }
      


                         // Trigger queued the “start” and “render” events.
                         return P.trigger('start').trigger('render')
                     }, //start
      


                     /**
                      * Render a new picker
                      */
                     render: function (entireComponent) {
      
                         // Insert a new component holder in the root or box.
                         if (entireComponent) P.$root.html(createWrappedComponent())
                         else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open))
      
                         // Trigger the queued “render” events.
                         return P.trigger('render')
                     }, //render
      


                     /**
                      * Destroy everything
                      */
                     stop: function () {
      
                         // If it’s already stopped, do nothing.
                         if (!STATE.start) return P
      
                         // Then close the picker.
                         P.close()
      
                         // Remove the hidden field.
                         if (P._hidden) {
                             P._hidden.parentNode.removeChild(P._hidden)
                         }
      
                         // Remove the root.
                         P.$root.remove()
      
                         // Remove the input class, remove the stored data, and unbind
                         // the events (after a tick for IE - see `P.close`).
                         $ELEMENT.removeClass(CLASSES.input).removeData(NAME)
                         setTimeout(function () {
                             $ELEMENT.off('.' + STATE.id)
                         }, 0)
      
                         // Restore the element state
                         ELEMENT.type = STATE.type
                         ELEMENT.readOnly = false
      
                         // Trigger the queued “stop” events.
                         P.trigger('stop')
      
                         // Reset the picker states.
                         STATE.methods = {}
                         STATE.start = false
      
                         return P
                     }, //stop
      


                     /**
                      * Open up the picker
                      */
                     open: function (dontGiveFocus) {
      
                         // If it’s already open, do nothing.
                         if (STATE.open) return P
      
                         // Add the “active” class.
                         $ELEMENT.addClass(CLASSES.active)
                         aria(ELEMENT, 'expanded', true)
      
                         // * A Firefox bug, when `html` has `overflow:hidden`, results in
                         //   killing transitions :(. So add the “opened” state on the next tick.
                         //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
                         setTimeout(function () {
      
                             // Add the “opened” class to the picker root.
                             P.$root.addClass(CLASSES.opened)
                             aria(P.$root[0], 'hidden', false)
      
                         }, 0)
      
                         // If we have to give focus, bind the element and doc events.
                         if (dontGiveFocus !== false) {
      
                             // Set it as open.
                             STATE.open = true
      
                             // Prevent the page from scrolling.
                             if (IS_DEFAULT_THEME) {
                                 $html.
                                 css('overflow', 'hidden').
                                 css('padding-right', '+=' + getScrollbarWidth())
                             }
      
                             // Pass focus to the root element’s jQuery object.
                             // * Workaround for iOS8 to bring the picker’s root into view.
                             P.$root.eq(0).focus()
      
                             // Bind the document events.
                             $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
      
                                 var target = event.target
      
                                 // If the target of the event is not the element, close the picker picker.
                                 // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
                                 //   Also, for Firefox, a click on an `option` element bubbles up directly
                                 //   to the doc. So make sure the target wasn't the doc.
                                 // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
                                 //   which causes the picker to unexpectedly close when right-clicking it. So make
                                 //   sure the event wasn’t a right-click.
                                 if (target != ELEMENT && target != document && event.which != 3) {
      
                                     // If the target was the holder that covers the screen,
                                     // keep the element focused to maintain tabindex.
                                     P.close(target === P.$root.children()[0])
                                 }
      
                             }).on('keydown.' + STATE.id, function (event) {
      
                                 var
                                 // Get the keycode.
                                     keycode = event.keyCode,
      
                                     // Translate that to a selection change.
                                     keycodeToMove = P.component.key[keycode],
      
                                     // Grab the target.
                                     target = event.target
      


                                 // On escape, close the picker and give focus.
                                 if (keycode == 27) {
                                     P.close(true)
                                 }
      


                                 // Check if there is a key movement or “enter” keypress on the element.
                                 else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
      
                                     // Prevent the default action to stop page movement.
                                     event.preventDefault()
      
                                     // Trigger the key movement action.
                                     if (keycodeToMove) {
                                         PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)])
                                     }
      
                                     // On “enter”, if the highlighted item isn’t disabled, set the value and close.
                                     else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
                                         P.set('select', P.component.item.highlight).close()
                                     }
                                 }
      


                                 // If the target is within the root and “enter” is pressed,
                                 // prevent the default action and trigger a click on the target instead.
                                 else if ($.contains(P.$root[0], target) && keycode == 13) {
                                     event.preventDefault()
                                     target.click()
                                 }
                             })
                         }
      
                         // Trigger the queued “open” events.
                         return P.trigger('open')
                     }, //open
      


                     /**
                      * Close the picker
                      */
                     close: function (giveFocus) {
      
                         // If we need to give focus, do it before changing states.
                         if (giveFocus) {
                             // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
                             // The focus is triggered *after* the close has completed - causing it
                             // to open again. So unbind and rebind the event at the next tick.
                             P.$root.off('focus.toOpen').eq(0).focus()
                             setTimeout(function () {
                                 P.$root.on('focus.toOpen', handleFocusToOpenEvent)
                             }, 0)
                         }
      
                         // Remove the “active” class.
                         $ELEMENT.removeClass(CLASSES.active)
                         aria(ELEMENT, 'expanded', false)
      
                         // * A Firefox bug, when `html` has `overflow:hidden`, results in
                         //   killing transitions :(. So remove the “opened” state on the next tick.
                         //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
                         setTimeout(function () {
      
                             // Remove the “opened” and “focused” class from the picker root.
                             P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused)
                             aria(P.$root[0], 'hidden', true)
      
                         }, 0)
      
                         // If it’s already closed, do nothing more.
                         if (!STATE.open) return P
      
                         // Set it as closed.
                         STATE.open = false
      
                         // Allow the page to scroll.
                         if (IS_DEFAULT_THEME) {
                             $html.
                             css('overflow', ).
                             css('padding-right', '-=' + getScrollbarWidth())
                         }
      
                         // Unbind the document events.
                         $document.off('.' + STATE.id)
      
                         // Trigger the queued “close” events.
                         return P.trigger('close')
                     }, //close
      


                     /**
                      * Clear the values
                      */
                     clear: function (options) {
                         return P.set('clear', null, options)
                     }, //clear
      


                     /**
                      * Set something
                      */
                     set: function (thing, value, options) {
      
                         var thingItem, thingValue,
                             thingIsObject = $.isPlainObject(thing),
                             thingObject = thingIsObject ? thing : {}
      
                         // Make sure we have usable options.
                         options = thingIsObject && $.isPlainObject(value) ? value : options || {}
      
                         if (thing) {
      
                             // If the thing isn’t an object, make it one.
                             if (!thingIsObject) {
                                 thingObject[thing] = value
                             }
      
                             // Go through the things of items to set.
                             for (thingItem in thingObject) {
      
                                 // Grab the value of the thing.
                                 thingValue = thingObject[thingItem]
      
                                 // First, if the item exists and there’s a value, set it.
                                 if (thingItem in P.component.item) {
                                     if (thingValue === undefined) thingValue = null
                                     P.component.set(thingItem, thingValue, options)
                                 }
      
                                 // Then, check to update the element value and broadcast a change.
                                 if (thingItem == 'select' || thingItem == 'clear') {
                                     $ELEMENT.
                                     val(thingItem == 'clear' ?  : P.get(thingItem, SETTINGS.format)).
                                     trigger('change')
                                 }
                             }
      
                             // Render a new picker.
                             P.render()
                         }
      
                         // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
                         return options.muted ? P : P.trigger('set', thingObject)
                     }, //set
      


                     /**
                      * Get something
                      */
                     get: function (thing, format) {
      
                         // Make sure there’s something to get.
                         thing = thing || 'value'
      
                         // If a picker state exists, return that.
                         if (STATE[thing] != null) {
                             return STATE[thing]
                         }
      
                         // Return the submission value, if that.
                         if (thing == 'valueSubmit') {
                             if (P._hidden) {
                                 return P._hidden.value
                             }
                             thing = 'value'
                         }
      
                         // Return the value, if that.
                         if (thing == 'value') {
                             return ELEMENT.value
                         }
      
                         // Check if a component item exists, return that.
                         if (thing in P.component.item) {
                             if (typeof format == 'string') {
                                 var thingValue = P.component.get(thing)
                                 return thingValue ?
                                     PickerConstructor._.trigger(
                                         P.component.formats.toString,
                                         P.component, [format, thingValue]
                                     ) : 
                             }
                             return P.component.get(thing)
                         }
                     }, //get
      


                     /**
                      * Bind events on the things.
                      */
                     on: function (thing, method, internal) {
      
                         var thingName, thingMethod,
                             thingIsObject = $.isPlainObject(thing),
                             thingObject = thingIsObject ? thing : {}
      
                         if (thing) {
      
                             // If the thing isn’t an object, make it one.
                             if (!thingIsObject) {
                                 thingObject[thing] = method
                             }
      
                             // Go through the things to bind to.
                             for (thingName in thingObject) {
      
                                 // Grab the method of the thing.
                                 thingMethod = thingObject[thingName]
      
                                 // If it was an internal binding, prefix it.
                                 if (internal) {
                                     thingName = '_' + thingName
                                 }
      
                                 // Make sure the thing methods collection exists.
                                 STATE.methods[thingName] = STATE.methods[thingName] || []
      
                                 // Add the method to the relative method collection.
                                 STATE.methods[thingName].push(thingMethod)
                             }
                         }
      
                         return P
                     }, //on
      


                     /**
                      * Unbind events on the things.
                      */
                     off: function () {
                         var i, thingName,
                             names = arguments;
                         for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
                             thingName = names[i]
                             if (thingName in STATE.methods) {
                                 delete STATE.methods[thingName]
                             }
                         }
                         return P
                     },
      


                     /**
                      * Fire off method events.
                      */
                     trigger: function (name, data) {
                             var _trigger = function (name) {
                                 var methodList = STATE.methods[name]
                                 if (methodList) {
                                     methodList.map(function (method) {
                                         PickerConstructor._.trigger(method, P, [data])
                                     })
                                 }
                             }
                             _trigger('_' + name)
                             _trigger(name)
                             return P
                         } //trigger
                 } //PickerInstance.prototype
      


             /**
              * Wrap the picker holder components together.
              */
             function createWrappedComponent() {
      
                 // Create a picker wrapper holder
                 return PickerConstructor._.node('div',
      
                         // Create a picker wrapper node
                         PickerConstructor._.node('div',
      
                             // Create a picker frame
                             PickerConstructor._.node('div',
      
                                 // Create a picker box node
                                 PickerConstructor._.node('div',
      
                                     // Create the components nodes.
                                     P.component.nodes(STATE.open),
      
                                     // The picker box class
                                     CLASSES.box
                                 ),
      
                                 // Picker wrap class
                                 CLASSES.wrap
                             ),
      
                             // Picker frame class
                             CLASSES.frame
                         ),
      
                         // Picker holder class
                         CLASSES.holder
                     ) //endreturn
             } //createWrappedComponent
      


             /**
              * Prepare the input element with all bindings.
              */
             function prepareElement() {
      
                 $ELEMENT.
      
                 // Store the picker data by component name.
                 data(NAME, P).
      
                 // Add the “input” class name.
                 addClass(CLASSES.input).
      
                 // Remove the tabindex.
                 attr('tabindex', -1).
      
                 // If there’s a `data-value`, update the value of the element.
                 val($ELEMENT.data('value') ?
                     P.get('select', SETTINGS.format) :
                     ELEMENT.value
                 )
      


                 // Only bind keydown events if the element isn’t editable.
                 if (!SETTINGS.editable) {
      
                     $ELEMENT.
      
                     // On focus/click, focus onto the root to open it up.
                     on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
                         event.preventDefault()
                         P.$root.eq(0).focus()
                     }).
      
                     // Handle keyboard event based on the picker being opened or not.
                     on('keydown.' + STATE.id, handleKeydownEvent)
                 }
      


                 // Update the aria attributes.
                 aria(ELEMENT, {
                     haspopup: true,
                     expanded: false,
                     readonly: false,
                     owns: ELEMENT.id + '_root'
                 })
             }
      


             /**
              * Prepare the root picker element with all bindings.
              */
             function prepareElementRoot() {
      
                 P.$root.
      
                 on({
      
                     // For iOS8.
                     keydown: handleKeydownEvent,
      
                     // When something within the root is focused, stop from bubbling
                     // to the doc and remove the “focused” state from the root.
                     focusin: function (event) {
                         P.$root.removeClass(CLASSES.focused)
                         event.stopPropagation()
                     },
      
                     // When something within the root holder is clicked, stop it
                     // from bubbling to the doc.
                     'mousedown click': function (event) {
      
                         var target = event.target
      
                         // Make sure the target isn’t the root holder so it can bubble up.
                         if (target != P.$root.children()[0]) {
      
                             event.stopPropagation()
      
                             // * For mousedown events, cancel the default action in order to
                             //   prevent cases where focus is shifted onto external elements
                             //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
                             //   Also, for Firefox, don’t prevent action on the `option` element.
                             if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
      
                                 event.preventDefault()
      
                                 // Re-focus onto the root so that users can click away
                                 // from elements focused within the picker.
                                 P.$root.eq(0).focus()
                             }
                         }
                     }
                 }).
      
                 // Add/remove the “target” class on focus and blur.
                 on({
                     focus: function () {
                         $ELEMENT.addClass(CLASSES.target)
                     },
                     blur: function () {
                         $ELEMENT.removeClass(CLASSES.target)
                     }
                 }).
      
                 // Open the picker and adjust the root “focused” state
                 on('focus.toOpen', handleFocusToOpenEvent).
      
                 // If there’s a click on an actionable element, carry out the actions.
                 on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
      
                         var $target = $(this),
                             targetData = $target.data(),
                             targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
      
                             // * For IE, non-focusable elements can be active elements as well
                             //   (http://stackoverflow.com/a/2684561).
                             activeElement = getActiveElement()
                         activeElement = activeElement && (activeElement.type || activeElement.href)
      
                         // If it’s disabled or nothing inside is actively focused, re-focus the element.
                         if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
                             P.$root.eq(0).focus()
                         }
      
                         // If something is superficially changed, update the `highlight` based on the `nav`.
                         if (!targetDisabled && targetData.nav) {
                             P.set('highlight', P.component.item.highlight, {
                                 nav: targetData.nav
                             })
                         }
      
                         // If something is picked, set `select` then close with focus.
                         else if (!targetDisabled && 'pick' in targetData) {
                             P.set('select', targetData.pick)
                         }
      
                         // If a “clear” button is pressed, empty the values and close with focus.
                         else if (targetData.clear) {
                             P.clear().close(true)
                         } else if (targetData.close) {
                             P.close(true)
                         }
      
                     }) //P.$root
      
                 aria(P.$root[0], 'hidden', true)
             }
      


             /**
              * Prepare the hidden input element along with all bindings.
              */
             function prepareElementHidden() {
      
                 var name
      
                 if (SETTINGS.hiddenName === true) {
                     name = ELEMENT.name
                     ELEMENT.name = 
                 } else {
                     name = [
                     typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : ,
                     typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
                 ]
                     name = name[0] + ELEMENT.name + name[1]
                 }
      
                 P._hidden = $(
                     '<input ' +
                     'type=hidden ' +
      
                     // Create the name using the original input’s with a prefix and suffix.
                     'name="' + name + '"' +
      
                     // If the element has a value, set the hidden value as well.
                     (
                         $ELEMENT.data('value') || ELEMENT.value ?
                         ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
                         
                     ) +
                     '>'
                 )[0]
      
                 $ELEMENT.
      
                 // If the value changes, update the hidden input with the correct format.
                 on('change.' + STATE.id, function () {
                     P._hidden.value = ELEMENT.value ?
                         P.get('select', SETTINGS.formatSubmit) :
                         
                 })
      


                 // Insert the hidden input as specified in the settings.
                 if (SETTINGS.container) $(SETTINGS.container).append(P._hidden)
                 else $ELEMENT.after(P._hidden)
             }
      


             // For iOS8.
             function handleKeydownEvent(event) {
      
                 var keycode = event.keyCode,
      
                     // Check if one of the delete keys was pressed.
                     isKeycodeDelete = /^(8|46)$/.test(keycode)
      
                 // For some reason IE clears the input value on “escape”.
                 if (keycode == 27) {
                     P.close()
                     return false
                 }
      
                 // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
                 if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
      
                     // Prevent it from moving the page and bubbling to doc.
                     event.preventDefault()
                     event.stopPropagation()
      
                     // If `delete` was pressed, clear the values and close the picker.
                     // Otherwise open the picker.
                     if (isKeycodeDelete) {
                         P.clear().close()
                     } else {
                         P.open()
                     }
                 }
             }
      


             // Separated for IE
             function handleFocusToOpenEvent(event) {
      
                 // Stop the event from propagating to the doc.
                 event.stopPropagation()
      
                 // If it’s a focus event, add the “focused” class to the root.
                 if (event.type == 'focus') {
                     P.$root.addClass(CLASSES.focused)
                 }
      
                 // And then finally open the picker.
                 P.open()
             }
      


             // Return a new picker instance.
             return new PickerInstance()
         } //PickerConstructor
      


         /**
          * The default classes and prefix to use for the HTML classes.
          */
         PickerConstructor.klasses = function (prefix) {
                 prefix = prefix || 'picker'
                 return {
      
                     picker: prefix,
                     opened: prefix + '--opened',
                     focused: prefix + '--focused',
      
                     input: prefix + '__input',
                     active: prefix + '__input--active',
                     target: prefix + '__input--target',
      
                     holder: prefix + '__holder',
      
                     frame: prefix + '__frame',
                     wrap: prefix + '__wrap',
      
                     box: prefix + '__box'
                 }
             } //PickerConstructor.klasses
      


         /**
          * Check if the default theme is being used.
          */
         function isUsingDefaultTheme(element) {
      
             var theme,
                 prop = 'position'
      
             // For IE.
             if (element.currentStyle) {
                 theme = element.currentStyle[prop]
             }
      
             // For normal browsers.
             else if (window.getComputedStyle) {
                 theme = getComputedStyle(element)[prop]
             }
      
             return theme == 'fixed'
         }
      


         /**
          * Get the width of the browser’s scrollbar.
          * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
          */
         function getScrollbarWidth() {
      
             if ($html.height() <= $window.height()) {
                 return 0
             }
      
             var $outer = $('<div style="visibility:hidden;width:100px" />').
             appendTo('body')
      
             // Get the width without scrollbars.
             var widthWithoutScroll = $outer[0].offsetWidth
      
             // Force adding scrollbars.
             $outer.css('overflow', 'scroll')
      
             // Add the inner div.
             var $inner = $('<div style="width:100%" />').appendTo($outer)
      
             // Get the width with scrollbars.
             var widthWithScroll = $inner[0].offsetWidth
      
             // Remove the divs.
             $outer.remove()
      
             // Return the difference between the widths.
             return widthWithoutScroll - widthWithScroll
         }
      


         /**
          * PickerConstructor helper methods.
          */
         PickerConstructor._ = {
      
                 /**
                  * Create a group of nodes. Expects:
                  * `
                     {
                         min:    {Integer},
                         max:    {Integer},
                         i:      {Integer},
                         node:   {String},
                         item:   {Function}
                     }
                  * `
                  */
                 group: function (groupObject) {
      
                     var
                     // Scope for the looped object
                         loopObjectScope,
      
                         // Create the nodes list
                         nodesList = ,
      
                         // The counter starts from the `min`
                         counter = PickerConstructor._.trigger(groupObject.min, groupObject)
      


                     // Loop from the `min` to `max`, incrementing by `i`
                     for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
      
                         // Trigger the `item` function within scope of the object
                         loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter])
      
                         // Splice the subgroup and create nodes out of the sub nodes
                         nodesList += PickerConstructor._.node(
                             groupObject.node,
                             loopObjectScope[0], // the node
                             loopObjectScope[1], // the classes
                             loopObjectScope[2] // the attributes
                         )
                     }
      
                     // Return the list of nodes
                     return nodesList
                 }, //group
      


                 /**
                  * Create a dom node string
                  */
                 node: function (wrapper, item, klass, attribute) {
      
                     // If the item is false-y, just return an empty string
                     if (!item) return 
      
                     // If the item is an array, do a join
                     item = $.isArray(item) ? item.join() : item
      
                     // Check for the class
                     klass = klass ? ' class="' + klass + '"' : 
      
                     // Check for any attributes
                     attribute = attribute ? ' ' + attribute : 
      
                     // Return the wrapped item
                     return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
                 }, //node
      


                 /**
                  * Lead numbers below 10 with a zero.
                  */
                 lead: function (number) {
                     return (number < 10 ? '0' : ) + number
                 },
      


                 /**
                  * Trigger a function otherwise return the value.
                  */
                 trigger: function (callback, scope, args) {
                     return typeof callback == 'function' ? callback.apply(scope, args || []) : callback
                 },
      


                 /**
                  * If the second character is a digit, length is 2 otherwise 1.
                  */
                 digits: function (string) {
                     return (/\d/).test(string[1]) ? 2 : 1
                 },
      


                 /**
                  * Tell if something is a date object.
                  */
                 isDate: function (value) {
                     return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate())
                 },
      


                 /**
                  * Tell if something is an integer.
                  */
                 isInteger: function (value) {
                     return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0
                 },
      


                 /**
                  * Create ARIA attribute strings.
                  */
                 ariaAttr: ariaAttr
             } //PickerConstructor._
      


         /**
          * Extend the picker with a component and defaults.
          */
         PickerConstructor.extend = function (name, Component) {
      
                 // Extend jQuery.
                 $.fn[name] = function (options, action) {
      
                     // Grab the component data.
                     var componentData = this.data(name)
      
                     // If the picker is requested, return the data object.
                     if (options == 'picker') {
                         return componentData
                     }
      
                     // If the component data exists and `options` is a string, carry out the action.
                     if (componentData && typeof options == 'string') {
                         return PickerConstructor._.trigger(componentData[options], componentData, [action])
                     }
      
                     // Otherwise go through each matched element and if the component
                     // doesn’t exist, create a new picker using `this` element
                     // and merging the defaults and options with a deep copy.
                     return this.each(function () {
                         var $this = $(this)
                         if (!$this.data(name)) {
                             new PickerConstructor(this, name, Component, options)
                         }
                     })
                 }
      
                 // Set the defaults.
                 $.fn[name].defaults = Component.defaults
             } //PickerConstructor.extend
      


         function aria(element, attribute, value) {
             if ($.isPlainObject(attribute)) {
                 for (var key in attribute) {
                     ariaSet(element, key, attribute[key])
                 }
             } else {
                 ariaSet(element, attribute, value)
             }
         }
      
         function ariaSet(element, attribute, value) {
             element.setAttribute(
                 (attribute == 'role' ?  : 'aria-') + attribute,
                 value
             )
         }
      
         function ariaAttr(attribute, data) {
             if (!$.isPlainObject(attribute)) {
                 attribute = {
                     attribute: data
                 }
             }
             data = 
             for (var key in attribute) {
                 var attr = (key == 'role' ?  : 'aria-') + key,
                     attrVal = attribute[key]
                 data += attrVal == null ?  : attr + '="' + attribute[key] + '"'
             }
             return data
         }
      
         // IE8 bug throws an error for activeElements within iframes.
         function getActiveElement() {
             try {
                 return document.activeElement
             } catch (err) {}
         }
      


         // Expose the picker constructor.
         return PickerConstructor
      


      }));

      /*!

      * Date picker for pickadate.js v3.5.0
      * http://amsul.github.io/pickadate.js/date.htm
      */
      

      (function (factory) {

         // AMD.
         if (typeof define == 'function' && define.amd)
             define(['picker', 'jquery'], factory)
      
         // Node.js/browserify.
         else if (typeof exports == 'object')
             module.exports = factory(require('./picker.js'), require('jquery'))
      
         // Browser globals.
         else factory(Picker, jQuery)
      

      }(function (Picker, $) {


         /**
          * Globals and constants
          */
         var DAYS_IN_WEEK = 7,
             WEEKS_IN_CALENDAR = 6,
             _ = Picker._;
      


         /**
          * The date picker constructor
          */
         function DatePicker(picker, settings) {
      
             var calendar = this,
                 element = picker.$node[0],
                 elementValue = element.value,
                 elementDataValue = picker.$node.data('value'),
                 valueString = elementDataValue || elementValue,
                 formatString = elementDataValue ? settings.formatSubmit : settings.format,
                 isRTL = function () {
      
                     return element.currentStyle ?
      
                         // For IE.
                         element.currentStyle.direction == 'rtl' :
      
                         // For normal browsers.
                         getComputedStyle(picker.$root[0]).direction == 'rtl'
                 }
      
             calendar.settings = settings
             calendar.$node = picker.$node
      
             // The queue of methods that will be used to build item objects.
             calendar.queue = {
                 min: 'measure create',
                 max: 'measure create',
                 now: 'now create',
                 select: 'parse create validate',
                 highlight: 'parse navigate create validate',
                 view: 'parse create validate viewset',
                 disable: 'deactivate',
                 enable: 'activate'
             }
      
             // The component's item object.
             calendar.item = {}
      
             calendar.item.clear = null
             calendar.item.disable = (settings.disable || []).slice(0)
             calendar.item.enable = -(function (collectionDisabled) {
                 return collectionDisabled[0] === true ? collectionDisabled.shift() : -1
             })(calendar.item.disable)
      
             calendar.
             set('min', settings.min).
             set('max', settings.max).
             set('now')
      
             // When there’s a value, set the `select`, which in turn
             // also sets the `highlight` and `view`.
             if (valueString) {
                 calendar.set('select', valueString, {
                     format: formatString
                 })
             }
      
             // If there’s no value, default to highlighting “today”.
             else {
                 calendar.
                 set('select', null).
                 set('highlight', calendar.item.now)
             }
      


             // The keycode to movement mapping.
             calendar.key = {
                 40: 7, // Down
                 38: -7, // Up
                 39: function () {
                     return isRTL() ? -1 : 1
                 }, // Right
                 37: function () {
                     return isRTL() ? 1 : -1
                 }, // Left
                 go: function (timeChange) {
                     var highlightedObject = calendar.item.highlight,
                         targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange)
                     calendar.set(
                         'highlight',
                         targetDate, {
                             interval: timeChange
                         }
                     )
                     this.render()
                 }
             }
      


             // Bind some picker events.
             picker.
             on('render', function () {
                 picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
                     var value = this.value
                     if (value) {
                         picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date])
                         picker.$root.find('.' + settings.klass.selectMonth).trigger('focus')
                     }
                 })
                 picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
                     var value = this.value
                     if (value) {
                         picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date])
                         picker.$root.find('.' + settings.klass.selectYear).trigger('focus')
                     }
                 })
             }, 1).
             on('open', function () {
                 var includeToday = 
                 if (calendar.disabled(calendar.get('now'))) {
                     includeToday = ':not(.' + settings.klass.buttonToday + ')'
                 }
                 picker.$root.find('button' + includeToday + ', select').attr('disabled', false)
             }, 1).
             on('close', function () {
                 picker.$root.find('button, select').attr('disabled', true)
             }, 1)
      
         } //DatePicker
      


         /**
          * Set a datepicker item object.
          */
         DatePicker.prototype.set = function (type, value, options) {
      
                 var calendar = this,
                     calendarItem = calendar.item
      
                 // If the value is `null` just set it immediately.
                 if (value === null) {
                     if (type == 'clear') type = 'select'
                     calendarItem[type] = value
                     return calendar
                 }
      
                 // Otherwise go through the queue of methods, and invoke the functions.
                 // Update this as the time unit, and set the final value as this item.
                 // * In the case of `enable`, keep the queue but set `disable` instead.
                 //   And in the case of `flip`, keep the queue but set `enable` instead.
                 calendarItem[(type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type)] = calendar.queue[type].split(' ').map(function (method) {
                     value = calendar[method](type, value, options)
                     return value
                 }).pop()
      
                 // Check if we need to cascade through more updates.
                 if (type == 'select') {
                     calendar.set('highlight', calendarItem.select, options)
                 } else if (type == 'highlight') {
                     calendar.set('view', calendarItem.highlight, options)
                 } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
                     if (calendarItem.select && calendar.disabled(calendarItem.select)) {
                         calendar.set('select', calendarItem.select, options)
                     }
                     if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
                         calendar.set('highlight', calendarItem.highlight, options)
                     }
                 }
      
                 return calendar
             } //DatePicker.prototype.set
      


         /**
          * Get a datepicker item object.
          */
         DatePicker.prototype.get = function (type) {
                 return this.item[type]
             } //DatePicker.prototype.get
      


         /**
          * Create a picker date object.
          */
         DatePicker.prototype.create = function (type, value, options) {
      
                 var isInfiniteValue,
                     calendar = this
      
                 // If there’s no value, use the type as the value.
                 value = value === undefined ? type : value
      


                 // If it’s infinity, update the value.
                 if (value == -Infinity || value == Infinity) {
                     isInfiniteValue = value
                 }
      
                 // If it’s an object, use the native date object.
                 else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
                     value = value.obj
                 }
      
                 // If it’s an array, convert it into a date and make sure
                 // that it’s a valid date – otherwise default to today.
                 else if ($.isArray(value)) {
                     value = new Date(value[0], value[1], value[2])
                     value = _.isDate(value) ? value : calendar.create().obj
                 }
      
                 // If it’s a number or date object, make a normalized date.
                 else if (_.isInteger(value) || _.isDate(value)) {
                     value = calendar.normalize(new Date(value), options)
                 }
      
                 // If it’s a literal true or any other case, set it to now.
                 else /*if ( value === true )*/ {
                     value = calendar.now(type, value, options)
                 }
      
                 // Return the compiled object.
                 return {
                     year: isInfiniteValue || value.getFullYear(),
                     month: isInfiniteValue || value.getMonth(),
                     date: isInfiniteValue || value.getDate(),
                     day: isInfiniteValue || value.getDay(),
                     obj: isInfiniteValue || value,
                     pick: isInfiniteValue || value.getTime()
                 }
             } //DatePicker.prototype.create
      


         /**
          * Create a range limit object using an array, date object,
          * literal “true”, or integer relative to another time.
          */
         DatePicker.prototype.createRange = function (from, to) {
      
                 var calendar = this,
                     createDate = function (date) {
                         if (date === true || $.isArray(date) || _.isDate(date)) {
                             return calendar.create(date)
                         }
                         return date
                     }
      
                 // Create objects if possible.
                 if (!_.isInteger(from)) {
                     from = createDate(from)
                 }
                 if (!_.isInteger(to)) {
                     to = createDate(to)
                 }
      
                 // Create relative dates.
                 if (_.isInteger(from) && $.isPlainObject(to)) {
                     from = [to.year, to.month, to.date + from];
                 } else if (_.isInteger(to) && $.isPlainObject(from)) {
                     to = [from.year, from.month, from.date + to];
                 }
      
                 return {
                     from: createDate(from),
                     to: createDate(to)
                 }
             } //DatePicker.prototype.createRange
      


         /**
          * Check if a date unit falls within a date range object.
          */
         DatePicker.prototype.withinRange = function (range, dateUnit) {
             range = this.createRange(range.from, range.to)
             return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
         }
      


         /**
          * Check if two date range objects overlap.
          */
         DatePicker.prototype.overlapRanges = function (one, two) {
      
             var calendar = this
      
             // Convert the ranges into comparable dates.
             one = calendar.createRange(one.from, one.to)
             two = calendar.createRange(two.from, two.to)
      
             return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) ||
                 calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to)
         }
      


         /**
          * Get the date today.
          */
         DatePicker.prototype.now = function (type, value, options) {
             value = new Date()
             if (options && options.rel) {
                 value.setDate(value.getDate() + options.rel)
             }
             return this.normalize(value, options)
         }
      


         /**
          * Navigate to next/prev month.
          */
         DatePicker.prototype.navigate = function (type, value, options) {
      
                 var targetDateObject,
                     targetYear,
                     targetMonth,
                     targetDate,
                     isTargetArray = $.isArray(value),
                     isTargetObject = $.isPlainObject(value),
                     viewsetObject = this.item.view
                     /*,
                             safety = 100*/
      


                 if (isTargetArray || isTargetObject) {
      
                     if (isTargetObject) {
                         targetYear = value.year
                         targetMonth = value.month
                         targetDate = value.date
                     } else {
                         targetYear = +value[0]
                         targetMonth = +value[1]
                         targetDate = +value[2]
                     }
      
                     // If we’re navigating months but the view is in a different
                     // month, navigate to the view’s year and month.
                     if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
                         targetYear = viewsetObject.year
                         targetMonth = viewsetObject.month
                     }
      
                     // Figure out the expected target year and month.
                     targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1)
                     targetYear = targetDateObject.getFullYear()
                     targetMonth = targetDateObject.getMonth()
      
                     // If the month we’re going to doesn’t have enough days,
                     // keep decreasing the date until we reach the month’s last date.
                     while ( /*safety &&*/ new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
                         targetDate -= 1
                             /*safety -= 1
                             if ( !safety ) {
                                 throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
                             }*/
                     }
      
                     value = [targetYear, targetMonth, targetDate]
                 }
      
                 return value
             } //DatePicker.prototype.navigate
      


         /**
          * Normalize a date by setting the hours to midnight.
          */
         DatePicker.prototype.normalize = function (value /*, options*/ ) {
             value.setHours(0, 0, 0, 0)
             return value
         }
      


         /**
          * Measure the range of dates.
          */
         DatePicker.prototype.measure = function (type, value /*, options*/ ) {
      
                 var calendar = this
      
                 // If it’s anything false-y, remove the limits.
                 if (!value) {
                     value = type == 'min' ? -Infinity : Infinity
                 }
      
                 // If it’s a string, parse it.
                 else if (typeof value == 'string') {
                     value = calendar.parse(type, value)
                 }
      
                 // If it's an integer, get a date relative to today.
                 else if (_.isInteger(value)) {
                     value = calendar.now(type, value, {
                         rel: value
                     })
                 }
      
                 return value
             } ///DatePicker.prototype.measure
      


         /**
          * Create a viewset object based on navigation.
          */
         DatePicker.prototype.viewset = function (type, dateObject /*, options*/ ) {
             return this.create([dateObject.year, dateObject.month, 1])
         }
      


         /**
          * Validate a date as enabled and shift if needed.
          */
         DatePicker.prototype.validate = function (type, dateObject, options) {
      
                 var calendar = this,
      
                     // Keep a reference to the original date.
                     originalDateObject = dateObject,
      
                     // Make sure we have an interval.
                     interval = options && options.interval ? options.interval : 1,
      
                     // Check if the calendar enabled dates are inverted.
                     isFlippedBase = calendar.item.enable === -1,
      
                     // Check if we have any enabled dates after/before now.
                     hasEnabledBeforeTarget, hasEnabledAfterTarget,
      
                     // The min & max limits.
                     minLimitObject = calendar.item.min,
                     maxLimitObject = calendar.item.max,
      
                     // Check if we’ve reached the limit during shifting.
                     reachedMin, reachedMax,
      
                     // Check if the calendar is inverted and at least one weekday is enabled.
                     hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
      
                         // If there’s a date, check where it is relative to the target.
                         if ($.isArray(value)) {
                             var dateTime = calendar.create(value).pick
                             if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true
                             else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true
                         }
      
                         // Return only integers for enabled weekdays.
                         return _.isInteger(value)
                     }).length
                     /*,
      
                             safety = 100*/
      


                 // Cases to validate for:
                 // [1] Not inverted and date disabled.
                 // [2] Inverted and some dates enabled.
                 // [3] Not inverted and out of range.
                 //
                 // Cases to **not** validate for:
                 // • Navigating months.
                 // • Not inverted and date enabled.
                 // • Inverted and all dates disabled.
                 // • ..and anything else.
                 if (!options || !options.nav)
                     if (
                         /* 1 */
                         (!isFlippedBase && calendar.disabled(dateObject)) ||
                         /* 2 */
                         (isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget)) ||
                         /* 3 */
                         (!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick))
                     ) {
      


                         // When inverted, flip the direction if there aren’t any enabled weekdays
                         // and there are no enabled dates in the direction of the interval.
                         if (isFlippedBase && !hasEnabledWeekdays && ((!hasEnabledAfterTarget && interval > 0) || (!hasEnabledBeforeTarget && interval < 0))) {
                             interval *= -1
                         }
      


                         // Keep looping until we reach an enabled date.
                         while ( /*safety &&*/ calendar.disabled(dateObject)) {
      
                             /*safety -= 1
                             if ( !safety ) {
                                 throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
                             }*/
      


                             // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
                             if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
                                 dateObject = originalDateObject
                                 interval = interval > 0 ? 1 : -1
                             }
      


                             // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
                             if (dateObject.pick <= minLimitObject.pick) {
                                 reachedMin = true
                                 interval = 1
                                 dateObject = calendar.create([
                         minLimitObject.year,
                         minLimitObject.month,
                         minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
                     ])
                             } else if (dateObject.pick >= maxLimitObject.pick) {
                                 reachedMax = true
                                 interval = -1
                                 dateObject = calendar.create([
                         maxLimitObject.year,
                         maxLimitObject.month,
                         maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
                     ])
                             }
      


                             // If we’ve reached both limits, just break out of the loop.
                             if (reachedMin && reachedMax) {
                                 break
                             }
      


                             // Finally, create the shifted date using the interval and keep looping.
                             dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval])
                         }
      
                     } //endif
      


                     // Return the date object settled on.
                 return dateObject
             } //DatePicker.prototype.validate
      


         /**
          * Check if a date is disabled.
          */
         DatePicker.prototype.disabled = function (dateToVerify) {
      
                 var
                     calendar = this,
      
                     // Filter through the disabled dates to check if this is one.
                     isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
      
                         // If the date is a number, match the weekday with 0index and `firstDay` check.
                         if (_.isInteger(dateToDisable)) {
                             return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7
                         }
      
                         // If it’s an array or a native JS date, create and match the exact date.
                         if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
                             return dateToVerify.pick === calendar.create(dateToDisable).pick
                         }
      
                         // If it’s an object, match a date within the “from” and “to” range.
                         if ($.isPlainObject(dateToDisable)) {
                             return calendar.withinRange(dateToDisable, dateToVerify)
                         }
                     })
      
                 // If this date matches a disabled date, confirm it’s not inverted.
                 isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
                     return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' ||
                         $.isPlainObject(dateToDisable) && dateToDisable.inverted
                 }).length
      
                 // Check the calendar “enabled” flag and respectively flip the
                 // disabled state. Then also check if it’s beyond the min/max limits.
                 return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
                     dateToVerify.pick < calendar.item.min.pick ||
                     dateToVerify.pick > calendar.item.max.pick
      
             } //DatePicker.prototype.disabled
      


         /**
          * Parse a string into a usable type.
          */
         DatePicker.prototype.parse = function (type, value, options) {
      
                 var calendar = this,
                     parsingObject = {}
      
                 // If it’s already parsed, we’re good.
                 if (!value || typeof value != 'string') {
                     return value
                 }
      
                 // We need a `.format` to parse the value with.
                 if (!(options && options.format)) {
                     options = options || {}
                     options.format = calendar.settings.format
                 }
      
                 // Convert the format into an array and then map through it.
                 calendar.formats.toArray(options.format).map(function (label) {
      
                     var
                     // Grab the formatting label.
                         formattingLabel = calendar.formats[label],
      
                         // The format length is from the formatting label function or the
                         // label length without the escaping exclamation (!) mark.
                         formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, ).length
      
                     // If there's a format label, split the value up to the format length.
                     // Then add it to the parsing object with appropriate label.
                     if (formattingLabel) {
                         parsingObject[label] = value.substr(0, formatLength)
                     }
      
                     // Update the value as the substring from format length to end.
                     value = value.substr(formatLength)
                 })
      
                 // Compensate for month 0index.
                 return [
             parsingObject.yyyy || parsingObject.yy,
             +(parsingObject.mm || parsingObject.m) - 1,
             parsingObject.dd || parsingObject.d
         ]
             } //DatePicker.prototype.parse
      


         /**
          * Various formats to display the object in.
          */
         DatePicker.prototype.formats = (function () {
      
                 // Return the length of the first word in a collection.
                 function getWordLengthFromCollection(string, collection, dateObject) {
      
                     // Grab the first word from the string.
                     var word = string.match(/\w+/)[0]
      
                     // If there's no month index, add it to the date object
                     if (!dateObject.mm && !dateObject.m) {
                         dateObject.m = collection.indexOf(word) + 1
                     }
      
                     // Return the length of the word.
                     return word.length
                 }
      
                 // Get the length of the first word in a string.
                 function getFirstWordLength(string) {
                     return string.match(/\w+/)[0].length
                 }
      
                 return {
      
                     d: function (string, dateObject) {
      
                         // If there's string, then get the digits length.
                         // Otherwise return the selected date.
                         return string ? _.digits(string) : dateObject.date
                     },
                     dd: function (string, dateObject) {
      
                         // If there's a string, then the length is always 2.
                         // Otherwise return the selected date with a leading zero.
                         return string ? 2 : _.lead(dateObject.date)
                     },
                     ddd: function (string, dateObject) {
      
                         // If there's a string, then get the length of the first word.
                         // Otherwise return the short selected weekday.
                         return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]
                     },
                     dddd: function (string, dateObject) {
      
                         // If there's a string, then get the length of the first word.
                         // Otherwise return the full selected weekday.
                         return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]
                     },
                     m: function (string, dateObject) {
      
                         // If there's a string, then get the length of the digits
                         // Otherwise return the selected month with 0index compensation.
                         return string ? _.digits(string) : dateObject.month + 1
                     },
                     mm: function (string, dateObject) {
      
                         // If there's a string, then the length is always 2.
                         // Otherwise return the selected month with 0index and leading zero.
                         return string ? 2 : _.lead(dateObject.month + 1)
                     },
                     mmm: function (string, dateObject) {
      
                         var collection = this.settings.monthsShort
      
                         // If there's a string, get length of the relevant month from the short
                         // months collection. Otherwise return the selected month from that collection.
                         return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
                     },
                     mmmm: function (string, dateObject) {
      
                         var collection = this.settings.monthsFull
      
                         // If there's a string, get length of the relevant month from the full
                         // months collection. Otherwise return the selected month from that collection.
                         return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]
                     },
                     yy: function (string, dateObject) {
      
                         // If there's a string, then the length is always 2.
                         // Otherwise return the selected year by slicing out the first 2 digits.
                         return string ? 2 : ( + dateObject.year).slice(2)
                     },
                     yyyy: function (string, dateObject) {
      
                         // If there's a string, then the length is always 4.
                         // Otherwise return the selected year.
                         return string ? 4 : dateObject.year
                     },
      
                     // Create an array by splitting the formatting string passed.
                     toArray: function (formatString) {
                         return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)
                     },
      
                     // Format an object into a string using the formatting options.
                     toString: function (formatString, itemObject) {
                         var calendar = this
                         return calendar.formats.toArray(formatString).map(function (label) {
                             return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, )
                         }).join()
                     }
                 }
             })() //DatePicker.prototype.formats
      



         /**
          * Check if two date units are the exact.
          */
         DatePicker.prototype.isDateExact = function (one, two) {
      
             var calendar = this
      
             // When we’re working with weekdays, do a direct comparison.
             if (
                 (_.isInteger(one) && _.isInteger(two)) ||
                 (typeof one == 'boolean' && typeof two == 'boolean')
             ) {
                 return one === two
             }
      
             // When we’re working with date representations, compare the “pick” value.
             if (
                 (_.isDate(one) || $.isArray(one)) &&
                 (_.isDate(two) || $.isArray(two))
             ) {
                 return calendar.create(one).pick === calendar.create(two).pick
             }
      
             // When we’re working with range objects, compare the “from” and “to”.
             if ($.isPlainObject(one) && $.isPlainObject(two)) {
                 return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to)
             }
      
             return false
         }
      


         /**
          * Check if two date units overlap.
          */
         DatePicker.prototype.isDateOverlap = function (one, two) {
      
             var calendar = this,
                 firstDay = calendar.settings.firstDay ? 1 : 0
      
             // When we’re working with a weekday index, compare the days.
             if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
                 one = one % 7 + firstDay
                 return one === calendar.create(two).day + 1
             }
             if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
                 two = two % 7 + firstDay
                 return two === calendar.create(one).day + 1
             }
      
             // When we’re working with range objects, check if the ranges overlap.
             if ($.isPlainObject(one) && $.isPlainObject(two)) {
                 return calendar.overlapRanges(one, two)
             }
      
             return false
         }
      


         /**
          * Flip the “enabled” state.
          */
         DatePicker.prototype.flipEnable = function (val) {
             var itemObject = this.item
             itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
         }
      


         /**
          * Mark a collection of dates as “disabled”.
          */
         DatePicker.prototype.deactivate = function (type, datesToDisable) {
      
                 var calendar = this,
                     disabledItems = calendar.item.disable.slice(0)
      


                 // If we’re flipping, that’s all we need to do.
                 if (datesToDisable == 'flip') {
                     calendar.flipEnable()
                 } else if (datesToDisable === false) {
                     calendar.flipEnable(1)
                     disabledItems = []
                 } else if (datesToDisable === true) {
                     calendar.flipEnable(-1)
                     disabledItems = []
                 }
      
                 // Otherwise go through the dates to disable.
                 else {
      
                     datesToDisable.map(function (unitToDisable) {
      
                         var matchFound
      
                         // When we have disabled items, check for matches.
                         // If something is matched, immediately break out.
                         for (var index = 0; index < disabledItems.length; index += 1) {
                             if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
                                 matchFound = true
                                 break
                             }
                         }
      
                         // If nothing was found, add the validated unit to the collection.
                         if (!matchFound) {
                             if (
                                 _.isInteger(unitToDisable) ||
                                 _.isDate(unitToDisable) ||
                                 $.isArray(unitToDisable) ||
                                 ($.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to)
                             ) {
                                 disabledItems.push(unitToDisable)
                             }
                         }
                     })
                 }
      
                 // Return the updated collection.
                 return disabledItems
             } //DatePicker.prototype.deactivate
      


         /**
          * Mark a collection of dates as “enabled”.
          */
         DatePicker.prototype.activate = function (type, datesToEnable) {
      
                 var calendar = this,
                     disabledItems = calendar.item.disable,
                     disabledItemsCount = disabledItems.length
      
                 // If we’re flipping, that’s all we need to do.
                 if (datesToEnable == 'flip') {
                     calendar.flipEnable()
                 } else if (datesToEnable === true) {
                     calendar.flipEnable(1)
                     disabledItems = []
                 } else if (datesToEnable === false) {
                     calendar.flipEnable(-1)
                     disabledItems = []
                 }
      
                 // Otherwise go through the disabled dates.
                 else {
      
                     datesToEnable.map(function (unitToEnable) {
      
                         var matchFound,
                             disabledUnit,
                             index,
                             isExactRange
      
                         // Go through the disabled items and try to find a match.
                         for (index = 0; index < disabledItemsCount; index += 1) {
      
                             disabledUnit = disabledItems[index]
      
                             // When an exact match is found, remove it from the collection.
                             if (calendar.isDateExact(disabledUnit, unitToEnable)) {
                                 matchFound = disabledItems[index] = null
                                 isExactRange = true
                                 break
                             }
      
                             // When an overlapped match is found, add the “inverted” state to it.
                             else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
                                 if ($.isPlainObject(unitToEnable)) {
                                     unitToEnable.inverted = true
                                     matchFound = unitToEnable
                                 } else if ($.isArray(unitToEnable)) {
                                     matchFound = unitToEnable
                                     if (!matchFound[3]) matchFound.push('inverted')
                                 } else if (_.isDate(unitToEnable)) {
                                     matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']
                                 }
                                 break
                             }
                         }
      
                         // If a match was found, remove a previous duplicate entry.
                         if (matchFound)
                             for (index = 0; index < disabledItemsCount; index += 1) {
                                 if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
                                     disabledItems[index] = null
                                     break
                                 }
                             }
      
                         // In the event that we’re dealing with an exact range of dates,
                         // make sure there are no “inverted” dates because of it.
                         if (isExactRange)
                             for (index = 0; index < disabledItemsCount; index += 1) {
                                 if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
                                     disabledItems[index] = null
                                     break
                                 }
                             }
      
                         // If something is still matched, add it into the collection.
                         if (matchFound) {
                             disabledItems.push(matchFound)
                         }
                     })
                 }
      
                 // Return the updated collection.
                 return disabledItems.filter(function (val) {
                     return val != null
                 })
             } //DatePicker.prototype.activate
      


         /**
          * Create a string for the nodes in the picker.
          */
         DatePicker.prototype.nodes = function (isOpen) {
      
                 var
                     calendar = this,
                     settings = calendar.settings,
                     calendarItem = calendar.item,
                     nowObject = calendarItem.now,
                     selectedObject = calendarItem.select,
                     highlightedObject = calendarItem.highlight,
                     viewsetObject = calendarItem.view,
                     disabledCollection = calendarItem.disable,
                     minLimitObject = calendarItem.min,
                     maxLimitObject = calendarItem.max,
      


                     // Create the calendar table head using a copy of weekday labels collection.
                     // * We do a copy so we don't mutate the original array.
                     tableHead = (function (collection, fullCollection) {
      
                         // If the first day should be Monday, move Sunday to the end.
                         if (settings.firstDay) {
                             collection.push(collection.shift())
                             fullCollection.push(fullCollection.shift())
                         }
      
                         // Create and return the table head group.
                         return _.node(
                                 'thead',
                                 _.node(
                                     'tr',
                                     _.group({
                                         min: 0,
                                         max: DAYS_IN_WEEK - 1,
                                         i: 1,
                                         node: 'th',
                                         item: function (counter) {
                                             return [
                                     collection[counter],
                                     settings.klass.weekdays,
                                     'scope=col title="' + fullCollection[counter] + '"'
                                 ]
                                         }
                                     })
                                 )
                             ) //endreturn
      
                         // Materialize modified
                     })((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead
      


                     // Create the nav for next/prev month.
                     createMonthNav = function (next) {
      
                         // Otherwise, return the created month tag.
                         return _.node(
                                 'div',
                                 ' ',
                                 settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
      
                                     // If the focused month is outside the range, disabled the button.
                                     (next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month) ||
                                     (!next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month) ?
                                     ' ' + settings.klass.navDisabled : 
                                 ),
                                 'data-nav=' + (next || -1) + ' ' +
                                 _.ariaAttr({
                                     role: 'button',
                                     controls: calendar.$node[0].id + '_table'
                                 }) + ' ' +
                                 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'
                             ) //endreturn
                     }, //createMonthNav
      


                     // Create the month label.
                     //Materialize modified
                     createMonthLabel = function (override) {
      
                         var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
      
                         // Materialize modified
                         if (override == "short_months") {
                             monthsCollection = settings.monthsShort;
                         }
      
                         // If there are months to select, add a dropdown menu.
                         if (settings.selectMonths && override == undefined) {
      
                             return _.node('select',
                                 _.group({
                                     min: 0,
                                     max: 11,
                                     i: 1,
                                     node: 'option',
                                     item: function (loopedMonth) {
      
                                         return [
      
                                     // The looped month and no classes.
                                     monthsCollection[loopedMonth], 0,
      
                                     // Set the value and selected index.
                                     'value=' + loopedMonth +
                                             (viewsetObject.month == loopedMonth ? ' selected' : ) +
                                             (
                                                 (
                                                     (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month) ||
                                                     (viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month)
                                                 ) ?
                                                 ' disabled' : 
                                     )
                                 ]
                                     }
                                 }),
                                 settings.klass.selectMonth + ' browser-default', (isOpen ?  : 'disabled') + ' ' +
                                 _.ariaAttr({
                                     controls: calendar.$node[0].id + '_table'
                                 }) + ' ' +
                                 'title="' + settings.labelMonthSelect + '"'
                             )
                         }
      
                         // Materialize modified
                         if (override == "short_months")
                             if (selectedObject != null)
                                 return monthsCollection[selectedObject.month];
                             else return monthsCollection[viewsetObject.month];
      
                             // If there's a need for a month selector
                         return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month)
                     }, //createMonthLabel
      


                     // Create the year label.
                     // Materialize modified
                     createYearLabel = function (override) {
      
                         var focusedYear = viewsetObject.year,
      
                             // If years selector is set to a literal "true", set it to 5. Otherwise
                             // divide in half to get half before and half after focused year.
                             numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2)
      
                         // If there are years to select, add a dropdown menu.
                         if (numberYears) {
      
                             var
                                 minYear = minLimitObject.year,
                                 maxYear = maxLimitObject.year,
                                 lowestYear = focusedYear - numberYears,
                                 highestYear = focusedYear + numberYears
      
                             // If the min year is greater than the lowest year, increase the highest year
                             // by the difference and set the lowest year to the min year.
                             if (minYear > lowestYear) {
                                 highestYear += minYear - lowestYear
                                 lowestYear = minYear
                             }
      
                             // If the max year is less than the highest year, decrease the lowest year
                             // by the lower of the two: available and needed years. Then set the
                             // highest year to the max year.
                             if (maxYear < highestYear) {
      
                                 var availableYears = lowestYear - minYear,
                                     neededYears = highestYear - maxYear
      
                                 lowestYear -= availableYears > neededYears ? neededYears : availableYears
                                 highestYear = maxYear
                             }
      
                             if (settings.selectYears && override == undefined) {
                                 return _.node('select',
                                     _.group({
                                         min: lowestYear,
                                         max: highestYear,
                                         i: 1,
                                         node: 'option',
                                         item: function (loopedYear) {
                                             return [
      
                                         // The looped year and no classes.
                                         loopedYear, 0,
      
                                         // Set the value and selected index.
                                         'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : )
                                     ]
                                         }
                                     }),
                                     settings.klass.selectYear + ' browser-default', (isOpen ?  : 'disabled') + ' ' + _.ariaAttr({
                                         controls: calendar.$node[0].id + '_table'
                                     }) + ' ' +
                                     'title="' + settings.labelYearSelect + '"'
                                 )
                             }
                         }
      
                         // Materialize modified
                         if (override == "raw")
                             return _.node('div', focusedYear)
      
                         // Otherwise just return the year focused
                         return _.node('div', focusedYear, settings.klass.year)
                     } //createYearLabel
      


                 // Materialize modified
                 createDayLabel = function () {
                     if (selectedObject != null)
                         return selectedObject.date
                     else return nowObject.date
                 }
                 createWeekdayLabel = function () {
                     var display_day;
      
                     if (selectedObject != null)
                         display_day = selectedObject.day;
                     else
                         display_day = nowObject.day;
                     var weekday = settings.weekdaysShort[display_day];
                     return weekday
                 }
      


                 // Create and return the entire calendar.
      
                 return _.node(
                         // Date presentation View
                         'div',
                         _.node(
                             // Div for Year
                             'div',
                             createYearLabel("raw"),
                             settings.klass.year_display
                         ) +
                         _.node(
                             'span',
                             createWeekdayLabel() + ', ',
                             "picker__weekday-display"
                         ) +
                         _.node(
                             // Div for short Month
                             'span',
                             createMonthLabel("short_months") + ' ',
                             settings.klass.month_display
                         ) +
                         _.node(
                             // Div for Day
                             'span',
                             createDayLabel(),
                             settings.klass.day_display
                         ),
                         settings.klass.date_display
                     ) +
                     // Calendar container
                     _.node('div',
                         _.node('div',
                             _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) +
                                 createMonthNav() + createMonthNav(1),
                                 settings.klass.header
                             ) + _.node(
                                 'table',
                                 tableHead +
                                 _.node(
                                     'tbody',
                                     _.group({
                                         min: 0,
                                         max: WEEKS_IN_CALENDAR - 1,
                                         i: 1,
                                         node: 'tr',
                                         item: function (rowCounter) {
      
                                             // If Monday is the first day and the month starts on Sunday, shift the date back a week.
                                             var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0
      
                                             return [
      

      _.group({

                                                         min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
                                                         max: function () {
                                                             return this.min + DAYS_IN_WEEK - 1
                                                         },
                                                         i: 1,
                                                         node: 'td',
                                                         item: function (targetDate) {
      
                                                             // Convert the time date from a relative date to a target date.
                                                             targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)])
      
                                                             var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
                                                                 isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
                                                                 isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
                                                                 formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate])
      
                                                             return [
      

      _.node(

                                                                         'div',
                                                                         targetDate.date, (function (klasses) {
      
                                                                             // Add the `infocus` or `outfocus` classes based on month in view.
                                                                             klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus)
      
                                                                             // Add the `today` class if needed.
                                                                             if (nowObject.pick == targetDate.pick) {
                                                                                 klasses.push(settings.klass.now)
                                                                             }
      
                                                                             // Add the `selected` class if something's selected and the time matches.
                                                                             if (isSelected) {
                                                                                 klasses.push(settings.klass.selected)
                                                                             }
      
                                                                             // Add the `highlighted` class if something's highlighted and the time matches.
                                                                             if (isHighlighted) {
                                                                                 klasses.push(settings.klass.highlighted)
                                                                             }
      
                                                                             // Add the `disabled` class if something's disabled and the object matches.
                                                                             if (isDisabled) {
                                                                                 klasses.push(settings.klass.disabled)
                                                                             }
      
                                                                             return klasses.join(' ')
                                                                         })([settings.klass.day]),
                                                                         'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
                                                                             role: 'gridcell',
                                                                             label: formattedDate,
                                                                             selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
                                                                             activedescendant: isHighlighted ? true : null,
                                                                             disabled: isDisabled ? true : null
                                                                         })
      

      ), , _.ariaAttr({

                                                                         role: 'presentation'
                                                                     })
      

      ] //endreturn

                                                         }
                                                     })
      

      ] //endreturn

                                         }
                                     })
                                 ),
                                 settings.klass.table,
                                 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
                                     role: 'grid',
                                     controls: calendar.$node[0].id,
                                     readonly: true
                                 })
                             ), settings.klass.calendar_container) // end calendar
      
                         +
      
                         // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
                         _.node(
                             'div',
                             _.node('button', settings.today, "btn-flat picker__today waves-effect",
                                 'type=button data-pick=' + nowObject.pick +
                                 (isOpen && !calendar.disabled(nowObject) ?  : ' disabled') + ' ' +
                                 _.ariaAttr({
                                     controls: calendar.$node[0].id
                                 })) +
                             _.node('button', settings.clear, "btn-flat picker__clear waves-effect",
                                 'type=button data-clear=1' +
                                 (isOpen ?  : ' disabled') + ' ' +
                                 _.ariaAttr({
                                     controls: calendar.$node[0].id
                                 })) +
                             _.node('button', settings.close, "btn-flat picker__close waves-effect",
                                 'type=button data-close=true ' +
                                 (isOpen ?  : ' disabled') + ' ' +
                                 _.ariaAttr({
                                     controls: calendar.$node[0].id
                                 })),
                             settings.klass.footer
                         ), 'picker__container__wrapper'
                     ) //endreturn
             } //DatePicker.prototype.nodes
      



         /**
          * The date picker defaults.
          */
         DatePicker.defaults = (function (prefix) {
      
             return {
      
                 // The title label to use for the month nav buttons
                 labelMonthNext: 'Next month',
                 labelMonthPrev: 'Previous month',
      
                 // The title label to use for the dropdown selectors
                 labelMonthSelect: 'Select a month',
                 labelYearSelect: 'Select a year',
      
                 // Months and weekdays
                 monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
                 monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
                 weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
                 weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
      
                 // Materialize modified
                 weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
      
                 // Today and clear
                 today: 'Today',
                 clear: 'Clear',
                 close: 'Ok',
      
                 // The format to show on the `input` element
                 format: 'd mmmm, yyyy',
      
                 // Classes
                 klass: {
      
                     table: prefix + 'table',
      
                     header: prefix + 'header',
      


                     // Materialize Added klasses
                     date_display: prefix + 'date-display',
                     day_display: prefix + 'day-display',
                     month_display: prefix + 'month-display',
                     year_display: prefix + 'year-display',
                     calendar_container: prefix + 'calendar-container',
                     // end
      


                     navPrev: prefix + 'nav--prev',
                     navNext: prefix + 'nav--next',
                     navDisabled: prefix + 'nav--disabled',
      
                     month: prefix + 'month',
                     year: prefix + 'year',
      
                     selectMonth: prefix + 'select--month',
                     selectYear: prefix + 'select--year',
      
                     weekdays: prefix + 'weekday',
      
                     day: prefix + 'day',
                     disabled: prefix + 'day--disabled',
                     selected: prefix + 'day--selected',
                     highlighted: prefix + 'day--highlighted',
                     now: prefix + 'day--today',
                     infocus: prefix + 'day--infocus',
                     outfocus: prefix + 'day--outfocus',
      
                     footer: prefix + 'footer',
      
                     buttonClear: prefix + 'button--clear',
                     buttonToday: prefix + 'button--today',
                     buttonClose: prefix + 'button--close'
                 }
             }
         })(Picker.klasses().picker + '__')
      



         /**
          * Extend the picker to add the date picker.
          */
         Picker.extend('pickadate', DatePicker)
      


      }));; /*!

      * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
      * Copyright 2014 Wang Shenwei.
      * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
      *
      * Further modified
      * Copyright 2015 Ching Yaw Hao.
      */
      

      (function () {

         var $ = window.jQuery,
             $win = $(window),
             $doc = $(document);
      
         // Can I use inline svg ?
         var svgNS = 'http://www.w3.org/2000/svg',
             svgSupported = 'SVGAngle' in window && (function () {
                 var supported,
                     el = document.createElement('div');
                 el.innerHTML = '<svg/>';
                 supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
                 el.innerHTML = ;
                 return supported;
             })();
      
         // Can I use transition ?
         var transitionSupported = (function () {
             var style = document.createElement('div').style;
             return 'transition' in style ||
                 'WebkitTransition' in style ||
                 'MozTransition' in style ||
                 'msTransition' in style ||
                 'OTransition' in style;
         })();
      
         // Listen touch events in touch screen device, instead of mouse events in desktop.
         var touchSupported = 'ontouchstart' in window,
             mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ),
             mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ),
             mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : );
      
         // Vibrate the device if supported
         var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
      
         function createSvgElement(name) {
             return document.createElementNS(svgNS, name);
         }
      
         function leadingZero(num) {
             return (num < 10 ? '0' : ) + num;
         }
      
         // Get a unique id
         var idCounter = 0;
      
         function uniqueId(prefix) {
             var id = ++idCounter + ;
             return prefix ? prefix + id : id;
         }
      
         // Clock size
         var dialRadius = 135,
             outerRadius = 105,
             // innerRadius = 80 on 12 hour clock
             innerRadius = 80,
             tickRadius = 20,
             diameter = dialRadius * 2,
             duration = transitionSupported ? 350 : 1;
      
         // Popover template
         var tpl = [
      
      '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ',

      '', ':', '',

      '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      '

      ].join();

         // ClockPicker
         function ClockPicker(element, options) {
             var popover = $(tpl),
                 plate = popover.find('.clockpicker-plate'),
                 holder = popover.find('.picker__holder'),
                 hoursView = popover.find('.clockpicker-hours'),
                 minutesView = popover.find('.clockpicker-minutes'),
                 amPmBlock = popover.find('.clockpicker-am-pm-block'),
                 isInput = element.prop('tagName') === 'INPUT',
                 input = isInput ? element : element.find('input'),
                 label = $("label[for=" + input.attr("id") + "]"),
                 self = this;
      
             this.id = uniqueId('cp');
             this.element = element;
             this.holder = holder;
             this.options = options;
             this.isAppended = false;
             this.isShown = false;
             this.currentView = 'hours';
             this.isInput = isInput;
             this.input = input;
             this.label = label;
             this.popover = popover;
             this.plate = plate;
             this.hoursView = hoursView;
             this.minutesView = minutesView;
             this.amPmBlock = amPmBlock;
             this.spanHours = popover.find('.clockpicker-span-hours');
             this.spanMinutes = popover.find('.clockpicker-span-minutes');
             this.spanAmPm = popover.find('.clockpicker-span-am-pm');
             this.footer = popover.find('.picker__footer');
             this.amOrPm = "PM";
      
             // Setup for for 12 hour clock if option is selected
             if (options.twelvehour) {
                 if (!options.ampmclickable) {
                     this.spanAmPm.empty();
      
      $('
      AM
      ').appendTo(this.spanAmPm); $('
      PM
      ').appendTo(this.spanAmPm);
                 } else {
                     this.spanAmPm.empty();
      
      $('
      AM
      ').on("click", function () {
                         self.spanAmPm.children('#click-am').addClass("text-primary");
                         self.spanAmPm.children('#click-pm').removeClass("text-primary");
                         self.amOrPm = "AM";
                     }).appendTo(this.spanAmPm);
      
      $('
      PM
      ').on("click", function () {
                         self.spanAmPm.children('#click-pm').addClass("text-primary");
                         self.spanAmPm.children('#click-am').removeClass("text-primary");
                         self.amOrPm = 'PM';
                     }).appendTo(this.spanAmPm);
                 }
             }
      
             // Add buttons to footer
             $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
             $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
             $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
      
             this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
             this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
      
             // Show or toggle
             input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
      
             // Build ticks
      
      var tickTpl = $('
      '),
                 i, tick, radian, radius;
      
             // Hours view
             if (options.twelvehour) {
                 for (i = 1; i < 13; i += 1) {
                     tick = tickTpl.clone();
                     radian = i / 6 * Math.PI;
                     radius = outerRadius;
                     tick.css({
                         left: dialRadius + Math.sin(radian) * radius - tickRadius,
                         top: dialRadius - Math.cos(radian) * radius - tickRadius
                     });
                     tick.html(i === 0 ? '00' : i);
                     hoursView.append(tick);
                     tick.on(mousedownEvent, mousedown);
                 }
             } else {
                 for (i = 0; i < 24; i += 1) {
                     tick = tickTpl.clone();
                     radian = i / 6 * Math.PI;
                     var inner = i > 0 && i < 13;
                     radius = inner ? innerRadius : outerRadius;
                     tick.css({
                         left: dialRadius + Math.sin(radian) * radius - tickRadius,
                         top: dialRadius - Math.cos(radian) * radius - tickRadius
                     });
                     tick.html(i === 0 ? '00' : i);
                     hoursView.append(tick);
                     tick.on(mousedownEvent, mousedown);
                 }
             }
      
             // Minutes view
             for (i = 0; i < 60; i += 5) {
                 tick = tickTpl.clone();
                 radian = i / 30 * Math.PI;
                 tick.css({
                     left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
                     top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
                 });
                 tick.html(leadingZero(i));
                 minutesView.append(tick);
                 tick.on(mousedownEvent, mousedown);
             }
      
             // Clicking on minutes view space
             plate.on(mousedownEvent, function (e) {
                 if ($(e.target).closest('.clockpicker-tick').length === 0) {
                     mousedown(e, true);
                 }
             });
      
             // Mousedown or touchstart
             function mousedown(e, space) {
                 var offset = plate.offset(),
                     isTouch = /^touch/.test(e.type),
                     x0 = offset.left + dialRadius,
                     y0 = offset.top + dialRadius,
                     dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
                     dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
                     z = Math.sqrt(dx * dx + dy * dy),
                     moved = false;
      
                 // When clicking on minutes view space, check the mouse position
                 if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
                     return;
                 }
                 e.preventDefault();
      
                 // Set cursor style of body after 200ms
                 var movingTimer = setTimeout(function () {
                     self.popover.addClass('clockpicker-moving');
                 }, 200);
      
                 // Clock
                 self.setHand(dx, dy, !space, true);
      
                 // Mousemove on document
                 $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
                     e.preventDefault();
                     var isTouch = /^touch/.test(e.type),
                         x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
                         y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
                     if (!moved && x === dx && y === dy) {
                         // Clicking in chrome on windows will trigger a mousemove event
                         return;
                     }
                     moved = true;
                     self.setHand(x, y, false, true);
                 });
      
                 // Mouseup on document
                 $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
                     $doc.off(mouseupEvent);
                     e.preventDefault();
                     var isTouch = /^touch/.test(e.type),
                         x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
                         y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
                     if ((space || moved) && x === dx && y === dy) {
                         self.setHand(x, y);
                     }
      
                     if (self.currentView === 'hours') {
                         self.toggleView('minutes', duration / 2);
                     } else if (options.autoclose) {
                         self.minutesView.addClass('clockpicker-dial-out');
                         setTimeout(function () {
                             self.done();
                         }, duration / 2);
                     }
                     plate.prepend(canvas);
      
                     // Reset cursor style of body
                     clearTimeout(movingTimer);
                     self.popover.removeClass('clockpicker-moving');
      
                     // Unbind mousemove event
                     $doc.off(mousemoveEvent);
                 });
             }
      
             if (svgSupported) {
                 // Draw clock hands and others
                 var canvas = popover.find('.clockpicker-canvas'),
                     svg = createSvgElement('svg');
                 svg.setAttribute('class', 'clockpicker-svg');
                 svg.setAttribute('width', diameter);
                 svg.setAttribute('height', diameter);
                 var g = createSvgElement('g');
                 g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
                 var bearing = createSvgElement('circle');
                 bearing.setAttribute('class', 'clockpicker-canvas-bearing');
                 bearing.setAttribute('cx', 0);
                 bearing.setAttribute('cy', 0);
                 bearing.setAttribute('r', 4);
                 var hand = createSvgElement('line');
                 hand.setAttribute('x1', 0);
                 hand.setAttribute('y1', 0);
                 var bg = createSvgElement('circle');
                 bg.setAttribute('class', 'clockpicker-canvas-bg');
                 bg.setAttribute('r', tickRadius);
                 g.appendChild(hand);
                 g.appendChild(bg);
                 g.appendChild(bearing);
                 svg.appendChild(g);
                 canvas.append(svg);
      
                 this.hand = hand;
                 this.bg = bg;
                 this.bearing = bearing;
                 this.g = g;
                 this.canvas = canvas;
             }
      
             raiseCallback(this.options.init);
         }
      
         function raiseCallback(callbackFunction) {
             if (callbackFunction && typeof callbackFunction === "function")
                 callbackFunction();
         }
      
         // Default options
         ClockPicker.DEFAULTS = {
             'default': , // default time, 'now' or '13:14' e.g.
             fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
             donetext: 'Ok', // done button text
             cleartext: 'Clear',
             canceltext: 'Cancel',
             autoclose: false, // auto close when minute is selected
             ampmclickable: true, // set am/pm button on itself
             darktheme: false, // set to dark theme
             twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
             vibrate: true // vibrate the device when dragging clock hand
         };
      
         // Show or hide popover
         ClockPicker.prototype.toggle = function () {
             this[this.isShown ? 'hide' : 'show']();
         };
      
         // Set popover position
         ClockPicker.prototype.locate = function () {
             var element = this.element,
                 popover = this.popover,
                 offset = element.offset(),
                 width = element.outerWidth(),
                 height = element.outerHeight(),
                 align = this.options.align,
                 self = this;
      
             popover.show();
         };
      
         // Show popover
         ClockPicker.prototype.show = function (e) {
             // Not show again
             if (this.isShown) {
                 return;
             }
             raiseCallback(this.options.beforeShow);
             $(':input').each(function () {
                 $(this).attr('tabindex', -1);
             })
             var self = this;
             // Initialize
             this.input.blur();
             this.popover.addClass('picker--opened');
             this.input.addClass('picker__input picker__input--active');
             $(document.body).css('overflow', 'hidden');
             // Get the time
             var value = ((this.input.prop('value') || this.options['default'] || ) + ).split(':');
             if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
                 if (value[1].indexOf("AM") > 0) {
                     this.amOrPm = 'AM';
                 } else {
                     this.amOrPm = 'PM';
                 }
                 value[1] = value[1].replace("AM", "").replace("PM", "");
             }
             if (value[0] === 'now') {
                 var now = new Date(+new Date() + this.options.fromnow);
                 value = [
      

      now.getHours(), now.getMinutes() ];

             }
             this.hours = +value[0] || 0;
             this.minutes = +value[1] || 0;
             this.spanHours.html(this.hours);
             this.spanMinutes.html(leadingZero(this.minutes));
             if (!this.isAppended) {
                 // Append popover to body
                 this.popover.insertAfter(this.input);
                 if (this.options.twelvehour) {
                     if (this.amOrPm === 'PM') {
                         this.spanAmPm.children('#click-pm').addClass("text-primary");
                         this.spanAmPm.children('#click-am').removeClass("text-primary");
                     } else {
                         this.spanAmPm.children('#click-am').addClass("text-primary");
                         this.spanAmPm.children('#click-pm').removeClass("text-primary");
                     }
                 }
                 // Reset position when resize
                 $win.on('resize.clockpicker' + this.id, function () {
                     if (self.isShown) {
                         self.locate();
                     }
                 });
                 this.isAppended = true;
             }
             // Toggle to hours view
             this.toggleView('hours');
             // Set position
             this.locate();
             this.isShown = true;
             // Hide when clicking or tabbing on any element except the clock and input
             $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
                 var target = $(e.target);
                 if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
                     self.hide();
                 }
             });
             // Hide when ESC is pressed
             $doc.on('keyup.clockpicker.' + this.id, function (e) {
                 if (e.keyCode === 27) {
                     self.hide();
                 }
             });
             raiseCallback(this.options.afterShow);
         };
         // Hide popover
         ClockPicker.prototype.hide = function () {
             raiseCallback(this.options.beforeHide);
             this.input.removeClass('picker__input picker__input--active');
             this.popover.removeClass('picker--opened');
             $(document.body).css('overflow', 'visible');
             this.isShown = false;
             $(':input').each(function (index) {
                 $(this).attr('tabindex', index + 1);
             });
             // Unbinding events on document
             $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
             $doc.off('keyup.clockpicker.' + this.id);
             this.popover.hide();
             raiseCallback(this.options.afterHide);
         };
         // Toggle to hours or minutes view
         ClockPicker.prototype.toggleView = function (view, delay) {
             var raiseAfterHourSelect = false;
             if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
                 raiseCallback(this.options.beforeHourSelect);
                 raiseAfterHourSelect = true;
             }
             var isHours = view === 'hours',
                 nextView = isHours ? this.hoursView : this.minutesView,
                 hideView = isHours ? this.minutesView : this.hoursView;
             this.currentView = view;
      
             this.spanHours.toggleClass('text-primary', isHours);
             this.spanMinutes.toggleClass('text-primary', !isHours);
      
             // Let's make transitions
             hideView.addClass('clockpicker-dial-out');
             nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
      
             // Reset clock hand
             this.resetClock(delay);
      
             // After transitions ended
             clearTimeout(this.toggleViewTimer);
             this.toggleViewTimer = setTimeout(function () {
                 hideView.css('visibility', 'hidden');
             }, duration);
      
             if (raiseAfterHourSelect) {
                 raiseCallback(this.options.afterHourSelect);
             }
         };
      
         // Reset clock hand
         ClockPicker.prototype.resetClock = function (delay) {
             var view = this.currentView,
                 value = this[view],
                 isHours = view === 'hours',
                 unit = Math.PI / (isHours ? 6 : 30),
                 radian = value * unit,
                 radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
                 x = Math.sin(radian) * radius,
                 y = -Math.cos(radian) * radius,
                 self = this;
      
             if (svgSupported && delay) {
                 self.canvas.addClass('clockpicker-canvas-out');
                 setTimeout(function () {
                     self.canvas.removeClass('clockpicker-canvas-out');
                     self.setHand(x, y);
                 }, delay);
             } else
                 this.setHand(x, y);
         };
      
         // Set clock hand to (x, y)
         ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
             var radian = Math.atan2(x, -y),
                 isHours = this.currentView === 'hours',
                 unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
                 z = Math.sqrt(x * x + y * y),
                 options = this.options,
                 inner = isHours && z < (outerRadius + innerRadius) / 2,
                 radius = inner ? innerRadius : outerRadius,
                 value;
      
             if (options.twelvehour) {
                 radius = outerRadius;
             }
      
             // Radian should in range [0, 2PI]
             if (radian < 0) {
                 radian = Math.PI * 2 + radian;
             }
      
             // Get the round value
             value = Math.round(radian / unit);
      
             // Get the round radian
             radian = value * unit;
      
             // Correct the hours or minutes
             if (options.twelvehour) {
                 if (isHours) {
                     if (value === 0)
                         value = 12;
                 } else {
                     if (roundBy5)
                         value *= 5;
                     if (value === 60)
                         value = 0;
                 }
             } else {
                 if (isHours) {
                     if (value === 12)
                         value = 0;
                     value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
                 } else {
                     if (roundBy5)
                         value *= 5;
                     if (value === 60)
                         value = 0;
                 }
             }
      
             // Once hours or minutes changed, vibrate the device
             if (this[this.currentView] !== value) {
                 if (vibrate && this.options.vibrate) {
                     // Do not vibrate too frequently
                     if (!this.vibrateTimer) {
                         navigator[vibrate](10);
                         this.vibrateTimer = setTimeout($.proxy(function () {
                             this.vibrateTimer = null;
                         }, this), 100);
                     }
                 }
             }
      
             this[this.currentView] = value;
             if (isHours) {
                 this['spanHours'].html(value);
             } else {
                 this['spanMinutes'].html(leadingZero(value));
             }
      
             // If svg is not supported, just add an active class to the tick
             if (!svgSupported) {
                 this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
                     var tick = $(this);
                     tick.toggleClass('active', value === +tick.html());
                 });
                 return;
             }
      
             // Set clock hand and others' position
             var cx1 = Math.sin(radian) * (radius - tickRadius),
                 cy1 = -Math.cos(radian) * (radius - tickRadius),
                 cx2 = Math.sin(radian) * radius,
                 cy2 = -Math.cos(radian) * radius;
             this.hand.setAttribute('x2', cx1);
             this.hand.setAttribute('y2', cy1);
             this.bg.setAttribute('cx', cx2);
             this.bg.setAttribute('cy', cy2);
         };
      
         // Hours and minutes are selected
         ClockPicker.prototype.done = function () {
             raiseCallback(this.options.beforeDone);
             this.hide();
             this.label.addClass('active');
      
             var last = this.input.prop('value'),
                 value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
             if (this.options.twelvehour) {
                 value = value + this.amOrPm;
             }
      
             this.input.prop('value', value);
             if (value !== last) {
                 this.input.triggerHandler('change');
                 if (!this.isInput) {
                     this.element.trigger('change');
                 }
             }
      
             if (this.options.autoclose)
                 this.input.trigger('blur');
      
             raiseCallback(this.options.afterDone);
         };
      
         // Clear input field
         ClockPicker.prototype.clear = function () {
             this.hide();
             this.label.removeClass('active');
      
             var last = this.input.prop('value'),
                 value = ;
      
             this.input.prop('value', value);
             if (value !== last) {
                 this.input.triggerHandler('change');
                 if (!this.isInput) {
                     this.element.trigger('change');
                 }
             }
      
             if (this.options.autoclose) {
                 this.input.trigger('blur');
             }
         };
      
         // Remove clockpicker from input
         ClockPicker.prototype.remove = function () {
             this.element.removeData('clockpicker');
             this.input.off('focus.clockpicker click.clockpicker');
             if (this.isShown) {
                 this.hide();
             }
             if (this.isAppended) {
                 $win.off('resize.clockpicker' + this.id);
                 this.popover.remove();
             }
         };
      
         // Extends $.fn.clockpicker
         $.fn.pickatime = function (option) {
             var args = Array.prototype.slice.call(arguments, 1);
             return this.each(function () {
                 var $this = $(this),
                     data = $this.data('clockpicker');
                 if (!data) {
                     var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
                     $this.data('clockpicker', new ClockPicker($this, options));
                 } else {
                     // Manual operatsions. show, hide, remove, e.g.
                     if (typeof data[option] === 'function') {
                         data[option].apply(data, args);
                     }
                 }
             });
         };
      

      }());; (function ($) {

         $.fn.characterCounter = function () {
             return this.each(function () {
                 var $input = $(this);
                 var $counterElement = $input.parent().find('span[class="character-counter"]');
      
                 // character counter has already been added appended to the parent container
                 if ($counterElement.length) {
                     return;
                 }
      
                 var itHasLengthAttribute = $input.attr('data-length') !== undefined;
      
                 if (itHasLengthAttribute) {
                     $input.on('input', updateCounter);
                     $input.on('focus', updateCounter);
                     $input.on('blur', removeCounterElement);
      
                     addCounterElement($input);
                 }
      
             });
         };
      
         function updateCounter() {
             var maxLength = +$(this).attr('data-length'),
                 actualLength = +$(this).val().length,
                 isValidLength = actualLength <= maxLength;
      
             $(this).parent().find('span[class="character-counter"]')
                 .html(actualLength + '/' + maxLength);
      
             addInputStyle(isValidLength, $(this));
         }
      
         function addCounterElement($input) {
             var $counterElement = $input.parent().find('span[class="character-counter"]');
      
             if ($counterElement.length) {
                 return;
             }
      
             $counterElement = $('<span/>')
                 .addClass('character-counter')
                 .css('float', 'right')
                 .css('font-size', '12px')
                 .css('height', 1);
      
             $input.parent().append($counterElement);
         }
      
         function removeCounterElement() {
             $(this).parent().find('span[class="character-counter"]').html();
         }
      
         function addInputStyle(isValidLength, $input) {
             var inputHasInvalidClass = $input.hasClass('invalid');
             if (isValidLength && inputHasInvalidClass) {
                 $input.removeClass('invalid');
             } else if (!isValidLength && !inputHasInvalidClass) {
                 $input.removeClass('valid');
                 $input.addClass('invalid');
             }
         }
      
         $(document).ready(function () {
             $('input, textarea').characterCounter();
         });
      

      }(jQuery));; (function ($) {

         var methods = {
      
             init: function (options) {
                 var defaults = {
                     duration: 200, // ms
                     dist: -100, // zoom scale TODO: make this more intuitive as an option
                     shift: 0, // spacing for center image
                     padding: 0, // Padding between non center items
                     fullWidth: false, // Change to full width styles
                     indicators: false, // Toggle indicators
                     noWrap: false, // Don't wrap around and cycle through items.
                     onCycleTo: null // Callback for when a new slide is cycled to.
                 };
                 options = $.extend(defaults, options);
                 var namespace = Materialize.objectSelectorString($(this));
      
                 return this.each(function (i) {
      
                     var uniqueNamespace = namespace + i;
                     var images, item_width, item_height, offset, center, pressed, dim, count,
                         reference, referenceY, amplitude, target, velocity, scrolling,
                         xform, frame, timestamp, ticker, dragged, vertical_dragged;
      
      var $indicators = $('
        ');
                       var scrollingTimeout = null;
                       var oneTimeCallback = null;
        


                       // Initialize
                       var view = $(this);
                       var showIndicators = view.attr('data-indicators') || options.indicators;
        


                       // Options
                       var setCarouselHeight = function () {
                           var firstImage = view.find('.carousel-item img').first();
                           if (firstImage.length) {
                               if (firstImage.prop('complete')) {
                                   view.css('height', firstImage.height());
                               } else {
                                   firstImage.on('load', function () {
                                       view.css('height', $(this).height());
                                   });
                               }
                           } else {
                               var imageHeight = view.find('.carousel-item').first().height();
                               view.css('height', imageHeight);
                           }
                       };
        
                       if (options.fullWidth) {
                           options.dist = 0;
                           setCarouselHeight();
        
                           // Offset fixed items when indicators.
                           if (showIndicators) {
                               view.find('.carousel-fixed-item').addClass('with-indicators');
                           }
                       }
        


                       // Don't double initialize.
                       if (view.hasClass('initialized')) {
                           // Recalculate variables
                           $(window).trigger('resize');
        
                           // Redraw carousel.
                           $(this).trigger('carouselNext', [0.000001]);
                           return true;
                       }
        


                       view.addClass('initialized');
                       pressed = false;
                       offset = target = 0;
                       images = [];
                       item_width = view.find('.carousel-item').first().innerWidth();
                       item_height = view.find('.carousel-item').first().innerHeight();
                       dim = item_width * 2 + options.padding;
        
                       view.find('.carousel-item').each(function (i) {
                           images.push($(this)[0]);
                           if (showIndicators) {
        
        var $indicator = $('
      • ');
                               // Add active to first by default.
                               if (i === 0) {
                                   $indicator.addClass('active');
                               }
        
                               // Handle clicks on indicators.
                               $indicator.click(function (e) {
                                   e.stopPropagation();
        
                                   var index = $(this).index();
                                   cycleTo(index);
                               });
                               $indicators.append($indicator);
                           }
                       });
        
                       if (showIndicators) {
                           view.append($indicators);
                       }
                       count = images.length;
        


                       function setupEvents() {
                           if (typeof window.ontouchstart !== 'undefined') {
                               view[0].addEventListener('touchstart', tap);
                               view[0].addEventListener('touchmove', drag);
                               view[0].addEventListener('touchend', release);
                           }
                           view[0].addEventListener('mousedown', tap);
                           view[0].addEventListener('mousemove', drag);
                           view[0].addEventListener('mouseup', release);
                           view[0].addEventListener('mouseleave', release);
                           view[0].addEventListener('click', click);
                       }
        
                       function xpos(e) {
                           // touch event
                           if (e.targetTouches && (e.targetTouches.length >= 1)) {
                               return e.targetTouches[0].clientX;
                           }
        
                           // mouse event
                           return e.clientX;
                       }
        
                       function ypos(e) {
                           // touch event
                           if (e.targetTouches && (e.targetTouches.length >= 1)) {
                               return e.targetTouches[0].clientY;
                           }
        
                           // mouse event
                           return e.clientY;
                       }
        
                       function wrap(x) {
                           return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
                       }
        
                       function scroll(x) {
                           // Track scrolling state
                           scrolling = true;
                           if (!view.hasClass('scrolling')) {
                               view.addClass('scrolling');
                           }
                           if (scrollingTimeout != null) {
                               window.clearTimeout(scrollingTimeout);
                           }
                           scrollingTimeout = window.setTimeout(function () {
                               scrolling = false;
                               view.removeClass('scrolling');
                           }, options.duration);
        
                           // Start actual scroll
                           var i, half, delta, dir, tween, el, alignment, xTranslation;
                           var lastCenter = center;
        
                           offset = (typeof x === 'number') ? x : offset;
                           center = Math.floor((offset + dim / 2) / dim);
                           delta = offset - center * dim;
                           dir = (delta < 0) ? 1 : -1;
                           tween = -dir * delta * 2 / dim;
                           half = count >> 1;
        
                           if (!options.fullWidth) {
                               alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
                               alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
                           } else {
                               alignment = 'translateX(0)';
                           }
        
                           // Set indicator active
                           if (showIndicators) {
                               var diff = (center % count);
                               var activeIndicator = $indicators.find('.indicator-item.active');
                               if (activeIndicator.index() !== diff) {
                                   activeIndicator.removeClass('active');
                                   $indicators.find('.indicator-item').eq(diff).addClass('active');
                               }
                           }
        
                           // center
                           // Don't show wrapped items.
                           if (!options.noWrap || (center >= 0 && center < count)) {
                               el = images[wrap(center)];
        
                               // Add active class to center item.
                               if (!$(el).hasClass('active')) {
                                   view.find('.carousel-item').removeClass('active');
                                   $(el).addClass('active');
                               }
                               el.style[xform] = alignment +
                                   ' translateX(' + (-delta / 2) + 'px)' +
                                   ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
                                   ' translateZ(' + (options.dist * tween) + 'px)';
                               el.style.zIndex = 0;
                               if (options.fullWidth) {
                                   tweenedOpacity = 1;
                               } else {
                                   tweenedOpacity = 1 - 0.2 * tween;
                               }
                               el.style.opacity = tweenedOpacity;
                               el.style.display = 'block';
                           }
        
                           for (i = 1; i <= half; ++i) {
                               // right side
                               if (options.fullWidth) {
                                   zTranslation = options.dist;
                                   tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
                               } else {
                                   zTranslation = options.dist * (i * 2 + tween * dir);
                                   tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
                               }
                               // Don't show wrapped items.
                               if (!options.noWrap || center + i < count) {
                                   el = images[wrap(center + i)];
                                   el.style[xform] = alignment +
                                       ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
                                       ' translateZ(' + zTranslation + 'px)';
                                   el.style.zIndex = -i;
                                   el.style.opacity = tweenedOpacity;
                                   el.style.display = 'block';
                               }
        


                               // left side
                               if (options.fullWidth) {
                                   zTranslation = options.dist;
                                   tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
                               } else {
                                   zTranslation = options.dist * (i * 2 - tween * dir);
                                   tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
                               }
                               // Don't show wrapped items.
                               if (!options.noWrap || center - i >= 0) {
                                   el = images[wrap(center - i)];
                                   el.style[xform] = alignment +
                                       ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
                                       ' translateZ(' + zTranslation + 'px)';
                                   el.style.zIndex = -i;
                                   el.style.opacity = tweenedOpacity;
                                   el.style.display = 'block';
                               }
                           }
        
                           // center
                           // Don't show wrapped items.
                           if (!options.noWrap || (center >= 0 && center < count)) {
                               el = images[wrap(center)];
                               el.style[xform] = alignment +
                                   ' translateX(' + (-delta / 2) + 'px)' +
                                   ' translateX(' + (dir * options.shift * tween) + 'px)' +
                                   ' translateZ(' + (options.dist * tween) + 'px)';
                               el.style.zIndex = 0;
                               if (options.fullWidth) {
                                   tweenedOpacity = 1;
                               } else {
                                   tweenedOpacity = 1 - 0.2 * tween;
                               }
                               el.style.opacity = tweenedOpacity;
                               el.style.display = 'block';
                           }
        
                           // onCycleTo callback
                           if (lastCenter !== center &&
                               typeof (options.onCycleTo) === "function") {
                               var $curr_item = view.find('.carousel-item').eq(wrap(center));
                               options.onCycleTo.call(this, $curr_item, dragged);
                           }
        
                           // One time callback
                           if (typeof (oneTimeCallback) === "function") {
                               oneTimeCallback.call(this, $curr_item, dragged);
                               oneTimeCallback = null;
                           }
                       }
        
                       function track() {
                           var now, elapsed, delta, v;
        
                           now = Date.now();
                           elapsed = now - timestamp;
                           timestamp = now;
                           delta = offset - frame;
                           frame = offset;
        
                           v = 1000 * delta / (1 + elapsed);
                           velocity = 0.8 * v + 0.2 * velocity;
                       }
        
                       function autoScroll() {
                           var elapsed, delta;
        
                           if (amplitude) {
                               elapsed = Date.now() - timestamp;
                               delta = amplitude * Math.exp(-elapsed / options.duration);
                               if (delta > 2 || delta < -2) {
                                   scroll(target - delta);
                                   requestAnimationFrame(autoScroll);
                               } else {
                                   scroll(target);
                               }
                           }
                       }
        
                       function click(e) {
                           // Disable clicks if carousel was dragged.
                           if (dragged) {
                               e.preventDefault();
                               e.stopPropagation();
                               return false;
        
                           } else if (!options.fullWidth) {
                               var clickedIndex = $(e.target).closest('.carousel-item').index();
                               var diff = wrap(center) - clickedIndex;
        
                               // Disable clicks if carousel was shifted by click
                               if (diff !== 0) {
                                   e.preventDefault();
                                   e.stopPropagation();
                               }
                               cycleTo(clickedIndex);
                           }
                       }
        
                       function cycleTo(n) {
                           var diff = (center % count) - n;
        
                           // Account for wraparound.
                           if (!options.noWrap) {
                               if (diff < 0) {
                                   if (Math.abs(diff + count) < Math.abs(diff)) {
                                       diff += count;
                                   }
        
                               } else if (diff > 0) {
                                   if (Math.abs(diff - count) < diff) {
                                       diff -= count;
                                   }
                               }
                           }
        
                           // Call prev or next accordingly.
                           if (diff < 0) {
                               view.trigger('carouselNext', [Math.abs(diff)]);
        
                           } else if (diff > 0) {
                               view.trigger('carouselPrev', [diff]);
                           }
                       }
        
                       function tap(e) {
                           if (e.type === 'mousedown') {
                               e.preventDefault();
                           }
                           pressed = true;
                           dragged = false;
                           vertical_dragged = false;
                           reference = xpos(e);
                           referenceY = ypos(e);
        
                           velocity = amplitude = 0;
                           frame = offset;
                           timestamp = Date.now();
                           clearInterval(ticker);
                           ticker = setInterval(track, 100);
                       }
        
                       function drag(e) {
                           var x, delta, deltaY;
                           if (pressed) {
                               x = xpos(e);
                               y = ypos(e);
                               delta = reference - x;
                               deltaY = Math.abs(referenceY - y);
                               if (deltaY < 30 && !vertical_dragged) {
                                   // If vertical scrolling don't allow dragging.
                                   if (delta > 2 || delta < -2) {
                                       dragged = true;
                                       reference = x;
                                       scroll(offset + delta);
                                   }
        
                               } else if (dragged) {
                                   // If dragging don't allow vertical scroll.
                                   e.preventDefault();
                                   e.stopPropagation();
                                   return false;
        
                               } else {
                                   // Vertical scrolling.
                                   vertical_dragged = true;
                               }
                           }
        
                           if (dragged) {
                               // If dragging don't allow vertical scroll.
                               e.preventDefault();
                               e.stopPropagation();
                               return false;
                           }
                       }
        
                       function release(e) {
                           if (pressed) {
                               pressed = false;
                           } else {
                               return;
                           }
        
                           clearInterval(ticker);
                           target = offset;
                           if (velocity > 10 || velocity < -10) {
                               amplitude = 0.9 * velocity;
                               target = offset + amplitude;
                           }
                           target = Math.round(target / dim) * dim;
        
                           // No wrap of items.
                           if (options.noWrap) {
                               if (target >= dim * (count - 1)) {
                                   target = dim * (count - 1);
                               } else if (target < 0) {
                                   target = 0;
                               }
                           }
                           amplitude = target - offset;
                           timestamp = Date.now();
                           requestAnimationFrame(autoScroll);
        
                           if (dragged) {
                               e.preventDefault();
                               e.stopPropagation();
                           }
                           return false;
                       }
        
                       xform = 'transform';
               ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
                           var e = prefix + 'Transform';
                           if (typeof document.body.style[e] !== 'undefined') {
                               xform = e;
                               return false;
                           }
                           return true;
                       });
        


                       $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, function () {
                           if (options.fullWidth) {
                               item_width = view.find('.carousel-item').first().innerWidth();
                               item_height = view.find('.carousel-item').first().innerHeight();
                               dim = item_width * 2 + options.padding;
                               offset = center * 2 * item_width;
                               target = offset;
                           } else {
                               scroll();
                           }
                       });
        
                       setupEvents();
                       scroll(offset);
        
                       $(this).on('carouselNext', function (e, n, callback) {
                           if (n === undefined) {
                               n = 1;
                           }
                           if (typeof (callback) === "function") {
                               oneTimeCallback = callback;
                           }
        
                           target = (dim * Math.round(offset / dim)) + (dim * n);
                           if (offset !== target) {
                               amplitude = target - offset;
                               timestamp = Date.now();
                               requestAnimationFrame(autoScroll);
                           }
                       });
        
                       $(this).on('carouselPrev', function (e, n, callback) {
                           if (n === undefined) {
                               n = 1;
                           }
                           if (typeof (callback) === "function") {
                               oneTimeCallback = callback;
                           }
        
                           target = (dim * Math.round(offset / dim)) - (dim * n);
                           if (offset !== target) {
                               amplitude = target - offset;
                               timestamp = Date.now();
                               requestAnimationFrame(autoScroll);
                           }
                       });
        
                       $(this).on('carouselSet', function (e, n, callback) {
                           if (n === undefined) {
                               n = 0;
                           }
                           if (typeof (callback) === "function") {
                               oneTimeCallback = callback;
                           }
        
                           cycleTo(n);
                       });
        
                   });
        


               },
               next: function (n, callback) {
                   $(this).trigger('carouselNext', [n, callback]);
               },
               prev: function (n, callback) {
                   $(this).trigger('carouselPrev', [n, callback]);
               },
               set: function (n, callback) {
                   $(this).trigger('carouselSet', [n, callback]);
               }
           };
        


           $.fn.carousel = function (methodOrOptions) {
               if (methods[methodOrOptions]) {
                   return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
               } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
                   // Default to "init"
                   return methods.init.apply(this, arguments);
               } else {
                   $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
               }
           }; // Plugin end
        

        }(jQuery));; (function ($) {

           var methods = {
               init: function (options) {
                   return this.each(function () {
                       var origin = $('#' + $(this).attr('data-activates'));
                       var screen = $('body');
        
                       // Creating tap target
                       var tapTargetEl = $(this);
                       var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
                       var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
                       var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
                       var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
        
                       // Creating wrapper
                       if (!tapTargetWrapper.length) {
        
        tapTargetWrapper = tapTargetEl.wrap($('
        ')).parent();
                       }
        
                       // Creating content
                       if (!tapTargetContentEl.length) {
        
        tapTargetContentEl = $('
        ');
                           tapTargetEl.append(tapTargetContentEl);
                       }
        
                       // Creating foreground wave
                       if (!tapTargetWave.length) {
        
        tapTargetWave = $('
        ');
                           // Creating origin
                           if (!tapTargetOriginEl.length) {
                               tapTargetOriginEl = origin.clone(true, true);
                               tapTargetOriginEl.addClass('tap-target-origin');
                               tapTargetOriginEl.removeAttr('id');
                               tapTargetOriginEl.removeAttr('style');
                               tapTargetWave.append(tapTargetOriginEl);
                           }
        
                           tapTargetWrapper.append(tapTargetWave);
                       }
        
                       // Open
                       var openTapTarget = function () {
                           if (tapTargetWrapper.is('.open')) {
                               return;
                           }
        
                           // Adding open class
                           tapTargetWrapper.addClass('open');
        
                           setTimeout(function () {
                               tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
                                   closeTapTarget();
                                   tapTargetOriginEl.off('click.tapTarget');
                               });
        
                               $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
                                   closeTapTarget();
                                   $(document).off('click.tapTarget');
                               });
        
                               var throttledCalc = Materialize.throttle(function () {
                                   calculateTapTarget();
                               }, 200);
                               $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
                           }, 0);
                       };
        
                       // Close
                       var closeTapTarget = function () {
                           if (!tapTargetWrapper.is('.open')) {
                               return;
                           }
        
                           tapTargetWrapper.removeClass('open');
                           tapTargetOriginEl.off('click.tapTarget')
                           $(document).off('click.tapTarget');
                           $(window).off('resize.tapTarget');
                       };
        
                       // Pre calculate
                       var calculateTapTarget = function () {
                           // Element or parent is fixed position?
                           var isFixed = origin.css('position') === 'fixed';
                           if (!isFixed) {
                               var parents = origin.parents();
                               for (var i = 0; i < parents.length; i++) {
                                   isFixed = $(parents[i]).css('position') == 'fixed';
                                   if (isFixed) {
                                       break;
                                   }
                               }
                           }
        
                           // Calculating origin
                           var originWidth = origin.outerWidth();
                           var originHeight = origin.outerHeight();
                           var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
                           var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
        
                           // Calculating screen
                           var windowWidth = $(window).width();
                           var windowHeight = $(window).height();
                           var centerX = windowWidth / 2;
                           var centerY = windowHeight / 2;
                           var isLeft = originLeft <= centerX;
                           var isRight = originLeft > centerX;
                           var isTop = originTop <= centerY;
                           var isBottom = originTop > centerY;
                           var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
                           var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
        
                           // Calculating tap target
                           var tapTargetWidth = tapTargetEl.outerWidth();
                           var tapTargetHeight = tapTargetEl.outerHeight();
                           var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
                           var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
                           var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
        
                           // Calculating content
                           var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
                           var tapTargetTextHeight = tapTargetHeight / 2;
                           var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
                           var tapTargetTextBottom = 0;
                           var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
                           var tapTargetTextRight = 0;
                           var tapTargetTextPadding = originWidth;
                           var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
        
                           // Calculating wave
                           var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
                           var tapTargetWaveHeight = tapTargetWaveWidth;
                           var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
                           var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
        
                           // Setting tap target
                           var tapTargetWrapperCssObj = {};
                           tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ;
                           tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ;
                           tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ;
                           tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ;
                           tapTargetWrapperCssObj.position = tapTargetPosition;
                           tapTargetWrapper.css(tapTargetWrapperCssObj);
        
                           // Setting content
                           tapTargetContentEl.css({
                               width: tapTargetTextWidth,
                               height: tapTargetTextHeight,
                               top: tapTargetTextTop,
                               right: tapTargetTextRight,
                               bottom: tapTargetTextBottom,
                               left: tapTargetTextLeft,
                               padding: tapTargetTextPadding,
                               verticalAlign: tapTargetTextAlign
                           });
        
                           // Setting wave
                           tapTargetWave.css({
                               top: tapTargetWaveTop,
                               left: tapTargetWaveLeft,
                               width: tapTargetWaveWidth,
                               height: tapTargetWaveHeight
                           });
                       }
        
                       if (options == 'open') {
                           calculateTapTarget();
                           openTapTarget();
                       }
        
                       if (options == 'close')
                           closeTapTarget();
                   });
               },
               open: function () {},
               close: function () {}
           };
        
           $.fn.tapTarget = function (methodOrOptions) {
               if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
                   return methods.init.apply(this, arguments);
        
               $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
           };
        

        }(jQuery));